code
stringlengths
3
1.05M
repo_name
stringlengths
5
104
path
stringlengths
4
251
language
stringclasses
1 value
license
stringclasses
15 values
size
int64
3
1.05M
''' Test Cases for DocumentConverter Class for WordCloud Project Daniel Klein Computer-Based Honors Program The University of Alabama 9.27.2013 ''' import unittest import os, os.path from src.core.python.SupremeCourtOpinionFileConverter import SupremeCourtOpinionFileConverter ##### Here are all the global variables used in these tests. VALID_OPINION_FILE_LINES = ([ """\ TITLE: UNITED STATES v. JOHNSON ET AL., DOING BUSINESS AS UNITED STATES\ DENTAL CO., ET AL.\ """, """CASE NUMBER: No. 43""", """US CITATION: 323 U.S. 273""", """SUPREME COURT CITATION: 65 S. Ct. 249""", """LAWYERS ED CITATION: 89 L. Ed. 236""", """LEXIS CITATION: 1944 U.S. LEXIS 1230""", """\ FULL CITATION: 323 U.S. 273; 65 S. Ct. 249; 89 L. Ed. 236; 1944 U.S. LEXIS 1230\ """, """DATES: November 8, 1944, Argued;December 18, 1944, Decided;""", """DISPOSITION: 53 F.Supp. 596, affirmed.""", """OPINION TYPE: concur""", """* * * * * * * *""", """MR. JUSTICE MURPHY, concurring.""", """I join in the opinion of the Court and believe that the judgment should be \ affirmed.""", """Congress has the constitutional power to fix venue at any place where a \ crime occurs. Our problem here is to determine, in the absence of a specific \ venue provision, where the crime outlawed by the Federal Denture Act occurred \ for purposes of venue.""", """The Act prohibits the use of the mails for the purpose of sending or \ bringing into any state certain prohibited articles. It is undisputed that \ when a defendant places a prohibited article in the mails in Illinois for \ the purpose of sending it into Delaware he has completed a statutory offense. \ Hence he is triable in Illinois. But to hold that the statutory crime also \ encompasses the receipt of the prohibited article in Delaware, justifying a \ trial at that point, requires an implication that I am unwilling to make in \ the absence of more explicit Congressional language.""", """Very often the difference between liberty and imprisonment in cases where \ the direct evidence offered by the government and the defendant is evenly \ balanced depends upon the presence of character witnesses. The defendant is \ more likely to obtain their presence in the district of his residence, which \ in this instance is usually the place where the prohibited article is mailed. \ The inconvenience, expense and loss of time involved in transplanting these \ witnesses to testify in trials far removed from their homes are often too \ great to warrant their use. Moreover, they are likely to lose much of their \ effectiveness before a distant jury that knows nothing of their reputations. \ Such factors make it difficult for me to conclude, where Congress has not \ said so specifically, that we should construe the Federal Denture Act as \ covering more than the first sufficient and punishable use of the mails \ insofar as the sender of a prohibited article is concerned. The principle of \ narrow construction of criminal statutes does not warrant interpreting the \ "use" of the mails to cover all possible uses in light of the foregoing \ considerations."""]) CASE_TITLE = """\ UNITED STATES v. JOHNSON ET AL., DOING BUSINESS AS UNITED STATES\ DENTAL CO., ET AL.\ """ CASE_NUM = "No. 43" CASE_US_CITE = "323 U.S. 273" CASE_SUPREME_COURT_CITE = "65 S. Ct. 249" CASE_LAWYERS_ED_CITE = "89 L. Ed. 236" CASE_LEXIS_CITE = "1944 U.S. LEXIS 1230" CASE_FULL_CITE = "323 U.S. 273; 65 S. Ct. 249; 89 L. Ed. 236; 1944 U.S. LEXIS 1230" CASE_DATES = "November 8, 1944 (Argued) December 18, 1944 (Decided) " # THIS MIGHT CHANGE!! CASE_DISPOSITION = "53 F.Supp. 596, affirmed." OPINION_AUTHOR = "MURPHY" OPINION_TYPE = "concur" OPINION_TEXT = "\n".join(VALID_OPINION_FILE_LINES[11:]) TEST_FILE_PATH = os.path.join(os.path.abspath(os.curdir), "MURPHY_1944 U.S. LEXIS 1230.txt") TEST_PICKLE_PATH = os.path.join(os.path.abspath(os.curdir), "pickled_test_doc") ##### def create_test_file(file_lines): with open(TEST_FILE_PATH, 'w') as test_file: for line in file_lines: test_file.write(line + "\n") class DocumentConverterTest(unittest.TestCase): def setUp(self): ''' what do i need to run tests? - a test file. ''' self.test_path = TEST_FILE_PATH self.test_converter = SupremeCourtOpinionFileConverter(self.test_path, TEST_PICKLE_PATH) def tearDown(self): if os.path.exists(self.test_path): os.remove(self.test_path) if os.path.exists(TEST_PICKLE_PATH): os.chmod(TEST_PICKLE_PATH, 0777) os.remove(TEST_PICKLE_PATH) del self.test_converter def testNormalCase(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() normal case...") # create a normal test file create_test_file(VALID_OPINION_FILE_LINES) converted_doc = self.test_converter.convert_file() print("Word count: {0}".format(converted_doc.word_count)) # here assert a bunch of things about the resulting converted_doc self.assertTrue(hasattr(converted_doc, 'output_filename')) self.assertEqual(converted_doc.output_filename, TEST_PICKLE_PATH) self.assertTrue(hasattr(converted_doc, 'doc_text')) self.assertEqual(converted_doc.doc_text, OPINION_TEXT) self.assertTrue(hasattr(converted_doc, 'doc_metadata')) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_title')) self.assertEqual(converted_doc.doc_metadata.case_title, CASE_TITLE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_author')) self.assertEqual(converted_doc.doc_metadata.opinion_author, OPINION_AUTHOR) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_type')) self.assertEqual(converted_doc.doc_metadata.opinion_type, OPINION_TYPE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_num')) self.assertEqual(converted_doc.doc_metadata.case_num, CASE_NUM) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_us_cite')) self.assertEqual(converted_doc.doc_metadata.case_us_cite, CASE_US_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_supreme_court_cite')) self.assertEqual(converted_doc.doc_metadata.case_supreme_court_cite, CASE_SUPREME_COURT_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lawyers_ed_cite')) self.assertEqual(converted_doc.doc_metadata.case_lawyers_ed_cite, CASE_LAWYERS_ED_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lexis_cite')) self.assertEqual(converted_doc.doc_metadata.case_lexis_cite, CASE_LEXIS_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_full_cite')) self.assertEqual(converted_doc.doc_metadata.case_full_cite, CASE_FULL_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_dates')) self.assertEqual(converted_doc.doc_metadata.case_dates, CASE_DATES) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_disposition')) self.assertEqual(converted_doc.doc_metadata.case_disposition, CASE_DISPOSITION) def testNoMetadataInFile(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() " "with no Metadata in the input file...") # create a test file without any metadata fields in it create_test_file(VALID_OPINION_FILE_LINES[10:]) converted_doc = self.test_converter.convert_file() # here assert a bunch of things about the resulting converted_doc self.assertTrue(hasattr(converted_doc, 'output_filename')) self.assertEqual(converted_doc.output_filename, TEST_PICKLE_PATH) self.assertTrue(hasattr(converted_doc, 'doc_text')) self.assertEqual(converted_doc.doc_text, OPINION_TEXT) self.assertTrue(hasattr(converted_doc, 'doc_metadata')) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_title')) self.assertEqual(converted_doc.doc_metadata.case_title, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_author')) self.assertEqual(converted_doc.doc_metadata.opinion_author, OPINION_AUTHOR) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_type')) self.assertEqual(converted_doc.doc_metadata.opinion_type, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_num')) self.assertEqual(converted_doc.doc_metadata.case_num, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_us_cite')) self.assertEqual(converted_doc.doc_metadata.case_us_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_supreme_court_cite')) self.assertEqual(converted_doc.doc_metadata.case_supreme_court_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lawyers_ed_cite')) self.assertEqual(converted_doc.doc_metadata.case_lawyers_ed_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lexis_cite')) self.assertEqual(converted_doc.doc_metadata.case_lexis_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_full_cite')) self.assertEqual(converted_doc.doc_metadata.case_full_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_dates')) self.assertEqual(converted_doc.doc_metadata.case_dates, '') self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_disposition')) self.assertEqual(converted_doc.doc_metadata.case_disposition, "") #self.fail("DocumentConverterTest: I haven't written testNoMetadataInFile yet.") def testNoBodyTextInFile(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() " "with no body text in the input file...") # create a test file with valid metadata but without any body text in it create_test_file(VALID_OPINION_FILE_LINES[:11]) converted_doc = self.test_converter.convert_file() # here assert a bunch of things about the resulting converted_doc self.assertTrue(hasattr(converted_doc, 'output_filename')) self.assertEqual(converted_doc.output_filename, TEST_PICKLE_PATH) self.assertTrue(hasattr(converted_doc, 'doc_text')) self.assertEqual(converted_doc.doc_text, "") self.assertTrue(hasattr(converted_doc, 