hexsha stringlengths 40 40 | size int64 5 2.06M | ext stringclasses 10
values | lang stringclasses 1
value | max_stars_repo_path stringlengths 3 248 | max_stars_repo_name stringlengths 5 125 | max_stars_repo_head_hexsha stringlengths 40 78 | max_stars_repo_licenses listlengths 1 10 | max_stars_count int64 1 191k ⌀ | max_stars_repo_stars_event_min_datetime stringlengths 24 24 ⌀ | max_stars_repo_stars_event_max_datetime stringlengths 24 24 ⌀ | max_issues_repo_path stringlengths 3 248 | max_issues_repo_name stringlengths 5 125 | max_issues_repo_head_hexsha stringlengths 40 78 | max_issues_repo_licenses listlengths 1 10 | max_issues_count int64 1 67k ⌀ | max_issues_repo_issues_event_min_datetime stringlengths 24 24 ⌀ | max_issues_repo_issues_event_max_datetime stringlengths 24 24 ⌀ | max_forks_repo_path stringlengths 3 248 | max_forks_repo_name stringlengths 5 125 | max_forks_repo_head_hexsha stringlengths 40 78 | max_forks_repo_licenses listlengths 1 10 | max_forks_count int64 1 105k ⌀ | max_forks_repo_forks_event_min_datetime stringlengths 24 24 ⌀ | max_forks_repo_forks_event_max_datetime stringlengths 24 24 ⌀ | content stringlengths 5 2.06M | avg_line_length float64 1 1.02M | max_line_length int64 3 1.03M | alphanum_fraction float64 0 1 | count_classes int64 0 1.6M | score_classes float64 0 1 | count_generators int64 0 651k | score_generators float64 0 1 | count_decorators int64 0 990k | score_decorators float64 0 1 | count_async_functions int64 0 235k | score_async_functions float64 0 1 | count_documentation int64 0 1.04M | score_documentation float64 0 1 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
9ddc3d1e0254e6926c024e8ba5ff8037971f9673 | 5,434 | py | Python | software/pynguin/pynguin/testcase/execution/monkeytypeexecutor.py | se2p/artifact-pynguin-ssbse2020 | 32b5f4d27ef1b81e5c541471e98fa6e50f5ce8a6 | [
"CC-BY-4.0"
] | 3 | 2020-08-20T10:27:13.000Z | 2021-11-02T20:28:16.000Z | software/pynguin/pynguin/testcase/execution/monkeytypeexecutor.py | se2p/artifact-pynguin-ssbse2020 | 32b5f4d27ef1b81e5c541471e98fa6e50f5ce8a6 | [
"CC-BY-4.0"
] | null | null | null | software/pynguin/pynguin/testcase/execution/monkeytypeexecutor.py | se2p/artifact-pynguin-ssbse2020 | 32b5f4d27ef1b81e5c541471e98fa6e50f5ce8a6 | [
"CC-BY-4.0"
] | null | null | null | # This file is part of Pynguin.
#
# Pynguin is free software: you can redistribute it and/or modify
# it under the terms of the GNU Lesser General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Pynguin is distributed in the ho... | 37.219178 | 88 | 0.636916 | 4,124 | 0.758925 | 0 | 0 | 224 | 0.041222 | 0 | 0 | 1,110 | 0.204269 |
9ddca262545e263f1aa26d015f1d96948d664c84 | 7,778 | py | Python | testproject/testapp/tests/test_history_entries.py | innovationinit/django-wicked-historian | bef0011639791e2275c6bf2272b57542174b4cf0 | [
"BSD-2-Clause"
] | null | null | null | testproject/testapp/tests/test_history_entries.py | innovationinit/django-wicked-historian | bef0011639791e2275c6bf2272b57542174b4cf0 | [
"BSD-2-Clause"
] | null | null | null | testproject/testapp/tests/test_history_entries.py | innovationinit/django-wicked-historian | bef0011639791e2275c6bf2272b57542174b4cf0 | [
"BSD-2-Clause"
] | 1 | 2022-03-15T07:29:58.000Z | 2022-03-15T07:29:58.000Z | "Test history entries for migrated, obsolete fields"
from datetime import (
time,
timedelta,
)
from decimal import Decimal
from typing import (
Any,
Dict,
)
from django.contrib.auth.models import User
from django.db import models
from wicked_historian.usersmuggler import usersmuggler
from wicked_histo... | 36.862559 | 125 | 0.613525 | 7,219 | 0.928131 | 0 | 0 | 123 | 0.015814 | 0 | 0 | 1,472 | 0.189252 |
9ddcc75effef9735c94806309f3290c831fcccf5 | 219 | py | Python | UnityEngine/HideFlags/__init__.py | Grim-es/udon-pie-auto-completion | c2cd86554ed615cdbbb01e19fa40665eafdfaedc | [
"MIT"
] | null | null | null | UnityEngine/HideFlags/__init__.py | Grim-es/udon-pie-auto-completion | c2cd86554ed615cdbbb01e19fa40665eafdfaedc | [
"MIT"
] | null | null | null | UnityEngine/HideFlags/__init__.py | Grim-es/udon-pie-auto-completion | c2cd86554ed615cdbbb01e19fa40665eafdfaedc | [
"MIT"
] | null | null | null | from UdonPie import UnityEngine
from UdonPie.Undefined import *
class HideFlags:
def __new__(cls, arg1=None):
'''
:returns: HideFlags
:rtype: UnityEngine.HideFlags
'''
pass
| 18.25 | 37 | 0.611872 | 152 | 0.694064 | 0 | 0 | 0 | 0 | 0 | 0 | 81 | 0.369863 |
9ddcd002e78260764fc62fd401536244bf8603dd | 536 | py | Python | solicitudes/migrations/0006_auto_20191101_0122.py | jmartipu/CrearSolicitudBack | e05c30d81eee3277c2e28e8e3e8991fa723dd770 | [
"MIT"
] | null | null | null | solicitudes/migrations/0006_auto_20191101_0122.py | jmartipu/CrearSolicitudBack | e05c30d81eee3277c2e28e8e3e8991fa723dd770 | [
"MIT"
] | 7 | 2019-10-10T16:57:29.000Z | 2022-02-10T08:14:25.000Z | solicitudes/migrations/0006_auto_20191101_0122.py | jmartipu/CrearSolicitudBack | e05c30d81eee3277c2e28e8e3e8991fa723dd770 | [
"MIT"
] | null | null | null | # Generated by Django 2.2.5 on 2019-11-01 06:22
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('solicitudes', '0005_auto_20191101_0115'),
]
operations = [
migrations.RemoveField(
model_name='solicitud',
name='tip... | 23.304348 | 73 | 0.600746 | 443 | 0.826493 | 0 | 0 | 0 | 0 | 0 | 0 | 166 | 0.309701 |
9ddcebb4e8c7a0186684b52cc9c2d36af16dce87 | 12,639 | py | Python | mmdetection/third_party/text_perceptron/mmdet/models/seg_heads/tp_head.py | chengzhanzhan/DAVAR-Lab-OCR | 79776915c616731698d452d935e7b599b1ce46f0 | [
"Apache-2.0"
] | 4 | 2021-07-08T03:08:16.000Z | 2022-03-20T02:53:29.000Z | mmdetection/third_party/text_perceptron/mmdet/models/seg_heads/tp_head.py | chengzhanzhan/DAVAR-Lab-OCR | 79776915c616731698d452d935e7b599b1ce46f0 | [
"Apache-2.0"
] | null | null | null | mmdetection/third_party/text_perceptron/mmdet/models/seg_heads/tp_head.py | chengzhanzhan/DAVAR-Lab-OCR | 79776915c616731698d452d935e7b599b1ce46f0 | [
"Apache-2.0"
] | null | null | null | """
####################################################################################################
# Copyright Info : Copyright (c) Davar Lab @ Hikvision Research Institute. All rights reserved.
# Filename : tp_head.py
# Abstract : Text Perceptron head structure, mainly including losses for s... | 48.240458 | 131 | 0.600047 | 11,007 | 0.870738 | 0 | 0 | 11,030 | 0.872558 | 0 | 0 | 4,558 | 0.360573 |
9ddd09288fc0047903028aaf720e265008e2c882 | 5,757 | py | Python | MyHDLSim/Wrappers/SignalWrapper.py | mattsnowboard/msu-myhdlsim | 5d0d881b682a72b77d9597cb84b8fdd4bd444afc | [
"BSD-2-Clause"
] | 1 | 2021-03-30T10:20:06.000Z | 2021-03-30T10:20:06.000Z | MyHDLSim/Wrappers/SignalWrapper.py | mattsnowboard/msu-myhdlsim | 5d0d881b682a72b77d9597cb84b8fdd4bd444afc | [
"BSD-2-Clause"
] | null | null | null | MyHDLSim/Wrappers/SignalWrapper.py | mattsnowboard/msu-myhdlsim | 5d0d881b682a72b77d9597cb84b8fdd4bd444afc | [
"BSD-2-Clause"
] | null | null | null | import wx, wx.lib.newevent
import wx.lib.ogl as ogl
from myhdl import Signal, always, intbv
from MyHDLSim.sequential import ClkDriver
# OGL object to draw a signal
class SignalOGLShape(ogl.CompositeShape):
""" This shape is used exclusively to contruct the SIGNAL main shape.
The shape is initially based wi... | 34.473054 | 94 | 0.589717 | 5,583 | 0.969776 | 0 | 0 | 0 | 0 | 0 | 0 | 1,507 | 0.261768 |
9ddd849ad1a926498070335095fce2ee85d5a45b | 1,403 | py | Python | Modular Chatbot/frankenbot-framework/frankenbot_console.py | MAhsanShahid/Frankenbot | d9425446fb3754591aeea7ab7e562199f937bd52 | [
"MIT"
] | 2 | 2021-04-27T12:51:35.000Z | 2021-08-16T12:43:50.000Z | Modular Chatbot/frankenbot-framework/frankenbot_console.py | MAhsanShahid/Frankenbot | d9425446fb3754591aeea7ab7e562199f937bd52 | [
"MIT"
] | null | null | null | Modular Chatbot/frankenbot-framework/frankenbot_console.py | MAhsanShahid/Frankenbot | d9425446fb3754591aeea7ab7e562199f937bd52 | [
"MIT"
] | 1 | 2021-08-16T12:43:51.000Z | 2021-08-16T12:43:51.000Z | import json
import sys
from frankenbot.bot import Bot
from frankenbot.console_chat_interface import ConsoleChatInterface
from frankenbot.persistence.json.json_unserializer import JSONUnserializer
bot_def = "bot_def/restaurantsearch.json"
unserializer = JSONUnserializer()
#simpleResponseGenerator object
bot = unseriali... | 34.219512 | 91 | 0.784034 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,038 | 0.739843 |
9dde6bfc80676d7c23483dae2cdebeb48e518e09 | 6,801 | py | Python | spinel_wisun_utils.py | LaudateCorpus1/ti-wisunfan-pyspinel | 5b911ef8319115fb2ef20a57358dd44733bed30a | [
"Apache-2.0"
] | 2 | 2021-03-22T21:42:03.000Z | 2021-09-01T09:12:43.000Z | spinel_wisun_utils.py | LaudateCorpus1/ti-wisunfan-pyspinel | 5b911ef8319115fb2ef20a57358dd44733bed30a | [
"Apache-2.0"
] | 1 | 2021-11-11T16:18:51.000Z | 2021-11-11T16:18:51.000Z | spinel_wisun_utils.py | LaudateCorpus1/ti-wisunfan-pyspinel | 5b911ef8319115fb2ef20a57358dd44733bed30a | [
"Apache-2.0"
] | 5 | 2021-08-18T03:15:32.000Z | 2022-01-20T05:19:41.000Z | #!/usr/bin/env python
#
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, soft... | 32.54067 | 94 | 0.642847 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2,031 | 0.298633 |
9ddef4eb6e5502bd565a0db158fed8bdc6d939f1 | 1,383 | py | Python | src/ModularChess/movements/EnPassant.py | ferranSanchezLlado/ModularChess | 896fa192fd49f86062ea79dd0d3cbe7e5cdc9d6b | [
"MIT"
] | null | null | null | src/ModularChess/movements/EnPassant.py | ferranSanchezLlado/ModularChess | 896fa192fd49f86062ea79dd0d3cbe7e5cdc9d6b | [
"MIT"
] | null | null | null | src/ModularChess/movements/EnPassant.py | ferranSanchezLlado/ModularChess | 896fa192fd49f86062ea79dd0d3cbe7e5cdc9d6b | [
"MIT"
] | null | null | null | from typing import TYPE_CHECKING, Optional
from ModularChess.movements.Movement import Movement, MovementData
if TYPE_CHECKING:
from ModularChess.pieces.Piece import Piece
from ModularChess.utils.Position import Position
class EnPassant(Movement):
def __init__(self, piece: "Piece", new_position: "Positi... | 44.612903 | 103 | 0.642805 | 1,149 | 0.830803 | 0 | 0 | 0 | 0 | 0 | 0 | 41 | 0.029646 |
9ddfecdb8db0a77645be766083a1ef5b0e142f16 | 2,387 | py | Python | pytemperaturectrl/julabo.py | jenrei/pytemperaturectrl | eabfbf8a6d732cda72c5cd8397a85b0d8960da78 | [
"MIT"
] | null | null | null | pytemperaturectrl/julabo.py | jenrei/pytemperaturectrl | eabfbf8a6d732cda72c5cd8397a85b0d8960da78 | [
"MIT"
] | null | null | null | pytemperaturectrl/julabo.py | jenrei/pytemperaturectrl | eabfbf8a6d732cda72c5cd8397a85b0d8960da78 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
"""
julabo.py
Contains Julabo temperature control
see documentation http://www.julabo.com/sites/default/files/downloads/manuals/french/19524837-V2.pdf at section 10.2.
:copyright: (c) 2015 by Maxime DAUPHIN
:license: MIT, see LICENSE for details
"""
import serial
import time
from .pytempera... | 26.820225 | 118 | 0.714286 | 2,027 | 0.849183 | 0 | 0 | 0 | 0 | 0 | 0 | 800 | 0.335149 |
9de15ad674c58a2528581460d79721fcb5a0883c | 1,143 | py | Python | algorithms/matrix.py | rkistner/contest-algorithms | 8133f8ddce4f257386c7bcf55589d559854c1955 | [
"Apache-2.0"
] | 4 | 2015-03-08T15:38:45.000Z | 2018-04-08T02:13:54.000Z | algorithms/matrix.py | rkistner/contest-algorithms | 8133f8ddce4f257386c7bcf55589d559854c1955 | [
"Apache-2.0"
] | 1 | 2017-11-29T01:15:55.000Z | 2017-11-29T01:17:40.000Z | algorithms/matrix.py | rkistner/contest-algorithms | 8133f8ddce4f257386c7bcf55589d559854c1955 | [
"Apache-2.0"
] | 4 | 2015-11-08T03:39:54.000Z | 2020-11-06T10:42:53.000Z | """
Some basic matrix-related functionality.
