Dataset Viewer
Auto-converted to Parquet Duplicate
messages
listlengths
2
2
images
images listlengths
1
1
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1)CN(CC3=CC2=C(C=CC(=C2)OC)NC3=O)CC4=NN=NN4CCC5=CC=CC=C5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1)CN3C(=O)C(=CC2=CC(=C(C(=C2)OC)OC)OC)C(=O)NC3=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=C(C=CC(=C1)OC(=O)C2=CC=C(C=C2)Br)C=C(C#N)C(=O)NC3=CC=C(C=C3Cl)[N+](=O)[O-]\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=C(C)C=CC=C3C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCC1=C(C=CC=C1)NC(=O)C2=C(C=CC=C2)SC4=C3C(=C(C)SC3=NC=N4)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC(=NO1)N4[C@H](C2=CC=C(C=C2)C(=O)OC)C(=C(C3=CC=C(C=C3)F)O)C(=O)C4=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)C1=C(C)N=C5N(C1C2=CC=CC=C2)C(=O)C(=CC4=CC=C(C3=CC(=C(C=C3)Cl)Cl)O4)S5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C#CC=CCC1C(CC=CCC(C(CC)Br)O1)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCN1C(=NNC1=S)CCN2C(=C(C(=N2)C)Br)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)N1CCC2=C(C1)SC(=C2C#N)NC(=O)C=CC3=CC=CC(=C3)[N+](=O)[O-]\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)C1=C(C=CC=C1)NC(=O)[C@@H](C)SC2=NC=NC4=C2C3=C(CCC3)S4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1CC(C)CN(C1)C(=O)C2=CC=C(C(=C2)[N+](=O)[O-])SCC3=CC=CN=C3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C[C@@H](C#N)OC(=O)C3=CC2=C(C1=CC=CC=C1)ON=C2C=C3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)C3=NN=C(NC(=O)C(C)NC(=O)C2=CC=C(C=C2)C(F)(F)F)S3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC=C(C=C1)C2=NN(CC2)C(=O)CSC4=NN=C(NCC3=CC=CO3)S4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C(=C(\\\\C(C(F)(F)F)(C(F)(F)F)F)/F)(/C(=O)O)\\\\F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC2=C(CC(=O)NCCCN1CCOCC1)C(=O)OC3=C2C(=CC(=C3)OC)OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)N3C(=O)C2=C(CC(C)S2)N=C3SCC(=O)NC4=CC(=CC=C4)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1NC2=C4C(=NC=N2)C3=C(C=C(C(=C3)OC)OC)N4)[N+](=O)[O-]\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC=C(C=C1)C#CC(=O)N2CCC3(CC2)CCN(C3)C(=O)CCOC4=C(C=CC=C4)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC2=NC(=C(C(=O)OCC1=CC=CC(=C1)I)N2C)[N+](=O)[O-]\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC=C(C=C1)C(C#N)C(=NNC(=O)C(=O)NN)C(=O)NC34CC2CC(CC(C2)C3)C4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C=C3C[C@@]24CC[C@H]1[C@@](C)(CCC[C@@]1(C)C(=O)OC)[C@@H]2CC[C@H]3C4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1Cl)C3CC2=C(C(=CC(=C2)Cl)F)N3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)C1=C(C)N(CC(=O)NCCN(C)C)C(=O)C[C@H]1C2=C(C=CC=C2)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC(=C(C(=C1)C)OCC(=O)OCC(=O)NC2=CC=C(C=C2[N+](=O)[O-])OC)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(CCC(C)O)O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C=CCN(C1=CC=C(C=C1)C(=O)NCCSC(C)(C)C)S(=O)(=O)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=CC(=C1)C(=O)N2CCSC23CCN(CC3)C(=O)NC4=C(C=CC=C4)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=C(C=CC=C1)OCC(=O)NC3=NC2=C(C=C(C=C2)NC(=O)C)O3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=CC(=C1)S(=O)(=O)C4=C(N)N([C@H](C)C2=CC=CC=C2)C5=NC3=C(C=CC=C3)N=C45\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)NC(=O)COC(=O)CC2=CC=C(C=C2)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC2=C(C=C1)SC(=C2Cl)C(=O)NNC(=O)C3=CC=CC(=C3)[N+](=O)[O-]\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC2=C(C=C1)NC=C2CC(=O)NC45CC3CC(CC(C3)C