'doc_metadata')) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_title')) self.assertEqual(converted_doc.doc_metadata.case_title, CASE_TITLE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_author')) self.assertEqual(converted_doc.doc_metadata.opinion_author, OPINION_AUTHOR) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_type')) self.assertEqual(converted_doc.doc_metadata.opinion_type, OPINION_TYPE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_num')) self.assertEqual(converted_doc.doc_metadata.case_num, CASE_NUM) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_us_cite')) self.assertEqual(converted_doc.doc_metadata.case_us_cite, CASE_US_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_supreme_court_cite')) self.assertEqual(converted_doc.doc_metadata.case_supreme_court_cite, CASE_SUPREME_COURT_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lawyers_ed_cite')) self.assertEqual(converted_doc.doc_metadata.case_lawyers_ed_cite, CASE_LAWYERS_ED_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lexis_cite')) self.assertEqual(converted_doc.doc_metadata.case_lexis_cite, CASE_LEXIS_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_full_cite')) self.assertEqual(converted_doc.doc_metadata.case_full_cite, CASE_FULL_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_dates')) self.assertEqual(converted_doc.doc_metadata.case_dates, CASE_DATES) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_disposition')) self.assertEqual(converted_doc.doc_metadata.case_disposition, CASE_DISPOSITION) #self.fail("DocumentConverterTest: I haven't written testNoBodyTextInFile yet.") def testOutputFileNotWritable(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() " "and save_converted_doc() with an unwritable output file...") create_test_file(VALID_OPINION_FILE_LINES) converted_doc = self.test_converter.convert_file() # assert stuff about the created converted_doc self.assertTrue(hasattr(converted_doc, 'output_filename')) self.assertEqual(converted_doc.output_filename, TEST_PICKLE_PATH) self.assertTrue(hasattr(converted_doc, 'doc_text')) self.assertEqual(converted_doc.doc_text, OPINION_TEXT) self.assertTrue(hasattr(converted_doc, 'doc_metadata')) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_title')) self.assertEqual(converted_doc.doc_metadata.case_title, CASE_TITLE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_author')) self.assertEqual(converted_doc.doc_metadata.opinion_author, OPINION_AUTHOR) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_type')) self.assertEqual(converted_doc.doc_metadata.opinion_type, OPINION_TYPE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_num')) self.assertEqual(converted_doc.doc_metadata.case_num, CASE_NUM) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_us_cite')) self.assertEqual(converted_doc.doc_metadata.case_us_cite, CASE_US_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_supreme_court_cite')) self.assertEqual(converted_doc.doc_metadata.case_supreme_court_cite, CASE_SUPREME_COURT_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lawyers_ed_cite')) self.assertEqual(converted_doc.doc_metadata.case_lawyers_ed_cite, CASE_LAWYERS_ED_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lexis_cite')) self.assertEqual(converted_doc.doc_metadata.case_lexis_cite, CASE_LEXIS_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_full_cite')) self.assertEqual(converted_doc.doc_metadata.case_full_cite, CASE_FULL_CITE) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_dates')) self.assertEqual(converted_doc.doc_metadata.case_dates, CASE_DATES) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_disposition')) self.assertEqual(converted_doc.doc_metadata.case_disposition, CASE_DISPOSITION) # I need to change the permisssions of the pickle_path (chmod 0444) with open(converted_doc.output_filename, 'w') as dummy: pass os.chmod(converted_doc.output_filename, 0444) self.assertRaises(IOError, self.test_converter.save_converted_doc) #self.fail("DocumentConverterTest: I haven't written testOutputFileNotWritable yet.") def testInputFileNonexistent(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() " "with nonexistent input file...") # skip the create_test_file call and just try to convert. self.assertRaises(IOError, self.test_converter.convert_file) #self.fail("DocumentConverterTest: I haven't written testInputFileNonexistent yet.") def testEmptyInputFile(self): print("DocumentConverterTest: testing DocumentConverter.convert_file() " "with completely empty input file...") # create a test file with nothing in it create_test_file([]) converted_doc = self.test_converter.convert_file() # here assert a bunch of things about the resulting converted_doc self.assertTrue(hasattr(converted_doc, 'output_filename')) self.assertEqual(converted_doc.output_filename, TEST_PICKLE_PATH) self.assertTrue(hasattr(converted_doc, 'doc_text')) self.assertEqual(converted_doc.doc_text, "") self.assertTrue(hasattr(converted_doc, 'doc_metadata')) self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_title')) self.assertEqual(converted_doc.doc_metadata.case_title, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_author')) self.assertEqual(converted_doc.doc_metadata.opinion_author, OPINION_AUTHOR) self.assertTrue(hasattr(converted_doc.doc_metadata, 'opinion_type')) self.assertEqual(converted_doc.doc_metadata.opinion_type, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_num')) self.assertEqual(converted_doc.doc_metadata.case_num, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_us_cite')) self.assertEqual(converted_doc.doc_metadata.case_us_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_supreme_court_cite')) self.assertEqual(converted_doc.doc_metadata.case_supreme_court_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lawyers_ed_cite')) self.assertEqual(converted_doc.doc_metadata.case_lawyers_ed_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_lexis_cite')) self.assertEqual(converted_doc.doc_metadata.case_lexis_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_full_cite')) self.assertEqual(converted_doc.doc_metadata.case_full_cite, "") self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_dates')) self.assertEqual(converted_doc.doc_metadata.case_dates, '') self.assertTrue(hasattr(converted_doc.doc_metadata, 'case_disposition')) self.assertEqual(converted_doc.doc_metadata.case_disposition, "") #self.fail("DocumentConverterTest: I haven't written testEmptyInputFile yet.") if __name__ == "__main__": #import sys;sys.argv = ['', 'Test.testName'] unittest.main()
dmarklein/WordCloud
test/unit/python/DocumentConverterTest.py
Python
apache-2.0
18,681
from ..fields.chart_field import ChartField from ..fields.title_field import TitleField from ..fields.series_field import SeriesField from ..fields.series.series import Series from ..fields.plot_options_field import PlotOptionsField from ..fields.plot_options.pie_plot_options import PiePlotOptions from highchart import HighChart class PieChart(HighChart): def __init__(self, title, data_label, data): ''' :param title: e.g. 'Browser market shares at a specific website, 2014' :param data_label: e.g. 'Browser shares' :param data: e.g. [ ['Firefox', 45.0], ['IE', 26.8], ['Chrome', 12.8], ... ] ''' self.title_field = TitleField(text=title) self.series_field = SeriesField() self.series_field.add_serie(Series(data_label, data)) self.plot_options_field = PlotOptionsField() self.plot_options_field.add_plot_option(PiePlotOptions()) self.chart_field = ChartField() self.chart_field.set_type('pie') def to_javascript(self): jsc = "{" jsc += self.chart_field.to_javascript() + ", " jsc += self.title_field.to_javascript() + ", " jsc += self.plot_options_field.to_javascript() + ", " jsc += self.series_field.to_javascript() jsc += "}" return jsc
jpmfribeiro/PyCharts
pycharts/charts/pie_chart.py
Python
mit
1,329
from __future__ import division, print_function import numpy as np np.random.seed(1337) from copy import deepcopy from numpy import log, sqrt from numpy.random import choice from time import time from keras.models import load_model import keras import numba as nb from numba import jit from heuristic_agent import * size = 15 goal = 5 @jit(nopython=True, nogil=True) def possible_actions(state): actions = [] for row in range(size): for col in range(size): if not state[row, col]: actions.append((row, col)) return actions @jit(nopython=True, nogil=True) def check_row(state, row, col): if 4 <= col and\ state[row, col - 4] == state[row, col - 3] == state[row, col - 2] ==\ state[row, col - 1] == state[row, col]: return True if 3 <= col <= 13 and\ state[row, col - 3] == state[row, col - 2] == state[row, col - 1] ==\ state[row, col] == state[row, col + 1]: return True if 2 <= col <= 12 and\ state[row, col - 2] == state[row, col - 1] == state[row, col] ==\ state[row, col + 1] == state[row, col + 2]: return True if 1 <= col <= 11 and\ state[row, col - 1] == state[row, col] == state[row, col + 1] ==\ state[row, col + 2] == state[row, col + 3]: return True if col <= 10 and\ state[row, col] == state[row, col + 1] == state[row, col + 2] ==\ state[row, col + 3] == state[row, col + 4]: return True return False @jit(nopython=True, nogil=True) def check_col(state, row, col): if 4 <= row and\ state[row - 4, col] == state[row - 3, col] == state[row - 2, col] ==\ state[row - 1, col] == state[row, col]: return True if 3 <= row <= 13 and\ state[row - 3, col] == state[row - 2, col] == state[row - 1, col] ==\ state[row, col] == state[row + 1, col]: return True if 2 <= row <= 12 and\ state[row - 2, col] == state[row - 1, col] == state[row, col] ==\ state[row + 1, col] == state[row + 2, col]: return True if 1 <= row <= 11 and\ state[row - 1, col] == state[row, col] == state[row + 1, col] ==\ state[row + 2, col] == state[row + 3, col]: return True if row <= 10 and\ state[row, col] == state[row + 1, col] == state[row + 2, col] ==\ state[row + 3, col] == state[row + 4, col]: return True return False @jit(nopython=True, nogil=True) def check_diag(state, row, col): if 4 <= row and 4 <= col and\ state[row - 4, col - 4] == state[row - 3, col - 3] == state[row - 2, col - 2] ==\ state[row - 1, col - 1] == state[row, col]: return True if 3 <= row <= 13 and 3 <= col <= 13 and\ state[row - 3, col - 3] == state[row - 2, col - 2] == state[row - 1, col - 1] ==\ state[row, col] == state[row + 1, col + 1]: return True if 2 <= row <= 12 and 2 <= col <= 12 and\ state[row - 2, col - 2] == state[row - 1, col - 1] == state[row, col] ==\ state[row + 1, col + 1] == state[row + 2, col + 2]: return True if 1 <= row <= 11 and 1 <= col <= 11 and\ state[row - 1, col - 1] == state[row, col] == state[row + 1, col + 1] ==\ state[row + 2, col + 2] == state[row + 3, col + 3]: return True if row <= 10 and col <= 10 and\ state[row, col] == state[row + 1, col + 1] == state[row + 2, col + 2] ==\ state[row + 3, col + 3] == state[row + 4, col + 4]: return True return False @jit(nopython=True, nogil=True) def check_anti_diag(state, row, col): if 4 <= row and col <= 10 and\ state[row - 4, col + 4] == state[row - 3, col + 3] == state[row - 2, col + 2] ==\ state[row - 1, col + 1] == state[row, col]: return True if 3 <= row <= 13 and 1 <= col <= 11 and\ state[row - 3, col + 3] == state[row - 2, col + 2] == state[row - 1, col + 1] ==\ state[row, col] == state[row + 1, col - 1]: return True if 2 <= row <= 12 and 2 <= col <= 12 and\ state[row - 2, col + 2] == state[row - 1, col + 1] == state[row, col] ==\ state[row + 1, col - 1] == state[row + 2, col - 2]: return True if 1 <= row <= 11 and 3 <= col <= 13 and\ state[row - 1, col + 1] == state[row, col] == state[row + 1, col - 1] ==\ state[row + 2, col - 2] == state[row + 3, col - 3]: return True if row <= 10 and 4 <= col and\ state[row, col] == state[row + 1, col - 1] == state[row + 2, col - 2] ==\ state[row + 3, col - 3] == state[row + 4, col - 4]: return True return False @jit(nopython=True, nogil=True) def next_state(state, action, stone): state[action] = stone return state class Board(object): def __init__(self): self.state = np.zeros(shape=(size, size), dtype=np.int8) def win(self, state, action): row, col = action return check_row(state, row, col) or check_col(state, row, col) or\ check_diag(state, row, col) or check_anti_diag(state, row, col) def tie(self, state): return len(possible_actions(state)) == 0 class Q_Trainer(object): def __init__(self, board): self.board = board self.state = np.zeros(shape=(size, size), dtype=np.int8) self.turn = 0 def train(self, X_player, O_player, epoch): self.X_player = X_player self.O_player = O_player self.X_player.learning = self.O_player.learning = True for test in range(epoch, 0, -1): for p in range(len(self.X_player.params)): self.O_player.params[p] += test self.test_game() winner = self.test_game() if winner > 0: self.O_player.params = self.X_player.params[:] else: self.X_player.params = self.O_player.params[:] if self.O_player.params[p] > test: self.O_player.params[p] -= test self.test_game() winner = self.test_game() if winner > 0: self.O_player.params = self.X_player.params[:] else: self.X_player.params = self.O_player.params[:] self.X_player.learning = self.O_player.learning = False def test_game(self): self.state = np.zeros(shape=(size, size), dtype=np.int8) self.turn = 1 for i in range(size * size): actions = possible_actions(self.state) if self.turn > 0: action, danger = self.X_player.make_action(self.state) else: action, danger = self.O_player.make_action(self.state) self.state[action] = self.turn if self.board.win(self.state, action): return self.turn self.turn *= -1 return 0 def enhash(state): hash_state = state.copy() np.place(hash_state, hash_state < 0, [2]) hash_value = ''.join(''.join(str(elem) for elem in row) for row in hash_state) return hash_value class Node(object): def __init__(self, parent, p, C, action): self.parent = parent self.children = {} self.visits = 0 self.value = 0 self.C = C self.p = p self.visited = False self.ucb_count = 0 self.policy_count = 0 self.action = action def expand(self, actions_states_probs): for action, S, p in actions_states_probs: if S not in self.children: self.children[S] = Node(self, p, self.C, action) def is_root(self): return self.parent is None def is_leaf(self): return self.children == {} def all_visited(self): visited = 0 for S in self.children: if self.children[S].visited: visited += 1 return visited == len(self.children) def policy_choice(self): raw = [] states = [] for S in self.children: states.append(S) raw.append(self.children[S].p) self.policy_count += 1 probs = [float(p) / sum(raw) for p in raw] pred = np.random.choice(len(states), p=probs) S = states[pred] self.children[S].visited = True return S, self.children[S] def UCB_value(self, log_total): return (self.value / (self.visits or 1)) +\ self.C * sqrt(log_total / (self.visits or 1)) def UCB_choice(self): self.ucb_count += 1 log_total = log(sum(self.children[S].visits for S in self.children) or 1) return max(iter(self.children.items()), key=lambda x: x[1].UCB_value(log_total)) def LCB_value(self, log_total): return (self.value / (self.visits or 1)) -\ self.C * sqrt(log_total / (self.visits or 1)) def LCB_choice(self): log_total = log(sum(self.children[S].visits for S in self.children) or 1) return max(iter(self.children.items()), key=lambda x: x[1].LCB_value(log_total)) def update(self, reward): self.visits += 1 self.value += reward def update_path(self, reward): if not self.is_root(): self.parent.update_path(reward) self.update(reward) @jit(nopython=True, nogil=True) def prepare_tensor(state, stone): board = np.zeros(shape=(size, size), dtype=np.float32) X_stones = np.zeros(shape=(size, size), dtype=np.float32) O_stones = np.zeros(shape=(size, size), dtype=np.float32) empty = np.zeros(shape=(size, size), dtype=np.float32) code = np.zeros(shape=(1, size, size, 4), dtype=np.float32) for row in range(size): for col in range(size): if state[row, col] > 0: board[row, col] = 1 X_stones[row, col] = 1 elif state[row, col] < 0: board[row, col] = 1 O_stones[row, col] = 1 else: empty[row, col] = 1 code[:, :, :, 0] = board if stone > 0: code[:, :, :, 1] = X_stones code[:, :, :, 2] = O_stones else: code[:, :, :, 1] = O_stones code[:, :, :, 2] = X_stones code[:, :, :, 3] = empty return code def get_actions_states_probs(actions, probs, state, stone): actions_states_probs = [] for cell in range(size * size): action = (cell // size, cell % size) if action in actions and probs[cell] > 0.05: new_state = next_state(state, action, stone) S = enhash(new_state) actions_states_probs.append((action, S, probs[cell])) return actions_states_probs class MonteCarlo(object): def __init__(self, board, **kwargs): self.type = 'tree' self.board = board self.C = kwargs.get('C', 1.4) self.root = Node(None, 1.0, self.C, None) self.time_limit = kwargs.get('time_limit', 10) self.playout_model = load_model(kwargs.get('playout_model')) self.stone = kwargs.get('stone', 0) self.last_action = None def prepare_Q(self): print('Preparing Q for player', self.stone) X = Q_learning(1) O = Q_learning(-1) q_trainer = Q_Trainer(self.board) q_trainer.train(X, O, size) X.learning = False O.learning = False if self.stone > 0: self.Q = O else: self.Q = X self.X = X self.O = O print(X.params, O.params) print('Ready!') def policy(self, state, mode): code = prepare_tensor(state, self.stone) probs = self.playout_model.predict(code, verbose=0)[0] return probs def uproot(self): if self.last_S in self.root.children: self.root = self.root.children[self.last_S] self.root.parent = None else: self.root = Node(None, 1.0, self.C, None) def run_simulation(self, in_state): state = in_state.copy() node = self.root player = self.stone for k in range(goal): if player == self.stone: if node.is_leaf(): probs = self.policy(state, 'playout') actions_states_probs = get_actions_states_probs(possible_actions(state), probs, state, self.stone) node.expand(actions_states_probs) if node.all_visited(): S, next_node = node.UCB_choice() action = next_node.action else: S, next_node = node.policy_choice() action = next_node.action if player > 0: safe_action, danger = self.X.make_action(state) else: safe_action, danger = self.O.make_action(state) if player == -self.stone: action = safe_action elif danger: action = safe_action S = enhash(next_state(state, action, self.stone)) if S not in node.children: node.children[S] = Node(node, 1.0, self.C, action) next_node = node.children[S] state[action] = player if player == self.stone: node = next_node if self.board.win(state, action) or self.board.tie(state): break player = -player reward = self.rollout(state, action, player) if player == -self.stone: reward = -reward node.update_path(reward) def rollout(self, state, action, player): if self.board.win(state, action): return 1 if self.board.tie(state): return 0 vic = False while True: if player > 0: action, danger = self.X.make_action(state) else: action, danger = self.O.make_action(state) state[action] = player if self.board.win(state, action): vic = True break if self.board.tie(state): break player = -player if vic: if player == self.stone: return 1 else: return -1 return 0 def get_action(self, state): games = 0 begin = time() while time() - begin < self.time_limit: current_state = state.copy() self.run_simulation(current_state) games += 1 if self.stone > 0: safe_action, danger = self.X.make_action(state) else: safe_action, danger = self.O.make_action(state) if danger: action = safe_action else: S = self.root.LCB_choice()[0] action = self.root.children[S].action return action def make_action(self, state): action = self.get_action(state) row, col = action self.last_S = enhash(next_state(state, action, self.stone)) self.uproot() return action class Two_Trees(object): def __init__(self): board = Board() self.X_Tree = MonteCarlo(board, stone=1, C=1.4, playout_model='Neo-Heuristic.h5', time_limit=9.5 ) self.X_Tree.prepare_Q() self.O_Tree = MonteCarlo(board, stone=-1, C=1.4, playout_model='Neo-Heuristic.h5', time_limit=9.5 ) self.O_Tree.prepare_Q() def str_coords(self, action): row, col = action if col >= ord('i') - ord('a'): col += 1 S = chr(col + ord('a')) S += str(row + 1) return S def make_move(self, state, stone): if stone > 0: action = self.X_Tree.make_action(state) else: action = self.O_Tree.make_action(state) return self.str_coords(action)