"""
def cumulative2d(grid):
"""
>>> cumulative2d([[2, 5, 4], [3, 8, 1]])
[[0, 0, 0, 0], [0, 2, 7, 11], [0, 5, 18, 23]]
"""
rows = []
for row in grid:
rrr = [0]
last = 0
for col in row:
last += col
rrr.a... | 21.166667 | 65 | 0.464567 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 408 | 0.356955 |
9de39c8afb68ea723afe9738f2762762838a1e06 | 5,361 | py | Python | douyu_spider/douyu_spider_v2.py | DH-JQ/WebSpider-DH | 71603c85cc5327ce7a0a864db145f3c650fa13a5 | [
"MIT"
] | null | null | null | douyu_spider/douyu_spider_v2.py | DH-JQ/WebSpider-DH | 71603c85cc5327ce7a0a864db145f3c650fa13a5 | [
"MIT"
] | null | null | null | douyu_spider/douyu_spider_v2.py | DH-JQ/WebSpider-DH | 71603c85cc5327ce7a0a864db145f3c650fa13a5 | [
"MIT"
] | null | null | null | from selenium import webdriver
from selenium.webdriver.common.by import By
from selenium.webdriver.support.ui import WebDriverWait
from selenium.webdriver.support import expected_conditions as EC
from lxml import etree
import json
class DouyuSpider:
def __init__(self):
""" 初始化
"""
start_u... | 43.233871 | 112 | 0.564447 | 5,100 | 0.941828 | 0 | 0 | 0 | 0 | 0 | 0 | 1,816 | 0.335365 |
9de3f58e34c1bda2a31dcb16e2481f3de5ab6ad2 | 960 | py | Python | setup.py | fungibit/bitcoinscript | ced6fb37dfa40eac7341826c758842e0ed7e7475 | [
"MIT"
] | 1 | 2017-10-25T17:11:44.000Z | 2017-10-25T17:11:44.000Z | setup.py | fungibit/bitcoinscript | ced6fb37dfa40eac7341826c758842e0ed7e7475 | [
"MIT"
] | 3 | 2017-03-10T05:27:29.000Z | 2017-04-07T16:06:28.000Z | setup.py | fungibit/bitcoinscript | ced6fb37dfa40eac7341826c758842e0ed7e7475 | [
"MIT"
] | null | null | null | #!/usr/bin/env python
from setuptools import setup, find_packages
from codecs import open
from os import path
here = path.abspath(path.dirname(__file__))
# Get the long description from the README file
with open(path.join(here, 'README.rst'), encoding='utf-8') as f:
long_description = f.read()
# Read version in... | 28.235294 | 64 | 0.726042 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 397 | 0.413542 |
9de4af217717d87a01fd3c8f160faa869464539b | 29,850 | py | Python | discretize/tree_mesh.py | ngodber/discretize | 2329c9e9552b5c05f40ebf62f0bb207267bd2f92 | [
"MIT"
] | 123 | 2017-01-09T04:59:25.000Z | 2022-03-29T08:06:43.000Z | discretize/tree_mesh.py | ngodber/discretize | 2329c9e9552b5c05f40ebf62f0bb207267bd2f92 | [
"MIT"
] | 246 | 2017-01-09T17:20:12.000Z | 2022-03-01T22:05:20.000Z | discretize/tree_mesh.py | ngodber/discretize | 2329c9e9552b5c05f40ebf62f0bb207267bd2f92 | [
"MIT"
] | 26 | 2018-03-27T19:24:46.000Z | 2021-11-11T20:28:09.000Z | # ___ ___ ___ ___ ___ ___
# /\ \ /\ \ /\ \ /\ \ /\ \ /\ \
# /::\ \ /::\ \ \:\ \ /::\ \ /::\ \ /::\ \
# /:/\:\ \ /:/\:\ \ \:\ \ /:/\:\ \ /:/\:\ \ /:/\:\ \
# /:/ \:\ \ /:/ \... | 38.665803 | 115 | 0.514807 | 25,409 | 0.851223 | 0 | 0 | 7,343 | 0.245997 | 0 | 0 | 14,321 | 0.479765 |
9de60149d3083eff4951fd6c5511316e856edce5 | 4,053 | py | Python | BLOX/Examples/DayTrader/data_downloader.py | linearlabstech/blox | 6a5c8a28fcfcb17731be89939284e7ac13a047d7 | [
"Apache-2.0"
] | 17 | 2019-03-31T18:37:35.000Z | 2020-08-17T18:14:40.000Z | BLOX/Examples/DayTrader/data_downloader.py | linearlabstech/blox | 6a5c8a28fcfcb17731be89939284e7ac13a047d7 | [
"Apache-2.0"
] | null | null | null | BLOX/Examples/DayTrader/data_downloader.py | linearlabstech/blox | 6a5c8a28fcfcb17731be89939284e7ac13a047d7 | [
"Apache-2.0"
] | 1 | 2019-04-02T07:02:08.000Z | 2019-04-02T07:02:08.000Z | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
"""
Copyright (c) 2019, Linear Labs Technology
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless ... | 40.939394 | 203 | 0.606464 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2,913 | 0.718727 |
9de667e4365b4429b64b9267a959ad26b53a85c3 | 790 | py | Python | services/db-api/project/config.py | JoshPrim/EVA-Projekt | 94e4f594519eda676e0f5f2787f8643831f346df | [
"Apache-2.0"
] | 2 | 2018-05-30T08:40:26.000Z | 2018-09-06T15:37:25.000Z | services/db-api/project/config.py | JoshPrim/EVA-Projekt | 94e4f594519eda676e0f5f2787f8643831f346df | [
"Apache-2.0"
] | 1 | 2021-06-01T22:37:55.000Z | 2021-06-01T22:37:55.000Z | services/db-api/project/config.py | JoshPrim/EVA-Projekt | 94e4f594519eda676e0f5f2787f8643831f346df | [
"Apache-2.0"
] | 2 | 2018-05-31T14:55:04.000Z | 2018-08-29T09:38:31.000Z | import os
from project import app, db
class BaseConfig:
"""Base configuration"""
TESTING = False
SQLALCHEMY_TRACK_MODIFICATIONS = False
print('Running through config')
class DevelopmentConfig(BaseConfig):
"""Development configuration"""
SQLALCHEMY_DATABASE_URI = os.environ.get('POSTGRES_URL')... | 27.241379 | 65 | 0.734177 | 744 | 0.941772 | 0 | 0 | 0 | 0 | 0 | 0 | 236 | 0.298734 |
9de764b4415129ff93630dd93ad535a3c634a3e9 | 625 | py | Python | webapp/models/steps.py | PratikMahajan/Recipe-Management-Webapp-And-Infrastructure | 234b0685ee0367a3e37401af3bd77d6fc6cde6ce | [
"Apache-2.0"
] | null | null | null | webapp/models/steps.py | PratikMahajan/Recipe-Management-Webapp-And-Infrastructure | 234b0685ee0367a3e37401af3bd77d6fc6cde6ce | [
"Apache-2.0"
] | null | null | null | webapp/models/steps.py | PratikMahajan/Recipe-Management-Webapp-And-Infrastructure | 234b0685ee0367a3e37401af3bd77d6fc6cde6ce | [
"Apache-2.0"
] | null | null | null | from sqlalchemy import Column,Integer,String, Float
from sqlalchemy.ext.declarative import declarative_base
from sqlalchemy import create_engine
from config.envvar import *
Base = declarative_base()
class Steps(Base):
__tablename__ = "steps"
id = Column(Integer, primary_key=True, autoincrement=True)
recip... | 31.25 | 120 | 0.7184 | 219 | 0.3504 | 0 | 0 | 0 | 0 | 0 | 0 | 74 | 0.1184 |
9de7ae2aa492539dbc68ce4c0725d40d32f1d767 | 2,184 | py | Python | causallearn/utils/ChoiceGenerator.py | softsys4ai/causal-config-labyrinth | 4f50f9ff15429b0ac6ad0a99fbe4cfdd17e360fc | [
"MIT"
] | 15 | 2022-01-20T12:35:35.000Z | 2022-03-24T16:25:24.000Z | causallearn/utils/ChoiceGenerator.py | softsys4ai/unicorn | 4f50f9ff15429b0ac6ad0a99fbe4cfdd17e360fc | [
"MIT"
] | 14 | 2022-01-23T00:20:00.000Z | 2022-02-22T01:40:43.000Z | causallearn/utils/ChoiceGenerator.py | softsys4ai/causal-config-labyrinth | 4f50f9ff15429b0ac6ad0a99fbe4cfdd17e360fc | [
"MIT"
] | 1 | 2022-02-23T08:59:24.000Z | 2022-02-23T08:59:24.000Z | class ChoiceGenerator:
'''
Generates (nonrecursively) all of the combinations of a choose b, where a, b
are nonnegative integers and a >= b. The values of a and b are given in the
constructor, and the sequence of choices is obtained by repeatedly calling
the next() method. When the sequence is fin... | 34.125 | 80 | 0.56456 | 2,183 | 0.999542 | 0 | 0 | 0 | 0 | 0 | 0 | 1,067 | 0.488553 |
9de9e23fa22dfbdc836f630d94dbe82b7f2350bd | 1,259 | py | Python | src/sample.py | xiajing10/akec | 239fdda923c8a0743f56dbf0a009fa2235b85451 | [
"MIT"
] | 14 | 2021-01-28T07:13:25.000Z | 2022-02-10T06:41:32.000Z | src/sample.py | xiajing10/akec | 239fdda923c8a0743f56dbf0a009fa2235b85451 | [
"MIT"
] | 2 | 2021-04-14T15:24:30.000Z | 2021-05-06T07:02:08.000Z | src/sample.py | xiajing10/akec | 239fdda923c8a0743f56dbf0a009fa2235b85451 | [
"MIT"
] | 1 | 2021-07-09T02:52:59.000Z | 2021-07-09T02:52:59.000Z | # -*- coding: utf-8 -*-
"""
Created on Thu Jun 11 11:17:21 2020
@author: eilxaix
"""
import pandas as pd
import re
def remove_hashtag(t):
t=re.sub('-',' ', t)
t=' '.join(t.split())
return t
def read_csv_data(df):
title = [remove_hashtag(i) for i in df['Document Title']]
abstract = [remove_hashta... | 38.151515 | 155 | 0.576648 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 483 | 0.383638 |
9deb0ef9427cc365d5801578cfd0695ec1ae527c | 17,705 | py | Python | scicopia/app/parser/ScicopiaParser.py | pikatech/Scicopia | dcdb3b4f55b9111fa3b4fe78afdb07bb2ceb9985 | [
"MIT"
] | null | null | null | scicopia/app/parser/ScicopiaParser.py | pikatech/Scicopia | dcdb3b4f55b9111fa3b4fe78afdb07bb2ceb9985 | [
"MIT"
] | 9 | 2021-07-24T16:12:03.000Z | 2021-07-24T16:58:19.000Z | scicopia/app/parser/ScicopiaParser.py | pikatech/Scicopia | dcdb3b4f55b9111fa3b4fe78afdb07bb2ceb9985 | [
"MIT"
] | 1 | 2021-06-18T16:00:06.000Z | 2021-06-18T16:00:06.000Z | # Generated from Scicopia.g4 by ANTLR 4.9.2
# encoding: utf-8
from antlr4 import *
from io import StringIO
import sys
if sys.version_info[1] > 5:
from typing import TextIO
else:
from typing.io import TextIO
def serializedATN():
with StringIO() as buf:
buf.write("\3\u608b\ua72a\u8133\ub9ed\u417c\u3be7\u7... | 33.468809 | 471 | 0.560859 | 15,791 | 0.891895 | 0 | 0 | 0 | 0 | 0 | 0 | 1,828 | 0.103248 |
9dec02cc3a734c80b921decedb5baec89b783ae0 | 259 | py | Python | scripts/init_db.py | LucienZhang/werewolf | c0b4baf2a0f7904978a26a533fe8a695fc274407 | [
"MIT"
] | null | null | null | scripts/init_db.py | LucienZhang/werewolf | c0b4baf2a0f7904978a26a533fe8a695fc274407 | [
"MIT"
] | 6 | 2020-02-10T10:01:03.000Z | 2020-04-01T06:19:55.000Z | scripts/init_db.py | LucienZhang/werewolf | c0b4baf2a0f7904978a26a533fe8a695fc274407 | [
"MIT"
] | null | null | null | from pathlib import Path
import sys
sys.path.append(str(Path(__file__).resolve().parents[1]))
from werewolf import create_app
from werewolf.database import db
app = create_app('db')
with app.app_context():
db.drop_all()
db.create_all()
| 19.923077 | 58 | 0.710425 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 | 0.015444 |
9deccc7336bb4388cafa2a33d6c4aebd562a78e9 | 936 | py | Python | tests/test_estimators/test_probweight_regression.py | janvdvegt/scikit-lego | 774e557c4d19f67ef54f3f0d1622c64ef9903b63 | [
"MIT"
] | null | null | null | tests/test_estimators/test_probweight_regression.py | janvdvegt/scikit-lego | 774e557c4d19f67ef54f3f0d1622c64ef9903b63 | [
"MIT"
] | null | null | null | tests/test_estimators/test_probweight_regression.py | janvdvegt/scikit-lego | 774e557c4d19f67ef54f3f0d1622c64ef9903b63 | [
"MIT"
] | null | null | null | import numpy as np
import pytest
from sklego.common import flatten
from sklego.linear_model import ProbWeightRegression
from tests.conftest import nonmeta_checks, regressor_checks, general_checks
@pytest.mark.parametrize("test_fn", flatten([
nonmeta_checks,
general_checks,
regressor_checks
]))
def test_e... | 36 | 95 | 0.794872 | 0 | 0 | 0 | 0 | 435 | 0.464744 | 0 | 0 | 47 | 0.050214 |
9ded0421224a68f8c7f744c1d9f09e3afc552f04 | 854 | py | Python | Python/problem0294.py | 1050669722/LeetCode-Answers | c8f4d1ccaac09cda63b60d75144335347b06dc81 | [
"MIT"
] | null | null | null | Python/problem0294.py | 1050669722/LeetCode-Answers | c8f4d1ccaac09cda63b60d75144335347b06dc81 | [
"MIT"
] | null | null | null | Python/problem0294.py | 1050669722/LeetCode-Answers | c8f4d1ccaac09cda63b60d75144335347b06dc81 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
"""
Created on Sat Jun 29 19:44:28 2019
@author: Administrator
"""
class Solution:
def canWin(self, s: str) -> bool:
ans = self.generatePossibleNextMoves(s)
print(ans)
count = 0
for state in ans:
# print(state)
for k in range(len(state... | 23.081081 | 60 | 0.432084 | 683 | 0.785057 | 0 | 0 | 0 | 0 | 0 | 0 | 197 | 0.226437 |
9def3bfc70e4954b3590123b603ffa0f9d2385b3 | 79 | py | Python | wmtexe/__init__.py | csdms/wmt-exe | d1e21537135a2d2c442ae6244427b076803d1254 | [
"MIT"
] | null | null | null | wmtexe/__init__.py | csdms/wmt-exe | d1e21537135a2d2c442ae6244427b076803d1254 | [
"MIT"
] | 10 | 2016-02-04T17:55:34.000Z | 2019-03-19T21:10:39.000Z | wmtexe/__init__.py | csdms/wmt-exe | d1e21537135a2d2c442ae6244427b076803d1254 | [
"MIT"
] | 1 | 2015-07-29T22:22:46.000Z | 2015-07-29T22:22:46.000Z | """The CSDMS Web Modeling Tool (WMT) execution server."""
