text
stringlengths
4
1.02M
meta
dict
import json from cloudify.workflows import parameters, ctx output_path = parameters.output_path with open(output_path, 'w') as f: f.write(json.dumps({ 'retries': ctx._task_retries, 'retry_interval': ctx._task_retry_interval, 'thread_pool_size': ctx._local_task_thread_pool_size }))
{ "content_hash": "839d30fc8c7eb0e1207a7e19208ed451", "timestamp": "", "source": "github", "line_count": 12, "max_line_length": 60, "avg_line_length": 26.416666666666668, "alnum_prop": 0.6656151419558359, "repo_name": "dankilman/clash", "id": "49f6331cb39352932ef4aa72fdd07ed97ed243e3", "size": "317", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "clash/tests/resources/blueprints/task_config/blueprint_workflows/workflow2.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "86047" }, { "name": "Shell", "bytes": "65" } ], "symlink_target": "" }
"""Test the ZMQ API.""" import configparser import os import struct from test_framework.test_framework import IonTestFramework, SkipTest from test_framework.util import * class ZMQTest (IonTestFramework): def __init__(self): super().__init__() self.num_nodes = 4 port = 28332 def setup_nodes(self): # Try to import python3-zmq. Skip this test if the import fails. try: import zmq except ImportError: raise SkipTest("python3-zmq module not available.") # Check that ion has been built with ZMQ enabled config = configparser.ConfigParser() if not self.options.configfile: self.options.configfile = os.path.dirname(__file__) + "/config.ini" config.read_file(open(self.options.configfile)) if not config["components"].getboolean("ENABLE_ZMQ"): raise SkipTest("iond has not been built with zmq enabled.") self.zmqContext = zmq.Context() self.zmqSubSocket = self.zmqContext.socket(zmq.SUB) self.zmqSubSocket.setsockopt(zmq.SUBSCRIBE, b"hashblock") self.zmqSubSocket.setsockopt(zmq.SUBSCRIBE, b"hashtx") self.zmqSubSocket.connect("tcp://127.0.0.1:%i" % self.port) self.nodes = self.start_nodes(self.num_nodes, self.options.tmpdir, extra_args=[ ['-zmqpubhashtx=tcp://127.0.0.1:'+str(self.port), '-zmqpubhashblock=tcp://127.0.0.1:'+str(self.port)], [], [], [] ]) def run_test(self): self.sync_all() genhashes = self.nodes[0].generate(1) self.sync_all() self.log.info("listen...") msg = self.zmqSubSocket.recv_multipart() topic = msg[0] assert_equal(topic, b"hashtx") body = msg[1] msgSequence = struct.unpack('<I', msg[-1])[-1] assert_equal(msgSequence, 0) #must be sequence 0 on hashtx msg = self.zmqSubSocket.recv_multipart() topic = msg[0] body = msg[1] msgSequence = struct.unpack('<I', msg[-1])[-1] assert_equal(msgSequence, 0) #must be sequence 0 on hashblock blkhash = bytes_to_hex_str(body) assert_equal(genhashes[0], blkhash) #blockhash from generate must be equal to the hash received over zmq n = 10 genhashes = self.nodes[1].generate(n) self.sync_all() zmqHashes = [] blockcount = 0 for x in range(0,n*2): msg = self.zmqSubSocket.recv_multipart() topic = msg[0] body = msg[1] if topic == b"hashblock": zmqHashes.append(bytes_to_hex_str(body)) msgSequence = struct.unpack('<I', msg[-1])[-1] assert_equal(msgSequence, blockcount+1) blockcount += 1 for x in range(0,n): assert_equal(genhashes[x], zmqHashes[x]) #blockhash from generate must be equal to the hash received over zmq #test tx from a second node hashRPC = self.nodes[1].sendtoaddress(self.nodes[0].getnewaddress(), 1.0) self.sync_all() # now we should receive a zmq msg because the tx was broadcast msg = self.zmqSubSocket.recv_multipart() topic = msg[0] body = msg[1] hashZMQ = "" if topic == b"hashtx": hashZMQ = bytes_to_hex_str(body) msgSequence = struct.unpack('<I', msg[-1])[-1] assert_equal(msgSequence, blockcount+1) assert_equal(hashRPC, hashZMQ) #blockhash from generate must be equal to the hash received over zmq if __name__ == '__main__': ZMQTest ().main ()
{ "content_hash": "80fcb0e57bc0914c64f996b3a523bb26", "timestamp": "", "source": "github", "line_count": 105, "max_line_length": 121, "avg_line_length": 34.68571428571428, "alnum_prop": 0.5881383855024712, "repo_name": "aspaas/ion", "id": "d57027ca605e19e56aa4db4023b98998beb0a983", "size": "3856", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "test/functional/zmq_test.py", "mode": "33261", "license": "mit", "language": [ { "name": "C", "bytes": "616463" }, { "name": "C++", "bytes": "4560754" }, { "name": "CSS", "bytes": "1127" }, { "name": "HTML", "bytes": "50621" }, { "name": "Java", "bytes": "2100" }, { "name": "M4", "bytes": "18274" }, { "name": "Makefile", "bytes": "16792" }, { "name": "NSIS", "bytes": "5917" }, { "name": "Objective-C++", "bytes": "6205" }, { "name": "Python", "bytes": "96149" }, { "name": "QMake", "bytes": "20721" }, { "name": "Shell", "bytes": "391146" } ], "symlink_target": "" }
from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('developers', '0005_auto_20150827_1230'), ] operations = [ migrations.RemoveField( model_name='preloadtestplan', name='addon', ), migrations.DeleteModel( name='PreloadTestPlan', ), ]
{ "content_hash": "84a97f2f33a206ef4ed7e678e23ff264", "timestamp": "", "source": "github", "line_count": 20, "max_line_length": 50, "avg_line_length": 20.9, "alnum_prop": 0.583732057416268, "repo_name": "washort/zamboni", "id": "8c1496f7aa5cacf6821f016e07a322114d9543c7", "size": "442", "binary": false, "copies": "6", "ref": "refs/heads/master", "path": "mkt/developers/migrations/0006_auto_20151110_1117.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "CSS", "bytes": "354243" }, { "name": "HTML", "bytes": "2383319" }, { "name": "JavaScript", "bytes": "532109" }, { "name": "Makefile", "bytes": "4313" }, { "name": "Python", "bytes": "4735484" }, { "name": "Shell", "bytes": "11135" }, { "name": "Smarty", "bytes": "1159" } ], "symlink_target": "" }
import os import sys sys.path.insert(0, os.path.abspath('..')) import pyblogit import pyblogit.blogger import pyblogit.database_handler
{ "content_hash": "24c17c99505d8d482a936b1377e33925", "timestamp": "", "source": "github", "line_count": 8, "max_line_length": 41, "avg_line_length": 17.25, "alnum_prop": 0.782608695652174, "repo_name": "jamalmoir/pyblogit", "id": "37fa9689ecf1d75641d93ca7c4633904c04431a7", "size": "138", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "tests/context.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "17083" } ], "symlink_target": "" }
""" Unit tests for L{benchmark}. """ from twisted.trial.unittest import TestCase from twisted.python.usage import UsageError from benchmark import BenchmarkOptions class BenchmarkOptionsTests(TestCase): """ Tests for L{benchmark.BenchmarkOptions}. """ def setUp(self): """ Create a L{BenchmarkOptions} instance to test. """ self.options = BenchmarkOptions() def test_parameters(self): """ The I{--parameters} option can be specified multiple time and each time specifies the parameters for a particular benchmark as a comma separated list of integers. """ self.options.parseOptions(["--parameters", "foo:1,10,100", "foo"]) self.assertEquals( self.options['parameters'], {"foo": [1, 10, 100]}) def test_filterBenchmarksWithoutDistribution(self): """ If neither I{--hosts-count} nor I{--host-index} are supplied, L{BenchmarkOptions} takes all positional arguments as the benchmarks to run. """ self.options.parseOptions(["foo", "bar", "baz"]) self.assertEquals(self.options['benchmarks'], ["foo", "bar", "baz"]) def test_hostsCountWithoutIndex(self): """ If I{--hosts-count} is provided but I{--host-index} is not, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--hosts-count=3", "foo"]) self.assertEquals( str(exc), "Specify neither or both of hosts-count and host-index") def test_hostIndexWithoutCount(self): """ If I{--host-index} is provided by I{--hosts-count} is not, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--host-index=3", "foo"]) self.assertEquals( str(exc), "Specify neither or both of hosts-count and host-index") def test_negativeHostsCount(self): """ If a negative value is provided for I{--hosts-count}, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--host-index=1", "--hosts-count=-1", "foo"]) self.assertEquals( str(exc), "Specify a positive integer for hosts-count") def test_nonIntegerHostsCount(self): """ If a string which cannot be converted to an integer is provided for I{--hosts-count}, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--host-index=1", "--hosts-count=hello", "foo"]) self.assertEquals( str(exc), "Parameter type enforcement failed: invalid literal for int() with base 10: 'hello'") def test_negativeHostIndex(self): """ If a negative value is provided for I{--host-index}, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--host-index=-1", "--hosts-count=2", "foo"]) self.assertEquals( str(exc), "Specify a positive integer for host-index") def test_nonIntegerHostIndex(self): """ If a string which cannot be converted to an integer is provided for I{--host-index}, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--host-index=hello", "--hosts-count=2", "foo"]) self.assertEquals( str(exc), "Parameter type enforcement failed: invalid literal for int() with base 10: 'hello'") def test_largeHostIndex(self): """ If the integer supplied to I{--host-index} is greater than or equal to the integer supplied to I{--hosts-count}, a L{UsageError} is raised. """ exc = self.assertRaises( UsageError, self.options.parseOptions, ["--hosts-count=2", "--host-index=2", "foo"]) self.assertEquals( str(exc), "host-index must be less than hosts-count") def test_hostIndexAndCount(self): """ If I{--hosts-count} and I{--host-index} are supplied, of the benchmarks supplied as positional arguments, only a subset is taken as the benchmarks to run. The subset is constructed so that for a particular value of I{hosts-count}, each benchmark will only appear in the subset returned for a single value of I{--host-index}, and all benchmarks will appear in one such subset. """ self.options.parseOptions([ "--hosts-count=3", "--host-index=0", "foo", "bar", "baz", "quux"]) self.assertEquals(self.options['benchmarks'], ["foo", "quux"]) self.options.parseOptions([ "--hosts-count=3", "--host-index=1", "foo", "bar", "baz", "quux"]) self.assertEquals(self.options['benchmarks'], ["bar"]) self.options.parseOptions([ "--hosts-count=3", "--host-index=2", "foo", "bar", "baz", "quux"]) self.assertEquals(self.options['benchmarks'], ["baz"])
{ "content_hash": "39f1950eac916dd77387b70d10d73c44", "timestamp": "", "source": "github", "line_count": 154, "max_line_length": 97, "avg_line_length": 35.1948051948052, "alnum_prop": 0.5701107011070111, "repo_name": "macosforge/ccs-calendarserver", "id": "a48c684abd702137bc0deeffc312ff63ece1b2e5", "size": "6031", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "contrib/performance/test_benchmark.py", "mode": "33188", "license": "apache-2.0", "language": [], "symlink_target": "" }
""" pyboard interface This module provides the Pyboard class, used to communicate with and control a MicroPython device over a communication channel. Both real boards and emulated devices (e.g. running in QEMU) are supported. Various communication channels are supported, including a serial connection, telnet-style network connection, external process connection. Example usage: import pyboard pyb = pyboard.Pyboard('/dev/ttyACM0') Or: pyb = pyboard.Pyboard('192.168.1.1') Then: pyb.enter_raw_repl() pyb.exec('import pyb') pyb.exec('pyb.LED(1).on()') pyb.exit_raw_repl() Note: if using Python2 then pyb.exec must be written as pyb.exec_. To run a script from the local machine on the board and print out the results: import pyboard pyboard.execfile('test.py', device='/dev/ttyACM0') This script can also be run directly. To execute a local script, use: ./pyboard.py test.py Or: python pyboard.py test.py """ import sys import time import os import ast try: stdout = sys.stdout.buffer except AttributeError: # Python2 doesn't have buffer attr stdout = sys.stdout def stdout_write_bytes(b): b = b.replace(b"\x04", b"") stdout.write(b) stdout.flush() class PyboardError(Exception): pass class TelnetToSerial: def __init__(self, ip, user, password, read_timeout=None): self.tn = None import telnetlib self.tn = telnetlib.Telnet(ip, timeout=15) self.read_timeout = read_timeout if b"Login as:" in self.tn.read_until(b"Login as:", timeout=read_timeout): self.tn.write(bytes(user, "ascii") + b"\r\n") if b"Password:" in self.tn.read_until(b"Password:", timeout=read_timeout): # needed because of internal implementation details of the telnet server time.sleep(0.2) self.tn.write(bytes(password, "ascii") + b"\r\n") if b"for more information." in self.tn.read_until( b'Type "help()" for more information.', timeout=read_timeout ): # login successful from collections import deque self.fifo = deque() return raise PyboardError("Failed to establish a telnet connection with the board") def __del__(self): self.close() def close(self): if self.tn: self.tn.close() def read(self, size=1): while len(self.fifo) < size: timeout_count = 0 data = self.tn.read_eager() if len(data): self.fifo.extend(data) timeout_count = 0 else: time.sleep(0.25) if self.read_timeout is not None and timeout_count > 4 * self.read_timeout: break timeout_count += 1 data = b"" while len(data) < size and len(self.fifo) > 0: data += bytes([self.fifo.popleft()]) return data def write(self, data): self.tn.write(data) return len(data) def inWaiting(self): n_waiting = len(self.fifo) if not n_waiting: data = self.tn.read_eager() self.fifo.extend(data) return len(data) else: return n_waiting class ProcessToSerial: "Execute a process and emulate serial connection using its stdin/stdout." def __init__(self, cmd): import subprocess self.subp = subprocess.Popen( cmd, bufsize=0, shell=True, preexec_fn=os.setsid, stdin=subprocess.PIPE, stdout=subprocess.PIPE, ) # Initially was implemented with selectors, but that adds Python3 # dependency. However, there can be race conditions communicating # with a particular child process (like QEMU), and selectors may # still work better in that case, so left inplace for now. # # import selectors # self.sel = selectors.DefaultSelector() # self.sel.register(self.subp.stdout, selectors.EVENT_READ) import select self.poll = select.poll() self.poll.register(self.subp.stdout.fileno()) def close(self): import signal os.killpg(os.getpgid(self.subp.pid), signal.SIGTERM) def read(self, size=1): data = b"" while len(data) < size: data += self.subp.stdout.read(size - len(data)) return data def write(self, data): self.subp.stdin.write(data) return len(data) def inWaiting(self): # res = self.sel.select(0) res = self.poll.poll(0) if res: return 1 return 0 class ProcessPtyToTerminal: """Execute a process which creates a PTY and prints secondary PTY as first line of its output, and emulate serial connection using this PTY.""" def __init__(self, cmd): import subprocess import re import serial self.subp = subprocess.Popen( cmd.split(), bufsize=0, shell=False, preexec_fn=os.setsid, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE, ) pty_line = self.subp.stderr.readline().decode("utf-8") m = re.search(r"/dev/pts/[0-9]+", pty_line) if not m: print("Error: unable to find PTY device in startup line:", pty_line) self.close() sys.exit(1) pty = m.group() # rtscts, dsrdtr params are to workaround pyserial bug: # http://stackoverflow.com/questions/34831131/pyserial-does-not-play-well-with-virtual-port self.ser = serial.Serial(pty, interCharTimeout=1, rtscts=True, dsrdtr=True) def close(self): import signal os.killpg(os.getpgid(self.subp.pid), signal.SIGTERM) def read(self, size=1): return self.ser.read(size) def write(self, data): return self.ser.write(data) def inWaiting(self): return self.ser.inWaiting() class Pyboard: def __init__( self, device, baudrate=115200, user="micro", password="python", wait=0, exclusive=True ): self.in_raw_repl = False self.use_raw_paste = True if device.startswith("exec:"): self.serial = ProcessToSerial(device[len("exec:") :]) elif device.startswith("execpty:"): self.serial = ProcessPtyToTerminal(device[len("qemupty:") :]) elif device and device[0].isdigit() and device[-1].isdigit() and device.count(".") == 3: # device looks like an IP address self.serial = TelnetToSerial(device, user, password, read_timeout=10) else: import serial # Set options, and exclusive if pyserial supports it serial_kwargs = {"baudrate": baudrate, "interCharTimeout": 1} if serial.__version__ >= "3.3": serial_kwargs["exclusive"] = exclusive delayed = False for attempt in range(wait + 1): try: self.serial = serial.Serial(device, **serial_kwargs) break except (OSError, IOError): # Py2 and Py3 have different errors if wait == 0: continue if attempt == 0: sys.stdout.write("Waiting {} seconds for pyboard ".format(wait)) delayed = True time.sleep(1) sys.stdout.write(".") sys.stdout.flush() else: if delayed: print("") raise PyboardError("failed to access " + device) if delayed: print("") def close(self): self.serial.close() def read_until(self, min_num_bytes, ending, timeout=10, data_consumer=None): # if data_consumer is used then data is not accumulated and the ending must be 1 byte long assert data_consumer is None or len(ending) == 1 data = self.serial.read(min_num_bytes) if data_consumer: data_consumer(data) timeout_count = 0 while True: if data.endswith(ending): break elif self.serial.inWaiting() > 0: new_data = self.serial.read(1) if data_consumer: data_consumer(new_data) data = new_data else: data = data + new_data timeout_count = 0 else: timeout_count += 1 if timeout is not None and timeout_count >= 100 * timeout: break time.sleep(0.01) return data def enter_raw_repl(self, soft_reset=True): self.serial.write(b"\r\x03\x03") # ctrl-C twice: interrupt any running program # flush input (without relying on serial.flushInput()) n = self.serial.inWaiting() while n > 0: self.serial.read(n) n = self.serial.inWaiting() self.serial.write(b"\r\x01") # ctrl-A: enter raw REPL if soft_reset: data = self.read_until(1, b"raw REPL; CTRL-B to exit\r\n>") if not data.endswith(b"raw REPL; CTRL-B to exit\r\n>"): print(data) raise PyboardError("could not enter raw repl") self.serial.write(b"\x04") # ctrl-D: soft reset # Waiting for "soft reboot" independently to "raw REPL" (done below) # allows boot.py to print, which will show up after "soft reboot" # and before "raw REPL". data = self.read_until(1, b"soft reboot\r\n") if not data.endswith(b"soft reboot\r\n"): print(data) raise PyboardError("could not enter raw repl") data = self.read_until(1, b"raw REPL; CTRL-B to exit\r\n") if not data.endswith(b"raw REPL; CTRL-B to exit\r\n"): print(data) raise PyboardError("could not enter raw repl") self.in_raw_repl = True def exit_raw_repl(self): self.serial.write(b"\r\x02") # ctrl-B: enter friendly REPL self.in_raw_repl = False def follow(self, timeout, data_consumer=None): # wait for normal output data = self.read_until(1, b"\x04", timeout=timeout, data_consumer=data_consumer) if not data.endswith(b"\x04"): raise PyboardError("timeout waiting for first EOF reception") data = data[:-1] # wait for error output data_err = self.read_until(1, b"\x04", timeout=timeout) if not data_err.endswith(b"\x04"): raise PyboardError("timeout waiting for second EOF reception") data_err = data_err[:-1] # return normal and error output return data, data_err def raw_paste_write(self, command_bytes): # Read initial header, with window size. data = self.serial.read(2) window_size = data[0] | data[1] << 8 window_remain = window_size # Write out the command_bytes data. i = 0 while i < len(command_bytes): while window_remain == 0 or self.serial.inWaiting(): data = self.serial.read(1) if data == b"\x01": # Device indicated that a new window of data can be sent. window_remain += window_size elif data == b"\x04": # Device indicated abrupt end. Acknowledge it and finish. self.serial.write(b"\x04") return else: # Unexpected data from device. raise PyboardError("unexpected read during raw paste: {}".format(data)) # Send out as much data as possible that fits within the allowed window. b = command_bytes[i : min(i + window_remain, len(command_bytes))] self.serial.write(b) window_remain -= len(b) i += len(b) # Indicate end of data. self.serial.write(b"\x04") # Wait for device to acknowledge end of data. data = self.read_until(1, b"\x04") if not data.endswith(b"\x04"): raise PyboardError("could not complete raw paste: {}".format(data)) def exec_raw_no_follow(self, command): if isinstance(command, bytes): command_bytes = command else: command_bytes = bytes(command, encoding="utf8") # check we have a prompt data = self.read_until(1, b">") if not data.endswith(b">"): raise PyboardError("could not enter raw repl") if self.use_raw_paste: # Try to enter raw-paste mode. self.serial.write(b"\x05A\x01") data = self.serial.read(2) if data == b"R\x00": # Device understood raw-paste command but doesn't support it. pass elif data == b"R\x01": # Device supports raw-paste mode, write out the command using this mode. return self.raw_paste_write(command_bytes) else: # Device doesn't support raw-paste, fall back to normal raw REPL. data = self.read_until(1, b"w REPL; CTRL-B to exit\r\n>") if not data.endswith(b"w REPL; CTRL-B to exit\r\n>"): print(data) raise PyboardError("could not enter raw repl") # Don't try to use raw-paste mode again for this connection. self.use_raw_paste = False # Write command using standard raw REPL, 256 bytes every 10ms. for i in range(0, len(command_bytes), 256): self.serial.write(command_bytes[i : min(i + 256, len(command_bytes))]) time.sleep(0.01) self.serial.write(b"\x04") # check if we could exec command data = self.serial.read(2) if data != b"OK": raise PyboardError("could not exec command (response: %r)" % data) def exec_raw(self, command, timeout=10, data_consumer=None): self.exec_raw_no_follow(command) return self.follow(timeout, data_consumer) def eval(self, expression): ret = self.exec_("print({})".format(expression)) ret = ret.strip() return ret def exec_(self, command, data_consumer=None): ret, ret_err = self.exec_raw(command, data_consumer=data_consumer) if ret_err: raise PyboardError("exception", ret, ret_err) return ret def execfile(self, filename): with open(filename, "rb") as f: pyfile = f.read() return self.exec_(pyfile) def get_time(self): t = str(self.eval("pyb.RTC().datetime()"), encoding="utf8")[1:-1].split(", ") return int(t[4]) * 3600 + int(t[5]) * 60 + int(t[6]) def fs_ls(self, src): cmd = ( "import uos\nfor f in uos.ilistdir(%s):\n" " print('{:12} {}{}'.format(f[3]if len(f)>3 else 0,f[0],'/'if f[1]&0x4000 else ''))" % (("'%s'" % src) if src else "") ) self.exec_(cmd, data_consumer=stdout_write_bytes) def fs_cat(self, src, chunk_size=256): cmd = ( "with open('%s') as f:\n while 1:\n" " b=f.read(%u)\n if not b:break\n print(b,end='')" % (src, chunk_size) ) self.exec_(cmd, data_consumer=stdout_write_bytes) def fs_get(self, src, dest, chunk_size=256): self.exec_("f=open('%s','rb')\nr=f.read" % src) with open(dest, "wb") as f: while True: data = bytearray() self.exec_("print(r(%u))" % chunk_size, data_consumer=lambda d: data.extend(d)) assert data.endswith(b"\r\n\x04") try: data = ast.literal_eval(str(data[:-3], "ascii")) if not isinstance(data, bytes): raise ValueError("Not bytes") except (UnicodeError, ValueError) as e: raise PyboardError("fs_get: Could not interpret received data: %s" % str(e)) if not data: break f.write(data) self.exec_("f.close()") def fs_put(self, src, dest, chunk_size=256): self.exec_("f=open('%s','wb')\nw=f.write" % dest) with open(src, "rb") as f: while True: data = f.read(chunk_size) if not data: break if sys.version_info < (3,): self.exec_("w(b" + repr(data) + ")") else: self.exec_("w(" + repr(data) + ")") self.exec_("f.close()") def fs_mkdir(self, dir): self.exec_("import uos\nuos.mkdir('%s')" % dir) def fs_rmdir(self, dir): self.exec_("import uos\nuos.rmdir('%s')" % dir) def fs_rm(self, src): self.exec_("import uos\nuos.remove('%s')" % src) # in Python2 exec is a keyword so one must use "exec_" # but for Python3 we want to provide the nicer version "exec" setattr(Pyboard, "exec", Pyboard.exec_) def execfile(filename, device="/dev/ttyACM0", baudrate=115200, user="micro", password="python"): pyb = Pyboard(device, baudrate, user, password) pyb.enter_raw_repl() output = pyb.execfile(filename) stdout_write_bytes(output) pyb.exit_raw_repl() pyb.close() def filesystem_command(pyb, args): def fname_remote(src): if src.startswith(":"): src = src[1:] return src def fname_cp_dest(src, dest): src = src.rsplit("/", 1)[-1] if dest is None or dest == "": dest = src elif dest == ".": dest = "./" + src elif dest.endswith("/"): dest += src return dest cmd = args[0] args = args[1:] try: if cmd == "cp": srcs = args[:-1] dest = args[-1] if srcs[0].startswith("./") or dest.startswith(":"): op = pyb.fs_put fmt = "cp %s :%s" dest = fname_remote(dest) else: op = pyb.fs_get fmt = "cp :%s %s" for src in srcs: src = fname_remote(src) dest2 = fname_cp_dest(src, dest) print(fmt % (src, dest2)) op(src, dest2) else: op = { "ls": pyb.fs_ls, "cat": pyb.fs_cat, "mkdir": pyb.fs_mkdir, "rmdir": pyb.fs_rmdir, "rm": pyb.fs_rm, }[cmd] if cmd == "ls" and not args: args = [""] for src in args: src = fname_remote(src) print("%s :%s" % (cmd, src)) op(src) except PyboardError as er: print(str(er.args[2], "ascii")) pyb.exit_raw_repl() pyb.close() sys.exit(1) _injected_import_hook_code = """\ import uos, uio class _FS: class File(uio.IOBase): def __init__(self): self.off = 0 def ioctl(self, request, arg): return 0 def readinto(self, buf): buf[:] = memoryview(_injected_buf)[self.off:self.off + len(buf)] self.off += len(buf) return len(buf) mount = umount = chdir = lambda *args: None def stat(self, path): if path == '_injected.mpy': return tuple(0 for _ in range(10)) else: raise OSError(-2) # ENOENT def open(self, path, mode): return self.File() uos.mount(_FS(), '/_') uos.chdir('/_') from _injected import * uos.umount('/_') del _injected_buf, _FS """ def main(): import argparse cmd_parser = argparse.ArgumentParser(description="Run scripts on the pyboard.") cmd_parser.add_argument( "-d", "--device", default=os.environ.get("PYBOARD_DEVICE", "/dev/ttyACM0"), help="the serial device or the IP address of the pyboard", ) cmd_parser.add_argument( "-b", "--baudrate", default=os.environ.get("PYBOARD_BAUDRATE", "115200"), help="the baud rate of the serial device", ) cmd_parser.add_argument("-u", "--user", default="micro", help="the telnet login username") cmd_parser.add_argument("-p", "--password", default="python", help="the telnet login password") cmd_parser.add_argument("-c", "--command", help="program passed in as string") cmd_parser.add_argument( "-w", "--wait", default=0, type=int, help="seconds to wait for USB connected board to become available", ) group = cmd_parser.add_mutually_exclusive_group() group.add_argument( "--soft-reset", default=True, action="store_true", help="Whether to perform a soft reset when connecting to the board [default]", ) group.add_argument( "--no-soft-reset", action="store_false", dest="soft_reset", ) group = cmd_parser.add_mutually_exclusive_group() group.add_argument( "--follow", action="store_true", default=None, help="follow the output after running the scripts [default if no scripts given]", ) group.add_argument( "--no-follow", action="store_false", dest="follow", ) group = cmd_parser.add_mutually_exclusive_group() group.add_argument( "--exclusive", action="store_true", default=True, help="Open the serial device for exclusive access [default]", ) group.add_argument( "--no-exclusive", action="store_false", dest="exclusive", ) cmd_parser.add_argument( "-f", "--filesystem", action="store_true", help="perform a filesystem action: " "cp local :device | cp :device local | cat path | ls [path] | rm path | mkdir path | rmdir path", ) cmd_parser.add_argument("files", nargs="*", help="input files") args = cmd_parser.parse_args() # open the connection to the pyboard try: pyb = Pyboard( args.device, args.baudrate, args.user, args.password, args.wait, args.exclusive ) except PyboardError as er: print(er) sys.exit(1) # run any command or file(s) if args.command is not None or args.filesystem or len(args.files): # we must enter raw-REPL mode to execute commands # this will do a soft-reset of the board try: pyb.enter_raw_repl(args.soft_reset) except PyboardError as er: print(er) pyb.close() sys.exit(1) def execbuffer(buf): try: if args.follow is None or args.follow: ret, ret_err = pyb.exec_raw( buf, timeout=None, data_consumer=stdout_write_bytes ) else: pyb.exec_raw_no_follow(buf) ret_err = None except PyboardError as er: print(er) pyb.close() sys.exit(1) except KeyboardInterrupt: sys.exit(1) if ret_err: pyb.exit_raw_repl() pyb.close() stdout_write_bytes(ret_err) sys.exit(1) # do filesystem commands, if given if args.filesystem: filesystem_command(pyb, args.files) del args.files[:] # run the command, if given if args.command is not None: execbuffer(args.command.encode("utf-8")) # run any files for filename in args.files: with open(filename, "rb") as f: pyfile = f.read() if filename.endswith(".mpy") and pyfile[0] == ord("M"): pyb.exec_("_injected_buf=" + repr(pyfile)) pyfile = _injected_import_hook_code execbuffer(pyfile) # exiting raw-REPL just drops to friendly-REPL mode pyb.exit_raw_repl() # if asked explicitly, or no files given, then follow the output if args.follow or (args.command is None and not args.filesystem and len(args.files) == 0): try: ret, ret_err = pyb.follow(timeout=None, data_consumer=stdout_write_bytes) except PyboardError as er: print(er) sys.exit(1) except KeyboardInterrupt: sys.exit(1) if ret_err: pyb.close() stdout_write_bytes(ret_err) sys.exit(1) # close the connection to the pyboard pyb.close() if __name__ == "__main__": main()
{ "content_hash": "d8b4234a863f0a9455c2e7f9b8eeada6", "timestamp": "", "source": "github", "line_count": 758, "max_line_length": 105, "avg_line_length": 32.84696569920845, "alnum_prop": 0.5410876375612499, "repo_name": "adafruit/circuitpython", "id": "a43a4d0574857cf0f2b2cecdaeb7e1fdb7186b29", "size": "25220", "binary": false, "copies": "1", "ref": "refs/heads/main", "path": "tools/pyboard.py", "mode": "33261", "license": "mit", "language": [ { "name": "Assembly", "bytes": "10241" }, { "name": "C", "bytes": "18450191" }, { "name": "C++", "bytes": "476" }, { "name": "CMake", "bytes": "18203" }, { "name": "CSS", "bytes": "316" }, { "name": "HTML", "bytes": "10126" }, { "name": "JavaScript", "bytes": "13854" }, { "name": "Jinja", "bytes": "11034" }, { "name": "Makefile", "bytes": "330832" }, { "name": "Python", "bytes": "1423935" }, { "name": "Shell", "bytes": "18681" } ], "symlink_target": "" }
import lmfit import numpy as np from collections import OrderedDict from pycqed.analysis import fitting_models as fit_mods from pycqed.analysis import analysis_toolbox as a_tools import pycqed.analysis_v2.base_analysis as ba from pycqed.analysis.tools.plotting import SI_val_to_msg_str from copy import deepcopy class Scope_Trace_analysis(ba.BaseDataAnalysis): """ Analysis to extract the intercept of two parameters. relevant options_dict parameters x_ch_idx (int): specifies x channel default = 1 y_ch_idx (int): specifies y channel default = 2 edge_time (float) : time corresponding to rising edge square_length (float) : duration of the square_pulse shortest_timescale(float): timescale after rising edge and falling edge up to which to ignore when calculating the deviation longest_timescale(float): timescale after rising edge and falling edge from which to ignore when calculating the deviation """ def __init__(self, t_start: str=None, t_stop: str=None, data_file_path: str=None, options_dict: dict=None, extract_only: bool=False, do_fitting: bool=True, auto=True): super().__init__(t_start=t_start, t_stop=t_stop, data_file_path=data_file_path, options_dict=options_dict, extract_only=extract_only, do_fitting=do_fitting) self.single_timestamp = False self.params_dict = {'xlabel': 'sweep_name', 'xvals': 'sweep_points', 'xunit': 'sweep_unit', 'measurementstring': 'measurementstring', 'value_names': 'value_names', 'value_units': 'value_units', 'measured_values': 'measured_values'} self.numeric_params = [] if auto: self.run_analysis() def process_data(self): """ selects the relevant acq channel based on "x_ch_idx" and "y_ch_idx" specified in the options dict. If x_ch_idx and y_ch_idx are the same it will unzip the data. """ # Extracting the basic x and y values self.proc_data_dict = deepcopy(self.raw_data_dict) # The channel containing the data must be specified in the options dict x_ch_idx = self.options_dict.get('x_ch_idx', 0) y_ch_idx = self.options_dict.get('y_ch_idx', 1) self.proc_data_dict['ylabel'] = self.raw_data_dict['value_names'][0][y_ch_idx] self.proc_data_dict['yunit'] = self.raw_data_dict['value_units'][0][y_ch_idx] self.proc_data_dict['xlabel'] = self.raw_data_dict['value_names'][0][x_ch_idx] self.proc_data_dict['xunit'] = self.raw_data_dict['value_units'][0][x_ch_idx] self.proc_data_dict['xvals'] = list(self.raw_data_dict ['measured_values_ord_dict'].values())[x_ch_idx][0] self.proc_data_dict['yvals'] = list(self.raw_data_dict ['measured_values_ord_dict'].values())[y_ch_idx][0] # Detect the rising edge and shift the time axis self.proc_data_dict['square_length'] = self.options_dict.get('square_length', 1e-6) r_edge_idx = detect_threshold_crossing( self.proc_data_dict['yvals'], 0.05) edge_time = self.proc_data_dict['xvals'][r_edge_idx] print(edge_time) stop_time = edge_time + self.proc_data_dict['square_length'] r_edge_idx = np.argmin(abs(self.proc_data_dict['xvals'] - edge_time)) f_edge_idx = np.argmin(abs(self.proc_data_dict['xvals'] - stop_time)) self.proc_data_dict['tvals'] = self.proc_data_dict['xvals'] - edge_time # Setting which part of the experiment to ignore when calculating difference shortest_timescale = self.options_dict.get('shortest_timescale', 0) sh_ign_idx = np.argmin(abs(self.proc_data_dict['xvals'] - shortest_timescale)) longest_timescale = self.options_dict.get('longest_timescale', 40e-6) lo_ign_idx = np.argmin(abs(self.proc_data_dict['xvals'] - longest_timescale)) # Determine the mean amplitude of the square pulse end_of_sq_idx = min(r_edge_idx+lo_ign_idx, f_edge_idx) self.proc_data_dict['sq_amp'] = np.mean( self.proc_data_dict['yvals'][r_edge_idx+sh_ign_idx:end_of_sq_idx]) self.proc_data_dict['background_amp'] = np.mean( self.proc_data_dict['yvals'][:r_edge_idx]) # Determine the expected waveform while ignoring the self.proc_data_dict['expected_wf'] = np.ones( len(self.proc_data_dict['tvals']))*self.proc_data_dict['background_amp'] self.proc_data_dict['expected_wf'][r_edge_idx:f_edge_idx] = self.proc_data_dict['sq_amp'] diff_to_exp = self.proc_data_dict['yvals'] - self.proc_data_dict['expected_wf'] # parts in cost function to ignore diff_to_exp[:r_edge_idx+sh_ign_idx] = 0 # part at short timescale diff_to_exp[r_edge_idx+lo_ign_idx:f_edge_idx] = 0 # part in pulse for long timescale diff_to_exp[f_edge_idx:] = 0 # part before the pulse deviation = np.sqrt(np.sum((diff_to_exp)**2))/len(diff_to_exp) self.proc_data_dict['diff_to_exp'] = diff_to_exp self.proc_data_dict['deviation'] = deviation def prepare_plots(self): self.plot_dicts['main'] = { 'plotfn': self.plot_line, 'xvals': self.proc_data_dict['tvals'], 'xlabel': self.proc_data_dict['xlabel'], 'xunit': self.proc_data_dict['xunit'], 'yvals': self.proc_data_dict['yvals'], 'ylabel': self.proc_data_dict['ylabel'], 'yunit': self.proc_data_dict['yunit'], 'setlabel': 'Scope Trace', 'marker':'', 'title': (self.proc_data_dict['timestamps'][0] + ' \n' + self.proc_data_dict['measurementstring'][0]), 'do_legend': True, 'legend_pos': 'upper right'} self.plot_dicts['expected_wf'] = { 'plotfn': self.plot_line, 'ax_id': 'main', 'xvals': self.proc_data_dict['tvals'], 'xlabel': self.proc_data_dict['xlabel'], 'xunit': self.proc_data_dict['xunit'], 'yvals': self.proc_data_dict['expected_wf'], 'ylabel': self.proc_data_dict['ylabel'], 'yunit': self.proc_data_dict['yunit'], 'setlabel': 'Desired waveform', 'marker':'', 'do_legend': True, 'legend_pos': 'upper right'} dev_msg = "Deviation from expected {:.4g}".format( self.proc_data_dict['deviation']) self.plot_dicts['text_msg'] = { 'ax_id': 'main', 'ypos': 0.8, 'plotfn': self.plot_text, 'box_props': 'fancy', 'text_string': dev_msg} self.plot_dicts['fine'] = deepcopy(self.plot_dicts['main']) self.plot_dicts['fine']['ax_id'] = 'fine' self.plot_dicts['fine']['yrange'] = (self.proc_data_dict['sq_amp']*.95, self.proc_data_dict['sq_amp']*1.05) self.plot_dicts['fine']['xrange'] = ( -0.05*self.proc_data_dict['square_length'], 1.05*self.proc_data_dict['square_length']) self.plot_dicts['fine_exp'] = deepcopy(self.plot_dicts['expected_wf']) self.plot_dicts['fine_exp']['ax_id'] = 'fine' self.plot_dicts['plus_percent'] = { 'plotfn': self.plot_matplot_ax_method, 'ax_id': 'fine', 'func': 'axhline', 'plot_kws': {'y': self.proc_data_dict['sq_amp']*1.01, 'ls':':', 'c':'grey', 'label':r'$\pm$ 1\%'}} self.plot_dicts['minus_percent'] = { 'plotfn': self.plot_matplot_ax_method, 'ax_id': 'fine', 'func': 'axhline', 'plot_kws': {'y': self.proc_data_dict['sq_amp']*0.99, 'ls':':', 'c':'grey'}} self.plot_dicts['plus_tenth_percent'] = { 'plotfn': self.plot_matplot_ax_method, 'ax_id': 'fine', 'func': 'axhline', 'plot_kws': {'y': self.proc_data_dict['sq_amp']*1.001, 'ls':'--', 'c':'grey', 'label':r'$\pm$ 0.1\%'}} self.plot_dicts['minus_tenth_percent'] = { 'plotfn': self.plot_matplot_ax_method, 'ax_id': 'fine', 'func': 'axhline', 'plot_kws': {'y': self.proc_data_dict['sq_amp']*0.999, 'ls':'--', 'c':'grey'}} self.plot_dicts['diff_to_exp'] = { 'plotfn': self.plot_line, 'ax_id': 'diff_to_exp', 'xvals': self.proc_data_dict['tvals'], 'xlabel': self.proc_data_dict['xlabel'], 'xunit': self.proc_data_dict['xunit'], 'yvals': self.proc_data_dict['diff_to_exp'], 'ylabel': self.proc_data_dict['ylabel'], 'yunit': self.proc_data_dict['yunit'], 'setlabel': 'Difference to desired waveform', 'marker':'', 'do_legend': True, 'legend_pos': 'upper right'} def detect_threshold_crossing(signal, frac_of_max=0.10): """ Detects the first crossing of some threshold and returns the index """ th = signal > frac_of_max*np.max(signal) # marks all but the first occurence of True to False th[1:][th[:-1] & th[1:]] = False return np.where(th)[0][0]
{ "content_hash": "8ac6e158b77e81b39a8a4c37e21b8f61", "timestamp": "", "source": "github", "line_count": 228, "max_line_length": 97, "avg_line_length": 42.32017543859649, "alnum_prop": 0.5513524717587315, "repo_name": "DiCarloLab-Delft/PycQED_py3", "id": "2f801dd8ffc7bd2d571ce22e806fd6657a8d5e6e", "size": "9649", "binary": false, "copies": "1", "ref": "refs/heads/develop", "path": "pycqed/analysis_v2/distortions_analysis.py", "mode": "33188", "license": "mit", "language": [ { "name": "C", "bytes": "8748" }, { "name": "C++", "bytes": "8802" }, { "name": "Cython", "bytes": "8291" }, { "name": "OpenQASM", "bytes": "15894" }, { "name": "Python", "bytes": "7978715" }, { "name": "TeX", "bytes": "8" } ], "symlink_target": "" }
from msrest.serialization import Model class OperationPropertiesFormatServiceSpecification(Model): """Specification of the service. :param metric_specifications: Operation service specification. :type metric_specifications: list[~azure.mgmt.network.v2018_01_01.models.MetricSpecification] :param log_specifications: Operation log specification. :type log_specifications: list[~azure.mgmt.network.v2018_01_01.models.LogSpecification] """ _attribute_map = { 'metric_specifications': {'key': 'metricSpecifications', 'type': '[MetricSpecification]'}, 'log_specifications': {'key': 'logSpecifications', 'type': '[LogSpecification]'}, } def __init__(self, *, metric_specifications=None, log_specifications=None, **kwargs) -> None: super(OperationPropertiesFormatServiceSpecification, self).__init__(**kwargs) self.metric_specifications = metric_specifications self.log_specifications = log_specifications
{ "content_hash": "9b9751d526cc0871cc2f2f7594b988ce", "timestamp": "", "source": "github", "line_count": 23, "max_line_length": 98, "avg_line_length": 43.04347826086956, "alnum_prop": 0.7191919191919192, "repo_name": "lmazuel/azure-sdk-for-python", "id": "aa8bf97f45644c0ab2febdda2234a65f006fd7a5", "size": "1464", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "azure-mgmt-network/azure/mgmt/network/v2018_01_01/models/operation_properties_format_service_specification_py3.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "42572767" } ], "symlink_target": "" }
"""Common functionality for the application object model The object model must be initialized at service start via solum.objects.load() and all objects should be retrieved via solum.objects.registry.<class> in application code. """ from oslo.config import cfg from solum.objects import registry from solum.openstack.common.db import api # noqa from solum.openstack.common import importutils db_opts = [ cfg.StrOpt('schema_mode', default='new', help="The version of the schema that should be " "running: 'old', 'transition', 'new'") ] CONF = cfg.CONF CONF.register_opts(db_opts, "database") _BACKEND_MAPPING = {'sqlalchemy': 'solum.objects.sqlalchemy'} def transition_schema(): """Is the new schema in write-only mode.""" return cfg.CONF.database.schema_mode == 'transition' def new_schema(): """Should objects be writing to the new schema.""" return cfg.CONF.database.schema_mode != 'old' def load(): """Ensure that the object model is initialized.""" registry.clear() backend_name = CONF.database.backend backend_path = _BACKEND_MAPPING.get(backend_name, backend_name) backend_mod = importutils.import_module(backend_path) backend_mod.load() registry = registry.Registry()
{ "content_hash": "75681da5bd5058ed0fea9da7af1b5eab", "timestamp": "", "source": "github", "line_count": 53, "max_line_length": 67, "avg_line_length": 24.37735849056604, "alnum_prop": 0.6896284829721362, "repo_name": "gilbertpilz/solum", "id": "f9ff06099ccfa39023ee1edb62658c1390160d7f", "size": "1872", "binary": false, "copies": "7", "ref": "refs/heads/camp/item-1", "path": "solum/objects/__init__.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Go", "bytes": "75" }, { "name": "Python", "bytes": "888136" }, { "name": "Ruby", "bytes": "217" }, { "name": "Shell", "bytes": "37758" } ], "symlink_target": "" }
"""An example of persistence for a directed graph structure. The graph is stored as a collection of edges, each referencing both a "lower" and an "upper" node in a table of nodes. Basic persistence and querying for lower- and upper- neighbors are illustrated:: n2 = Node(2) n5 = Node(5) n2.add_neighbor(n5) print n2.higher_neighbors() """
{ "content_hash": "b5b66c9664f4e0faac539f2999718791", "timestamp": "", "source": "github", "line_count": 11, "max_line_length": 67, "avg_line_length": 32.63636363636363, "alnum_prop": 0.7103064066852368, "repo_name": "rclmenezes/sqlalchemy", "id": "629808abe91ffede9e5354bc74da686701357f99", "size": "359", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "examples/graphs/__init__.py", "mode": "33188", "license": "mit", "language": [ { "name": "C", "bytes": "38103" }, { "name": "CSS", "bytes": "7760" }, { "name": "JavaScript", "bytes": "244" }, { "name": "Makefile", "bytes": "7072" }, { "name": "Python", "bytes": "7243712" }, { "name": "TeX", "bytes": "13927" } ], "symlink_target": "" }
"""Implementation of the convolutional neural net.""" from keras.models import Sequential from keras.layers import Dense, Activation, Flatten from keras.layers import Convolution2D, MaxPooling2D from keras.optimizers import SGD from keras.callbacks import ModelCheckpoint, TensorBoard import os import numpy as np from config import MODELS_DIR, TENSORBOARD_DIR from io_util import save_makedirs, save_model def train_model(model, features, labels, tile_size, model_id, nb_epoch=10, checkpoints=False, tensorboard=False): """Train a model with the given features and labels.""" # The features and labels are a list of triples when passed # to the function. Each triple contains the tile and information # about its source image and its postion in the source. To train # the model we extract just the tiles. X, y = get_matrix_form(features, labels, tile_size) X = normalise_input(X) # Directory which is used to store the model and its weights. model_dir = os.path.join(MODELS_DIR, model_id) checkpointer = None if checkpoints: checkpoints_file = os.path.join(model_dir, "weights.hdf5") checkpointer = ModelCheckpoint(checkpoints_file) tensorboarder = None if tensorboard: log_dir = os.path.join(TENSORBOARD_DIR, model_id) tensorboarder = TensorBoard(log_dir=log_dir) callbacks = [c for c in [checkpointer, tensorboarder] if c] print("Start training.") model.fit(X, y, nb_epoch=nb_epoch, callbacks=callbacks, validation_split=0.1) save_model(model, model_dir) return model def init_model(tile_size, model_id, architecture='one_layer', nb_filters_1=64, filter_size_1=12, stride_1=(4, 4), pool_size_1=(3, 3), nb_filters_2=128, filter_size_2=4, stride_2=(1, 1), learning_rate=0.005, momentum=0.9, decay=0.002): """Initialise a new model with the given hyperparameters and save it for later use.""" num_channels = 3 model = Sequential() if architecture == 'one_layer': model.add( Convolution2D( nb_filters_1, filter_size_1, filter_size_1, subsample=stride_1, input_shape=(tile_size, tile_size, num_channels))) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=pool_size_1)) model.add(Flatten()) model.add(Dense(tile_size * tile_size)) model.add(Activation('sigmoid')) elif architecture == 'two_layer': model.add( Convolution2D( nb_filters_1, filter_size_1, filter_size_1, subsample=stride_1, input_shape=(tile_size, tile_size, num_channels))) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=pool_size_1)) model.add( Convolution2D( nb_filters_2, filter_size_2, filter_size_2, subsample=stride_2)) model.add(Activation('relu')) model.add(Flatten()) model.add(Dense(tile_size * tile_size)) model.add(Activation('sigmoid')) model = compile_model(model, learning_rate, momentum, decay) # Print a summary of the model to the console. model.summary() model_dir = os.path.join(MODELS_DIR, model_id) save_makedirs(model_dir) save_model(model, model_dir) return model def compile_model(model, learning_rate, momentum, decay): """Compile the keras model with the given hyperparameters.""" optimizer = SGD(lr=learning_rate, momentum=momentum, decay=decay) model.compile( loss='categorical_crossentropy', optimizer=optimizer, metrics=['accuracy']) return model def normalise_input(features): """Normalise the features such that all values are in the range [0,1].""" features = features.astype(np.float32) return np.multiply(features, 1.0 / 255.0) def get_matrix_form(features, labels, tile_size): """Transform a list of triples of features and labels. To a matrix which contains only the tiles used for training the model.""" features = [tile for tile, position, path in features] labels = [tile for tile, position, path in labels] # The model will have one output corresponding to each pixel in the feature tile. # So we need to transform the labels which are given as a 2D bitmap into a vector. labels = np.reshape(labels, (len(labels), tile_size * tile_size)) return np.array(features), np.array(labels)
{ "content_hash": "d4e2a7abc25ff67c916145b4cb00c8c6", "timestamp": "", "source": "github", "line_count": 149, "max_line_length": 90, "avg_line_length": 32.53691275167785, "alnum_prop": 0.614480198019802, "repo_name": "treigerm/WaterNet", "id": "2f8e59fdb6e497ac7fc7924bcbd05608180fbb5a", "size": "4848", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "waterNet/model.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "37654" } ], "symlink_target": "" }
from __future__ import unicode_literals from django.db import migrations ROLE_DUPLICATES_QUERY = """ SELECT id FROM ( SELECT id, ROW_NUMBER() OVER ( PARTITION BY github_user, github_repo ORDER BY modified DESC) AS rnum FROM main_role) temp WHERE temp.rnum > 1; """ def drop_role_duplicates(apps, schema_editor): db_alias = schema_editor.connection.alias Role = apps.get_model('main', 'Role') # NOTE(cutwater): All on_delete constraints in Django are software # defined, so we have to first query ids for deletion and then delete # Role objects with ORM. roles = Role.objects.using(db_alias).raw(ROLE_DUPLICATES_QUERY) for role in ( Role.objects.using(db_alias) .filter(pk__in=(r.id for r in roles))): # NOTE(cutwater): When calling .delete() on QuerySet, Django ORM # it seems that on_delete is not executed, so we have to execute # .delete() on each object specifically. role.delete() class Migration(migrations.Migration): dependencies = [ ('main', '0055_contentblock'), ] operations = [ # NOTE(cutwater): Since Django creates all constraints as DEFERRED, # we need to set them to IMMEDIATE to perform DDL and DML queries # in one single transaction. migrations.RunSQL('SET CONSTRAINTS ALL IMMEDIATE', reverse_sql=migrations.RunSQL.noop), migrations.RunPython(drop_role_duplicates, reverse_code=migrations.RunPython.noop), migrations.AlterUniqueTogether( name='role', unique_together={ ('namespace', 'name'), ('github_user', 'github_repo') }, ), migrations.RunSQL(sql=migrations.RunSQL.noop, reverse_sql='SET CONSTRAINTS ALL IMMEDIATE'), ]
{ "content_hash": "945e4ae574506a31206394616c985be2", "timestamp": "", "source": "github", "line_count": 56, "max_line_length": 75, "avg_line_length": 33.785714285714285, "alnum_prop": 0.6152219873150105, "repo_name": "chouseknecht/galaxy", "id": "5501a36fc1e0ac2e21dbd40adc6a90d317dfdd23", "size": "1916", "binary": false, "copies": "1", "ref": "refs/heads/develop", "path": "galaxy/main/migrations/0056_role_unique_repos.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "106646" }, { "name": "HTML", "bytes": "180778" }, { "name": "JavaScript", "bytes": "555658" }, { "name": "Makefile", "bytes": "5862" }, { "name": "Python", "bytes": "526433" }, { "name": "Shell", "bytes": "3147" }, { "name": "VCL", "bytes": "1235" } ], "symlink_target": "" }
INGRESS_DIR = 'ingress' EGRESS_DIR = 'egress' STATUS_BUILDING = 'building' STATUS_ACTIVE = 'active' STATUS_ERROR = 'error' STATUS_DELETING = 'deleting' SERVICE_CHAIN = 'servicechain' SERVICECHAIN_TOPIC = 'q-servicechain-plugin' SERVICECHAIN_AGENT_TOPIC = 'q-servicechain-agent' AGENT_TYPE_SERVICECHAIN = 'Service chain agent' PORTFLOW_OPT_ADD = 'add-flows' PROTFLOW_OPT_DELETE = 'delete-flows' PROTFLOW_OPT_UPDATE = 'update-flows' MAX_HASH = 16
{ "content_hash": "7a112972224f6a293b31f9d01e3908b3", "timestamp": "", "source": "github", "line_count": 19, "max_line_length": 49, "avg_line_length": 23.68421052631579, "alnum_prop": 0.7444444444444445, "repo_name": "nash-x/hws", "id": "cc7fc006107fa9f41fddc5a5bd46eba7e8c5c99b", "size": "1125", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "neutron/services/servicechain/constants.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Mako", "bytes": "1043" }, { "name": "PLpgSQL", "bytes": "12782" }, { "name": "Python", "bytes": "20443623" }, { "name": "Shell", "bytes": "4643" } ], "symlink_target": "" }