EterniusVGM/Renju
renju/MCTS.py
Python
mit
16,077
# -*- coding: utf-8 -*- # Copyright 2022 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # Generated code. DO NOT EDIT! # # Snippet for CreateBackup # NOTE: This snippet has been automatically generated for illustrative purposes only. # It may require modifications to work in your environment. # To install the latest published package dependency, execute the following: # python3 -m pip install google-cloud-metastore # [START metastore_v1alpha_generated_DataprocMetastore_CreateBackup_sync] from google.cloud import metastore_v1alpha def sample_create_backup(): # Create a client client = metastore_v1alpha.DataprocMetastoreClient() # Initialize request argument(s) request = metastore_v1alpha.CreateBackupRequest( parent="parent_value", backup_id="backup_id_value", ) # Make the request operation = client.create_backup(request=request) print("Waiting for operation to complete...") response = operation.result() # Handle the response print(response) # [END metastore_v1alpha_generated_DataprocMetastore_CreateBackup_sync]
googleapis/python-dataproc-metastore
samples/generated_samples/metastore_v1alpha_generated_dataproc_metastore_create_backup_sync.py
Python
apache-2.0
1,611
from collections import namedtuple import sublime from sublime_plugin import WindowCommand from ..git_command import GitCommand from ...common import util MenuOption = namedtuple("MenuOption", ["requires_action", "menu_text", "filename", "is_untracked"]) CLEAN_WORKING_DIR = "Nothing to commit, working directory clean." ADD_ALL_UNSTAGED_FILES = " ? All unstaged files" ADD_ALL_FILES = " + All files" STAGED = "--- {} files are staged for commit. ---" COMMIT = " git: quick commit" AMEND = " git: amend from stage" FIXUP = " git: fixup from stage" class GsQuickStageCommand(WindowCommand, GitCommand): """ Display a quick panel of unstaged files in the current git repository, allowing the user to select one or more files for staging. Display filenames with one of the following indicators: * [M] modified * [A] added * [D] deleted * [R] renamed/moved * [C] copied * [U] updated but unmerged * [?] untracked """ def run(self): sublime.set_timeout_async(self.run_async) def run_async(self): menu_options = self.get_menu_options() menu_entries = [f.menu_text for f in menu_options] def on_selection(id): if id == -1: return selection = menu_options[id] if not selection.requires_action: return elif selection.menu_text == COMMIT: self.window.run_command("gs_quick_commit") return elif selection.menu_text == AMEND: self.window.run_command("gs_amend") return elif selection.menu_text == FIXUP: self.window.run_command("gs_fixup_from_stage") return elif selection.menu_text == ADD_ALL_UNSTAGED_FILES: self.git("add", "--update", ".") scope_of_action = "all unstaged files" elif selection.menu_text == ADD_ALL_FILES: self.git("add", "--all") scope_of_action = "all files" elif selection.is_untracked: self.git("add", "--", selection.filename) scope_of_action = "`{}`".format(selection.filename) else: self.git("add", "--update", "--", selection.filename) scope_of_action = "`{}`".format(selection.filename) self.window.status_message("Successfully added `{}`.".format( scope_of_action)) util.view.refresh_gitsavvy(self.window.active_view()) sublime.set_timeout_async(self.run_async, 0) self.window.show_quick_panel( menu_entries, on_selection, flags=sublime.MONOSPACE_FONT ) def get_menu_options(self): """ Determine the git status of the current working directory, and return a list of menu options for each file that is shown. """ status_entries = self.get_status() if not status_entries: return [MenuOption(False, CLEAN_WORKING_DIR, None, None)] menu_options = [] staged_count = 0 unstaged_count = 0 (staged_entries, unstaged_entries, untracked_entries, conflict_entries) = self.sort_status_entries(self.get_status()) staged_count = len(staged_entries) unstaged_count = len(unstaged_entries) # untracked_count = len(untracked_entries) # conflict_count = len(conflict_entries) for entry in unstaged_entries: filename = (entry.path if not entry.index_status == "R" else entry.path + " <- " + entry.path_alt) menu_text = "[{0}] {1}".format(entry.working_status, filename) menu_options.append(MenuOption(True, menu_text, filename, False)) for entry in untracked_entries: menu_text = "[{0}] {1}".format(entry.working_status, entry.path) menu_options.append(MenuOption(True, menu_text, entry.path, True)) for entry in conflict_entries: menu_text = "[{0}] {1}".format(entry.working_status, entry.path) menu_options.append(MenuOption(True, menu_text, entry.path, False)) if unstaged_count > 0: menu_options.append(MenuOption(True, ADD_ALL_UNSTAGED_FILES, None, None)) menu_options.append(MenuOption(True, ADD_ALL_FILES, None, None)) if staged_count > 0: menu_options.append(MenuOption(False, STAGED.format(staged_count), None, None)) menu_options.append(MenuOption(True, COMMIT, None, None)) menu_options.append(MenuOption(True, AMEND, None, None)) menu_options.append(MenuOption(True, FIXUP, None, None)) return menu_options
divmain/GitSavvy
core/commands/quick_stage.py
Python
mit
4,843
#!/usr/bin/python # -*- coding: utf-8 -*- import sys import configargparse import os import math import json import logging import random import time import socket import struct import zipfile import requests from uuid import uuid4 from s2sphere import CellId, LatLng from . import config log = logging.getLogger(__name__) def parse_unicode(bytestring): decoded_string = bytestring.decode(sys.getfilesystemencoding()) return decoded_string def memoize(function): memo = {} def wrapper(*args): if args in memo: return memo[args] else: rv = function(*args) memo[args] = rv return rv return wrapper @memoize def get_args(): # Pre-check to see if the -cf or --config flag is used on the command line. # If not, we'll use the env var or default value. This prevents layering of # config files as well as a missing config.ini. defaultconfigfiles = [] if '-cf' not in sys.argv and '--config' not in sys.argv: defaultconfigfiles = [os.getenv('POGOMAP_CONFIG', os.path.join( os.path.dirname(__file__), '../config/config.ini'))] parser = configargparse.ArgParser( default_config_files=defaultconfigfiles, auto_env_var_prefix='POGOMAP_') parser.add_argument('-cf', '--config', is_config_file=True, help='Set configuration file') parser.add_argument('-a', '--auth-service', type=str.lower, action='append', default=[], help=('Auth Services, either one for all accounts ' + 'or one per account: ptc or google. Defaults ' + 'all to ptc.')) parser.add_argument('-u', '--username', action='append', default=[], help='Usernames, one per account.') parser.add_argument('-p', '--password', action='append', default=[], help=('Passwords, either single one for all ' + 'accounts or one per account.')) parser.add_argument('-w', '--workers', type=int, help=('Number of search worker threads to start. ' + 'Defaults to the number of accounts specified.')) parser.add_argument('-asi', '--account-search-interval', type=int, default=0, help=('Seconds for accounts to search before ' + 'switching to a new account. 