__version__ = '0.3'
| 19.75 | 57 | 0.683544 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 62 | 0.78481 |
9df0774506aa365c6756ee8a870b647ac6699146 | 8,284 | py | Python | GEM/plt_resukts_GEM.py | Webbah/sec-for-reinforcement-learning | 19db622dce4963d25cb1b6e4ae12ddf98b6d27d2 | [
"MIT"
] | 2 | 2021-12-16T12:49:26.000Z | 2022-01-28T19:18:43.000Z | GEM/plt_resukts_GEM.py | Webbah/sec-for-reinforcement-learning | 19db622dce4963d25cb1b6e4ae12ddf98b6d27d2 | [
"MIT"
] | null | null | null | GEM/plt_resukts_GEM.py | Webbah/sec-for-reinforcement-learning | 19db622dce4963d25cb1b6e4ae12ddf98b6d27d2 | [
"MIT"
] | null | null | null | import matplotlib
import matplotlib.pyplot as plt
import numpy as np
import pandas as pd
save_results = False
def plot_stored_GEM_reults(interval_x=None, interval_y=None):
if interval_x is None:
#interval_list_x = [0.499, 0.506] # 1
interval_list_x = [0, 1]
#interval_list_x = [0.299, 0.30... | 49.017751 | 185 | 0.543457 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4,034 | 0.486963 |
9df19b2f9979610a8ed9bef79a44747496f8dd2a | 3,725 | py | Python | Adhesion/Interactions/PowerLaw.py | ContactEngineering/Adhesion | acc46ad9bfe49fec667cb9a116ebde426faa38c4 | [
"MIT"
] | null | null | null | Adhesion/Interactions/PowerLaw.py | ContactEngineering/Adhesion | acc46ad9bfe49fec667cb9a116ebde426faa38c4 | [
"MIT"
] | 4 | 2021-08-18T07:30:57.000Z | 2022-03-05T11:05:09.000Z | Adhesion/Interactions/PowerLaw.py | ContactEngineering/Adhesion | acc46ad9bfe49fec667cb9a116ebde426faa38c4 | [
"MIT"
] | null | null | null | #
# Copyright 2020 Antoine Sanner
# 2020 Lars Pastewka
#
# ### MIT license
#
# Permission is hereby granted, free of charge, to any person obtaining a copy
# of this software and associated documentation files (the "Software"), to deal
# in the Software without restriction, including without limitation the ri... | 32.391304 | 79 | 0.628725 | 2,482 | 0.666309 | 0 | 0 | 258 | 0.069262 | 0 | 0 | 1,726 | 0.463356 |
9df469a37713b98c57237b63b551cab2396ffeab | 4,687 | py | Python | theory/func/bardell/print_bardell_integrals_to_C.py | mrosemeier/compmech | f18f6d0471c72b26a3b014d2df41df3463505eae | [
"BSD-3-Clause"
] | 4 | 2019-02-05T06:12:12.000Z | 2022-03-25T14:41:18.000Z | theory/func/bardell/print_bardell_integrals_to_C.py | saullocastro/panels | 5387daab1ec656b065f7a9be820e2c234e53764e | [
"BSD-3-Clause"
] | null | null | null | theory/func/bardell/print_bardell_integrals_to_C.py | saullocastro/panels | 5387daab1ec656b065f7a9be820e2c234e53764e | [
"BSD-3-Clause"
] | 2 | 2019-06-05T07:19:35.000Z | 2020-12-29T00:22:18.000Z | import os
import glob
from ast import literal_eval
import numpy as np
import sympy
from sympy import pi, sin, cos, var
from sympy.printing import ccode
from compmech.conecyl.sympytools import mprint_as_sparse, pow2mult
var('x1t, x1r, x2t, x2r')
var('y1t, y1r, y2t, y2r')
var('xi1, xi2')
var('c0, c1')
subs = {
... | 34.211679 | 100 | 0.53019 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,712 | 0.365266 |
9df4e6c48971da6fc4b9921811db567e82ddd1ec | 6,277 | py | Python | src/distributeddictionarylearning.py | att/Distributed-Dictionary-Learning | c6915477dac1ffe7d9a732dd31333d540f5bd00b | [
"MIT"
] | 5 | 2020-07-25T18:44:54.000Z | 2022-03-27T14:14:20.000Z | src/distributeddictionarylearning.py | att/Distributed-Dictionary-Learning | c6915477dac1ffe7d9a732dd31333d540f5bd00b | [
"MIT"
] | null | null | null | src/distributeddictionarylearning.py | att/Distributed-Dictionary-Learning | c6915477dac1ffe7d9a732dd31333d540f5bd00b | [
"MIT"
] | 3 | 2019-09-04T08:04:09.000Z | 2022-03-27T14:14:26.000Z | import time
import numpy as np
from sparsecoding import sparse_encode_omp
from sparsecoding import sparse_encode_nnmp
from distributedpowermethod import distri_powermethod
def cloud_ksvd(X, AtomN, dict_init, s, NodeN, networkGraph, vec_init, max_iter, powerIterations, consensusIterations):
sigdim = ... | 44.204225 | 135 | 0.463916 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 74 | 0.011789 |
9df5471ca3ddddaa94bd6982c624b686b6a66f95 | 677 | py | Python | Python3/Books/Douson/chapter09/simple_game.py | neon1ks/Study | 5d40171cf3bf5e8d3a95539e91f5afec54d1daf3 | [
"MIT"
] | null | null | null | Python3/Books/Douson/chapter09/simple_game.py | neon1ks/Study | 5d40171cf3bf5e8d3a95539e91f5afec54d1daf3 | [
"MIT"
] | null | null | null | Python3/Books/Douson/chapter09/simple_game.py | neon1ks/Study | 5d40171cf3bf5e8d3a95539e91f5afec54d1daf3 | [
"MIT"
] | 2 | 2018-07-31T23:25:43.000Z | 2019-07-03T14:26:18.000Z | # Simple Game
# Demonstrates importing modules
import games, random
print("Welcome to the world's simplest game!\n")
again = None
while again != "n":
players = []
num = games.ask_number(question = "How many players? (2 - 5): ",
low = 2, high = 5)
for i in range(num):
na... | 26.038462 | 68 | 0.589365 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 235 | 0.34712 |
9df56584ef8b053ce1af3875d1ad5df2cd5671e4 | 189 | py | Python | src/1.foundation/1.embedding_python/1.4.create_custom_module/assets/scripts/game.py | Chukobyte/learn-engine-dev | 3f4437ed4abab9011d584bdc0ab4eff921393f00 | [
"CC-BY-4.0",
"CC0-1.0"
] | 5 | 2021-08-13T01:53:59.000Z | 2022-01-23T18:50:17.000Z | src/1.foundation/1.embedding_python/1.4.create_custom_module/assets/scripts/game.py | Chukobyte/learn-engine-dev | 3f4437ed4abab9011d584bdc0ab4eff921393f00 | [
"CC-BY-4.0",
"CC0-1.0"
] | null | null | null | src/1.foundation/1.embedding_python/1.4.create_custom_module/assets/scripts/game.py | Chukobyte/learn-engine-dev | 3f4437ed4abab9011d584bdc0ab4eff921393f00 | [
"CC-BY-4.0",
"CC0-1.0"
] | null | null | null | import engine
class Player:
def talk(self, message: str) -> None:
engine_version = engine.get_version()
engine.print_log(message=f"Engine version = {engine_version}")
| 23.625 | 70 | 0.68254 | 172 | 0.910053 | 0 | 0 | 0 | 0 | 0 | 0 | 36 | 0.190476 |
9df570a8cc43113443b6b213e6ab3adba4fc6941 | 964 | py | Python | yomikatawa/run.py | tensorknower69/yomikatawa-py | 3e49e5e5d2ebfc49ddabe5a20e486ea0927b362a | [
"MIT"
] | null | null | null | yomikatawa/run.py | tensorknower69/yomikatawa-py | 3e49e5e5d2ebfc49ddabe5a20e486ea0927b362a | [
"MIT"
] | null | null | null | yomikatawa/run.py | tensorknower69/yomikatawa-py | 3e49e5e5d2ebfc49ddabe5a20e486ea0927b362a | [
"MIT"
] | null | null | null | import argparse
import yomikatawa as yomi
def create_parser():
parser = argparse.ArgumentParser(description="A command line interface for https://yomikatawa.com.")
parser.add_argument("-c", "--category", type=str, default="kanji", help="print possible choices on error")
parser.add_argument("-r", "--romaji"... | 41.913043 | 140 | 0.706432 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 315 | 0.326763 |
9df5c3a1c0529a4f203b0c8d4d096dd4cd43ed68 | 10,873 | py | Python | izzoLambertSolver.py | tylera277/voyagerTrajectoryCalculator | fded6356e670fbc2b182cac2bfcc98e7223e2b80 | [
"MIT"
] | null | null | null | izzoLambertSolver.py | tylera277/voyagerTrajectoryCalculator | fded6356e670fbc2b182cac2bfcc98e7223e2b80 | [
"MIT"
] | null | null | null | izzoLambertSolver.py | tylera277/voyagerTrajectoryCalculator | fded6356e670fbc2b182cac2bfcc98e7223e2b80 | [
"MIT"
] | null | null | null | """ A module hosting all algorithms devised by Izzo """
import time
import numpy as np
from numpy import cross, pi
from numpy.linalg import norm
from scipy.special import hyp2f1
def izzo2015(
mu,
r1,
r2,
tof,
M=0,
prograde=True,
low_path=True,
maxiter=35,
a... | 32.360119 | 89 | 0.54925 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4,525 | 0.416015 |
9df6b818788dd513c66a7c66d4ffd98206ba31ae | 2,688 | py | Python | integrationtest/vm/virtualrouter/regression/delete_sg_with_2_attached_nics.py | sherry546/zstack-woodpecker | 54a37459f2d72ce6820974feaa6eb55772c3d2ce | [
"Apache-2.0"
] | 2 | 2016-03-23T08:45:44.000Z | 2017-06-26T02:40:46.000Z | integrationtest/vm/virtualrouter/regression/delete_sg_with_2_attached_nics.py | KevinDavidMitnick/zstack-woodpecker | 96257faaf3c362168d008bdb47002025ad669b24 | [
"Apache-2.0"
] | null | null | null | integrationtest/vm/virtualrouter/regression/delete_sg_with_2_attached_nics.py | KevinDavidMitnick/zstack-woodpecker | 96257faaf3c362168d008bdb47002025ad669b24 | [
"Apache-2.0"
] | 2 | 2020-03-12T03:11:28.000Z | 2021-07-26T01:57:58.000Z | '''
Test deleting SG with 2 attached NICs.