import re import threading from django.conf import settings from django.core.exceptions import MiddlewareNotUsed, ImproperlyConfigured from django.core.urlresolvers import set_urlconf from .utils import from_dotted_path _thread_local = threading.local() class SubdomainMiddleware(object): """ Adjust incoming request's urlconf based on `settings.SUBDOMAINS`. Overview ======== This middleware routes requests to specific subdomains to different URL schemes ("urlconf"). For example, if you own ``example.com`` but want to serve specific content at ``api.example.com` and ``beta.example.com``, add the following to your ``settings.py``: from dynamic_subdomains.defaults import patterns, subdomain SUBDOMAINS = patterns( subdomain('api', 'path.to.api.urls', name='api'), subdomain('beta', 'path.to.beta.urls', name='beta'), ) This causes requests to ``{api,beta}.example.com`` to be routed to their corresponding urlconf. You can use your ``urls.py`` as a template for these urlconfs. Patterns are evaluated in order. If no pattern matches, the request is processed in the usual way, ie. using ``settings.ROOT_URLCONF``. Pattern format ============== The patterns on the left-hand side are regular expressions. For example, the following ``settings.SUBDOMAINS`` will route ``foo.example.com`` and ``bar.example.com`` to the same urlconf. SUBDOMAINS = patterns( subdomain(r'(foo|bar)', 'path.to.urls', name='foo-or-bar'), ) .. note: * Patterns are matched against the extreme left of the requested host * It is implied that all patterns end either with a literal full stop (ie. ".") or an end of line metacharacter. * As with all regular expressions, various metacharacters need quoting. Dynamic subdomains using regular expressions ============================================ Patterns being regular expressions allows setups to feature dynamic (or "wildcard") subdomain schemes: SUBDOMAINS = patterns( subdomain('www', ROOT_URLCONF, name='static'), subdomain('\w+', 'path.to.custom_urls', name='wildcard'), ) Here, requests to ``www.example.com`` will be routed as normal but a request to ``lamby.example.com`` is routed to ``path.to.custom_urls``. As patterns are matched in order, we placed ``www`` first as it otherwise would have matched against ``\w+`` and thus routed to the wrong destination. Alternatively, we could have used negative lookahead: SUBDOMAINS = patterns( subdomain('(?!www)\w+', 'path.to.custom_urls', name='wildcard'), ) Callback methods to simplify dynamic subdomains =============================================== The previous section outlined using regular expressions to implement dynamic subdomains. However, inside every view referenced by the target urlconf we would have to parse the subdomain from ``request.get_host()`` and lookup its corresponding object instance, violating DRY. If these dynamic subdomains had a lot of views this would become particularly unwieldy. To remedy this, you can optionally specify a callback method to be called if your subdomain matches: SUBDOMAINS = patterns( subdomain('www', ROOT_URLCONF, name='static'), subdomain('(?P<username>\w+)', 'path.to.custom_urls', callback='path.to.custom_fn', name='with-callback'), ) [..] from django.shortcuts import get_object_or_404 from django.contrib.auth.models import User def custom_fn(request, username): request.viewing_user = get_object_or_404(User, username=username) This example avoids the duplicated work in every view by attaching a ``viewing_user`` instance to the request object. Views referenced by the "dynamic" urlconf can now assume that this object exists. The custom method is called with the ``request`` object and any named captured arguments, similar to regular Django url processing. Callbacks may return either ``None`` or an ``HttpResponse`` object. If it returns ``None``, the request continues to be processed and the appropriate view is eventually called. If a callback returns an ``HttpResponse`` object, that ``HttpResponse`` is returned to the client without any further processing. .. note: Callbacks are executed with the urlconf set to the second argument in the ``SUBDOMAINS`` list. For example, in the example above, the callback will be executed with the urlconf as ``path.to.custom_urls`` and not the default urlconf. This can cause problems when reversing URLs within your callback as they may not be "visible" to ``django.core.urlresolvers.reverse`` as they are specified in (eg.) the default urlconf. To remedy this, specify the ``urlconf`` parameter when calling ``reverse``. Notes ===== * When using dynamic subdomains based on user input, ensure users cannot specify names that conflict with static subdomains such as "www" or their subdomain will not be accessible. * Don't forget to add ``handler404`` and ``handler500`` entries for your custom urlconfs. """ def __init__(self): try: settings.SUBDOMAINS except AttributeError: raise ImproperlyConfigured("Missing settings.SUBDOMAINS setting") try: self.default = settings.SUBDOMAINS[settings.SUBDOMAIN_DEFAULT] except AttributeError: raise ImproperlyConfigured( "Missing settings.SUBDOMAIN_DEFAULT setting" ) except KeyError: raise ImproperlyConfigured( "settings.SUBDOMAIN_DEFAULT does not point to a valid domain" ) if not settings.SUBDOMAINS: raise MiddlewareNotUsed() # Compile subdomains. We add a literal fullstop to the end of every # pattern to avoid rather unwieldy escaping in every definition. for subdomain in settings.SUBDOMAINS.values(): callback = subdomain.get('callback', lambda *args, **kwargs: None) if isinstance(callback, (basestring,)): callback = from_dotted_path(callback) subdomain['_regex'] = re.compile(r'%s(\.|$)' % subdomain['regex']) subdomain['_callback'] = callback def process_request(self, request): if not getattr(_thread_local, 'enabled', True): return host = request.get_host() # Find best match, falling back to settings.SUBDOMAIN_DEFAULT for subdomain in settings.SUBDOMAINS.values(): match = subdomain['_regex'].match(host) if match: kwargs = match.groupdict() break else: kwargs = {} subdomain = self.default urlconf = subdomain['urlconf'] callback = subdomain['_callback'] request.urlconf = urlconf try: set_urlconf(urlconf) return callback(request, **kwargs) finally: set_urlconf(None)
{ "content_hash": "091dab1e8e5e764086ba033044592c77", "timestamp": "", "source": "github", "line_count": 204, "max_line_length": 79, "avg_line_length": 36.05392156862745, "alnum_prop": 0.6420122365737594, "repo_name": "playfire/django-dynamic-subdomains", "id": "974a754ac97f8b88c6ae050c6f99bed50e3670db", "size": "7355", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "dynamic_subdomains/middleware.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Python", "bytes": "17477" } ], "symlink_target": "" }
""" Django settings for jobvisualization project. Generated by 'django-admin startproject' using Django 1.8.3. For more information on this file, see https://docs.djangoproject.com/en/1.8/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/1.8/ref/settings/ """ # Build paths inside the project like this: os.path.join(BASE_DIR, ...) import os import dj_database_url BASE_DIR = os.path.dirname(os.path.dirname(__file__)) # Quick-start development settings - unsuitable for production # See https://docs.djangoproject.com/en/1.8/howto/deployment/checklist/ # SECURITY WARNING: keep the secret key used in production secret! SECRET_KEY = '2ivu!k(bf(+$e_9#75-a+@(#z#*r8u(bqd%k^%d8@z==r_ae@*' # SECURITY WARNING: don't run with debug turned on in production! DEBUG = True TEMPLATE_DEBUG = True # Application definition INSTALLED_APPS = ( 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', 'apps.data_storage', 'apps.mapvisuals', ) MIDDLEWARE_CLASSES = ( 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.auth.middleware.SessionAuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', 'django.middleware.security.SecurityMiddleware', ) ROOT_URLCONF = 'jobvisualization.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'jobvisualization.wsgi.application' # Database # https://docs.djangoproject.com/en/1.8/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # Parse database configuration from $DATABASE_URL # DATABASES['default'] = dj_database_url.config() # # Enable Connection Pooling (if desired) # DATABASES['default']['ENGINE'] = 'django_postgrespool' # Honor the 'X-Forwarded-Proto' header for request.is_secure() SECURE_PROXY_SSL_HEADER = ('HTTP_X_FORWARDED_PROTO', 'https') # Allow all host headers ALLOWED_HOSTS = ['*'] # Internationalization # https://docs.djangoproject.com/en/1.8/topics/i18n/ LANGUAGE_CODE = 'en-us' TIME_ZONE = 'UTC' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.8/howto/static-files/ BASE_DIR = os.path.dirname(os.path.abspath(__file__)) STATIC_ROOT = 'staticfiles' STATIC_URL = '/static/' STATICFILES_DIRS = ( os.path.join(BASE_DIR, 'static'), ) # STATICFILES_STORAGE = 'whitenoise.django.GzipManifestStaticFilesStorage'
{ "content_hash": "8e9899b49458bbfccf53219ef6e8f9c2", "timestamp": "", "source": "github", "line_count": 121, "max_line_length": 74, "avg_line_length": 27.40495867768595, "alnum_prop": 0.6975271411338962, "repo_name": "nmccrory/job-visualization", "id": "61eeb09a909f06509380f195d42bf2a0e8d7cff6", "size": "3316", "binary": false, "copies": "5", "ref": "refs/heads/master", "path": "jobvisualization/jobvisualization/settings.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "HTML", "bytes": "6499" }, { "name": "Python", "bytes": "13148" } ], "symlink_target": "" }
from a10sdk.common.A10BaseClass import A10BaseClass class MacAddress(A10BaseClass): """ :param static_list: {"minItems": 1, "items": {"type": "static"}, "uniqueItems": true, "array": [{"required": ["mac", "vlan"], "properties": {"dest": {"default": 0, "optional": true, "type": "number", "description": "Trap MAC with this DA to CPU", "format": "flag"}, "mac": {"optional": false, "type": "string", "description": "Configure a Static MAC address", "format": "mac-address"}, "vlan": {"description": "VLAN Id", "format": "number", "optional": false, "maximum": 4094, "minimum": 2, "type": "number", "$ref": "/axapi/v3/network/vlan"}, "port": {"optional": true, "type": "number", "description": "Ethernet Port on which the Address is applicable (Port Value (Defualt VLAN is 1))", "format": "interface"}, "uuid": {"description": "uuid of the object", "format": "string", "minLength": 1, "modify-not-allowed": 1, "optional": true, "maxLength": 64, "type": "string"}}}], "type": "array", "$ref": "/axapi/v3/network/mac-address/static/{mac}+{vlan}"} :param DeviceProxy: The device proxy for REST operations and session handling. Refer to `common/device_proxy.py` Class Description:: Configure a MAC address. Class mac-address supports CRUD Operations and inherits from `common/A10BaseClass`. This class is the `"PARENT"` class for this module.` URL for this object:: `https://<Hostname|Ip address>//axapi/v3/network/mac-address`. """ def __init__(self, **kwargs): self.ERROR_MSG = "" self.required=[] self.b_key = "mac-address" self.a10_url="/axapi/v3/network/mac-address" self.DeviceProxy = "" self.static_list = [] for keys, value in kwargs.items(): setattr(self,keys, value)
{ "content_hash": "4046b67ce8906dcdbc3c3aa5d408388b", "timestamp": "", "source": "github", "line_count": 35, "max_line_length": 965, "avg_line_length": 51.68571428571428, "alnum_prop": 0.6301824212271974, "repo_name": "amwelch/a10sdk-python", "id": "a35f80524bb17fcfa3b62d8797a4c76e6d70095f", "size": "1809", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "a10sdk/core/network/network_mac_address.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "6956398" } ], "symlink_target": "" }
import smbus from time import * class i2c_device: def __init__(self, addr, port=1): self.addr = addr self.bus = smbus.SMBus(port) # Write a single command def write_cmd(self, cmd): self.bus.write_byte(self.addr, cmd) sleep(0.0001) # Write a command and argument def write_cmd_arg(self, cmd, data): self.bus.write_byte_data(self.addr, cmd, data) sleep(0.0001) # Write a block of data def write_block_data(self, cmd, data): self.bus.write_block_data(self.addr, cmd, data) sleep(0.0001) # Read a single byte def read(self): return self.bus.read_byte(self.addr) # Read def read_data(self, cmd): return self.bus.read_byte_data(self.addr, cmd) # Read a block of data def read_block_data(self, cmd): return self.bus.read_block_data(self.addr, cmd)
{ "content_hash": "bf6eb3d12e90d7f25cef89dd229d462c", "timestamp": "", "source": "github", "line_count": 34, "max_line_length": 53, "avg_line_length": 24.676470588235293, "alnum_prop": 0.6436233611442194, "repo_name": "jaschawilcox/raspi-lockout", "id": "95fff2fa70b550b7edfbb5a8f72de276f011dd56", "size": "956", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "i2c_lib.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "19508" } ], "symlink_target": "" }
from south.utils import datetime_utils as datetime from south.db import db from south.v2 import DataMigration from django.db import models class Migration(DataMigration): def forwards(self, orm): # Note: Don't use "from appname.models import ModelName". # Use orm.ModelName to refer to models in this application, # and orm['appname.ModelName'] for models in other applications. orm.Project.objects.filter(project_type='pebblejs').update(sdk_version='3') def backwards(self, orm): orm.Project.objects.filter(project_type='pebblejs').update(sdk_version='2') models = { u'auth.group': { 'Meta': {'object_name': 'Group'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, u'auth.permission': { 'Meta': {'ordering': "(u'content_type__app_label', u'content_type__model', u'codename')", 'unique_together': "((u'content_type', u'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, u'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Group']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Permission']"}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, u'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, 'ide.buildresult': { 'Meta': {'object_name': 'BuildResult'}, 'finished': ('django.db.models.fields.DateTimeField', [], {'null': 'True', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'project': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'builds'", 'to': "orm['ide.Project']"}), 'started': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'db_index': 'True', 'blank': 'True'}), 'state': ('django.db.models.fields.IntegerField', [], {'default': '1'}), 'uuid': ('django.db.models.fields.CharField', [], {'default': "'6c855f5d-99f5-436c-93cf-9282a2c455be'", 'max_length': '36'}) }, 'ide.buildsize': { 'Meta': {'object_name': 'BuildSize'}, 'binary_size': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'build': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'sizes'", 'to': "orm['ide.BuildResult']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'platform': ('django.db.models.fields.CharField', [], {'max_length': '20'}), 'resource_size': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'total_size': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'worker_size': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) }, 'ide.project': { 'Meta': {'object_name': 'Project'}, 'app_capabilities': ('django.db.models.fields.CharField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'app_company_name': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'app_is_watchface': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'app_jshint': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'app_keys': ('django.db.models.fields.TextField', [], {'default': "'{}'"}), 'app_long_name': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'app_platforms': ('django.db.models.fields.TextField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'app_short_name': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'app_uuid': ('django.db.models.fields.CharField', [], {'default': "'78a89854-17e3-41e4-ab00-72b61dd516b0'", 'max_length': '36', 'null': 'True', 'blank': 'True'}), 'app_version_label': ('django.db.models.fields.CharField', [], {'default': "'1.0'", 'max_length': '40', 'null': 'True', 'blank': 'True'}), 'github_branch': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'github_hook_build': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'github_hook_uuid': ('django.db.models.fields.CharField', [], {'max_length': '36', 'null': 'True', 'blank': 'True'}), 'github_last_commit': ('django.db.models.fields.CharField', [], {'max_length': '40', 'null': 'True', 'blank': 'True'}), 'github_last_sync': ('django.db.models.fields.DateTimeField', [], {'null': 'True', 'blank': 'True'}), 'github_repo': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'last_modified': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}), 'optimisation': ('django.db.models.fields.CharField', [], {'default': "'s'", 'max_length': '1'}), 'owner': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']"}), 'project_type': ('django.db.models.fields.CharField', [], {'default': "'native'", 'max_length': '10'}), 'sdk_version': ('django.db.models.fields.CharField', [], {'default': "'2'", 'max_length': '6'}) }, 'ide.resourcefile': { 'Meta': {'unique_together': "(('project', 'file_name'),)", 'object_name': 'ResourceFile'}, 'file_name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_menu_icon': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'kind': ('django.db.models.fields.CharField', [], {'max_length': '9'}), 'project': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'resources'", 'to': "orm['ide.Project']"}) }, 'ide.resourceidentifier': { 'Meta': {'unique_together': "(('resource_file', 'resource_id'),)", 'object_name': 'ResourceIdentifier'}, 'character_regex': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'compatibility': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'resource_file': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'identifiers'", 'to': "orm['ide.ResourceFile']"}), 'resource_id': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'tracking': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) }, 'ide.resourcevariant': { 'Meta': {'unique_together': "(('resource_file', 'variant'),)", 'object_name': 'ResourceVariant'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_legacy': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'resource_file': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'variants'", 'to': "orm['ide.ResourceFile']"}), 'variant': ('django.db.models.fields.IntegerField', [], {}) }, 'ide.sourcefile': { 'Meta': {'unique_together': "(('project', 'file_name'),)", 'object_name': 'SourceFile'}, 'file_name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'last_modified': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'null': 'True', 'blank': 'True'}), 'project': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'source_files'", 'to': "orm['ide.Project']"}), 'target': ('django.db.models.fields.CharField', [], {'default': "'app'", 'max_length': '10'}) }, 'ide.templateproject': { 'Meta': {'object_name': 'TemplateProject', '_ormbases': ['ide.Project']}, u'project_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['ide.Project']", 'unique': 'True', 'primary_key': 'True'}), 'template_kind': ('django.db.models.fields.IntegerField', [], {'db_index': 'True'}) }, 'ide.usergithub': { 'Meta': {'object_name': 'UserGithub'}, 'avatar': ('django.db.models.fields.CharField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'nonce': ('django.db.models.fields.CharField', [], {'max_length': '36', 'null': 'True', 'blank': 'True'}), 'token': ('django.db.models.fields.CharField', [], {'max_length': '50', 'null': 'True', 'blank': 'True'}), 'user': ('django.db.models.fields.related.OneToOneField', [], {'related_name': "'github'", 'unique': 'True', 'primary_key': 'True', 'to': u"orm['auth.User']"}), 'username': ('django.db.models.fields.CharField', [], {'max_length': '50', 'null': 'True', 'blank': 'True'}) }, 'ide.usersettings': { 'Meta': {'object_name': 'UserSettings'}, 'accepted_terms': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'autocomplete': ('django.db.models.fields.IntegerField', [], {'default': '1'}), 'keybinds': ('django.db.models.fields.CharField', [], {'default': "'default'", 'max_length': '20'}), 'tab_width': ('django.db.models.fields.PositiveSmallIntegerField', [], {'default': '2'}), 'theme': ('django.db.models.fields.CharField', [], {'default': "'cloudpebble'", 'max_length': '50'}), 'use_spaces': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'user': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.User']", 'unique': 'True', 'primary_key': 'True'}), 'whats_new': ('django.db.models.fields.PositiveIntegerField', [], {'default': '15'}) } } complete_apps = ['ide'] symmetrical = True
{ "content_hash": "8f645566249a5297feac495aabcb5955", "timestamp": "", "source": "github", "line_count": 158, "max_line_length": 195, "avg_line_length": 82.63924050632912, "alnum_prop": 0.552806923489316, "repo_name": "pebble/cloudpebble", "id": "7ffe3e1d9e0a3ea502d02600af8bd3905c3f177b", "size": "13081", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "ide/migrations/0033_migrate_pebblejs_to_sdk3.py", "mode": "33188", "license": "mit", "language": [ { "name": "C", "bytes": "4664" }, { "name": "CSS", "bytes": "70652" }, { "name": "HTML", "bytes": "122226" }, { "name": "JavaScript", "bytes": "508689" }, { "name": "Makefile", "bytes": "202" }, { "name": "Python", "bytes": "950740" }, { "name": "Shell", "bytes": "7895" } ], "symlink_target": "" }
class FDSObjectSummary(object): """ The FDS Object Summary class. """ def __init__(self): self.bucket_name = None self.object_name = None self.owner = None self.size = None
{ "content_hash": "c3ff4a421a8ae8cf32c12e88973dcaf1", "timestamp": "", "source": "github", "line_count": 10, "max_line_length": 31, "avg_line_length": 19.8, "alnum_prop": 0.6212121212121212, "repo_name": "XiaoMi/galaxy-fds-sdk-python", "id": "158f0ec7b02ace82e04ec11f02dacf040acaa064", "size": "198", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "fds/model/fds_object_summary.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "215501" } ], "symlink_target": "" }
import unittest import array from Crypto.Cipher import AES from Crypto.Protocol.KDF import PBKDF2 from Crypto import Random class SimpleAESException(Exception): pass class PaddingError(SimpleAESException): pass class SimpleAES(object): ''' AES CBC PKCS#7 Note that arguments `salt` and `c` are used exclusively for key expansion with the PBKDF2 function. Setting `salt` but leaving c=0 raises an exception as salt will have no effect unless c > 0. ''' KEY_SIZE = 32 def __init__(self, key, iv=None, salt=None, c=0): self._key = key self._iv = iv self._salt = salt self._c = c def _new_cipher(self, **kw): iv = kw.get('iv', self._iv or SimpleAES.new_iv()) salt = kw.get('salt', self._salt) c = kw.get('c', self._c) key = self._derive_key(self._key, salt, c) cipher = AES.new(key, AES.MODE_CBC, iv) return cipher @classmethod def new_salt(cls): return Random.new().read(cls.KEY_SIZE) @classmethod def new_iv(cls): return Random.new().read(AES.block_size) def _derive_key(self, inkey, salt, c): if not salt and not c: return inkey elif (salt and not c) or (c and not salt): errmsg = 'salt requires c > 0 and vice versa' raise SimpleAESException(errmsg) key = PBKDF2(inkey, salt, self.KEY_SIZE, self._c) return key def _pkcs7_encode(self, data): _pcount = 16 - (len(data) % 16) pkcs7 = data + chr(_pcount) * _pcount return pkcs7 def _pkcs7_decode(self, pkcs7): try: assert len(pkcs7) assert len(pkcs7) % 16 == 0 p = ord(pkcs7[-1]) assert 1 <= p <= 16 prange = pkcs7[-p:] assert prange == chr(p) * p except AssertionError: raise PaddingError data = pkcs7[:-p] return data def _encrypt(self, plaintext, **kw): pkcs7 = self._pkcs7_encode(plaintext) cipher = self._new_cipher(**kw) ciphertext = cipher.encrypt(pkcs7) return ciphertext def _decrypt(self, ciphertext, **kw): cipher = self._new_cipher(**kw) pkcs7 = cipher.decrypt(ciphertext) plaintext = self._pkcs7_decode(pkcs7) return plaintext def _tostring(self, val): if isinstance(val, array.array): val = val.tostring() elif type(val) is str: pass else: errmsg = 'Only arrays and strings are accepted (not {0}).' errmsg = errmsg.format(type(val)) raise SimpleAESException(errmsg) return val def encrypt(self, plaintext, **kw): plaintext = self._tostring(plaintext) return self._encrypt(plaintext, **kw) def decrypt(self, ciphertext, **kw): ciphertext = self._tostring(ciphertext) return self._decrypt(ciphertext, **kw) def raises(ex, fn, *args, **kw): try: fn(*args, **kw) except ex: return True return False class Test_SimpleAES(unittest.TestCase): def test_test(self): assert 1 == 1 def test_vectors_simple(self): from operator import itemgetter from aes_cbc_pkcs7_testdata import vectors for v in vectors: key, iv, pt = itemgetter('key', 'IV', 'plaintext')(v) aes = SimpleAES(key=key, iv=iv) ct = aes.encrypt(pt) assert ct == v['ciphertext'] pt = aes.decrypt(ct) assert pt == v['plaintext'] def test_vectors_with_pbkdf2(self): from operator import itemgetter from aes_cbc_pkcs7_testdata import vectors for c in (3, 11, 29, 107, 383): for v in vectors: key, iv, pt = itemgetter('key', 'IV', 'plaintext')(v) salt = SimpleAES.new_salt() aes = SimpleAES(key=key, iv=iv, salt=salt, c=c) ct = aes.encrypt(pt) assert ct != v['ciphertext'] pt = aes.decrypt(ct) assert pt == v['plaintext'] def test_cipher_padding_errors(self): from operator import itemgetter from aes_cbc_pkcs7_testdata import vectors for c in xrange(1, 32): for v in vectors: key, iv, ct = itemgetter('key', 'IV', 'ciphertext')(v) salt = SimpleAES.new_salt() aes = SimpleAES(key=key, iv=iv, salt=salt, c=c) ct = chr((ord(ct[0]) + 1) % 256) + ct[1:] try: pt = aes.decrypt(ct) except PaddingError: pass else: assert pt != v['plaintext'] if 0: print len(pt), pt.encode('hex') print len(v['plaintext']), v['plaintext'].encode('hex') print '------' def _test(): import doctest import unittest unittest.main() print(doctest.testmod()) if __name__ == "__main__": _test()
{ "content_hash": "d4968ef307e4d9db0410585259c905cf", "timestamp": "", "source": "github", "line_count": 174, "max_line_length": 79, "avg_line_length": 29.436781609195403, "alnum_prop": 0.5355329949238579, "repo_name": "kristerhedfors/paddingoracle", "id": "3a732f6426f8c49e94fc90cdea5dae98558ff56d", "size": "5208", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "simpleaes.py", "mode": "33188", "license": "bsd-2-clause", "language": [ { "name": "Python", "bytes": "14189" } ], "symlink_target": "" }
import sys, os from distutils.core import setup, Extension # Below ROOT, we expect to find include, include/libxml2, lib and bin. # On *nix, it is not needed (but should not harm), # on Windows, it is set by configure.js. ROOT = r'/opt/opscode/embedded' # Thread-enabled libxml2 with_threads = 1 # If this flag is set (windows only), # a private copy of the dlls are included in the package. # If this flag is not set, the libxml2 and libxslt # dlls must be found somewhere in the PATH at runtime. WITHDLLS = 1 and sys.platform.startswith('win') def missing(file): if os.access(file, os.R_OK) == 0: return 1 return 0 try: HOME = os.environ['HOME'] except: HOME="C:" if WITHDLLS: # libxml dlls (expected in ROOT/bin) dlls = [ 'iconv.dll','libxml2.dll','libxslt.dll','libexslt.dll' ] dlls = map(lambda dll: os.path.join(ROOT,'bin',dll),dlls) # create __init__.py for the libxmlmods package if not os.path.exists("libxmlmods"): os.mkdir("libxmlmods") open("libxmlmods/__init__.py","w").close() def altImport(s): s = s.replace("import libxml2mod","from libxmlmods import libxml2mod") s = s.replace("import libxsltmod","from libxmlmods import libxsltmod") return s if sys.platform.startswith('win'): libraryPrefix = 'lib' platformLibs = [] else: libraryPrefix = '' platformLibs = ["m","z"] # those are examined to find # - libxml2/libxml/tree.h # - iconv.h # - libxslt/xsltconfig.h includes_dir = [ "/usr/include", "/usr/local/include", "/opt/include", os.path.join(ROOT,'include'), HOME ]; xml_includes="" for dir in includes_dir: if not missing(dir + "/libxml2/libxml/tree.h"): xml_includes=dir + "/libxml2" break; if xml_includes == "": print "failed to find headers for libxml2: update includes_dir" sys.exit(1) iconv_includes="" for dir in includes_dir: if not missing(dir + "/iconv.h"): iconv_includes=dir break; if iconv_includes == "": print "failed to find headers for libiconv: update includes_dir" sys.exit(1) # those are added in the linker search path for libraries libdirs = [ os.path.join(ROOT,'lib'), ] xml_files = ["libxml2-api.xml", "libxml2-python-api.xml", "libxml.c", "libxml.py", "libxml_wrap.h", "types.c", "xmlgenerator.py", "README", "TODO", "drv_libxml2.py"] xslt_files = ["libxslt-api.xml", "libxslt-python-api.xml", "libxslt.c", "libxsl.py", "libxslt_wrap.h", "xsltgenerator.py"] if missing("libxml2-py.c") or missing("libxml2.py"): try: try: import xmlgenerator except: import generator except: print "failed to find and generate stubs for libxml2, aborting ..." print sys.exc_type, sys.exc_value sys.exit(1) head = open("libxml.py", "r") generated = open("libxml2class.py", "r") result = open("libxml2.py", "w") for line in head.readlines(): if WITHDLLS: result.write(altImport(line)) else: result.write(line) for line in generated.readlines(): result.write(line) head.close() generated.close() result.close() with_xslt=0 if missing("libxslt-py.c") or missing("libxslt.py"): if missing("xsltgenerator.py") or missing("libxslt-api.xml"): print "libxslt stub generator not found, libxslt not built" else: try: import xsltgenerator except: print "failed to generate stubs for libxslt, aborting ..." print sys.exc_type, sys.exc_value else: head = open("libxsl.py", "r") generated = open("libxsltclass.py", "r") result = open("libxslt.py", "w") for line in head.readlines(): if WITHDLLS: result.write(altImport(line)) else: result.write(line) for line in generated.readlines(): result.write(line) head.close() generated.close() result.close() with_xslt=1 else: with_xslt=1 if with_xslt == 1: xslt_includes="" for dir in includes_dir: if not missing(dir + "/libxslt/xsltconfig.h"): xslt_includes=dir + "/libxslt" break; if xslt_includes == "": print "failed to find headers for libxslt: update includes_dir" with_xslt = 0 descr = "libxml2 package" modules = [ 'libxml2', 'drv_libxml2' ] if WITHDLLS: modules.append('libxmlmods.__init__') c_files = ['libxml2-py.c', 'libxml.c', 'types.c' ] includes= [xml_includes, iconv_includes] libs = [libraryPrefix + "xml2"] + platformLibs macros = [] if with_threads: macros.append(('_REENTRANT','1')) if with_xslt == 1: descr = "libxml2 and libxslt package" if not sys.platform.startswith('win'): # # We are gonna build 2 identical shared libs with merge initializing # both libxml2mod and libxsltmod # c_files = c_files + ['libxslt-py.c', 'libxslt.c'] xslt_c_files = c_files macros.append(('MERGED_MODULES', '1')) else: # # On windows the MERGED_MODULE option is not needed # (and does not work) # xslt_c_files = ['libxslt-py.c', 'libxslt.c', 'types.c'] libs.insert(0, libraryPrefix + 'exslt') libs.insert(0, libraryPrefix + 'xslt') includes.append(xslt_includes) modules.append('libxslt') extens=[Extension('libxml2mod', c_files, include_dirs=includes, library_dirs=libdirs, libraries=libs, define_macros=macros)] if with_xslt == 1: extens.append(Extension('libxsltmod', xslt_c_files, include_dirs=includes, library_dirs=libdirs, libraries=libs, define_macros=macros)) if missing("MANIFEST"): manifest = open("MANIFEST", "w") manifest.write("setup.py\n") for file in xml_files: manifest.write(file + "\n") if with_xslt == 1: for file in xslt_files: manifest.write(file + "\n") manifest.close() if WITHDLLS: ext_package = "libxmlmods" if sys.version >= "2.2": base = "lib/site-packages/" else: base = "" data_files = [(base+"libxmlmods",dlls)] else: ext_package = None data_files = [] setup (name = "libxml2-python", # On *nix, the version number is created from setup.py.in # On windows, it is set by configure.js version = "2.7.7", description = descr, author = "Daniel Veillard", author_email = "[email protected]", url = "http://xmlsoft.org/python.html", licence="MIT Licence", py_modules=modules, ext_modules=extens, ext_package=ext_package, data_files=data_files, ) sys.exit(0)
{ "content_hash": "3de4e81409285e9ff93bf01e182b9f81", "timestamp": "", "source": "github", "line_count": 238, "max_line_length": 78, "avg_line_length": 27.827731092436974, "alnum_prop": 0.619507775932357, "repo_name": "jtimberman/omnibus", "id": "085e863be4b1f6fd910bb76c420daf2409aa6442", "size": "6696", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "source/libxml2-2.7.7/python/setup.py", "mode": "33261", "license": "apache-2.0", "language": [], "symlink_target": "" }
DOCUMENTATION = ''' --- module: group author: Stephen Fromm version_added: "0.0.2" short_description: Add or remove groups requirements: [ groupadd, groupdel, groupmod ] description: - Manage presence of groups on a host. options: name: required: true description: - Name of the group to manage. gid: required: false description: - Optional I(GID) to set for the group. state: required: false default: "present" choices: [ present, absent ] description: - Whether the group should be present or not on the remote host. system: required: false default: "no" choices: [ "yes", "no" ] description: - If I(yes), indicates that the group created is a system group. ''' EXAMPLES = ''' # Example group command from Ansible Playbooks - group: name=somegroup state=present ''' import grp import syslog import platform class Group(object): """ This is a generic Group manipulation class that is subclassed based on platform. A subclass may wish to override the following action methods:- - group_del() - group_add() - group_mod() All subclasses MUST define platform and distribution (which may be None). """ platform = 'Generic' distribution = None GROUPFILE = '/etc/group' def __new__(cls, *args, **kwargs): return load_platform_subclass(Group, args, kwargs) def __init__(self, module): self.module = module self.state = module.params['state'] self.name = module.params['name'] self.gid = module.params['gid'] self.system = module.params['system'] self.syslogging = False def execute_command(self, cmd): if self.syslogging: syslog.openlog('ansible-%s' % os.path.basename(__file__)) syslog.syslog(syslog.LOG_NOTICE, 'Command %s' % '|'.join(cmd)) return self.module.run_command(cmd) def group_del(self): cmd = [self.module.get_bin_path('groupdel', True), self.name] return self.execute_command(cmd) def group_add(self, **kwargs): cmd = [self.module.get_bin_path('groupadd', True)] for key in kwargs: if key == 'gid' and kwargs[key] is not None: cmd.append('-g') cmd.append(kwargs[key]) elif key == 'system' and kwargs[key] == True: cmd.append('-r') cmd.append(self.name) return self.execute_command(cmd) def group_mod(self, **kwargs): cmd = [self.module.get_bin_path('groupmod', True)] info = self.group_info() for key in kwargs: if key == 'gid': if kwargs[key] is not None and info[2] != int(kwargs[key]): cmd.append('-g') cmd.append(kwargs[key]) if len(cmd) == 1: return (None, '', '') if self.module.check_mode: return (0, '', '') cmd.append(self.name) return self.execute_command(cmd) def group_exists(self): try: if grp.getgrnam(self.name): return True except KeyError: return False def group_info(self): if not self.group_exists(): return False try: info = list(grp.getgrnam(self.name)) except KeyError: return False return info # =========================================== class SunOS(Group): """ This is a SunOS Group manipulation class. Solaris doesn't have the 'system' group concept. This overrides the following methods from the generic class:- - group_add() """ platform = 'SunOS' distribution = None GROUPFILE = '/etc/group' def group_add(self, **kwargs): cmd = [self.module.get_bin_path('groupadd', True)] for key in kwargs: if key == 'gid' and kwargs[key] is not None: cmd.append('-g') cmd.append(kwargs[key]) cmd.append(self.name) return self.execute_command(cmd) # =========================================== class AIX(Group): """ This is a AIX Group manipulation class. This overrides the following methods from the generic class:- - group_del() - group_add() - group_mod() """ platform = 'AIX' distribution = None GROUPFILE = '/etc/group' def group_del(self): cmd = [self.module.get_bin_path('rmgroup', True), self.name] return self.execute_command(cmd) def group_add(self, **kwargs): cmd = [self.module.get_bin_path('mkgroup', True)] for key in kwargs: if key == 'gid' and kwargs[key] is not None: cmd.append('id='+kwargs[key]) elif key == 'system' and kwargs[key] == True: cmd.append('-a') cmd.append(self.name) return self.execute_command(cmd) def group_mod(self, **kwargs): cmd = [self.module.get_bin_path('chgroup', True)] info = self.group_info() for key in kwargs: if key == 'gid': if kwargs[key] is not None and info[2] != int(kwargs[key]): cmd.append('id='+kwargs[key]) if len(cmd) == 1: return (None, '', '') if self.module.check_mode: return (0, '', '') cmd.append(self.name) return self.execute_command(cmd) # =========================================== class FreeBsdGroup(Group): """ This is a FreeBSD Group manipulation class. This overrides the following methods from the generic class:- - group_del() - group_add() - group_mod() """ platform = 'FreeBSD' distribution = None GROUPFILE = '/etc/group' def group_del(self): cmd = [self.module.get_bin_path('pw', True), 'groupdel', self.name] return self.execute_command(cmd) def group_add(self, **kwargs): cmd = [self.module.get_bin_path('pw', True), 'groupadd', self.name] if self.gid is not None: cmd.append('-g') cmd.append('%d' % int(self.gid)) return self.execute_command(cmd) def group_mod(self, **kwargs): cmd = [self.module.get_bin_path('pw', True), 'groupmod', self.name] info = self.group_info() cmd_len = len(cmd) if self.gid is not None and int(self.gid) != info[2]: cmd.append('-g') cmd.append('%d' % int(self.gid)) # modify the group if cmd will do anything if cmd_len != len(cmd): if self.module.check_mode: return (0, '', '') return self.execute_command(cmd) return (None, '', '') # =========================================== class DarwinGroup(Group): """ This is a Mac OS X Darwin Group manipulation class. This overrides the following methods from the generic class:- - group_del() - group_add() - group_mod() group manupulation are done using dseditgroup(1). """ platform = 'Darwin' distribution = None def group_add(self, **kwargs): cmd = [self.module.get_bin_path('dseditgroup', True)] cmd += [ '-o', 'create' ] if self.gid is not None: cmd += [ '-i', self.gid ] cmd += [ '-L', self.name ] (rc, out, err) = self.execute_command(cmd) return (rc, out, err) def group_del(self): cmd = [self.module.get_bin_path('dseditgroup', True)] cmd += [ '-o', 'delete' ] cmd += [ '-L', self.name ] (rc, out, err) = self.execute_command(cmd) return (rc, out, err) def group_mod(self, gid=None): info = self.group_info() if self.gid is not None and int(self.gid) != info[2]: cmd = [self.module.get_bin_path('dseditgroup', True)] cmd += [ '-o', 'edit' ] if gid is not None: cmd += [ '-i', gid ] cmd += [ '-L', self.name ] (rc, out, err) = self.execute_command(cmd) return (rc, out, err) return (None, '', '') class OpenBsdGroup(Group): """ This is a OpenBSD Group manipulation class. This overrides the following methods from the generic class:- - group_del() - group_add() - group_mod() """ platform = 'OpenBSD' distribution = None GROUPFILE = '/etc/group' def group_del(self): cmd = [self.module.get_bin_path('groupdel', True), self.name] return self.execute_command(cmd) def group_add(self, **kwargs): cmd = [self.module.get_bin_path('groupadd', True)] if self.gid is not None: cmd.append('-g') cmd.append('%d' % int(self.gid)) cmd.append(self.name) return self.execute_command(cmd) def group_mod(self, **kwargs): cmd = [self.module.get_bin_path('groupmod', True)] info = self.group_info() cmd_len = len(cmd) if self.gid is not None and int(self.gid) != info[2]: cmd.append('-g') cmd.append('%d' % int(self.gid)) if len(cmd) == 1: return (None, '', '') if self.module.check_mode: return (0, '', '') cmd.append(self.name) return self.execute_command(cmd) # =========================================== class NetBsdGroup(Group): """ This is a NetBSD Group manipulation class. This overrides the following methods from the generic class:- - group_del() - group_add() - group_mod() """ platform = 'NetBSD' distribution = None GROUPFILE = '/etc/group' def group_del(self): cmd = [self.module.get_bin_path('groupdel', True), self.name] return self.execute_command(cmd) def group_add(self, **kwargs): cmd = [self.module.get_bin_path('groupadd', True)] if self.gid is not None: cmd.append('-g') cmd.append('%d' % int(self.gid)) cmd.append(self.name) return self.execute_command(cmd) def group_mod(self, **kwargs): cmd = [self.module.get_bin_path('groupmod', True)] info = self.group_info() cmd_len = len(cmd) if self.gid is not None and int(self.gid) != info[2]: cmd.append('-g') cmd.append('%d' % int(self.gid)) if len(cmd) == 1: return (None, '', '') if self.module.check_mode: return (0, '', '') cmd.append(self.name) return self.execute_command(cmd) # =========================================== def main(): module = AnsibleModule( argument_spec = dict( state=dict(default='present', choices=['present', 'absent'], type='str'), name=dict(required=True, type='str'), gid=dict(default=None, type='str'), system=dict(default=False, type='bool'), ), supports_check_mode=True ) group = Group(module) if group.syslogging: syslog.openlog('ansible-%s' % os.path.basename(__file__)) syslog.syslog(syslog.LOG_NOTICE, 'Group instantiated - platform %s' % group.platform) if user.distribution: syslog.syslog(syslog.LOG_NOTICE, 'Group instantiated - distribution %s' % group.distribution) rc = None out = '' err = '' result = {} result['name'] = group.name result['state'] = group.state if group.state == 'absent': if group.group_exists(): if module.check_mode: module.exit_json(changed=True) (rc, out, err) = group.group_del() if rc != 0: module.fail_json(name=group.name, msg=err) elif group.state == 'present': if not group.group_exists(): if module.check_mode: module.exit_json(changed=True) (rc, out, err) = group.group_add(gid=group.gid, system=group.system) else: (rc, out, err) = group.group_mod(gid=group.gid) if rc is not None and rc != 0: module.fail_json(name=group.name, msg=err) if rc is None: result['changed'] = False else: result['changed'] = True if out: result['stdout'] = out if err: result['stderr'] = err if group.group_exists(): info = group.group_info() result['system'] = group.system result['gid'] = info[2] module.exit_json(**result) # import module snippets from ansible.module_utils.basic import * main()
{ "content_hash": "33f1dd74b9419934d22ce4cb68b12bf2", "timestamp": "", "source": "github", "line_count": 430, "max_line_length": 105, "avg_line_length": 29.376744186046512, "alnum_prop": 0.536811272957568, "repo_name": "mith1979/ansible_automation", "id": "51254f4ef76aa3ca3ea1f1c0e0522f0cf3a55ae0", "size": "13375", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "applied_python/applied_python/lib/python2.7/site-packages/ansible/modules/core/system/group.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Batchfile", "bytes": "1005" }, { "name": "C", "bytes": "84868" }, { "name": "CSS", "bytes": "50289" }, { "name": "HTML", "bytes": "70428" }, { "name": "JavaScript", "bytes": "105262" }, { "name": "PowerShell", "bytes": "51840" }, { "name": "Python", "bytes": "19073705" }, { "name": "Shell", "bytes": "3747" }, { "name": "XSLT", "bytes": "152770" } ], "symlink_target": "" }
import logging try: import psycopg2 as Database except ImportError, e: from django.core.exceptions import ImproperlyConfigured raise ImproperlyConfigured("Error loading psycopg2 module: %s" % e) from librdbms.server.rdbms_base_lib import BaseRDBMSDataTable, BaseRDBMSResult, BaseRDMSClient LOG = logging.getLogger(__name__) class DataTable(BaseRDBMSDataTable): pass class Result(BaseRDBMSResult): pass class PostgreSQLClient(BaseRDMSClient): """Same API as Beeswax""" data_table_cls = DataTable result_cls = Result def __init__(self, *args, **kwargs): super(PostgreSQLClient, self).__init__(*args, **kwargs) self.connection = Database.connect(**self._conn_params) @property def _conn_params(self): params = { 'user': self.query_server['username'], 'password': self.query_server['password'], 'host': self.query_server['server_host'], 'port': self.query_server['server_port'] == 0 and 5432 or self.query_server['server_port'], 'database': self.query_server['name'] } if self.query_server['options']: params.update(self.query_server['options']) # handle transaction commits manually. if 'autocommit' in params: del params['autocommit'] return params def use(self, database): # No op since postgresql requires a new connection per database pass def execute_statement(self, statement): cursor = self.connection.cursor() cursor.execute(statement) self.connection.commit() if cursor.description: columns = [column[0] for column in cursor.description] else: columns = [] return self.data_table_cls(cursor, columns) def get_databases(self): # List all the schemas in the database try: cursor = self.connection.cursor() cursor.execute('SELECT nspname from pg_catalog.pg_namespace') self.connection.commit() return [row[0] for row in cursor.fetchall()] except Exception: LOG.exception('Failed to select nspname from pg_catalog.pg_namespace') return [self._conn_params['database']] def get_tables(self, database, table_names=[]): cursor = self.connection.cursor() query = "SELECT tablename FROM pg_catalog.pg_tables WHERE schemaname = '%s'" % database if table_names: clause = ' OR '.join(["tablename LIKE '%%%(table)s%%'" % {'table': table} for table in table_names]) query += ' AND (%s)' % clause cursor.execute(query) self.connection.commit() return [row[0] for row in cursor.fetchall()] def get_columns(self, database, table, names_only=True): cursor = self.connection.cursor() query = """ SELECT a.attname as "name", pg_catalog.format_type(a.atttypid, a.atttypmod) as "datatype" FROM pg_catalog.pg_attribute a WHERE a.attnum > 0 AND NOT a.attisdropped AND a.attrelid = ( SELECT c.oid FROM pg_catalog.pg_class c LEFT JOIN pg_catalog.pg_namespace n ON n.oid = c.relnamespace WHERE c.relname ~ '^(%(table)s)$' AND n.nspname = '%(database)s' AND pg_catalog.pg_table_is_visible(c.oid) ) """ % {'table': table, 'database': database} cursor.execute(query) self.connection.commit() if names_only: columns = [row[0] for row in cursor.fetchall()] else: columns = [dict(name=row[0], type=row[1], comment='') for row in cursor.fetchall()] return columns def get_sample_data(self, database, table, column=None, limit=100): column = '"%s"' % column if column else '*' statement = 'SELECT %s FROM "%s"."%s" LIMIT %d' % (column, database, table, limit) return self.execute_statement(statement)
{ "content_hash": "c93a806d133ef3d27834c5826020b404", "timestamp": "", "source": "github", "line_count": 122, "max_line_length": 106, "avg_line_length": 31.008196721311474, "alnum_prop": 0.6402326196140629, "repo_name": "jayceyxc/hue", "id": "ec9a29b919bb1acfb1e66b91c47af4970c602b9c", "size": "4575", "binary": false, "copies": "7", "ref": "refs/heads/master", "path": "desktop/libs/librdbms/src/librdbms/server/postgresql_lib.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Assembly", "bytes": "3096" }, { "name": "Batchfile", "bytes": "41710" }, { "name": "C", "bytes": "2716690" }, { "name": "C++", "bytes": "200268" }, { "name": "CSS", "bytes": "630891" }, { "name": "Emacs Lisp", "bytes": "11704" }, { "name": "Genshi", "bytes": "946" }, { "name": "Go", "bytes": "6671" }, { "name": "HTML", "bytes": "23982883" }, { "name": "Java", "bytes": "575404" }, { "name": "JavaScript", "bytes": "5068327" }, { "name": "Lex", "bytes": "36239" }, { "name": "M4", "bytes": "1377" }, { "name": "Makefile", "bytes": "146292" }, { "name": "Mako", "bytes": "3334641" }, { "name": "Myghty", "bytes": "936" }, { "name": "PLSQL", "bytes": "31565" }, { "name": "PLpgSQL", "bytes": "3646" }, { "name": "Perl", "bytes": "3499" }, { "name": "PigLatin", "bytes": "328" }, { "name": "Python", "bytes": "45608023" }, { "name": "Roff", "bytes": "16669" }, { "name": "Shell", "bytes": "46700" }, { "name": "Smarty", "bytes": "130" }, { "name": "Thrift", "bytes": "278712" }, { "name": "Visual Basic", "bytes": "2884" }, { "name": "XSLT", "bytes": "517693" }, { "name": "Yacc", "bytes": "381310" } ], "symlink_target": "" }
from silopub import util from silopub.ext import db from silopub.models import Account, Tumblr from flask import Blueprint, current_app, redirect, url_for, request, flash from flask import session from requests_oauthlib import OAuth1Session, OAuth1 import html import requests import sys REQUEST_TOKEN_URL = 'https://www.tumblr.com/oauth/request_token' AUTHORIZE_URL = 'https://www.tumblr.com/oauth/authorize' ACCESS_TOKEN_URL = 'https://www.tumblr.com/oauth/access_token' USER_INFO_URL = 'https://api.tumblr.com/v2/user/info' CREATE_POST_URL = 'https://api.tumblr.com/v2/blog/{}/post' FETCH_POST_URL = 'https://api.tumblr.com/v2/blog/{}/posts' SERVICE_NAME = 'tumblr' tumblr = Blueprint('tumblr', __name__) @tumblr.route('/tumblr/authorize', methods=['POST']) def authorize(): try: callback_uri = url_for('.callback', _external=True) return redirect(get_authorize_url(callback_uri)) except: current_app.logger.exception('Starting Tumblr authorization') flash(html.escape(str(sys.exc_info()[0])), 'danger') return redirect(url_for('views.index')) def get_authorize_url(callback_uri, **kwargs): oauth = OAuth1Session( client_key=current_app.config['TUMBLR_CLIENT_KEY'], client_secret=current_app.config['TUMBLR_CLIENT_SECRET'], callback_uri=callback_uri) r = oauth.fetch_request_token(REQUEST_TOKEN_URL) session['oauth_token_secret'] = r.get('oauth_token_secret') return oauth.authorization_url(AUTHORIZE_URL) @tumblr.route('/tumblr/callback') def callback(): try: callback_uri = url_for('.callback', _external=True) result = process_callback(callback_uri) if 'error' in result: flash(result['error'], category='danger') return redirect(url_for('views.index')) account = result['account'] flash('Authorized {}: {}'.format(account.username, ', '.join( s.domain for s in account.sites))) return redirect(url_for('views.setup_account', service=SERVICE_NAME, user_id=account.user_id)) except: current_app.logger.exception('During Tumblr authorization callback') flash(html.escape(str(sys.exc_info()[0])), 'danger') return redirect(url_for('views.index')) def process_callback(callback_uri): verifier = request.args.get('oauth_verifier') request_token = request.args.get('oauth_token') if not verifier or not request_token: # user declined return {'error': 'Tumblr authorization declined'} request_token_secret = session.get('oauth_token_secret') oauth = OAuth1Session( client_key=current_app.config['TUMBLR_CLIENT_KEY'], client_secret=current_app.config['TUMBLR_CLIENT_SECRET'], resource_owner_key=request_token, resource_owner_secret=request_token_secret) oauth.parse_authorization_response(request.url) # get the access token and secret r = oauth.fetch_access_token(ACCESS_TOKEN_URL) token = r.get('oauth_token') secret = r.get('oauth_token_secret') info_resp = oauth.get(USER_INFO_URL).json() user_info = info_resp.get('response', {}).get('user') user_id = username = user_info.get('name') account = Account.query.filter_by( service='tumblr', user_id=user_id).first() if not account: account = Account(service='tumblr', user_id=user_id) db.session.add(account) account.username = username account.user_info = user_info account.token = token account.token_secret = secret sites = [] for blog in user_info.get('blogs', []): sites.append(Tumblr( url=blog.get('url'), domain=util.domain_for_url(blog.get('url')), site_id=blog.get('name'), site_info=blog)) account.update_sites(sites) db.session.commit() util.set_authed(account.sites) return {'account': account} def publish(site): auth = OAuth1( client_key=current_app.config['TUMBLR_CLIENT_KEY'], client_secret=current_app.config['TUMBLR_CLIENT_SECRET'], resource_owner_key=site.account.token, resource_owner_secret=site.account.token_secret) create_post_url = CREATE_POST_URL.format(site.domain) photo_url = util.get_first(util.get_possible_array_value(request.form, 'photo')) photo_file = util.get_first(util.get_possible_array_value(request.files, 'photo')) if photo_url: data = util.trim_nulls({ 'type': 'photo', 'slug': request.form.get('slug'), 'caption': request.form.get('content[html]') or request.form.get('content') or request.form.get('name') or request.form.get('summary'), 'source': photo_url }) r = requests.post(create_post_url, data=data, auth=auth) elif photo_file: # tumblr signs multipart in a weird way. first sign the request as if # it's application/x-www-form-urlencoded, then recreate the request as # multipart but use the signed headers from before. Mostly cribbed from # https://github.com/tumblr/pytumblr/blob/\ # 20e7e38ba6f0734335deee64d4cae45fa8a2ce90/pytumblr/request.py#L101 # The API documentation and some of the code samples gave me the # impression that you could also send files just as part of the # form-encoded data but I couldnit make it work # https://www.tumblr.com/docs/en/api/v2#pphoto-posts # https://gist.github.com/codingjester/1649885#file-upload-php-L56 data = util.trim_nulls({ 'type': 'photo', 'slug': request.form.get('slug'), 'caption': request.form.get('content[html]') or request.form.get('content') or request.form.get('name') or request.form.get('summary'), }) fake_req = requests.Request('POST', create_post_url, data=data) fake_req = fake_req.prepare() auth(fake_req) real_headers = dict(fake_req.headers) # manually strip these, requests will recalculate them for us del real_headers['Content-Type'] del real_headers['Content-Length'] current_app.logger.info( 'uploading photo to tumblr %s, headers=%r', create_post_url, real_headers) r = requests.post(create_post_url, data=data, files={ 'data': photo_file, }, headers=real_headers) else: data = util.trim_nulls({ # one of: text, photo, quote, link, chat, audio, video 'type': 'text', 'slug': request.form.get('slug'), 'title': request.form.get('name'), 'body': util.get_complex_content(request.form), }) current_app.logger.info( 'posting to tumblr %s, data=%r', create_post_url, data) r = requests.post(create_post_url, data=data, auth=auth) current_app.logger.info( 'response from tumblr %r, data=%r, headers=%r', r, r.content, r.headers) if r.status_code // 100 != 2: current_app.logger.warn( 'Tumblr publish failed with response %s', r.text) return util.wrap_silo_error_response(r) location = None if 'Location' in r.headers: location = r.headers['Location'] else: # only get back the id, look up the url post_id = r.json().get('response').get('id') r = requests.get(FETCH_POST_URL.format(site.domain), params={ 'api_key': current_app.config['TUMBLR_CLIENT_KEY'], 'id': post_id, }) if r.status_code // 100 == 2: posts = r.json().get('response', {}).get('posts', []) if posts: location = posts[0].get('post_url') return util.make_publish_success_response(location)
{ "content_hash": "f513fe928c5aef38e123d47dfbb0763c", "timestamp": "", "source": "github", "line_count": 207, "max_line_length": 86, "avg_line_length": 37.85990338164251, "alnum_prop": 0.6265152481817022, "repo_name": "kylewm/feverdream", "id": "deb6e62e7b034abfcd13e8841b055a5aacbbb0e8", "size": "7837", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "silopub/tumblr.py", "mode": "33188", "license": "bsd-2-clause", "language": [ { "name": "Python", "bytes": "119663" }, { "name": "Shell", "bytes": "281" } ], "symlink_target": "" }