0 to disable.')) parser.add_argument('-ari', '--account-rest-interval', type=int, default=7200, help=('Seconds for accounts to rest when they fail ' + 'or are switched out.')) parser.add_argument('-ac', '--accountcsv', help=('Load accounts from CSV file containing ' + '"auth_service,username,passwd" lines.')) parser.add_argument('-hlvl', '--high-lvl-accounts', help=('Load high level accounts from CSV file ' + ' containing ' + '"auth_service,username,passwd"' + ' lines.')) parser.add_argument('-bh', '--beehive', help=('Use beehive configuration for multiple ' + 'accounts, one account per hex. Make sure ' + 'to keep -st under 5, and -w under the total ' + 'amount of accounts available.'), action='store_true', default=False) parser.add_argument('-wph', '--workers-per-hive', help=('Only referenced when using --beehive. Sets ' + 'number of workers per hive. Default value ' + 'is 1.'), type=int, default=1) parser.add_argument('-l', '--location', type=parse_unicode, help='Location, can be an address or coordinates.') # Default based on the average elevation of cities around the world. # Source: https://www.wikiwand.com/en/List_of_cities_by_elevation parser.add_argument('-alt', '--altitude', help='Default altitude in meters.', type=int, default=507) parser.add_argument('-altv', '--altitude-variance', help='Variance for --altitude in meters', type=int, default=1) parser.add_argument('-uac', '--use-altitude-cache', help=('Query the Elevation API for each step,' + ' rather than only once, and store results in' + ' the database.'), action='store_true', default=False) parser.add_argument('-nj', '--no-jitter', help=("Don't apply random -9m to +9m jitter to " + "location."), action='store_true', default=False) parser.add_argument('-al', '--access-logs', help=("Write web logs to access.log."), action='store_true', default=False) parser.add_argument('-st', '--step-limit', help='Steps.', type=int, default=12) parser.add_argument('-sd', '--scan-delay', help='Time delay between requests in scan threads.', type=float, default=10) parser.add_argument('--spawn-delay', help=('Number of seconds after spawn time to wait ' + 'before scanning to be sure the Pokemon ' + 'is there.'), type=float, default=10) parser.add_argument('-enc', '--encounter', help='Start an encounter to gather IVs and moves.', action='store_true', default=False) parser.add_argument('-cs', '--captcha-solving', help='Enables captcha solving.', action='store_true', default=False) parser.add_argument('-ck', '--captcha-key', help='2Captcha API key.') parser.add_argument('-cds', '--captcha-dsk', help='Pokemon Go captcha data-sitekey.', default="6LeeTScTAAAAADqvhqVMhPpr_vB9D364Ia-1dSgK") parser.add_argument('-mcd', '--manual-captcha-domain', help='Domain to where captcha tokens will be sent.', default="http://127.0.0.1:5000") parser.add_argument('-mcr', '--manual-captcha-refresh', help='Time available before captcha page refreshes.', type=int, default=30) parser.add_argument('-mct', '--manual-captcha-timeout', help='Maximum time captchas will wait for manual ' + 'captcha solving. On timeout, if enabled, 2Captcha ' + 'will be used to solve captcha. Default is 0.', type=int, default=0) parser.add_argument('-ed', '--encounter-delay', help=('Time delay between encounter pokemon ' + 'in scan threads.'), type=float, default=1) parser.add_argument('-encwf', '--enc-whitelist-file', default='', help='File containing a list of ' 'Pokemon IDs to encounter for' ' IV/CP scanning.') parser.add_argument('-nostore', '--no-api-store', help=("Don't store the API objects used by the high" + ' level accounts in memory. This will increase' + ' the number of logins per account, but ' + ' decreases memory usage.'), action='store_true', default=False) webhook_list = parser.add_mutually_exclusive_group() webhook_list.add_argument('-wwht', '--webhook-whitelist', action='append', default=[], help=('List of Pokemon to send to ' 'webhooks. Specified as Pokemon ID.')) webhook_list.add_argument('-wblk', '--webhook-blacklist', action='append', default=[], help=('List of Pokemon NOT to send to ' 'webhooks. Specified as Pokemon ID.')) webhook_list.add_argument('-wwhtf', '--webhook-whitelist-file', default='', help='File containing a list of ' 'Pokemon IDs to be sent to ' 'webhooks.') webhook_list.add_argument('-wblkf', '--webhook-blacklist-file', default='', help='File containing a list of ' 'Pokemon IDs NOT to be sent to' 'webhooks.') parser.add_argument('-ld', '--login-delay', help='Time delay between each login attempt.', type=float, default=6) parser.add_argument('-lr', '--login-retries', help=('Number of times to retry the login before ' + 'refreshing a thread.'), type=int, default=3) parser.add_argument('-mf', '--max-failures', help=('Maximum number of failures to parse ' + 'locations before an account will go into a ' + 'sleep for -ari/--account-rest-interval ' + 'seconds.'), type=int, default=5) parser.add_argument('-me', '--max-empty', help=('Maximum number of empty scans before an ' + 'account will go into a sleep for ' + '-ari/--account-rest-interval seconds.' + 'Reasonable to use with proxies.'), type=int, default=0) parser.add_argument('-bsr', '--bad-scan-retry', help=('Number of bad scans before giving up on a ' + 'step. Default 2, 0 to disable.'), type=int, default=2) parser.add_argument('-msl', '--min-seconds-left', help=('Time that must be left on a spawn before ' + 'considering it too late and skipping it. ' + 'For example 600 would skip anything with ' + '< 10 minutes remaining. Default 0.'), type=int, default=0) parser.add_argument('-dc', '--display-in-console', help='Display Found Pokemon in Console.', action='store_true', default=False) parser.add_argument('-H', '--host', help='Set web server listening host.', default='127.0.0.1') parser.add_argument('-P', '--port', type=int, help='Set web server listening port.', default=5000) parser.add_argument('-L', '--locale', help=('Locale for Pokemon names (default: {}, check ' + '{} for more).').format(config['LOCALE'], config['LOCALES_DIR']), default='en') parser.add_argument('-c', '--china', help='Coordinates transformer for China.', action='store_true') parser.add_argument('-m', '--mock', type=str, help=('Mock mode - point to a fpgo endpoint instead ' + 'of using the real PogoApi, ec: ' + 'http://127.0.0.1:9090'), default='') parser.add_argument('-ns', '--no-server', help=('No-Server Mode. Starts the searcher but not ' + 'the Webserver.'), action='store_true', default=False) parser.add_argument('-os', '--only-server', help=('Server-Only Mode. Starts only the Webserver ' + 'without the searcher.'), action='store_true', default=False) parser.add_argument('-sc', '--search-control', help='Enables search control.', action='store_true', dest='search_control', default=False) parser.add_argument('-nfl', '--no-fixed-location', help='Disables a fixed map location and shows the ' + 'search bar for use in shared maps.', action='store_false', dest='fixed_location', default=True) parser.add_argument('-k', '--gmaps-key', help='Google Maps Javascript API Key.', required=True) parser.add_argument('--skip-empty', help=('Enables skipping of empty cells in normal ' + 'scans - requires previously populated ' + 'database (not to be used with -ss)'), action='store_true', default=False) parser.add_argument('-C', '--cors', help='Enable CORS on web server.', action='store_true', default=False) parser.add_argument('-D', '--db', help='Database filename for SQLite.', default='pogom.db') parser.add_argument('-cd', '--clear-db', help=('Deletes the existing database before ' + 'starting the Webserver.'), action='store_true', default=False) parser.add_argument('-np', '--no-pokemon', help=('Disables Pokemon from the map (including ' + 'parsing them into local db.)'), action='store_true', default=False) parser.add_argument('-ng', '--no-gyms', help=('Disables Gyms from the map (including ' + 'parsing them into local db).'), action='store_true', default=False) parser.add_argument('-nk', '--no-pokestops', help=('Disables PokeStops from the map (including ' + 'parsing them into local db).'), action='store_true', default=False) parser.add_argument('-ss', '--spawnpoint-scanning', help=('Use spawnpoint scanning (instead of hex ' + 'grid). Scans in a circle based on step_limit ' + 'when on DB.'), nargs='?', const='nofile', default=False) parser.add_argument('-speed', '--speed-scan', help=('Use speed scanning to identify spawn points ' + 'and then scan closest spawns.'), action='store_true', default=False) parser.add_argument('-kph', '--kph', help=('Set a maximum speed in km/hour for scanner ' + 'movement.'), type=int, default=35) parser.add_argument('-hkph', '--hlvl-kph', help=('Set a maximum speed in km/hour for scanner ' + 'movement, for high-level (L30) accounts.'), type=int, default=25) parser.add_argument('-ldur', '--lure-duration', help=('Change duration for lures set on pokestops. ' + 'This is useful for events that extend lure ' + 'duration.'), type=int, default=30) parser.add_argument('--dump-spawnpoints', help=('Dump the spawnpoints from the db to json ' + '(only for use with -ss).'), action='store_true', default=False) parser.add_argument('-pd', '--purge-data', help=('Clear Pokemon from database this many hours ' + 'after they disappear (0 to disable).'), type=int, default=0) parser.add_argument('-px', '--proxy', help='Proxy url (e.g. socks5://127.0.0.1:9050)', action='append') parser.add_argument('-pxsc', '--proxy-skip-check', help='Disable checking of proxies before start.', action='store_true', default=False) parser.add_argument('-pxt', '--proxy-timeout', help='Timeout settings for proxy checker in seconds.', type=int, default=5) parser.add_argument('-pxd', '--proxy-display', help=('Display info on which proxy being used ' + '(index or full). To be used with -ps.'), type=str, default='index') parser.add_argument('-pxf', '--proxy-file', help=('Load proxy list from text file (one proxy ' + 'per line), overrides -px/--proxy.')) parser.add_argument('-pxr', '--proxy-refresh', help=('Period of proxy file reloading, in seconds. ' + 'Works only with -pxf/--proxy-file. ' + '(0 to disable).'), type=int, default=0) parser.add_argument('-pxo', '--proxy-rotation', help=('Enable proxy rotation with account changing ' + 'for search threads (none/round/random).'), type=str, default='none') parser.add_argument('--db-type', help='Type of database to be used (default: sqlite).', default='sqlite') parser.add_argument('--db-name', help='Name of the database to be used.') parser.add_argument('--db-user', help='Username for the database.') parser.add_argument('--db-pass', help='Password for the database.') parser.add_argument('--db-host', help='IP or hostname for the database.') parser.add_argument( '--db-port', help='Port for the