@author: Youyk
'''
import zstackwoodpecker.test_util as test_util
import zstackwoodpecker.test_lib as test_lib
import zstackwoodpecker.test_state as test_state
import zstackwoodpecker.zstack_test.zstack_test_security_group as test_sg_header
import zstackwoodpecker.... | 33.6 | 97 | 0.696801 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 743 | 0.276414 |
9df90abf6f95f0cc5563b0534b8331a0e2b2223e | 15,365 | py | Python | examples/deep_architect.py | negrinho/sane_tikz | fd6f291d9815613594d724678cb91ac9d412fbb7 | [
"MIT"
] | 274 | 2020-02-13T20:24:50.000Z | 2022-03-23T01:51:20.000Z | examples/deep_architect.py | negrinho/sane_tikz | fd6f291d9815613594d724678cb91ac9d412fbb7 | [
"MIT"
] | null | null | null | examples/deep_architect.py | negrinho/sane_tikz | fd6f291d9815613594d724678cb91ac9d412fbb7 | [
"MIT"
] | 19 | 2020-02-14T01:07:42.000Z | 2022-02-28T11:42:36.000Z | # Figure 5 in https://arxiv.org/pdf/1909.13404.pdf (towards modular and programmable architecture search)
import sane_tikz.core as stz
import sane_tikz.formatting as fmt
frame_height = 9.5
frame_width = 10.0
frame_spacing = 0.2
frame_roundness = 0.6
frame_line_width = 4.5 * fmt.standard_line_width
module_height = 1.6... | 33.918322 | 105 | 0.615164 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,147 | 0.07465 |
9dfa3001c3ff293c70ee1d697f313a0584e7ea7e | 25,801 | py | Python | pytests/epengine/basic_ops.py | pavithra-mahamani/TAF | ff854adcc6ca3e50d9dc64e7756ca690251128d3 | [
"Apache-2.0"
] | null | null | null | pytests/epengine/basic_ops.py | pavithra-mahamani/TAF | ff854adcc6ca3e50d9dc64e7756ca690251128d3 | [
"Apache-2.0"
] | null | null | null | pytests/epengine/basic_ops.py | pavithra-mahamani/TAF | ff854adcc6ca3e50d9dc64e7756ca690251128d3 | [
"Apache-2.0"
] | null | null | null | import time
import json
from basetestcase import BaseTestCase
from couchbase_helper.documentgenerator import doc_generator
from couchbase_helper.durability_helper import DurabilityHelper, \
DurableExceptions
from couchbase_helper.tuq_generators import JsonGenerator
from ... | 46.155635 | 138 | 0.609744 | 24,945 | 0.966823 | 0 | 0 | 0 | 0 | 0 | 0 | 5,782 | 0.2241 |
9dfb7758cdce3c78cd800cea3cdddc3f4635fbfc | 1,025 | py | Python | plot/different_optimal_classifier_scale_for_different_classes.py | ZGCTroy/guided-diffusion | af987bb2b65db2875148a5466df79736ea5ae6a1 | [
"MIT"
] | null | null | null | plot/different_optimal_classifier_scale_for_different_classes.py | ZGCTroy/guided-diffusion | af987bb2b65db2875148a5466df79736ea5ae6a1 | [
"MIT"
] | null | null | null | plot/different_optimal_classifier_scale_for_different_classes.py | ZGCTroy/guided-diffusion | af987bb2b65db2875148a5466df79736ea5ae6a1 | [
"MIT"
] | null | null | null | import matplotlib.pyplot as plt
import yaml
import os
workspace = "/workspace/mnt/storage/guangcongzheng/zju_zgc/guided-diffusion"
num_samples = 192
log = os.path.join(workspace, 'log/imagenet1000_classifier256x256_channel128_upperbound/predict/model500000_imagenet1000_stepsddim25_sample{}_selectedClass'.format(num_... | 25 | 177 | 0.68878 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 286 | 0.279024 |
9dfef6c55764a02f7c38cb42e6e52c30df77aaec | 2,882 | py | Python | main.py | swapmali/WalliScrapper | b7853f7d25da594045039847ad76eddd8d1204d8 | [
"MIT"
] | null | null | null | main.py | swapmali/WalliScrapper | b7853f7d25da594045039847ad76eddd8d1204d8 | [
"MIT"
] | null | null | null | main.py | swapmali/WalliScrapper | b7853f7d25da594045039847ad76eddd8d1204d8 | [
"MIT"
] | null | null | null | from bs4 import BeautifulSoup
import requests
import urllib.request
from datetime import datetime
import time
from PIL import Image, ImageDraw, ImageFont
import ctypes
import os
import shutil
import socket
import sys
def is_connected(hostname):
try:
# see if we can resolve the host name -- tells us if the... | 34.722892 | 165 | 0.597155 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,162 | 0.403052 |
9dff88c39b7da4ce4056ad2977600b1620da0183 | 9,401 | py | Python | model_rnn_attention.py | zhzhx2008/keras_text_classification | e10565fb82ffbfa8b1d685be8b162c26f1429784 | [
"MIT"
] | 2 | 2019-07-11T17:01:17.000Z | 2019-07-11T17:01:19.000Z | model_rnn_attention.py | zhzhx2008/keras_text_classification | e10565fb82ffbfa8b1d685be8b162c26f1429784 | [
"MIT"
] | null | null | null | model_rnn_attention.py | zhzhx2008/keras_text_classification | e10565fb82ffbfa8b1d685be8b162c26f1429784 | [
"MIT"
] | 1 | 2019-12-24T01:03:47.000Z | 2019-12-24T01:03:47.000Z | # coding=utf-8
# @Author : zhzhx2008
# @Time : 18-10-9
import os
import warnings
import jieba
import numpy as np
from keras import Input
from keras import Model
from keras import backend as K
from keras import initializers, regularizers, constraints
from keras.callbacks import EarlyStopping, ModelCheckpoint
from... | 37.454183 | 189 | 0.688118 | 3,554 | 0.377483 | 0 | 0 | 0 | 0 | 0 | 0 | 2,956 | 0.313967 |
9dfff168d101cb9f78868b0ee56c24261cd170c9 | 73 | py | Python | 01-sample-instance/settings.py | diodonfrost/pulumi-aws-examples | 2fa07f3219dc01d00051559eb207c547d3554232 | [
"Apache-2.0"
] | null | null | null | 01-sample-instance/settings.py | diodonfrost/pulumi-aws-examples | 2fa07f3219dc01d00051559eb207c547d3554232 | [
"Apache-2.0"
] | null | null | null | 01-sample-instance/settings.py | diodonfrost/pulumi-aws-examples | 2fa07f3219dc01d00051559eb207c547d3554232 | [
"Apache-2.0"
] | null | null | null | # coding: utf8
vpc_cidr = "192.168.0.0/16"
http_cidr = "192.168.1.0/24"
| 14.6 | 28 | 0.643836 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 46 | 0.630137 |
3b00d75cd611416080f44811a3c1f126a3ad61da | 6,731 | py | Python | fastfold/model/fastnn/ops.py | hpcaitech/FastFold | a65d5009279ef84c1518081344db5c02213c387a | [
"Apache-2.0"
] | 303 | 2022-03-03T01:59:47.000Z | 2022-03-31T07:46:42.000Z | fastfold/model/fastnn/ops.py | hpcaitech/FastFold | a65d5009279ef84c1518081344db5c02213c387a | [
"Apache-2.0"
] | 6 | 2022-03-03T22:17:03.000Z | 2022-03-17T06:09:11.000Z | fastfold/model/fastnn/ops.py | hpcaitech/FastFold | a65d5009279ef84c1518081344db5c02213c387a | [
"Apache-2.0"
] | 35 | 2022-03-03T01:58:56.000Z | 2022-03-29T21:21:06.000Z | import torch
import torch.nn as nn
import torch.nn.functional as F
from einops import rearrange
from fastfold.model.fastnn.kernel import scale_mask_softmax, scale_mask_bias_softmax
from fastfold.model.fastnn.kernel import LayerNorm
from .initializer import glorot_uniform_af
from fastfold.model.fastnn.kernel ... | 34.875648 | 106 | 0.592334 | 6,227 | 0.925123 | 0 | 0 | 0 | 0 | 0 | 0 | 1,368 | 0.203239 |
3b031f123e10590a23278a8471646c084f1f967a | 1,093 | py | Python | src/input/__init__.py | huyingjun/PyAgent | ff7096634aa8deb617d2fe9d47fd2c6fbf8ff9a4 | [
"MIT"
] | 1 | 2021-12-23T11:56:19.000Z | 2021-12-23T11:56:19.000Z | src/input/__init__.py | huyingjun/PyAgent | ff7096634aa8deb617d2fe9d47fd2c6fbf8ff9a4 | [
"MIT"
] | null | null | null | src/input/__init__.py | huyingjun/PyAgent | ff7096634aa8deb617d2fe9d47fd2c6fbf8ff9a4 | [
"MIT"
] | null | null | null | # -*- coding:utf-8 -*-
"""
__init__.py
~~~~~~~~
数据收集插件 input
:author: Fufu, 2021/6/7
"""
from abc import abstractmethod
from asyncio import create_task, sleep
from typing import Any
from loguru import logger
from ..libs.plugin import BasePlugin
class InputPlugin(BasePlugin):
"""数据采集插件基类"""
... | 22.770833 | 76 | 0.610247 | 924 | 0.76808 | 0 | 0 | 90 | 0.074813 | 369 | 0.306733 | 435 | 0.361596 |
3b03f07ac42f24043a890f0020944e25aecce786 | 1,933 | py | Python | repositorybots/bots/Librarian.py | conda/conda-bots | a68cff7b0318093328e355e18871518c050f5493 | [
"BSD-3-Clause"
] | 2 | 2021-09-27T02:29:26.000Z | 2021-10-20T19:10:39.000Z | repositorybots/bots/Librarian.py | conda/conda-bots | a68cff7b0318093328e355e18871518c050f5493 | [
"BSD-3-Clause"
] | 14 | 2021-09-09T21:16:05.000Z | 2022-03-28T09:31:09.000Z | repositorybots/bots/Librarian.py | conda/conda-bots | a68cff7b0318093328e355e18871518c050f5493 | [
"BSD-3-Clause"
] | 2 | 2021-09-09T12:11:48.000Z | 2022-01-28T20:25:26.000Z | import yaml
import re
from .SummonableBot import SummonableBot
class Librarian(SummonableBot):
def __init__(self, bot_name, event):
self.help_command = 'help'
self.help_preamble = "Here are my available responses"
self.event = event
with open('./responses.yml') as file:
... | 42.021739 | 114 | 0.621314 | 1,868 | 0.966374 | 0 | 0 | 0 | 0 | 785 | 0.406105 | 262 | 0.135541 |
3b04c0970a5c74618f4b5ea5a958ded0e0f252eb | 8,201 | py | Python | word_game_helper.py | avendesora/wordle-helper | 651c1eddca14f56be798e0fe242c1f2cf98ae7ba | [
"MIT"
] | null | null | null | word_game_helper.py | avendesora/wordle-helper | 651c1eddca14f56be798e0fe242c1f2cf98ae7ba | [
"MIT"
] | null | null | null | word_game_helper.py | avendesora/wordle-helper | 651c1eddca14f56be798e0fe242c1f2cf98ae7ba | [
"MIT"
] | null | null | null | import pprint
import statistics
from contextlib import suppress
from dataclasses import dataclass
from enum import Enum
from typing import Optional
@dataclass
class ValidCharacter:
definite_locations: set[int]
definite_not_locations: set[int]
class CharacterStatus(Enum):
GRAY = "gray"
GREEN = "green... | 34.603376 | 90 | 0.573954 | 8,005 | 0.9761 | 0 | 0 | 336 | 0.040971 | 0 | 0 | 1,067 | 0.130106 |
d178683893b91fd9a85c22e3c3785427e4b51812 | 2,249 | py | Python | 876.middle-of-the-linked-list.py | windard/leeeeee | 0107a5f95746592ca4fe78d2b5875cf65b1910e7 | [
"MIT"
] | null | null | null | 876.middle-of-the-linked-list.py | windard/leeeeee | 0107a5f95746592ca4fe78d2b5875cf65b1910e7 | [
"MIT"
] | null | null | null | 876.middle-of-the-linked-list.py | windard/leeeeee | 0107a5f95746592ca4fe78d2b5875cf65b1910e7 | [
"MIT"
] | null | null | null | # coding=utf-8
#
# @lc app=leetcode id=876 lang=python
#
# [876] Middle of the Linked List
#
# https://leetcode.com/problems/middle-of-the-linked-list/description/
#
# algorithms
# Easy (64.97%)
# Likes: 593
# Dislikes: 42
# Total Accepted: 76.4K
# Total Submissions: 117.5K
# Testcase Example: '[1,2,3,4,5]'
#
# ... | 21.834951 | 79 | 0.595376 | 661 | 0.293387 | 0 | 0 | 0 | 0 | 0 | 0 | 1,603 | 0.711496 |
d17e6c29b97301453dbf67266605a0471b95c7b0 | 3,442 | py | Python | ava_asd/vis.py | tuanchien/asd | 190c1c6d155b16a27717596d6350598e5cd4ffac | [
"Apache-2.0",
"MIT"
] | 18 | 2020-06-19T01:18:13.000Z | 2022-03-21T10:42:13.000Z | ava_asd/vis.py | tuanchien/asd | 190c1c6d155b16a27717596d6350598e5cd4ffac | [
"Apache-2.0",
"MIT"
] | 8 | 2020-12-17T06:09:59.000Z | 2021-07-10T02:07:41.000Z | ava_asd/vis.py | tuanchien/asd | 190c1c6d155b16a27717596d6350598e5cd4ffac | [
"Apache-2.0",
"MIT"
] | 4 | 2020-06-20T01:05:01.000Z | 2021-08-05T13:45:48.000Z | # New BSD License
#
# Copyright (c) 2007-2019 The scikit-learn developers.
# All rights reserved.
#
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are met:
#
# a. Redistributions of source code must retain the above copyright... | 40.494118 | 107 | 0.691458 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2,187 | 0.635386 |
d1802643daf10062a7ef847447ff5fef65abb757 | 1,757 | py | Python | tests/state_tests.py | Alasdair-Macindoe/TuringMachineEmulator | 4c2639876bd94209b170232b2f33ea1409a61a45 | [
"MIT"
] | null | null | null | tests/state_tests.py | Alasdair-Macindoe/TuringMachineEmulator | 4c2639876bd94209b170232b2f33ea1409a61a45 | [
"MIT"
] | null | null | null | tests/state_tests.py | Alasdair-Macindoe/TuringMachineEmulator | 4c2639876bd94209b170232b2f33ea1409a61a45 | [
"MIT"
] | null | null | null | import pytest
import sys
sys.path.append('.')