import os import re import csv import generate_task_summaries emails_by_task = {} email_to_name = {} DO_NOT_INCLUDE = ["[email protected]"] def get_name_for_email(line, email): # Match: My Name ([email protected]) match = re.search(r"([\w\s\.,<>/-]+)\s+\(?\[?'?`?" + re.escape(email), line) if not match: # Match: [Kevin Gimpel](https://home.ttic.edu/~kgimpel/) ([email protected]) match = re.search(r"\[([\w\s\.,<>/-]+)\]\([^)]+\)\s+\(?'?`?" + re.escape(email), line) if match: name = match.group(1).strip() assert not ":" in name for i in range(3): # Do this a few times to deal with Oxford comma name = re.sub(r"^(and |, )", r"", name) name = re.sub(r"^\s*-\s*", r"", name) name = re.sub(r"\s*[,-]\s*$", r"", name) name = re.sub(r"<sup>.*</sup>", r"", name) return name else: return None try: os.chdir(generate_task_summaries.bench_dir) except FileNotFoundError: raise ValueError(f"Cannot chdir to {generate_task_summaries.bench_dir}") for root, dirs, files in os.walk("."): dirs.sort() for fname in files: if fname == "README.md": path = os.path.join(root, fname) components = path.split("/") assert components[0] == "." task = components[1] with open(path, "r", encoding="utf-8") as f: in_authors_section = False for line in f: authors_match = re.search(r"Authors?|Contributors?", line, re.IGNORECASE) emails_match = re.findall(r'[\w.+-]+@[\w-]+\.[\w.-]+', line) whitespace_match = re.match(r"^\s*$", line) if authors_match: in_authors_section = True elif in_authors_section: if emails_match or whitespace_match: # Sometimes we see "Authors:" and then emails span # several lines. Stay in authors section as long as we # keep seeing emails. pass elif task in emails_by_task and len(emails_by_task[task]) > 0: # Stop after we're done with one authors section. # Make sure we found some emails, rather than just # saw the word "authors" somewhere. break else: # We saw "authors" but found no emails, so keep # looking. in_authors_section = False if in_authors_section and emails_match: if not task in emails_by_task: emails_by_task[task] = list() for email in emails_match: if email in DO_NOT_INCLUDE: continue if not email in emails_by_task[task]: emails_by_task[task].append(email) name = get_name_for_email(line, email) if name: email_to_name[email] = name else: print(f"WARNING: Name not found for email {email}\n" f"LINE: {line.strip()}\n" f"FILE: {path}\n") elif emails_match: print(f"WARNING: Email found in non-authors section, skipping.\n" f"LINE: {line.strip()}\n" f"FILE: {path}\n") # Save the results tsv_filename = "task_authors.tsv" with open(tsv_filename, "w", encoding="utf-8") as tsv_file: writer = csv.DictWriter( tsv_file, delimiter="\t", fieldnames=["task", "email", "name"]) writer.writeheader() for task in sorted(emails_by_task): for email in emails_by_task[task]: try: name = email_to_name[email] except KeyError: name = "" writer.writerow({"task": task, "email": email, "name": name}) print(f"Results saved to {os.path.join(os.getcwd(), tsv_filename)}\n")
{ "content_hash": "586a0d4e7979c5288e76f4e5a32891b4", "timestamp": "", "source": "github", "line_count": 115, "max_line_length": 94, "avg_line_length": 38.504347826086956, "alnum_prop": 0.46160794941282746, "repo_name": "google/BIG-bench", "id": "23930ff156b5f107dc8865ece53aa20c117a9d6d", "size": "5028", "binary": false, "copies": "1", "ref": "refs/heads/main", "path": "bigbench/task_postprocessing_scripts/parse_author_emails.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Dockerfile", "bytes": "1453" }, { "name": "Jupyter Notebook", "bytes": "638615" }, { "name": "Python", "bytes": "1564542" }, { "name": "Shell", "bytes": "1436" } ], "symlink_target": "" }
import numpy as np import matplotlib.pyplot as plt import pyeparse as pp fname = '../pyeparse/tests/data/test_raw.edf' raw = pp.read_raw(fname) # visualize initial calibration raw.plot_calibration(title='5-Point Calibration') # create heatmap raw.plot_heatmap(start=3., stop=60.) # find events and epoch data events = raw.find_events('SYNCTIME', event_id=1) tmin, tmax, event_id = -0.5, 1.5, 1 epochs = pp.Epochs(raw, events=events, event_id=event_id, tmin=tmin, tmax=tmax) # access pandas data frame and plot single epoch fig, ax = plt.subplots() ax.plot(epochs[3].get_data('xpos')[0], epochs[3].get_data('ypos')[0]) # iterate over and access numpy arrays. # find epochs withouth loss of tracking / blinks print(len([e for e in epochs if not np.isnan(e).any()])) fig, ax = plt.subplots() ax.set_title('Superimposed saccade responses') n_trials = 12 # first 12 trials for epoch in epochs[:n_trials]: ax.plot(epochs.times * 1e3, epoch[0].T) time_mask = epochs.times > 0 times = epochs.times * 1e3 fig, ax = plt.subplots() ax.plot(times[time_mask], epochs.data[0, 0, time_mask]) ax.set_title('Post baseline saccade (X, pos)') # plot single trials epochs.plot(picks=['xpos'], draw_discrete='saccades') plt.show()
{ "content_hash": "b9f7a0a9cb4f377d0f75ad53e5784c9d", "timestamp": "", "source": "github", "line_count": 45, "max_line_length": 69, "avg_line_length": 27.68888888888889, "alnum_prop": 0.6990369181380417, "repo_name": "drammock/pyeparse", "id": "a8d4d348ca415ef24037df093d1f3905ba41e84d", "size": "1328", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "examples/plot_from_raw_to_epochs.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Makefile", "bytes": "701" }, { "name": "PowerShell", "bytes": "2988" }, { "name": "Python", "bytes": "119299" } ], "symlink_target": "" }
"""Define tests for the Ambient PWS config flow.""" import json from unittest.mock import patch import aioambient import pytest from homeassistant import data_entry_flow from homeassistant.components.ambient_station import CONF_APP_KEY, DOMAIN, config_flow from homeassistant.config_entries import SOURCE_USER from homeassistant.const import CONF_API_KEY from tests.common import MockConfigEntry, load_fixture, mock_coro @pytest.fixture def get_devices_response(): """Define a fixture for a successful /devices response.""" return mock_coro() @pytest.fixture def mock_aioambient(get_devices_response): """Mock the aioambient library.""" with patch("homeassistant.components.ambient_station.config_flow.Client") as Client: Client().api.get_devices.return_value = get_devices_response yield Client async def test_duplicate_error(hass): """Test that errors are shown when duplicates are added.""" conf = {CONF_API_KEY: "12345abcde12345abcde", CONF_APP_KEY: "67890fghij67890fghij"} MockConfigEntry( domain=DOMAIN, unique_id="67890fghij67890fghij", data=conf ).add_to_hass(hass) result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": SOURCE_USER}, data=conf ) assert result["type"] == data_entry_flow.RESULT_TYPE_ABORT assert result["reason"] == "already_configured" @pytest.mark.parametrize( "get_devices_response", [mock_coro(exception=aioambient.errors.AmbientError)] ) async def test_invalid_api_key(hass, mock_aioambient): """Test that an invalid API/App Key throws an error.""" conf = {CONF_API_KEY: "12345abcde12345abcde", CONF_APP_KEY: "67890fghij67890fghij"} flow = config_flow.AmbientStationFlowHandler() flow.hass = hass flow.context = {"source": SOURCE_USER} result = await flow.async_step_user(user_input=conf) assert result["errors"] == {"base": "invalid_key"} @pytest.mark.parametrize("get_devices_response", [mock_coro(return_value=[])]) async def test_no_devices(hass, mock_aioambient): """Test that an account with no associated devices throws an error.""" conf = {CONF_API_KEY: "12345abcde12345abcde", CONF_APP_KEY: "67890fghij67890fghij"} flow = config_flow.AmbientStationFlowHandler() flow.hass = hass flow.context = {"source": SOURCE_USER} result = await flow.async_step_user(user_input=conf) assert result["errors"] == {"base": "no_devices"} async def test_show_form(hass): """Test that the form is served with no input.""" flow = config_flow.AmbientStationFlowHandler() flow.hass = hass flow.context = {"source": SOURCE_USER} result = await flow.async_step_user(user_input=None) assert result["type"] == data_entry_flow.RESULT_TYPE_FORM assert result["step_id"] == "user" @pytest.mark.parametrize( "get_devices_response", [mock_coro(return_value=json.loads(load_fixture("ambient_devices.json")))], ) async def test_step_user(hass, mock_aioambient): """Test that the user step works.""" conf = {CONF_API_KEY: "12345abcde12345abcde", CONF_APP_KEY: "67890fghij67890fghij"} flow = config_flow.AmbientStationFlowHandler() flow.hass = hass flow.context = {"source": SOURCE_USER} result = await flow.async_step_user(user_input=conf) assert result["type"] == data_entry_flow.RESULT_TYPE_CREATE_ENTRY assert result["title"] == "67890fghij67" assert result["data"] == { CONF_API_KEY: "12345abcde12345abcde", CONF_APP_KEY: "67890fghij67890fghij", }
{ "content_hash": "e8ea5a1830988bd1a7e5d5dc5e7e650b", "timestamp": "", "source": "github", "line_count": 104, "max_line_length": 88, "avg_line_length": 34.04807692307692, "alnum_prop": 0.7048856255295114, "repo_name": "FreekingDean/home-assistant", "id": "806d31b5386b6d2c9aebfee336e6a6c8c822625e", "size": "3541", "binary": false, "copies": "4", "ref": "refs/heads/dev", "path": "tests/components/ambient_station/test_config_flow.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Dockerfile", "bytes": "2335" }, { "name": "Python", "bytes": "36746639" }, { "name": "Shell", "bytes": "4910" } ], "symlink_target": "" }
import importlib import io import operator import pkgutil import traceback import types from docutils import nodes from docutils.parsers import rst from docutils import utils TAG = ':yaql:' def _get_modules_names(package): """Get names of modules in package""" return sorted( map(operator.itemgetter(1), pkgutil.walk_packages(package.__path__, '{0}.'.format(package.__name__)))) def _get_functions_names(module): """Get names of the functions in the current module""" return [name for name in dir(module) if isinstance(getattr(module, name, None), types.FunctionType)] def write_method_doc(method, output): """Construct method documentation from a docstring. 1) Strip TAG 2) Embolden function name 3) Add :callAs: after :signature: """ msg = "Error: function {0} has no valid YAQL documentation." if method.__doc__: doc = method.__doc__ try: # strip TAG doc = doc[doc.index(TAG) + len(TAG):] # embolden function name line_break = doc.index('\n') yaql_name = doc[:line_break] (emit_header, is_overload) = yield yaql_name if emit_header: output.write(yaql_name) output.write('\n') output.write('~' * len(yaql_name)) output.write('\n') doc = doc[line_break:] # add :callAs: parameter try: signature_index = doc.index(':signature:') position = doc.index(' :', signature_index + len(':signature:')) if hasattr(method, '__yaql_function__'): if (method.__yaql_function__.name and 'operator' in method.__yaql_function__.name): call_as = 'operator' elif (method.__yaql_function__.is_function and method.__yaql_function__.is_method): call_as = 'function or method' elif method.__yaql_function__.is_method: call_as = 'method' else: call_as = 'function' else: call_as = 'function' call_as_str = ' :callAs: {0}\n'.format(call_as) text = doc[:position] + call_as_str + doc[position:] except ValueError: text = doc if is_overload: text = '* ' + '\n '.join(text.split('\n')) output.write(text) else: output.write(text) except ValueError: yield method.func_name output.write(msg.format(method.func_name)) def write_module_doc(module, output): """Generate and write rst document for module. Generate and write rst document for the single module. :parameter module: takes a Python module which should be documented. :type module: Python module :parameter output: takes file to which generated document will be written. :type output: file """ functions_names = _get_functions_names(module) if module.__doc__: output.write(module.__doc__) output.write('\n') seq = [] for name in functions_names: method = getattr(module, name) it = write_method_doc(method, output) try: name = next(it) seq.append((name, it)) except StopIteration: pass seq.sort(key=operator.itemgetter(0)) prev_name = None for i, item in enumerate(seq): name = item[0] emit_header = name != prev_name prev_name = name if emit_header: overload = i < len(seq) - 1 and seq[i + 1][0] == name else: overload = True try: item[1].send((emit_header, overload)) except StopIteration: pass output.write('\n\n') output.write('\n') def write_package_doc(package, output): """Writes rst document for the package. Generate and write rst document for the modules in the given package. :parameter package: takes a Python package which should be documented :type package: Python module :parameter output: takes file to which generated document will be written. :type output: file """ modules = _get_modules_names(package) for module_name in modules: module = importlib.import_module(module_name) write_module_doc(module, output) def generate_doc(source): try: package = importlib.import_module(source) except ImportError: return 'Error: No such module {0}'.format(source) out = io.StringIO() try: if hasattr(package, '__path__'): write_package_doc(package, out) else: write_module_doc(package, out) res = out.getvalue() return res except Exception as e: return '.. code-block:: python\n\n Error: {0}\n {1}\n\n'.format( str(e), '\n '.join([''] + traceback.format_exc().split('\n'))) class YaqlDocNode(nodes.General, nodes.Element): source = None def __init__(self, source): self.source = source super(YaqlDocNode, self).__init__() class YaqlDocDirective(rst.Directive): has_content = False required_arguments = 1 def run(self): return [YaqlDocNode(self.arguments[0])] def render(app, doctree, fromdocname): for node in doctree.traverse(YaqlDocNode): new_doc = utils.new_document('YAQL', doctree.settings) content = generate_doc(node.source) rst.Parser().parse(content, new_doc) node.replace_self(new_doc.children) def setup(app): app.add_node(YaqlDocNode) app.add_directive('yaqldoc', YaqlDocDirective) app.connect('doctree-resolved', render) return {'version': '0.1'}
{ "content_hash": "af1b9e9128747bc9b88d621c27a70451", "timestamp": "", "source": "github", "line_count": 200, "max_line_length": 78, "avg_line_length": 30, "alnum_prop": 0.5585, "repo_name": "openstack/yaql", "id": "caba4023ea8c6d21f56afb0a65efc74ea01211df", "size": "6611", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "doc/source/_exts/yaqlautodoc.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "481598" } ], "symlink_target": "" }
import unittest import os import comm import commands class TestCrosswalkApptoolsFunctions(unittest.TestCase): def test_list_target_platforms(self): comm.setUp() os.chdir(comm.TEMP_DATA_PATH) cmd = "crosswalk-app platforms" status = os.popen(cmd).readlines() self.assertEquals("deb", status[0].strip(" *\n")) self.assertEquals("android", status[1].strip(" *\n")) if __name__ == '__main__': unittest.main()
{ "content_hash": "0abaa592f544889100d8b127ac10979d", "timestamp": "", "source": "github", "line_count": 18, "max_line_length": 61, "avg_line_length": 25.88888888888889, "alnum_prop": 0.6394849785407726, "repo_name": "crosswalk-project/crosswalk-test-suite", "id": "6bef381d188c5770e4c847d1246e9e987cd707b6", "size": "2013", "binary": false, "copies": "16", "ref": "refs/heads/master", "path": "apptools/apptools-linux-tests/apptools/target_platforms.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "C", "bytes": "2738" }, { "name": "C#", "bytes": "1437" }, { "name": "CSS", "bytes": "63576" }, { "name": "Cucumber", "bytes": "133383" }, { "name": "GLSL", "bytes": "2187925" }, { "name": "HTML", "bytes": "23702581" }, { "name": "Java", "bytes": "1755638" }, { "name": "JavaScript", "bytes": "3166019" }, { "name": "Makefile", "bytes": "1044" }, { "name": "PHP", "bytes": "37474" }, { "name": "Python", "bytes": "1882174" }, { "name": "Shell", "bytes": "614247" } ], "symlink_target": "" }
r""" This code was generated by \ / _ _ _| _ _ | (_)\/(_)(_|\/| |(/_ v1.0.0 / / """ from twilio.base import deserialize from twilio.base import values from twilio.base.instance_resource import InstanceResource from twilio.base.list_resource import ListResource from twilio.base.page import Page class VoipList(ListResource): def __init__(self, version, account_sid, country_code): """ Initialize the VoipList :param Version version: Version that contains the resource :param account_sid: The account_sid :param country_code: The ISO-3166-1 country code of the country. :returns: twilio.rest.api.v2010.account.available_phone_number.voip.VoipList :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipList """ super(VoipList, self).__init__(version) # Path Solution self._solution = {'account_sid': account_sid, 'country_code': country_code, } self._uri = '/Accounts/{account_sid}/AvailablePhoneNumbers/{country_code}/Voip.json'.format(**self._solution) def stream(self, area_code=values.unset, contains=values.unset, sms_enabled=values.unset, mms_enabled=values.unset, voice_enabled=values.unset, exclude_all_address_required=values.unset, exclude_local_address_required=values.unset, exclude_foreign_address_required=values.unset, beta=values.unset, near_number=values.unset, near_lat_long=values.unset, distance=values.unset, in_postal_code=values.unset, in_region=values.unset, in_rate_center=values.unset, in_lata=values.unset, in_locality=values.unset, fax_enabled=values.unset, limit=None, page_size=None): """ Streams VoipInstance records from the API as a generator stream. This operation lazily loads records as efficiently as possible until the limit is reached. The results are returned as a generator, so this operation is memory efficient. :param unicode area_code: The area code of the phone numbers to read :param unicode contains: The pattern on which to match phone numbers :param bool sms_enabled: Whether the phone numbers can receive text messages :param bool mms_enabled: Whether the phone numbers can receive MMS messages :param bool voice_enabled: Whether the phone numbers can receive calls. :param bool exclude_all_address_required: Whether to exclude phone numbers that require an Address :param bool exclude_local_address_required: Whether to exclude phone numbers that require a local address :param bool exclude_foreign_address_required: Whether to exclude phone numbers that require a foreign address :param bool beta: Whether to read phone numbers new to the Twilio platform :param unicode near_number: Given a phone number, find a geographically close number within distance miles. (US/Canada only) :param unicode near_lat_long: Given a latitude/longitude pair lat,long find geographically close numbers within distance miles. (US/Canada only) :param unicode distance: The search radius, in miles, for a near_ query. (US/Canada only) :param unicode in_postal_code: Limit results to a particular postal code. (US/Canada only) :param unicode in_region: Limit results to a particular region. (US/Canada only) :param unicode in_rate_center: Limit results to a specific rate center, or given a phone number search within the same rate center as that number. (US/Canada only) :param unicode in_lata: Limit results to a specific local access and transport area. (US/Canada only) :param unicode in_locality: Limit results to a particular locality :param bool fax_enabled: Whether the phone numbers can receive faxes :param int limit: Upper limit for the number of records to return. stream() guarantees to never return more than limit. Default is no limit :param int page_size: Number of records to fetch per request, when not set will use the default value of 50 records. If no page_size is defined but a limit is defined, stream() will attempt to read the limit with the most efficient page size, i.e. min(limit, 1000) :returns: Generator that will yield up to limit results :rtype: list[twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance] """ limits = self._version.read_limits(limit, page_size) page = self.page( area_code=area_code, contains=contains, sms_enabled=sms_enabled, mms_enabled=mms_enabled, voice_enabled=voice_enabled, exclude_all_address_required=exclude_all_address_required, exclude_local_address_required=exclude_local_address_required, exclude_foreign_address_required=exclude_foreign_address_required, beta=beta, near_number=near_number, near_lat_long=near_lat_long, distance=distance, in_postal_code=in_postal_code, in_region=in_region, in_rate_center=in_rate_center, in_lata=in_lata, in_locality=in_locality, fax_enabled=fax_enabled, page_size=limits['page_size'], ) return self._version.stream(page, limits['limit']) def list(self, area_code=values.unset, contains=values.unset, sms_enabled=values.unset, mms_enabled=values.unset, voice_enabled=values.unset, exclude_all_address_required=values.unset, exclude_local_address_required=values.unset, exclude_foreign_address_required=values.unset, beta=values.unset, near_number=values.unset, near_lat_long=values.unset, distance=values.unset, in_postal_code=values.unset, in_region=values.unset, in_rate_center=values.unset, in_lata=values.unset, in_locality=values.unset, fax_enabled=values.unset, limit=None, page_size=None): """ Lists VoipInstance records from the API as a list. Unlike stream(), this operation is eager and will load `limit` records into memory before returning. :param unicode area_code: The area code of the phone numbers to read :param unicode contains: The pattern on which to match phone numbers :param bool sms_enabled: Whether the phone numbers can receive text messages :param bool mms_enabled: Whether the phone numbers can receive MMS messages :param bool voice_enabled: Whether the phone numbers can receive calls. :param bool exclude_all_address_required: Whether to exclude phone numbers that require an Address :param bool exclude_local_address_required: Whether to exclude phone numbers that require a local address :param bool exclude_foreign_address_required: Whether to exclude phone numbers that require a foreign address :param bool beta: Whether to read phone numbers new to the Twilio platform :param unicode near_number: Given a phone number, find a geographically close number within distance miles. (US/Canada only) :param unicode near_lat_long: Given a latitude/longitude pair lat,long find geographically close numbers within distance miles. (US/Canada only) :param unicode distance: The search radius, in miles, for a near_ query. (US/Canada only) :param unicode in_postal_code: Limit results to a particular postal code. (US/Canada only) :param unicode in_region: Limit results to a particular region. (US/Canada only) :param unicode in_rate_center: Limit results to a specific rate center, or given a phone number search within the same rate center as that number. (US/Canada only) :param unicode in_lata: Limit results to a specific local access and transport area. (US/Canada only) :param unicode in_locality: Limit results to a particular locality :param bool fax_enabled: Whether the phone numbers can receive faxes :param int limit: Upper limit for the number of records to return. list() guarantees never to return more than limit. Default is no limit :param int page_size: Number of records to fetch per request, when not set will use the default value of 50 records. If no page_size is defined but a limit is defined, list() will attempt to read the limit with the most efficient page size, i.e. min(limit, 1000) :returns: Generator that will yield up to limit results :rtype: list[twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance] """ return list(self.stream( area_code=area_code, contains=contains, sms_enabled=sms_enabled, mms_enabled=mms_enabled, voice_enabled=voice_enabled, exclude_all_address_required=exclude_all_address_required, exclude_local_address_required=exclude_local_address_required, exclude_foreign_address_required=exclude_foreign_address_required, beta=beta, near_number=near_number, near_lat_long=near_lat_long, distance=distance, in_postal_code=in_postal_code, in_region=in_region, in_rate_center=in_rate_center, in_lata=in_lata, in_locality=in_locality, fax_enabled=fax_enabled, limit=limit, page_size=page_size, )) def page(self, area_code=values.unset, contains=values.unset, sms_enabled=values.unset, mms_enabled=values.unset, voice_enabled=values.unset, exclude_all_address_required=values.unset, exclude_local_address_required=values.unset, exclude_foreign_address_required=values.unset, beta=values.unset, near_number=values.unset, near_lat_long=values.unset, distance=values.unset, in_postal_code=values.unset, in_region=values.unset, in_rate_center=values.unset, in_lata=values.unset, in_locality=values.unset, fax_enabled=values.unset, page_token=values.unset, page_number=values.unset, page_size=values.unset): """ Retrieve a single page of VoipInstance records from the API. Request is executed immediately :param unicode area_code: The area code of the phone numbers to read :param unicode contains: The pattern on which to match phone numbers :param bool sms_enabled: Whether the phone numbers can receive text messages :param bool mms_enabled: Whether the phone numbers can receive MMS messages :param bool voice_enabled: Whether the phone numbers can receive calls. :param bool exclude_all_address_required: Whether to exclude phone numbers that require an Address :param bool exclude_local_address_required: Whether to exclude phone numbers that require a local address :param bool exclude_foreign_address_required: Whether to exclude phone numbers that require a foreign address :param bool beta: Whether to read phone numbers new to the Twilio platform :param unicode near_number: Given a phone number, find a geographically close number within distance miles. (US/Canada only) :param unicode near_lat_long: Given a latitude/longitude pair lat,long find geographically close numbers within distance miles. (US/Canada only) :param unicode distance: The search radius, in miles, for a near_ query. (US/Canada only) :param unicode in_postal_code: Limit results to a particular postal code. (US/Canada only) :param unicode in_region: Limit results to a particular region. (US/Canada only) :param unicode in_rate_center: Limit results to a specific rate center, or given a phone number search within the same rate center as that number. (US/Canada only) :param unicode in_lata: Limit results to a specific local access and transport area. (US/Canada only) :param unicode in_locality: Limit results to a particular locality :param bool fax_enabled: Whether the phone numbers can receive faxes :param str page_token: PageToken provided by the API :param int page_number: Page Number, this value is simply for client state :param int page_size: Number of records to return, defaults to 50 :returns: Page of VoipInstance :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipPage """ data = values.of({ 'AreaCode': area_code, 'Contains': contains, 'SmsEnabled': sms_enabled, 'MmsEnabled': mms_enabled, 'VoiceEnabled': voice_enabled, 'ExcludeAllAddressRequired': exclude_all_address_required, 'ExcludeLocalAddressRequired': exclude_local_address_required, 'ExcludeForeignAddressRequired': exclude_foreign_address_required, 'Beta': beta, 'NearNumber': near_number, 'NearLatLong': near_lat_long, 'Distance': distance, 'InPostalCode': in_postal_code, 'InRegion': in_region, 'InRateCenter': in_rate_center, 'InLata': in_lata, 'InLocality': in_locality, 'FaxEnabled': fax_enabled, 'PageToken': page_token, 'Page': page_number, 'PageSize': page_size, }) response = self._version.page(method='GET', uri=self._uri, params=data, ) return VoipPage(self._version, response, self._solution) def get_page(self, target_url): """ Retrieve a specific page of VoipInstance records from the API. Request is executed immediately :param str target_url: API-generated URL for the requested results page :returns: Page of VoipInstance :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipPage """ response = self._version.domain.twilio.request( 'GET', target_url, ) return VoipPage(self._version, response, self._solution) def __repr__(self): """ Provide a friendly representation :returns: Machine friendly representation :rtype: str """ return '<Twilio.Api.V2010.VoipList>' class VoipPage(Page): def __init__(self, version, response, solution): """ Initialize the VoipPage :param Version version: Version that contains the resource :param Response response: Response from the API :param account_sid: The account_sid :param country_code: The ISO-3166-1 country code of the country. :returns: twilio.rest.api.v2010.account.available_phone_number.voip.VoipPage :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipPage """ super(VoipPage, self).__init__(version, response) # Path Solution self._solution = solution def get_instance(self, payload): """ Build an instance of VoipInstance :param dict payload: Payload response from the API :returns: twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance """ return VoipInstance( self._version, payload, account_sid=self._solution['account_sid'], country_code=self._solution['country_code'], ) def __repr__(self): """ Provide a friendly representation :returns: Machine friendly representation :rtype: str """ return '<Twilio.Api.V2010.VoipPage>' class VoipInstance(InstanceResource): def __init__(self, version, payload, account_sid, country_code): """ Initialize the VoipInstance :returns: twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance :rtype: twilio.rest.api.v2010.account.available_phone_number.voip.VoipInstance """ super(VoipInstance, self).__init__(version) # Marshaled Properties self._properties = { 'friendly_name': payload.get('friendly_name'), 'phone_number': payload.get('phone_number'), 'lata': payload.get('lata'), 'locality': payload.get('locality'), 'rate_center': payload.get('rate_center'), 'latitude': deserialize.decimal(payload.get('latitude')), 'longitude': deserialize.decimal(payload.get('longitude')), 'region': payload.get('region'), 'postal_code': payload.get('postal_code'), 'iso_country': payload.get('iso_country'), 'address_requirements': payload.get('address_requirements'), 'beta': payload.get('beta'), 'capabilities': payload.get('capabilities'), } # Context self._context = None self._solution = {'account_sid': account_sid, 'country_code': country_code, } @property def friendly_name(self): """ :returns: A formatted version of the phone number :rtype: unicode """ return self._properties['friendly_name'] @property def phone_number(self): """ :returns: The phone number in E.164 format :rtype: unicode """ return self._properties['phone_number'] @property def lata(self): """ :returns: The LATA of this phone number :rtype: unicode """ return self._properties['lata'] @property def locality(self): """ :returns: The locality or city of this phone number's location :rtype: unicode """ return self._properties['locality'] @property def rate_center(self): """ :returns: The rate center of this phone number :rtype: unicode """ return self._properties['rate_center'] @property def latitude(self): """ :returns: The latitude of this phone number's location :rtype: unicode """ return self._properties['latitude'] @property def longitude(self): """ :returns: The longitude of this phone number's location :rtype: unicode """ return self._properties['longitude'] @property def region(self): """ :returns: The two-letter state or province abbreviation of this phone number's location :rtype: unicode """ return self._properties['region'] @property def postal_code(self): """ :returns: The postal or ZIP code of this phone number's location :rtype: unicode """ return self._properties['postal_code'] @property def iso_country(self): """ :returns: The ISO country code of this phone number :rtype: unicode """ return self._properties['iso_country'] @property def address_requirements(self): """ :returns: The type of Address resource the phone number requires :rtype: unicode """ return self._properties['address_requirements'] @property def beta(self): """ :returns: Whether the phone number is new to the Twilio platform :rtype: bool """ return self._properties['beta'] @property def capabilities(self): """ :returns: Whether a phone number can receive calls or messages :rtype: unicode """ return self._properties['capabilities'] def __repr__(self): """ Provide a friendly representation :returns: Machine friendly representation :rtype: str """ return '<Twilio.Api.V2010.VoipInstance>'
{ "content_hash": "2d4d4f3596fde60206ef26e4fec6f692", "timestamp": "", "source": "github", "line_count": 454, "max_line_length": 171, "avg_line_length": 44.71145374449339, "alnum_prop": 0.6399330016256959, "repo_name": "twilio/twilio-python", "id": "bd28b4bf57860908edecb2576259ccd45b5e93f8", "size": "20314", "binary": false, "copies": "1", "ref": "refs/heads/main", "path": "twilio/rest/api/v2010/account/available_phone_number/voip.py", "mode": "33188", "license": "mit", "language": [ { "name": "Dockerfile", "bytes": "234" }, { "name": "Makefile", "bytes": "2157" }, { "name": "Python", "bytes": "11241545" } ], "symlink_target": "" }
from kivy.properties import ObjectProperty from kivy.uix.boxlayout import BoxLayout class HelpDialog(BoxLayout): '''HelpDialog, in which help will be displayed from help.rst. It emits 'on_cancel' event when 'Cancel' button is released. ''' rst = ObjectProperty(None) '''rst is reference to `kivy.uix.rst.RstDocument` to display help from help.rst ''' __events__ = ('on_cancel',) def on_cancel(self, *args): '''Default handler for 'on_cancel' event ''' pass
{ "content_hash": "51ccca2d8264b9ec29086833cde7a251", "timestamp": "", "source": "github", "line_count": 20, "max_line_length": 74, "avg_line_length": 26.4, "alnum_prop": 0.6420454545454546, "repo_name": "aron-bordin/kivy-designer", "id": "9266a4258c078608467cf75e82843deade83977a", "size": "528", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "designer/components/dialogs/help.py", "mode": "33188", "license": "mit", "language": [ { "name": "Batchfile", "bytes": "2239" }, { "name": "Makefile", "bytes": "914" }, { "name": "Python", "bytes": "487442" }, { "name": "Ruby", "bytes": "12440" }, { "name": "Shell", "bytes": "13" } ], "symlink_target": "" }
import pytest from pysagereader.sage_ii_reader import SAGEIILoaderV700 import os def test_loader(): sage = SAGEIILoaderV700(os.path.join(os.path.dirname(__file__), 'data')) data = sage.load_data(min_date='1984', max_date='1985') assert len(data.time) == 238 if __name__ == '__main__': test_loader()
{ "content_hash": "64a921f373bf53b2c5f3259ab81eaccd", "timestamp": "", "source": "github", "line_count": 14, "max_line_length": 76, "avg_line_length": 22.785714285714285, "alnum_prop": 0.664576802507837, "repo_name": "LandonRieger/pySAGE", "id": "9700f7b2d0a1533effb082ae792bd6a676fca498", "size": "319", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "tests/test_basic.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "144887" } ], "symlink_target": "" }
import json from indy import IndyError from indy import did import pytest from indy.error import ErrorCode @pytest.mark.asyncio async def test_store_their_did_works(wallet_handle, did_my): await did.store_their_did(wallet_handle, json.dumps({"did": did_my})) @pytest.mark.asyncio async def test_store_their_did_works_for_invalid_json(wallet_handle): with pytest.raises(IndyError) as e: await did.store_their_did(wallet_handle, '{"field":"value"}') assert ErrorCode.CommonInvalidStructure == e.value.error_code @pytest.mark.asyncio async def test_store_their_did_works_for_invalid_handle(wallet_handle, did_my): with pytest.raises(IndyError) as e: await did.store_their_did(wallet_handle + 1, json.dumps({"did": did_my})) assert ErrorCode.WalletInvalidHandle == e.value.error_code @pytest.mark.asyncio async def test_store_their_did_works_with_verkey(wallet_handle, did_my1, verkey_my1): await did.store_their_did(wallet_handle, json.dumps({"did": did_my1, "verkey": verkey_my1})) @pytest.mark.asyncio async def test_store_their_did_works_without_did(wallet_handle, verkey_my1): with pytest.raises(IndyError) as e: await did.store_their_did(wallet_handle, json.dumps({"verkey": verkey_my1})) assert ErrorCode.CommonInvalidStructure == e.value.error_code @pytest.mark.asyncio async def test_store_their_did_works_for_invalid_did(wallet_handle): with pytest.raises(IndyError) as e: await did.store_their_did(wallet_handle, '{"did": "invalid_base58_string"}') assert ErrorCode.CommonInvalidStructure == e.value.error_code
{ "content_hash": "e5a44380b749fd45d3aa3d36e58ca212", "timestamp": "", "source": "github", "line_count": 46, "max_line_length": 96, "avg_line_length": 34.891304347826086, "alnum_prop": 0.735202492211838, "repo_name": "anastasia-tarasova/indy-sdk", "id": "0292f6164cf444a272395a05f22064ee294e3227", "size": "1605", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "wrappers/python/tests/did/test_store_their_did.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "C", "bytes": "207870" }, { "name": "C#", "bytes": "842011" }, { "name": "C++", "bytes": "229233" }, { "name": "CSS", "bytes": "137079" }, { "name": "Dockerfile", "bytes": "23945" }, { "name": "Groovy", "bytes": "102863" }, { "name": "HTML", "bytes": "897750" }, { "name": "Java", "bytes": "882162" }, { "name": "JavaScript", "bytes": "185247" }, { "name": "Makefile", "bytes": "328" }, { "name": "Objective-C", "bytes": "584121" }, { "name": "Objective-C++", "bytes": "706749" }, { "name": "Perl", "bytes": "8271" }, { "name": "Python", "bytes": "750776" }, { "name": "Ruby", "bytes": "80525" }, { "name": "Rust", "bytes": "5872898" }, { "name": "Shell", "bytes": "251160" }, { "name": "Swift", "bytes": "1114" }, { "name": "TypeScript", "bytes": "197439" } ], "symlink_target": "" }
"""The functions to handle the main function""" from argparse import ArgumentParser, SUPPRESS from ORCSchlange.command.fetch import FetchReporeter from ORCSchlange.command.db import DbCommand __version__ = "0.7.1" """The version of the package""" def main(): """The main function that loads the commands.""" parser = ArgumentParser(prog='orcs', description="A simple tool to interact with the ORICID-Public-API.") add_global(parser) subparsers = parser.add_subparsers(metavar="The ORC-Schlange commands are:") fetch = subparsers.add_parser('fetch', help="""Fetch the information from the ORICID-Public-API. Call "fetch -h" for more details.""") add_fetch(fetch) db = subparsers.add_parser('db', help='Manage the SQLite DB that contains the orcids. Call \"db -h\" for more details.', add_help=False) add_db(db) args = parser.parse_args() args.func(args) def add_global(parser): """Add the global arguments to the parser. :param parser: The global ArgumentParser """ parser.set_defaults(func=lambda x: parser.print_help()) parser.add_argument('--version', action='version', version='%(prog)s ' + __version__) parser.add_argument('-v', '--verbose', action='store_true', dest="verbose", help="Create verbose output") def add_fetch(fetch): """Add the fetch arguments to the fetch command. :param fetch: The fetch ArgumentParser. """ fetch.set_defaults(func=lambda args: FetchReporeter(args).fetch(), config=1) fetch.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") fetch.add_argument('--html', action='store_false', dest="html", help="Is a html output created. (default: %(default)s)") fetch.add_argument('--bib', action='store_true', dest="bib", help="Is a bib output created. (default: %(default)s)") fetch.add_argument('--path', action='store', dest="path", help="The path where the output is created. (default: %(default)s)", default="output/") fetch.add_argument('--name', action='store', dest="name", help="The name of the output. (default: %(default)s)", default="index") fetch.add_argument('--jQuery', action='store_true', dest="jquery", help="Copy jQuery version 3.2.1 to the output path. (default: %(default)s)") api = fetch.add_argument_group(title="API-Configuration", description="""To interact with the ORCID-API the client-id and client-secret need to set or loaded. The default is the sandbox""") api.add_argument("--sandbox", action='store_const', const=0, dest="config", help="Run in the ORCID-Sandbox These need no further options.") api.add_argument("--db", action='store_const', const=1, dest="config", help="Load the options out of the SQLite DB.These need that they are added before with db addAPI.") api.add_argument("--file", action='store', dest="config", help="""Load the options out of the file that is given. These need that the file is in a json format that have a field \"client_id\" and \"client_secret\".""") api.add_argument("--inline", nargs=2, dest="config", help="Give the data inline. First the id then the secret.") def add_db(db): """Add the db arguments and subcommands to the db command :param db: The db ArgumentParser. """ db.set_defaults(func=lambda args: db.print_help() if not args.test else DbCommand(args).create_test()) db.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") db.add_argument('-t', '--test', action='store_true', help=SUPPRESS) db.add_argument('-h', "--help", action='store_true', help=SUPPRESS) dbsubs = db.add_subparsers(title="db", description="Manage the SQLite DB that contains the orcids", metavar="The databank functions are:") add_dbs = dbsubs.add_parser('add', help='Add an new ORCID to the DB') add_dbs.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") add_adddb(add_dbs) conf_db = dbsubs.add_parser('addConf', help='Add an new Config to the DB') conf_db.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") add_conf(conf_db) print_db = dbsubs.add_parser('print', help='Print the content of the databank') print_db.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") print_db.set_defaults(func=lambda args: DbCommand(args).prints()) clean_db = dbsubs.add_parser('clean', help='Reset the databank') clean_db.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") clean_db.set_defaults(func=lambda args: DbCommand(args).clean()) create_db = dbsubs.add_parser('create', help='Create a new databank') create_db.add_argument('--dbfile', action='store', dest="dbfile", help="The SQLite DB file that is used.", default="people.db") create_db.set_defaults(func=lambda args: DbCommand(args).create()) def add_adddb(add_dbs): """Add the arguments to the add command :param add_dbs: THe db add ArgumentParser. """ add_dbs.add_argument('orchid', action="store", help="The new added ORCID.") add_dbs.add_argument('start', action="store", help="""The date after the ORCID data is fetched in form "YYYY-MM-DD".""") add_dbs.add_argument('stop', action="store", help="The date until the ORCID data is fetched in form \"YYYY-MM-DD\".", nargs="?") add_dbs.set_defaults(func=lambda args: DbCommand(args).add()) add_dbs.set_defaults(func=lambda args: DbCommand(args).add()) def add_conf(conf_db): """Add the arguments to the addConf command :param conf_db: THe db addConf ArgumentParser. """ conf_db.add_argument('cliend_id', action="store", help="The client id of you app.") conf_db.add_argument('clien_secret', action="store", help="The client secret of you app.") conf_db.add_argument('auth', action="store", help="The url to authenticate.", nargs="?", default="https://orcid.org/oauth/token") conf_db.add_argument('api', action="store", help="The url of the api.", nargs="?", default="https://pub.orcid.org/v2.0/") conf_db.set_defaults(func=lambda args: DbCommand(args).add_conf())
{ "content_hash": "a605cb63c6adf990e1594eab8bea64a7", "timestamp": "", "source": "github", "line_count": 140, "max_line_length": 120, "avg_line_length": 50.55714285714286, "alnum_prop": 0.6134501271545635, "repo_name": "ScaDS/ORC-Schlange", "id": "24d76fdeae4a9c5e08860fe002bc43b770a3c659", "size": "7078", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "ORCSchlange/__init__.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "HTML", "bytes": "18383" }, { "name": "Python", "bytes": "64140" }, { "name": "Shell", "bytes": "118" }, { "name": "TeX", "bytes": "4142" } ], "symlink_target": "" }
import logging import matplotlib import matplotlib.pyplot as plt from PIL import Image import re import requests import StringIO import tempfile import app_config from plugins.base import CarebotPlugin from util.analytics import GoogleAnalytics from util.chart import ChartTools from util.models import Story from util.s3 import Uploader s3 = Uploader() logging.basicConfig() logger = logging.getLogger(__name__) logger.setLevel(logging.INFO) class NPRScrollDepth(CarebotPlugin): """ Get scroll depth stats on NPR stories """ SLUG_SEARCH_REGEX = re.compile(ur'slug ((\w*-*)+)') def get_listeners(self): """ Associate regular expression matches to the appropriate handler """ return [ ['depth', self.SLUG_SEARCH_REGEX, self.handle_slug_inquiry, self.get_wait_message], # ['linger-url', self.GRUBER_URLINTEXT_PAT, self.handle_url_inquiry], ] def get_wait_message(self): return "All right, I'm looking up the scroll depth stats." def get_slug_query_params(self, team, slug=None): """ Given a slug, get parameters needed to query google analytics for the scroll depth """ filters = 'ga:eventLabel==10,ga:eventLabel==20,ga:eventLabel==30,ga:eventLabel==40,ga:eventLabel==50,ga:eventLabel==60,ga:eventLabel==70,ga:eventLabel==80,ga:eventLabel==90,ga:eventLabel==100;ga:eventCategory==%s;ga:eventAction==scroll-depth' % slug params = { 'ids': 'ga:{0}'.format(team['ga_org_id']), 'start-date': '90daysAgo', # start_date.strftime('%Y-%m-%d'), 'end-date': 'today', 'metrics': 'ga:users,ga:eventValue', 'dimensions': 'ga:eventLabel', 'filters': filters, 'max-results': app_config.GA_RESULT_SIZE, 'samplingLevel': app_config.GA_SAMPLING_LEVEL, 'start-index': 1, } return params @staticmethod def fill_in_max(data): """ Sometime people start at 20, 30, 40% of the article read because their screens are large or the article is short. fill_in_max finds the starting bucket with the largest number of people and fills in all previous buckets with that count.that That way we get an accurate count of how many people read the top of the article. """ max_people = max(data, key=lambda item:item[1])[1] for row in data: if row[1] == max_people: break row[1] = max_people # Calculate the percentage of users for row in data: pct = round((row[1] / float(max_people)) * 100) row.append(int(pct)) return data def clean_data(self, data): """ Fix data types, truncate the data, and otherwise make it fit for consumption. """ rows = [] for row in data: row[0] = int(row[0]) # Percent depth on page row[1] = int(row[1]) # Total users row[2] = int(row[2]) # Seconds on page rows.append(row) # Sort the row data from 10% => 100% # Currently handled by the filter above; legacy from before, but doesn't # hurt to have. rows.sort(key=lambda tup: tup[0]) rows = NPRScrollDepth.fill_in_max(rows) # Only take the first 10 rows. truncated = rows[:10] return truncated def get_median(self, data): """ Take the scroll depth data we have (number of people per percent) Then calculate how many people only got to THAT bucket (aka didn't get to the next percent bucket) """ length = len(data) for i, row in enumerate(data): if not i == length - 1: row[1] = row[1] - data[i + 1][1] lst = [] # Flatten the [percent, count] tuples # This is a really inefficient way to do this! for bucket in data: for _ in range(bucket[1]): lst.append(bucket[0]) median = GoogleAnalytics.median(lst) return int(median) def get_total_people(self, data): """ Find the tuple with the max number of people. """ return max(data, key=lambda item:item[1])[1] def get_chart(self, rows, median=None, labels=None): """ Create a scroll depth histogram """ if labels is None: labels = ['100%', '90%', '80%', '70%', '60%', '50%', '40%', '30%', '20%', '10%'] r = range(1, len(rows) + 1) data = [] # Rows are drawn "upside down" so we need to reverse them: rows.reverse() for row in rows: data.append(row[3]) # Set the chart size plt.figure(figsize=(2,4), dpi=100) # Remove the plot frame lines. They are unnecessary chartjunk. ax = plt.subplot(1, 1, 1) ax.spines["top"].set_visible(False) ax.spines["right"].set_visible(False) ax.spines["bottom"].set_visible(False) ax.spines["left"].set_visible(False) # Ensure that the axis ticks only show up on the bottom and left of the plot. # Ticks on the right and top of the plot are generally unnecessary chartjunk. ax.get_xaxis().tick_bottom() ax.get_yaxis().tick_left() # Configure x-axis ticks plt.xlim(0, 100) ax.tick_params(axis='x', colors='#b8b8b8', labelsize=8, labelbottom='off') plt.axes().xaxis.set_ticks_position('none') # Configure y-axis ticks plt.axes().yaxis.set_ticks_position('none') ax.tick_params(axis='y', colors='#b8b8b8', labelsize=7) ax.yaxis.label.set_fontsize(10) plt.yticks(r, labels) chart = plt.barh(r, data, align="center") for index, value in enumerate(data): chart[index].set_color('#4b7ef0') # TODO: Median line # for bar in chart: # width = bar.get_width() # print width # print bar.get_y() # if bar.get_y() == 1.6: # print # ax.text( # bar.get_y() + bar.get_height()/2., # 1.05 * width, # "MED", # ha='center', # va='bottom', # color='#b8b8b8', # fontsize=8 # ) with tempfile.TemporaryFile(suffix=".png") as tmpfile: plt.savefig(tmpfile, bbox_inches='tight') tmpfile.seek(0) # Rewind the file to the beginning url = s3.upload(tmpfile) return url def get_slug_message(self, slug, story=None): # Try to match the story to a slug to accurately get a team # The Google Analytics property ID comes from the team config # We use the default team if none is found stories = Story.select().where(Story.slug.contains(slug)) team = self.config.get_team_for_stories(stories) params = self.get_slug_query_params(team=team, slug=slug) data = GoogleAnalytics.query_ga(params) if not data.get('rows'): logger.info('No rows found for slug %s' % slug) return # Clean up the data clean_data = self.clean_data(data.get('rows')) total_people = self.get_total_people(clean_data) friendly_people = "{:,}".format(total_people) # Comma-separated #s median = self.get_median(clean_data) # Set up the chart scroll_histogram_url = self.get_chart(clean_data) if story: scroll_histogram_url = ChartTools.add_screenshot_to_chart(story, scroll_histogram_url) # TODO: Not confident in median calculations so far # text = "*%s people* got a median of *%s percent* down the page." % (friendly_people, median) text = '' attachments = [{ "fallback": slug + " update", "color": "#eeeeee", "title": "How far down did people scroll?", "image_url": scroll_histogram_url }] return { 'text': text, 'attachments': attachments } def handle_slug_inquiry(self, message): """ Respond to an inquiry about the slug with stats and charts """ match = re.search(self.SLUG_SEARCH_REGEX, message.body['text']) slug = match.group(1) if slug: return self.get_slug_message(slug) def get_update_message(self, story): """ Only one slug in the story (should be the first) will return scroll depth results. TODO: Will need to handle the case when it's not the first slug reporting depth data. """ story_slugs = story.slug_list() team = self.config.get_team_for_story(story) return self.get_slug_message(story_slugs[0])
{ "content_hash": "e17641d55174e6bb383290423a135897", "timestamp": "", "source": "github", "line_count": 274, "max_line_length": 257, "avg_line_length": 33.14963503649635, "alnum_prop": 0.5600572498073324, "repo_name": "thecarebot/carebot", "id": "0cd3437d0e7d6af7a7d83f4e6d8230f1d7b54d7c", "size": "9083", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "plugins/npr/scrolldepth.py", "mode": "33188", "license": "mit", "language": [ { "name": "Dockerfile", "bytes": "203" }, { "name": "HTML", "bytes": "2660" }, { "name": "Python", "bytes": "126000" }, { "name": "Shell", "bytes": "128" } ], "symlink_target": "" }
"""Unit tests for the metadata package.""" from __future__ import with_statement import path_initializer path_initializer.InitSysPath() import copy import os import tempfile from google.apputils import app import gflags as flags import unittest from gcutil_lib import metadata FLAGS = flags.FLAGS class MetadataTest(unittest.TestCase): def testGatherMetadata(self): flag_values = copy.deepcopy(FLAGS) metadata_flags_processor = metadata.MetadataFlagsProcessor(flag_values) handle, path = tempfile.mkstemp() try: with os.fdopen(handle, 'w') as metadata_file: metadata_file.write('metadata file content') metadata_file.flush() flag_values.metadata = ['bar:baz'] flag_values.metadata_from_file = ['bar_file:%s' % path] metadata_entries = metadata_flags_processor.GatherMetadata() self.assertEqual(len(metadata_entries), 2) self.assertEqual(metadata_entries[0]['key'], 'bar') self.assertEqual(metadata_entries[0]['value'], 'baz') self.assertEqual(metadata_entries[1]['key'], 'bar_file') self.assertEqual(metadata_entries[1]['value'], 'metadata file content') finally: os.remove(path) def testGatherMetadataWithDuplicateKeys(self): flag_values = copy.deepcopy(FLAGS) metadata_flags_processor = metadata.MetadataFlagsProcessor(flag_values) flag_values.metadata = ['bar:baz', 'bar:foo'] self.assertRaises(app.UsageError, metadata_flags_processor.GatherMetadata) flag_values.metadata = ['bar:baz', 'bar:foo', 'foo:baz', 'foobar:val'] self.assertRaises(app.UsageError, metadata_flags_processor.GatherMetadata) flag_values.metadata = ['foo:foo', 'bar:baz', 'bar:foo', 'foo:baz', 'foobar:val'] self.assertRaises(app.UsageError, metadata_flags_processor.GatherMetadata) handle, path = tempfile.mkstemp() try: with os.fdopen(handle, 'w') as metadata_file: metadata_file.write('metadata file content') metadata_file.flush() flag_values.metadata = ['bar:baz'] flag_values.metadata_from_file = ['bar:%s' % metadata_file.name] self.assertRaises(app.UsageError, metadata_flags_processor.GatherMetadata) finally: os.remove(path) def testGatherMetadataWithBannedMetadata(self): flag_values = copy.deepcopy(FLAGS) metadata_flags_processor = metadata.MetadataFlagsProcessor(flag_values) flag_values.metadata = [ metadata.INITIAL_WINDOWS_PASSWORD_METADATA_NAME + ':' + 'Pa$$0rd'] self.assertRaises(app.UsageError, metadata_flags_processor.GatherMetadata) if __name__ == '__main__': unittest.main()