database.', type=int, default=3306) parser.add_argument('--db-max_connections', help='Max connections (per thread) for the database.', type=int, default=5) parser.add_argument('--db-threads', help=('Number of db threads; increase if the db ' + 'queue falls behind.'), type=int, default=1) parser.add_argument('-wh', '--webhook', help='Define URL(s) to POST webhook information to.', default=None, dest='webhooks', action='append') parser.add_argument('-gi', '--gym-info', help=('Get all details about gyms (causes an ' + 'additional API hit for every gym).'), action='store_true', default=False) parser.add_argument('--disable-clean', help='Disable clean db loop.', action='store_true', default=False) parser.add_argument('--webhook-updates-only', help='Only send updates (Pokemon & lured pokestops).', action='store_true', default=False) parser.add_argument('--wh-threads', help=('Number of webhook threads; increase if the ' + 'webhook queue falls behind.'), type=int, default=1) parser.add_argument('-whc', '--wh-concurrency', help=('Async requests pool size.'), type=int, default=25) parser.add_argument('-whr', '--wh-retries', help=('Number of times to retry sending webhook ' + 'data on failure.'), type=int, default=3) parser.add_argument('-wht', '--wh-timeout', help='Timeout (in seconds) for webhook requests.', type=float, default=1.0) parser.add_argument('-whbf', '--wh-backoff-factor', help=('Factor (in seconds) by which the delay ' + 'until next retry will increase.'), type=float, default=0.25) parser.add_argument('-whlfu', '--wh-lfu-size', help='Webhook LFU cache max size.', type=int, default=2500) parser.add_argument('-whsu', '--webhook-scheduler-updates', help=('Send webhook updates with scheduler status ' + '(use with -wh).'), action='store_true', default=True) parser.add_argument('--ssl-certificate', help='Path to SSL certificate file.') parser.add_argument('--ssl-privatekey', help='Path to SSL private key file.') parser.add_argument('-ps', '--print-status', help=('Show a status screen instead of log ' + 'messages. Can switch between status and ' + 'logs by pressing enter. Optionally specify ' + '"logs" to startup in logging mode.'), nargs='?', const='status', default=False, metavar='logs') parser.add_argument('-slt', '--stats-log-timer', help='In log view, list per hr stats every X seconds', type=int, default=0) parser.add_argument('-sn', '--status-name', default=None, help=('Enable status page database update using ' + 'STATUS_NAME as main worker name.')) parser.add_argument('-spp', '--status-page-password', default=None, help='Set the status page password.') parser.add_argument('-hk', '--hash-key', default=None, action='append', help='Key for hash server') parser.add_argument('-tut', '--complete-tutorial', action='store_true', help=("Complete ToS and tutorial steps on accounts " + "if they haven't already."), default=False) parser.add_argument('-novc', '--no-version-check', action='store_true', help='Disable API version check.', default=False) parser.add_argument('-vci', '--version-check-interval', type=int, help='Interval to check API version in seconds ' + '(Default: in [60, 300]).', default=random.randint(60, 300)) parser.add_argument('-el', '--encrypt-lib', help=('Path to encrypt lib to be used instead of ' + 'the shipped ones.')) parser.add_argument('-odt', '--on-demand_timeout', help=('Pause searching while web UI is inactive ' + 'for this timeout (in seconds).'), type=int, default=0) parser.add_argument('--disable-blacklist', help=('Disable the global anti-scraper IP blacklist.'), action='store_true', default=False) parser.add_argument('-tp', '--trusted-proxies', default=[], action='append', help=('Enables the use of X-FORWARDED-FOR headers ' + 'to identify the IP of clients connecting ' + 'through these trusted proxies.')) verbosity = parser.add_mutually_exclusive_group() verbosity.add_argument('-v', '--verbose', help=('Show debug messages from RocketMap ' + 'and pgoapi. Optionally specify file ' + 'to log to.'), nargs='?', const='nofile', default=False, metavar='filename.log') verbosity.add_argument('-vv', '--very-verbose', help=('Like verbose, but show debug messages ' + 'from all modules as well. Optionally ' + 'specify file to log to.'), nargs='?', const='nofile', default=False, metavar='filename.log') parser.set_defaults(DEBUG=False) args = parser.parse_args() if args.only_server: if args.location is None: parser.print_usage() print(sys.argv[0] + ": error: arguments -l/--location is required.") sys.exit(1) else: # If using a CSV file, add the data where needed into the username, # password and auth_service arguments. # CSV file should have lines like "ptc,username,password", # "username,password" or "username". if args.accountcsv is not None: # Giving num_fields something it would usually not get. num_fields = -1 with open(args.accountcsv, 'r') as f: for num, line in enumerate(f, 1): fields = [] # First time around populate num_fields with current field # count. if num_fields < 0: num_fields = line.count(',') + 1 csv_input = [] csv_input.append('') csv_input.append('<username>') csv_input.append('<username>,<password>') csv_input.append('<ptc/google>,<username>,<password>') # If the number of fields is differend this is not a CSV. if num_fields != line.count(',') + 1: print(sys.argv[0] + ": Error parsing CSV file on line " + str(num) + ". Your file started with the following " + "input, '" + csv_input[num_fields] + "' but now you gave us '" + csv_input[line.count(',') + 1] + "'.") sys.exit(1) field_error = '' line = line.strip() # Ignore blank lines and comment lines. if len(line) == 0 or line.startswith('#'): continue # If number of fields is more than 1 split the line into # fields and strip them. if num_fields > 1: fields = line.split(",") fields = map(str.strip, fields) # If the number of fields is one then assume this is # "username". As requested. if num_fields == 1: # Empty lines are already ignored. args.username.append(line) # If the number of fields is two then assume this is # "username,password". As requested. if num_fields == 2: # If field length is not longer than 0 something is # wrong! if len(fields[0]) > 0: args.username.append(fields[0]) else: field_error = 'username' # If field length is not longer than 0 something is # wrong! if len(fields[1]) > 0: args.password.append(fields[1]) else: field_error = 'password' # If the number of fields is three then assume this is # "ptc,username,password". As requested. if num_fields == 3: # If field 0 is not ptc or google something is wrong! if (fields[0].lower() == 'ptc' or fields[0].lower() == 'google'): args.auth_service.append(fields[0]) else: field_error = 'method' # If field length is not longer then 0 something is # wrong! if len(fields[1]) > 0: args.username.append(fields[1]) else: field_error = 'username' # If field length is not longer then 0 something is # wrong! if len(fields[2]) > 0: args.password.append(fields[2]) else: field_error = 'password' if num_fields > 3: print(('Too many fields in accounts file: max ' + 'supported are 3 fields. ' + 'Found {} fields').format(num_fields)) sys.exit(1) # If something is wrong display error. if field_error != '': type_error = 'empty!' if field_error == 'method': type_error = ( 'not ptc or google instead we got \'' + fields[0] + '\'!') print(sys.argv[0] + ": Error parsing CSV file on line " + str(num) + ". We found " + str(num_fields) + " fields, " + "so your input should have looked like '" + csv_input[num_fields] + "'\nBut you gave us '" + line + "', your " + field_error + " was " + type_error) sys.exit(1) errors = [] num_auths = len(args.auth_service) num_usernames = 0 num_passwords = 0 if len(args.username) == 0: errors.append( 'Missing `username` either as -u/--username, csv file ' + 'using -ac, or in config.') else: num_usernames = len(args.username) if args.location is None: errors.append( 'Missing `location` either as -l/--location or in config.') if len(args.password) == 0: errors.append( 'Missing `password` either as -p/--password, csv file, ' + 'or in config.') else: num_passwords = len(args.password) if args.step_limit is None: errors.append( 'Missing `step_limit` either as -st/--step-limit or ' + 'in config.') if num_auths == 0: args.auth_service = ['ptc'] num_auths = len(args.auth_service) if num_usernames > 1: if num_passwords > 1 and num_usernames != num_passwords: errors.append(( 'The number of provided passwords ({}) must match the ' + 'username count ({})').format(num_passwords, num_usernames)) if num_auths > 1 and num_usernames != num_auths: errors.append(( 'The number of provided auth ({}) must match the ' + 'username count ({}).').format(num_auths, num_usernames)) if len(errors) > 0: parser.print_usage() print(sys.argv[0] + ": errors: \n - " + "\n - ".join(errors)) sys.exit(1) # Fill the pass/auth if set to a single value. if num_passwords == 1: args.password = [args.password[0]] * num_usernames if num_auths == 1: args.auth_service = [args.auth_service[0]] * num_usernames # Make the accounts list. args.accounts = [] for i, username in enumerate(args.username): args.accounts.append({'username': username, 'password': args.password[i], 'auth_service': args.auth_service[i]}) # Prepare the L30 accounts for the account sets. args.accounts_L30 = [] if args.high_lvl_accounts: # Context processor. with open(args.high_lvl_accounts, 'r') as accs: for line in accs: # Make sure it's not an empty line. if not line.strip(): continue line = line.split(',') # We need "service, user, pass". if len(line) < 3: raise Exception('L30 account is