from turingmachine import Transition, Direction, State
def test_create_transition():
q0 = State()
q1 = State()
#In q0 upon reading a move to q1, output b, and move the tape 1 right
q0.create_transition('a', q1, 'b', Direction.RIGHT)
assert q0.transiti... | 31.375 | 94 | 0.650541 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 174 | 0.099032 |
d1813862bfc10545d923154e8ce565b2682d6c7b | 558 | py | Python | Python3/0041-First-Missing-Positive/soln-1.py | wyaadarsh/LeetCode-Solutions | 3719f5cb059eefd66b83eb8ae990652f4b7fd124 | [
"MIT"
] | 5 | 2020-07-24T17:48:59.000Z | 2020-12-21T05:56:00.000Z | Python3/0041-First-Missing-Positive/soln-1.py | zhangyaqi1989/LeetCode-Solutions | 2655a1ffc8678ad1de6c24295071308a18c5dc6e | [
"MIT"
] | null | null | null | Python3/0041-First-Missing-Positive/soln-1.py | zhangyaqi1989/LeetCode-Solutions | 2655a1ffc8678ad1de6c24295071308a18c5dc6e | [
"MIT"
] | 2 | 2020-07-24T17:49:01.000Z | 2020-08-31T19:57:35.000Z | class Solution:
def firstMissingPositive(self, nums):
"""
:type nums: List[int]
:rtype: int
"""
# constant space
# [1, len(nums) + 1]
n = len(nums)
for i, num in enumerate(nums):
if num < 0 or num > n:
nums[i] = 0
n ... | 26.571429 | 41 | 0.405018 | 558 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 101 | 0.181004 |
d18168c2e3ac9ceaadcf572633e69461bbc92841 | 294 | py | Python | default/modules/cwd.py | AshlynnInWonderland/zsh-powerline | e6f3326b3e15d8a89a0ea959314ea0ea5768ea86 | [
"MIT"
] | null | null | null | default/modules/cwd.py | AshlynnInWonderland/zsh-powerline | e6f3326b3e15d8a89a0ea959314ea0ea5768ea86 | [
"MIT"
] | null | null | null | default/modules/cwd.py | AshlynnInWonderland/zsh-powerline | e6f3326b3e15d8a89a0ea959314ea0ea5768ea86 | [
"MIT"
] | null | null | null | import os
def returnText():
cwd = os.getcwd().replace(os.environ['HOME'],'~')
lstCwd = str.split(cwd, '/')
if len(lstCwd) > 3:
lstCwd.reverse()
lstCwd = lstCwd[0:3]
lstCwd.append('+')
lstCwd.reverse()
strCwd = '/'.join(lstCwd)
return strCwd
| 22.615385 | 53 | 0.547619 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 18 | 0.061224 |
d1819b0206e55ddd28666cb193356c3dd4977602 | 1,850 | py | Python | openwisp_users/tests/test_adapter.py | ShreeshaRelysys/openwisp-users | af5f95e89656cbf3dd32f2392ba6d0f1b2c4df96 | [
"BSD-3-Clause"
] | null | null | null | openwisp_users/tests/test_adapter.py | ShreeshaRelysys/openwisp-users | af5f95e89656cbf3dd32f2392ba6d0f1b2c4df96 | [
"BSD-3-Clause"
] | 1 | 2022-01-24T16:44:03.000Z | 2022-01-24T16:44:03.000Z | openwisp_users/tests/test_adapter.py | ShreeshaRelysys/openwisp-users | af5f95e89656cbf3dd32f2392ba6d0f1b2c4df96 | [
"BSD-3-Clause"
] | null | null | null | from unittest import mock
from django.contrib.auth import get_user_model
from django.core import mail
from django.template import TemplateDoesNotExist
from django.test import TestCase
from django.urls import reverse
from ..accounts.adapter import EmailAdapter
from .utils import TestOrganizationMixin
User = get_user_... | 40.217391 | 87 | 0.718919 | 1,519 | 0.821081 | 0 | 0 | 639 | 0.345405 | 0 | 0 | 298 | 0.161081 |
d18388ef51dc04c9d268500afd15bf62ce17867a | 382 | py | Python | setup.py | ashtonwebster/vuln_toolkit | 74792341104b2806e224bde4c2e704003d685a54 | [
"MIT"
] | 3 | 2021-05-13T14:20:12.000Z | 2021-06-20T18:58:22.000Z | setup.py | ashtonwebster/vuln_toolkit | 74792341104b2806e224bde4c2e704003d685a54 | [
"MIT"
] | null | null | null | setup.py | ashtonwebster/vuln_toolkit | 74792341104b2806e224bde4c2e704003d685a54 | [
"MIT"
] | null | null | null | from setuptools import setup
setup(
name='vuln_toolkit',
version='0.1',
description='Transfer Learning Toolkit',
url='https://para.cs.umd.edu/purtilo/vulnerability-detection-tool-set/tree/master',
author='Ashton Webster',
author_email='[email protected]',
license='MIT',
packages=... | 27.285714 | 87 | 0.701571 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 206 | 0.539267 |
d185040fe764c47e88800452a2deca88a3ec3079 | 13,255 | py | Python | edna2/tasks/Is4aTasks.py | gsantoni/edna2 | 0aad63a3ea8091ce62118f0b2c8ac78a2286da9e | [
"CC0-1.0",
"MIT"
] | null | null | null | edna2/tasks/Is4aTasks.py | gsantoni/edna2 | 0aad63a3ea8091ce62118f0b2c8ac78a2286da9e | [
"CC0-1.0",
"MIT"
] | 2 | 2020-04-06T10:39:50.000Z | 2021-04-14T19:24:37.000Z | edna2/tasks/Is4aTasks.py | gsantoni/edna2 | 0aad63a3ea8091ce62118f0b2c8ac78a2286da9e | [
"CC0-1.0",
"MIT"
] | 5 | 2019-06-14T07:28:38.000Z | 2021-04-28T13:10:39.000Z | #
# Copyright (c) European Synchrotron Radiation Facility (ESRF)
#
# Permission is hereby granted, free of charge, to any person obtaining a copy of
# this software and associated documentation files (the "Software"), to deal in
# the Software without restriction, including without limitation the rights to
# use, copy,... | 40.045317 | 106 | 0.485704 | 11,893 | 0.897246 | 0 | 0 | 0 | 0 | 0 | 0 | 4,109 | 0.309996 |
d187fe47d5524b63a0f74b45076d6dc9c23a3d02 | 1,556 | py | Python | predict.py | SuperbTUM/RAW-image-denoising | 9f81be8da6a576f641022707d98b8c37f5c599ab | [
"MIT"
] | 4 | 2021-10-18T04:13:52.000Z | 2022-03-10T14:10:46.000Z | predict.py | SuperbTUM/computational-photography | 9f81be8da6a576f641022707d98b8c37f5c599ab | [
"MIT"
] | 2 | 2021-12-10T02:59:30.000Z | 2022-03-10T03:32:09.000Z | predict.py | SuperbTUM/computational-photography | 9f81be8da6a576f641022707d98b8c37f5c599ab | [
"MIT"
] | 1 | 2021-12-10T02:57:34.000Z | 2021-12-10T02:57:34.000Z | import numpy as np
from tqdm import *
from utils import DataLoaderX
from dataset import collate
from math import *
def prediction(data, model, batch_size, cuda):
data_loader = DataLoaderX(data, batch_size=batch_size, collate_fn=collate, num_workers=0)
model.training = False
iterator = tqdm(data_loader)
... | 32.416667 | 93 | 0.561697 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 46 | 0.029563 |
d188ece94a0b8fbdf8e8a6257addd7cf8fc804b8 | 3,318 | py | Python | token_shift_gpt/autoregressive_wrapper.py | fwcwmc/token-shift-gpt | 58c946a8a59976681a90424be5db85ed9a034a59 | [
"MIT"
] | null | null | null | token_shift_gpt/autoregressive_wrapper.py | fwcwmc/token-shift-gpt | 58c946a8a59976681a90424be5db85ed9a034a59 | [
"MIT"
] | null | null | null | token_shift_gpt/autoregressive_wrapper.py | fwcwmc/token-shift-gpt | 58c946a8a59976681a90424be5db85ed9a034a59 | [
"MIT"
] | null | null | null | import torch
from torch import nn
from tqdm import tqdm
from entmax import entmax_bisect
import torch.nn.functional as F
# helper function
def eval_decorator(fn):
def inner(model, *args, **kwargs):
was_training = model.training
model.eval()
out = fn(model, *args, **kwargs)
model.tr... | 30.440367 | 171 | 0.622664 | 1,923 | 0.579566 | 0 | 0 | 1,426 | 0.429777 | 0 | 0 | 64 | 0.019289 |
d18af7b94f4f32850b9d3a02c85ca36d568510f0 | 1,686 | py | Python | Contest/LeetCode/BiweeklyContest28/4.py | WatsonWangZh/CodingPractice | dc057dd6ea2fc2034e14fd73e07e73e6364be2ae | [
"MIT"
] | 11 | 2019-09-01T22:36:00.000Z | 2021-11-08T08:57:20.000Z | Contest/LeetCode/BiweeklyContest28/4.py | WatsonWangZh/LeetCodePractice | dc057dd6ea2fc2034e14fd73e07e73e6364be2ae | [
"MIT"
] | null | null | null | Contest/LeetCode/BiweeklyContest28/4.py | WatsonWangZh/LeetCodePractice | dc057dd6ea2fc2034e14fd73e07e73e6364be2ae | [
"MIT"
] | 2 | 2020-05-27T14:58:52.000Z | 2020-05-27T15:04:17.000Z | # 1478. Allocate Mailboxes
# User Accepted:342
# User Tried:594
# Total Accepted:364
# Total Submissions:1061
# Difficulty:Hard
# Given the array houses and an integer k. where houses[i] is the location of the ith house along a street, your task is to allocate k mailboxes in the street.
# Return the minimum total dista... | 28.576271 | 159 | 0.580664 | 525 | 0.311388 | 0 | 0 | 0 | 0 | 0 | 0 | 1,419 | 0.841637 |
d18b16204dc6401e0872226dc90166eab90caa4c | 990 | py | Python | Full/Python/01_Python_Basico/04_operadoresLogicos.py | ramonabreu-cdev/Revisao-JS | 9a44ea0e7d3c22945b2ee6364d5c292d8be6a762 | [
"RSA-MD"
] | 1 | 2021-06-29T14:51:41.000Z | 2021-06-29T14:51:41.000Z | Full/Python/01_Python_Basico/04_operadoresLogicos.py | ramonabreu-cdev/Revisao-WD | 9a44ea0e7d3c22945b2ee6364d5c292d8be6a762 | [
"RSA-MD"
] | null | null | null | Full/Python/01_Python_Basico/04_operadoresLogicos.py | ramonabreu-cdev/Revisao-WD | 9a44ea0e7d3c22945b2ee6364d5c292d8be6a762 | [
"RSA-MD"
] | null | null | null | """
Operadores lógicos
Para agrupar operações com lógica booleana, utilizaremos operadores lógicos.
Python suporta três operadores básicos: not (não), and (e), or (ou). Esses operadores
podem ser traduzidos como não (¬ negação), e (Λ conjunção) e ou (V disjunção).
"""
# Operador not
"""
>>> not True
False
>>> not Fa... | 18 | 149 | 0.710101 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 999 | 0.985207 |
d18b904208aa3a3c863151a2c83c482991eec4aa | 944 | py | Python | nfv/nfv-vim/nfv_vim/alarm/__init__.py | SidneyAn/nfv | 5f0262a5b6ea4be59f977b9c587c483cbe0e373d | [
"Apache-2.0"
] | 2 | 2020-02-07T19:01:36.000Z | 2022-02-23T01:41:46.000Z | nfv/nfv-vim/nfv_vim/alarm/__init__.py | SidneyAn/nfv | 5f0262a5b6ea4be59f977b9c587c483cbe0e373d | [
"Apache-2.0"
] | 1 | 2021-01-14T12:02:25.000Z | 2021-01-14T12:02:25.000Z | nfv/nfv-vim/nfv_vim/alarm/__init__.py | SidneyAn/nfv | 5f0262a5b6ea4be59f977b9c587c483cbe0e373d | [
"Apache-2.0"
] | 2 | 2021-01-13T08:39:21.000Z | 2022-02-09T00:21:55.000Z | #
# Copyright (c) 2015-2016 Wind River Systems, Inc.
#
# SPDX-License-Identifier: Apache-2.0
#
from nfv_common.alarm import * # noqa: F401,F403
from nfv_vim.alarm._general import clear_general_alarm # noqa: F401
from nfv_vim.alarm._general import raise_general_alarm # noqa: F401
from nfv_vim.alarm._host import host... | 49.684211 | 89 | 0.814619 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 239 | 0.253178 |
d18d78e18bf3386dbb4d67d5c7497d3685c7a3b5 | 101 | py | Python | src/libsrv/lib/lib__PROJECT_/__init__.py | tecnickcom/pygen | 9c969137b472c100fe8815ec5a52beabd08e179b | [
"MIT"
] | 7 | 2018-04-23T08:03:12.000Z | 2021-01-28T20:44:19.000Z | src/lib/_PROJECT_/__init__.py | tecnickcom/pygen | 9c969137b472c100fe8815ec5a52beabd08e179b | [
"MIT"
] | 1 | 2018-07-09T09:44:54.000Z | 2018-07-09T09:44:54.000Z | src/libapp/lib/lib__PROJECT_/__init__.py | tecnickcom/pygen | 9c969137b472c100fe8815ec5a52beabd08e179b | [
"MIT"
] | 1 | 2018-07-09T09:33:43.000Z | 2018-07-09T09:33:43.000Z | """~#SHORTDESCRIPTION#~"""
__version__ = "1.0.0"
__release__ = "1"
__program_name__ = "~#PROJECT#~"
| 16.833333 | 32 | 0.643564 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 49 | 0.485149 |
d18def4fbac29199069d5db3991e15a8d8b23343 | 2,225 | py | Python | rl_multi_agent/experiments/furnmove_grid_marginal_nocl_rot_config.py | allenai/cordial-sync | 4005fdc4816c86f6489e5f4b9252fa66b79602be | [
"MIT"
] | 28 | 2020-07-07T16:21:10.000Z | 2021-11-15T11:15:20.000Z | rl_multi_agent/experiments/furnmove_grid_marginal_nocl_rot_config.py | allenai/cordial-sync | 4005fdc4816c86f6489e5f4b9252fa66b79602be | [
"MIT"
] | 5 | 2020-09-29T07:54:43.000Z | 2022-01-04T22:33:02.000Z | rl_multi_agent/experiments/furnmove_grid_marginal_nocl_rot_config.py | allenai/cordial-sync | 4005fdc4816c86f6489e5f4b9252fa66b79602be | [
"MIT"
] | 2 | 2022-02-01T19:50:27.000Z | 2022-03-21T12:23:16.000Z | from typing import Optional
from torch import nn
from rl_multi_agent.experiments.furnmove_grid_marginal_nocl_base_config import (
FurnMoveExperimentConfig,
)
from rl_multi_agent.models import A3CLSTMNStepComCoordinatedActionsEgoGridsEmbedCNN
class FurnMoveGridExperimentConfig(FurnMoveExperimentConfig):
# In... | 38.362069 | 86 | 0.621573 | 1,908 | 0.857528 | 0 | 0 | 1,743 | 0.783371 | 0 | 0 | 96 | 0.043146 |
d18eb208e3b4bdd661680b8efa65073500d31974 | 728 | py | Python | relations/controllers.py | poad42/arxiv-external-links | a60941d93f20d85e8e524240631f6f3234c03e02 | [
"MIT"
] | null | null | null | relations/controllers.py | poad42/arxiv-external-links | a60941d93f20d85e8e524240631f6f3234c03e02 | [
"MIT"
] | null | null | null | relations/controllers.py | poad42/arxiv-external-links | a60941d93f20d85e8e524240631f6f3234c03e02 | [
"MIT"
] | null | null | null | """
Request controllers for the external links service.
These may be used handle requests originating from the :mod:`.routes.api`
and/or the :mod:`.routes.ui`.
If the behavior of these controllers diverges along the UI/API lines, then we
can split this into ``controllers/api.py`` and ``controllers/ui.py``.
"""
from ... | 29.12 | 77 | 0.722527 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 461 | 0.633242 |
d191008bf7777b6c542e5bf7e0d000e40eac38e6 | 3,101 | py | Python | apps/roster/views.py | dulrich15/spot | 5fa57dbb9c0c9a010b4dc153f832b2d130bc8f73 | [
"MIT"
] | null | null | null | apps/roster/views.py | dulrich15/spot | 5fa57dbb9c0c9a010b4dc153f832b2d130bc8f73 | [
"MIT"
] | null | null | null | apps/roster/views.py | dulrich15/spot | 5fa57dbb9c0c9a010b4dc153f832b2d130bc8f73 | [
"MIT"
] | null | null | null | from __future__ import division
from __future__ import unicode_literals
import re
from django.http import HttpResponse
from django.shortcuts import redirect
from django.template import RequestContext
from django.template import loader
from models import *
from apps.core.views import get_bg_color
def list_students(... | 28.449541 | 84 | 0.653015 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 301 | 0.097065 |
d191a9aab35b5cf9693c2d15e10ff5f31d5411f3 | 6,635 | py | Python | mac-changer.py | Hiiirad/Mac-Changer | df23de01dde3f55b45a8f0bacb065cf2170feb06 | [
"MIT"
] | 1 | 2020-08-06T13:39:50.000Z | 2020-08-06T13:39:50.000Z | mac-changer.py | Hiiirad/Mac-Changer | df23de01dde3f55b45a8f0bacb065cf2170feb06 | [
"MIT"
] | null | null | null | mac-changer.py | Hiiirad/Mac-Changer | df23de01dde3f55b45a8f0bacb065cf2170feb06 | [
"MIT"
] | null | null | null | from __future__ import unicode_literals
from subprocess import call
from re import search
from random import sample, choice
from csv import reader
from os import popen
from prompt_toolkit import prompt
from prompt_toolkit.completion import WordCompleter
'''
The strings, input and output of this program is in lowercase... | 46.398601 | 289 | 0.64009 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2,622 | 0.395177 |
d192362b3381c7ad2fe4d69f9810feb1a55a0fba | 4,775 | py | Python | core/tests/test_StenciledFile.py | mxmlnkn/ratarmount | f63a5f6af64ccb43c1075884626ea61ba0202f83 | [
"MIT"
] | 208 | 2019-02-21T08:10:54.000Z | 2022-03-20T12:07:31.000Z | core/tests/test_StenciledFile.py | mxmlnkn/ratarmount | f63a5f6af64ccb43c1075884626ea61ba0202f83 | [
"MIT"
] | 72 | 2019-04-18T08:54:26.000Z | 2022-03-27T11:41:58.000Z | core/tests/test_StenciledFile.py | mxmlnkn/ratarmount | f63a5f6af64ccb43c1075884626ea61ba0202f83 | [
"MIT"
] | 19 | 2019-03-15T18:23:10.000Z | 2021-09-10T14:17:16.000Z | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
# pylint: disable=wrong-import-position
# pylint: disable=protected-access
import concurrent.futures
import io
import os
import sys
import tempfile
import threading
sys.path.insert(0, os.path.abspath(os.path.join(os.path.dirname(__file__), '..')))