{ "content_hash": "155605b807abe2e1ca3e0a20de13ae9a", "timestamp": "", "source": "github", "line_count": 86, "max_line_length": 78, "avg_line_length": 31.61627906976744, "alnum_prop": 0.6778227289444648, "repo_name": "ychen820/microblog", "id": "02d449e5cfcca91b281cdb5b937fab371e339257", "size": "3336", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "y/google-cloud-sdk/platform/gcutil/lib/google_compute_engine/gcutil_lib/metadata_test.py", "mode": "33261", "license": "bsd-3-clause", "language": [ { "name": "C", "bytes": "414229" }, { "name": "CSS", "bytes": "257787" }, { "name": "Emacs Lisp", "bytes": "4733" }, { "name": "Groff", "bytes": "1236200" }, { "name": "HTML", "bytes": "2617468" }, { "name": "JavaScript", "bytes": "1106437" }, { "name": "Makefile", "bytes": "15714" }, { "name": "Objective-C", "bytes": "26302" }, { "name": "PHP", "bytes": "2511443" }, { "name": "Perl", "bytes": "1109010" }, { "name": "Python", "bytes": "71588489" }, { "name": "R", "bytes": "548" }, { "name": "Shell", "bytes": "49796" }, { "name": "TeX", "bytes": "3149" }, { "name": "VimL", "bytes": "5645" } ], "symlink_target": "" }
from __future__ import unicode_literals import requests import datetime import json try: basestring except NameError: basestring = (str, bytes) class AccessError(Exception): def __init__(self, response): self.status_code = response.status_code data = response.json() super(AccessError, self).__init__(data["message"]) class ArgumentOutOfRangeException(Exception): def __init__(self, message): self.message = message.replace('ArgumentOutOfRangeException: ', '') super(ArgumentOutOfRangeException, self).__init__(self.message) class TranslateApiException(Exception): def __init__(self, message, *args): self.message = message.replace('TranslateApiException: ', '') super(TranslateApiException, self).__init__(self.message, *args) class AccessToken(object): access_url = "https://api.cognitive.microsoft.com/sts/v1.0/issueToken" expire_delta = datetime.timedelta(minutes=9) # Translator API valid for 10 minutes, actually def __init__(self, subscription_key): self.subscription_key = subscription_key self._token = None self._expdate = None def __call__(self, r): r.headers['Authorization'] = "Bearer " + self.token return r def request_token(self): headers = { 'Ocp-Apim-Subscription-Key': self.subscription_key } resp = requests.post(self.access_url, headers=headers) if resp.status_code == 200: self._token = resp.text self._expdate = datetime.datetime.now() + self.expire_delta else: raise AccessError(resp) @property def expired(self): return datetime.datetime.now() > self._expdate @property def token(self): if not self._token or self.expired: self.request_token() return self._token class Translator(object): api_url = "https://api.microsofttranslator.com/v2/ajax.svc/" def __init__(self, subscription_key): self.auth = AccessToken(subscription_key) def make_url(self, action): return self.api_url + action def make_request(self, action, params=None): url = self.make_url(action) resp = requests.get(url, auth=self.auth, params=params) return self.make_response(resp) def make_response(self, resp): resp.encoding = 'UTF-8-sig' data = resp.json() if isinstance(data, basestring) and data.startswith("ArgumentOutOfRangeException"): raise ArgumentOutOfRangeException(data) if isinstance(data, basestring) and data.startswith("TranslateApiException"): raise TranslateApiException(data) return data def _translate(self, action, text_params, lang_from, lang_to, contenttype, category): if not lang_to: raise ValueError('lang_to parameter is required') if contenttype not in ('text/plain', 'text/html'): raise ValueError('Invalid contenttype value') params = { 'to': lang_to, 'contentType': contenttype, 'category': category, } if lang_from: params['from'] = lang_from params.update(text_params) return self.make_request(action, params) def translate(self, text, lang_from=None, lang_to=None, contenttype='text/plain', category='general'): params = { 'text': text, } return self._translate('Translate', params, lang_from, lang_to, contenttype, category) def translate_array(self, texts=[], lang_from=None, lang_to=None, contenttype='text/plain', category='general'): params = { 'texts': json.dumps(texts), } return self._translate('TranslateArray', params, lang_from, lang_to, contenttype, category) def translate_array2(self, texts=[], lang_from=None, lang_to=None, contenttype='text/plain', category='general'): params = { 'texts': json.dumps(texts), } return self._translate('TranslateArray2', params, lang_from, lang_to, contenttype, category) def get_translations(self, text, lang_from, lang_to, max_n=10, contenttype='text/plain', category='general', url=None, user=None, state=None): options = { 'Category': category, 'ContentType': contenttype, } if url: options['Uri'] = url if user: options['User'] = user if state: options['State'] = state params = { 'text': text, 'to': lang_to, 'from': lang_from, 'maxTranslations': max_n, 'options': json.dumps(options) } return self.make_request('GetTranslations', params) def break_sentences(self, text, lang): if len(text) > 10000: raise ValueError('The text maximum length is 10000 characters') params = { 'text': text, 'language': lang, } lengths = self.make_request('BreakSentences', params) if isinstance(text, bytes): text = text.decode('utf-8') c = 0 result = [] for i in lengths: result.append(text[c:c+i]) c += i return result def add_translation(self, text_orig, text_trans, lang_from, lang_to, user, rating=1, contenttype='text/plain', category='general', url=None): if len(text_orig) > 1000: raise ValueError('The original text maximum length is 1000 characters') if len(text_trans) > 2000: raise ValueError('The translated text maximum length is 1000 characters') if contenttype not in ('text/plain', 'text/html'): raise ValueError('Invalid contenttype value') if not -10 < rating < 10 or not isinstance(rating, int): raise ValueError('Raiting must be an integer value between -10 and 10') params = { 'originalText': text_orig, 'translatedText': text_trans, 'from': lang_from, 'to': lang_to, 'user': user, 'contentType': contenttype, 'rating': rating, 'category': category, } if url: params['uri'] = url return self.make_request('AddTranslation', params) def get_langs(self, speakable=False): action = 'GetLanguagesForSpeak' if speakable else 'GetLanguagesForTranslate' return self.make_request(action) def get_lang_names(self, langs, lang_to): params = { 'locale': lang_to, 'languageCodes': json.dumps(langs), } return self.make_request('GetLanguageNames', params) def detect_lang(self, text): return self.make_request('Detect', {'text': text}) def detect_langs(self, texts=[]): return self.make_request('DetectArray', {'texts': json.dumps(texts)}) def speak(self, text, lang, format='audio/wav', best_quality=False): if format not in ('audio/wav', 'audio/mp3'): raise ValueError('Invalid format value') params = { 'text': text, 'language': lang, 'format': format, 'options': 'MaxQuality' if best_quality else 'MinSize', } return self.make_request('Speak', params) def speak_to_file(self, file, *args, **kwargs): resp = requests.get(self.speak(*args, **kwargs)) if isinstance(file, basestring): with open(file, 'wb'): file.write(resp.content) elif hasattr(file, 'write'): file.write(resp.content) else: raise ValueError('Expected filepath or a file-like object')
{ "content_hash": "fe45c4b7465d33e0b1dceb985f6912f1", "timestamp": "", "source": "github", "line_count": 230, "max_line_length": 112, "avg_line_length": 34.61739130434783, "alnum_prop": 0.5787490580256217, "repo_name": "wronglink/mstranslator", "id": "5aa20576a2cb4d6e0e51371168468931c0e4a12b", "size": "7986", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "mstranslator.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "12906" } ], "symlink_target": "" }
''' TabbedPanel =========== .. image:: images/tabbed_panel.jpg :align: right .. versionadded:: 1.3.0 .. warning:: This widget is still experimental, and its API is subject to change in a future version. The `TabbedPanel` widget manages different widgets in tabs, with a header area for the actual tab buttons and a content area for showing the current tab content. The :class:`TabbedPanel` provides one default tab. Simple example -------------- .. include:: ../../examples/widgets/tabbedpanel.py :literal: .. note:: A new class :class:`TabbedPanelItem` has been introduced in 1.5.0 for convenience. So now one can simply add a :class:`TabbedPanelItem` to a :class:`TabbedPanel` and `content` to the :class:`TabbedPanelItem` as in the example provided above. Customize the Tabbed Panel -------------------------- You can choose the position in which the tabs are displayed:: tab_pos = 'top_mid' An individual tab is called a TabbedPanelHeader. It is a special button containing a `content` property. You add the TabbedPanelHeader first, and set its `content` property separately:: tp = TabbedPanel() th = TabbedPanelHeader(text='Tab2') tp.add_widget(th) An individual tab, represented by a TabbedPanelHeader, needs its content set. This content can be any widget. It could be a layout with a deep hierarchy of widgets, or it could be an individual widget, such as a label or a button:: th.content = your_content_instance There is one "shared" main content area active at any given time, for all the tabs. Your app is responsible for adding the content of individual tabs and for managing them, but it's not responsible for content switching. The tabbed panel handles switching of the main content object as per user action. .. note:: The default_tab functionality is turned off by default since 1.5.0. To turn it back on, set `do_default_tab` = True. There is a default tab added when the tabbed panel is instantiated. Tabs that you add individually as above, are added in addition to the default tab. Thus, depending on your needs and design, you will want to customize the default tab:: tp.default_tab_text = 'Something Specific To Your Use' The default tab machinery requires special consideration and management. Accordingly, an `on_default_tab` event is provided for associating a callback:: tp.bind(default_tab = my_default_tab_callback) It's important to note that by default, :data:`default_tab_cls` is of type :class:`TabbedPanelHeader` and thus has the same properties as other tabs. Since 1.5.0, it is now possible to disable the creation of the :data:`default_tab` by setting :data:`do_default_tab` to False. Tabs and content can be removed in several ways:: tp.remove_widget(widget/tabbed_panel_header) or tp.clear_widgets() # to clear all the widgets in the content area or tp.clear_tabs() # to remove the TabbedPanelHeaders To access the children of the tabbed panel, use content.children:: tp.content.children To access the list of tabs:: tp.tab_list To change the appearance of the main tabbed panel content:: background_color = (1, 0, 0, .5) #50% translucent red border = [0, 0, 0, 0] background_image = 'path/to/background/image' To change the background of a individual tab, use these two properties:: tab_header_instance.background_normal = 'path/to/tab_head/img' tab_header_instance.background_down = 'path/to/tab_head/img_pressed' A TabbedPanelStrip contains the individual tab headers. To change the appearance of this tab strip, override the canvas of TabbedPanelStrip. For example, in the kv language:: <TabbedPanelStrip> canvas: Color: rgba: (0, 1, 0, 1) # green Rectangle: size: self.size pos: self.pos By default the tabbed panel strip takes its background image and color from the tabbed panel's background_image and background_color. ''' __all__ = ('StripLayout', 'TabbedPanel', 'TabbedPanelContent', 'TabbedPanelHeader','TabbedPanelItem', 'TabbedPanelStrip', 'TabbedPanelException') from functools import partial from kivy.clock import Clock from kivy.uix.togglebutton import ToggleButton from kivy.uix.image import Image from kivy.uix.widget import Widget from kivy.uix.scatter import Scatter from kivy.uix.scrollview import ScrollView from kivy.uix.gridlayout import GridLayout from kivy.uix.floatlayout import FloatLayout from kivy.logger import Logger from kivy.metrics import dp from kivy.properties import ObjectProperty, StringProperty, OptionProperty, \ ListProperty, NumericProperty, AliasProperty, BooleanProperty class TabbedPanelException(Exception): '''The TabbedPanelException class. ''' pass class TabbedPanelHeader(ToggleButton): '''A Base for implementing a Tabbed Panel Head. A button intended to be used as a Heading/Tab for a TabbedPanel widget. You can use this TabbedPanelHeader widget to add a new tab to a TabbedPanel. ''' content = ObjectProperty(None, allownone=True) '''Content to be loaded when this tab header is selected. :data:`content` is an :class:`~kivy.properties.ObjectProperty` and defaults to None. ''' # only allow selecting the tab if not already selected def on_touch_down(self, touch): if self.state == 'down': #dispatch to children, not to self for child in self.children: child.dispatch('on_touch_down', touch) return else: super(TabbedPanelHeader, self).on_touch_down(touch) def on_release(self, *largs): # Tabbed panel header is a child of tab_strib which has a # `tabbed_panel` property if self.parent: self.parent.tabbed_panel.switch_to(self) else: # tab removed before we could switch to it. Switch back to # previous tab self.panel.switch_to(self.panel.current_tab) class TabbedPanelItem(TabbedPanelHeader): '''This is a convenience class that provides a header of type TabbedPanelHeader and links it with the content automatically. Thus facilitating you to simply do the following in kv language:: <TabbedPanel>: ...other settings TabbedPanelItem: BoxLayout: Label: text: 'Second tab content area' Button: text: 'Button that does nothing' .. versionadded:: 1.5.0 ''' def add_widget(self, widget, index=0): self.content = widget if not self.parent: return panel = self.parent.tabbed_panel if panel.current_tab == self: panel.switch_to(self) def remove_widget(self, widget): self.content = None if not self.parent: return panel = self.parent.tabbed_panel if panel.current_tab == self: panel.remove_widget(widget) class TabbedPanelStrip(GridLayout): '''A strip intended to be used as background for Heading/Tab. This does not cover the blank areas in case the tabs don't cover the entire width/height of the TabbedPanel(use StripLayout for that). ''' tabbed_panel = ObjectProperty(None) '''Link to the panel that the tab strip is a part of. :data:`tabbed_panel` is an :class:`~kivy.properties.ObjectProperty` and defaults to None . ''' class StripLayout(GridLayout): ''' The main layout that is used to house the entire tabbedpanel strip including the blank areas in case the tabs don't cover the entire width/height. .. versionadded:: 1.8.0 ''' border = ListProperty([4, 4, 4, 4]) '''Border property for the :data:`background_image`. :data:`border` is a :class:`~kivy.properties.ListProperty` and defaults to [4, 4, 4, 4] ''' background_image = StringProperty( 'atlas://data/images/defaulttheme/action_view') '''Background image to be used for the Strip layout of the TabbedPanel. :data:`background_image` is a :class:`~kivy.properties.StringProperty` and defaults to a transparent image. ''' class TabbedPanelContent(FloatLayout): '''The TabbedPanelContent class. ''' pass class TabbedPanel(GridLayout): '''The TabbedPanel class. See module documentation for more information. ''' background_color = ListProperty([1, 1, 1, 1]) '''Background color, in the format (r, g, b, a). :data:`background_color` is a :class:`~kivy.properties.ListProperty` and defaults to [1, 1, 1, 1]. ''' border = ListProperty([16, 16, 16, 16]) '''Border used for :class:`~kivy.graphics.vertex_instructions.BorderImage` graphics instruction, used itself for :data:`background_image`. Can be changed for a custom background. It must be a list of four values: (top, right, bottom, left). Read the BorderImage instructions for more information. :data:`border` is a :class:`~kivy.properties.ListProperty` and defaults to (16, 16, 16, 16) ''' background_image = StringProperty('atlas://data/images/defaulttheme/tab') '''Background image of the main shared content object. :data:`background_image` is a :class:`~kivy.properties.StringProperty` and defaults to 'atlas://data/images/defaulttheme/tab'. ''' background_disabled_image = StringProperty( 'atlas://data/images/defaulttheme/tab_disabled') '''Background image of the main shared content object when disabled. .. versionadded:: 1.8.0 :data:`background_disabled_image` is a :class:`~kivy.properties.StringProperty` and defaults to 'atlas://data/images/defaulttheme/tab'. ''' strip_image = StringProperty( 'atlas://data/images/defaulttheme/action_view') '''Background image of the tabbed strip. .. versionadded:: 1.8.0 :data:`strip_image` is a :class:`~kivy.properties.StringProperty` and defaults to a empty image. ''' strip_border = ListProperty([4, 4, 4, 4]) '''Border to be used on :data:`strip_image`. .. versionadded:: 1.8.0 :data:`strip_border` is a :class:`~kivy.properties.ListProperty` and defaults to [4, 4, 4, 4]. ''' _current_tab = ObjectProperty(None) def get_current_tab(self): return self._current_tab current_tab = AliasProperty(get_current_tab, None, bind=('_current_tab', )) '''Links to the currently selected or active tab. .. versionadded:: 1.4.0 :data:`current_tab` is an :class:`~kivy.AliasProperty`, read-only. ''' tab_pos = OptionProperty( 'top_left', options=('left_top', 'left_mid', 'left_bottom', 'top_left', 'top_mid', 'top_right', 'right_top', 'right_mid', 'right_bottom', 'bottom_left', 'bottom_mid', 'bottom_right')) '''Specifies the position of the tabs relative to the content. Can be one of: `left_top`, `left_mid`, `left_bottom`, `top_left`, `top_mid`, `top_right`, `right_top`, `right_mid`, `right_bottom`, `bottom_left`, `bottom_mid`, `bottom_right`. :data:`tab_pos` is an :class:`~kivy.properties.OptionProperty` and defaults to 'bottom_mid'. ''' tab_height = NumericProperty('40dp') '''Specifies the height of the tab header. :data:`tab_height` is a :class:`~kivy.properties.NumericProperty` and defaults to 40. ''' tab_width = NumericProperty('100dp', allownone=True) '''Specifies the width of the tab header. :data:`tab_width` is a :class:`~kivy.properties.NumericProperty` and defaults to 100. ''' do_default_tab = BooleanProperty(True) '''Specifies whether a default_tab head is provided. .. versionadded:: 1.5.0 :data:`do_default_tab` is a :class:`~kivy.properties.BooleanProperty` and defaults to 'True'. ''' default_tab_text = StringProperty('Default tab') '''Specifies the text displayed on the default tab header. :data:`default_tab_text` is a :class:`~kivy.properties.StringProperty` and defaults to 'default tab'. ''' default_tab_cls = ObjectProperty(TabbedPanelHeader) '''Specifies the class to use for the styling of the default tab. .. versionadded:: 1.4.0 .. warning:: `default_tab_cls` should be subclassed from `TabbedPanelHeader` :data:`default_tab_cls` is an :class:`~kivy.properties.ObjectProperty` and defaults to `TabbedPanelHeader`. ''' def get_tab_list(self): if self._tab_strip: return self._tab_strip.children return 1. tab_list = AliasProperty(get_tab_list, None) '''List of all the tab headers. :data:`tab_list` is an :class:`~kivy.properties.AliasProperty` and is read-only. ''' content = ObjectProperty(None) '''This is the object holding (current_tab's content is added to this) the content of the current tab. To Listen to the changes in the content of the current tab, you should bind to current_tabs `content` property. :data:`content` is an :class:`~kivy.properties.ObjectProperty` and defaults to 'None'. ''' _default_tab = ObjectProperty(None, allow_none=True) def get_def_tab(self): return self._default_tab def set_def_tab(self, new_tab): if not issubclass(new_tab.__class__, TabbedPanelHeader): raise TabbedPanelException('`default_tab_class` should be\ subclassed from `TabbedPanelHeader`') if self._default_tab == new_tab: return oltab = self._default_tab self._default_tab = new_tab self.remove_widget(oltab) self._original_tab = None self.switch_to(new_tab) new_tab.state = 'down' default_tab = AliasProperty(get_def_tab, set_def_tab, bind=('_default_tab', )) '''Holds the default tab. .. Note:: For convenience, the automatically provided default tab is deleted when you change default_tab to something else. As of 1.5.0, this behaviour has been extended to every `default_tab` for consistency and not just the automatically provided one. :data:`default_tab` is an :class:`~kivy.properties.AliasProperty`. ''' def get_def_tab_content(self): return self.default_tab.content def set_def_tab_content(self, *l): self.default_tab.content = l[0] default_tab_content = AliasProperty(get_def_tab_content, set_def_tab_content) '''Holds the default tab content. :data:`default_tab_content` is an :class:`~kivy.properties.AliasProperty`. ''' def __init__(self, **kwargs): # these variables need to be initialized before the kv lang is # processed setup the base layout for the tabbed panel self._childrens = [] self._tab_layout = StripLayout(rows=1) self.rows = 1 self._tab_strip = TabbedPanelStrip( tabbed_panel=self, rows=1, cols=99, size_hint=(None, None), height=self.tab_height, width=self.tab_width) self._partial_update_scrollview = None self.content = TabbedPanelContent() self._current_tab = self._original_tab \ = self._default_tab = TabbedPanelHeader() super(TabbedPanel, self).__init__(**kwargs) self.bind(size=self._reposition_tabs) if not self.do_default_tab: Clock.schedule_once(self._switch_to_first_tab) return self._setup_default_tab() self.switch_to(self.default_tab) def switch_to(self, header): '''Switch to a specific panel header. ''' header_content = header.content self._current_tab.state = 'normal' header.state = 'down' self._current_tab = header self.clear_widgets() if header_content is None: return # if content has a previous parent remove it from that parent parent = header_content.parent if parent: parent.remove_widget(header_content) self.add_widget(header_content) def clear_tabs(self, *l): self_tabs = self._tab_strip self_tabs.clear_widgets() if self.do_default_tab: self_default_tab = self._default_tab self_tabs.add_widget(self_default_tab) self_tabs.width = self_default_tab.width self._reposition_tabs() def add_widget(self, widget, index=0): content = self.content if content is None: return parent = widget.parent if parent: parent.remove_widget(widget) if widget in (content, self._tab_layout): super(TabbedPanel, self).add_widget(widget, index) elif isinstance(widget, TabbedPanelHeader): self_tabs = self._tab_strip self_tabs.add_widget(widget) widget.group = '__tab%r__' % self_tabs.uid self.on_tab_width() else: widget.pos_hint = {'x': 0, 'top': 1} self._childrens.append(widget) content.disabled = self.current_tab.disabled content.add_widget(widget, index) def remove_widget(self, widget): content = self.content if content is None: return if widget in (content, self._tab_layout): super(TabbedPanel, self).remove_widget(widget) elif isinstance(widget, TabbedPanelHeader): if not (self.do_default_tab and widget is self._default_tab): self_tabs = self._tab_strip self_tabs.width -= widget.width self_tabs.remove_widget(widget) if widget.state == 'down' and self.do_default_tab: self._default_tab.on_release() self._reposition_tabs() else: Logger.info('TabbedPanel: default tab! can\'t be removed.\n' + 'Change `default_tab` to a different tab.') else: self._childrens.pop(widget, None) if widget in content.children: content.remove_widget(widget) def clear_widgets(self, **kwargs): content = self.content if content is None: return if kwargs.get('do_super', False): super(TabbedPanel, self).clear_widgets() else: content.clear_widgets() def on_strip_image(self, instance, value): if not self._tab_layout: return self._tab_layout.background_image = value def on_strip_border(self, instance, value): if not self._tab_layout: return self._tab_layout.border = value def on_do_default_tab(self, instance, value): if not value: dft = self.default_tab if dft in self.tab_list: self.remove_widget(dft) self._switch_to_first_tab() self._default_tab = self._current_tab else: self._current_tab.state = 'normal' self._setup_default_tab() def on_default_tab_text(self, *args): self._default_tab.text = self.default_tab_text def on_tab_width(self, *l): Clock.unschedule(self._update_tab_width) Clock.schedule_once(self._update_tab_width, 0) def on_tab_height(self, *l): self._tab_layout.height = self._tab_strip.height = self.tab_height self._reposition_tabs() def on_tab_pos(self, *l): # ensure canvas self._reposition_tabs() def _setup_default_tab(self): if self._default_tab in self.tab_list: return content = self._default_tab.content _tabs = self._tab_strip cls = self.default_tab_cls if not issubclass(cls, TabbedPanelHeader): raise TabbedPanelException('`default_tab_class` should be\ subclassed from `TabbedPanelHeader`') # no need to instanciate if class is TabbedPanelHeader if cls != TabbedPanelHeader: self._current_tab = self._original_tab = self._default_tab = cls() default_tab = self.default_tab if self._original_tab == self.default_tab: default_tab.text = self.default_tab_text default_tab.height = self.tab_height default_tab.group = '__tab%r__' % _tabs.uid default_tab.state = 'down' default_tab.width = self.tab_width if self.tab_width else 100 default_tab.content = content tl = self.tab_list if default_tab not in tl: _tabs.add_widget(default_tab, len(tl)) if default_tab.content: self.clear_widgets() self.add_widget(self.default_tab.content) else: Clock.schedule_once(self._load_default_tab_content) self._current_tab = default_tab def _switch_to_first_tab(self, *l): ltl = len(self.tab_list) - 1 if ltl > -1: self._current_tab = dt = self._original_tab \ = self.tab_list[ltl] self.switch_to(dt) def _load_default_tab_content(self, dt): if self.default_tab: self.switch_to(self.default_tab) def _reposition_tabs(self, *l): Clock.unschedule(self._update_tabs) Clock.schedule_once(self._update_tabs, 0) def _update_tabs(self, *l): self_content = self.content if not self_content: return # cache variables for faster access tab_pos = self.tab_pos tab_layout = self._tab_layout tab_layout.clear_widgets() scrl_v = ScrollView(size_hint=(None, 1)) tabs = self._tab_strip parent = tabs.parent if parent: parent.remove_widget(tabs) scrl_v.add_widget(tabs) scrl_v.pos = (0, 0) self_update_scrollview = self._update_scrollview # update scrlv width when tab width changes depends on tab_pos if self._partial_update_scrollview is not None: tabs.unbind(width=self._partial_update_scrollview) self._partial_update_scrollview = partial( self_update_scrollview, scrl_v) tabs.bind(width=self._partial_update_scrollview) # remove all widgets from the tab_strip self.clear_widgets(do_super=True) tab_height = self.tab_height widget_list = [] tab_list = [] pos_letter = tab_pos[0] if pos_letter == 'b' or pos_letter == 't': # bottom or top positions # one col containing the tab_strip and the content self.cols = 1 self.rows = 2 # tab_layout contains the scrollview containing tabs and two blank # dummy widgets for spacing tab_layout.rows = 1 tab_layout.cols = 3 tab_layout.size_hint = (1, None) tab_layout.height = tab_height + tab_layout.padding[1] +\ tab_layout.padding[3] + dp(2) self_update_scrollview(scrl_v) if pos_letter == 'b': # bottom if tab_pos == 'bottom_mid': tab_list = (Widget(), scrl_v, Widget()) widget_list = (self_content, tab_layout) else: if tab_pos == 'bottom_left': tab_list = (scrl_v, Widget(), Widget()) elif tab_pos == 'bottom_right': #add two dummy widgets tab_list = (Widget(), Widget(), scrl_v) widget_list = (self_content, tab_layout) else: # top if tab_pos == 'top_mid': tab_list = (Widget(), scrl_v, Widget()) elif tab_pos == 'top_left': tab_list = (scrl_v, Widget(), Widget()) elif tab_pos == 'top_right': tab_list = (Widget(), Widget(), scrl_v) widget_list = (tab_layout, self_content) elif pos_letter == 'l' or pos_letter == 'r': # left ot right positions # one row containing the tab_strip and the content self.cols = 2 self.rows = 1 # tab_layout contains two blank dummy widgets for spacing # "vertically" and the scatter containing scrollview # containing tabs tab_layout.rows = 3 tab_layout.cols = 1 tab_layout.size_hint = (None, 1) tab_layout.width = tab_height scrl_v.height = tab_height self_update_scrollview(scrl_v) # rotate the scatter for vertical positions rotation = 90 if tab_pos[0] == 'l' else -90 sctr = Scatter(do_translation=False, rotation=rotation, do_rotation=False, do_scale=False, size_hint=(None, None), auto_bring_to_front=False, size=scrl_v.size) sctr.add_widget(scrl_v) lentab_pos = len(tab_pos) # Update scatter's top when it's pos changes. # Needed for repositioning scatter to the correct place after its # added to the parent. Use clock_schedule_once to ensure top is # calculated after the parent's pos on canvas has been calculated. # This is needed for when tab_pos changes to correctly position # scatter. Without clock.schedule_once the positions would look # fine but touch won't translate to the correct position if tab_pos[lentab_pos - 4:] == '_top': #on positions 'left_top' and 'right_top' sctr.bind(pos=partial(self._update_top, sctr, 'top', None)) tab_list = (sctr, ) elif tab_pos[lentab_pos - 4:] == '_mid': #calculate top of scatter sctr.bind(pos=partial(self._update_top, sctr, 'mid', scrl_v.width)) tab_list = (Widget(), sctr, Widget()) elif tab_pos[lentab_pos - 7:] == '_bottom': tab_list = (Widget(), Widget(), sctr) if pos_letter == 'l': widget_list = (tab_layout, self_content) else: widget_list = (self_content, tab_layout) # add widgets to tab_layout add = tab_layout.add_widget for widg in tab_list: add(widg) # add widgets to self add = self.add_widget for widg in widget_list: add(widg) def _update_tab_width(self, *l): if self.tab_width: for tab in self.tab_list: tab.size_hint_x = 1 tsw = self.tab_width * len(self._tab_strip.children) else: # tab_width = None tsw = 0 for tab in self.tab_list: if tab.size_hint_x: # size_hint_x: x/.xyz tab.size_hint_x = 1 #drop to default tab_width tsw += 100 else: # size_hint_x: None tsw += tab.width self._tab_strip.width = tsw self._reposition_tabs() def _update_top(self, *args): sctr, top, scrl_v_width, x, y = args Clock.unschedule(partial(self._updt_top, sctr, top, scrl_v_width)) Clock.schedule_once( partial(self._updt_top, sctr, top, scrl_v_width), 0) def _updt_top(self, sctr, top, scrl_v_width, *args): if top[0] == 't': sctr.top = self.top else: sctr.top = self.top - (self.height - scrl_v_width) / 2 def _update_scrollview(self, scrl_v, *l): self_tab_pos = self.tab_pos self_tabs = self._tab_strip if self_tab_pos[0] == 'b' or self_tab_pos[0] == 't': #bottom or top scrl_v.width = min(self.width, self_tabs.width) #required for situations when scrl_v's pos is calculated #when it has no parent scrl_v.top += 1 scrl_v.top -= 1 else: # left or right scrl_v.width = min(self.height, self_tabs.width) self_tabs.pos = (0, 0)
{ "content_hash": "6f338341c17fc54639519468d818fdf9", "timestamp": "", "source": "github", "line_count": 823, "max_line_length": 82, "avg_line_length": 34.72904009720535, "alnum_prop": 0.6006927436848366, "repo_name": "hansent/kivy", "id": "59b0dc9b96e24245595a65d53ae34d7aa1097f5f", "size": "28582", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "kivy/uix/tabbedpanel.py", "mode": "33188", "license": "mit", "language": [ { "name": "C", "bytes": "153750" }, { "name": "CSS", "bytes": "6827" }, { "name": "Emacs Lisp", "bytes": "9603" }, { "name": "F#", "bytes": "289" }, { "name": "JavaScript", "bytes": "11300" }, { "name": "Python", "bytes": "2900209" }, { "name": "Shell", "bytes": "6236" }, { "name": "TeX", "bytes": "4271" }, { "name": "VimL", "bytes": "1123" } ], "symlink_target": "" }
""" Session Handling for SQLAlchemy backend """ from sqlalchemy import create_engine from sqlalchemy import pool from sqlalchemy.orm import sessionmaker from nova import exception from nova import flags FLAGS = flags.FLAGS _ENGINE = None _MAKER = None def get_session(autocommit=True, expire_on_commit=False): """Helper method to grab session""" global _ENGINE global _MAKER if not _MAKER: if not _ENGINE: kwargs = {'pool_recycle': FLAGS.sql_idle_timeout, 'echo': False} if FLAGS.sql_connection.startswith('sqlite'): kwargs['poolclass'] = pool.NullPool _ENGINE = create_engine(FLAGS.sql_connection, **kwargs) _MAKER = (sessionmaker(bind=_ENGINE, autocommit=autocommit, expire_on_commit=expire_on_commit)) session = _MAKER() session.query = exception.wrap_db_error(session.query) session.flush = exception.wrap_db_error(session.flush) return session
{ "content_hash": "1ed2ed60c2ef08894011e6822f18beec", "timestamp": "", "source": "github", "line_count": 38, "max_line_length": 67, "avg_line_length": 28.394736842105264, "alnum_prop": 0.6070435588507878, "repo_name": "superstack/nova", "id": "4a9a28f4300981850a86db30330745b633e480a6", "size": "1855", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "nova/db/sqlalchemy/session.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "JavaScript", "bytes": "47238" }, { "name": "Python", "bytes": "2491049" }, { "name": "Shell", "bytes": "31698" } ], "symlink_target": "" }
"""End-to-end test for the streaming wordcount example with debug.""" # pytype: skip-file import logging import unittest import uuid import pytest from hamcrest.core.core.allof import all_of from apache_beam.examples import streaming_wordcount_debugging from apache_beam.io.gcp.tests.pubsub_matcher import PubSubMessageMatcher from apache_beam.runners.runner import PipelineState from apache_beam.testing import test_utils from apache_beam.testing.pipeline_verifiers import PipelineStateMatcher from apache_beam.testing.test_pipeline import TestPipeline INPUT_TOPIC = 'wc_topic_input' OUTPUT_TOPIC = 'wc_topic_output' INPUT_SUB = 'wc_subscription_input' OUTPUT_SUB = 'wc_subscription_output' SAMPLE_MESSAGES = [ '150', '151', '152', '153', '154', '210', '211', '212', '213', '214' ] EXPECTED_MESSAGE = [ '150: 1', '151: 1', '152: 1', '153: 1', '154: 1', '210: 1', '211: 1', '212: 1', '213: 1', '214: 1' ] WAIT_UNTIL_FINISH_DURATION = 6 * 60 * 1000 # in milliseconds class StreamingWordcountDebuggingIT(unittest.TestCase): def setUp(self): self.test_pipeline = TestPipeline(is_integration_test=True) self.project = self.test_pipeline.get_option('project') self.setup_pubsub() def setup_pubsub(self): self.uuid = str(uuid.uuid4()) # Set up PubSub environment. from google.cloud import pubsub self.pub_client = pubsub.PublisherClient() self.input_topic = self.pub_client.create_topic( name=self.pub_client.topic_path(self.project, INPUT_TOPIC + self.uuid)) self.output_topic = self.pub_client.create_topic( name=self.pub_client.topic_path(self.project, OUTPUT_TOPIC + self.uuid)) self.sub_client = pubsub.SubscriberClient() self.input_sub = self.sub_client.create_subscription( name=self.sub_client.subscription_path( self.project, INPUT_SUB + self.uuid), topic=self.input_topic.name) self.output_sub = self.sub_client.create_subscription( name=self.sub_client.subscription_path( self.project, OUTPUT_SUB + self.uuid), topic=self.output_topic.name, ack_deadline_seconds=60) def _inject_data(self, topic, data): """Inject numbers as test data to PubSub.""" logging.debug('Injecting test data to topic %s', topic.name) for n in data: self.pub_client.publish(self.input_topic.name, str(n).encode('utf-8')) def tearDown(self): test_utils.cleanup_subscriptions( self.sub_client, [self.input_sub, self.output_sub]) test_utils.cleanup_topics( self.pub_client, [self.input_topic, self.output_topic]) @pytest.mark.it_postcommit @unittest.skip( "Skipped due to [BEAM-3377]: assert_that not working for streaming") def test_streaming_wordcount_debugging_it(self): # Set extra options to the pipeline for test purpose state_verifier = PipelineStateMatcher(PipelineState.RUNNING) pubsub_msg_verifier = PubSubMessageMatcher( self.project, self.output_sub.name, EXPECTED_MESSAGE, timeout=400) extra_opts = { 'input_subscription': self.input_sub.name, 'output_topic': self.output_topic.name, 'wait_until_finish_duration': WAIT_UNTIL_FINISH_DURATION, 'on_success_matcher': all_of(state_verifier, pubsub_msg_verifier) } # Generate input data and inject to PubSub. self._inject_data(self.input_topic, SAMPLE_MESSAGES) # Get pipeline options from command argument: --test-pipeline-options, # and start pipeline job by calling pipeline main function. streaming_wordcount_debugging.run( self.test_pipeline.get_full_options_as_args(**extra_opts), save_main_session=False) if __name__ == '__main__': logging.getLogger().setLevel(logging.INFO) unittest.main()
{ "content_hash": "4d305ea734b21e8d8367293d6e15088d", "timestamp": "", "source": "github", "line_count": 110, "max_line_length": 80, "avg_line_length": 34.41818181818182, "alnum_prop": 0.6925515055467512, "repo_name": "robertwb/incubator-beam", "id": "b0c041c05ca0cbb6565c4296f7971ad4e6d7d1ef", "size": "4571", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "sdks/python/apache_beam/examples/streaming_wordcount_debugging_it_test.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "ANTLR", "bytes": "1598" }, { "name": "C", "bytes": "3869" }, { "name": "CSS", "bytes": "4957" }, { "name": "Cython", "bytes": "59582" }, { "name": "Dart", "bytes": "541526" }, { "name": "Dockerfile", "bytes": "48191" }, { "name": "FreeMarker", "bytes": "7933" }, { "name": "Go", "bytes": "4688736" }, { "name": "Groovy", "bytes": "888171" }, { "name": "HCL", "bytes": "101646" }, { "name": "HTML", "bytes": "164685" }, { "name": "Java", "bytes": "38649211" }, { "name": "JavaScript", "bytes": "105966" }, { "name": "Jupyter Notebook", "bytes": "55818" }, { "name": "Kotlin", "bytes": "209531" }, { "name": "Lua", "bytes": "3620" }, { "name": "Python", "bytes": "9785295" }, { "name": "SCSS", "bytes": "312814" }, { "name": "Sass", "bytes": "19336" }, { "name": "Scala", "bytes": "1429" }, { "name": "Shell", "bytes": "336583" }, { "name": "Smarty", "bytes": "2618" }, { "name": "Thrift", "bytes": "3260" }, { "name": "TypeScript", "bytes": "181369" } ], "symlink_target": "" }
from django.forms.fields import BooleanField from django.test.client import RequestFactory from django.utils.safestring import SafeText from django.utils.translation import ugettext_lazy as _ import mock from nose.tools import eq_, ok_ import mkt import mkt.site.tests from mkt.comm.models import CommunicationNote from mkt.constants.features import APP_FEATURES from mkt.developers.models import AppLog from mkt.files.models import FileUpload from mkt.reviewers.models import RereviewQueue from mkt.site.fixtures import fixture from mkt.site.tests import user_factory from mkt.submit import forms from mkt.users.models import UserProfile from mkt.webapps.models import AppFeatures, Webapp class TestNewWebappForm(mkt.site.tests.TestCase): def setUp(self): self.request = RequestFactory().get('/') self.request.user = user_factory() self.file = FileUpload.objects.create(valid=True) self.file.user = self.request.user self.file.save() def test_no_user(self): self.file.user = None self.file.save() form = forms.NewWebappForm({'free_platforms': ['free-firefoxos'], 'upload': self.file.uuid}, request=self.request) assert not form.is_valid() eq_(form.ERRORS['user'], form.errors['upload']) def test_correct_user(self): form = forms.NewWebappForm({'free_platforms': ['free-firefoxos'], 'upload': self.file.uuid}, request=self.request) assert form.is_valid(), form.errors def test_incorrect_user(self): self.file.user = user_factory() self.file.save() form = forms.NewWebappForm({'upload': self.file.uuid}, request=self.request) assert not form.is_valid() eq_(form.ERRORS['user'], form.errors['upload']) def test_not_packaged(self): form = forms.NewWebappForm({'free_platforms': ['free-firefoxos'], 'upload': self.file.uuid}) assert form.is_valid(), form.errors assert not form.is_packaged() @mock.patch('mkt.submit.forms.parse_addon', lambda *args: {'version': None}) def test_packaged_allowed_everywhere(self): for device in ('free-firefoxos', 'free-desktop', 'free-android-tablet', 'free-android-mobile'): form = forms.NewWebappForm({'free_platforms': [device], 'upload': self.file.uuid, 'packaged': True}, request=self.request) assert form.is_valid(), form.errors assert form.is_packaged() class TestNewWebappVersionForm(mkt.site.tests.TestCase): def setUp(self): self.request = RequestFactory().get('/') self.file = FileUpload.objects.create(valid=True) def test_no_upload(self): form = forms.NewWebappVersionForm(request=self.request, is_packaged=True) assert not form.is_valid(), form.errors @mock.patch('mkt.submit.forms.parse_addon', lambda *args: {"origin": "app://hy.fr"}) @mock.patch('mkt.submit.forms.verify_app_domain') def test_verify_app_domain_called(self, _verify): self.create_switch('webapps-unique-by-domain') form = forms.NewWebappVersionForm({'upload': self.file.uuid}, request=self.request, is_packaged=True) assert form.is_valid(), form.errors assert _verify.called @mock.patch('mkt.submit.forms.parse_addon', lambda *args: {"origin": "app://hy.fr"}) def test_verify_app_domain_exclude_same(self): app = mkt.site.tests.app_factory(app_domain='app://hy.fr') form = forms.NewWebappVersionForm( {'upload': self.file.uuid}, request=self.request, is_packaged=True, addon=app) assert form.is_valid(), form.errors @mock.patch('mkt.submit.forms.parse_addon', lambda *args: {"origin": "app://hy.fr"}) def test_verify_app_domain_exclude_different(self): app = mkt.site.tests.app_factory(app_domain='app://yo.lo') mkt.site.tests.app_factory(app_domain='app://hy.fr') form = forms.NewWebappVersionForm( {'upload': self.file.uuid}, request=self.request, is_packaged=True, addon=app) assert not form.is_valid(), form.errors assert ('An app already exists on this domain; ' 'only one app per domain is allowed.' in form.errors['upload']) class TestAppDetailsBasicForm(mkt.site.tests.TestCase): fixtures = fixture('user_999', 'webapp_337141') def setUp(self): self.request = mock.Mock() self.request.user = UserProfile.objects.get(id=999) self.request.groups = () def get_app(self): return Webapp.objects.get(pk=337141) def get_data(self, **kwargs): default = { 'app_slug': 'thisIsAslug', 'description': '...', 'privacy_policy': '...', 'support_email': '[email protected]', 'notes': '', 'publish_type': mkt.PUBLISH_IMMEDIATE, } default.update(kwargs) return default def test_slug(self): app = self.get_app() form = forms.AppDetailsBasicForm(self.get_data(), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() eq_(app.app_slug, 'thisisaslug') def test_comm_thread(self): app = self.get_app() note_body = 'please approve this app' form = forms.AppDetailsBasicForm(self.get_data(notes=note_body), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() notes = CommunicationNote.objects.all() eq_(notes.count(), 1) eq_(notes[0].body, note_body) def test_publish_type(self): app = self.get_app() form = forms.AppDetailsBasicForm( self.get_data(publish_type=mkt.PUBLISH_PRIVATE), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() eq_(app.publish_type, mkt.PUBLISH_PRIVATE) def test_help_text_uses_safetext_and_includes_url(self): app = self.get_app() form = forms.AppDetailsBasicForm( self.get_data(publish_type=mkt.PUBLISH_PRIVATE), request=self.request, instance=app) help_text = form.base_fields['privacy_policy'].help_text eq_(type(help_text), SafeText) ok_('{url}' not in help_text) ok_(form.PRIVACY_MDN_URL in help_text) def test_is_offline_guess_false(self): app = self.get_app() app.guess_is_offline = lambda: False assert not app.is_offline forms.AppDetailsBasicForm( self.get_data(), request=self.request, instance=app) assert not app.is_offline def test_is_offline_guess_false_override(self): app = self.get_app() app.guess_is_offline = lambda: False form = forms.AppDetailsBasicForm( self.get_data(is_offline=True), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() eq_(app.is_offline, True) def test_is_offline_guess_true(self): app = self.get_app() app.guess_is_offline = lambda: True assert not app.is_offline forms.AppDetailsBasicForm( self.get_data(is_offline=None), request=self.request, instance=app) assert app.is_offline def test_is_offline_guess_true_override(self): app = self.get_app() app.guess_is_offline = lambda: True form = forms.AppDetailsBasicForm( self.get_data(is_offline=False), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() eq_(app.is_offline, False) def test_tags(self): app = self.get_app() form = forms.AppDetailsBasicForm( self.get_data(tags='card games, poker'), request=self.request, instance=app) assert form.is_valid(), form.errors form.save() eq_(app.tags.count(), 2) self.assertSetEqual( app.tags.values_list('tag_text', flat=True), ['card games', 'poker']) class TestAppFeaturesForm(mkt.site.tests.TestCase): fixtures = fixture('user_999', 'webapp_337141') def setUp(self): mkt.set_user(UserProfile.objects.all()[0]) self.form = forms.AppFeaturesForm() self.app = Webapp.objects.get(pk=337141) self.features = self.app.current_version.features def _check_log(self, action): assert AppLog.objects.filter( addon=self.app, activity_log__action=action.id).exists(), ( "Didn't find `%s` action in logs." % action.short) def test_required(self): f_names = self.form.fields.keys() for value in (True, False): form = forms.AppFeaturesForm(dict((n, value) for n in f_names)) eq_(form.is_valid(), True, form.errors) def test_correct_fields(self): fields = self.form.fields f_values = fields.values() assert 'version' not in fields assert all(isinstance(f, BooleanField) for f in f_values) self.assertSetEqual(fields, AppFeatures()._fields()) def test_required_api_fields(self): fields = [f.help_text for f in self.form.required_api_fields()] eq_(fields, sorted(f['name'] for f in APP_FEATURES.values())) def test_required_api_fields_nonascii(self): forms.AppFeaturesForm.base_fields['has_apps'].help_text = _( u'H\xe9llo') fields = [f.help_text for f in self.form.required_api_fields()] eq_(fields, sorted(f['name'] for f in APP_FEATURES.values())) def test_changes_mark_for_rereview(self): self.features.update(has_sms=True) data = {'has_apps': True} self.form = forms.AppFeaturesForm(instance=self.features, data=data) self.form.save() ok_(self.features.has_apps) ok_(not self.features.has_sms) ok_(not self.features.has_contacts) action_id = mkt.LOG.REREVIEW_FEATURES_CHANGED.id assert AppLog.objects.filter(addon=self.app, activity_log__action=action_id).exists() eq_(RereviewQueue.objects.count(), 1) def test_no_changes_not_marked_for_rereview(self): self.features.update(has_sms=True) data = {'has_sms': True} self.form = forms.AppFeaturesForm(instance=self.features, data=data) self.form.save() ok_(not self.features.has_apps) ok_(self.features.has_sms) eq_(RereviewQueue.objects.count(), 0) action_id = mkt.LOG.REREVIEW_FEATURES_CHANGED.id assert not AppLog.objects.filter( addon=self.app, activity_log__action=action_id).exists() def test_changes_mark_for_rereview_bypass(self): self.features.update(has_sms=True) data = {'has_apps': True} self.form = forms.AppFeaturesForm(instance=self.features, data=data) self.form.save(mark_for_rereview=False) ok_(self.features.has_apps) ok_(not self.features.has_sms) eq_(RereviewQueue.objects.count(), 0) action_id = mkt.LOG.REREVIEW_FEATURES_CHANGED.id assert not AppLog.objects.filter( addon=self.app, activity_log__action=action_id).exists()
{ "content_hash": "f887514f2501607a717c5685f0f7f763", "timestamp": "", "source": "github", "line_count": 311, "max_line_length": 79, "avg_line_length": 38.47909967845659, "alnum_prop": 0.5912091585192613, "repo_name": "jasonthomas/zamboni", "id": "d1e5824a066af97cf6a7356cc042282548b74888", "size": "11967", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "mkt/submit/tests/test_forms.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "CSS", "bytes": "354193" }, { "name": "HTML", "bytes": "2313765" }, { "name": "JavaScript", "bytes": "529996" }, { "name": "Makefile", "bytes": "4281" }, { "name": "Python", "bytes": "4386929" }, { "name": "Shell", "bytes": "10771" }, { "name": "Smarty", "bytes": "1086" } ], "symlink_target": "" }
import pyjd from pyjamas.ui.RootPanel import RootPanel from pyjamas import DOM from pyjamas.ui.Anchor import Anchor from pyjamas.ui.Hyperlink import Hyperlink from pyjamas import Window from pyjamas.ui.HTML import HTML from pyjamas.ui.HTMLPanel import HTMLPanel from pyjamas.ui.Label import Label from pyjamas.ui.Image import Image from pyjamas.ui.HorizontalPanel import HorizontalPanel def onClick(sender): Window.alert('Make service request using %s'%sender.getID()) if __name__ == '__main__': pyjd.setup("public/Anchor.html") # EXAMPLE 1 a1 = Anchor(Widget = HTML('Test 1: Anchor to external site using HTML widget.'), Href='http://pyjs.org', Title = 'Test1') RootPanel().add(a1) # EXAMPLE 2 label = Label(text = 'Test 2: Click listener added to a label.') label.addClickListener(onClick) RootPanel().add(label) # EXAMPLE 3 a2 = Hyperlink(text = 'Hyperlink', Element = DOM.createSpan()) a2.setID('param1') a2.addClickListener(onClick) html2=HTMLPanel("Test 3: <span id ='t3'></span> added to HTMLPanel with click listener.") html2.add(a2, "t3") RootPanel().add(html2) # EXAMPLE 4 hpanel = HorizontalPanel() hpanel.append(HTML('Test 4: Anchor to external site using Image widget')) a3 = Anchor(Widget = Image('http://pyjs.org/assets/images/pyjs.128x128.png'), Href='http://pyjs.org', Title = 'Test4') hpanel.append(a3) RootPanel().add(hpanel) # EXAMPLE 5 serverXml = \ """ <html> <head> <title>Example 5</title> </head> <body> <p>Test 5: Processes server html and insert click listeners into links: <span id='link1' class = 'wikilink'>link 1</span> and <span id='link2' class = 'wikilink'>link 2</span>. </p> </body> </html> """ html3 = HTMLPanel(serverXml) links = list() for elem in html3.findTags('span'): if DOM.getElemAttribute(elem, 'class') == 'wikilink': linkClass = DOM.getElemAttribute(elem, 'class') links.append(elem) if len(links) > 0: parent = DOM.getParent(links[0]) for link in links: linkId = DOM.getElemAttribute(link, 'id') linkClass = DOM.getElemAttribute(link, 'class') linkInner = DOM.getInnerHTML(link) a3 = Hyperlink(text = linkInner, Element = DOM.createSpan()) a3.addClickListener(onClick) a3.setID('param2') #todo: modify HTMLPanel to replace an element instead of add #html3.replace(a3, linkId) DOM.setInnerHTML(link, '') # clear existing text html3.add(a3, linkId) RootPanel().add(html3) pyjd.run()
{ "content_hash": "ddc1055ab06fba83b1c1626e4aa32f84", "timestamp": "", "source": "github", "line_count": 73, "max_line_length": 125, "avg_line_length": 36.465753424657535, "alnum_prop": 0.6450037565740045, "repo_name": "pombredanne/pyjs", "id": "e96303a0201aed63324cd4c0e2e4b539ebf08199", "size": "2662", "binary": false, "copies": "6", "ref": "refs/heads/master", "path": "examples/anchor/Anchor.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "4640" }, { "name": "Groff", "bytes": "6633" }, { "name": "HTML", "bytes": "10106" }, { "name": "JavaScript", "bytes": "63385" }, { "name": "Makefile", "bytes": "453" }, { "name": "Python", "bytes": "5515375" }, { "name": "Shell", "bytes": "4264" } ], "symlink_target": "" }
""" We need this module when storing files in S3 as the S3BotoStorage backend always uses the bucket name as the root by default, but we don't want to create two separate buckets for static and media files. We basically want: /bucket-name/media/ for media files /bucket-name/static/ for static files Source: http://stackoverflow.com/questions/10390244/how-to-set-up-a-django-\ project-with-django-storages-and-amazon-s3-but-with-diff """ from django.conf import settings from storages.backends.s3boto import S3BotoStorage MediaRootS3BotoStorage = lambda: S3BotoStorage( location=settings.MEDIA_ROOT, file_overwrite=False ) StaticRootS3BotoStorage = lambda: S3BotoStorage( location=settings.STATIC_ROOT )
{ "content_hash": "23884dc2a423b7711a9802466c04a42a", "timestamp": "", "source": "github", "line_count": 26, "max_line_length": 79, "avg_line_length": 28.384615384615383, "alnum_prop": 0.7696476964769647, "repo_name": "jcalazan/glucose-tracker", "id": "ccac8b2538ad3e16392d337e1a849894ed9b72b6", "size": "738", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "glucosetracker/core/s3utils.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "52335" }, { "name": "HTML", "bytes": "1674117" }, { "name": "JavaScript", "bytes": "349783" }, { "name": "PHP", "bytes": "1684" }, { "name": "Python", "bytes": "208166" }, { "name": "Ruby", "bytes": "1056" }, { "name": "Shell", "bytes": "3145" } ], "symlink_target": "" }
import os import logging import urllib.request DOWNDIR = os.path.join(os.path.dirname(__file__), 'downloadedpapers') URL = { 'bg-8-515-2011.pdf': 'https://www.biogeosciences.net/8/515/2011/bg-8-515-2011.pdf', 'esd-4-11-2013.pdf': 'https://www.earth-syst-dynam.net/4/11/2013/esd-4-11-2013.pdf', 'esd-4-11-2013-supplement.pdf': 'https://www.earth-syst-dynam.net/4/11/2013/esd-4-11-2013-supplement.pdf', } def _downloadpdf(url, filename, overwrite=False): if os.path.exists(filename) and not overwrite: logging.info(filename+' already present') return direc = os.path.dirname(filename) if direc and not os.path.exists(direc): os.makedirs(direc) print('download',url,'to',filename) response = urllib.request.urlopen(url) resp = response.read() with open(filename, 'wb') as f: f.write(resp) def downloadpdf(pdf): fname = os.path.join(DOWNDIR, pdf) url = URL[pdf] _downloadpdf(url, fname) return fname def downloadall(): for pdf in URL: downloadpdf(pdf) if __name__ == '__main__': downloadall()