missing a' + ' field. Each line requires: ' + '"service,user,pass".') # Let's remove trailing whitespace. service = line[0].strip() username = line[1].strip() password = line[2].strip() hlvl_account = { 'auth_service': service, 'username': username, 'password': password, 'captcha': False } args.accounts_L30.append(hlvl_account) # Prepare the IV/CP scanning filters. args.enc_whitelist = [] # IV/CP scanning. if args.enc_whitelist_file: with open(args.enc_whitelist_file) as f: args.enc_whitelist = frozenset([int(l.strip()) for l in f]) # Make max workers equal number of accounts if unspecified, and disable # account switching. if args.workers is None: args.workers = len(args.accounts) args.account_search_interval = None # Disable search interval if 0 specified. if args.account_search_interval == 0: args.account_search_interval = None # Make sure we don't have an empty account list after adding command # line and CSV accounts. if len(args.accounts) == 0: print(sys.argv[0] + ": Error: no accounts specified. Use -a, -u, and -p or " + "--accountcsv to add accounts.") sys.exit(1) if args.webhook_whitelist_file: with open(args.webhook_whitelist_file) as f: args.webhook_whitelist = frozenset( [int(p_id.strip()) for p_id in f]) elif args.webhook_blacklist_file: with open(args.webhook_blacklist_file) as f: args.webhook_blacklist = frozenset( [int(p_id.strip()) for p_id in f]) else: args.webhook_blacklist = frozenset( [int(i) for i in args.webhook_blacklist]) args.webhook_whitelist = frozenset( [int(i) for i in args.webhook_whitelist]) # Decide which scanning mode to use. if args.spawnpoint_scanning: args.scheduler = 'SpawnScan' elif args.skip_empty: args.scheduler = 'HexSearchSpawnpoint' elif args.speed_scan: args.scheduler = 'SpeedScan' else: args.scheduler = 'HexSearch' # Disable webhook scheduler updates if webhooks are disabled if args.webhooks is None: args.webhook_scheduler_updates = False return args def now(): # The fact that you need this helper... return int(time.time()) # Gets the seconds past the hour. def cur_sec(): return (60 * time.gmtime().tm_min) + time.gmtime().tm_sec # Gets the total seconds past the hour for a given date. def date_secs(d): return d.minute * 60 + d.second # Checks to see if test is between start and end accounting for hour # wraparound. def clock_between(start, test, end): return ((start <= test <= end and start < end) or (not (end <= test <= start) and start > end)) # Return the s2sphere cellid token from a location. def cellid(loc): return CellId.from_lat_lng(LatLng.from_degrees(loc[0], loc[1])).to_token() # Return equirectangular approximation distance in km. def equi_rect_distance(loc1, loc2): R = 6371 # Radius of the earth in km. lat1 = math.radians(loc1[0]) lat2 = math.radians(loc2[0]) x = (math.radians(loc2[1]) - math.radians(loc1[1]) ) * math.cos(0.5 * (lat2 + lat1)) y = lat2 - lat1 return R * math.sqrt(x * x + y * y) # Return True if distance between two locs is less than distance in km. def in_radius(loc1, loc2, distance): return equi_rect_distance(loc1, loc2) < distance def i8ln(word): if config['LOCALE'] == "en": return word if not hasattr(i8ln, 'dictionary'): file_path = os.path.join( config['ROOT_PATH'], config['LOCALES_DIR'], '{}.min.json'.format(config['LOCALE'])) if os.path.isfile(file_path): with open(file_path, 'r') as f: i8ln.dictionary = json.loads(f.read()) else: log.warning( 'Skipping translations - unable to find locale file: %s', file_path) return word if word in i8ln.dictionary: return i8ln.dictionary[word] else: log.debug('Unable to find translation for "%s" in locale %s!', word, config['LOCALE']) return word def get_pokemon_data(pokemon_id): if not hasattr(get_pokemon_data, 'pokemon'): file_path = os.path.join( config['ROOT_PATH'], config['DATA_DIR'], 'pokemon.min.json') with open(file_path, 'r') as f: get_pokemon_data.pokemon = json.loads(f.read()) return get_pokemon_data.pokemon[str(pokemon_id)] def get_pokemon_id(pokemon_name): if not hasattr(get_pokemon_id, 'ids'): if not hasattr(get_pokemon_data, 'pokemon'): # initialize from file get_pokemon_data(1) get_pokemon_id.ids = {} for pokemon_id, data in get_pokemon_data.pokemon.iteritems(): get_pokemon_id.ids[data['name']] = int(pokemon_id) return get_pokemon_id.ids.get(pokemon_name, -1) def get_pokemon_name(pokemon_id): return i8ln(get_pokemon_data(pokemon_id)['name']) def get_pokemon_rarity(pokemon_id): return i8ln(get_pokemon_data(pokemon_id)['rarity']) def get_pokemon_types(pokemon_id): pokemon_types = get_pokemon_data(pokemon_id)['types'] return map(lambda x: {"type": i8ln(x['type']), "color": x['color']}, pokemon_types) def get_moves_data(move_id): if not hasattr(get_moves_data, 'moves'): file_path = os.path.join( config['ROOT_PATH'], config['DATA_DIR'], 'moves.min.json') with open(file_path, 'r') as f: get_moves_data.moves = json.loads(f.read()) return get_moves_data.moves[str(move_id)] def get_move_name(move_id): return i8ln(get_moves_data(move_id)['name']) def get_move_damage(move_id): return i8ln(get_moves_data(move_id)['damage']) def get_move_energy(move_id): return i8ln(get_moves_data(move_id)['energy']) def get_move_type(move_id): move_type = get_moves_data(move_id)['type'] return {"type": i8ln(move_type), "type_en": move_type} def dottedQuadToNum(ip): return struct.unpack("!L", socket.inet_aton(ip))[0] def get_blacklist(): try: url = 'https://blist.devkat.org/blacklist.json' blacklist = requests.get(url, timeout=5).json() log.debug('Entries in blacklist: %s.', len(blacklist)) return blacklist except (requests.exceptions.RequestException, IndexError, KeyError): log.error('Unable to retrieve blacklist, setting to empty.') return [] # Generate random device info. # Original by Noctem. IPHONES = {'iPhone5,1': 'N41AP', 'iPhone5,2': 'N42AP', 'iPhone5,3': 'N48AP', 'iPhone5,4': 'N49AP', 'iPhone6,1': 'N51AP', 'iPhone6,2': 'N53AP', 'iPhone7,1': 'N56AP', 'iPhone7,2': 'N61AP', 'iPhone8,1': 'N71AP', 'iPhone8,2': 'N66AP', 'iPhone8,4': 'N69AP', 'iPhone9,1': 'D10AP', 'iPhone9,2': 'D11AP', 'iPhone9,3': 'D101AP', 'iPhone9,4': 'D111AP'} def generate_device_info(): device_info = {'device_brand': 'Apple', 'device_model': 'iPhone', 'hardware_manufacturer': 'Apple', 'firmware_brand': 'iPhone OS'} devices = tuple(IPHONES.keys()) ios8 = ('8.0', '8.0.1', '8.0.2', '8.1', '8.1.1', '8.1.2', '8.1.3', '8.2', '8.3', '8.4', '8.4.1') ios9 = ('9.0', '9.0.1', '9.0.2', '9.1', '9.2', '9.2.1', '9.3', '9.3.1', '9.3.2', '9.3.3', '9.3.4', '9.3.5') ios10 = ('10.0', '10.0.1', '10.0.2', '10.0.3', '10.1', '10.1.1') device_info['device_model_boot'] = random.choice(devices) device_info['hardware_model'] = IPHONES[device_info['device_model_boot']] device_info['device_id'] = uuid4().hex if device_info['hardware_model'] in ('iPhone9,1', 'iPhone9,2', 'iPhone9,3', 'iPhone9,4'): device_info['firmware_type'] = random.choice(ios10) elif device_info['hardware_model'] in ('iPhone8,1', 'iPhone8,2', 'iPhone8,4'): device_info['firmware_type'] = random.choice(ios9 + ios10) else: device_info['firmware_type'] = random.choice(ios8 + ios9 + ios10) return device_info def extract_sprites(root_path): zip_path = os.path.join( root_path, 'static01.zip') extract_path = os.path.join( root_path, 'static') log.debug('Extracting sprites from "%s" to "%s"', zip_path, extract_path) zip = zipfile.ZipFile(zip_path, 'r') zip.extractall(extract_path) zip.close() def clear_dict_response(response, keep_inventory=False): if 'platform_returns' in response: del response['platform_returns'] if 'responses' not in response: return response if 'GET_INVENTORY' in response['responses'] and not keep_inventory: del response['responses']['GET_INVENTORY'] if 'GET_HATCHED_EGGS' in response['responses']: del response['responses']['GET_HATCHED_EGGS'] if 'CHECK_AWARDED_BADGES' in response['responses']: del response['responses']['CHECK_AWARDED_BADGES'] if 'DOWNLOAD_SETTINGS' in response['responses']: del response['responses']['DOWNLOAD_SETTINGS'] if 'GET_BUDDY_WALKED' in response['responses']: del response['responses']['GET_BUDDY_WALKED'] return response def calc_pokemon_level(cp_multiplier): if cp_multiplier < 0.734: pokemon_level = (58.35178527 * cp_multiplier * cp_multiplier - 2.838007664 * cp_multiplier + 0.8539209906) else: pokemon_level = 171.0112688 * cp_multiplier - 95.20425243 pokemon_level = int((round(pokemon_level) * 2) / 2) return pokemon_level
pgandev/RocketMap
pogom/utils.py
Python
agpl-3.0
43,916