from ratarmountcore i... | 40.811966 | 103 | 0.595602 | 4,213 | 0.882304 | 0 | 0 | 4,130 | 0.864921 | 0 | 0 | 289 | 0.060524 |
d194460e4175a7a303de85ee742fccf7806780cb | 3,029 | py | Python | scripts/check_status.py | frangiz/walter-server | 0c9ab88a9cc6cf446ba86b1b06bcf9f8c64cf639 | [
"MIT"
] | null | null | null | scripts/check_status.py | frangiz/walter-server | 0c9ab88a9cc6cf446ba86b1b06bcf9f8c64cf639 | [
"MIT"
] | 21 | 2019-09-16T08:08:17.000Z | 2020-05-27T06:49:34.000Z | scripts/check_status.py | frangiz/walter-server | 0c9ab88a9cc6cf446ba86b1b06bcf9f8c64cf639 | [
"MIT"
] | 1 | 2019-10-16T11:23:38.000Z | 2019-10-16T11:23:38.000Z | import datetime
import json
import os
import requests
import smtplib
import ssl
def check_status(config):
new_state = get_current_state()
last_known_state = get_last_known_state()
activated = get_activated(new_state, last_known_state)
deactivated = get_deactivated(new_state, last_known_state)
save... | 30.908163 | 85 | 0.665896 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 579 | 0.191152 |
d19579492873b16f25e4b138c45496b98a9c1bd3 | 5,340 | py | Python | mngSettings.py | guidanoli/fibonaccibot | fead3a151835648f7140945b94afdd0f32aa55ce | [
"MIT"
] | null | null | null | mngSettings.py | guidanoli/fibonaccibot | fead3a151835648f7140945b94afdd0f32aa55ce | [
"MIT"
] | null | null | null | mngSettings.py | guidanoli/fibonaccibot | fead3a151835648f7140945b94afdd0f32aa55ce | [
"MIT"
] | null | null | null | # Settings Manager
# guidanoli
DEFAULT_STGS = {
"commas": "true",
"comments": "true",
"tknlistpath": "tknlist.tk",
"tokenpath": "token.tk"
}
SETTINGS_PATH = "fibonacci.cfg"
TYPE_STR = type("")
TYPE_LIST = type([])
def _validateFilename( filename , extension = "" ):
from re import match
return... | 31.597633 | 78 | 0.618914 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,335 | 0.25 |
d19832a8ebc406b607f9daf11bbd5483f8a533f1 | 632 | py | Python | core/commands/public/staff.py | Smashulica/nebula8 | 010df165e3cc61e0154d20310fa972482ec0e7be | [
"Apache-2.0"
] | null | null | null | core/commands/public/staff.py | Smashulica/nebula8 | 010df165e3cc61e0154d20310fa972482ec0e7be | [
"Apache-2.0"
] | null | null | null | core/commands/public/staff.py | Smashulica/nebula8 | 010df165e3cc61e0154d20310fa972482ec0e7be | [
"Apache-2.0"
] | null | null | null | #!/usr/bin/env python
# -*- coding: utf-8 -*-
# Copyright SquirrelNetwork
from core import decorators
from telegram.utils.helpers import mention_markdown
@decorators.public.init
@decorators.delete.init
def init(update,context):
bot = context.bot
administrators = update.effective_chat.get_administrators()
... | 31.6 | 85 | 0.705696 | 0 | 0 | 0 | 0 | 478 | 0.752756 | 0 | 0 | 110 | 0.173228 |
d19be2f76f9b868d04aab5ea3ee253005cbeb0af | 762 | py | Python | pytglib/api/types/users.py | iTeam-co/pytglib | e5e75e0a85f89b77762209b32a61b0a883c0ae61 | [
"MIT"
] | 6 | 2019-10-30T08:57:27.000Z | 2021-02-08T14:17:43.000Z | pytglib/api/types/users.py | iTeam-co/python-telegram | e5e75e0a85f89b77762209b32a61b0a883c0ae61 | [
"MIT"
] | 1 | 2021-08-19T05:44:10.000Z | 2021-08-19T07:14:56.000Z | pytglib/api/types/users.py | iTeam-co/python-telegram | e5e75e0a85f89b77762209b32a61b0a883c0ae61 | [
"MIT"
] | 5 | 2019-12-04T05:30:39.000Z | 2021-05-21T18:23:32.000Z |
from ..utils import Object
class Users(Object):
"""
Represents a list of users
Attributes:
ID (:obj:`str`): ``Users``
Args:
total_count (:obj:`int`):
Approximate total count of users found
user_ids (List of :obj:`int`):
A list of user identifiers
... | 20.594595 | 56 | 0.56168 | 730 | 0.958005 | 0 | 0 | 178 | 0.233596 | 0 | 0 | 398 | 0.52231 |
d19cf55d1eed29f5e017627cc562825403fd7101 | 2,937 | py | Python | 方法二/無LM算capacity.py | jell0213/MUNIT_DataHiding | 75cb80a7ee5175c0a2235336e230ce3759f5b296 | [
"Unlicense"
] | null | null | null | 方法二/無LM算capacity.py | jell0213/MUNIT_DataHiding | 75cb80a7ee5175c0a2235336e230ce3759f5b296 | [
"Unlicense"
] | null | null | null | 方法二/無LM算capacity.py | jell0213/MUNIT_DataHiding | 75cb80a7ee5175c0a2235336e230ce3759f5b296 | [
"Unlicense"
] | null | null | null | # -*- coding: utf-8 -*-
#######################################################
'''
input
路徑
圖片數量
MOD值
嵌密率
處理內容
輸入一張圖片的資料，包含：
1.資料夾名稱
2.檔案名稱(圖片)，單純用來記錄在xlsx檔案中
3.輸出路徑-xlsx
4.嵌密mod值
5.嵌密率
output
產生輸入圖片的xlsx檔(依序將所有圖片的資料寫入xlsx檔中)
包含執行時間
'''
####... | 40.232877 | 138 | 0.405856 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,309 | 0.402151 |
d19e24dc55adbb4574f0c6afd0acb289ae9f8abb | 183 | py | Python | foo.py | Lnvictor/i_am_learning_shellscript | 7ee0ebcbdf41fb94ff0ad0210b580f29583444bb | [
"Apache-2.0"
] | null | null | null | foo.py | Lnvictor/i_am_learning_shellscript | 7ee0ebcbdf41fb94ff0ad0210b580f29583444bb | [
"Apache-2.0"
] | null | null | null | foo.py | Lnvictor/i_am_learning_shellscript | 7ee0ebcbdf41fb94ff0ad0210b580f29583444bb | [
"Apache-2.0"
] | null | null | null | from collections import OrderedDict
my_dict = OrderedDict()
def populate(data: dict):
my_dict.update(data)
return True
if __name__ == "__main__":
print(populate({})) | 14.076923 | 35 | 0.693989 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0.054645 |
d19f00e9b0507a59fe36f2031d52bc840d7e8792 | 2,592 | py | Python | venv/lib/python3.6/site-packages/ansible_collections/community/hashi_vault/tests/unit/plugins/module_utils/test_hashi_vault_option_group_base.py | usegalaxy-no/usegalaxy | 75dad095769fe918eb39677f2c887e681a747f3a | [
"MIT"
] | 1 | 2020-01-22T13:11:23.000Z | 2020-01-22T13:11:23.000Z | venv/lib/python3.6/site-packages/ansible_collections/community/hashi_vault/tests/unit/plugins/module_utils/test_hashi_vault_option_group_base.py | usegalaxy-no/usegalaxy | 75dad095769fe918eb39677f2c887e681a747f3a | [
"MIT"
] | 12 | 2020-02-21T07:24:52.000Z | 2020-04-14T09:54:32.000Z | venv/lib/python3.6/site-packages/ansible_collections/community/hashi_vault/tests/unit/plugins/module_utils/test_hashi_vault_option_group_base.py | usegalaxy-no/usegalaxy | 75dad095769fe918eb39677f2c887e681a747f3a | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
# Copyright (c) 2021 Brian Scholer (@briantist)
# GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt)
from __future__ import (absolute_import, division, print_function)
__metaclass__ = type
import os
import pytest
from ansible_collections.community.hashi... | 31.609756 | 129 | 0.669367 | 310 | 0.119599 | 217 | 0.083719 | 1,351 | 0.521219 | 0 | 0 | 973 | 0.375386 |
d19f0f44e314141fc23b7283d9ad1c7b8685c068 | 384 | py | Python | iniciante/python/1113-crescente-e-decrescente.py | tfn10/beecrowd | 1ebf19ca9a253eb326160f03145d20be33064969 | [
"MIT"
] | null | null | null | iniciante/python/1113-crescente-e-decrescente.py | tfn10/beecrowd | 1ebf19ca9a253eb326160f03145d20be33064969 | [
"MIT"
] | null | null | null | iniciante/python/1113-crescente-e-decrescente.py | tfn10/beecrowd | 1ebf19ca9a253eb326160f03145d20be33064969 | [
"MIT"
] | null | null | null | def crescente_e_decrescente():
while True:
n1, n2 = entrada()
if n1 > n2:
print('Decrescente')
elif n1 < n2:
print('Crescente')
else:
break
def entrada():
numeros = list(map(int, input().split(' ')))
numero1 = numeros[0]
numero2 = num... | 19.2 | 48 | 0.544271 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 27 | 0.070313 |
d19f23d69e8c497f2703e0ce9519ea14add2903f | 2,695 | py | Python | app/client.py | akakou/privacy-enhanced-antivirus | 4cd32b27374016dd489eb13ac196c2c044912933 | [
"MIT"
] | null | null | null | app/client.py | akakou/privacy-enhanced-antivirus | 4cd32b27374016dd489eb13ac196c2c044912933 | [
"MIT"
] | null | null | null | app/client.py | akakou/privacy-enhanced-antivirus | 4cd32b27374016dd489eb13ac196c2c044912933 | [
"MIT"
] | null | null | null | from kivy.lang import Builder
import array
import scipy
import os
import syft as sy
import tensorflow as tf
import numpy
import time
import scipy
import sys
from dataset import get_dataset
from cluster import get_cluster
from PIL import Image
import leargist
from skimage import transform
from imageio import imsave
f... | 21.910569 | 72 | 0.638219 | 1,048 | 0.388868 | 0 | 0 | 0 | 0 | 0 | 0 | 310 | 0.115028 |
d1a1b2cdca7fb838822d102ce1eb3031bc813ef4 | 5,910 | py | Python | network/vgg16.py | CamilaAlvarez/tensorflow-demo | 57f576bafe97054046610ded7a9ce39caa7e84b4 | [
"MIT"
] | null | null | null | network/vgg16.py | CamilaAlvarez/tensorflow-demo | 57f576bafe97054046610ded7a9ce39caa7e84b4 | [
"MIT"
] | null | null | null | network/vgg16.py | CamilaAlvarez/tensorflow-demo | 57f576bafe97054046610ded7a9ce39caa7e84b4 | [
"MIT"
] | null | null | null | from network.network import Network
import tensorflow as tf
import numpy as np
class VGG16(Network):
def __init__(self, input_shape, class_number, x, y, train=False, learning_rate=0.001):
super().__init__()
self.loss = None
self.accuracy = None
self._build_network(input_shape, cla... | 57.941176 | 111 | 0.644501 | 5,825 | 0.985618 | 0 | 0 | 0 | 0 | 0 | 0 | 368 | 0.062267 |
d1a20a252ae1bd2bda733e48649244f828568be5 | 2,840 | py | Python | S4/S4 Library/generated/protocolbuffers/ResourceKey_pb2.py | NeonOcean/Environment | ca658cf66e8fd6866c22a4a0136d415705b36d26 | [
"CC-BY-4.0"
] | 1 | 2021-05-20T19:33:37.000Z | 2021-05-20T19:33:37.000Z | S4/S4 Library/generated/protocolbuffers/ResourceKey_pb2.py | NeonOcean/Environment | ca658cf66e8fd6866c22a4a0136d415705b36d26 | [
"CC-BY-4.0"
] | null | null | null | S4/S4 Library/generated/protocolbuffers/ResourceKey_pb2.py | NeonOcean/Environment | ca658cf66e8fd6866c22a4a0136d415705b36d26 | [
"CC-BY-4.0"
] | null | null | null | from google.protobuf import descriptor
from google.protobuf import message
from google.protobuf import reflection
from google.protobuf import descriptor_pb2
DESCRIPTOR = descriptor.FileDescriptor(name='ResourceKey.proto', package='EA.Sims4.Network', serialized_pb='\n\x11ResourceKey.proto\x12\x10EA.Sims4.Network"<\n\x0b... | 167.058824 | 1,189 | 0.817254 | 240 | 0.084507 | 0 | 0 | 0 | 0 | 0 | 0 | 666 | 0.234507 |
d1a59054375691b39ba6ea30c594eff643b8391c | 5,787 | py | Python | scripts/elfw-plotResults.py | multimedia-eurecat/ELFW | 98a6eca7ab9152a7cf8c447ee9f4a62b5629e3b2 | [
"Apache-2.0"
] | 15 | 2020-07-10T08:19:13.000Z | 2022-02-24T08:52:24.000Z | scripts/elfw-plotResults.py | multimedia-eurecat/ELFW | 98a6eca7ab9152a7cf8c447ee9f4a62b5629e3b2 | [
"Apache-2.0"
] | 7 | 2020-08-11T06:26:54.000Z | 2021-04-23T08:32:21.000Z | scripts/elfw-plotResults.py | multimedia-eurecat/ELFW | 98a6eca7ab9152a7cf8c447ee9f4a62b5629e3b2 | [
"Apache-2.0"
] | 5 | 2020-08-11T09:09:42.000Z | 2020-11-25T12:02:54.000Z | import math
import numpy as np
import matplotlib.pyplot as plt
from matplotlib.patches import Polygon
# from matplotlib.ticker import MaxNLocator
# Rafael Redondo (c) Eurecat 2020
colors = np.array([
[[247, 197, 188],[242, 151, 136],[242, 120, 99],[237, 85, 59]],
[[255, 242, 196], [247, 232, 176], [250, 225, 135], [... | 49.887931 | 183 | 0.637809 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 847 | 0.146363 |
d1a66059d6aa2f43be85ef5e0f0969dc1f348e3f | 4,299 | py | Python | preprocessing/gen_clustering.py | HaowenWeiJohn/CV_Project | 8e2414796f60a8c3fe452f3721e4a6ef7edfdb11 | [
"MIT"
] | null | null | null | preprocessing/gen_clustering.py | HaowenWeiJohn/CV_Project | 8e2414796f60a8c3fe452f3721e4a6ef7edfdb11 | [
"MIT"
] | null | null | null | preprocessing/gen_clustering.py | HaowenWeiJohn/CV_Project | 8e2414796f60a8c3fe452f3721e4a6ef7edfdb11 | [
"MIT"
] | null | null | null | import yaml
import os
import sys
import yaml
import numpy as np
from tqdm import tqdm
import matplotlib.pyplot as plt
from utils import load_poses, load_calib, load_files, load_vertex
from preprocessing.utils import *
from example.laserscan import *
from PC_cluster.ScanLineRun_cluster.build import ScanLineRun_Cluster
... | 34.119048 | 125 | 0.623168 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,610 | 0.374506 |
d1a8c0ef8c78390a7389441f044f0c0970746917 | 529 | py | Python | src/Python/701-800/744.NextGreatestLetter.py | Peefy/PeefyLeetCode | 92156e4b48ba19e3f02e4286b9f733e9769a1dee | [
"Apache-2.0"
] | 2 | 2018-05-03T07:50:03.000Z | 2018-06-17T04:32:13.000Z | src/Python/701-800/744.NextGreatestLetter.py | Peefy/PeefyLeetCode | 92156e4b48ba19e3f02e4286b9f733e9769a1dee | [
"Apache-2.0"
] | null | null | null | src/Python/701-800/744.NextGreatestLetter.py | Peefy/PeefyLeetCode | 92156e4b48ba19e3f02e4286b9f733e9769a1dee | [
"Apache-2.0"
] | 3 | 2018-11-09T14:18:11.000Z | 2021-11-17T15:23:52.000Z |
class Solution:
def nextGreatestLetter(self, letters, target):
"""
:type letters: List[str]
:type target: str
:rtype: str
"""
for l in letters:
if l > target:
return l
return letters[0]
if __name__ == '__main__':
solution = S... | 23 | 60 | 0.529301 | 273 | 0.516068 | 0 | 0 | 0 | 0 | 0 | 0 | 140 | 0.26465 |
d1a9642bf9111e3ce2efbfc78ec14600b2219939 | 592 | py | Python | codecademy_scripts/estimate_pi.py | Faraaz54/python_training_problems | 24c7b42daaf54366759e1d7c4b42f9936316e94b | [
"MIT"
] | null | null | null | codecademy_scripts/estimate_pi.py | Faraaz54/python_training_problems | 24c7b42daaf54366759e1d7c4b42f9936316e94b | [
"MIT"
] | null | null | null | codecademy_scripts/estimate_pi.py | Faraaz54/python_training_problems | 24c7b42daaf54366759e1d7c4b42f9936316e94b | [
"MIT"
] | null | null | null | from math import sqrt
def factorial(n):
"""Computes factorial of n."""