{ "content_hash": "46acdaf8204c818585ee25749cde833c", "timestamp": "", "source": "github", "line_count": 47, "max_line_length": 110, "avg_line_length": 23.595744680851062, "alnum_prop": 0.648331830477908, "repo_name": "perrette/myref", "id": "86b60ff9c97f9c8e1ca2ca34680bf9750dc503b0", "size": "1128", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "tests/download.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "314500" } ], "symlink_target": "" }
"""Functionality for inspecting jax tracers.""" from .. import errors import jax def current_trace(): """Returns the innermost Jax tracer.""" return jax.core.find_top_trace(()) def trace_level(main): """Returns the level of the trace of -infinity if it is None.""" if main: return main.level return float('-inf') def check_trace_level(base_level): level = trace_level(current_trace()) if level != base_level: raise errors.JaxTransformError()
{ "content_hash": "3907f3f163ff1c3c937d57a9f2fa3ed5", "timestamp": "", "source": "github", "line_count": 22, "max_line_length": 66, "avg_line_length": 21.40909090909091, "alnum_prop": 0.6878980891719745, "repo_name": "google/flax", "id": "db35e43e27f62b1ae8e753c01611da0f7b489eac", "size": "1053", "binary": false, "copies": "1", "ref": "refs/heads/main", "path": "flax/core/tracers.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Dockerfile", "bytes": "2643" }, { "name": "Jupyter Notebook", "bytes": "12612" }, { "name": "Python", "bytes": "956526" }, { "name": "Shell", "bytes": "3995" } ], "symlink_target": "" }
import supriya def test_unaggregated_anonymous(server): with supriya.SynthDefBuilder(frequency=440) as builder: source = supriya.ugens.SinOsc.ar(frequency=builder["frequency"]) supriya.ugens.Out.ar(bus=0, source=source) synthdef = builder.build() assert synthdef not in server with server.osc_io.capture() as transcript: synthdef.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(5, synthdef.compile()) ] with server.osc_io.capture() as transcript: synthdef.free() assert synthdef not in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(53, synthdef.anonymous_name) ] def test_unaggregated_named(server): with supriya.SynthDefBuilder(frequency=440) as builder: source = supriya.ugens.SinOsc.ar(frequency=builder["frequency"]) supriya.ugens.Out.ar(bus=0, source=source) synthdef = builder.build(name="test-synthdef") assert synthdef not in server with server.osc_io.capture() as transcript: synthdef.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(5, synthdef.compile()) ] with server.osc_io.capture() as transcript: synthdef.free() assert synthdef not in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(53, synthdef.name) ] def test_aggregated_anonymous(server): with supriya.SynthDefBuilder(frequency=440) as builder: source = supriya.ugens.SinOsc.ar(frequency=builder["frequency"]) supriya.ugens.Out.ar(bus=0, source=source) synthdef = builder.build() assert synthdef not in server synth_a = supriya.Synth(synthdef=synthdef, frequency=666) synth_b = supriya.Synth(synthdef=synthdef, frequency=777) synth_c = supriya.Synth(synthdef=synthdef, frequency=888) # allocate synthdef on node allocation with server.osc_io.capture() as transcript: synth_a.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage( 5, synthdef.compile(), supriya.osc.OscMessage( 9, synthdef.anonymous_name, 1000, 0, 1, "frequency", 666.0 ), ) ] # don't need to re-allocate with server.osc_io.capture() as transcript: synth_b.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage( 9, synthdef.anonymous_name, 1001, 0, 1, "frequency", 777.0 ) ] # just free the synthdef with server.osc_io.capture() as transcript: synthdef.free() assert synthdef not in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(53, synthdef.anonymous_name) ] # allocate synthdef (again)n on node allocation with server.osc_io.capture() as transcript: synth_c.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage( 5, synthdef.compile(), supriya.osc.OscMessage( 9, synthdef.anonymous_name, 1002, 0, 1, "frequency", 888.0 ), ) ] def test_aggregated_named(server): with supriya.SynthDefBuilder(frequency=440) as builder: source = supriya.ugens.SinOsc.ar(frequency=builder["frequency"]) supriya.ugens.Out.ar(bus=0, source=source) synthdef = builder.build(name="test-synthdef") assert synthdef not in server synth_a = supriya.Synth(synthdef=synthdef, frequency=666) synth_b = supriya.Synth(synthdef=synthdef, frequency=777) synth_c = supriya.Synth(synthdef=synthdef, frequency=888) # allocate synthdef on node allocation with server.osc_io.capture() as transcript: synth_a.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage( 5, synthdef.compile(), supriya.osc.OscMessage(9, synthdef.name, 1000, 0, 1, "frequency", 666.0), ) ] # don't need to re-allocate with server.osc_io.capture() as transcript: synth_b.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(9, synthdef.name, 1001, 0, 1, "frequency", 777.0) ] # just free the synthdef with server.osc_io.capture() as transcript: synthdef.free() assert synthdef not in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage(53, synthdef.name) ] # allocate synthdef (again)n on node allocation with server.osc_io.capture() as transcript: synth_c.allocate(server=server) assert synthdef in server assert [message for timestamp, message in transcript.sent_messages] == [ supriya.osc.OscMessage( 5, synthdef.compile(), supriya.osc.OscMessage(9, synthdef.name, 1002, 0, 1, "frequency", 888.0), ) ]
{ "content_hash": "02d025b606022b3a85eae478e941faf3", "timestamp": "", "source": "github", "line_count": 151, "max_line_length": 85, "avg_line_length": 36.90728476821192, "alnum_prop": 0.6624798133859681, "repo_name": "Pulgama/supriya", "id": "ef3ee57528ac71b4d611ab36d01ae74f83483b6c", "size": "5573", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "tests/test_synthdefs_SynthDef_lifecycle.py", "mode": "33188", "license": "mit", "language": [ { "name": "Batchfile", "bytes": "6712" }, { "name": "CSS", "bytes": "446" }, { "name": "HTML", "bytes": "1083" }, { "name": "JavaScript", "bytes": "6163" }, { "name": "Makefile", "bytes": "6775" }, { "name": "Python", "bytes": "2790612" }, { "name": "Shell", "bytes": "569" } ], "symlink_target": "" }
""" Wrapper to be used to apply a fixed delay to any `ChannelModel` by modifying the 'cm-delay' annotation. Revision Info ============= * $LastChangedBy: mandke $ * $LastChangedDate: 2011-09-06 16:44:24 -0500 (Tue, 06 Sep 2011) $ * $LastChangedRevision: 5121 $ :author: Ketan Mandke <[email protected]> :copyright: Copyright 2009 The University of Texas at Austin Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ __docformat__ = "restructuredtext en" from wins.channel.channelbase import ChannelModel from wins.packet import ANNO def _apply_fixed_delay(cm, *args, **kwargs): """Internal method to implement `FixedDelay` `ChannelModel` wrapper.""" assert isinstance(cm, ChannelModel) assert hasattr(cm, '__subclass__') assert hasattr(cm, '__fixed_delay__') subclass = cm.__subclass__ delay = cm.__fixed_delay__ r = subclass.apply(cm, *args, **kwargs) if ANNO.supports(r, 'cm-delay'): r.delanno('cm-delay') if ANNO.supported(r) and (delay>0): r.setanno('cm-delay', delay) return r def FixedDelay(model, delay=0): """Create a new `ChannelModel` with overloaded `ChannelModel.apply()` method to modify 'cm-delay' annotation. :param model: `ChannelModel` class. :param delay: Fixed delay value [default = 0]. """ assert issubclass(model, ChannelModel) clsname = model.__name__ newname = "_FixedDelay_%s"%(clsname) tracename = "D%s"%(model.tracename) createclass = "class %s(model):\n\tpass"%(newname) exec(createclass) globals()[newname] = eval(newname) exec("%s.__subclass__ = model"%(newname) ) exec("%s.apply = _apply_fixed_delay"%(newname) ) exec("%s.__fixed_delay__ = delay"%(newname) ) return eval(newname)
{ "content_hash": "b96e44a0ea1212a329c36abeaaa5fc7e", "timestamp": "", "source": "github", "line_count": 64, "max_line_length": 80, "avg_line_length": 35.3125, "alnum_prop": 0.6783185840707965, "repo_name": "reidlindsay/wins", "id": "7b0fd3c148eca7494202d051bda664e35da31c43", "size": "2285", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "wins/channel/fixdelay.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "C", "bytes": "5653" }, { "name": "C++", "bytes": "51883" }, { "name": "Makefile", "bytes": "2270" }, { "name": "Python", "bytes": "1193050" }, { "name": "Shell", "bytes": "665341" } ], "symlink_target": "" }
""" Settings for the text item. """ from django.conf import settings # Allow the "cross site" feature in shared content: FLUENT_SHARED_CONTENT_ENABLE_CROSS_SITE = getattr(settings, "FLUENT_SHARED_CONTENT_ENABLE_CROSS_SITE", True)
{ "content_hash": "b1f69fc46d9154d19d6fc1ee3fdbb118", "timestamp": "", "source": "github", "line_count": 7, "max_line_length": 108, "avg_line_length": 33, "alnum_prop": 0.7619047619047619, "repo_name": "ixc/django-fluent-contents", "id": "f1ddcd34c71f1f4535739192760fd2d30f8075ab", "size": "231", "binary": false, "copies": "2", "ref": "refs/heads/ixc", "path": "fluent_contents/plugins/sharedcontent/appsettings.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "13003" }, { "name": "HTML", "bytes": "33138" }, { "name": "JavaScript", "bytes": "81000" }, { "name": "Python", "bytes": "449106" } ], "symlink_target": "" }
{% extends "cmd_target_tmpl.py" %}
{ "content_hash": "78d211623f84d77eaab130b9fe515a25", "timestamp": "", "source": "github", "line_count": 1, "max_line_length": 34, "avg_line_length": 35, "alnum_prop": 0.6285714285714286, "repo_name": "grbd/GBD.Build.BlackJack", "id": "32947778e1bedbb7b9d9557d6412309d86b9b08f", "size": "35", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "generator/templates/cmds/add_executable.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "248002" }, { "name": "Visual Basic", "bytes": "46489" } ], "symlink_target": "" }
"""`Dependency` provider example.""" import abc import dataclasses from dependency_injector import containers, providers class DbAdapter(metaclass=abc.ABCMeta): ... class SqliteDbAdapter(DbAdapter): ... class PostgresDbAdapter(DbAdapter): ... @dataclasses.dataclass class UserService: database: DbAdapter class Container(containers.DeclarativeContainer): database = providers.Dependency(instance_of=DbAdapter) user_service = providers.Factory( UserService, database=database, ) if __name__ == "__main__": container1 = Container(database=providers.Singleton(SqliteDbAdapter)) container2 = Container(database=providers.Singleton(PostgresDbAdapter)) assert isinstance(container1.user_service().database, SqliteDbAdapter) assert isinstance(container2.user_service().database, PostgresDbAdapter) container3 = Container(database=providers.Singleton(object)) container3.user_service() # <-- raises error: # <object ...> is not an instance of DbAdapter
{ "content_hash": "fd28761337b113170ed6853f493fe194", "timestamp": "", "source": "github", "line_count": 45, "max_line_length": 76, "avg_line_length": 23.022222222222222, "alnum_prop": 0.7306949806949807, "repo_name": "ets-labs/dependency_injector", "id": "e53b6dc4705eb4fa3536a773f283e9f7ad317dd1", "size": "1036", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "examples/providers/dependency.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Python", "bytes": "171148" } ], "symlink_target": "" }
""" ORCID Member No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) # noqa: E501 OpenAPI spec version: Latest Generated by: https://github.com/swagger-api/swagger-codegen.git """ import pprint import re # noqa: F401 import six class PreferencesV30(object): """NOTE: This class is auto generated by the swagger code generator program. Do not edit the class manually. """ """ Attributes: swagger_types (dict): The key is attribute name and the value is attribute type. attribute_map (dict): The key is attribute name and the value is json key in definition. """ swagger_types = { 'locale': 'str' } attribute_map = { 'locale': 'locale' } def __init__(self, locale=None): # noqa: E501 """PreferencesV30 - a model defined in Swagger""" # noqa: E501 self._locale = None self.discriminator = None if locale is not None: self.locale = locale @property def locale(self): """Gets the locale of this PreferencesV30. # noqa: E501 :return: The locale of this PreferencesV30. # noqa: E501 :rtype: str """ return self._locale @locale.setter def locale(self, locale): """Sets the locale of this PreferencesV30. :param locale: The locale of this PreferencesV30. # noqa: E501 :type: str """ allowed_values = ["AR", "CS", "DE", "EN", "ES", "FR", "IT", "JA", "KO", "PT", "RU", "ZH_CN", "ZH_TW", "XX"] # noqa: E501 if locale not in allowed_values: raise ValueError( "Invalid value for `locale` ({0}), must be one of {1}" # noqa: E501 .format(locale, allowed_values) ) self._locale = locale def to_dict(self): """Returns the model properties as a dict""" result = {} for attr, _ in six.iteritems(self.swagger_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value if issubclass(PreferencesV30, dict): for key, value in self.items(): result[key] = value return result def to_str(self): """Returns the string representation of the model""" return pprint.pformat(self.to_dict()) def __repr__(self): """For `print` and `pprint`""" return self.to_str() def __eq__(self, other): """Returns true if both objects are equal""" if not isinstance(other, PreferencesV30): return False return self.__dict__ == other.__dict__ def __ne__(self, other): """Returns true if both objects are not equal""" return not self == other
{ "content_hash": "f70b01e7457158c7de13b1c9d5051061", "timestamp": "", "source": "github", "line_count": 115, "max_line_length": 129, "avg_line_length": 29.617391304347827, "alnum_prop": 0.5325895478567234, "repo_name": "Royal-Society-of-New-Zealand/NZ-ORCID-Hub", "id": "af813807c3d7eec02b7f204c84dd9e8a67fbe078", "size": "3423", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "orcid_api_v3/models/preferences_v30.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "20266" }, { "name": "Dockerfile", "bytes": "3303" }, { "name": "HTML", "bytes": "239338" }, { "name": "JavaScript", "bytes": "2240" }, { "name": "Makefile", "bytes": "600" }, { "name": "PLpgSQL", "bytes": "2581" }, { "name": "Python", "bytes": "7935510" }, { "name": "Shell", "bytes": "12088" } ], "symlink_target": "" }
""" This is a simple example where I(Q,E) data is already in the form of a histogram, reduced from the raw experimental data. All this script does is to convert I(Q,E) to Density of States by performing multiphonon correction. """ import histogram.hdf as hh, os, numpy as np # when the system is headless, do not plot headless = 'DISPLAY' not in os.environ or not os.environ['DISPLAY'] if not headless: from matplotlib import pyplot as plt # change into "examples" dir here = os.path.dirname(__file__) or os.curdir os.chdir(here) # load I(Q,E) data iqehist = hh.load("data/Al-iqe.h5") # interpolate I(Q, E) data so that the energy axis has "zero" as a bin center from multiphonon.sqe import interp newiqe = interp(iqehist, newE = np.arange(-40, 70, 1.)) # save interpolated data just in case we need it later hh.dump(newiqe, 'data/Al-iqe-interped.h5') # create processing engine with processing parameters from multiphonon.backward import sqe2dos workdir = 'work-Al' iterdos = sqe2dos.sqe2dos( newiqe, T=300, Ecutoff=50., elastic_E_cutoff=(-10., 7), M=26.98, C_ms=0.2, Ei=80., workdir=workdir) # process for i, dos in enumerate(iterdos): print("* Iteration", i) if not headless: plt.plot(dos.E, dos.I, label='%d' % i) continue if not headless: plt.legend() plt.show() print("Intermediate and final results are stored in directory %r" % workdir)
{ "content_hash": "ee41f49972b0477388d8295c14aa1452", "timestamp": "", "source": "github", "line_count": 47, "max_line_length": 77, "avg_line_length": 29.78723404255319, "alnum_prop": 0.7057142857142857, "repo_name": "sns-chops/multiphonon", "id": "48740d85cc4c94f56cc6a69682aca4de082ae740", "size": "1400", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "examples/getdos-Al.py", "mode": "33188", "license": "mit", "language": [ { "name": "Batchfile", "bytes": "36" }, { "name": "Jupyter Notebook", "bytes": "151761" }, { "name": "Python", "bytes": "134339" }, { "name": "Shell", "bytes": "102" }, { "name": "TeX", "bytes": "6533" } ], "symlink_target": "" }
import socket, os, sys, binascii, time, datetime, threading, logging, importlib import re """ Rcon protocol class. Used to establish the connection and to send keep-alive packages Also it provides some default commands, like kickAll, sendChat , lockServer, etc... The module loader <loadmodule(name, class)> allows the use of the following events: - OnConnected - OnReconnected - OnPlayerConnect - OnPlayerDisconnect - OnChat """ class Rcon(): Timeout = 60 # When the connection did not received any response after this period KeepAlive = 30 # KeepAlive must always be lower than Timeout, otherwise the Timeout occurs ConnectionRetries = 5 # Try to reconnect (at startup) X times and... ConnectionInterval = 10 # ... try it every 10 seconds. Example (1 + 5 tries X 10 seconds = 60 seconds until server should be up) """ constructor: create an instance by passing ip, password and port as arguments """ def __init__(self, ip, password, Port): # constructor parameters self.ip = ip self.password = password self.port = int(Port) # module instances as dict (to have them loaded only once) self.__instances = {} # last timestamp used for checkinh keepalive self.isExit = False self.isAuthenticated = False self.retry = 0 self.lastcmd = "" # server message receive filters self.receiveFilter = [ # receive all players ("\n(\d+)\s+(.*?)\s+([0-9]+)\s+([A-z0-9]{32})\(.*?\)\s(.*)", self.__players, True), # receive missions ("\n(.*\.[A-z0-9_-]+\.pbo)", self.__missions, True), # when player is connected ("Verified GUID \(([A-Fa-f0-9]+)\) of player #([0-9]+) (.*)", self.__playerConnect, False), # when player is disconnected ("Player #([0-9]+) (.*?) disconnected", self.__playerDisconnect, False), # chat messages ("\((\w+)\) (.*?): (.*)", self.__chatMessage, False), ] try: self.s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) except socket.error as serr: print ('Failed to create socket') logging.error('rconprotocol: Failed to created socket: {}'.format(serr)) sys.exit() """ public: load additional modules. @param string name - module name without .py suffix @param string cls - class name to create an instance of """ def loadmodule(self, name, cls, *args): if type(self).__name__ == cls: return self key = "%s.%s" % (name, cls) if not key in self.__instances.keys(): mod = importlib.import_module('lib.' + name) classT = getattr(mod, cls) clsObj = classT(self, *args) self.__instances[key] = clsObj return self.__instances[key] """ private: threaded method sending keepAlive messages to the server. Use the KeepAlive constant to define the interval """ def _keepAliveThread(self): time.sleep(self.KeepAlive) self.sendCommand(None) if not self.isExit: self._keepAliveThread() """ private: to calculate the crc (Battleye). More Info: http://www.battleye.com/downloads/BERConProtocol.txt """ def __compute_crc(self, Bytes): buf = memoryview(Bytes) crc = binascii.crc32(buf) & 0xffffffff crc32 = '0x%08x' % crc return int(crc32[8:10], 16), int(crc32[6:8], 16), int(crc32[4:6], 16), int(crc32[2:4], 16) """ public: send individual server commands. @param string toSendCommand - any valid server command, like "#ban <playerid>" """ def sendCommand(self, toSendCommand): if not self.isAuthenticated: logging.error('Command failed - Not Authenticated') return # request = "B" + "E" + 4 bytes crc check + command command = bytearray() command.append(0xFF) command.append(0x01) command.append(0x00) if toSendCommand: logging.debug('Sending command "{}"'.format(toSendCommand)) command.extend(toSendCommand.encode('utf-8','replace')) else: logging.debug('Sending keepAlive package') self.lastcmd = toSendCommand request = bytearray(b'BE') request.extend( self.__compute_crc(command) ) request.extend(command) self.s.sendto(request ,(self.ip, self.port)) """ private: send the magic bytes to login as Rcon admin. More Info: http://www.battleye.com/downloads/BERConProtocol.txt """ def _sendLogin(self, passwd): logging.debug('Sending login information') # request = "B" + "E" + 4 bytes crc check + command command = bytearray() command.append(0xFF) command.append(0x00) command.extend(passwd.encode('utf-8','replace')) request = bytearray(b'BE') request.extend( self.__compute_crc(command) ) request.extend(command) return request """ private: accept server messages. More Info: http://www.battleye.com/downloads/BERConProtocol.txt """ def _acknowledge(self, Bytes): command = bytearray() command.append(0xFF) command.append(0x02) command.extend(Bytes) request = bytearray(b'BE') request.extend( self.__compute_crc(command) ) request.extend(command) seqNo = Bytes[0] logging.info('ACK seq:{}'.format(seqNo)) return request """ private: handle all incoming server messages from socket.recvfrom method @param unknown packet - received package """ def __streamReader(self, packet): # reset the retries if from now one some connection problems occured self.retry = 0 #ACKNOWLEDGE THE MESSAGE p = packet[0] try: if p[0:2] == b'BE' and self.isAuthenticated: self.s.sendto(self._acknowledge(p[8:9]), (self.ip, self.port)) except: pass # Debug output the complete packet received from server logging.debug("[Server: %s:%s]: %s" % (self.ip, self.port, packet)) stream = packet[0] # successfully authenticad packet received if stream[6:] == b'\xff\x00\x01': self.s.settimeout( self.Timeout ) logging.info("[Server: %s:%s]: %s" % (self.ip, self.port, "Authenticated")) # Only do the below if this is the initial connect call if not self.isAuthenticated: self.isAuthenticated = True self.OnConnected() else: self.OnReconnected() return # when authentication failed, exit the program if stream[6:] == b'\xff\x00\x00': logging.error("Not Authenticated") exit() # ausume when the last command is empty, its a keepAlive packet if stream[6:8] == b'\xff\x01' and not self.lastcmd: logging.info("[Server: %s:%s]: %s" % (self.ip, self.port, "KeepAlive")) return # success message from the server for the previous command (or keep alive) if stream[6:9] == b'\xff\x01' and self.lastcmd: logging.info("[Server: %s:%s]: %s" % (self.ip, self.port, "ACK " + self.lastcmd)) # all other packages and commands if len(stream[9:]) > 0: stream = stream[9:].decode('utf-8', 'replace') self.__parseResponse(stream) logging.info("[Server: %s:%s]: %s" % (self.ip, self.port, stream)) def __players(self, pl): l = [] for m in pl: l.append( Player(m[0], m[3], m[4]) ) self.OnPlayers(l) def __missions(self, missions): self.OnMissions(missions) def __playerConnect(self, m): self.OnPlayerConnect( Player(m[1], m[0], m[2]) ) def __playerDisconnect(self, m): self.OnPlayerDisconnect( Player(m[0], "", m[1]) ) def __chatMessage(self, m): self.OnChat( ChatMessage( m[0], m[1], m[2]) ) """ private: parse the incoming message from __streamReader to provide eventing """ def __parseResponse(self, msg): for x in self.receiveFilter: regex, action, multiline = x if multiline: m = re.findall(regex, msg) if len(m) > 0: action(m) break else: m = re.search(regex, msg) if m: action(m.groups()) break """ public: send a chat message to everyone @param string msg - message text """ def sendChat(self, msg, ident = -1): self.sendCommand("say %s \"%s\"" % (ident,msg)) """ public: kick all players """ def kickAll(self): logging.info('Kick All player before restart take action') for i in range(1, 100): self.sendCommand('kick %s' % (i)) time.sleep(0.05) """ public: lock the server (until next restart/unlock). So nobody can join anymore """ def lockServer(self): self.sendCommand('#lock') time.sleep(1) """ Event: when list of players is requested """ def OnPlayers(self, playerList): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnPlayers', None) if func: func(playerList) """ Event: when mission files are requested """ def OnMissions(self, missionList): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnMissions', None) if func: func(missionList) """ Event: when a player connects to the server """ def OnPlayerConnect(self, player): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnPlayerConnect', None) if func: func(player) """ Event: when a player disconnects from the server """ def OnPlayerDisconnect(self, player): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnPlayerDisconnect', None) if func: func(player) """ Event: Incoming chat messages @param ChatMessage chatObj - chat object containing channel and message """ def OnChat(self, chatObj): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnChat', None) if func: func(chatObj) """ Event: when program is successfully connected and authenticated to the server. This can perfectly be used in modules. """ def OnConnected(self): # initialize keepAlive thread _t = threading.Thread(target=self._keepAliveThread) _t.daemon = True _t.start() for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnConnected', None) if func: func() """ Event: when program is successfully reconnected and authenticated to the server. This can perfectly be used in modules. """ def OnReconnected(self): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnReconnected', None) if func: func() def OnAbort(self): for clsObj in self.__instances.values(): func = getattr(clsObj, 'OnAbort', None) if func: func() """ public: cancel all loops (keepAlive and others from modules) and send the final "exit" command to disconnect from server """ def Abort(self): logging.info("Exit loop") self.isExit = True self.OnAbort() def connectAsync(self): _t = threading.Thread(target=self.connect, name='connectionThread') _t.daemon = True _t.start() """ public: used to establish the connection to the server giving by constructor call """ def connect(self): try: self.s.settimeout(self.ConnectionInterval) #Set the whole string logging.info('Connecting to {}:{} #{}'.format(self.ip, self.port, self.retry)) self.s.sendto(self._sendLogin(self.password) ,(self.ip, self.port)) # receive data from client (data, addr) while not self.isExit: d = self.s.recvfrom(2048) #1024 value crash on players request on full server self.__streamReader(d) # Connection timed out except socket.timeout as et: logging.error('Socket timeout: {}'.format(et)) if self.retry < self.ConnectionRetries and not self.isExit: self.retry += 1 self.connect() else: self.Abort() # Some problem sending data ?? except socket.error as e: logging.error('Socket error: {}'.format(e)) self.Abort() # Ctrl + C except (KeyboardInterrupt, SystemExit): logging.debug('rconprotocol.connect: Keyboard interrupted') self.Abort() except: logging.exception("Unhandled Exception") self.Abort() """ Player class commonly used for events OnPlayerConnect and OnPlayerDisconnect """ class Player(): def __init__(self, no, guid, name): self.number = no self.guid = guid self.name = name self.allowed = False def Allow(self): self.allowed = True def Disallow(self): self.allowed = False def toJSON(self): return json.dumps(self, default=lambda o: o.__dict__, sort_keys=True, indent=4) @staticmethod def fromJSON(i): o = Player(i['number'], i['guid'], i['name']) if i['allowed']: o.Allow() return o """ Chat class commonly used for event OnChat """ class ChatMessage(): def __init__(self, channel, sender, message): self.channel = channel.lower() self.sender = sender self.message = message
{ "content_hash": "8ff62d8f09cbf912fae85c2cd53b58ec", "timestamp": "", "source": "github", "line_count": 438, "max_line_length": 132, "avg_line_length": 32.1986301369863, "alnum_prop": 0.5747004183507055, "repo_name": "Au1st3in/au1st3in.net", "id": "f4514662afb6bbd06a36971f172820cf31501830", "size": "14103", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "py3rcon/rconprotocol.py", "mode": "33261", "license": "mit", "language": [ { "name": "CSS", "bytes": "9477" }, { "name": "HTML", "bytes": "41427" }, { "name": "JavaScript", "bytes": "141" }, { "name": "Makefile", "bytes": "958" }, { "name": "Nginx", "bytes": "683" }, { "name": "Python", "bytes": "91431" }, { "name": "Shell", "bytes": "172" } ], "symlink_target": "" }
import weechat as w import time SCRIPT_NAME = "buffer_autoclose" SCRIPT_AUTHOR = "xt <[email protected]>" SCRIPT_VERSION = "0.4" SCRIPT_LICENSE = "GPL3" SCRIPT_DESC = "Automatically close inactive private message buffers" settings = { 'interval': '1', # How often in minutes to check 'age_limit': '30', # How old in minutes before auto close 'ignore': '', # Buffers to ignore (use full name: server.buffer_name) } if w.register(SCRIPT_NAME, SCRIPT_AUTHOR, SCRIPT_VERSION, SCRIPT_LICENSE, SCRIPT_DESC, "", ""): for option, default_value in settings.items(): if not w.config_is_set_plugin(option): w.config_set_plugin(option, default_value) w.hook_timer(\ int(w.config_get_plugin('interval')) * 1000 * 60, 0, 0, "close_time_cb", '') def get_all_buffers(): '''Returns list with pointers of all open buffers.''' buffers = [] infolist = w.infolist_get('buffer', '', '') while w.infolist_next(infolist): buffer_type = w.buffer_get_string(w.infolist_pointer(infolist, 'pointer'), 'localvar_type') if buffer_type == 'private': # we only close private message buffers for now buffers.append(w.infolist_pointer(infolist, 'pointer')) w.infolist_free(infolist) return buffers def get_last_line_date(buffer): date = '1970-01-01 01:00:00' infolist = w.infolist_get('buffer_lines', buffer, '') while w.infolist_prev(infolist): date = w.infolist_time(infolist, 'date') if date != '1970-01-01 01:00:00': # Some lines like "Day changed to" message doesn't have date # set so loop until we find a message that does break w.infolist_free(infolist) return date def is_in_hotlist(buffer): ''' Returns true if buffer is in hotlist, false if not''' hotlist = w.infolist_get('hotlist', '', '') found = False while w.infolist_next(hotlist): thebuffer = w.infolist_pointer(hotlist, 'buffer_pointer') if thebuffer == buffer: found = True name = w.buffer_get_string(thebuffer, 'short_name') break w.infolist_free(hotlist) return found def close_time_cb(buffer, args): ''' Callback for check for inactivity and close ''' for buffer in get_all_buffers(): name = w.buffer_get_string(buffer, 'name') date = get_last_line_date(buffer) date = time.mktime(time.strptime(date, '%Y-%m-%d %H:%M:%S')) now = time.time() seconds_old = now - date if seconds_old > int(w.config_get_plugin('age_limit'))*60: if is_in_hotlist(buffer): #w.prnt('', '%s: Not closing buffer: %s: it is in hotlist' %(SCRIPT_NAME, name)) continue if name in w.config_get_plugin('ignore').split(','): #w.prnt('', '%s: Not closing buffer: %s: it is in ignore list' %(SCRIPT_NAME, name)) continue if buffer == w.current_buffer(): # Never close current buffer #w.prnt('', '%s: Not closing buffer: %s: it is in currently active' %(SCRIPT_NAME, name)) continue if len(w.buffer_get_string(buffer, 'input')): # Don't close buffers with text on input line #w.prnt('', '%s: Not closing buffer: %s: it has input' %(SCRIPT_NAME, name)) continue w.prnt('', '%s: Closing buffer: %s' %(SCRIPT_NAME, name)) w.command(buffer, '/buffer close') #else: # w.prnt('', '%s: Not closing buffer: %s: it is too new: %s' %(SCRIPT_NAME, name, seconds_old)) return w.WEECHAT_RC_OK
{ "content_hash": "2f011b83d0c532976aba199fa0ef76cf", "timestamp": "", "source": "github", "line_count": 99, "max_line_length": 106, "avg_line_length": 37.73737373737374, "alnum_prop": 0.5784261241970021, "repo_name": "deepredsky/dotfiles", "id": "303f5b37cc84bf11242b4cee905fe82261ecd124", "size": "4766", "binary": false, "copies": "7", "ref": "refs/heads/master", "path": "weechat/python/buffer_autoclose.py", "mode": "33188", "license": "mit", "language": [ { "name": "HTML", "bytes": "3812" }, { "name": "Lua", "bytes": "333" }, { "name": "Perl", "bytes": "135224" }, { "name": "Python", "bytes": "175209" }, { "name": "Ruby", "bytes": "11581" }, { "name": "Shell", "bytes": "45537" }, { "name": "Vim Script", "bytes": "14976" } ], "symlink_target": "" }
from horizon.test import helpers as test class ActionsTests(test.TestCase): # Unit tests for add_provider. def test_me(self): self.assertTrue(1 + 1 == 2)
{ "content_hash": "ddce853149fc7608100c59cb912bcdb9", "timestamp": "", "source": "github", "line_count": 7, "max_line_length": 40, "avg_line_length": 24.571428571428573, "alnum_prop": 0.6744186046511628, "repo_name": "emitrom/integra-openstack-ui", "id": "6a1b3f7b473643b30877263203a9d65a0f8ea81e", "size": "172", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "actions/tests.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "34" }, { "name": "HTML", "bytes": "4382" }, { "name": "JavaScript", "bytes": "41" }, { "name": "Python", "bytes": "49167" } ], "symlink_target": "" }
from msrest.paging import Paged class SBAuthorizationRulePaged(Paged): """ A paging container for iterating over a list of :class:`SBAuthorizationRule <azure.mgmt.servicebus.models.SBAuthorizationRule>` object """ _attribute_map = { 'next_link': {'key': 'nextLink', 'type': 'str'}, 'current_page': {'key': 'value', 'type': '[SBAuthorizationRule]'} } def __init__(self, *args, **kwargs): super(SBAuthorizationRulePaged, self).__init__(*args, **kwargs)
{ "content_hash": "c11b5622fa116696fc8513d80a007fce", "timestamp": "", "source": "github", "line_count": 16, "max_line_length": 138, "avg_line_length": 31.5, "alnum_prop": 0.6388888888888888, "repo_name": "lmazuel/azure-sdk-for-python", "id": "24c4f71b00015fc2e14a090315a6c198e44792c8", "size": "978", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "azure-mgmt-servicebus/azure/mgmt/servicebus/models/sb_authorization_rule_paged.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "42572767" } ], "symlink_target": "" }
""" Window arrangement. This contains the data structure for the tab pages with their windows and buffers. It's not the same as a `prompt-toolkit` layout. The latter directly represents the rendering, while this is more specific for the editor itself. """ from __future__ import unicode_literals from six import string_types import weakref from .editor_buffer import EditorBuffer __all__ = ( 'WindowArrangement', ) class HSplit(list): """ Horizontal split. (This is a higher level split than prompt_toolkit.layout.HSplit.) """ class VSplit(list): """ Horizontal split. """ class Window(object): """ Editor window: a window can show any open buffer. """ def __init__(self, editor_buffer): assert isinstance(editor_buffer, EditorBuffer) self.editor_buffer = editor_buffer def __repr__(self): return '%s(editor_buffer=%r)' % (self.__class__.__name__, self.editor_buffer) class TabPage(object): """ Tab page. Container for windows. """ def __init__(self, window): assert isinstance(window, Window) self.root = VSplit([window]) # Keep track of which window is focusesd in this tab. self.active_window = window def windows(self): """ Return a list of all windows in this tab page. """ return [window for _, window in self._walk_through_windows()] def window_count(self): """ The amount of windows in this tab. """ return len(self.windows()) def visible_editor_buffers(self): """ Return a list of visible `EditorBuffer` instances. """ return [w.editor_buffer for w in self.windows()] def _walk_through_windows(self): """ Yields (Split, Window) tuples. """ def walk(split): for c in split: if isinstance(c, (HSplit, VSplit)): for i in walk(c): yield i elif isinstance(c, Window): yield split, c return walk(self.root) def _walk_through_splits(self): """ Yields (parent_split, child_plit) tuples. """ def walk(split): for c in split: if isinstance(c, (HSplit, VSplit)): yield split, c for i in walk(c): yield i return walk(self.root) def _get_active_split(self): for split, window in self._walk_through_windows(): if window == self.active_window: return split raise Exception('active_window not found. Something is wrong.') def _get_split_parent(self, split): for parent, child in self._walk_through_splits(): if child == split: return parent def _split(self, split_cls, editor_buffer=None): """ Split horizontal or vertical. (when editor_buffer is None, show the current buffer there as well.) """ if editor_buffer is None: editor_buffer = self.active_window.editor_buffer active_split = self._get_active_split() index = active_split.index(self.active_window) new_window = Window(editor_buffer) if isinstance(active_split, split_cls): # Add new window to active split. active_split.insert(index, new_window) else: # Split in the other direction. active_split[index] = split_cls([active_split[index], new_window]) # Focus new window. self.active_window = new_window def hsplit(self, editor_buffer=None): """ Split active window horizontally. """ self._split(HSplit, editor_buffer) def vsplit(self, editor_buffer=None): """ Split active window vertically. """ self._split(VSplit, editor_buffer) def show_editor_buffer(self, editor_buffer): """ Open this `EditorBuffer` in the active window. """ assert isinstance(editor_buffer, EditorBuffer) self.active_window.editor_buffer = editor_buffer def close_editor_buffer(self, editor_buffer): """ Close all the windows that have this editor buffer open. """ for split, window in self._walk_through_windows(): if window.editor_buffer == editor_buffer: self._close_window(window) def _close_window(self, window): """ Close this window. """ if window == self.active_window: self.close_active_window() else: original_active_window = self.active_window self.close_active_window() self.active_window = original_active_window def close_active_window(self): """ Close active window. """ active_split = self._get_active_split() # First remove the active window from its split. index = active_split.index(self.active_window) del active_split[index] # Move focus. if len(active_split): new_active_window = active_split[max(0, index - 1)] while isinstance(new_active_window, (HSplit, VSplit)): new_active_window = new_active_window[0] self.active_window = new_active_window else: self.active_window = None # No windows left. # When there is exactly on item left, move this back into the parent # split. (We don't want to keep a split with one item around -- exept # for the root.) if len(active_split) == 1 and active_split != self.root: parent = self._get_split_parent(active_split) index = parent.index(active_split) parent[index] = active_split[0] def cycle_focus(self): """ Cycle through all windows. """ windows = self.windows() new_index = (windows.index(self.active_window) + 1) % len(windows) self.active_window = windows[new_index] @property def has_unsaved_changes(self): """ True when any of the visible buffers in this tab has unsaved changes. """ for w in self.windows(): if w.editor_buffer.has_unsaved_changes: return True return False class WindowArrangement(object): def __init__(self, editor): self._editor_ref = weakref.ref(editor) self.tab_pages = [] self.active_tab_index = None self.editor_buffers = [] # List of EditorBuffer self._buffer_index = 0 # Index for generating buffer names. @property def editor(self): """ The Editor instance. """ return self._editor_ref() @property def active_tab(self): """ The active TabPage or None. """ if self.active_tab_index is not None: return self.tab_pages[self.active_tab_index] @property def active_editor_buffer(self): """ The active EditorBuffer or None. """ if self.active_tab and self.active_tab.active_window: return self.active_tab.active_window.editor_buffer def get_editor_buffer_for_location(self, location): """ Return the `EditorBuffer` for this location. When this file was not yet loaded, return None """ for eb in self.editor_buffers: if eb.location == location: return eb def get_editor_buffer_for_buffer_name(self, buffer_name): """ Return the `EditorBuffer` for this buffer_name. When not found, return None """ for eb in self.editor_buffers: if eb.buffer_name == buffer_name: return eb def close_window(self): """ Close active window of active tab. """ self.active_tab.close_active_window() # Clean up buffers. self._auto_close_new_empty_buffers() def close_tab(self): """ Close active tab. """ if len(self.tab_pages) > 1: # Cannot close last tab. del self.tab_pages[self.active_tab_index] self.active_tab_index = max(0, self.active_tab_index - 1) # Clean up buffers. self._auto_close_new_empty_buffers() def hsplit(self, location=None, new=False, text=None): """ Split horizontally. """ assert location is None or text is None or new is False # Don't pass two of them. if location or text or new: editor_buffer = self._get_or_create_editor_buffer(location=location, text=text) else: editor_buffer = None self.active_tab.hsplit(editor_buffer) def vsplit(self, location=None, new=False, text=None): """ Split vertically. """ assert location is None or text is None or new is False # Don't pass two of them. if location or text or new: editor_buffer = self._get_or_create_editor_buffer(location=location, text=text) else: editor_buffer = None self.active_tab.vsplit(editor_buffer) def keep_only_current_window(self): """ Close all other windows, except the current one. """ self.tab_pages = [TabPage(self.active_tab.active_window)] self.active_tab_index = 0 def cycle_focus(self): """ Focus next visible window. """ self.active_tab.cycle_focus() def show_editor_buffer(self, editor_buffer): """ Show this EditorBuffer in the current window. """ self.active_tab.show_editor_buffer(editor_buffer) # Clean up buffers. self._auto_close_new_empty_buffers() def go_to_next_buffer(self, _previous=False): """ Open next buffer in active window. """ if self.active_editor_buffer: # Find the active opened buffer. index = self.editor_buffers.index(self.active_editor_buffer) # Get index of new buffer. if _previous: new_index = (len(self.editor_buffers) + index - 1) % len(self.editor_buffers) else: new_index = (index + 1) % len(self.editor_buffers) # Open new buffer in active tab. self.active_tab.show_editor_buffer(self.editor_buffers[new_index]) # Clean up buffers. self._auto_close_new_empty_buffers() def go_to_previous_buffer(self): """ Open the previous buffer in the active window. """ self.go_to_next_buffer(_previous=True) def go_to_next_tab(self): """ Focus the next tab. """ self.active_tab_index = (self.active_tab_index + 1) % len(self.tab_pages) def go_to_previous_tab(self): """ Focus the previous tab. """ self.active_tab_index = (self.active_tab_index - 1 + len(self.tab_pages)) % len(self.tab_pages) def go_to_buffer(self, buffer_name): """ Go to one of the open buffers. """ assert isinstance(buffer_name, string_types) for i, eb in enumerate(self.editor_buffers): if (eb.location == buffer_name or (buffer_name.isdigit() and int(buffer_name) == i)): self.show_editor_buffer(eb) break def _add_editor_buffer(self, editor_buffer, show_in_current_window=False): """ Insert this new buffer in the list of buffers, right after the active one. """ assert isinstance(editor_buffer, EditorBuffer) and editor_buffer not in self.editor_buffers # Add to list of EditorBuffers eb = self.active_editor_buffer if eb is None: self.editor_buffers.append(editor_buffer) else: # Append right after the currently active one. try: index = self.editor_buffers.index(self.active_editor_buffer) except ValueError: index = 0 self.editor_buffers.insert(index, editor_buffer) # When there are no tabs/windows yet, create one for this buffer. if self.tab_pages == []: self.tab_pages.append(TabPage(Window(editor_buffer))) self.active_tab_index = 0 # To be shown? if show_in_current_window and self.active_tab: self.active_tab.show_editor_buffer(editor_buffer) # Add buffer to CLI. self.editor.cli.add_buffer(editor_buffer.buffer_name, editor_buffer.buffer) # Start reporter. self.editor.run_reporter_for_editor_buffer(editor_buffer) def _get_or_create_editor_buffer(self, location=None, text=None): """ Given a location, return the `EditorBuffer` instance that we have if the file is already open, or create a new one. When location is None, this creates a new buffer. """ assert location is None or text is None # Don't pass two of them. assert location is None or isinstance(location, string_types) def new_name(): """ Generate name for new buffer. """ self._buffer_index += 1 return 'buffer-%i' % self._buffer_index if location is None: # Create and add an empty EditorBuffer eb = EditorBuffer(self.editor, new_name(), text=text) self._add_editor_buffer(eb) return eb else: # When a location is given, first look whether the file was already # opened. eb = self.get_editor_buffer_for_location(location) # Not found? Create one. if eb is None: # Create and add EditorBuffer eb = EditorBuffer(self.editor, new_name(), location) self._add_editor_buffer(eb) return eb else: # Found! Return it. return eb def open_buffer(self, location=None, show_in_current_window=False): """ Open/create a file, load it, and show it in a new buffer. """ eb = self._get_or_create_editor_buffer(location) if show_in_current_window: self.show_editor_buffer(eb) def _auto_close_new_empty_buffers(self): """ When there are new, empty buffers open. (Like, created when the editor starts without any files.) These can be removed at the point when there is no more window showing them. This should be called every time when a window is closed, or when the content of a window is replcaed by something new. """ # Get all visible EditorBuffers ebs = set() for t in self.tab_pages: ebs |= set(t.visible_editor_buffers()) # Remove empty/new buffers that are hidden. for eb in self.editor_buffers[:]: if eb.is_new and not eb.location and eb not in ebs and eb.buffer.text == '': self.editor_buffers.remove(eb) def close_buffer(self): """ Close current buffer. When there are other windows showing the same buffer, they are closed as well. When no windows are left, the previous buffer or an empty buffer is shown. """ eb = self.active_editor_buffer # Remove this buffer. index = self.editor_buffers.index(eb) self.editor_buffers.remove(eb) # Close the active window. self.active_tab.close_active_window() # Close all the windows that still have this buffer open. for i, t in enumerate(self.tab_pages[:]): t.close_editor_buffer(eb) # Remove tab when there are no windows left. if t.window_count() == 0: self.tab_pages.remove(t) if i >= self.active_tab_index: self.active_tab_index = max(0, self.active_tab_index - 1) # When there are no windows/tabs left, create a new tab. if len(self.tab_pages) == 0: self.active_tab_index = None if len(self.editor_buffers) > 0: # Open the previous buffer. new_index = (len(self.editor_buffers) + index - 1) % len(self.editor_buffers) eb = self.editor_buffers[new_index] # Create a window for this buffer. self.tab_pages.append(TabPage(Window(eb))) self.active_tab_index = 0 else: # Create a new buffer. (This will also create the window # automatically.) eb = self._get_or_create_editor_buffer() def create_tab(self, location=None): """ Create a new tab page. """ eb = self._get_or_create_editor_buffer(location) self.tab_pages.insert(self.active_tab_index + 1, TabPage(Window(eb))) self.active_tab_index += 1 def list_open_buffers(self): """ Return a `OpenBufferInfo` list that gives information about the open buffers. """ active_eb = self.active_editor_buffer visible_ebs = self.active_tab.visible_editor_buffers() def make_info(i, eb): return OpenBufferInfo( index=i, editor_buffer=eb, is_active=(eb == active_eb), is_visible=(eb in visible_ebs)) return [make_info(i, eb) for i, eb in enumerate(self.editor_buffers)] class OpenBufferInfo(object): """ Information about an open buffer, returned by `WindowArrangement.list_open_buffers`. """ def __init__(self, index, editor_buffer, is_active, is_visible): self.index = index self.editor_buffer = editor_buffer self.is_active = is_active self.is_visible = is_visible
{ "content_hash": "92aed50fa6e32e1d16feffbc94760628", "timestamp": "", "source": "github", "line_count": 543, "max_line_length": 99, "avg_line_length": 32.935543278084715, "alnum_prop": 0.5747036457168418, "repo_name": "tianzhihen/pyvim", "id": "2315752dae068a17f6dd731fe7f838256f5bda9d", "size": "17884", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "pyvim/window_arrangement.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Python", "bytes": "109564" } ], "symlink_target": "" }
"""Attribute implementation for _Dispatch classes. The various listener targets for a particular event class are represented as attributes, which refer to collections of listeners to be fired off. These collections can exist at the class level as well as at the instance level. An event is fired off using code like this:: some_object.dispatch.first_connect(arg1, arg2) Above, ``some_object.dispatch`` would be an instance of ``_Dispatch`` and ``first_connect`` is typically an instance of ``_ListenerCollection`` if event listeners are present, or ``_EmptyListener`` if none are present. The attribute mechanics here spend effort trying to ensure listener functions are available with a minimum of function call overhead, that unnecessary objects aren't created (i.e. many empty per-instance listener collections), as well as that everything is garbage collectable when owning references are lost. Other features such as "propagation" of listener functions across many ``_Dispatch`` instances, "joining" of multiple ``_Dispatch`` instances, as well as support for subclass propagation (e.g. events assigned to ``Pool`` vs. ``QueuePool``) are all implemented here. """ from __future__ import absolute_import from __future__ import with_statement import collections from itertools import chain import weakref from . import legacy from . import registry from .. import exc from .. import util from ..util import threading class RefCollection(util.MemoizedSlots): __slots__ = ("ref",) def _memoized_attr_ref(self): return weakref.ref(self, registry._collection_gced) class _empty_collection(object): def append(self, element): pass def extend(self, other): pass def remove(self, element): pass def __iter__(self): return iter([]) def clear(self): pass class _ClsLevelDispatch(RefCollection): """Class-level events on :class:`._Dispatch` classes.""" __slots__ = ( "name", "arg_names", "has_kw", "legacy_signatures", "_clslevel", "__weakref__", ) def __init__(self, parent_dispatch_cls, fn): self.name = fn.__name__ argspec = util.inspect_getfullargspec(fn) self.arg_names = argspec.args[1:] self.has_kw = bool(argspec.varkw) self.legacy_signatures = list( reversed( sorted( getattr(fn, "_legacy_signatures", []), key=lambda s: s[0] ) ) ) fn.__doc__ = legacy._augment_fn_docs(self, parent_dispatch_cls, fn) self._clslevel = weakref.WeakKeyDictionary() def _adjust_fn_spec(self, fn, named): if named: fn = self._wrap_fn_for_kw(fn) if self.legacy_signatures: try: argspec = util.get_callable_argspec(fn, no_self=True) except TypeError: pass else: fn = legacy._wrap_fn_for_legacy(self, fn, argspec) return fn def _wrap_fn_for_kw(self, fn): def wrap_kw(*args, **kw): argdict = dict(zip(self.arg_names, args)) argdict.update(kw) return fn(**argdict) return wrap_kw def insert(self, event_key, propagate): target = event_key.dispatch_target assert isinstance( target, type ), "Class-level Event targets must be classes." if not getattr(target, "_sa_propagate_class_events", True): raise exc.InvalidRequestError( "Can't assign an event directly to the %s class" % target ) stack = [target] while stack: cls = stack.pop(0) stack.extend(cls.__subclasses__()) if cls is not target and cls not in self._clslevel: self.update_subclass(cls) else: if cls not in self._clslevel: self._assign_cls_collection(cls) self._clslevel[cls].appendleft(event_key._listen_fn) registry._stored_in_collection(event_key, self) def append(self, event_key, propagate): target = event_key.dispatch_target assert isinstance( target, type ), "Class-level Event targets must be classes." if not getattr(target, "_sa_propagate_class_events", True): raise exc.InvalidRequestError( "Can't assign an event directly to the %s class" % target ) stack = [target] while stack: cls = stack.pop(0) stack.extend(cls.__subclasses__()) if cls is not target and cls not in self._clslevel: self.update_subclass(cls) else: if cls not in self._clslevel: self._assign_cls_collection(cls) self._clslevel[cls].append(event_key._listen_fn) registry._stored_in_collection(event_key, self) def _assign_cls_collection(self, target): if getattr(target, "_sa_propagate_class_events", True): self._clslevel[target] = collections.deque() else: self._clslevel[target] = _empty_collection() def update_subclass(self, target): if target not in self._clslevel: self._assign_cls_collection(target) clslevel = self._clslevel[target] for cls in target.__mro__[1:]: if cls in self._clslevel: clslevel.extend( [fn for fn in self._clslevel[cls] if fn not in clslevel] ) def remove(self, event_key): target = event_key.dispatch_target stack = [target] while stack: cls = stack.pop(0) stack.extend(cls.__subclasses__()) if cls in self._clslevel: self._clslevel[cls].remove(event_key._listen_fn) registry._removed_from_collection(event_key, self) def clear(self): """Clear all class level listeners""" to_clear = set() for dispatcher in self._clslevel.values(): to_clear.update(dispatcher) dispatcher.clear() registry._clear(self, to_clear) def for_modify(self, obj): """Return an event collection which can be modified. For _ClsLevelDispatch at the class level of a dispatcher, this returns self. """ return self class _InstanceLevelDispatch(RefCollection): __slots__ = () def _adjust_fn_spec(self, fn, named): return self.parent._adjust_fn_spec(fn, named) class _EmptyListener(_InstanceLevelDispatch): """Serves as a proxy interface to the events served by a _ClsLevelDispatch, when there are no instance-level events present. Is replaced by _ListenerCollection when instance-level events are added. """ propagate = frozenset() listeners = () __slots__ = "parent", "parent_listeners", "name" def __init__(self, parent, target_cls): if target_cls not in parent._clslevel: parent.update_subclass(target_cls) self.parent = parent # _ClsLevelDispatch self.parent_listeners = parent._clslevel[target_cls] self.name = parent.name def for_modify(self, obj): """Return an event collection which can be modified. For _EmptyListener at the instance level of a dispatcher, this generates a new _ListenerCollection, applies it to the instance, and returns it. """ result = _ListenerCollection(self.parent, obj._instance_cls) if getattr(obj, self.name) is self: setattr(obj, self.name, result) else: assert isinstance(getattr(obj, self.name), _JoinedListener) return result def _needs_modify(self, *args, **kw): raise NotImplementedError("need to call for_modify()") exec_once = insert = append = remove = clear = _needs_modify def __call__(self, *args, **kw): """Execute this event.""" for fn in self.parent_listeners: fn(*args, **kw) def __len__(self): return len(self.parent_listeners) def __iter__(self): return iter(self.parent_listeners) def __bool__(self): return bool(self.parent_listeners) __nonzero__ = __bool__ class _CompoundListener(_InstanceLevelDispatch): __slots__ = "_exec_once_mutex", "_exec_once" def _memoized_attr__exec_once_mutex(self): return threading.Lock() def exec_once(self, *args, **kw): """Execute this event, but only if it has not been executed already for this collection.""" if not self._exec_once: with self._exec_once_mutex: if not self._exec_once: try: self(*args, **kw) finally: self._exec_once = True def __call__(self, *args, **kw): """Execute this event.""" for fn in self.parent_listeners: fn(*args, **kw) for fn in self.listeners: fn(*args, **kw) def __len__(self): return len(self.parent_listeners) + len(self.listeners) def __iter__(self): return chain(self.parent_listeners, self.listeners) def __bool__(self): return bool(self.listeners or self.parent_listeners) __nonzero__ = __bool__ class _ListenerCollection(_CompoundListener): """Instance-level attributes on instances of :class:`._Dispatch`. Represents a collection of listeners. As of 0.7.9, _ListenerCollection is only first created via the _EmptyListener.for_modify() method. """ __slots__ = ( "parent_listeners", "parent", "name", "listeners", "propagate", "__weakref__", ) def __init__(self, parent, target_cls): if target_cls not in parent._clslevel: parent.update_subclass(target_cls) self._exec_once = False self.parent_listeners = parent._clslevel[target_cls] self.parent = parent self.name = parent.name self.listeners = collections.deque() self.propagate = set() def for_modify(self, obj): """Return an event collection which can be modified. For _ListenerCollection at the instance level of a dispatcher, this returns self. """ return self def _update(self, other, only_propagate=True): """Populate from the listeners in another :class:`_Dispatch` object.""" existing_listeners = self.listeners existing_listener_set = set(existing_listeners) self.propagate.update(other.propagate) other_listeners = [ l for l in other.listeners if l not in existing_listener_set and not only_propagate or l in self.propagate ] existing_listeners.extend(other_listeners) to_associate = other.propagate.union(other_listeners) registry._stored_in_collection_multi(self, other, to_associate) def insert(self, event_key, propagate): if event_key.prepend_to_list(self, self.listeners): if propagate: self.propagate.add(event_key._listen_fn) def append(self, event_key, propagate): if event_key.append_to_list(self, self.listeners): if propagate: self.propagate.add(event_key._listen_fn) def remove(self, event_key): self.listeners.remove(event_key._listen_fn) self.propagate.discard(event_key._listen_fn) registry._removed_from_collection(event_key, self) def clear(self): registry._clear(self, self.listeners) self.propagate.clear() self.listeners.clear() class _JoinedListener(_CompoundListener): __slots__ = "parent", "name", "local", "parent_listeners" def __init__(self, parent, name, local): self._exec_once = False self.parent = parent self.name = name self.local = local self.parent_listeners = self.local @property def listeners(self): return getattr(self.parent, self.name) def _adjust_fn_spec(self, fn, named): return self.local._adjust_fn_spec(fn, named) def for_modify(self, obj): self.local = self.parent_listeners = self.local.for_modify(obj) return self def insert(self, event_key, propagate): self.local.insert(event_key, propagate) def append(self, event_key, propagate): self.local.append(event_key, propagate) def remove(self, event_key): self.local.remove(event_key) def clear(self): raise NotImplementedError()