4)C5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C/C(=N/NC1=NON=C1N)/C(C)(C)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCCCC1CCC(CC1)C(=S)N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=C(C=CC=C1Cl)NC(=O)C(=O)NCCC[NH+]2CCOCC2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCNC(=O)C1=CC=C(C=C1)CSC2=NC(=CC(=N2)C(C)(C)C)N3CCCC3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C3=CN([C@H]1[C@H]([C@@H]([C@@H](CO)O1)O[C@H]2[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)O)C(=O)N=C3N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC2=NN(CC(=O)NCC1=CC=CC(=C1)Cl)C(=C2S(=O)(=O)N3CCCCC3)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)C2=C(C1=C(C=C(C(=C1)OC)OC)N2)NC(=O)CCN3CCN(CC3)C4=C(C=CC=C4)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)C2=C(NC(=O)COC(=O)[C@@H]1CC=CCC1)SC(=C2C)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC1=CC=CC2=C1OC(=O)C(=C2)C3=CSC(=N3)NC4=C(C=CC=C4)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)OC1=C(C=CC=C1)C(=O)NC3=NC=C(CC2=CC=C(C)C=C2)S3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=C(C=CC(=C1)OC(F)F)NC(=S)N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC5=C(C(=O)N(C1=CC=C2C(=C1)OCCO2)C(C3=CC=C(C=C3)OC)C(=O)NC4CCCCC4)SC(=N5)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)N2C(=O)C[C@@H](C2=O)N3CCC(CC3)C(=O)O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1[N+](=O)[O-])C(=O)N/N=C\\\\C2=CC=C(C(=C2)CN3C=NC(=N3)[N+](=O)[O-])OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC=C(C=C1)S(=O)(=O)NN=CC2=CC=C(Cl)S2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CN1C2=C(C(=O)N(C)C1=O)NC(=N2)SCCN3CCCCC3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)C1=CC=C(C=C1)C(=O)NCC2=CC=C(C=C2)OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC2=C(C=C1)C3=C(C=C2)OC(=O)C(=C3)C4=CSC(=N4)C(=CC5=CC=CN5C6=CC=C(C=C6)[N+](=O)[O-])C#N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCCOC1=CC=C(C=C1)N2C[C@H](CC2=O)C(=O)NC3=CC=C(C=C3F)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=NOC(=C1CN2CCCN(CC2)CC3=CC=C(C=C3)S(=O)(=O)C)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(=CCCC(=CCSC[C@@H](C(=O)O)NC(=O)C)C)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)C1=CC=C(C=C1)OCC2=NN=C(O2)SCC(=O)N3[C@@H](C)CCC[C@H]3C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC2=CC=CC(=O)C3=C(C)N(CC1=CC=CC=C1)C(=C23)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCC3(CC)CC1=C(C=CC=C1)/C(=C(/C#N)\\\\C2=CC=CC=C2)/N3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)C1=CC=C(C=C1)[C@@H](C2=C(C)NC3=C2C=CC=C3)[NH+]4CCN(CC4)C5=CC=C(C=C5)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1)OC6C(C2=CC=C3C(=C2)OCO3)N(CC4=CC=C5C(=C4)OCO5)C6=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC(=O)CNC(=O)COC(=O)C1=CC=C(C(=C1)S(=O)(=O)N2CCCC2)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C=C1COC2=CC=C(C=C2Cl)Cl)C=NNC(=O)C(=O)NC3=CC=C(C(=C3)Cl)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C=CCNC(=O)C1=C(C=CC=C1)NC(=O)CSCC2=CC=C(C)C=C2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1CCCC(C1C)NC(=O)COC(=O)C2=C(C=CC=C2)CC3=CC=CC=C3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC(=CC(=C1OC)OC)C=C4C(=O)N(CCC2=CC=CC=C2)C(=NC3=CC=CC=C3)S4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC(=O)[C@]2(C)[C@H]4[C@@H]([C@H](C1=CC=CS1)N2)C(=O)N(C3=CC=CC=C3)C4=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC2=C(C=C1)NC(=O)[C@]24[C@H]6[C@@H]([C@H]3CCC[NH+]34)C(=O)N(C5=CC=C(C=C5)Cl)C6=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C(=C1)NC(=O)C2=CC=CC(=C2)OCCOC3=CC=CC=C3)OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=CC(=C1)OCC(=O)NN=CC2=CC=C(C(=C2)OC)O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC(=CC=C1)C=NC2=CC=C(C=C2)S(=O)(=O)N3CCCC3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C[C@H](CC(=O)NC[C@@H](C1=CC=C(C=C1)F)[NH+]2CCOCC2)N3C=CN=C3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C#CCOCC2CN(C1=CC(=CC=C1)Br)C(=O)O2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=C(C=CC(=C1)C2CCNCC2)CC#N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1[N+](=O)[O-])NC(=S)NC(=O)CCC(=O)OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC[C@@]2(C)C(=O)N(CC(=O)O[C@@H](C)C(=O)NC1=CC=C(C=N1)Cl)C(=O)N2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCC[NH+](CCC)CC2=C(C)NC1=C(C(=CC(=C1)C)C)C2=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)[C@@]3(C)C(=O)N(C[C@@H](COC2=CC=C(C=C2)C(=O)C)O)C(=O)N3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC=C(C(=N1)OC)N(C(=O)CSC2=CC=C(C=C2)Cl)S(=O)(=O)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C3=C(/C=C1/C(=O)OC(=N/1)C2=CC(=C(C=C2)Cl)Cl)C=C4C(=C3)OCO4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC[C@H](C)C1=CC=C(C=C1)NC(=O)C3=C2C=CC=CC2=NC4=C3CN(CC4)CC5=CC=CC=C5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)C1=CC=C(C=C1)C(C3=C(C=CC2=CC=C(C=C23)O)O)NC(=O)C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC2(C)C(=O)NC1=C(C=CC=C1)N2C(=O)COC(=O)/C(=C/C3=CC=CO3)/C#N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC1=CC=C(C=C1)NC(=O)C=CC2=CC=C(C)C=C2\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=C(C(=CC(=C1)C=C3C(=O)NC(=S)N(C2=CC(=CC=C2)C(=O)O)C3=O)Cl)OCC4=CC=C(C=C4)Br\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C/C(=C\\\\C(=O)NC1=CC=C(C=C1Cl)Cl)/NCCNC2=NC=C(C=C2Cl)C(F)(F)F\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC=CC=CCOC(=O)C(C)(C)CCC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC3=C(/C=C/C1=CC=NC(=N1)SC2=NC=CC=C2[N+](=O)[O-])SC=C3\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC(=CC(=C1)C)OCC(=O)N/N=C\\\\C3=C(Cl)N(C2=CC=CC=C2)N=C3C\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"COC1=CC2=C(C=C1)NC(=O)C(=C2)[C@H](C3=NN=NN3CC4=CC=CC=C4)N5CCN(CC5)C6=CC(=CC=C6)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCOC1=C(C=CC=C1)C2C(=CN(C)C=C2C(=O)OCC)C(=O)OCC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC3=C(C=C1)N=CN(CCCOC2=C(C=CC=C2)Br)C3=O\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)NC3=C2CSCC2=NN3C4=CC=C(C)C=C4\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"C1=CC(=C(C=C1)OCC(=O)NCC2=NC=CC=C2)C#N\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=C(C)C5=C(C=C1)C=C(CN(CC2=CC=C(C=C2)OC)S(=O)(=O)C4=CC=CC3=NSN=C34)C(=O)N5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)(C(=O)NC2=CC=C1CCCC1=C2)OC3=CC=C(C=C3)Cl\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(=O)NC1=CC(=C(C=C1Cl)C(=O)NCC2=CC=C3C(=C2)OCO3)OC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC(C)CCOC1=CC(=CC=C1)C2C(=C(C(=O)N2CC3=CC=CC=C3)O)C(=O)C5=CC4=C(C(=CC=C4)OC)O5\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CCC1=CC=CC(=C1NC(=O)CN2CC(C)OC(C)C2)CC\"}" } ]
[ { "role": "user", "content": "Analyze the molecular image and convert it to DeepSMILES format. First identify all substructures with BRICS connection points(DeepSMILES), then reconstruct the complete molecule. Output MUST be a dictionary with keys complete_structure' (string FULL_DEEPSMILES).\n<image>" }, { "role": "assistant", "content": "{\"complete_structure\": \"CC1=CC=C(C=C1)NC(=O)COC2=CC=C(C=C2Cl)C3C(=C(N)OC4=NNC(=C34)C)C#N\"}" } ]
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
16