if n == 0:
return 1
else:
recurse = factorial(n-1)
result = n * recurse
return result
def estimate_pi():
factor = (sqrt(2) * 2) / 9801
k = 0
total = 0
while True:
nu... | 20.413793 | 48 | 0.469595 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 30 | 0.050676 |
d1aa0e60389e9105536a41fff2a976838f0e6c36 | 1,202 | py | Python | pywinrt/winsdk/windows/graphics/printing/printticket/__init__.py | pywinrt/python-winsdk | 1e2958a712949579f5e84d38220062b2cec12511 | [
"MIT"
] | 3 | 2022-02-14T14:53:08.000Z | 2022-03-29T20:48:54.000Z | pywinrt/winsdk/windows/graphics/printing/printticket/__init__.py | pywinrt/python-winsdk | 1e2958a712949579f5e84d38220062b2cec12511 | [
"MIT"
] | 4 | 2022-01-28T02:53:52.000Z | 2022-02-26T18:10:05.000Z | pywinrt/winsdk/windows/graphics/printing/printticket/__init__.py | pywinrt/python-winsdk | 1e2958a712949579f5e84d38220062b2cec12511 | [
"MIT"
] | null | null | null | # WARNING: Please don't edit this file. It was generated by Python/WinRT v1.0.0-beta.4
import enum
import winsdk
_ns_module = winsdk._import_ns_module("Windows.Graphics.Printing.PrintTicket")
try:
import winsdk.windows.data.xml.dom
except Exception:
pass
try:
import winsdk.windows.foundation
except Exc... | 26.130435 | 86 | 0.811148 | 278 | 0.231281 | 0 | 0 | 0 | 0 | 0 | 0 | 125 | 0.103993 |
d1ac4c4b62c7a69033fe73553cd10cf79ee11495 | 638 | py | Python | MyThread.py | hectorpadin1/Computer-Vision-Algorithms | 4ef66353f2453ec1be764787e23260f6ef402e0f | [
"MIT"
] | null | null | null | MyThread.py | hectorpadin1/Computer-Vision-Algorithms | 4ef66353f2453ec1be764787e23260f6ef402e0f | [
"MIT"
] | null | null | null | MyThread.py | hectorpadin1/Computer-Vision-Algorithms | 4ef66353f2453ec1be764787e23260f6ef402e0f | [
"MIT"
] | null | null | null | import threading
import sys
class ReturnValueThread(threading.Thread):
def __init__(self, *args, **kwargs):
super().__init__(*args, **kwargs)
self.result = None
def run(self):
if self._target is None:
return # could alternatively raise an exception, depends on the use cas... | 31.9 | 99 | 0.617555 | 608 | 0.952978 | 0 | 0 | 0 | 0 | 0 | 0 | 126 | 0.197492 |
d1ac6a90c4729800926b6568f7d2006371d58651 | 540 | py | Python | it/versions/structures/default/python/bar/v2_1.py | nezdolik/reproto | 2d69d8efca518a6ea23a4182b29872fcc62a1a71 | [
"Apache-2.0",
"MIT"
] | null | null | null | it/versions/structures/default/python/bar/v2_1.py | nezdolik/reproto | 2d69d8efca518a6ea23a4182b29872fcc62a1a71 | [
"Apache-2.0",
"MIT"
] | null | null | null | it/versions/structures/default/python/bar/v2_1.py | nezdolik/reproto | 2d69d8efca518a6ea23a4182b29872fcc62a1a71 | [
"Apache-2.0",
"MIT"
] | null | null | null | class Other:
def __init__(self, name21):
self.name21 = name21
def get_name21(self):
return self.name21
@staticmethod
def decode(data):
f_name21 = data["name21"]
if not isinstance(f_name21, unicode):
raise Exception("not a string")
return Other(f_name21)
def encode(self):
dat... | 18.62069 | 52 | 0.648148 | 539 | 0.998148 | 0 | 0 | 172 | 0.318519 | 0 | 0 | 80 | 0.148148 |
d1aca30c7404605a4e877890f728a3f9b0615ca4 | 623 | py | Python | Python/Perfect-Python/12/1_4_2_echoclient.py | hrntsm/study-language | 922578a5321d70c26b935e6052f400125e15649c | [
"MIT"
] | 1 | 2022-02-06T10:50:42.000Z | 2022-02-06T10:50:42.000Z | Python/Perfect-Python/12/1_4_2_echoclient.py | hrntsm/study-language | 922578a5321d70c26b935e6052f400125e15649c | [
"MIT"
] | null | null | null | Python/Perfect-Python/12/1_4_2_echoclient.py | hrntsm/study-language | 922578a5321d70c26b935e6052f400125e15649c | [
"MIT"
] | null | null | null | import asyncio
class EchoClient(asyncio.Protocol):
def __init__(self, message, loop):
self.mesage = message
self.loop = loop
def connection_made(self, transport):
transport.write(self.mesage.encode("utf-8"))
self.transport = transport
def data_received(self, data):
... | 23.961538 | 83 | 0.670947 | 425 | 0.671406 | 0 | 0 | 0 | 0 | 0 | 0 | 42 | 0.066351 |
d1aca4dd340ce95cab59972197c8c8400eb12629 | 482 | py | Python | Tinify.dzbundle/tinify/result_meta.py | F-Pseudonym/dropzone4-actions | d36f581a6be081ff303324bf3ca35daa5133c36a | [
"Ruby"
] | 1 | 2021-02-01T22:44:36.000Z | 2021-02-01T22:44:36.000Z | Tinify.dzbundle/tinify/result_meta.py | F-Pseudonym/dropzone4-actions | d36f581a6be081ff303324bf3ca35daa5133c36a | [
"Ruby"
] | null | null | null | Tinify.dzbundle/tinify/result_meta.py | F-Pseudonym/dropzone4-actions | d36f581a6be081ff303324bf3ca35daa5133c36a | [
"Ruby"
] | null | null | null | # -*- coding: utf-8 -*-
from __future__ import absolute_import, division, print_function, unicode_literals
class ResultMeta(object):
def __init__(self, meta):
self._meta = meta
@property
def width(self):
return int(self._meta['Image-Width'])
@property
def height(self):
ret... | 21.909091 | 82 | 0.639004 | 373 | 0.773859 | 0 | 0 | 225 | 0.466805 | 0 | 0 | 60 | 0.124481 |
d1ad2457b9a62c330bcd5b7334696d9a9143b52a | 855 | py | Python | app.py | wataxiwaX/OSCspider | 7f0635c49cca6c14ffac3a37cbb9c10cc2c15cc0 | [
"MIT"
] | null | null | null | app.py | wataxiwaX/OSCspider | 7f0635c49cca6c14ffac3a37cbb9c10cc2c15cc0 | [
"MIT"
] | null | null | null | app.py | wataxiwaX/OSCspider | 7f0635c49cca6c14ffac3a37cbb9c10cc2c15cc0 | [
"MIT"
] | 1 | 2019-04-29T10:52:40.000Z | 2019-04-29T10:52:40.000Z | # -*- coding: UTF-8 -*-
from spider import *
def main_view():
print '-------------------------------------------------------'
print 'l.列出项目\ts.查找项目\tc.更新项目\tq.退出'
print '|---0.顺序 \t|---0.关键字'
print '|---1.收藏↑\t|---1.收藏>='
print '|---2.收藏↓\t|---2.收藏<'
print '|---3.评论↑\t|---3.评论>='
print '|-... | 23.75 | 67 | 0.389474 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 478 | 0.493292 |
d1ae965b8719af361c251c7b3021070130bbaa7e | 5,653 | py | Python | LDA/lda.py | wimpykid26/Evolutionary-Classification | 0a78cbebc252c0a13703aee20dac9fa234f07b08 | [
"Apache-2.0"
] | 3 | 2019-11-10T08:51:11.000Z | 2020-08-05T14:23:27.000Z | LDA/lda.py | wimpykid26/Evolutionary-Classification | 0a78cbebc252c0a13703aee20dac9fa234f07b08 | [
"Apache-2.0"
] | null | null | null | LDA/lda.py | wimpykid26/Evolutionary-Classification | 0a78cbebc252c0a13703aee20dac9fa234f07b08 | [
"Apache-2.0"
] | 2 | 2017-12-12T13:35:41.000Z | 2017-12-28T10:00:56.000Z | import pandas as pd
from matplotlib import pyplot as plt
import numpy as np
import math
from matplotlib import pyplot as plt
from sklearn.preprocessing import LabelEncoder
feature_dict = {i:label for i,label in zip(
range(4),
('sepal length in cm',
'sepal width in c... | 30.722826 | 101 | 0.613833 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,371 | 0.242526 |
d1ae9c9c1b63d403d1996a3a61d581f139b38fa2 | 1,509 | py | Python | js_services/migrations/0013_auto_20190709_2315.py | evgeny-dmi3ev/js-services | 8d4960ec49a44b0eda537713af9f4976456e0f5e | [
"BSD-3-Clause"
] | null | null | null | js_services/migrations/0013_auto_20190709_2315.py | evgeny-dmi3ev/js-services | 8d4960ec49a44b0eda537713af9f4976456e0f5e | [
"BSD-3-Clause"
] | null | null | null | js_services/migrations/0013_auto_20190709_2315.py | evgeny-dmi3ev/js-services | 8d4960ec49a44b0eda537713af9f4976456e0f5e | [
"BSD-3-Clause"
] | null | null | null | # -*- coding: utf-8 -*-
# Generated by Django 1.11.22 on 2019-07-09 23:15
from __future__ import unicode_literals
from django.db import migrations, models
import js_color_picker.fields
class Migration(migrations.Migration):
dependencies = [
('js_services', '0012_auto_20190430_0804'),
]
operatio... | 35.928571 | 288 | 0.612326 | 1,320 | 0.874751 | 0 | 0 | 0 | 0 | 0 | 0 | 452 | 0.299536 |
d1b01bba827b8c38a0f0739fb791912ffc9c1b74 | 29,968 | py | Python | gentex/texmeas.py | NPann/GenTex | 8a2c7cc746abefd252613f4ddf0d7f70d7ff26f8 | [
"BSD-3-Clause"
] | 3 | 2019-04-26T00:48:01.000Z | 2020-07-06T19:10:17.000Z | gentex/texmeas.py | NPann/GenTex | 8a2c7cc746abefd252613f4ddf0d7f70d7ff26f8 | [
"BSD-3-Clause"
] | null | null | null | gentex/texmeas.py | NPann/GenTex | 8a2c7cc746abefd252613f4ddf0d7f70d7ff26f8 | [
"BSD-3-Clause"
] | 2 | 2019-01-10T18:38:05.000Z | 2021-05-19T16:54:01.000Z | """ gentex.texmeas package
"""
import numpy as np
class Texmeas:
"""Class texmeas for generating texture measures from co-occurrence matrix
Parameters
----------
comat: ndarray
Non-normalized co-occurrence matrix - chi-squared conditional distribution
comparisons require the actua... | 45.613394 | 154 | 0.525894 | 29,912 | 0.998131 | 0 | 0 | 0 | 0 | 0 | 0 | 12,399 | 0.413741 |
d1b22c20857895713f38d86719437c73c6f5f5b7 | 3,373 | py | Python | AutoSketcher/utils/dataio.py | D1anaGreen/essaykiller | 75311a23dc1f5dc8b5040114fdeda67248700f7a | [
"Apache-2.0"
] | 4,551 | 2020-09-29T14:50:03.000Z | 2022-03-31T00:40:45.000Z | AutoSketcher/utils/dataio.py | D1anaGreen/essaykiller | 75311a23dc1f5dc8b5040114fdeda67248700f7a | [
"Apache-2.0"
] | 28 | 2020-10-01T08:03:23.000Z | 2022-03-30T15:40:40.000Z | AutoSketcher/utils/dataio.py | D1anaGreen/essaykiller | 75311a23dc1f5dc8b5040114fdeda67248700f7a | [
"Apache-2.0"
] | 809 | 2020-10-01T05:34:58.000Z | 2022-03-31T00:40:48.000Z | #!/usr/bin/env python
# encoding: utf-8
"""
@author: zk
@contact: [email protected]
@file: dataio.py
@time: 8/27/2019 4:31 PM
@desc:
"""
import os
def load_txt_data(path, mode='utf-8-sig', origin=False):
"""
This func is used to reading txt file
:param origin:
:param path: path where file stored
... | 20.319277 | 76 | 0.590276 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,541 | 0.456863 |
d1b6e00f1b7c8a15539c5d29a89c356e88a3f73c | 20,511 | py | Python | music_maker.py | kenanbit/loopsichord | d02e021a68333c52adff38cc869bf217deebfc5c | [
"MIT"
] | null | null | null | music_maker.py | kenanbit/loopsichord | d02e021a68333c52adff38cc869bf217deebfc5c | [
"MIT"
] | null | null | null | music_maker.py | kenanbit/loopsichord | d02e021a68333c52adff38cc869bf217deebfc5c | [
"MIT"
] | null | null | null | from constants import *
import pygame as pg
from time import sleep
from metronome import *
import math
import numpy as np
from copy import deepcopy
from audio import *
from instructions_panel import *
from loop import *
class MusicMaker:
def __init__(self, screen):
self.pitch = 0
self.screen = scr... | 49.305288 | 211 | 0.610502 | 20,289 | 0.989177 | 0 | 0 | 0 | 0 | 0 | 0 | 2,574 | 0.125494 |