{ "content_hash": "453b66fb5e68f266ffd82f707c71204a", "timestamp": "", "source": "github", "line_count": 414, "max_line_length": 77, "avg_line_length": 30.82125603864734, "alnum_prop": 0.5983542319749217, "repo_name": "wujuguang/sqlalchemy", "id": "9dfa89809dc985d5504055c2260f58ed93b50baf", "size": "12994", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "lib/sqlalchemy/event/attr.py", "mode": "33188", "license": "mit", "language": [ { "name": "C", "bytes": "45930" }, { "name": "Python", "bytes": "11287383" } ], "symlink_target": "" }
def extractKuromarutranslationsHomeBlog(item): ''' Parser for 'kuromarutranslations.home.blog' ''' vol, chp, frag, postfix = extractVolChapterFragmentPostfix(item['title']) if not (chp or vol) or "preview" in item['title'].lower(): return None tagmap = [ ('PRC', 'PRC', 'translated'), ('Loiterous', 'Loiterous', 'oel'), ] for tagname, name, tl_type in tagmap: if tagname in item['tags']: return buildReleaseMessageWithType(item, name, vol, chp, frag=frag, postfix=postfix, tl_type=tl_type) return False
{ "content_hash": "6552f0ddf65e1b27cc1654ec4b82b712", "timestamp": "", "source": "github", "line_count": 21, "max_line_length": 104, "avg_line_length": 27.19047619047619, "alnum_prop": 0.6427320490367776, "repo_name": "fake-name/ReadableWebProxy", "id": "5c946ed920425c4b70d36c0c9554e2b83b8da626", "size": "572", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "WebMirror/management/rss_parser_funcs/feed_parse_extractKuromarutranslationsHomeBlog.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "CSS", "bytes": "105811" }, { "name": "Dockerfile", "bytes": "1178" }, { "name": "HTML", "bytes": "119737" }, { "name": "JavaScript", "bytes": "3006524" }, { "name": "Jupyter Notebook", "bytes": "148075" }, { "name": "Mako", "bytes": "1454" }, { "name": "Python", "bytes": "5264346" }, { "name": "Shell", "bytes": "1059" } ], "symlink_target": "" }
from rapidsms.backends.base import BackendBase as RapidBackendBase class BackendBase(RapidBackendBase): """ Backend that overrides the default RapidSMS backend to keep threads from starting. """ def start(self): """ Override BackendBase.start(), which never returns """ self._running = True
{ "content_hash": "472173db692417551209dadf6eb8394d", "timestamp": "", "source": "github", "line_count": 12, "max_line_length": 71, "avg_line_length": 27.5, "alnum_prop": 0.693939393939394, "repo_name": "caktus/rapidsms-threadless-router", "id": "f9b93a6f7dab159899b3088cdb0cf3f604ade6cc", "size": "330", "binary": false, "copies": "2", "ref": "refs/heads/develop", "path": "threadless_router/backends/base.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Python", "bytes": "36982" } ], "symlink_target": "" }
import numpy as np import pytest import pandas as pd import pandas.util.testing as tm @pytest.fixture def sparse_df(): return pd.SparseDataFrame({0: {0: 1}, 1: {1: 1}, 2: {2: 1}}) # eye @pytest.fixture def multi_index3(): return pd.MultiIndex.from_tuples([(0, 0), (1, 1), (2, 2)]) @pytest.mark.filterwarnings("ignore:Sparse:FutureWarning") def test_sparse_frame_stack(sparse_df, multi_index3): ss = sparse_df.stack() expected = pd.SparseSeries(np.ones(3), index=multi_index3) tm.assert_sp_series_equal(ss, expected) @pytest.mark.filterwarnings("ignore:Sparse:FutureWarning") def test_sparse_frame_unstack(sparse_df): mi = pd.MultiIndex.from_tuples([(0, 0), (1, 0), (1, 2)]) sparse_df.index = mi arr = np.array([[1, np.nan, np.nan], [np.nan, 1, np.nan], [np.nan, np.nan, 1]]) unstacked_df = pd.DataFrame(arr, index=mi).unstack() unstacked_sdf = sparse_df.unstack() tm.assert_numpy_array_equal(unstacked_df.values, unstacked_sdf.values) @pytest.mark.filterwarnings("ignore:Sparse:FutureWarning") def test_sparse_series_unstack(sparse_df, multi_index3): frame = pd.SparseSeries(np.ones(3), index=multi_index3).unstack() arr = np.array([1, np.nan, np.nan]) arrays = {i: pd.SparseArray(np.roll(arr, i)) for i in range(3)} expected = pd.DataFrame(arrays) tm.assert_frame_equal(frame, expected)
{ "content_hash": "015435991517261473a3cb311e6df91e", "timestamp": "", "source": "github", "line_count": 43, "max_line_length": 83, "avg_line_length": 31.767441860465116, "alnum_prop": 0.6793557833089312, "repo_name": "kushalbhola/MyStuff", "id": "bb5232f065a0496aeba1720672529d8e076beb73", "size": "1366", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "Practice/PythonApplication/env/Lib/site-packages/pandas/tests/sparse/test_reshape.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Batchfile", "bytes": "1330" }, { "name": "C#", "bytes": "332967" }, { "name": "CSS", "bytes": "1451" }, { "name": "HTML", "bytes": "7539" }, { "name": "Java", "bytes": "14860" }, { "name": "JavaScript", "bytes": "9843" }, { "name": "Jupyter Notebook", "bytes": "374013" }, { "name": "PowerShell", "bytes": "1448" }, { "name": "Python", "bytes": "6511820" }, { "name": "Tcl", "bytes": "24289" }, { "name": "TypeScript", "bytes": "15697" } ], "symlink_target": "" }
''' @Autor: Esperanza Ramirez Armijos @Tema: Pronosticador del Futbol Ecuatoriano @Descripcion: Contiene la clase info_liga para procesar y almacenar la información sobre las estadísticas contenida en los distintos archivos .txt: ''' import sys import os # CLASE INFO_LIGA class info_liga: #Constructor que solo toma por argumentos la jornada y % goles después minuto 80 def __init__(self, jornada): self.jornada=jornada self.timing=None self.timing_partes=None self.ratios=None self.ratios_partes=None self.casa=None self.fuera=None self.clasif=None self.partidosCasa=None self.partidosFuera=None self.infopartidos=None self.goleslocal=None self.golesvisitante=None self.empates0=None self.golestotal=None self.marcaprimero=None self.encajaprimero=None self.minimoR=0 self.maximoR=0 self.siguiente_jornada=None #Metodo __str__ llamado cuando se realice una llamada a imprimir por pantalla a la variable con la instancia de la clase def __str__(self): mensaje="Instancia para la jornada"+ str(self.jornada) return mensaje #Metodos set get para el valor de jornada def set_jornada(self, ultima_jornada): self.jornada=ultima_jornada def get_jornada(self): return self.jornada #Metodo que recoge la informacion contenida en general.txt para establecer los valores de # - clasif, partidosCasa, partidosFuera, infopartidos def procesar_clasificacion(self): fi=open('infotxt/general.txt', 'r') info = [i for i in fi] fi.close() #print(info) while '\n' in info: info.remove('\n') todo={} clasif={} partidoscasa={} partidosfuera={} ipartidos={} cont=0 for i in info: temp=i.split('\t') if not cont: eq=temp[1] aux=[] aux=[j for j in temp if j!=temp[1]] cont=1 else: for j in temp: aux.append(j) cont+=1 if cont==3: todo[eq]=aux[:] cont=0 aux.clear() for i in todo: aux=todo[i] clasif[i]=[aux[0], aux[1], aux[8], aux[2], aux[3], aux[4], aux[5], aux[6], aux[7]] partidoscasa[i]=aux[10:15] partidosfuera[i]=aux[21:26] ipartidos[i]=aux[27:32] ipartidos[i][4]=ipartidos[i][4][0:3] self.clasif=clasif self.partidosCasa=partidoscasa self.partidosFuera=partidosfuera self.infopartidos=ipartidos # Metodo que devuelve un array con todos los nombres de los equpipos (son keys de los maps) def get_equipos(self): return [i for i in self.clasif] # Metodos get para las variables asignadas tras la ejecucion del metodo clasificacion def get_clasif(self): return self.clasif def get_partidosCasa(self): return self.partidosCasa def get_partidosFuera(self): return self.partidosFuera def get_infopartidos(self): return self.infopartidos #Metodo que recoge la informacion en timing.txt para establecer los valores de # - timing, timing_partes, ratios, ratios_partes def procesar_timing(self): fi=open('infotxt/timing.txt', 'r') info = [i for i in fi] fi.close() timing={} timing_partes={} ratios={} ratios_partes={} for i in info: temp=i.split('\t') aux=temp[1:11] timing[temp[0]]=aux for i in info: temp=i.split('\t') aux=temp[10:13] timing_partes[temp[0]]=[aux[-2], aux[-1]] for i in timing: aux=timing[i] t=[] for j in aux: if j!='': if j[1]!=' ': a=int(j[0:2]) else: a=int(j[0]) if j[5]!=' ': b=int(j[4:6]) else: b=int(j[4]) ratio=a-b t.append(ratio) ratios[i]=t[:] t.clear() for i in timing_partes: aux=timing_partes[i] t=[] for j in aux: if j!='': if j[1]!=' ': a=int(j[0:2]) else: a=int(j[0]) if j[5]!='\\': b=int(j[4:6]) else: b=int(j[4]) ratio=a-b t.append(ratio) ratios_partes[i]=t[:] t.clear() self.timing=timing self.timing_partes=timing_partes self.ratios=ratios self.ratios_partes=ratios_partes # Metodos get para las variables asignadas tras la ejecucion del metodo timing def get_timing(self): return self.timing def get_timing_partes(self): return self.timing_partes def get_ratios(self): return self.ratios def get_ratios_partes(self): return self.ratios_partes #Metodo que recoge la informacion ya almacenada en ratios para establecer los valores de # - maximoR, minimoR def procesar_ratiomaxmin(self): if(self.ratios!=None): max_temp = min_temp = 0 for i in self.ratios: aux=self.ratios[i] if max(aux)>max_temp: max_temp=max(aux) if min(aux)<min_temp: min_temp=min(aux) self.maximoR=max_temp self.minimoR=min_temp # Metodos get para las variables asignadas tras la ejecucion del metodo procesar_ratiomaxmin def get_maximoR(self): return self.maximoR def get_minimoR(self): return self.minimoR #Metodo que recoge la informacion en goleslocal.txt, golesvisitante.txt, golestotal.txt para establecer los valores de # - gcasa, gfuera, gall def procesar_goles(self): info=[] gcasa={} gfuera={} gall={} #Goles Local fi=open('infotxt/goleslocal.txt', 'r') info = [ i for i in fi] for i in fi: info.append(i) fi.close() cont=0 for i in info: temp=i.split('\t') if not cont: eq=temp[0] aux=[] aux=[j for j in temp if j!=temp[0] and j!='\n' and j!=temp[2]] cont=1 else: for j in temp: if j!='': aux.append(j) if cont==1: gcasa[eq]=aux[:] gcasa[eq][6]=gcasa[eq][6][:-1] cont=0 aux.clear() info.clear() #Goles Visitante fi=open('infotxt/golesvisitante.txt', 'r') for i in fi: info.append(i) fi.close() cont=0 for i in info: temp=i.split('\t') if not cont: eq=temp[0] aux=[] aux=[j for j in temp if j!=temp[0] and j!='\n' and j!=temp[2]] cont=1 else: for j in temp: if j!='': aux.append(j) if cont==1: gfuera[eq]=aux[:] gfuera[eq][6]=gfuera[eq][6][:-1] cont=0 aux.clear() info.clear() #Goles Total fi=open('infotxt/golestotal.txt', 'r') for i in fi: info.append(i) fi.close() cont=0 for i in info: temp=i.split('\t') if not cont: eq=temp[0] aux=[] aux=[j for j in temp if j!=temp[0] and j!='\n' and j!=temp[2]] cont=1 else: for j in temp: if j!='': aux.append(j) if cont == 1: gall[eq]=aux[:] gall[eq][6]=gall[eq][6][:-1] cont=0 aux.clear() self.goleslocal=gcasa self.golesvisitante=gfuera self.golestotal=gall # Metodos get para las variables asignadas tras la ejecucion del metodo goles def get_golesLocal(self): return self.goleslocal def get_golesVisitante(self): return self.golesvisitante def get_golesTotal(self): return self.golestotal #Metodo que recoge la informacion en first.txt para establecer los valores de # - casa, fuera, empates0 def procesar_primero(self): fi=open('infotxt/first.txt', 'r') info = [i for i in fi] fi.close() casa={} fuera={} for i in info: temp2=i.split("\t") temp=[i for i in temp2 if i!=' ' and i!=' ' and i!=''] for i in temp: casa[temp[0]]=[temp[1:6]] fuera[temp[0]]=[temp[6], temp[7], temp[8], temp[9], temp[10]] empates={} for i in self.ratios: k=i[1:] empates[i]=int(casa[k][0][1])+int(fuera[k][1]) self.casa=casa self.fuera=fuera self.empates0=empates # Metodos get para las variables asignadas tras la ejecucion del metodo primero def get_casa(self): return self.casa def get_fuera(self): return self.fuera def get_empates0(self): return self.empates0 #Metodo que recoge la informacion en marcaprimero.txt para establecer los valores de # - marcaprimero def procesar_marcaprimero(self): info=[] victoria_primero={} fi=open('infotxt/marcaprimero.txt', 'r') for i in fi: info.append(i) fi.close() for i in info: temp2=i.split("\t") temp=[i for i in temp2 if i!=' ' and i!=' ' and i!=''] victoria_primero[temp[0][1:-1]]=[temp[3], temp[4], temp[5]] self.marcaprimero=victoria_primero #Metodo que recoge la informacion en encajaprimero.txt para establecer los valores de # - encajaprimero def procesar_encajaprimero(self): encaja_primero={} fi=open('infotxt/encajaprimero.txt', 'r') info = [i for i in fi] fi.close() for i in info: temp2=i.split("\t") temp=[i for i in temp2 if i!=' ' and i!=' ' and i!=''] encaja_primero[temp[0][1:-1]]=[temp[3], temp[4], temp[5]] self.encajaprimero=encaja_primero # Metodos get para las variables asignadas tras la ejecucion de los metodos marcaprimero y encajaprimero def get_marcaPrimero(self): return self.marcaprimero def get_encajaPrimero(self): return self.encajaprimero # Metodo que establece los valores de los partidos de la siguiente jornada def set_siguiente_jornada(self, partidos): self.siguiente_jornada=[] for i in partidos: self.siguiente_jornada.append(i) # Metodo que devuelve la lista de listas de los partidos de la siguiente jornada def get_siguiente_jornada(self): return self.siguiente_jornada # Metodo que compila la informacion al completo en la instancia actual def procesar_todo(self): self.procesar_clasificacion() self.procesar_timing() self.procesar_goles() self.procesar_primero() self.procesar_marcaprimero() self.procesar_encajaprimero() self.procesar_ratiomaxmin() # FIN CLASE INFO_LIGA #MAIN PARA MOSTRAR if __name__ == "__main__": j=7 test=info_liga(j) test.procesar_todo() #Para verificar si los datos se recolectaron correctamente print ('Valor de la jornada si se ingresa j = x get_jornada') print(test.get_jornada()) print ('\nValor de todos los equipos get_equipos') print(test.get_equipos()) print ('\nMuestra la clasificacion get_clasif') print(test.get_clasif()) print ('\nMuestra los partidos casa get_partidosCasa') print(test.get_partidosCasa()) print ('\nMuestra los partidos fuera get_partidosFuera') print(test.get_partidosFuera()) print ('\nMuestra la informacion de partidos get_infopartidos') print(test.get_infopartidos()) print ('\nMuestra el timing get_timing') print(test.get_timing()) print ('\nMuestra el timing partes get_timing_partes') print(test.get_timing_partes()) print ('\nMuestra ratios get_ratios') print(test.get_ratios()) print ('\nMuestra ratios partes get_ratios_partes') print(test.get_ratios_partes()) print ('\nMuestra maximo r get_maximoR') print(test.get_maximoR()) print ('\nMuestra minimo r get_minimoR') print(test.get_minimoR()) print ('\nMuestra goles local get_golesLocal') print(test.get_golesLocal()) print ('\nMuestra goles visitante get_golesVisitante') print(test.get_golesVisitante()) print ('\nMuestra goles total get_golesTotal') print(test.get_golesTotal()) print ('\nMuestra casa get_casa') print(test.get_casa()) print ('\nMuestra fuera get_fuera ') print(test.get_fuera()) print ('\nMuestra empates get_empates0 ') print(test.get_empates0()) print ('\nMuestra marca primero get_marcaPrimero') print(test.get_marcaPrimero()) print ('\nMuestra encaja primero get_encajaPrimero') print(test.get_encajaPrimero()) print ('\nMuestra siguiente jornada get_siguiente_jornada') print(test.get_siguiente_jornada())
{ "content_hash": "57e1670c73c28b9f346e4374ec0a1283", "timestamp": "", "source": "github", "line_count": 435, "max_line_length": 147, "avg_line_length": 32.52183908045977, "alnum_prop": 0.5270375344596028, "repo_name": "mariaesperanza/Pronosticador", "id": "b13c4e51d4b3117d98b37b4d885dede1b0487694", "size": "14196", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "recoleccion_info.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "21701" }, { "name": "HTML", "bytes": "57324" }, { "name": "Python", "bytes": "75252" } ], "symlink_target": "" }
"""Provides an API for generating Event protocol buffers.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import os.path import time import warnings from tensorflow.core.framework import graph_pb2 from tensorflow.core.framework import summary_pb2 from tensorflow.core.protobuf import meta_graph_pb2 from tensorflow.core.util import event_pb2 from tensorflow.python.eager import context from tensorflow.python.framework import meta_graph from tensorflow.python.framework import ops from tensorflow.python.platform import gfile from tensorflow.python.platform import tf_logging as logging from tensorflow.python.summary import plugin_asset from tensorflow.python.summary.writer.event_file_writer import EventFileWriter from tensorflow.python.summary.writer.event_file_writer_v2 import EventFileWriterV2 from tensorflow.python.util.tf_export import tf_export _PLUGINS_DIR = "plugins" class SummaryToEventTransformer(object): """Abstractly implements the SummaryWriter API. This API basically implements a number of endpoints (add_summary, add_session_log, etc). The endpoints all generate an event protobuf, which is passed to the contained event_writer. """ def __init__(self, event_writer, graph=None, graph_def=None): """Creates a `SummaryWriter` and an event file. On construction the summary writer creates a new event file in `logdir`. This event file will contain `Event` protocol buffers constructed when you call one of the following functions: `add_summary()`, `add_session_log()`, `add_event()`, or `add_graph()`. If you pass a `Graph` to the constructor it is added to the event file. (This is equivalent to calling `add_graph()` later). TensorBoard will pick the graph from the file and display it graphically so you can interactively explore the graph you built. You will usually pass the graph from the session in which you launched it: ```python ...create a graph... # Launch the graph in a session. sess = tf.compat.v1.Session() # Create a summary writer, add the 'graph' to the event file. writer = tf.compat.v1.summary.FileWriter(<some-directory>, sess.graph) ``` Args: event_writer: An EventWriter. Implements add_event and get_logdir. graph: A `Graph` object, such as `sess.graph`. graph_def: DEPRECATED: Use the `graph` argument instead. """ self.event_writer = event_writer # For storing used tags for session.run() outputs. self._session_run_tags = {} if graph is not None or graph_def is not None: # Calling it with both graph and graph_def for backward compatibility. self.add_graph(graph=graph, graph_def=graph_def) # Also export the meta_graph_def in this case. # graph may itself be a graph_def due to positional arguments maybe_graph_as_def = (graph.as_graph_def(add_shapes=True) if isinstance(graph, ops.Graph) else graph) self.add_meta_graph( meta_graph.create_meta_graph_def(graph_def=graph_def or maybe_graph_as_def)) # This set contains tags of Summary Values that have been encountered # already. The motivation here is that the SummaryWriter only keeps the # metadata property (which is a SummaryMetadata proto) of the first Summary # Value encountered for each tag. The SummaryWriter strips away the # SummaryMetadata for all subsequent Summary Values with tags seen # previously. This saves space. self._seen_summary_tags = set() def add_summary(self, summary, global_step=None): """Adds a `Summary` protocol buffer to the event file. This method wraps the provided summary in an `Event` protocol buffer and adds it to the event file. You can pass the result of evaluating any summary op, using `tf.Session.run` or `tf.Tensor.eval`, to this function. Alternatively, you can pass a `tf.compat.v1.Summary` protocol buffer that you populate with your own data. The latter is commonly done to report evaluation results in event files. Args: summary: A `Summary` protocol buffer, optionally serialized as a string. global_step: Number. Optional global step value to record with the summary. """ if isinstance(summary, bytes): summ = summary_pb2.Summary() summ.ParseFromString(summary) summary = summ # We strip metadata from values with tags that we have seen before in order # to save space - we just store the metadata on the first value with a # specific tag. for value in summary.value: if not value.metadata: continue if value.tag in self._seen_summary_tags: # This tag has been encountered before. Strip the metadata. value.ClearField("metadata") continue # We encounter a value with a tag we have not encountered previously. And # it has metadata. Remember to strip metadata from future values with this # tag string. self._seen_summary_tags.add(value.tag) event = event_pb2.Event(summary=summary) self._add_event(event, global_step) def add_session_log(self, session_log, global_step=None): """Adds a `SessionLog` protocol buffer to the event file. This method wraps the provided session in an `Event` protocol buffer and adds it to the event file. Args: session_log: A `SessionLog` protocol buffer. global_step: Number. Optional global step value to record with the summary. """ event = event_pb2.Event(session_log=session_log) self._add_event(event, global_step) def _add_graph_def(self, graph_def, global_step=None): graph_bytes = graph_def.SerializeToString() event = event_pb2.Event(graph_def=graph_bytes) self._add_event(event, global_step) def add_graph(self, graph, global_step=None, graph_def=None): """Adds a `Graph` to the event file. The graph described by the protocol buffer will be displayed by TensorBoard. Most users pass a graph in the constructor instead. Args: graph: A `Graph` object, such as `sess.graph`. global_step: Number. Optional global step counter to record with the graph. graph_def: DEPRECATED. Use the `graph` parameter instead. Raises: ValueError: If both graph and graph_def are passed to the method. """ if graph is not None and graph_def is not None: raise ValueError("Please pass only graph, or graph_def (deprecated), " "but not both.") if isinstance(graph, ops.Graph) or isinstance(graph_def, ops.Graph): # The user passed a `Graph`. # Check if the user passed it via the graph or the graph_def argument and # correct for that. if not isinstance(graph, ops.Graph): logging.warning("When passing a `Graph` object, please use the `graph`" " named argument instead of `graph_def`.") graph = graph_def # Serialize the graph with additional info. true_graph_def = graph.as_graph_def(add_shapes=True) self._write_plugin_assets(graph) elif (isinstance(graph, graph_pb2.GraphDef) or isinstance(graph_def, graph_pb2.GraphDef)): # The user passed a `GraphDef`. logging.warning("Passing a `GraphDef` to the SummaryWriter is deprecated." " Pass a `Graph` object instead, such as `sess.graph`.") # Check if the user passed it via the graph or the graph_def argument and # correct for that. if isinstance(graph, graph_pb2.GraphDef): true_graph_def = graph else: true_graph_def = graph_def else: # The user passed neither `Graph`, nor `GraphDef`. raise TypeError("The passed graph must be an instance of `Graph` " "or the deprecated `GraphDef`") # Finally, add the graph_def to the summary writer. self._add_graph_def(true_graph_def, global_step) def _write_plugin_assets(self, graph): plugin_assets = plugin_asset.get_all_plugin_assets(graph) logdir = self.event_writer.get_logdir() for asset_container in plugin_assets: plugin_name = asset_container.plugin_name plugin_dir = os.path.join(logdir, _PLUGINS_DIR, plugin_name) gfile.MakeDirs(plugin_dir) assets = asset_container.assets() for (asset_name, content) in assets.items(): asset_path = os.path.join(plugin_dir, asset_name) with gfile.Open(asset_path, "w") as f: f.write(content) def add_meta_graph(self, meta_graph_def, global_step=None): """Adds a `MetaGraphDef` to the event file. The `MetaGraphDef` allows running the given graph via `saver.import_meta_graph()`. Args: meta_graph_def: A `MetaGraphDef` object, often as returned by `saver.export_meta_graph()`. global_step: Number. Optional global step counter to record with the graph. Raises: TypeError: If both `meta_graph_def` is not an instance of `MetaGraphDef`. """ if not isinstance(meta_graph_def, meta_graph_pb2.MetaGraphDef): raise TypeError("meta_graph_def must be type MetaGraphDef, saw type: %s" % type(meta_graph_def)) meta_graph_bytes = meta_graph_def.SerializeToString() event = event_pb2.Event(meta_graph_def=meta_graph_bytes) self._add_event(event, global_step) def add_run_metadata(self, run_metadata, tag, global_step=None): """Adds a metadata information for a single session.run() call. Args: run_metadata: A `RunMetadata` protobuf object. tag: The tag name for this metadata. global_step: Number. Optional global step counter to record with the StepStats. Raises: ValueError: If the provided tag was already used for this type of event. """ if tag in self._session_run_tags: raise ValueError("The provided tag was already used for this event type") self._session_run_tags[tag] = True tagged_metadata = event_pb2.TaggedRunMetadata() tagged_metadata.tag = tag # Store the `RunMetadata` object as bytes in order to have postponed # (lazy) deserialization when used later. tagged_metadata.run_metadata = run_metadata.SerializeToString() event = event_pb2.Event(tagged_run_metadata=tagged_metadata) self._add_event(event, global_step) def _add_event(self, event, step): event.wall_time = time.time() if step is not None: event.step = int(step) self.event_writer.add_event(event) @tf_export(v1=["summary.FileWriter"]) class FileWriter(SummaryToEventTransformer): """Writes `Summary` protocol buffers to event files. The `FileWriter` class provides a mechanism to create an event file in a given directory and add summaries and events to it. The class updates the file contents asynchronously. This allows a training program to call methods to add data to the file directly from the training loop, without slowing down training. When constructed with a `tf.compat.v1.Session` parameter, a `FileWriter` instead forms a compatibility layer over new graph-based summaries (`tf.contrib.summary`) to facilitate the use of new summary writing with pre-existing code that expects a `FileWriter` instance. """ def __init__(self, logdir, graph=None, max_queue=10, flush_secs=120, graph_def=None, filename_suffix=None, session=None): """Creates a `FileWriter`, optionally shared within the given session. Typically, constructing a file writer creates a new event file in `logdir`. This event file will contain `Event` protocol buffers constructed when you call one of the following functions: `add_summary()`, `add_session_log()`, `add_event()`, or `add_graph()`. If you pass a `Graph` to the constructor it is added to the event file. (This is equivalent to calling `add_graph()` later). TensorBoard will pick the graph from the file and display it graphically so you can interactively explore the graph you built. You will usually pass the graph from the session in which you launched it: ```python ...create a graph... # Launch the graph in a session. sess = tf.compat.v1.Session() # Create a summary writer, add the 'graph' to the event file. writer = tf.compat.v1.summary.FileWriter(<some-directory>, sess.graph) ``` The `session` argument to the constructor makes the returned `FileWriter` a compatibility layer over new graph-based summaries (`tf.contrib.summary`). Crucially, this means the underlying writer resource and events file will be shared with any other `FileWriter` using the same `session` and `logdir`, and with any `tf.contrib.summary.SummaryWriter` in this session using the the same shared resource name (which by default scoped to the logdir). If no such resource exists, one will be created using the remaining arguments to this constructor, but if one already exists those arguments are ignored. In either case, ops will be added to `session.graph` to control the underlying file writer resource. See `tf.contrib.summary` for more details. Args: logdir: A string. Directory where event file will be written. graph: A `Graph` object, such as `sess.graph`. max_queue: Integer. Size of the queue for pending events and summaries. flush_secs: Number. How often, in seconds, to flush the pending events and summaries to disk. graph_def: DEPRECATED: Use the `graph` argument instead. filename_suffix: A string. Every event file's name is suffixed with `suffix`. session: A `tf.compat.v1.Session` object. See details above. Raises: RuntimeError: If called with eager execution enabled. @compatibility(eager) `FileWriter` is not compatible with eager execution. To write TensorBoard summaries under eager execution, use `tf.contrib.summary` instead. @end_compatibility """ if context.executing_eagerly(): raise RuntimeError( "tf.summary.FileWriter is not compatible with eager execution. " "Use tf.contrib.summary instead.") if session is not None: event_writer = EventFileWriterV2( session, logdir, max_queue, flush_secs, filename_suffix) else: event_writer = EventFileWriter(logdir, max_queue, flush_secs, filename_suffix) self._closed = False super(FileWriter, self).__init__(event_writer, graph, graph_def) def __enter__(self): """Make usable with "with" statement.""" return self def __exit__(self, unused_type, unused_value, unused_traceback): """Make usable with "with" statement.""" self.close() def get_logdir(self): """Returns the directory where event file will be written.""" return self.event_writer.get_logdir() def _warn_if_event_writer_is_closed(self): if self._closed: warnings.warn("Attempting to use a closed FileWriter. " "The operation will be a noop unless the FileWriter " "is explicitly reopened.") def _add_event(self, event, step): self._warn_if_event_writer_is_closed() super(FileWriter, self)._add_event(event, step) def add_event(self, event): """Adds an event to the event file. Args: event: An `Event` protocol buffer. """ self._warn_if_event_writer_is_closed() self.event_writer.add_event(event) def flush(self): """Flushes the event file to disk. Call this method to make sure that all pending events have been written to disk. """ # Flushing a closed EventFileWriterV2 raises an exception. It is, # however, a noop for EventFileWriter. self._warn_if_event_writer_is_closed() self.event_writer.flush() def close(self): """Flushes the event file to disk and close the file. Call this method when you do not need the summary writer anymore. """ self.event_writer.close() self._closed = True def reopen(self): """Reopens the EventFileWriter. Can be called after `close()` to add more events in the same directory. The events will go into a new events file. Does nothing if the EventFileWriter was not closed. """ self.event_writer.reopen() self._closed = False
{ "content_hash": "4aaf7d3ac234782e3dd57c74cc9c94b1", "timestamp": "", "source": "github", "line_count": 417, "max_line_length": 83, "avg_line_length": 39.51558752997602, "alnum_prop": 0.6844277218108994, "repo_name": "adit-chandra/tensorflow", "id": "9757ed7db4f4c52582ee59084cf045693f23211a", "size": "17167", "binary": false, "copies": "7", "ref": "refs/heads/master", "path": "tensorflow/python/summary/writer/writer.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Assembly", "bytes": "5003" }, { "name": "Batchfile", "bytes": "45988" }, { "name": "C", "bytes": "773694" }, { "name": "C#", "bytes": "8562" }, { "name": "C++", "bytes": "76734263" }, { "name": "CMake", "bytes": "6545" }, { "name": "Dockerfile", "bytes": "81136" }, { "name": "Go", "bytes": "1679107" }, { "name": "HTML", "bytes": "4686483" }, { "name": "Java", "bytes": "952944" }, { "name": "Jupyter Notebook", "bytes": "567243" }, { "name": "LLVM", "bytes": "6536" }, { "name": "MLIR", "bytes": "1299322" }, { "name": "Makefile", "bytes": "61397" }, { "name": "Objective-C", "bytes": "104706" }, { "name": "Objective-C++", "bytes": "297753" }, { "name": "PHP", "bytes": "24055" }, { "name": "Pascal", "bytes": "3752" }, { "name": "Pawn", "bytes": "17546" }, { "name": "Perl", "bytes": "7536" }, { "name": "Python", "bytes": "38764318" }, { "name": "RobotFramework", "bytes": "891" }, { "name": "Ruby", "bytes": "7459" }, { "name": "Shell", "bytes": "643787" }, { "name": "Smarty", "bytes": "34727" }, { "name": "Swift", "bytes": "62814" } ], "symlink_target": "" }
"""Rename ``concurrency`` column in ``dag`` table to`` max_active_tasks`` Revision ID: 30867afad44a Revises: e9304a3141f0 Create Date: 2021-06-04 22:11:19.849981 """ from __future__ import annotations import sqlalchemy as sa from alembic import op # revision identifiers, used by Alembic. revision = '30867afad44a' down_revision = 'e9304a3141f0' branch_labels = None depends_on = None airflow_version = '2.2.0' def upgrade(): """Apply Rename ``concurrency`` column in ``dag`` table to`` max_active_tasks``""" conn = op.get_bind() is_sqlite = bool(conn.dialect.name == "sqlite") if is_sqlite: op.execute("PRAGMA foreign_keys=off") with op.batch_alter_table('dag') as batch_op: batch_op.alter_column( 'concurrency', new_column_name='max_active_tasks', type_=sa.Integer(), nullable=False, ) if is_sqlite: op.execute("PRAGMA foreign_keys=on") def downgrade(): """Unapply Rename ``concurrency`` column in ``dag`` table to`` max_active_tasks``""" with op.batch_alter_table('dag') as batch_op: batch_op.alter_column( 'max_active_tasks', new_column_name='concurrency', type_=sa.Integer(), nullable=False, )
{ "content_hash": "5251af9466a27df4fcd70dcf368fdc02", "timestamp": "", "source": "github", "line_count": 47, "max_line_length": 88, "avg_line_length": 27.319148936170212, "alnum_prop": 0.617601246105919, "repo_name": "cfei18/incubator-airflow", "id": "44c74778362467a7371f23e27a76f6c4586c2cf5", "size": "2071", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "airflow/migrations/versions/0090_2_2_0_rename_concurrency_column_in_dag_table_.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "25980" }, { "name": "Dockerfile", "bytes": "72003" }, { "name": "HCL", "bytes": "3786" }, { "name": "HTML", "bytes": "173434" }, { "name": "JavaScript", "bytes": "143068" }, { "name": "Jinja", "bytes": "38808" }, { "name": "Jupyter Notebook", "bytes": "5482" }, { "name": "Mako", "bytes": "1339" }, { "name": "Python", "bytes": "22660683" }, { "name": "R", "bytes": "313" }, { "name": "Shell", "bytes": "312715" }, { "name": "TypeScript", "bytes": "472379" } ], "symlink_target": "" }
from test.vim_test_case import VimTestCase as _VimTest from test.constant import * from test.util import running_on_windows class _ExpandTabs(_VimTest): def _extra_vim_config(self, vim_config): vim_config.append("set sw=3") vim_config.append("set expandtab") class RecTabStopsWithExpandtab_SimpleExample_ECR(_ExpandTabs): snippets = ("m", "\tBlaahblah \t\t ") keys = "m" + EX wanted = " Blaahblah \t\t " class RecTabStopsWithExpandtab_SpecialIndentProblem_ECR(_ExpandTabs): # Windows indents the Something line after pressing return, though it # shouldn't because it contains a manual indent. All other vim versions do # not do this. Windows vim does not interpret the changes made by :py as # changes made 'manually', while the other vim version seem to do so. Since # the fault is not with UltiSnips, we simply skip this test on windows # completely. skip_if = lambda self: running_on_windows() snippets = (("m1", "Something"), ("m", "\t$0")) keys = "m" + EX + "m1" + EX + "\nHallo" wanted = " Something\n Hallo" def _extra_vim_config(self, vim_config): _ExpandTabs._extra_vim_config(self, vim_config) vim_config.append("set indentkeys=o,O,*<Return>,<>>,{,}") vim_config.append("set indentexpr=8") class ProperIndenting_SimpleCase_ECR(_VimTest): snippets = ("test", "for\n blah") keys = " test" + EX + "Hui" wanted = " for\n blahHui" class ProperIndenting_SingleLineNoReindenting_ECR(_VimTest): snippets = ("test", "hui") keys = " test" + EX + "blah" wanted = " huiblah" class ProperIndenting_AutoIndentAndNewline_ECR(_VimTest): snippets = ("test", "hui") keys = " test" + EX + "\n" + "blah" wanted = " hui\n blah" def _extra_vim_config(self, vim_config): vim_config.append("set autoindent") # Test for bug 1073816 class ProperIndenting_FirstLineInFile_ECR(_VimTest): text_before = "" text_after = "" files = { "us/all.snippets": r""" global !p def complete(t, opts): if t: opts = [ m[len(t):] for m in opts if m.startswith(t) ] if len(opts) == 1: return opts[0] elif len(opts) > 1: return "(" + "|".join(opts) + ")" else: return "" endglobal snippet '^#?inc' "#include <>" !r #include <$1`!p snip.rv = complete(t[1], ['cassert', 'cstdio', 'cstdlib', 'cstring', 'fstream', 'iostream', 'sstream'])`> endsnippet """ } keys = "inc" + EX + "foo" wanted = "#include <foo>" class ProperIndenting_FirstLineInFileComplete_ECR(ProperIndenting_FirstLineInFile_ECR): keys = "inc" + EX + "cstdl" wanted = "#include <cstdlib>" class _FormatoptionsBase(_VimTest): def _extra_vim_config(self, vim_config): vim_config.append("set tw=20") vim_config.append("set fo=lrqntc") class FOSimple_Break_ExpectCorrectResult(_FormatoptionsBase): snippets = ("test", "${1:longer expand}\n$1\n$0", "", "f") keys = ( "test" + EX + "This is a longer text that should wrap as formatoptions are enabled" + JF + "end" ) wanted = ( "This is a longer\ntext that should\nwrap as\nformatoptions are\nenabled\n" + "This is a longer\ntext that should\nwrap as\nformatoptions are\nenabled\n" + "end" ) class FOTextBeforeAndAfter_ExpectCorrectResult(_FormatoptionsBase): snippets = ("test", "Before${1:longer expand}After\nstart$1end") keys = "test" + EX + "This is a longer text that should wrap" wanted = """BeforeThis is a longer text that should wrapAfter startThis is a longer text that should wrapend""" # Tests for https://bugs.launchpad.net/bugs/719998 class FOTextAfter_ExpectCorrectResult(_FormatoptionsBase): snippets = ("test", "${1:longer expand}after\nstart$1end") keys = ( "test" + EX + "This is a longer snippet that should wrap properly " "and the mirror below should work as well" ) wanted = """This is a longer snippet that should wrap properly and the mirror below should work as wellafter startThis is a longer snippet that should wrap properly and the mirror below should work as wellend""" class FOWrapOnLongWord_ExpectCorrectResult(_FormatoptionsBase): snippets = ("test", "${1:longer expand}after\nstart$1end") keys = "test" + EX + "This is a longersnippet that should wrap properly" wanted = """This is a longersnippet that should wrap properlyafter startThis is a longersnippet that should wrap properlyend"""
{ "content_hash": "e8e6a884c605f4436ec415537f8b0981", "timestamp": "", "source": "github", "line_count": 151, "max_line_length": 121, "avg_line_length": 30.1523178807947, "alnum_prop": 0.6479244454206018, "repo_name": "khatchad/vimrc", "id": "8c5c3152d76aa0742eb697c1f673b7f15363e469", "size": "4553", "binary": false, "copies": "5", "ref": "refs/heads/master", "path": "sources_non_forked/ultisnips/test/test_Format.py", "mode": "33188", "license": "mit", "language": [ { "name": "Batchfile", "bytes": "961" }, { "name": "C", "bytes": "11028" }, { "name": "C#", "bytes": "1235" }, { "name": "C++", "bytes": "3464" }, { "name": "CMake", "bytes": "3900" }, { "name": "CSS", "bytes": "950" }, { "name": "Clojure", "bytes": "720" }, { "name": "CoffeeScript", "bytes": "11440" }, { "name": "Crystal", "bytes": "9834" }, { "name": "Dart", "bytes": "4388" }, { "name": "Dockerfile", "bytes": "2148" }, { "name": "Elixir", "bytes": "1903" }, { "name": "Elm", "bytes": "5333" }, { "name": "Emacs Lisp", "bytes": "4563" }, { "name": "Go", "bytes": "1113" }, { "name": "HTML", "bytes": "1634" }, { "name": "Haml", "bytes": "39" }, { "name": "Haskell", "bytes": "863" }, { "name": "Java", "bytes": "9033" }, { "name": "JavaScript", "bytes": "10452" }, { "name": "Lua", "bytes": "19732" }, { "name": "Makefile", "bytes": "16292" }, { "name": "PHP", "bytes": "2726" }, { "name": "PowerShell", "bytes": "10114" }, { "name": "PureScript", "bytes": "7576" }, { "name": "Python", "bytes": "392724" }, { "name": "R", "bytes": "1288" }, { "name": "Ruby", "bytes": "119025" }, { "name": "Rust", "bytes": "6153" }, { "name": "SCSS", "bytes": "1801" }, { "name": "Scala", "bytes": "1504" }, { "name": "Shell", "bytes": "40972" }, { "name": "TypeScript", "bytes": "4661" }, { "name": "VBScript", "bytes": "7510" }, { "name": "Vim Script", "bytes": "13029765" }, { "name": "Vim Snippet", "bytes": "785859" }, { "name": "Vue", "bytes": "662" } ], "symlink_target": "" }
""" PHP date() style date formatting See http://www.php.net/date for format strings Usage: >>> import datetime >>> d = datetime.datetime.now() >>> df = DateFormat(d) >>> print(df.format('jS F Y H:i')) 7th October 2003 11:39 >>> """ from __future__ import unicode_literals import calendar import datetime import re import time from django.utils import six from django.utils.dates import ( MONTHS, MONTHS_3, MONTHS_ALT, MONTHS_AP, WEEKDAYS, WEEKDAYS_ABBR, ) from django.utils.encoding import force_text from django.utils.timezone import get_default_timezone, is_aware, is_naive from django.utils.translation import ugettext as _ re_formatchars = re.compile(r'(?<!\\)([aAbBcdDeEfFgGhHiIjlLmMnNoOPrsStTUuwWyYzZ])') re_escaped = re.compile(r'\\(.)') class Formatter(object): def format(self, formatstr): pieces = [] for i, piece in enumerate(re_formatchars.split(force_text(formatstr))): if i % 2: pieces.append(force_text(getattr(self, piece)())) elif piece: pieces.append(re_escaped.sub(r'\1', piece)) return ''.join(pieces) class TimeFormat(Formatter): def __init__(self, obj): self.data = obj self.timezone = None # We only support timezone when formatting datetime objects, # not date objects (timezone information not appropriate), # or time objects (against established django policy). if isinstance(obj, datetime.datetime): if is_naive(obj): self.timezone = get_default_timezone() else: self.timezone = obj.tzinfo def a(self): "'a.m.' or 'p.m.'" if self.data.hour > 11: return _('p.m.') return _('a.m.') def A(self): "'AM' or 'PM'" if self.data.hour > 11: return _('PM') return _('AM') def B(self): "Swatch Internet time" raise NotImplementedError('may be implemented in a future release') def e(self): """ Timezone name. If timezone information is not available, this method returns an empty string. """ if not self.timezone: return "" try: if hasattr(self.data, 'tzinfo') and self.data.tzinfo: # Have to use tzinfo.tzname and not datetime.tzname # because datatime.tzname does not expect Unicode return self.data.tzinfo.tzname(self.data) or "" except NotImplementedError: pass return "" def f(self): """ Time, in 12-hour hours and minutes, with minutes left off if they're zero. Examples: '1', '1:30', '2:05', '2' Proprietary extension. """ if self.data.minute == 0: return self.g() return '%s:%s' % (self.g(), self.i()) def g(self): "Hour, 12-hour format without leading zeros; i.e. '1' to '12'" if self.data.hour == 0: return 12 if self.data.hour > 12: return self.data.hour - 12 return self.data.hour def G(self): "Hour, 24-hour format without leading zeros; i.e. '0' to '23'" return self.data.hour def h(self): "Hour, 12-hour format; i.e. '01' to '12'" return '%02d' % self.g() def H(self): "Hour, 24-hour format; i.e. '00' to '23'" return '%02d' % self.G() def i(self): "Minutes; i.e. '00' to '59'" return '%02d' % self.data.minute def O(self): """ Difference to Greenwich time in hours; e.g. '+0200', '-0430'. If timezone information is not available, this method returns an empty string. """ if not self.timezone: return "" seconds = self.Z() if seconds == "": return "" sign = '-' if seconds < 0 else '+' seconds = abs(seconds) return "%s%02d%02d" % (sign, seconds // 3600, (seconds // 60) % 60) def P(self): """ Time, in 12-hour hours, minutes and 'a.m.'/'p.m.', with minutes left off if they're zero and the strings 'midnight' and 'noon' if appropriate. Examples: '1 a.m.', '1:30 p.m.', 'midnight', 'noon', '12:30 p.m.' Proprietary extension. """ if self.data.minute == 0 and self.data.hour == 0: return _('midnight') if self.data.minute == 0 and self.data.hour == 12: return _('noon') return '%s %s' % (self.f(), self.a()) def s(self): "Seconds; i.e. '00' to '59'" return '%02d' % self.data.second def T(self): """ Time zone of this machine; e.g. 'EST' or 'MDT'. If timezone information is not available, this method returns an empty string. """ if not self.timezone: return "" name = None try: name = self.timezone.tzname(self.data) except Exception: # pytz raises AmbiguousTimeError during the autumn DST change. # This happens mainly when __init__ receives a naive datetime # and sets self.timezone = get_default_timezone(). pass if name is None: name = self.format('O') return six.text_type(name) def u(self): "Microseconds; i.e. '000000' to '999999'" return '%06d' % self.data.microsecond def Z(self): """ Time zone offset in seconds (i.e. '-43200' to '43200'). The offset for timezones west of UTC is always negative, and for those east of UTC is always positive. If timezone information is not available, this method returns an empty string. """ if not self.timezone: return "" try: offset = self.timezone.utcoffset(self.data) except Exception: # pytz raises AmbiguousTimeError during the autumn DST change. # This happens mainly when __init__ receives a naive datetime # and sets self.timezone = get_default_timezone(). return "" # `offset` is a datetime.timedelta. For negative values (to the west of # UTC) only days can be negative (days=-1) and seconds are always # positive. e.g. UTC-1 -> timedelta(days=-1, seconds=82800, microseconds=0) # Positive offsets have days=0 return offset.days * 86400 + offset.seconds class DateFormat(TimeFormat): year_days = [None, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334] def b(self): "Month, textual, 3 letters, lowercase; e.g. 'jan'" return MONTHS_3[self.data.month] def c(self): """ ISO 8601 Format Example : '2008-01-02T10:30:00.000123' """ return self.data.isoformat() def d(self): "Day of the month, 2 digits with leading zeros; i.e. '01' to '31'" return '%02d' % self.data.day def D(self): "Day of the week, textual, 3 letters; e.g. 'Fri'" return WEEKDAYS_ABBR[self.data.weekday()] def E(self): "Alternative month names as required by some locales. Proprietary extension." return MONTHS_ALT[self.data.month] def F(self): "Month, textual, long; e.g. 'January'" return MONTHS[self.data.month] def I(self): "'1' if Daylight Savings Time, '0' otherwise." try: if self.timezone and self.timezone.dst(self.data): return '1' else: return '0' except Exception: # pytz raises AmbiguousTimeError during the autumn DST change. # This happens mainly when __init__ receives a naive datetime # and sets self.timezone = get_default_timezone(). return '' def j(self): "Day of the month without leading zeros; i.e. '1' to '31'" return self.data.day def l(self): "Day of the week, textual, long; e.g. 'Friday'" return WEEKDAYS[self.data.weekday()] def L(self): "Boolean for whether it is a leap year; i.e. True or False" return calendar.isleap(self.data.year) def m(self): "Month; i.e. '01' to '12'" return '%02d' % self.data.month def M(self): "Month, textual, 3 letters; e.g. 'Jan'" return MONTHS_3[self.data.month].title() def n(self): "Month without leading zeros; i.e. '1' to '12'" return self.data.month def N(self): "Month abbreviation in Associated Press style. Proprietary extension." return MONTHS_AP[self.data.month] def o(self): "ISO 8601 year number matching the ISO week number (W)" return self.data.isocalendar()[0] def r(self): "RFC 2822 formatted date; e.g. 'Thu, 21 Dec 2000 16:01:07 +0200'" return self.format('D, j M Y H:i:s O') def S(self): "English ordinal suffix for the day of the month, 2 characters; i.e. 'st', 'nd', 'rd' or 'th'" if self.data.day in (11, 12, 13): # Special case return 'th' last = self.data.day % 10 if last == 1: return 'st' if last == 2: return 'nd' if last == 3: return 'rd' return 'th' def t(self): "Number of days in the given month; i.e. '28' to '31'" return '%02d' % calendar.monthrange(self.data.year, self.data.month)[1] def U(self): "Seconds since the Unix epoch (January 1 1970 00:00:00 GMT)" if isinstance(self.data, datetime.datetime) and is_aware(self.data): return int(calendar.timegm(self.data.utctimetuple())) else: return int(time.mktime(self.data.timetuple())) def w(self): "Day of the week, numeric, i.e. '0' (Sunday) to '6' (Saturday)" return (self.data.weekday() + 1) % 7 def W(self): "ISO-8601 week number of year, weeks starting on Monday" # Algorithm from http://www.personal.ecu.edu/mccartyr/ISOwdALG.txt week_number = None jan1_weekday = self.data.replace(month=1, day=1).weekday() + 1 weekday = self.data.weekday() + 1 day_of_year = self.z() if day_of_year <= (8 - jan1_weekday) and jan1_weekday > 4: if jan1_weekday == 5 or (jan1_weekday == 6 and calendar.isleap(self.data.year - 1)): week_number = 53 else: week_number = 52 else: if calendar.isleap(self.data.year): i = 366 else: i = 365 if (i - day_of_year) < (4 - weekday): week_number = 1 else: j = day_of_year + (7 - weekday) + (jan1_weekday - 1) week_number = j // 7 if jan1_weekday > 4: week_number -= 1 return week_number def y(self): "Year, 2 digits; e.g. '99'" return six.text_type(self.data.year)[2:] def Y(self): "Year, 4 digits; e.g. '1999'" return self.data.year def z(self): "Day of the year; i.e. '0' to '365'" doy = self.year_days[self.data.month] + self.data.day if self.L() and self.data.month > 2: doy += 1 return doy def format(value, format_string): "Convenience function" df = DateFormat(value) return df.format(format_string) def time_format(value, format_string): "Convenience function" tf = TimeFormat(value) return tf.format(format_string)
{ "content_hash": "d257cddc6e4682b0ca3c2459ae33b42e", "timestamp": "", "source": "github", "line_count": 373, "max_line_length": 102, "avg_line_length": 32.07774798927614, "alnum_prop": 0.5370664437944004, "repo_name": "yephper/django", "id": "2f6ad431f60e0154db1c2cd63cb57c30205e8739", "size": "11965", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "django/utils/dateformat.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "ASP", "bytes": "1538" }, { "name": "CSS", "bytes": "1697381" }, { "name": "HTML", "bytes": "390772" }, { "name": "Java", "bytes": "588" }, { "name": "JavaScript", "bytes": "3172126" }, { "name": "Makefile", "bytes": "134" }, { "name": "PHP", "bytes": "19336" }, { "name": "Python", "bytes": "13365273" }, { "name": "Shell", "bytes": "837" }, { "name": "Smarty", "bytes": "133" } ], "symlink_target": "" }
class UdacityPipeline(object): def process_item(self, item, spider): return item
{ "content_hash": "f7662107a07e31ddd9a0f4007131c7b4", "timestamp": "", "source": "github", "line_count": 3, "max_line_length": 41, "avg_line_length": 31, "alnum_prop": 0.6881720430107527, "repo_name": "cdhekne/Masters_Thesis", "id": "10d6761318c86a7c4afccb0eed2ea490358bc992", "size": "287", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "Thesis_WebCrawler/udacity/udacity/pipelines.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "ApacheConf", "bytes": "466" }, { "name": "CSS", "bytes": "464970" }, { "name": "HTML", "bytes": "368686" }, { "name": "Java", "bytes": "84571" }, { "name": "JavaScript", "bytes": "556245" }, { "name": "PHP", "bytes": "14557" }, { "name": "Python", "bytes": "11890" }, { "name": "Web Ontology Language", "bytes": "40414" } ], "symlink_target": "" }
import sys import random import string import pycurl import json #STEP 2 INIT BOOLS josh = False bcheap = False ncheap = False decided = False #STEP 3 CHECK ARGS, WARN FOR SHIT INPUT if len(sys.argv) > 2: if (sys.argv[1] == 'cheap' and sys.argv[2] == 'ncheap') or (sys.argv[1] == 'ncheap' and sys.argv[2] == 'cheap'): print "ugh wtf are you doing? I am not writing the error handling for stupidity. You're gonna get cheap food" if len(sys.argv) > 1 and sys.argv[1]=='josh': josh = True elif len(sys.argv) > 1 and sys.argv[1]=='cheap': bcheap = True elif len(sys.argv) > 1 and sys.argv[1]=='ncheap': ncheap = True #STEP 4 KEEP CHECKING ARGS if len(sys.argv) > 2: if sys.argv[2]=='cheap': bcheap=True elif sys.argv[2] == 'ncheap': ncheap=True else: print "You fucked up... discarding arg " + sys.argv[2] #OPEN THEM DATA FILES FOR READ/READ+ Cheap = open("cheapeats.txt","r") NotCheap = open("notcheapeats.txt","r") Veto = open("vetolist.txt","r") AteThere = open("atethere.txt","r+") #READ THEM DATAFILES, FILL THEM LISTS cheapeats = Cheap.readlines() notcheapeats = NotCheap.readlines() veto = Veto.readlines() atethere = AteThere.readlines() #CHECK AGAINST LAST 5 PLACES EATEN AT if len(atethere) > 5: AteThere.close() AteThere = open("atethere.txt",'w') i = 1 for item in range(1,6): AteThere.write(atethere[i]) i=i+1 #CLEAR THE DATAFILE, REWRITE LAST PLACES EATEN AT FROM LIST AteThere.close() NotAgain = open("atethere.txt","r") notagain = NotAgain.readlines() #CHECK CASES FOR CHEAP OR NOT CHEAT OPTIONS, CONCATENATE LISTS if not bcheap and not ncheap: eats = cheapeats+notcheapeats elif (bcheap): eats = cheapeats elif (ncheap): eats = notcheapeats #REMOVE ANYTHING IN LIST THAT WAS CHOSEN LAST 5 TIMES eats = [x for x in eats if x not in notagain] #IF JOSH IS COMING, SCRUB ENTRIES THAT HE DOESN'T LIKE if (josh): eats = [x for x in eats if x not in veto] #SEED RANDOM FUNCTION while not (decided): secure_random = random.SystemRandom() #SELECT LUNCH SPOT lunch = secure_random.choice(eats) #RUN AND TELL DAT TO CONSOLE print lunch #DID GROUP ACCEPT CHOICE? IF SO KILL LOOP vote = raw_input("Yay or nay?") if (vote == 'y' or vote == 'Y' or vote == 'Yay'): decided = True #ADD CHOICE TO ATE THERE LIST AteThere=open("atethere.txt","a") AteThere.write(lunch) AteThere.close() #RUN AND TELL DAT TO SLACK #DEFINE JSON MESSAGE: data = json.dumps({"username": "LUNCH WILL BE AT:", "icon_emoji": ":hamburger:", "text": lunch}) #DEFINE SLACK WEBHOOK URL: slackurl='https://hooks.slack.com/services/PUT/YOURURL/HERE' #Create CURL object c = pycurl.Curl() #Define CURL Paramters c.setopt(c.URL, slackurl) c.setopt(c.HTTPHEADER, [ 'Content-Type: application/json' ]) c.setopt(c.POSTFIELDS, data) c.setopt(pycurl.POST, 1) #POST TO SLACK c.perform()
{ "content_hash": "bb402a5f8130ae9af7afa029160868b1", "timestamp": "", "source": "github", "line_count": 110, "max_line_length": 113, "avg_line_length": 25.472727272727273, "alnum_prop": 0.7009279086366881, "repo_name": "packetracer/lunch", "id": "41a299d4ab02273f421729fa4c84beff5a10a1f1", "size": "2867", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "lunch.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "2867" } ], "symlink_target": "" }
from backend.common.consts.award_type import AwardType class DistrictPointValues: """ A class that contains various district point constants over the years: Documents containing point systems: - 2016: same as 2015 - 2015: http://www.firstinspires.org/sites/default/files/uploads/resource_library/frc/game-and-season-info/archive/2015/AdminManual20150407.pdf - 2014: http://www.firstinmichigan.org/FRC_2014/District_Standard_Points_Ranking_System.pdf - 2013: http://www.firstinmichigan.org/FRC_2013/2013_Rules_Supplement.pdf - 2012: http://www.firstinmichigan.org/FRC_2012/2012_Rules_Supplement.pdf - 2011: http://www.firstinmichigan.org/FRC_2011/2011_Rules_Supplement.pdf - 2010: http://www.firstinmichigan.org/FRC_2010/2010_Update_3.pdf - 2009: https://www.chiefdelphi.com/forums/showpost.php?p=759453&postcount=67 """ STANDARD_MULTIPLIER = 1 # Since 2014, points earned at District CMP has 3x bonus DISTRICT_CMP_MULIPLIER_DEFAULT = 3 DISTRICT_CMP_MULTIPLIER = {2013: 1, 2012: 1, 2011: 1, 2010: 1, 2009: 1} # In years prior to 2015, teams get points for a win/tie in a qualification match MATCH_WIN = 2 MATCH_TIE = 1 # Used to determine alliance selection points # Captain/First pick get 17-alliance number, second pick gets 17 - draft order ALLIANCE_MAX_DEFAULT = 17 # In 2009 - 2013 (except 2010), second pick teams got fewer elim round advancement points as captain/pick 1 # TODO many of these events don't have alliance selection data, so we can't factor this in ELIM_SECOND_PICK_MULTIPLIER_DEFAULT = 1 ELIM_SECOND_PICK_MULTIPLIER = {2013: 0.8, 2012: 0.8, 2011: 0.8, 2009: 0.8} # Used to determine elim/playoff points. # Teams on each round's winning alliance gets points per match won # For the 2015 game, these are awarded for participating in a qf/sf match, since there were no wins QF_WIN_DEFAULT = 5 QF_WIN = {2015: 5.0} SF_WIN_DEFAULT = 5 SF_WIN = { 2015: 3.3, } F_WIN_DEFAULT = 5 F_WIN = {2015: 5.0} # Chairman's Award CHAIRMANS_DEFAULT = 10 CHAIRMANS = {2013: 0, 2012: 0, 2011: 0, 2009: 0} # Engineering Inspiration and Rookie All-Star EI_AND_RAS_DEFAULT = 8 OTHER_AWARD_DEFAULT = 5 # Points for playing your first two events as # back-to-back single day events BACK_TO_BACK_2022_BONUS = 2 # Pre-2014 Awards, all worth either 5 or 2 points LEGACY_5_PT_AWARDS = { 2013: [ AwardType.INDUSTRIAL_DESIGN, AwardType.QUALITY, AwardType.ENGINEERING_EXCELLENCE, AwardType.INNOVATION_IN_CONTROL, AwardType.CREATIVITY, ], 2012: [ AwardType.INDUSTRIAL_DESIGN, AwardType.QUALITY, AwardType.ENGINEERING_EXCELLENCE, AwardType.INNOVATION_IN_CONTROL, AwardType.CREATIVITY, AwardType.ENTREPRENEURSHIP, AwardType.COOPERTITION, ], 2011: [ AwardType.INDUSTRIAL_DESIGN, AwardType.QUALITY, AwardType.ENGINEERING_EXCELLENCE, AwardType.INNOVATION_IN_CONTROL, AwardType.CREATIVITY, AwardType.ENTREPRENEURSHIP, AwardType.COOPERTITION, AwardType.EXCELLENCE_IN_DESIGN, ], 2010: [ AwardType.INDUSTRIAL_DESIGN, AwardType.QUALITY, AwardType.ENGINEERING_EXCELLENCE, AwardType.INNOVATION_IN_CONTROL, AwardType.CREATIVITY, AwardType.ROOKIE_ALL_STAR, AwardType.ENGINEERING_INSPIRATION, AwardType.ENTREPRENEURSHIP, AwardType.COOPERTITION, ], 2009: [ AwardType.INDUSTRIAL_DESIGN, AwardType.QUALITY, AwardType.DRIVING_TOMORROWS_TECHNOLOGY, AwardType.INNOVATION_IN_CONTROL, AwardType.CREATIVITY, ], } LEGACY_2_PT_AWARDS = { 2013: [ AwardType.SPIRIT, AwardType.GRACIOUS_PROFESSIONALISM, AwardType.IMAGERY, AwardType.HIGHEST_ROOKIE_SEED, AwardType.SAFETY, AwardType.JUDGES, AwardType.ROOKIE_INSPIRATION, ], 2012: [ AwardType.SPIRIT, AwardType.GRACIOUS_PROFESSIONALISM, AwardType.IMAGERY, AwardType.HIGHEST_ROOKIE_SEED, AwardType.SAFETY, AwardType.JUDGES, AwardType.ROOKIE_INSPIRATION, AwardType.WEBSITE, ], 2011: [ AwardType.SPIRIT, AwardType.GRACIOUS_PROFESSIONALISM, AwardType.IMAGERY, AwardType.HIGHEST_ROOKIE_SEED, AwardType.SAFETY, AwardType.JUDGES, AwardType.ROOKIE_INSPIRATION, AwardType.WEBSITE, ], 2010: [ AwardType.SPIRIT, AwardType.GRACIOUS_PROFESSIONALISM, AwardType.IMAGERY, AwardType.HIGHEST_ROOKIE_SEED, AwardType.SAFETY, AwardType.JUDGES, AwardType.ROOKIE_INSPIRATION, AwardType.WEBSITE, ], 2009: [ AwardType.SPIRIT, AwardType.GRACIOUS_PROFESSIONALISM, AwardType.IMAGERY, AwardType.JUDGES, AwardType.ROOKIE_INSPIRATION, AwardType.SAFETY, AwardType.WSU_AIM_HIGHER, AwardType.WEBSITE, ], }
{ "content_hash": "0612eccef2aed7a821e59d7ebb2505bd", "timestamp": "", "source": "github", "line_count": 161, "max_line_length": 148, "avg_line_length": 34.422360248447205, "alnum_prop": 0.6086250451100685, "repo_name": "the-blue-alliance/the-blue-alliance", "id": "767443f515835cbcbdfab1204610c60401f3331a", "size": "5542", "binary": false, "copies": "1", "ref": "refs/heads/py3", "path": "src/backend/common/consts/district_point_values.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "359032" }, { "name": "Dockerfile", "bytes": "2503" }, { "name": "HTML", "bytes": "5877313" }, { "name": "JavaScript", "bytes": "755910" }, { "name": "Less", "bytes": "244218" }, { "name": "PHP", "bytes": "10727" }, { "name": "Pug", "bytes": "1857" }, { "name": "Python", "bytes": "4321885" }, { "name": "Ruby", "bytes": "4677" }, { "name": "Shell", "bytes": "27698" } ], "symlink_target": "" }
""" Garret's python vs panda comparison of speed for matching N**2 problem""" # `list(enumerate(sents))` and `dict(map(lambda x: x[::-1], enumerate(sents))` import pandas as pd
{ "content_hash": "351da8da15e38564293b962df706028c", "timestamp": "", "source": "github", "line_count": 3, "max_line_length": 78, "avg_line_length": 59, "alnum_prop": 0.7005649717514124, "repo_name": "hobson/hobson.github.io", "id": "d83ce2be4b647c62e4d34d973644d1606f92659d", "size": "177", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "_posts/panda_vs_python.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "118834" }, { "name": "HTML", "bytes": "1145875" }, { "name": "JavaScript", "bytes": "57872" }, { "name": "Python", "bytes": "9253" }, { "name": "Ruby", "bytes": "13563" }, { "name": "Shell", "bytes": "7943" } ], "symlink_target": "" }
problem = """ 145 is a curious number, as 1! + 4! + 5! = 1 + 24 + 120 = 145. Find the sum of all numbers which are equal to the sum of the factorial of their digits. Note: as 1! = 1 and 2! = 2 are not sums they are not included. """ from math import factorial from itertools import takewhile, count, combinations_with_replacement, imap def largest_sum(num_digits): return largest_sum.f * num_digits largest_sum.f = factorial(9) def smallest_num(num_digits): return 10**(num_digits - 1) max_num_digits = max(takewhile(lambda num_digits: largest_sum(num_digits) >= smallest_num(num_digits), count(1))) numbers = set() base_digits = [0,1,2,3,4,5,6,7,8,9] for num_digits in range(1, max_num_digits+1): for x in combinations_with_replacement(zip(base_digits, map(factorial, base_digits)), num_digits): digits, digit_factorials = zip(*x) if len(digits) < 2: continue number = sum(digit_factorials) if (tuple(map(int, sorted(str(number)))) == digits): numbers.add(number) print sum(numbers)
{ "content_hash": "56ef54f7fba6462f24886e1a6b01e8d4", "timestamp": "", "source": "github", "line_count": 33, "max_line_length": 113, "avg_line_length": 32.15151515151515, "alnum_prop": 0.6654099905749293, "repo_name": "lorenyu/project-euler", "id": "782b5f9f6f1300262d14e90adef9c45518404e36", "size": "1061", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "problem-034.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "51438" } ], "symlink_target": "" }
""" Package for script API properties tests. """ __version__ = "$Revision-Id:$"
{ "content_hash": "27abb1be2f72f829425be25659a9dade", "timestamp": "", "source": "github", "line_count": 6, "max_line_length": 40, "avg_line_length": 14.166666666666666, "alnum_prop": 0.6, "repo_name": "DLR-SC/DataFinder", "id": "298ff964c7d2122ceca1ba1f61a52e51b10d1735", "size": "1781", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "test/unittest/datafinder_test/script_api/properties/__init__.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "NSIS", "bytes": "7649" }, { "name": "Python", "bytes": "7056802" }, { "name": "QMake", "bytes": "1975" } ], "symlink_target": "" }
"""Manifest validation.""" from typing import Dict import voluptuous as vol from voluptuous.humanize import humanize_error from .model import Integration MANIFEST_SCHEMA = vol.Schema({ vol.Required('domain'): str, vol.Required('name'): str, vol.Optional('config_flow'): bool, vol.Optional('zeroconf'): [str], vol.Optional('ssdp'): vol.Schema({ vol.Optional('st'): [str], vol.Optional('manufacturer'): [str], vol.Optional('device_type'): [str], }), vol.Optional('homekit'): vol.Schema({ vol.Optional('models'): [str], }), vol.Required('documentation'): str, vol.Required('requirements'): [str], vol.Required('dependencies'): [str], vol.Optional('after_dependencies'): [str], vol.Required('codeowners'): [str], }) def validate_manifest(integration: Integration): """Validate manifest.""" try: MANIFEST_SCHEMA(integration.manifest) except vol.Invalid as err: integration.add_error( 'manifest', "Invalid manifest: {}".format( humanize_error(integration.manifest, err))) integration.manifest = None return if integration.manifest['domain'] != integration.path.name: integration.add_error('manifest', 'Domain does not match dir name') def validate(integrations: Dict[str, Integration], config): """Handle all integrations manifests.""" for integration in integrations.values(): if integration.manifest: validate_manifest(integration)
{ "content_hash": "e6c0d0fb3c4eb58a50ad06efb071e32a", "timestamp": "", "source": "github", "line_count": 51, "max_line_length": 75, "avg_line_length": 30.294117647058822, "alnum_prop": 0.6394822006472491, "repo_name": "jabesq/home-assistant", "id": "3e25ab31712c6c9fe20fc37f4a2ad4716c0131d6", "size": "1545", "binary": false, "copies": "2", "ref": "refs/heads/dev", "path": "script/hassfest/manifest.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Batchfile", "bytes": "1175" }, { "name": "Dockerfile", "bytes": "1829" }, { "name": "Python", "bytes": "16238292" }, { "name": "Ruby", "bytes": "745" }, { "name": "Shell", "bytes": "17615" } ], "symlink_target": "" }
from django.shortcuts import render from django.http import HttpResponse from django.contrib.auth.models import User from django.contrib.auth.decorators import login_required from django.shortcuts import get_object_or_404 from fly_project import settings from api.models import Badge, Me, Notification @login_required(login_url='/authentication') def dashboard_page(request): # BADGE ID #1 # Check to see if the logged in User has the Badge wit the ID #1. If not # then create it now. me = get_object_or_404(Me, user=request.user.id) badge = get_object_or_404(Badge, id=1) if badge not in me.badges.all(): me.badges.add(badge) Notification.objects.create( type=2, title=badge.title, description=badge.description, user=me.user, badge=badge, ) return render(request, 'dashboard/view.html',{ 'settings': settings, })
{ "content_hash": "4bf55008a648c543b49cdc2afcd30e88", "timestamp": "", "source": "github", "line_count": 29, "max_line_length": 76, "avg_line_length": 32.44827586206897, "alnum_prop": 0.6726886291179596, "repo_name": "evan-rusin/fly-project", "id": "4d8e3e0ce506a3da81bc0acd1ec60103be0a12f8", "size": "941", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "dashboard/views.py", "mode": "33261", "license": "bsd-2-clause", "language": [ { "name": "CSS", "bytes": "188049" }, { "name": "HTML", "bytes": "334623" }, { "name": "JavaScript", "bytes": "136630" }, { "name": "Python", "bytes": "218526" }, { "name": "Shell", "bytes": "280" } ], "symlink_target": "" }
""" Startup script for the server.""" import argparse import sys import tornado.web import socket import tornado.options from metadatastore.mds import MDS, MDSRO from metadataservice.server.engine import (RunStartHandler, RunStopHandler, EventDescriptorHandler, EventHandler, loop) from metadataservice.server.conf import load_configuration if __name__ == "__main__": config = {} parser = argparse.ArgumentParser() parser.add_argument('--database', dest='database', type=str, help='name of database to use') parser.add_argument('--mongo-host', dest='mongohost', type=str, help='mongodb host to connect to') parser.add_argument('--timezone', dest='timezone', type=str, help='Local timezone') parser.add_argument('--mongo-port', dest='mongoport', type=int, help='mongodb port to connect') parser.add_argument('--service-port', dest='serviceport', type=int, help='port to broadcast from') parser.add_argument('--no-auth', dest='auth', action='store_false') parser.add_argument('--auth', dest='auth', action='store_true') parser.set_defaults(auth=False) parser.add_argument('--mongo-user', dest='mongo_user', type=str, help='Mongo username') parser.add_argument('--mongo-pwd', dest='mongo_pwd', type=str, help='Mongo password') args = parser.parse_args() # name of the database server will talk to. # If db does not exist, creates one if args.database is not None: config['database'] = args.database else: raise KeyError('--database is a required arg') # name/ip address of the machine hosting mongodb if args.mongohost is not None: config['mongohost'] = args.mongohost else: raise KeyError('--mongo-host is a required arg') # US/Eastern for BNL if args.timezone is not None: config['timezone'] = args.timezone else: raise KeyError('--timezone is a required arg') # port mongo uses on the mongo-host machine, 27017 by default if args.mongoport is not None: config['mongoport'] = args.mongoport else: raise KeyError('--mongo-port is a required arg') # Port that this server will use to communicate if args.serviceport is not None: config['serviceport'] = args.serviceport else: raise KeyError('--service-port is a required arg') if args.auth: if args.mongo_user and args.mongo_pwd: config['mongo_user'] = args.mongo_user config['mongo_pwd'] = args.mongo_pwd else: raise KeyError('--mongo-user and --mongo-pwd required with auth') else: config['mongo_user'] = None config['mongo_pwd'] = None libconfig = dict(host=config['mongohost'], port=config['mongoport'], timezone=config['timezone'], database=config['database'], mongo_user= config['mongo_user'], mongo_pwd=config['mongo_pwd']) mdsro = MDSRO(version=1, config=libconfig, auth=args.auth) mdsrw = MDS(version=1, config=libconfig, auth=args.auth) print('Connecting to mongodb...{}:{}/{}'.format(config['mongohost'], config['mongoport'], config['database'])) args = sys.argv # args.append("--log_file_prefix=/tmp/metadataservice.log") # tornado.options.parse_command_line(args) application = tornado.web.Application([ (r'/run_start', RunStartHandler), (r'/run_stop', RunStopHandler), (r'/event_descriptor', EventDescriptorHandler), (r'/event', EventHandler) ], mdsro=mdsro, mdsrw=mdsrw) application.listen(config['serviceport']) print('Service live on address {}:{}'.format(socket.gethostname(), config['serviceport'])) loop.start()
{ "content_hash": "42251e202182d0f73c8c92d79614ff13", "timestamp": "", "source": "github", "line_count": 91, "max_line_length": 85, "avg_line_length": 44.934065934065934, "alnum_prop": 0.595255563707508, "repo_name": "NSLS-II/metadataservice", "id": "90234328c80d3e8e9777954e6a6f24eeed27acfa", "size": "4089", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "startup.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Python", "bytes": "96670" }, { "name": "Shell", "bytes": "924" } ], "symlink_target": "" }
"""Support for Dyson Pure Cool Link Sensors.""" from libpurecool.dyson_pure_cool import DysonPureCool from libpurecool.dyson_pure_cool_link import DysonPureCoolLink from homeassistant.components.sensor import SensorEntity from homeassistant.const import ( ATTR_DEVICE_CLASS, ATTR_ICON, ATTR_UNIT_OF_MEASUREMENT, DEVICE_CLASS_HUMIDITY, DEVICE_CLASS_TEMPERATURE, PERCENTAGE, STATE_OFF, TEMP_CELSIUS, TIME_HOURS, ) from . import DYSON_DEVICES, DysonEntity SENSOR_ATTRIBUTES = { "air_quality": {ATTR_ICON: "mdi:fan"}, "dust": {ATTR_ICON: "mdi:cloud"}, "humidity": { ATTR_DEVICE_CLASS: DEVICE_CLASS_HUMIDITY, ATTR_UNIT_OF_MEASUREMENT: PERCENTAGE, }, "temperature": {ATTR_DEVICE_CLASS: DEVICE_CLASS_TEMPERATURE}, "filter_life": { ATTR_ICON: "mdi:filter-outline", ATTR_UNIT_OF_MEASUREMENT: TIME_HOURS, }, "carbon_filter_state": { ATTR_ICON: "mdi:filter-outline", ATTR_UNIT_OF_MEASUREMENT: PERCENTAGE, }, "combi_filter_state": { ATTR_ICON: "mdi:filter-outline", ATTR_UNIT_OF_MEASUREMENT: PERCENTAGE, }, "hepa_filter_state": { ATTR_ICON: "mdi:filter-outline", ATTR_UNIT_OF_MEASUREMENT: PERCENTAGE, }, } SENSOR_NAMES = { "air_quality": "AQI", "dust": "Dust", "humidity": "Humidity", "temperature": "Temperature", "filter_life": "Filter Life", "carbon_filter_state": "Carbon Filter Remaining Life", "combi_filter_state": "Combi Filter Remaining Life", "hepa_filter_state": "HEPA Filter Remaining Life", } DYSON_SENSOR_DEVICES = "dyson_sensor_devices" def setup_platform(hass, config, add_entities, discovery_info=None): """Set up the Dyson Sensors.""" if discovery_info is None: return hass.data.setdefault(DYSON_SENSOR_DEVICES, []) unit = hass.config.units.temperature_unit devices = hass.data[DYSON_SENSOR_DEVICES] # Get Dyson Devices from parent component device_ids = [device.unique_id for device in hass.data[DYSON_SENSOR_DEVICES]] new_entities = [] for device in hass.data[DYSON_DEVICES]: if isinstance(device, DysonPureCool): if f"{device.serial}-temperature" not in device_ids: new_entities.append(DysonTemperatureSensor(device, unit)) if f"{device.serial}-humidity" not in device_ids: new_entities.append(DysonHumiditySensor(device)) # For PureCool+Humidify devices, a single filter exists, called "Combi Filter". # It's reported with the HEPA state, while the Carbon state is set to INValid. if device.state and device.state.carbon_filter_state == "INV": if f"{device.serial}-hepa_filter_state" not in device_ids: new_entities.append(DysonHepaFilterLifeSensor(device, "combi")) else: if f"{device.serial}-hepa_filter_state" not in device_ids: new_entities.append(DysonHepaFilterLifeSensor(device)) if f"{device.serial}-carbon_filter_state" not in device_ids: new_entities.append(DysonCarbonFilterLifeSensor(device)) elif isinstance(device, DysonPureCoolLink): new_entities.append(DysonFilterLifeSensor(device)) new_entities.append(DysonDustSensor(device)) new_entities.append(DysonHumiditySensor(device)) new_entities.append(DysonTemperatureSensor(device, unit)) new_entities.append(DysonAirQualitySensor(device)) if not new_entities: return devices.extend(new_entities) add_entities(devices) class DysonSensor(DysonEntity, SensorEntity): """Representation of a generic Dyson sensor.""" def __init__(self, device, sensor_type): """Create a new generic Dyson sensor.""" super().__init__(device, None) self._old_value = None self._sensor_type = sensor_type self._attributes = SENSOR_ATTRIBUTES[sensor_type] def on_message(self, message): """Handle new messages which are received from the fan.""" # Prevent refreshing if not needed if self._old_value is None or self._old_value != self.state: self._old_value = self.state self.schedule_update_ha_state() @property def name(self): """Return the name of the Dyson sensor name.""" return f"{super().name} {SENSOR_NAMES[self._sensor_type]}" @property def unique_id(self): """Return the sensor's unique id.""" return f"{self._device.serial}-{self._sensor_type}" @property def native_unit_of_measurement(self): """Return the unit the value is expressed in.""" return self._attributes.get(ATTR_UNIT_OF_MEASUREMENT) @property def icon(self): """Return the icon for this sensor.""" return self._attributes.get(ATTR_ICON) @property def device_class(self): """Return the device class of this sensor.""" return self._attributes.get(ATTR_DEVICE_CLASS) class DysonFilterLifeSensor(DysonSensor): """Representation of Dyson Filter Life sensor (in hours).""" def __init__(self, device): """Create a new Dyson Filter Life sensor.""" super().__init__(device, "filter_life") @property def native_value(self): """Return filter life in hours.""" return int(self._device.state.filter_life) class DysonCarbonFilterLifeSensor(DysonSensor): """Representation of Dyson Carbon Filter Life sensor (in percent).""" def __init__(self, device): """Create a new Dyson Carbon Filter Life sensor.""" super().__init__(device, "carbon_filter_state") @property def native_value(self): """Return filter life remaining in percent.""" return int(self._device.state.carbon_filter_state) class DysonHepaFilterLifeSensor(DysonSensor): """Representation of Dyson HEPA (or Combi) Filter Life sensor (in percent).""" def __init__(self, device, filter_type="hepa"): """Create a new Dyson Filter Life sensor.""" super().__init__(device, f"{filter_type}_filter_state") @property def native_value(self): """Return filter life remaining in percent.""" return int(self._device.state.hepa_filter_state) class DysonDustSensor(DysonSensor): """Representation of Dyson Dust sensor (lower is better).""" def __init__(self, device): """Create a new Dyson Dust sensor.""" super().__init__(device, "dust") @property def native_value(self): """Return Dust value.""" return self._device.environmental_state.dust class DysonHumiditySensor(DysonSensor): """Representation of Dyson Humidity sensor.""" def __init__(self, device): """Create a new Dyson Humidity sensor.""" super().__init__(device, "humidity") @property def native_value(self): """Return Humidity value.""" if self._device.environmental_state.humidity == 0: return STATE_OFF return self._device.environmental_state.humidity class DysonTemperatureSensor(DysonSensor): """Representation of Dyson Temperature sensor.""" def __init__(self, device, unit): """Create a new Dyson Temperature sensor.""" super().__init__(device, "temperature") self._unit = unit @property def native_value(self): """Return Temperature value.""" temperature_kelvin = self._device.environmental_state.temperature if temperature_kelvin == 0: return STATE_OFF if self._unit == TEMP_CELSIUS: return float(f"{(temperature_kelvin - 273.15):.1f}") return float(f"{(temperature_kelvin * 9 / 5 - 459.67):.1f}") @property def native_unit_of_measurement(self): """Return the unit the value is expressed in.""" return self._unit class DysonAirQualitySensor(DysonSensor): """Representation of Dyson Air Quality sensor (lower is better).""" def __init__(self, device): """Create a new Dyson Air Quality sensor.""" super().__init__(device, "air_quality") @property def native_value(self): """Return Air Quality value.""" return int(self._device.environmental_state.volatil_organic_compounds)
{ "content_hash": "007f5963d44efec095d440f1d852dd4c", "timestamp": "", "source": "github", "line_count": 248, "max_line_length": 91, "avg_line_length": 33.693548387096776, "alnum_prop": 0.6376256582096697, "repo_name": "FreekingDean/home-assistant", "id": "be83a7e43735b192b7a8ae6e8d16ed0ef2b6b39a", "size": "8356", "binary": false, "copies": "5", "ref": "refs/heads/dev", "path": "homeassistant/components/dyson/sensor.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Dockerfile", "bytes": "2335" }, { "name": "Python", "bytes": "36746639" }, { "name": "Shell", "bytes": "4910" } ], "symlink_target": "" }
from joommf.energies.baseenergy import energy import textwrap class Exchange(energy): def __init__(self, A): energy.__init__(self, "Exchange") self.A = A def get_mif(self): exchange_mif = textwrap.dedent("""\ Specify Oxs_UniformExchange {{ A {:.2e} }}\n\n""").format(self.A) return exchange_mif
{ "content_hash": "12cf7036ec6a2532ec585e7932aa34fc", "timestamp": "", "source": "github", "line_count": 17, "max_line_length": 53, "avg_line_length": 24.294117647058822, "alnum_prop": 0.5060532687651331, "repo_name": "ryanpepper/oommf-python", "id": "d00b0f89300a64f55570cce841d952bb394e96ed", "size": "413", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "joommf/energies/exchange.py", "mode": "33188", "license": "bsd-2-clause", "language": [ { "name": "C", "bytes": "161" }, { "name": "Emacs Lisp", "bytes": "2282" }, { "name": "Jupyter Notebook", "bytes": "101733" }, { "name": "Makefile", "bytes": "352" }, { "name": "Python", "bytes": "137229" }, { "name": "Ruby", "bytes": "295" }, { "name": "Shell", "bytes": "3512" } ], "symlink_target": "" }
import sys sys.path.insert(1, "../../") import h2o, tests def varimp_test(): train = h2o.import_file(path=h2o.locate("smalldata/iris/iris_wheader.csv")) # Run GBM my_gbm = h2o.gbm(y=train["class"], x=train[1:4], ntrees=50, learn_rate=0.1, distribution="multinomial") should_be_none = my_gbm.varimp() assert should_be_none is None, "expected varimp to return None, but returned {0}".format(should_be_none) should_be_list = my_gbm.varimp(return_list=True) assert len(should_be_list) == 3, "expected varimp list to contain 3 entries, but it has " \ "{0}".format(len(should_be_list)) assert len(should_be_list[0]) == 4, "expected varimp entry to contain 4 elements (variable, relative_importance, " \ "scaled_importance, percentage), but it has {0}".format(len(should_be_list[0])) if __name__ == "__main__": tests.run_test(sys.argv, varimp_test)
{ "content_hash": "4c247a8bad7683b55b01f850da47e53f", "timestamp": "", "source": "github", "line_count": 23, "max_line_length": 120, "avg_line_length": 42.17391304347826, "alnum_prop": 0.6134020618556701, "repo_name": "junwucs/h2o-3", "id": "96cf0380e8b29fa865c8f094cd5432ea234f382d", "size": "970", "binary": false, "copies": "5", "ref": "refs/heads/master", "path": "h2o-py/tests/testdir_misc/pyunit_varimp.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Batchfile", "bytes": "5090" }, { "name": "CSS", "bytes": "163561" }, { "name": "CoffeeScript", "bytes": "262107" }, { "name": "Emacs Lisp", "bytes": "8927" }, { "name": "Groovy", "bytes": "78" }, { "name": "HTML", "bytes": "147257" }, { "name": "Java", "bytes": "5815537" }, { "name": "JavaScript", "bytes": "38932" }, { "name": "Makefile", "bytes": "34005" }, { "name": "Python", "bytes": "2084348" }, { "name": "R", "bytes": "1818321" }, { "name": "Rebol", "bytes": "7059" }, { "name": "Ruby", "bytes": "3506" }, { "name": "Scala", "bytes": "16336" }, { "name": "Shell", "bytes": "46944" }, { "name": "TeX", "bytes": "583215" } ], "symlink_target": "" }
from test_framework.test_framework import BitcoinTestFramework from test_framework.util import * # Create one-input, one-output, no-fee transaction: class RawTransactionsTest(BitcoinTestFramework): def setup_chain(self): print("Initializing test directory "+self.options.tmpdir) initialize_chain_clean(self.options.tmpdir, 3) def setup_network(self, split=False): self.nodes = start_nodes(3, self.options.tmpdir) #connect to a local machine for debugging #url = "http://bitcoinrpc:DP6DvqZtqXarpeNWyN3LZTFchCCyCUuHwNF7E8pX99x1@%s:%d" % ('127.0.0.1', 18332) #proxy = AuthServiceProxy(url) #proxy.url = url # store URL on proxy for info #self.nodes.append(proxy) connect_nodes_bi(self.nodes,0,1) connect_nodes_bi(self.nodes,1,2) connect_nodes_bi(self.nodes,0,2) self.is_network_split=False self.sync_all() def run_test(self): #prepare some coins for multiple *rawtransaction commands self.nodes[2].generate(1) self.sync_all() self.nodes[0].generate(101) self.sync_all() self.nodes[0].sendtoaddress(self.nodes[2].getnewaddress(),1.5) self.nodes[0].sendtoaddress(self.nodes[2].getnewaddress(),1.0) self.nodes[0].sendtoaddress(self.nodes[2].getnewaddress(),5.0) self.sync_all() self.nodes[0].generate(5) self.sync_all() ######################################### # sendrawtransaction with missing input # ######################################### inputs = [ {'txid' : "1d1d4e24ed99057e84c3f80fd8fbec79ed9e1acee37da269356ecea000000000", 'vout' : 1}] #won't exists outputs = { self.nodes[0].getnewaddress() : 4.998 } rawtx = self.nodes[2].createrawtransaction(inputs, outputs) rawtx = self.nodes[2].signrawtransaction(rawtx) try: rawtx = self.nodes[2].sendrawtransaction(rawtx['hex']) except JSONRPCException as e: assert("Missing inputs" in e.error['message']) else: assert(False) ######################### # RAW TX MULTISIG TESTS # ######################### # 2of2 test addr1 = self.nodes[2].getnewaddress() addr2 = self.nodes[2].getnewaddress() addr1Obj = self.nodes[2].validateaddress(addr1) addr2Obj = self.nodes[2].validateaddress(addr2) mSigObj = self.nodes[2].addmultisigaddress(2, [addr1Obj['pubkey'], addr2Obj['pubkey']]) mSigObjValid = self.nodes[2].validateaddress(mSigObj) #use balance deltas instead of absolute values bal = self.nodes[2].getbalance() # send 1.2 BTC to msig adr txId = self.nodes[0].sendtoaddress(mSigObj, 1.2) self.sync_all() self.nodes[0].generate(1) self.sync_all() assert_equal(self.nodes[2].getbalance(), bal+Decimal('1.20000000')) #node2 has both keys of the 2of2 ms addr., tx should affect the balance # 2of3 test from different nodes bal = self.nodes[2].getbalance() addr1 = self.nodes[1].getnewaddress() addr2 = self.nodes[2].getnewaddress() addr3 = self.nodes[2].getnewaddress() addr1Obj = self.nodes[1].validateaddress(addr1) addr2Obj = self.nodes[2].validateaddress(addr2) addr3Obj = self.nodes[2].validateaddress(addr3) mSigObj = self.nodes[2].addmultisigaddress(2, [addr1Obj['pubkey'], addr2Obj['pubkey'], addr3Obj['pubkey']]) mSigObjValid = self.nodes[2].validateaddress(mSigObj) txId = self.nodes[0].sendtoaddress(mSigObj, 2.2) decTx = self.nodes[0].gettransaction(txId) rawTx = self.nodes[0].decoderawtransaction(decTx['hex']) sPK = rawTx['vout'][0]['scriptPubKey']['hex'] self.sync_all() self.nodes[0].generate(1) self.sync_all() #THIS IS A INCOMPLETE FEATURE #NODE2 HAS TWO OF THREE KEY AND THE FUNDS SHOULD BE SPENDABLE AND COUNT AT BALANCE CALCULATION assert_equal(self.nodes[2].getbalance(), bal) #for now, assume the funds of a 2of3 multisig tx are not marked as spendable txDetails = self.nodes[0].gettransaction(txId, True) rawTx = self.nodes[0].decoderawtransaction(txDetails['hex']) vout = False for outpoint in rawTx['vout']: if outpoint['value'] == Decimal('2.20000000'): vout = outpoint break bal = self.nodes[0].getbalance() inputs = [{ "txid" : txId, "vout" : vout['n'], "scriptPubKey" : vout['scriptPubKey']['hex']}] outputs = { self.nodes[0].getnewaddress() : 2.19 } rawTx = self.nodes[2].createrawtransaction(inputs, outputs) rawTxPartialSigned = self.nodes[1].signrawtransaction(rawTx, inputs) assert_equal(rawTxPartialSigned['complete'], False) #node1 only has one key, can't comp. sign the tx rawTxSigned = self.nodes[2].signrawtransaction(rawTx, inputs) assert_equal(rawTxSigned['complete'], True) #node2 can sign the tx compl., own two of three keys self.nodes[2].sendrawtransaction(rawTxSigned['hex']) rawTx = self.nodes[0].decoderawtransaction(rawTxSigned['hex']) self.sync_all() self.nodes[0].generate(1) self.sync_all() assert_equal(self.nodes[0].getbalance(), bal+Decimal('50.00000000')+Decimal('2.19000000')) #block reward + tx if __name__ == '__main__': RawTransactionsTest().main()
{ "content_hash": "a3f7ae2f79ca43acffb313de2cb7eb28", "timestamp": "", "source": "github", "line_count": 131, "max_line_length": 147, "avg_line_length": 42.05343511450382, "alnum_prop": 0.6169903793791977, "repo_name": "krzysztofwos/BitcoinUnlimited", "id": "40c9fa252154a01ae3f619614d9f6cb5b076eda7", "size": "5915", "binary": false, "copies": "6", "ref": "refs/heads/dev", "path": "qa/rpc-tests/rawtransactions.py", "mode": "33261", "license": "mit", "language": [ { "name": "C", "bytes": "647624" }, { "name": "C++", "bytes": "4618568" }, { "name": "CSS", "bytes": "1127" }, { "name": "Groff", "bytes": "3821" }, { "name": "HTML", "bytes": "50621" }, { "name": "Java", "bytes": "2100" }, { "name": "M4", "bytes": "156005" }, { "name": "Makefile", "bytes": "96732" }, { "name": "Objective-C", "bytes": "5375" }, { "name": "Objective-C++", "bytes": "7360" }, { "name": "Protocol Buffer", "bytes": "2308" }, { "name": "Python", "bytes": "687509" }, { "name": "QMake", "bytes": "2020" }, { "name": "Shell", "bytes": "38644" } ], "symlink_target": "" }
from itsdangerous import BadSignature, BadTimeSignature from sqlalchemy.exc import IntegrityError from flask_jsonschema import ValidationError from app.api.decorators import json_response from app.api.errors import forbidden from app.api.errors import not_acceptable # noqa from . import auth @auth.errorhandler(IntegrityError) @json_response def server_error(e): return {'message': e.args[0]}, 500 @auth.errorhandler(403) def forbidden_handler(e): return forbidden('You don\'t have the permission to access the requested' ' resource. It is either read-protected or not readable ' 'by the server.') @auth.errorhandler(ValidationError) @json_response def on_validation_error(e): return {'message': e.message, 'validator': e.validator}, 422 @auth.errorhandler(BadTimeSignature) @json_response def on_bad_time_signature(e): return {'message': e.args[0], 'validator': 'signature'}, 400 @auth.errorhandler(BadSignature) @json_response def on_bad_signature(e): return {'message': e.args[0]}, 400
{ "content_hash": "2d2100a064c4ef8ea1e9f327c671edfd", "timestamp": "", "source": "github", "line_count": 38, "max_line_length": 78, "avg_line_length": 27.973684210526315, "alnum_prop": 0.7281279397930386, "repo_name": "certeu/do-portal", "id": "22e874fa73f3b2b5f3ba76f8b6fcd84526f3a4b3", "size": "1063", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "app/auth/errors.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "CSS", "bytes": "31516" }, { "name": "HTML", "bytes": "241648" }, { "name": "JavaScript", "bytes": "84093" }, { "name": "Makefile", "bytes": "3016" }, { "name": "Mako", "bytes": "412" }, { "name": "Python", "bytes": "480459" } ], "symlink_target": "" }
'''OpenGL extension NV.texture_expand_normal This module customises the behaviour of the OpenGL.raw.GL.NV.texture_expand_normal to provide a more Python-friendly API Overview (from the spec) This extension provides a remapping mode where unsigned texture components (in the range [0,1]) can be treated as though they contained signed data (in the range [-1,+1]). This allows applications to easily encode signed data into unsigned texture formats. The functionality of this extension is nearly identical to the EXPAND_NORMAL_NV remapping mode provided in the NV_register_combiners extension, although it applies even if register combiners are used. The official definition of this extension is available here: http://www.opengl.org/registry/specs/NV/texture_expand_normal.txt ''' from OpenGL import platform, constants, constant, arrays from OpenGL import extensions, wrapper from OpenGL.GL import glget import ctypes from OpenGL.raw.GL.NV.texture_expand_normal import * ### END AUTOGENERATED SECTION
{ "content_hash": "624b09d35578a42e0b7cc75d33677aa9", "timestamp": "", "source": "github", "line_count": 27, "max_line_length": 70, "avg_line_length": 37.7037037037037, "alnum_prop": 0.7966601178781926, "repo_name": "Universal-Model-Converter/UMC3.0a", "id": "e96e6b741eb038a0a15713c4b308feca821b2216", "size": "1018", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "data/Python/x86/Lib/site-packages/OpenGL/GL/NV/texture_expand_normal.py", "mode": "33188", "license": "mit", "language": [ { "name": "Batchfile", "bytes": "226" }, { "name": "C", "bytes": "1082640" }, { "name": "C#", "bytes": "8440" }, { "name": "C++", "bytes": "3621086" }, { "name": "CSS", "bytes": "6226" }, { "name": "F#", "bytes": "2310" }, { "name": "FORTRAN", "bytes": "7795" }, { "name": "Forth", "bytes": "506" }, { "name": "GLSL", "bytes": "1040" }, { "name": "Groff", "bytes": "5943" }, { "name": "HTML", "bytes": "1196266" }, { "name": "Java", "bytes": "5793" }, { "name": "Makefile", "bytes": "1109" }, { "name": "Mask", "bytes": "969" }, { "name": "Matlab", "bytes": "4346" }, { "name": "Python", "bytes": "33351557" }, { "name": "R", "bytes": "1370" }, { "name": "Shell", "bytes": "6931" }, { "name": "Tcl", "bytes": "2084458" }, { "name": "Visual Basic", "bytes": "481" } ], "symlink_target": "" }
from pkgutil import extend_path __path__ = extend_path(__path__, __name__)
{ "content_hash": "d8d5e0425d9fe7703e6188c153a83b35", "timestamp": "", "source": "github", "line_count": 2, "max_line_length": 42, "avg_line_length": 37.5, "alnum_prop": 0.6533333333333333, "repo_name": "gds-attic/backdrop-collector", "id": "2d8a5192bd299b1c73745faff499ab517be7249c", "size": "143", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "backdrop/__init__.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "22079" }, { "name": "Shell", "bytes": "182" } ], "symlink_target": "" }
'''HiFive1-specific (flash only) runner.''' from os import path from runners.core import ZephyrBinaryRunner, RunnerCaps class HiFive1BinaryRunner(ZephyrBinaryRunner): '''Runner front-end for the HiFive1 board, using openocd.''' def __init__(self, cfg): super().__init__(cfg) self.openocd_config = path.join(cfg.board_dir, 'support', 'openocd.cfg') @classmethod def name(cls): return 'hifive1' @classmethod def capabilities(cls): return RunnerCaps(commands={'flash'}) @classmethod def do_add_parser(cls, parser): pass @classmethod def do_create(cls, cfg, args): if cfg.gdb is None: raise ValueError('--gdb not provided at command line') return HiFive1BinaryRunner(cfg) def do_run(self, command, **kwargs): self.require(self.cfg.openocd) self.require(self.cfg.gdb) openocd_cmd = ([self.cfg.openocd, '-f', self.openocd_config]) gdb_cmd = ([self.cfg.gdb, self.cfg.elf_file, '--batch', '-ex', 'set remotetimeout 240', '-ex', 'target extended-remote localhost:3333', '-ex', 'load', '-ex', 'quit']) self.run_server_and_client(openocd_cmd, gdb_cmd)
{ "content_hash": "03f1d4a8e7c7ead22d0246b567c39d2e", "timestamp": "", "source": "github", "line_count": 43, "max_line_length": 80, "avg_line_length": 29.86046511627907, "alnum_prop": 0.5919003115264797, "repo_name": "finikorg/zephyr", "id": "1a72d3018e114c28891b67b600291e592aedb8f8", "size": "1359", "binary": false, "copies": "6", "ref": "refs/heads/main", "path": "scripts/west_commands/runners/hifive1.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Assembly", "bytes": "445128" }, { "name": "Batchfile", "bytes": "110" }, { "name": "C", "bytes": "44321001" }, { "name": "C++", "bytes": "29292" }, { "name": "CMake", "bytes": "1369918" }, { "name": "Cadence", "bytes": "1501" }, { "name": "EmberScript", "bytes": "997" }, { "name": "Forth", "bytes": "1648" }, { "name": "GDB", "bytes": "1285" }, { "name": "Haskell", "bytes": "722" }, { "name": "JetBrains MPS", "bytes": "3152" }, { "name": "PLSQL", "bytes": "281" }, { "name": "Perl", "bytes": "215338" }, { "name": "Python", "bytes": "2251570" }, { "name": "Shell", "bytes": "171294" }, { "name": "SmPL", "bytes": "36840" }, { "name": "Smalltalk", "bytes": "1885" }, { "name": "SourcePawn", "bytes": "14890" }, { "name": "Tcl", "bytes": "5838" }, { "name": "VBA", "bytes": "294" }, { "name": "Verilog", "bytes": "6394" } ], "symlink_target": "" }
import arcpy, pythonaddins import os, urllib2, json, zipfile class dl2012(object): """Implementation for dl2012.tool (Tool)""" def __init__(self): self.enabled = True self.cursor = 3 self.shape = "Rectangle" def onMouseDown(self, x, y, button, shift): pass def onMouseDownMap(self, x, y, button, shift): pass def onMouseUp(self, x, y, button, shift): pass def onMouseUpMap(self, x, y, button, shift): pass def onMouseMove(self, x, y, button, shift): pass def onMouseMoveMap(self, x, y, button, shift): pass def onDblClick(self): pass def onKeyDown(self, keycode, shift): pass def onKeyUp(self, keycode, shift): pass def deactivate(self): pass def onCircle(self, circle_geometry): pass def onLine(self, line_geometry): pass def onRectangle(self, rectangle_geometry): # perform some sanity checks if not (rectangle_geometry.spatialReference.PCSCode == 3424): rectangle_geometry = rectangle_geometry.projectAs(arcpy.SpatialReference(3424)) if(not isinstance(rectangle_geometry.XMin, float)): pythonaddins.MessageBox("Click and drag to select an area.", "Incorrect Extent Specified", 1) return False if(rectangle_geometry.XMin < 0 or rectangle_geometry.YMin < 0 or rectangle_geometry.XMax > 1000000 or rectangle_geometry.YMax > 1000000): pythonaddins.MessageBox("Select an area within New Jersey.", "Out of bounds", 1) return False # build the URL to request features from the NJGIN service wfsurl = "http://njgin.state.nj.us/NJ_GeoServer/wfs?service=wfs&version=2.0.0&request=GetFeature&typeName=NJOGIS:Ortho07Grid_poly&srsName=EPSG:3424&bbox={minx},{miny},{maxx},{maxy}&outputFormat=json" \ .format(minx=rectangle_geometry.XMin,miny=rectangle_geometry.YMin,maxx=rectangle_geometry.XMax,maxy=rectangle_geometry.YMax) try: response = urllib2.urlopen(wfsurl) wfsd = json.loads(response.read())['features'] except: pythonaddins.MessageBox("Unable to connect to the NJGIN web service. Please try again.", "Unable to connect", 0) return False # warn people about the potentially large download download = pythonaddins.MessageBox("You have selected {0} tiles, approximately {1}MB in size. Do you want to continue downloading?".format(len(wfsd), 10.1*len(wfsd)), "Continue Download?", 4) if(download == "No"): return False # specify output directory dldir = pythonaddins.SaveDialog("Choose download directory location...", "NewDownloadDirectory", r"C:\temp") if(dldir == None or dldir == 'None'): return False if(not os.path.exists(dldir)): os.makedirs(dldir) # one more notice finalnotice = """Please note, the download may take a while. Open the Python Console (in the "Geoprocessing" menu) for progress updates. You will be notified when the download is complete.""" if("Cancel" == pythonaddins.MessageBox(finalnotice, "Beginning download...", 1)): return False #iterate over features in the JSON returned by the WFS service for f in wfsd: url = "https://njgin.state.nj.us/ortho2012/nj2012ortho_sid_{0}.zip".format(f["properties"]["TILE_NO"]) response = urllib2.urlopen(url) # output the requested zip to disk ozf = os.path.join(dldir, os.path.basename(url)) if(not os.path.exists(ozf)): with open(ozf, "wb") as zipf: zipf.write(response.read()) print f["properties"]["TILE_NO"] + ".zip downloaded...", else: print f["properties"]["TILE_NO"] + ".zip already downloaded..." # open the zip and extract the juicy raster goodness if(not os.path.exists(os.path.join(dldir,f["properties"]["TILE_NO"]+".sid"))): with zipfile.ZipFile(ozf, 'r') as sidzip: sidzip.extract(f["properties"]["TILE_NO"]+".sid",dldir) sidzip.extract(f["properties"]["TILE_NO"]+".sdw",dldir) print "extracted." else: print f["properties"]["TILE_NO"] + ".sid already extracted..." # add each raster to the current map frame mxd = arcpy.mapping.MapDocument("CURRENT") df = arcpy.mapping.ListDataFrames(mxd)[0] result = arcpy.MakeRasterLayer_management(os.path.join(dldir, f["properties"]["TILE_NO"]+".sid"), f["properties"]["TILE_NO"]+".sid") pythonaddins.MessageBox("Download complete.", "Done!", 0) arcpy.RefreshActiveView() class openGeoweb(object): """Implementation for openGeoweb.tool (Tool)""" def __init__(self): self.enabled = True self.cursor = 3 import webbrowser self.wb = webbrowser self.shape = "Rectangle" def onMouseDown(self, x, y, button, shift): pass def onMouseDownMap(self, x, y, button, shift): pass def onMouseUp(self, x, y, button, shift): pass def onMouseUpMap(self, x, y, button, shift): pass def onMouseMove(self, x, y, button, shift): pass def onMouseMoveMap(self, x, y, button, shift): pass def onDblClick(self): pass def onKeyDown(self, keycode, shift): pass def onKeyUp(self, keycode, shift): pass def deactivate(self): pass def onCircle(self, circle_geometry): pass def onLine(self, line_geometry): pass def onRectangle(self, rectangle_geometry): # if not in NJ State Plane feet, reproject it if not (rectangle_geometry.spatialReference.PCSCode == 3424): rectangle_geometry = rectangle_geometry.projectAs(arcpy.SpatialReference(3424)) # catch single-clicks if(not isinstance(rectangle_geometry.XMin, float)): pythonaddins.MessageBox("Click and drag to select an area. NJ-Geoweb will then open at the same extent.", "Incorrect Extent Specified", 1) return False # catch bounding boxes drawn far outside of New Jersey if(rectangle_geometry.XMin < 0 or rectangle_geometry.YMin < 0 or rectangle_geometry.XMax > 1000000 or rectangle_geometry.YMax > 1000000): pythonaddins.MessageBox("Select an area within New Jersey.", "Out of bounds", 1) return False # build the URL and open a browser geoweb = "http://njwebmap.state.nj.us/NJGeoWeb//UrlHandler.ashx?MAPTABID=2&MINX={minx}&MINY={miny}&MAXX={maxx}&MAXY={maxy}&SIZE=800,600&LABEL=%7c431434.194025001%7c482873.283329998%7c102711%7c0%2c0%2c0%7c12%7cCIRCLE%7c0%2c128%2c255%7c10%7c%7c&THEME=&LANGUAGE=en-US" \ .format(minx=rectangle_geometry.XMin,miny=rectangle_geometry.YMin,maxx=rectangle_geometry.XMax,maxy=rectangle_geometry.YMax) self.wb.open(geoweb) # cross your fingers and hope that GeoWeb loads
{ "content_hash": "9f49252bcdcea120775db633558534a6", "timestamp": "", "source": "github", "line_count": 146, "max_line_length": 275, "avg_line_length": 49.013698630136986, "alnum_prop": 0.6260480715483511, "repo_name": "RowanGeolab/arcgisPythonAddins", "id": "eca3b9ad512a02e9226b2e1d51e1a21ceb29bfb3", "size": "7156", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "NJServices/Install/NJServices_addin.py", "mode": "33261", "license": "mit", "language": [ { "name": "Python", "bytes": "22628" } ], "symlink_target": "" }
from marshmallow import Schema, fields from api.tags.schemas import TagSchema class FileSchema(Schema): tags = fields.Nested(TagSchema, attribute="tags", many=True) class Meta: fields = ("sha1", "sha256", "md5", "timestamp_first_scan", "timestamp_last_scan", "size", "mimetype", "tags")
{ "content_hash": "d9f55123ecca4681f007d18bb75362e1", "timestamp": "", "source": "github", "line_count": 16, "max_line_length": 64, "avg_line_length": 27, "alnum_prop": 0.49074074074074076, "repo_name": "quarkslab/irma", "id": "0476926dd071d28586f1cee277db303785db8227", "size": "957", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "frontend/api/files/schemas.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Batchfile", "bytes": "79" }, { "name": "CSS", "bytes": "86535" }, { "name": "DIGITAL Command Language", "bytes": "68" }, { "name": "Gherkin", "bytes": "2366" }, { "name": "HTML", "bytes": "26577" }, { "name": "JavaScript", "bytes": "1774854" }, { "name": "Jinja", "bytes": "2672" }, { "name": "Less", "bytes": "13774" }, { "name": "Mako", "bytes": "494" }, { "name": "PowerShell", "bytes": "15660" }, { "name": "Python", "bytes": "797592" }, { "name": "Shell", "bytes": "61907" } ], "symlink_target": "" }
""" ncurses interface """ import sys import curses import sys_backlight from .. import backlight keys = { 'esc': 27, 'q': 113, 'up': 259, 'down': 258, 'left': 260, 'right': 261 } alias = { 'esc': 'quit', 'q': 'quit', 'up': 'inc', 'down': 'dec', 'left': 'min', 'right': 'max', } action = { "quit": (lambda _: sys.exit(sys_backlight.success)), "inc": (lambda b: b.addrel(sys_backlight.default['step'])), "dec": (lambda b: b.subrel(sys_backlight.default['step'])), "min": (lambda b: b.setrel(0)), "max": (lambda b: b.setrel(100)), } def interface(): b = backlight.Backlight() screen = curses.initscr() curses.noecho() screen.keypad(1) try: while True: char = screen.getch() # fetch input for keyname, keycode in keys.items(): # loop through defined keys if char == keycode: # inputed key matches definied entry if alias[keyname]: # alias for key exists if action[alias[keyname]]: # action for alias exists action[alias[keyname]](b) # execute key action finally: screen.keypad(0) curses.endwin() curses.echo() def main(): interface() sys.exit(sys_backlight.success) if __name__ == "__main__": main()
{ "content_hash": "fdb580f9b9f338940be177a4efe244a2", "timestamp": "", "source": "github", "line_count": 62, "max_line_length": 78, "avg_line_length": 21.919354838709676, "alnum_prop": 0.5349521707137601, "repo_name": "hamgom95/sys_backlight", "id": "46ed581296d892e5e725d1f9999dd9020b754b2e", "size": "1551", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "sys_backlight/ncurses/__init__.py", "mode": "33188", "license": "mit", "language": [ { "name": "Python", "bytes": "11337" } ], "symlink_target": "" }