d1b7d1521d980a52988abbf6e1742ba50379f867 | 10,084 | py | Python | danmu/danmaku/egame.py | simplecelery/zhibo | f1b69dabfde6cd2fc8a8a7fc4112da99feaf778f | [
"Apache-2.0"
] | 4 | 2021-11-21T15:30:32.000Z | 2022-03-11T02:49:30.000Z | danmu/danmaku/egame.py | simplecelery/zhibo | f1b69dabfde6cd2fc8a8a7fc4112da99feaf778f | [
"Apache-2.0"
] | 1 | 2021-11-11T15:44:44.000Z | 2021-11-11T15:44:44.000Z | danmu/danmaku/egame.py | simplecelery/zhibo | f1b69dabfde6cd2fc8a8a7fc4112da99feaf778f | [
"Apache-2.0"
] | 9 | 2021-09-24T03:26:21.000Z | 2022-03-23T01:32:15.000Z | import aiohttp
import struct
import json
import re
class eGame:
heartbeat = b'\x00\x00\x00\x12\x00\x12\x00\x01\x00\x07\x00\x00\x00\x01\x00\x00\x00\x00'
heartbeatInterval = 60
@staticmethod
async def get_ws_info(url):
rid = url.split('/')[-1]
page_id = aid = rid
headers = {
... | 28.485876 | 380 | 0.416501 | 10,119 | 0.994399 | 0 | 0 | 2,712 | 0.266509 | 1,761 | 0.173054 | 1,858 | 0.182586 |
d1b947c30d3ec40d21821c8ac176cfd383593e74 | 832 | py | Python | minimal_rating_system/views.py | dvischi/minimal-rating-system | 25b42f49dbc36a8dfc912368273face49f9a4d97 | [
"MIT"
] | null | null | null | minimal_rating_system/views.py | dvischi/minimal-rating-system | 25b42f49dbc36a8dfc912368273face49f9a4d97 | [
"MIT"
] | null | null | null | minimal_rating_system/views.py | dvischi/minimal-rating-system | 25b42f49dbc36a8dfc912368273face49f9a4d97 | [
"MIT"
] | null | null | null | from django.views.generic import DetailView, TemplateView
from star_ratings.models import Rating
from .models import Beer, Snack
class BeerRateView(TemplateView):
model = Beer
template_name = 'minimal_rating_system/article_ratings.html'
def get_context_data(self, **kwargs):
kwargs['article_class... | 33.28 | 78 | 0.72476 | 696 | 0.836538 | 0 | 0 | 0 | 0 | 0 | 0 | 179 | 0.215144 |
d1b9a244a6632704e7c6e345d736e70ca933a771 | 335 | py | Python | AwardsApp/migrations/0005_remove_userprofile_bio.py | josphat-otieno/project-reviews | 5eaf9334fbd15b95726aee922f936d83e6f3d56f | [
"MIT"
] | null | null | null | AwardsApp/migrations/0005_remove_userprofile_bio.py | josphat-otieno/project-reviews | 5eaf9334fbd15b95726aee922f936d83e6f3d56f | [
"MIT"
] | null | null | null | AwardsApp/migrations/0005_remove_userprofile_bio.py | josphat-otieno/project-reviews | 5eaf9334fbd15b95726aee922f936d83e6f3d56f | [
"MIT"
] | null | null | null | # Generated by Django 3.2.5 on 2021-07-20 15:33
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('AwardsApp', '0004_alter_userprofile_bio'),
]
operations = [
migrations.RemoveField(
model_name='userprofile',
name='bio',
... | 18.611111 | 52 | 0.6 | 250 | 0.746269 | 0 | 0 | 0 | 0 | 0 | 0 | 104 | 0.310448 |
d1b9c4876479aca8264e006843673c2f7fdb84e7 | 8,530 | py | Python | app.py | tpirate/SchoolPortal | ca4c7739126b0223b360de5b4927b3a8c9bda218 | [
"MIT"
] | 1 | 2020-12-07T07:40:33.000Z | 2020-12-07T07:40:33.000Z | app.py | tpirate/SchoolPortal | ca4c7739126b0223b360de5b4927b3a8c9bda218 | [
"MIT"
] | null | null | null | app.py | tpirate/SchoolPortal | ca4c7739126b0223b360de5b4927b3a8c9bda218 | [
"MIT"
] | null | null | null | # Imports
from flask import Flask, render_template, session, redirect, request, flash, url_for, abort
from flask_session import Session
from werkzeug.exceptions import default_exceptions, HTTPException, InternalServerError
from werkzeug.security import check_password_hash, generate_password_hash
from cs50 import S... | 40.813397 | 252 | 0.62966 | 0 | 0 | 0 | 0 | 7,633 | 0.894842 | 0 | 0 | 2,784 | 0.326377 |
d1bae04489d859e76db95e43fda5086ae3c123aa | 621 | py | Python | tests/test_rot13.py | onlykood/pycipher | 8f1d7cf3cba4e12171e27d9ce723ad890194de19 | [
"MIT"
] | 196 | 2015-01-16T19:09:19.000Z | 2022-03-13T16:19:21.000Z | tests/test_rot13.py | rafaelmessias/pycipher | 787eb947a173138869ddd388b5331559e5cd3a5a | [
"MIT"
] | 9 | 2015-10-09T18:07:32.000Z | 2021-12-22T12:04:00.000Z | tests/test_rot13.py | rafaelmessias/pycipher | 787eb947a173138869ddd388b5331559e5cd3a5a | [
"MIT"
] | 76 | 2015-02-08T23:17:43.000Z | 2021-12-27T04:15:30.000Z | from pycipher import Rot13
import unittest
class TestRot13(unittest.TestCase):
def test_decipher(self):
text = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ'
declist = ['nopqrstuvwxyzabcdefghijklmnopqrstuvwxyzabcdefghijklm']
dec = Rot13().decipher(text)
self.assertEqual(dec... | 36.529412 | 74 | 0.723027 | 575 | 0.925926 | 0 | 0 | 0 | 0 | 0 | 0 | 216 | 0.347826 |
d1bd24d999e751c41059b172e51cf7f0d7f8e82a | 246 | py | Python | tests/functional_tests/identity_tests/test_definition.py | lycantropos/lz | 632baaffc1c62cd644f6e67f0bcd7971ae6580da | [
"MIT"
] | 7 | 2019-05-26T15:30:03.000Z | 2022-03-07T16:00:31.000Z | tests/functional_tests/identity_tests/test_definition.py | lycantropos/lz | 632baaffc1c62cd644f6e67f0bcd7971ae6580da | [
"MIT"
] | 29 | 2018-11-12T11:45:56.000Z | 2021-05-04T17:24:45.000Z | tests/functional_tests/identity_tests/test_definition.py | lycantropos/lz | 632baaffc1c62cd644f6e67f0bcd7971ae6580da | [
"MIT"
] | null | null | null | from typing import Any
from hypothesis import given
from lz.functional import identity
from tests import strategies
@given(strategies.scalars)
def test_basic(object_: Any) -> None:
result = identity(object_)
assert result is object_
| 17.571429 | 37 | 0.772358 | 0 | 0 | 0 | 0 | 125 | 0.50813 | 0 | 0 | 0 | 0 |
d1bd46a35b1176540180e5d836f7a6d20314a7dc | 3,703 | py | Python | lib/cogs/reactionpolls.py | pille1842/gerfroniabot | 291dc8f3cf9fb00f3f5e89e36b066660a410026f | [
"MIT"
] | null | null | null | lib/cogs/reactionpolls.py | pille1842/gerfroniabot | 291dc8f3cf9fb00f3f5e89e36b066660a410026f | [
"MIT"
] | null | null | null | lib/cogs/reactionpolls.py | pille1842/gerfroniabot | 291dc8f3cf9fb00f3f5e89e36b066660a410026f | [
"MIT"
] | null | null | null | from datetime import datetime, timedelta
from discord import Embed
from discord.ext.commands import Cog
from discord.ext.commands import command
import logging
class Reactionpolls(Cog):
NUMBERS = [
"1️⃣", "2️⃣", "3️⃣", "4️⃣", "5️⃣", "6️⃣", "7️⃣", "8️⃣", "9️⃣", "🔟"
]
def __init__(self, bot):
... | 44.614458 | 163 | 0.654604 | 3,537 | 0.942697 | 0 | 0 | 2,838 | 0.756397 | 3,083 | 0.821695 | 1,354 | 0.360874 |
d1be71acaff6d8c302bc2e4dd7fae486925372c6 | 5,975 | py | Python | scripts/visualize_image_dataset.py | Sergio5714/pybf | bf56b353cd715c1bdb16d6cbb79aef44e3ef49bc | [
"Apache-2.0"
] | 1 | 2021-11-02T09:54:41.000Z | 2021-11-02T09:54:41.000Z | scripts/visualize_image_dataset.py | Sergio5714/pybf | bf56b353cd715c1bdb16d6cbb79aef44e3ef49bc | [
"Apache-2.0"
] | null | null | null | scripts/visualize_image_dataset.py | Sergio5714/pybf | bf56b353cd715c1bdb16d6cbb79aef44e3ef49bc | [
"Apache-2.0"
] | 2 | 2020-04-17T10:50:06.000Z | 2021-11-02T09:54:47.000Z | """
Copyright (C) 2020 ETH Zurich. All rights reserved.
Author: Sergei Vostrikov, ETH Zurich
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LI... | 33.757062 | 75 | 0.59364 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,739 | 0.291046 |
d1bef0f9641ed3b8503a1d2834c347e28d936599 | 4,725 | py | Python | tests/ut/python/dataset/test_datasets_get_dataset_size.py | unseenme/mindspore | 4ba052f0cd9146ac0ccc4880a778706f1b2d0af8 | [
"Apache-2.0"
] | 7 | 2020-05-24T03:19:26.000Z | 2020-05-24T03:20:00.000Z | tests/ut/python/dataset/test_datasets_get_dataset_size.py | liyong126/mindspore | 930a1fb0a8fa9432025442c4f4732058bb7af592 | [
"Apache-2.0"
] | 7 | 2020-03-30T08:31:56.000Z | 2020-04-01T09:54:39.000Z | tests/ut/python/dataset/test_datasets_get_dataset_size.py | liyong126/mindspore | 930a1fb0a8fa9432025442c4f4732058bb7af592 | [
"Apache-2.0"
] | 1 | 2020-03-30T17:07:43.000Z | 2020-03-30T17:07:43.000Z | # Copyright 2019 Huawei Technologies Co., Ltd
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to... | 41.447368 | 90 | 0.748995 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1,098 | 0.232381 |
d1bfe6581b046ee9479ce7089c84c5e5bea00961 | 4,651 | py | Python | tobiko/shell/iperf/_interface.py | FedericoRessi/tobiko | 188825386dc30197a37b7fe8be03318c73abbc48 | [
"Apache-2.0"
] | 1 | 2022-01-11T20:50:06.000Z | 2022-01-11T20:50:06.000Z | tobiko/shell/iperf/_interface.py | FedericoRessi/tobiko | 188825386dc30197a37b7fe8be03318c73abbc48 | [
"Apache-2.0"
] | null | null | null | tobiko/shell/iperf/_interface.py | FedericoRessi/tobiko | 188825386dc30197a37b7fe8be03318c73abbc48 | [
"Apache-2.0"
] | null | null | null | # Copyright (c) 2021 Red Hat, Inc.
#
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless requi... | 31.425676 | 78 | 0.641797 | 3,472 | 0.746506 | 0 | 0 | 1,427 | 0.306816 | 0 | 0 | 1,099 | 0.236293 |
d1c1735ef2cb4649ea44c8972cfcfb01cf792d82 | 512 | py | Python | Tensorflow_official/cnn/.ipynb_checkpoints/test.py | starkidstory/OmegaTensor | 2a80d38236a7ce6d6460be59528b33227d98b93b | [
"MIT"
] | 2 | 2020-04-07T03:01:03.000Z | 2020-04-16T14:33:21.000Z | Tensorflow_official/cnn/.ipynb_checkpoints/test.py | starkidstory/OmegaTensor | 2a80d38236a7ce6d6460be59528b33227d98b93b | [
"MIT"
] | null | null | null | Tensorflow_official/cnn/.ipynb_checkpoints/test.py | starkidstory/OmegaTensor | 2a80d38236a7ce6d6460be59528b33227d98b93b | [
"MIT"
] | null | null | null | import tensorflow as tf
import pathlib
import matplotlib.pyplot as plt
import pandas as pd
import numpy as np
#print(np.version.version)
#np.set_printoptions(precision=4)
dataset=tf.data.Dataset.from_tensor_slices([8,3,0,8,2,1])
num=np.arange(5)
numT=tf.convert_to_tensor(num)
numF=tf.cast(numT,dtype=tf.float32)
print(... | 24.380952 | 57 | 0.785156 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 59 | 0.115234 |
d1c367c3ef3880ac8d8c1957203e2309d51cb673 | 315 | py | Python | 378.py | geethakamath18/Leetcode | 8e55e0a47ee35ed100b30dda6682c7ce1033d4b2 | [
"MIT"
] | null | null | null | 378.py | geethakamath18/Leetcode | 8e55e0a47ee35ed100b30dda6682c7ce1033d4b2 | [
"MIT"
] | null | null | null | 378.py | geethakamath18/Leetcode | 8e55e0a47ee35ed100b30dda6682c7ce1033d4b2 | [
"MIT"
] | null | null | null | #LeetCode problem 378: Kth Smallest Element in a Sorted Matrix
class Solution:
def kthSmallest(self, matrix: List[List[int]], k: int) -> int:
res=[]
for i in range(len(matrix)):
for j in range(len(matrix[0])):
res.append(matrix[i][j])
return(sorted(res)[k-1]) | 39.375 | 66 | 0.584127 | 252 | 0.8 | 0 | 0 | 0 | 0 | 0 | 0 | 62 | 0.196825 |