import unittest from airflow.models import Connection from airflow.providers.apache.spark.hooks.spark_jdbc import SparkJDBCHook from airflow.utils import db class TestSparkJDBCHook(unittest.TestCase): _config = { 'cmd_type': 'spark_to_jdbc', 'jdbc_table': 'tableMcTableFace', 'jdbc_driver': 'org.postgresql.Driver', 'metastore_table': 'hiveMcHiveFace', 'jdbc_truncate': False, 'save_mode': 'append', 'save_format': 'parquet', 'batch_size': 100, 'fetch_size': 200, 'num_partitions': 10, 'partition_column': 'columnMcColumnFace', 'lower_bound': '10', 'upper_bound': '20', 'create_table_column_types': 'columnMcColumnFace INTEGER(100), name CHAR(64),' 'comments VARCHAR(1024)', } # this config is invalid because if one of [partitionColumn, lowerBound, upperBound] # is set, all of the options must be enabled (enforced by Spark) _invalid_config = { 'cmd_type': 'spark_to_jdbc', 'jdbc_table': 'tableMcTableFace', 'jdbc_driver': 'org.postgresql.Driver', 'metastore_table': 'hiveMcHiveFace', 'jdbc_truncate': False, 'save_mode': 'append', 'save_format': 'parquet', 'batch_size': 100, 'fetch_size': 200, 'num_partitions': 10, 'partition_column': 'columnMcColumnFace', 'upper_bound': '20', 'create_table_column_types': 'columnMcColumnFace INTEGER(100), name CHAR(64),' 'comments VARCHAR(1024)', } def setUp(self): db.merge_conn( Connection( conn_id='spark-default', conn_type='spark', host='yarn://yarn-master', extra='{"queue": "root.etl", "deploy-mode": "cluster"}', ) ) db.merge_conn( Connection( conn_id='jdbc-default', conn_type='postgres', host='localhost', schema='default', port=5432, login='user', password='supersecret', extra='{"conn_prefix":"jdbc:postgresql://"}', ) ) def test_resolve_jdbc_connection(self): # Given hook = SparkJDBCHook(jdbc_conn_id='jdbc-default') expected_connection = { 'url': 'localhost:5432', 'schema': 'default', 'conn_prefix': 'jdbc:postgresql://', 'user': 'user', 'password': 'supersecret', } # When connection = hook._resolve_jdbc_connection() # Then self.assertEqual(connection, expected_connection) def test_build_jdbc_arguments(self): # Given hook = SparkJDBCHook(**self._config) # When cmd = hook._build_jdbc_application_arguments(hook._resolve_jdbc_connection()) # Then expected_jdbc_arguments = [ '-cmdType', 'spark_to_jdbc', '-url', 'jdbc:postgresql://localhost:5432/default', '-user', 'user', '-password', 'supersecret', '-metastoreTable', 'hiveMcHiveFace', '-jdbcTable', 'tableMcTableFace', '-jdbcDriver', 'org.postgresql.Driver', '-batchsize', '100', '-fetchsize', '200', '-numPartitions', '10', '-partitionColumn', 'columnMcColumnFace', '-lowerBound', '10', '-upperBound', '20', '-saveMode', 'append', '-saveFormat', 'parquet', '-createTableColumnTypes', 'columnMcColumnFace INTEGER(100), name CHAR(64),comments VARCHAR(1024)', ] self.assertEqual(expected_jdbc_arguments, cmd) def test_build_jdbc_arguments_invalid(self): # Given hook = SparkJDBCHook(**self._invalid_config) # Expect Exception hook._build_jdbc_application_arguments(hook._resolve_jdbc_connection())
{ "content_hash": "b68b8b628de81dfda23fa3adbd020adc", "timestamp": "", "source": "github", "line_count": 135, "max_line_length": 88, "avg_line_length": 30.896296296296295, "alnum_prop": 0.5202589307120594, "repo_name": "DinoCow/airflow", "id": "bd80bccdd8072ae4f945a648b7cab74d61644831", "size": "4960", "binary": false, "copies": "3", "ref": "refs/heads/master", "path": "tests/providers/apache/spark/hooks/test_spark_jdbc.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CSS", "bytes": "56963" }, { "name": "HTML", "bytes": "140781" }, { "name": "JavaScript", "bytes": "1370838" }, { "name": "Mako", "bytes": "1037" }, { "name": "Python", "bytes": "1473771" }, { "name": "Shell", "bytes": "18638" } ], "symlink_target": "" }
"""quick and dirty test""" import unittest import subprocess import os class MyTest(unittest.TestCase): """RNA Alignment test""" def test_rna_align_find_seq_in_alignment(self): print('----------------------------------------------------------------------') cmd = "./rna_align_find_seq_in_alignment.py -a test_data/RF00167.stockholm.sto -f test_data/xx.fa" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_rna_align_find_core(self): print('----------------------------------------------------------------------') cmd = "./rna_align_find_core.py test_data/RF00167.stockholm.sto" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_rna_align_seq_to_alignment(self): print('----------------------------------------------------------------------') cmd = "./rna_align_seq_to_alignment.py -f test_data/4lvv_cmalign.txt -a test_data/RF01831.stockholm.sto" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_rna_align_seq_to_alignment_2(self): print('----------------------------------------------------------------------') cmd = "./rna_align_seq_to_alignment.py -s test_data/4lvv.seq -a test_data/RF01831.stockholm.sto -m test_data/RF01831.cm" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_rna_align_get_ss_from_alignment(self): print('----------------------------------------------------------------------') cmd = "./rna_align_get_ss_from_alignment.py test_data/ade.fa" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_rna_alignment(self): print('----------------------------------------------------------------------') cmd = "./rna_alignment.py" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) def test_random_assignment_of_nucleotides(self): print('----------------------------------------------------------------------') cmd = "python random_assignment_of_nucleotides.py --alignfn test_data/aln1.fasta" print(cmd) code = os.system(cmd) self.assertEqual(code, 0) if __name__ == '__main__': unittest.main()
{ "content_hash": "077a807facf68517f5ebc942e4c3679c", "timestamp": "", "source": "github", "line_count": 59, "max_line_length": 128, "avg_line_length": 39.6271186440678, "alnum_prop": 0.47005988023952094, "repo_name": "m4rx9/rna-pdb-tools", "id": "69a2660db0cd799535ce47a311053fcbf675a571", "size": "2361", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "rna_tools/tools/rna_alignment/test.py", "mode": "33261", "license": "mit", "language": [ { "name": "Python", "bytes": "34107" }, { "name": "Shell", "bytes": "1130" } ], "symlink_target": "" }
'''tzinfo timezone information for Etc/GMT0.''' from pytz.tzinfo import StaticTzInfo from pytz.tzinfo import memorized_timedelta as timedelta class GMT0(StaticTzInfo): '''Etc/GMT0 timezone definition. See datetime.tzinfo for details''' zone = 'Etc/GMT0' _utcoffset = timedelta(seconds=0) _tzname = 'GMT' GMT0 = GMT0()
{ "content_hash": "0f302215c9bd6619ea509f2310d2aa0a", "timestamp": "", "source": "github", "line_count": 12, "max_line_length": 71, "avg_line_length": 28.083333333333332, "alnum_prop": 0.7210682492581603, "repo_name": "gauribhoite/personfinder", "id": "ce857ca06d75d61b938df871d594ff243eebc962", "size": "337", "binary": false, "copies": "9", "ref": "refs/heads/master", "path": "app/pytz/zoneinfo/Etc/GMT0.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Assembly", "bytes": "423" }, { "name": "Batchfile", "bytes": "5005" }, { "name": "C", "bytes": "413819" }, { "name": "CSS", "bytes": "330448" }, { "name": "Emacs Lisp", "bytes": "4733" }, { "name": "HTML", "bytes": "720955" }, { "name": "JavaScript", "bytes": "1072023" }, { "name": "Makefile", "bytes": "16086" }, { "name": "PHP", "bytes": "2582470" }, { "name": "Python", "bytes": "60243792" }, { "name": "Shell", "bytes": "7491" }, { "name": "TeX", "bytes": "60219" }, { "name": "VimL", "bytes": "5645" } ], "symlink_target": "" }
""" Functions for provisioning environments with fabtools (eat shit puppet!) """ # standard library import sys import copy import os from distutils.util import strtobool # 3rd party import fabric from fabric.api import env, task, local, run, settings, cd, sudo, lcd import fabtools from fabtools.vagrant import vagrant_settings # local import decorators import utils @task @decorators.needs_environment def apt_get_update(max_age=86400*7): """refresh apt-get index if its more than max_age out of date """ with vagrant_settings(env.host_string): try: fabtools.require.deb.uptodate_index(max_age=max_age) except AttributeError: msg = ( "Looks like your fabtools is out of date. " "Try updating fabtools first:\n" " sudo pip install fabtools==0.17.0" ) raise Exception(msg) @task @decorators.needs_environment def python_packages(): """install python packages""" filename = os.path.join(utils.remote_project_root(), "REQUIREMENTS") with vagrant_settings(env.host_string): fabtools.require.python.requirements(filename, use_sudo=True) @task @decorators.needs_environment def debian_packages(): """install debian packages""" # get the list of packages filename = os.path.join(utils.project_root(), "REQUIREMENTS-DEB") with open(filename, 'r') as stream: packages = stream.read().strip().splitlines() # install them all with fabtools. with vagrant_settings(env.host_string): fabtools.require.deb.packages(packages) @task @decorators.needs_environment def packages(): """install all packages""" debian_packages() python_packages() @task @decorators.needs_environment def setup_shell_environment(): """setup the shell environment on the remote machine""" with vagrant_settings(env.host_string): # change into the /vagrant directory by default template = os.path.join( utils.fabfile_templates_root(), '.bash_profile', ) fabtools.require.files.file( path="/home/vagrant/.bash_profile", contents="cd /vagrant", ) @task @decorators.needs_environment def setup_analysis(): """prepare analysis environment""" with vagrant_settings(env.host_string): # write a analysis.ini file that has the provider so we can # easily distinguish between development and production # environments when we run our analysis template = os.path.join( utils.fabfile_templates_root(), "server_config.ini", ) fabtools.require.files.template_file( path="/vagrant/server_config.ini", template_source=template, context=env, ) # create a data directory where all of the analysis and raw # data is stored. data_dir = "/vagrant/data" fabtools.require.files.directory(data_dir) @task(default=True) @decorators.needs_environment def default(do_rsync=True): """run all provisioning tasks""" # http://stackoverflow.com/a/19536667/564709 if isinstance(do_rsync, (str, unicode,)): do_rsync = bool(strtobool(do_rsync)) # rsync files (Vagrant isn't doing any provisioning now) if do_rsync: local("vagrant provision %(host_string)s" % env) # run all of these provisioning tasks in the order specified here apt_get_update() # install debian packages first to make sure any compiling python # packages have necessary dependencies packages() # set up anything else that should be done on the virtual machine # to get it into the same state for everyone setup_shell_environment() setup_analysis()
{ "content_hash": "09322f7f837832d7218d0c2366cf8b17", "timestamp": "", "source": "github", "line_count": 132, "max_line_length": 72, "avg_line_length": 28.795454545454547, "alnum_prop": 0.6566692975532754, "repo_name": "bjlange/revenge", "id": "0bc4dcb4fe2bb8069846bfbe293a614fb4dc3a7a", "size": "3801", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "fabfile/provision.py", "mode": "33188", "license": "mit", "language": [ { "name": "JavaScript", "bytes": "6329" }, { "name": "Python", "bytes": "13784" } ], "symlink_target": "" }
import logging import sys import xml.dom.minidom from pysnmp.entity.rfc3413.oneliner import cmdgen from snmputils import print_validation_error, splunk_escape __author__ = 'John Oxley' class SnmpStanza: """ A class to represent a SNMP stanza in inputs.conf """ def __init__(self): self.conf = {} def scheme(self): return "XML Scheme here. Some way of extending it..." def read_config(self): # read everything from stdin config_str = sys.stdin.read() # parse the config XML doc = xml.dom.minidom.parseString(config_str) root = doc.documentElement conf_node = root.getElementsByTagName("configuration")[0] if conf_node: logging.debug("XML: found configuration") stanza = conf_node.getElementsByTagName("stanza")[0] if stanza: stanza_name = stanza.getAttribute("name") if stanza_name: logging.debug("XML: found stanza " + stanza_name) self.conf["name"] = stanza_name params = stanza.getElementsByTagName("param") for param in params: param_name = param.getAttribute("name") logging.debug("XML: found param '%s'" % param_name) if param_name and param.firstChild and \ param.firstChild.nodeType == param.firstChild.TEXT_NODE: data = param.firstChild.data self.conf[param_name] = data logging.debug("XML: '%s' -> '%s'" % (param_name, data)) conf_dict = [(param, splunk_escape(self.conf[param])) for param in self.conf if param in ['destination', 'interfaces', 'operations']] conf_str = ' '.join(['%s=%s' % nvp for nvp in conf_dict]) logging.info('action=configured stanza="%s" %s', self.conf['name'], conf_str) checkpnt_node = root.getElementsByTagName("checkpoint_dir")[0] if (checkpnt_node and checkpnt_node.firstChild and checkpnt_node.firstChild.nodeType == checkpnt_node.firstChild.TEXT_NODE): self.conf["checkpoint_dir"] = checkpnt_node.firstChild.data if not self.conf: raise Exception("Invalid configuration received from Splunk.") def port(self): return int(self.conf.get("port", 161)) def destination(self): return self.conf.get("destination") def snmpinterval(self): return self.conf.get("snmpinterval", 60) def name(self): return self.conf.get("name") def ipv6(self): return int(self.conf.get("ipv6", 0)) def transport(self): """ Get the SNMP transport taking into consideration ipv4/ipv6 :return: SNMP transport """ if self.ipv6(): transport = cmdgen.Udp6TransportTarget((self.destination(), self.port())) else: transport = cmdgen.UdpTransportTarget((self.destination(), self.port()), timeout=5) return transport def security_object(self): """ Get the SNMP security object from the configuration, taking into consideration the SNMP version :return: security object """ # snmp 1 and 2C params snmp_version = self.conf.get("snmp_version", "2C") if snmp_version == "3": v3_security_name = self.conf.get("v3_securityName", "") v3_auth_key = self.conf.get("v3_authKey", None) v3_priv_key = self.conf.get("v3_privKey", None) v3_auth_protocol_str = self.conf.get("v3_authProtocol", "usmHMACMD5AuthProtocol") v3_priv_protocol_str = self.conf.get("v3_privProtocol", "usmDESPrivProtocol") v3_auth_protocol = { 'usmHMACMD5AuthProtocol': cmdgen.usmHMACMD5AuthProtocol, 'usmHMACSHAAuthProtocol': cmdgen.usmHMACSHAAuthProtocol, 'usmNoAuthProtocol': cmdgen.usmNoAuthProtocol }.get(v3_auth_protocol_str) v3_priv_protocol = { 'usmDESPrivProtocol': cmdgen.usmDESPrivProtocol, 'usm3DESEDEPrivProtocol': cmdgen.usm3DESEDEPrivProtocol, 'usmAesCfb128Protocol': cmdgen.usmAesCfb128Protocol, 'usmAesCfb192Protocol': cmdgen.usmAesCfb192Protocol, 'usmAesCfb256Protocol': cmdgen.usmAesCfb256Protocol, 'usmNoPrivProtocol': cmdgen.usmNoPrivProtocol, }.get(v3_priv_protocol_str) security_object = cmdgen.UsmUserData(v3_security_name, authKey=v3_auth_key, privKey=v3_priv_key, authProtocol=v3_auth_protocol, privProtocol=v3_priv_protocol) else: communitystring = self.conf.get("communitystring", "public") mp_model_val = 1 if snmp_version == "1": mp_model_val = 0 security_object = cmdgen.CommunityData(communitystring, mpModel=mp_model_val) return security_object def is_valid(self): valid = True if self.port() is None or int(self.port()) < 1: print_validation_error("Port value must be a positive integer") valid = False if self.snmpinterval() is None or int(self.snmpinterval()) < 1: print_validation_error("SNMP Polling interval must be a positive integer") valid = False if self.destination() is None: print_validation_error("Destination must be present") valid = False # TODO Validate security options?? return valid
{ "content_hash": "c9edc0c9ad6348dd1917b33b21465e28", "timestamp": "", "source": "github", "line_count": 147, "max_line_length": 110, "avg_line_length": 39.36054421768708, "alnum_prop": 0.5782924300034566, "repo_name": "liquidtelecom/splunk-snmpmod", "id": "fe5cd7af53d96ab428b7a527cb2bcdb6a37eff4f", "size": "5786", "binary": false, "copies": "2", "ref": "refs/heads/master", "path": "snmpmod/bin/SnmpStanza.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "PowerShell", "bytes": "392" }, { "name": "Python", "bytes": "77395" }, { "name": "Ruby", "bytes": "534" }, { "name": "Shell", "bytes": "315" } ], "symlink_target": "" }
from __future__ import (unicode_literals, absolute_import, division, print_function) import logging from collections import OrderedDict from django.utils import timezone from snisi_web.views.upload import ( handle_report_upload as original_handle_report_upload) from snisi_nutrition.xls_import import NutritionExcelForm from snisi_core.models.Reporting import ExpectedReporting, ReportClass from snisi_nutrition.integrity import ( create_nut_report, URENAMNutritionRIntegrityChecker, URENASNutritionRIntegrityChecker, URENINutritionRIntegrityChecker, StocksNutritionRIntegrityChecker) from snisi_nutrition.models.URENAM import AbstractURENAMNutritionR from snisi_nutrition.models.URENAS import AbstractURENASNutritionR from snisi_nutrition.models.URENI import AbstractURENINutritionR from snisi_nutrition.models.Stocks import AbstractNutritionStocksR reportcls_nut = ReportClass.get_or_none(slug='nutrition_monthly_routine') logger = logging.getLogger(__name__) def handle_report_upload(excel_form, form, provider): if not isinstance(excel_form, NutritionExcelForm): return original_handle_report_upload(excel_form, form, provider) excel_form.set('submit_time', timezone.now()) excel_form.set('submitter', provider) # ensure we have a expecteds and all excel_form.check() if not excel_form.is_valid(): return None, excel_form.errors.pop().render(short=True) # build requirements for report entity = excel_form.get('entity') period = excel_form.get('period') # expected reporting defines if report is expeted or not expected_reporting = ExpectedReporting.get_or_none( report_class=reportcls_nut, period=period, within_period=False, entity=entity, within_entity=False, amount_expected=ExpectedReporting.EXPECTED_SINGLE) # should have already been checked in excel_form. if expected_reporting is None: logger.error("Expected reporting not found: " "cls:{cls} - period:{period} - entity:{entity}" .format(cls=reportcls_nut, period=period, entity=entity)) return None, ("Aucun rapport de routine attendu à " "{entity} pour {period}" .format(entity=entity, period=period)) # check data individually for sub reports integrity_map = OrderedDict([ ('urenam', (AbstractURENAMNutritionR, URENAMNutritionRIntegrityChecker)), ('urenas', (AbstractURENASNutritionR, URENASNutritionRIntegrityChecker)), ('ureni', (AbstractURENINutritionR, URENINutritionRIntegrityChecker)), ('stocks', (AbstractNutritionStocksR, StocksNutritionRIntegrityChecker)), ]) sr_checkers = {} master_fields = ['entity', 'period', 'submitter', 'submit_time'] for sr, sr_data in integrity_map.items(): sr_rcls, sr_cls = sr_data if sr == 'stocks' or getattr(entity, 'has_{}'.format(sr), False): logger.debug("checking {}".format(sr)) sri = sr_cls() # feed checker with meta-data for field in master_fields: sri.set(field, excel_form.get(field)) # feed checker with UREN data for field in sr_rcls.data_fields(): sri.set(field, excel_form.get('{}_{}'.format(sr, field))) sri.check() if not sri.is_valid(): for feedback in sri.feedbacks: # should_raise = sri.raised == feedback excel_form.add_feedback(feedback, False) else: sr_checkers[sr] = sri # checker now includes sub-reports errors if not excel_form.is_valid(): return None, None # all sub reports have been checked. we can safely create reports logger.debug("[UPLOAD] ALL UREN+STOCKS CHECKS PERFORMED. CREATING REPORT") return create_nut_report( provider=provider, expected_reporting=expected_reporting, completed_on=timezone.now(), integrity_checker=excel_form, data_source=excel_form, subreport_checkers=sr_checkers)
{ "content_hash": "1fb02e8d34363ea096a39bfafb4473d0", "timestamp": "", "source": "github", "line_count": 116, "max_line_length": 78, "avg_line_length": 36.91379310344828, "alnum_prop": 0.6510976179355441, "repo_name": "yeleman/snisi", "id": "04cc80fcf0b9843a3bd1479afaecfbe8b7d1e61e", "size": "4362", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "snisi_nutrition/upload.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "410022" }, { "name": "HTML", "bytes": "1007275" }, { "name": "Java", "bytes": "7211" }, { "name": "JavaScript", "bytes": "292583" }, { "name": "Python", "bytes": "2237855" }, { "name": "Shell", "bytes": "111" } ], "symlink_target": "" }
from bisect import bisect_left from whoosh.compat import iteritems, xrange from whoosh.filedb.compound import CompoundStorage from whoosh.filedb.fieldcache import FieldCache, DefaultFieldCachingPolicy from whoosh.matching import FilterMatcher from whoosh.reading import IndexReader, TermNotFound from whoosh.store import OverlayStorage from whoosh.support import dawg SAVE_BY_DEFAULT = True # Reader class class SegmentReader(IndexReader): GZIP_CACHES = False def __init__(self, storage, schema, segment, generation=None, codec=None): self.storage = storage self.schema = schema self.segment = segment self._gen = generation self.is_closed = False # Copy info from underlying segment self._has_deletions = segment.has_deletions() self._dc = segment.doc_count() self._dc_all = segment.doc_count_all() if hasattr(self.segment, "segment_id"): self.segid = self.segment.segment_id() else: from whoosh.codec.base import Segment self.segid = Segment._random_id() # self.files is a storage object from which to load the segment files. # This is different from the general storage (which will be used for # cahces) if the segment is in a compound file. if segment.is_compound(): # Use an overlay here instead of just the compound storage because # in rare circumstances a segment file may be added after the # segment is written self.files = OverlayStorage(segment.open_compound_file(storage), self.storage) else: self.files = storage # Get microreaders from codec if codec is None: from whoosh.codec import default_codec codec = default_codec() self._codec = codec self._terms = codec.terms_reader(self.files, self.segment) self._lengths = codec.lengths_reader(self.files, self.segment) self._stored = codec.stored_fields_reader(self.files, self.segment) self._vectors = None # Lazy open with self._open_vectors() self._graph = None # Lazy open with self._open_dawg() self.set_caching_policy() def _open_vectors(self): if self._vectors: return self._vectors = self._codec.vector_reader(self.files, self.segment) def _open_dawg(self): if self._graph: return self._graph = self._codec.graph_reader(self.files, self.segment) def has_deletions(self): return self._has_deletions def doc_count(self): return self._dc def doc_count_all(self): return self._dc_all def is_deleted(self, docnum): return self.segment.is_deleted(docnum) def generation(self): return self._gen def __repr__(self): return "%s(%s)" % (self.__class__.__name__, self.segment) def __contains__(self, term): return term in self._terms def close(self): self._terms.close() self._stored.close() if self._lengths: self._lengths.close() if self._vectors: self._vectors.close() if self._graph: self._graph.close() self.files.close() self.caching_policy = None self.is_closed = True def stored_fields(self, docnum): assert docnum >= 0 schema = self.schema return dict(item for item in iteritems(self._stored[docnum]) if item[0] in schema) def all_stored_fields(self): is_deleted = self.segment.is_deleted sf = self.stored_fields for docnum in xrange(self._dc_all): if not is_deleted(docnum): yield sf(docnum) def field_length(self, fieldname): return self._lengths.field_length(fieldname) def min_field_length(self, fieldname): return self._lengths.min_field_length(fieldname) def max_field_length(self, fieldname): return self._lengths.max_field_length(fieldname) def doc_field_length(self, docnum, fieldname, default=0): return self._lengths.doc_field_length(docnum, fieldname, default=default) def has_vector(self, docnum, fieldname): if self.schema[fieldname].vector: try: self._open_vectors() except (NameError, IOError): return False return (docnum, fieldname) in self._vectors else: return False def _test_field(self, fieldname): if fieldname not in self.schema: raise TermNotFound("No field %r" % fieldname) if self.schema[fieldname].format is None: raise TermNotFound("Field %r is not indexed" % fieldname) def all_terms(self): schema = self.schema return ((fieldname, text) for fieldname, text in self._terms.keys() if fieldname in schema) def terms_from(self, fieldname, prefix): self._test_field(fieldname) schema = self.schema return ((fname, text) for fname, text in self._terms.keys_from((fieldname, prefix)) if fname in schema) def term_info(self, fieldname, text): self._test_field(fieldname) try: return self._terms[fieldname, text] except KeyError: raise TermNotFound("%s:%r" % (fieldname, text)) def _texts_in_fieldcache(self, fieldname, prefix=''): # The first value in a fieldcache is the default texts = self.fieldcache(fieldname).texts[1:] if prefix: i = bisect_left(texts, prefix) while i < len(texts) and texts[i].startswith(prefix): yield texts[i] i += 1 else: for text in texts: yield text def expand_prefix(self, fieldname, prefix): self._test_field(fieldname) # If a fieldcache for the field is already loaded, we already have the # values for the field in memory, so just yield them from there if self.fieldcache_loaded(fieldname): return self._texts_in_fieldcache(fieldname, prefix) else: # Call super return IndexReader.expand_prefix(self, fieldname, prefix) def lexicon(self, fieldname): self._test_field(fieldname) # If a fieldcache for the field is already loaded, we already have the # values for the field in memory, so just yield them from there if self.fieldcache_loaded(fieldname): return self._texts_in_fieldcache(fieldname) else: # Call super return IndexReader.lexicon(self, fieldname) def __iter__(self): schema = self.schema return ((term, terminfo) for term, terminfo in self._terms.items() if term[0] in schema) def iter_from(self, fieldname, text): schema = self.schema self._test_field(fieldname) for term, terminfo in self._terms.items_from((fieldname, text)): if term[0] not in schema: continue yield (term, terminfo) def frequency(self, fieldname, text): self._test_field(fieldname) try: return self._terms.frequency((fieldname, text)) except KeyError: return 0 def doc_frequency(self, fieldname, text): self._test_field(fieldname) try: return self._terms.doc_frequency((fieldname, text)) except KeyError: return 0 def postings(self, fieldname, text, scorer=None): if fieldname not in self.schema: raise TermNotFound("No field %r" % fieldname) format_ = self.schema[fieldname].format matcher = self._terms.matcher(fieldname, text, format_, scorer=scorer) deleted = self.segment.deleted if deleted: matcher = FilterMatcher(matcher, deleted, exclude=True) return matcher def vector(self, docnum, fieldname): if fieldname not in self.schema: raise TermNotFound("No field %r" % fieldname) vformat = self.schema[fieldname].vector if not vformat: raise Exception("No vectors are stored for field %r" % fieldname) self._open_vectors() return self._vectors.matcher(docnum, fieldname, vformat) # DAWG methods def has_word_graph(self, fieldname): if fieldname not in self.schema: return False if not self.schema[fieldname].spelling: return False try: self._open_dawg() except (NameError, IOError, dawg.FileVersionError): return False return self._graph.has_root(fieldname) def word_graph(self, fieldname): if not self.has_word_graph(fieldname): raise KeyError("No word graph for field %r" % fieldname) return dawg.Node(self._graph, self._graph.root(fieldname)) def terms_within(self, fieldname, text, maxdist, prefix=0): if not self.has_word_graph(fieldname): # This reader doesn't have a graph stored, use the slow method return IndexReader.terms_within(self, fieldname, text, maxdist, prefix=prefix) return dawg.within(self._graph, text, k=maxdist, prefix=prefix, address=self._graph.root(fieldname)) # Field cache methods def supports_caches(self): return True def set_caching_policy(self, cp=None, save=True, storage=None): """This method lets you control the caching policy of the reader. You can either pass a :class:`whoosh.filedb.fieldcache.FieldCachingPolicy` as the first argument, *or* use the `save` and `storage` keywords to alter the default caching policy:: # Use a custom field caching policy object reader.set_caching_policy(MyPolicy()) # Use the default caching policy but turn off saving caches to disk reader.set_caching_policy(save=False) # Use the default caching policy but save caches to a custom # storage from whoosh.filedb.filestore import FileStorage mystorage = FileStorage("path/to/cachedir") reader.set_caching_policy(storage=mystorage) :param cp: a :class:`whoosh.filedb.fieldcache.FieldCachingPolicy` object. If this argument is not given, the default caching policy is used. :param save: save field caches to disk for re-use. If a caching policy object is specified using `cp`, this argument is ignored. :param storage: a custom :class:`whoosh.store.Storage` object to use for saving field caches. If a caching policy object is specified using `cp` or `save` is `False`, this argument is ignored. """ if not cp: if save and storage is None: storage = self.storage elif not save: storage = None cp = DefaultFieldCachingPolicy(self.segment.segment_id(), storage=storage) if type(cp) is type: cp = cp() self.caching_policy = cp def _fieldkey(self, fieldname): return "%s/%s" % (self.segid, fieldname) def fieldcache(self, fieldname, save=SAVE_BY_DEFAULT): """Returns a :class:`whoosh.filedb.fieldcache.FieldCache` object for the given field. :param fieldname: the name of the field to get a cache for. :param save: if True (the default), the cache is saved to disk if it doesn't already exist. """ key = self._fieldkey(fieldname) fc = self.caching_policy.get(key) if not fc: fc = FieldCache.from_field(self, fieldname) self.caching_policy.put(key, fc, save=save) return fc def fieldcache_available(self, fieldname): """Returns True if a field cache exists for the given field (either in memory already or on disk). """ return self._fieldkey(fieldname) in self.caching_policy def fieldcache_loaded(self, fieldname): """Returns True if a field cache for the given field is in memory. """ return self.caching_policy.is_loaded(self._fieldkey(fieldname)) def unload_fieldcache(self, name): self.caching_policy.delete(self._fieldkey(name))
{ "content_hash": "639e2e54271f20b2afc64099a977e3c6", "timestamp": "", "source": "github", "line_count": 351, "max_line_length": 79, "avg_line_length": 36.06837606837607, "alnum_prop": 0.6022116903633491, "repo_name": "mozilla/popcorn_maker", "id": "9c63691af2ec247482474d49f715174bdafa25c2", "size": "14190", "binary": false, "copies": "4", "ref": "refs/heads/master", "path": "vendor-local/lib/python/whoosh/filedb/filereading.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "JavaScript", "bytes": "3779620" }, { "name": "Puppet", "bytes": "11668" }, { "name": "Python", "bytes": "5113791" }, { "name": "Ruby", "bytes": "1970" }, { "name": "Shell", "bytes": "2419" } ], "symlink_target": "" }
from __future__ import absolute_import __author__ = 'chad nelson' __project__ = 'blowdrycss' # TODO: Consider what it would take to handle shorthand property 'font'. class FontParser(object): """ **Features:** - Parses unquoted font families. Unquoted Font-Family References: | http://www.cssfontstack.com/ | https://mathiasbynens.be/notes/unquoted-font-family - Holds a basic ``font_families_dict`` (could be extended as desired): | Keys: ``font-family`` category names | Values: ``font-family`` member names - Can generate web safe fallback fonts. Assumes that the property_name is ``font-family``. It does not handle the shorthand property_name ``font`` **Examples:** >>> font_parser = FontParser('papyrus') >>> font_parser.generate_fallback_fonts() 'papyrus, fantasy' """ def __init__(self, font_value=''): self.font_value = font_value self.font_families_dict = { 'serif': { 'georgia', 'palatino', 'times', 'cambria', 'didot', 'garamond', 'perpetua', 'rockwell', 'baskerville', }, 'sans-serif': { 'arial', 'helvetica', 'gadget', 'cursive', 'impact', 'charcoal', 'tahoma', 'geneva', 'verdana', 'calibri', 'candara', 'futura', 'optima', }, 'monospace': {'courier', 'monaco', 'consolas', }, 'fantasy': {'copperplate', 'papyrus', }, } def generate_fallback_fonts(self): """ Generates web safe fallback fonts Reference: http://www.w3schools.com/cssref/css_websafe_fonts.asp :return: (str) -- Returns a web safe fallback font string. **Examples:** >>> font_parser = FontParser('arial') >>> font_parser.generate_fallback_fonts() 'arial, sans-serif' >>> font_parser.font_value = 'monospace' 'monospace' >>> font_parser.font_value = 'invalid' '' """ fallback = '' # set default font to empty string if self.font_value in self.font_families_dict: fallback = self.font_value # font_value 'monospace' returns 'monospace' else: for family, fonts in self.font_families_dict.items(): if self.font_value in fonts: fallback = self.font_value + ", " + family # font_value 'arial' returns 'arial, sans-serif' return fallback # TODO: Consider the handling of multi-word double quoted fonts i.e. "Palatino Linotype", "Book Antiqua", etc. # Seems complicated. # could use 'qq', 'q--q' or 'dq' to indicate double-quotes e.g. # 'qqPalatino-Linotypeqq' - confusing 'Linotype' looks like 'Linotypeg'. The letter 'q' looks like a 'g' at the end. # 'q-Palatino-Linotype-q' - might work # 'dqPalatino-Linotypedq' - confusing 'Linotype' becomes 'Linotyped'. The letter 'd' commonly ends words.
{ "content_hash": "6c6c48f18aa88be54a5ed5a3a431456f", "timestamp": "", "source": "github", "line_count": 78, "max_line_length": 120, "avg_line_length": 38.56410256410256, "alnum_prop": 0.5784574468085106, "repo_name": "nueverest/BlowDryCSS", "id": "afc2cd8ea75ebde9a1f7e884a9b77d47cd44a69a", "size": "3019", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "blowdrycss/fontparser.py", "mode": "33188", "license": "mit", "language": [ { "name": "ASP", "bytes": "3689" }, { "name": "CSS", "bytes": "1378" }, { "name": "HTML", "bytes": "17637" }, { "name": "JavaScript", "bytes": "10569" }, { "name": "Python", "bytes": "399730" } ], "symlink_target": "" }
""" This script is for creating download reports for a given folder, recursively. Examples: girder audit-logs-report --folder=57557fac8d777f68be8f3f49 --start-date=2018-09-10T13:55:34.847Z --end-date=2018-09-13T13:55:34.847Z --output report.csv girder audit-logs-report -f 57557fac8d777f68be8f3f49 """ import click import csv import dateutil.parser import sys from bson.objectid import ObjectId from girder.models.item import Item from girder.models.folder import Folder from girder_audit_logs import Record def index_folder(folderId): if Folder().load(folderId, force=True) is None: raise ValueError('folderId={} was not a valid folder'.format(folderId)) items = Item().find({'folderId': ObjectId(folderId)}) subfolders = Folder().find({'parentId': ObjectId(folderId)}) files = [] for item in items: for file in Item().childFiles(item, fields={'_id': True}): fileId = file['_id'] files.append(fileId) for folder in subfolders: files += index_folder(folder['_id']) return files def get_file_download_records(files, start=None, end=None): query = { 'type': 'file.download', 'details.fileId': { '$in': files, }, 'details.startByte': 0 } if (start is not None) or (end is not None): whenClause = {'when': {}} if start is not None: whenClause['when']['$gte'] = dateutil.parser.parse(start) if end is not None: whenClause['when']['$lt'] = dateutil.parser.parse(end) query.update(whenClause) return Record().find(query) @click.command(name='audit-logs-report') @click.option('-f', '--folder', help='folder ID to use as root for all download reports.', required=True) @click.option('--start-date', help='ISO 8601 format') @click.option('--end-date', help='ISO 8601 format') @click.option('-o', '--output', type=click.File('w'), default=sys.stdout, help='file to write out') def report(folder, start_date, end_date, output): files = index_folder(folder) records = get_file_download_records(files, start=start_date, end=end_date) fieldnames = ['file_id', 'ip', 'timestamp'] rows = ({ 'file_id': r['details']['fileId'], 'ip': r['ip'], 'timestamp': r['when'].isoformat(), } for r in records) reportwriter = csv.DictWriter(output, fieldnames=fieldnames) reportwriter.writeheader() reportwriter.writerows(rows) if __name__ == '__main__': report()
{ "content_hash": "99ed5ae64a0054d62cdcdec6a76c2fe9", "timestamp": "", "source": "github", "line_count": 82, "max_line_length": 99, "avg_line_length": 31.20731707317073, "alnum_prop": 0.6307151230949589, "repo_name": "girder/girder", "id": "f00fd82e2c463c1d9a87076037e877605ed7d014", "size": "2559", "binary": false, "copies": "5", "ref": "refs/heads/master", "path": "plugins/audit_logs/girder_audit_logs/report.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "CMake", "bytes": "26244" }, { "name": "CSS", "bytes": "6537" }, { "name": "Dockerfile", "bytes": "1528" }, { "name": "HTML", "bytes": "14" }, { "name": "JavaScript", "bytes": "1176017" }, { "name": "Jinja", "bytes": "322" }, { "name": "Mako", "bytes": "7571" }, { "name": "Pug", "bytes": "137980" }, { "name": "Python", "bytes": "2018697" }, { "name": "Roff", "bytes": "17" }, { "name": "Shell", "bytes": "3354" }, { "name": "Stylus", "bytes": "48706" } ], "symlink_target": "" }
# -*- coding: utf-8 -*- # ProjectEuler/src/python/problem363.py # # Bézier Curves # ============= # Published on Sunday, 18th December 2011, 10:00 am # # A cubic Bézier curve is defined by four points: P0, P1, P2 and P3. import projecteuler as pe def main(): pass if __name__ == "__main__": main()
{ "content_hash": "98e49f855818231fdc4a28b6045c0e9e", "timestamp": "", "source": "github", "line_count": 16, "max_line_length": 68, "avg_line_length": 19.375, "alnum_prop": 0.6129032258064516, "repo_name": "olduvaihand/ProjectEuler", "id": "3fa3fccf761986dbac3e06927d3aea743bbf1c1e", "size": "314", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "src/python/problem363.py", "mode": "33188", "license": "mit", "language": [ { "name": "Go", "bytes": "0" }, { "name": "Python", "bytes": "422751" } ], "symlink_target": "" }
""" An APF auth plugin to provide SSH key info. """ import base64 import logging import os import traceback # Does not need to be a thread because it doesn't need to perform asynch actions. class SSH(object): """ Container for SSH account info. Works with provided filepaths. Work with config-only provided base64-encoded tokens, with files created. Files written to <authbasedir>/<name>/<ssh.type> <authbasedir>/<name>/<ssh.type>.pub """ def __init__(self, manager, config, section): self.log = logging.getLogger('autopyfactory.auth') self.name = section self.manager = manager self.factory = manager.factory self.basedir = os.path.expanduser(config.get(section, 'authbasedir')) self.sshtype = config.get(section, 'ssh.type' ) self.privkey = config.get(section, 'ssh.privatekey' ) self.pubkey = config.get(section, 'ssh.publickey' ) self.privkeypass = config.get(section, 'ssh.privkeypass') self.privkeypath = os.path.expanduser(config.get(section, 'ssh.privatekeyfile' )) self.pubkeypath = os.path.expanduser(config.get(section, 'ssh.publickeyfile' )) self.privkeypasspath = config.get(section, 'ssh.privkeypassfile') #self.passwordfile = config.get(section, 'ssh.passwordfile') # Handle raw empty values if self.privkey.lower() == 'none': self.privkey = None if self.privkeypass.lower() == 'none': self.privkeypass = None if self.pubkey.lower() == 'none': self.pubkey = None # Handle path empty values if self.privkeypath.lower() == 'none': self.privkeypath = None if self.privkeypasspath.lower() == 'none': self.privkeypasspath = None if self.pubkeypath.lower() == 'none': self.pubkeypath = None #if self.passwordfile.lower() == 'none': # self.passwordfile = None # Create files if needed if self.privkey is not None: fdir = "%s/%s" % (self.basedir, self.name) fpath = "%s/%s" % (fdir, self.sshtype) try: self._ensuredir(fdir) self._decodewrite(fpath, self.privkey) self.privkeypath = fpath os.chmod(fpath, 0600) self.log.debug("Wrote decoded private key to %s and set config OK." % self.privkeypath) except Exception, e: self.log.error("Exception: %s" % str(e)) self.log.debug("Exception: %s" % traceback.format_exc()) if self.pubkey is not None: fdir = "%s/%s" % (self.basedir, self.name) fpath = "%s/%s.pub" % (fdir, self.sshtype) try: self._ensuredir(fdir) self._decodewrite(fpath, self.pubkey) self.pubkeypath = fpath self.log.debug("Wrote decoded public key to %s and set config OK." % self.pubkeypath) except Exception, e: self.log.error("Exception: %s" % str(e)) self.log.debug("Exception: %s" % traceback.format_exc()) self.log.debug("SSH Handler for profile %s initialized." % self.name) def _ensuredir(self, dirpath): self.log.debug("Ensuring directory %s" % dirpath) if not os.path.exists(dirpath): os.makedirs(dirpath) def _decodewrite(self, filepath, b64string ): self.log.debug("Writing key to %s" % filepath) decoded = SSH.decode(b64string) try: fh = open(filepath, 'w') fh.write(decoded) fh.close() except Exception, e: self.log.error("Exception: %s" % str(e)) self.log.debug("Exception: %s" % traceback.format_exc()) raise else: fh.close() def _validate(self): """ Confirm credentials exist and are valid. """ return True def getSSHPubKey(self): pass def getSSHPrivKey(self): pass def getSSHPubKeyFilePath(self): self.log.debug('[%s] Retrieving pubkeypath: %s' % (self.name, self.pubkeypath)) return self.pubkeypath def getSSHPrivKeyFilePath(self): self.log.debug('[%s] Retrieving privkeypath: %s' % (self.name, self.privkeypath)) return self.privkeypath def getSSHPassFilePath(self): self.log.debug('[%s] Retrieving passpath: %s' % (self.name, self.privkeypasspath)) return self.privkeypasspath ############################################## # External Utility class methods. ############################################## @classmethod def encode(self, string): return base64.b64encode(string) @classmethod def decode(self, string): return base64.b64decode(string)
{ "content_hash": "14dd7ca6b62089b05e52dd5d9ee1d166", "timestamp": "", "source": "github", "line_count": 139, "max_line_length": 103, "avg_line_length": 36.25179856115108, "alnum_prop": 0.5562611629291526, "repo_name": "btovar/autopyfactory", "id": "f6d882bee6e7bba6c3adcc2e4c0f4bd3fc34ca36", "size": "5039", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "autopyfactory/plugins/authmanager/auth/SSH.py", "mode": "33188", "license": "apache-2.0", "language": [ { "name": "Python", "bytes": "827948" }, { "name": "Shell", "bytes": "97872" } ], "symlink_target": "" }
import re from django.urls import reverse_lazy from django.http import HttpResponseRedirect from django.contrib import messages from django.conf import settings from core import models EXEMPT_URLS = [re.compile(expr) for expr in settings.LOGIN_EXEMPT_URLS] EXEMPT_URLS += [re.compile(expr) for expr in settings.ROOT_CRT_INTERFACE] class RootCrtMiddleware: def __init__(self, get_response): self.get_response = get_response def __call__(self, request): response = self.get_response(request) if any(m.match(request.path_info) for m in EXEMPT_URLS): return response if models.RootCrt.objects.exists(): return response messages.info(request, 'Please create crt root') return HttpResponseRedirect(reverse_lazy('root_crt'))
{ "content_hash": "0e8db1ea450c69a40342303ff3d0ea2b", "timestamp": "", "source": "github", "line_count": 25, "max_line_length": 73, "avg_line_length": 32.16, "alnum_prop": 0.7052238805970149, "repo_name": "telminov/ca", "id": "d3d38fab10a65df1ce6914234061ddefe775dff1", "size": "804", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "core/middleware.py", "mode": "33188", "license": "mit", "language": [ { "name": "CSS", "bytes": "2346" }, { "name": "Dockerfile", "bytes": "1352" }, { "name": "HTML", "bytes": "21396" }, { "name": "JavaScript", "bytes": "1109" }, { "name": "Python", "bytes": "90979" } ], "symlink_target": "" }
from __future__ import absolute_import import pandas as pd import numpy as np import pyaf.ForecastEngine as autof import pyaf.Bench.TS_datasets as tsds b1 = tsds.load_ozone() df = b1.mPastData #df.tail(10) #df[:-10].tail() #df[:-10:-1] #df.describe() lEngine = autof.cForecastEngine() lEngine H = b1.mHorizon; # lEngine.mOptions.enable_slow_mode(); lEngine.mOptions.mDebugPerformance = True; lEngine.mOptions.mModelSelection_Criterion = "CRPS" lEngine.train(df , b1.mTimeVar , b1.mSignalVar, H); lEngine.getModelInfo(); print(lEngine.mSignalDecomposition.mTrPerfDetails.columns); lColumns = ['Split', 'Transformation', 'Model', 'Category', 'Complexity', 'FitCRPS', 'ForecastCRPS', 'TestCRPS'] print(lEngine.mSignalDecomposition.mTrPerfDetails[lColumns].head(10)); lEngine.mSignalDecomposition.mBestModel.mTimeInfo.mResolution lEngine.standardPlots("outputs/my_ozone"); dfapp_in = df.copy(); dfapp_in.tail() #H = 12 dfapp_out = lEngine.forecast(dfapp_in, H); #dfapp_out.to_csv("outputs/ozone_apply_out.csv") dfapp_out.tail(2 * H) print("Forecast Columns " , dfapp_out.columns); Forecast_DF = dfapp_out[[b1.mTimeVar , b1.mSignalVar, b1.mSignalVar + '_Forecast']] print(Forecast_DF.info()) print("Forecasts\n" , Forecast_DF.tail(H)); print("\n\n<ModelInfo>") print(lEngine.to_json()); print("</ModelInfo>\n\n") print("\n\n<Forecast>") print(Forecast_DF.tail(2*H).to_json(date_format='iso')) print("</Forecast>\n\n")
{ "content_hash": "0d4056358256298dff25c135805a7b26", "timestamp": "", "source": "github", "line_count": 57, "max_line_length": 83, "avg_line_length": 25.280701754385966, "alnum_prop": 0.7244968771686329, "repo_name": "antoinecarme/pyaf", "id": "58642401d7e5d4ecf471bd62f2b3231ebe32a1bb", "size": "1441", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "tests/probabilistic_forecasting/test_ozone.py", "mode": "33188", "license": "bsd-3-clause", "language": [ { "name": "Makefile", "bytes": "6773299" }, { "name": "Procfile", "bytes": "24" }, { "name": "Python", "bytes": "54209093" }, { "name": "R", "bytes": "807" }, { "name": "Shell", "bytes": "3619" } ], "symlink_target": "" }
""" Sliding-window-based job/task queue class (& example of use.) May use ``multiprocessing.Process`` or ``threading.Thread`` objects as queue items, though within Fabric itself only ``Process`` objects are used/supported. """ from __future__ import with_statement import time import Queue from collections import deque from progressbar import Bar, ETA, Percentage, ProgressBar, SimpleProgress from fabric.context_managers import settings from fabric.network import ssh class JobQueue(object): """ The goal of this class is to make a queue of processes to run, and go through them running X number at any given time. So if the bubble is 5 start with 5 running and move the bubble of running procs along the queue looking something like this: Start ........................... [~~~~~].................... ___[~~~~~]................. _________[~~~~~]........... __________________[~~~~~].. ____________________[~~~~~] ___________________________ End """ def __init__(self, max_running, comms_queue, role_limits=None, debug=False): """ Setup the class to resonable defaults. """ self._max = max_running self._comms_queue = comms_queue self._debug = debug if role_limits is None: role_limits = {} role_limits.setdefault('default', self._max) self._pools = {} for role, limit in role_limits.iteritems(): self._pools[role] = { 'running': [], 'queue': deque(), 'limit': limit, } self._completed = [] self._num_of_jobs = 0 self._finished = False self._closed = False widgets = ['Running tasks: ', Percentage(), ' ', Bar(), ' ', SimpleProgress(), ' ', ETA()] self.pbar = ProgressBar(widgets=widgets) def _all_alive(self): """ Simply states if all procs are alive or not. Needed to determine when to stop looping, and pop dead procs off and add live ones. """ if self._running: for pool in self._pools.itervalues(): if not all(x.is_alive() for x in pool['running']): return False return True else: return False def __len__(self): """ Just going to use number of jobs as the JobQueue length. """ return self._num_of_jobs def close(self): """ A sanity check, so that the need to care about new jobs being added in the last throws of the job_queue's run are negated. """ if self._debug: print("JOB QUEUE: closed") self._closed = True def append(self, process): """ Add the Process() to the queue, so that later it can be checked up on. That is if the JobQueue is still open. If the queue is closed, this will just silently do nothing. To get data back out of this process, give ``process`` access to a ``multiprocessing.Queue`` object, and give it here as ``queue``. Then ``JobQueue.run`` will include the queue's contents in its return value. """ if not self._closed: r = process.name.split('|')[0] role = r if r in self._pools else 'default' self._pools[role]['queue'].appendleft(process) self._num_of_jobs += 1 self.pbar.maxval = self._num_of_jobs if self._debug: print("JOB QUEUE: %s: added %s" % (role, process.name)) def run(self): """ This is the workhorse. It will take the intial jobs from the _queue, start them, add them to _running, and then go into the main running loop. This loop will check for done procs, if found, move them out of _running into _completed. It also checks for a _running queue with open spots, which it will then fill as discovered. To end the loop, there have to be no running procs, and no more procs to be run in the queue. This function returns an iterable of all its children's exit codes. """ def _advance_the_queue(pool): """ Helper function to do the job of poping a new proc off the queue start it, then add it to the running queue. This will eventually depleate the _queue, which is a condition of stopping the running while loop. It also sets the env.host_string from the job.name, so that fabric knows that this is the host to be making connections on. """ job = pool['queue'].pop() if self._debug: print("Popping '%s' off the queue and starting it" % job.name) with settings(clean_revert=True, host_string=job.name, host=job.name): job.start() pool['running'].append(job) # Prep return value so we can start filling it during main loop results = {} for pool in self._pools.itervalues(): for job in pool['queue']: # job.name contains role so split that off and discard job_name = job.name.split('|')[-1] results[job_name] = dict.fromkeys(('exit_code', 'results')) if not self._closed: raise Exception("Need to close() before starting.") if self._debug: print("JOB QUEUE: starting") self.pbar.start() while len(self._completed) < self._num_of_jobs: for pool_name, pool in self._pools.iteritems(): while len(pool['queue']) and len(pool['running']) < pool['limit']: _advance_the_queue(pool) for i, job in enumerate(pool['running']): if not job.is_alive(): if self._debug: print("JOB QUEUE: %s: %s: finish" % (pool_name, job.name)) job.join() # not necessary for Process but is for Thread self._completed.append(job) pool['running'].pop(i) job_name = job.name.split('|')[-1] results[job_name]['exit_code'] = job.exitcode # Each loop pass, try pulling results off the queue to keep its # size down. At this point, we don't actually care if any results # have arrived yet; they will be picked up after the main loop. self._fill_results(results) time.sleep(ssh.io_sleep) if self._debug: print("JOB QUEUE: %s: %d running jobs" % (pool_name, len(pool['running']))) if len(pool['queue']) == 0: print("JOB QUEUE: %s: depleted" % pool_name) # Allow some context switching time.sleep(ssh.io_sleep) self.pbar.update(len(self._completed)) # Consume anything left in the results queue. Note that there is no # need to block here, as the main loop ensures that all workers will # already have finished. self._fill_results(results) # Attach exit codes now that we're all done & have joined all jobs for job in self._completed: results[job.name]['exit_code'] = job.exitcode self.pbar.finish() return results def _fill_results(self, results): """ Attempt to pull data off self._comms_queue and add to 'results' dict. If no data is available (i.e. the queue is empty), bail immediately. """ while True: try: datum = self._comms_queue.get_nowait() results[datum['name']]['results'] = datum['result'] except Queue.Empty: break #### Sample def try_using(parallel_type): """ This will run the queue through it's paces, and show a simple way of using the job queue. """ def print_number(number): """ Simple function to give a simple task to execute. """ print(number) if parallel_type == "multiprocessing": from multiprocessing import Process as Bucket # noqa elif parallel_type == "threading": from threading import Thread as Bucket # noqa # Make a job_queue with a bubble of len 5, and have it print verbosely jobs = JobQueue(5) jobs._debug = True # Add 20 procs onto the stack for x in range(20): jobs.append(Bucket( target=print_number, args=[x], kwargs={}, )) # Close up the queue and then start it's execution jobs.close() jobs.run() if __name__ == '__main__': try_using("multiprocessing") try_using("threading")
{ "content_hash": "818dfb9aad71601cb0aced07b0eaea0b", "timestamp": "", "source": "github", "line_count": 266, "max_line_length": 98, "avg_line_length": 33.755639097744364, "alnum_prop": 0.5425993985967257, "repo_name": "getsentry/fabric", "id": "41476709da7627abb03e9e3256af917b82ac4bab", "size": "8979", "binary": false, "copies": "1", "ref": "refs/heads/master", "path": "fabric/job_queue.py", "mode": "33188", "license": "bsd-2-clause", "language": [ { "name": "Python", "bytes": "438132" } ], "symlink_target": "" }