"""Define patches used for androidtv tests.""" from unittest.mock import mock_open, patch KEY_PYTHON = "python" KEY_SERVER = "server" ADB_DEVICE_TCP_ASYNC_FAKE = "AdbDeviceTcpAsyncFake" DEVICE_ASYNC_FAKE = "DeviceAsyncFake" class AdbDeviceTcpAsyncFake: """A fake of the `adb_shell.adb_device_async.AdbDeviceTcpAsync` class.""" def __init__(self, *args, **kwargs): """Initialize a fake `adb_shell.adb_device_async.AdbDeviceTcpAsync` instance.""" self.available = False async def close(self): """Close the socket connection.""" self.available = False async def connect(self, *args, **kwargs): """Try to connect to a device.""" raise NotImplementedError async def shell(self, cmd, *args, **kwargs): """Send an ADB shell command.""" return None class ClientAsyncFakeSuccess: """A fake of the `ClientAsync` class when the connection and shell commands succeed.""" def __init__(self, host="127.0.0.1", port=5037): """Initialize a `ClientAsyncFakeSuccess` instance.""" self._devices = [] async def device(self, serial): """Mock the `ClientAsync.device` method when the device is connected via ADB.""" device = DeviceAsyncFake(serial) self._devices.append(device) return device class ClientAsyncFakeFail: """A fake of the `ClientAsync` class when the connection and shell commands fail.""" def __init__(self, host="127.0.0.1", port=5037): """Initialize a `ClientAsyncFakeFail` instance.""" self._devices = [] async def device(self, serial): """Mock the `ClientAsync.device` method when the device is not connected via ADB.""" self._devices = [] return None class DeviceAsyncFake: """A fake of the `DeviceAsync` class.""" def __init__(self, host): """Initialize a `DeviceAsyncFake` instance.""" self.host = host async def shell(self, cmd): """Send an ADB shell command.""" raise NotImplementedError def patch_connect(success): """Mock the `adb_shell.adb_device_async.AdbDeviceTcpAsync` and `ClientAsync` classes.""" async def connect_success_python(self, *args, **kwargs): """Mock the `AdbDeviceTcpAsyncFake.connect` method when it succeeds.""" self.available = True async def connect_fail_python(self, *args, **kwargs): """Mock the `AdbDeviceTcpAsyncFake.connect` method when it fails.""" raise OSError if success: return { KEY_PYTHON: patch( f"{__name__}.{ADB_DEVICE_TCP_ASYNC_FAKE}.connect", connect_success_python, ), KEY_SERVER: patch( "androidtv.adb_manager.adb_manager_async.ClientAsync", ClientAsyncFakeSuccess, ), } return { KEY_PYTHON: patch( f"{__name__}.{ADB_DEVICE_TCP_ASYNC_FAKE}.connect", connect_fail_python ), KEY_SERVER: patch( "androidtv.adb_manager.adb_manager_async.ClientAsync", ClientAsyncFakeFail ), } def patch_shell(response=None, error=False): """Mock the `AdbDeviceTcpAsyncFake.shell` and `DeviceAsyncFake.shell` methods.""" async def shell_success(self, cmd, *args, **kwargs): """Mock the `AdbDeviceTcpAsyncFake.shell` and `DeviceAsyncFake.shell` methods when they are successful.""" self.shell_cmd = cmd return response async def shell_fail_python(self, cmd, *args, **kwargs): """Mock the `AdbDeviceTcpAsyncFake.shell` method when it fails.""" self.shell_cmd = cmd raise ValueError async def shell_fail_server(self, cmd): """Mock the `DeviceAsyncFake.shell` method when it fails.""" self.shell_cmd = cmd raise ConnectionResetError if not error: return { KEY_PYTHON: patch( f"{__name__}.{ADB_DEVICE_TCP_ASYNC_FAKE}.shell", shell_success ), KEY_SERVER: patch(f"{__name__}.{DEVICE_ASYNC_FAKE}.shell", shell_success), } return { KEY_PYTHON: patch( f"{__name__}.{ADB_DEVICE_TCP_ASYNC_FAKE}.shell", shell_fail_python ), KEY_SERVER: patch(f"{__name__}.{DEVICE_ASYNC_FAKE}.shell", shell_fail_server), } PATCH_ADB_DEVICE_TCP = patch( "androidtv.adb_manager.adb_manager_async.AdbDeviceTcpAsync", AdbDeviceTcpAsyncFake ) PATCH_ANDROIDTV_OPEN = patch( "homeassistant.components.androidtv.media_player.open", mock_open() ) PATCH_KEYGEN = patch("homeassistant.components.androidtv.media_player.keygen") PATCH_SIGNER = patch( "homeassistant.components.androidtv.media_player.ADBPythonSync.load_adbkey", return_value="signer for testing", ) def isfile(filepath): """Mock `os.path.isfile`.""" return filepath.endswith("adbkey") PATCH_ISFILE = patch("os.path.isfile", isfile) PATCH_ACCESS = patch("os.access", return_value=True) def patch_firetv_update(state, current_app, running_apps, hdmi_input): """Patch the `FireTV.update()` method.""" return patch( "androidtv.firetv.firetv_async.FireTVAsync.update", return_value=(state, current_app, running_apps, hdmi_input), ) def patch_androidtv_update( state, current_app, running_apps, device, is_volume_muted, volume_level, hdmi_input ): """Patch the `AndroidTV.update()` method.""" return patch( "androidtv.androidtv.androidtv_async.AndroidTVAsync.update", return_value=( state, current_app, running_apps, device, is_volume_muted, volume_level, hdmi_input, ), ) PATCH_LAUNCH_APP = patch("androidtv.basetv.basetv_async.BaseTVAsync.launch_app") PATCH_STOP_APP = patch("androidtv.basetv.basetv_async.BaseTVAsync.stop_app") # Cause the update to raise an unexpected type of exception PATCH_ANDROIDTV_UPDATE_EXCEPTION = patch( "androidtv.androidtv.androidtv_async.AndroidTVAsync.update", side_effect=ZeroDivisionError, )
jawilson/home-assistant
tests/components/androidtv/patchers.py
Python
apache-2.0
6,081
#!/usr/bin/env python from distutils.core import setup import fedex LONG_DESCRIPTION = open('README.rst').read() CLASSIFIERS = [ 'Development Status :: 5 - Production/Stable', 'Intended Audience :: Developers', 'License :: OSI Approved :: BSD License', 'Natural Language :: English', 'Operating System :: OS Independent', 'Programming Language :: Python', 'Topic :: Software Development :: Libraries :: Python Modules' ] KEYWORDS = 'fedex soap suds wrapper' setup(name='fedex', version=fedex.VERSION, description='Fedex Web Services API wrapper.', long_description=LONG_DESCRIPTION, author='Gregory Taylor', author_email='[email protected]', url='https://github.com/gtaylor/python-fedex', download_url='http://pypi.python.org/pypi/fedex/', packages=['fedex', 'fedex.services', 'fedex.printers'], package_dir={'fedex': 'fedex'}, package_data={'fedex': ['wsdl/*.wsdl', 'wsdl/test_server_wsdl/*.wsdl']}, platforms=['Platform Independent'], license='BSD', classifiers=CLASSIFIERS, keywords=KEYWORDS, requires=['suds'], install_requires=['suds'], )
obr/python-fedex
setup.py
Python
bsd-3-clause
1,212
# This is the Twisted Get Poetry Now! client, version 1.0. # NOTE: This should not be used as the basis for production code. # It uses low-level Twisted APIs as a learning exercise. import datetime, errno, optparse, socket from twisted.internet import main def parse_args(): usage = """usage: %prog [options] [hostname]:port ... This is the Get Poetry Now! client, Twisted version 1.0. Run it like this: python get-poetry.py port1 port2 port3 ... If you are in the base directory of the twisted-intro package, you could run it like this: python twisted-client-1/get-poetry.py 10001 10002 10003 to grab poetry from servers on ports 10001, 10002, and 10003. Of course, there need to be servers listening on those ports for that to work. """ parser = optparse.OptionParser(usage) _, addresses = parser.parse_args() if not addresses: print parser.format_help() parser.exit() def parse_address(addr): if ':' not in addr: host = '127.0.0.1' port = addr else: host, port = addr.split(':', 1) if not port.isdigit(): parser.error('Ports must be integers.') return host, int(port) return map(parse_address, addresses) class PoetrySocket(object): poem = '' def __init__(self, task_num, address): self.task_num = task_num self.address = address self.sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) self.sock.connect(address) self.sock.setblocking(0) # tell the Twisted reactor to monitor this socket for reading from twisted.internet import reactor reactor.addReader(self) def fileno(self): try: return self.sock.fileno() except socket.error: return -1 def connectionLost(self, reason): self.sock.close() # stop monitoring this socket from twisted.internet import reactor reactor.removeReader(self) # see if there are any poetry sockets left for reader in reactor.getReaders(): if isinstance(reader, PoetrySocket): return reactor.stop() # no more poetry def doRead(self): bytes = '' while True: try: bytesread = self.sock.recv(1024) if not bytesread: break else: bytes += bytesread except socket.error, e: if e.args[0] == errno.EWOULDBLOCK: break return main.CONNECTION_LOST if not bytes: print 'Task %d finished' % self.task_num return main.CONNECTION_DONE else: msg = 'Task %d: got %d bytes of poetry from %s' print msg % (self.task_num, len(bytes), self.format_addr()) self.poem += bytes def logPrefix(self): return 'poetry' def format_addr(self): host, port = self.address return '%s:%s' % (host or '127.0.0.1', port) def poetry_main(): addresses = parse_args() start = datetime.datetime.now() sockets = [PoetrySocket(i + 1, addr) for i, addr in enumerate(addresses)] print socket from twisted.internet import reactor reactor.run() elapsed = datetime.datetime.now() - start for i, sock in enumerate(sockets): print 'Task %d: %d bytes of poetry' % (i + 1, len(sock.poem)) print 'Got %d poems in %s' % (len(addresses), elapsed) if __name__ == '__main__': poetry_main()
GavinCando/twisted_test
twisted-client-1/get-poetry.py
Python
mit
3,576
# -*- coding: utf-8 -*- # ------------------------------------------------------------ # pelisalacarta 4 # Copyright 2015 [email protected] # http://blog.tvalacarta.info/plugin-xbmc/pelisalacarta/ # # Distributed under the terms of GNU General Public License v3 (GPLv3) # http://www.gnu.org/licenses/gpl-3.0.html # ------------------------------------------------------------ # This file is part of pelisalacarta 4. # # pelisalacarta 4 is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # pelisalacarta 4 is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with pelisalacarta 4. If not, see <http://www.gnu.org/licenses/>. # ------------------------------------------------------------ # MCT - Mini Cliente Torrent para pelisalacarta #------------------------------------------------------------ import os import re import shutil import tempfile import urllib import urllib2 try: from python_libtorrent import get_libtorrent lt = get_libtorrent() except Exception, e: import libtorrent as lt import xbmc import xbmcgui from core import config from core import scrapertools from core import filetools def play(url, xlistitem, is_view=None, subtitle=""): # -- Necesario para algunas webs ---------------------------- if not url.endswith(".torrent") and not url.startswith("magnet"): t_file = scrapertools.get_header_from_response(url, header_to_get="location") if len(t_file) > 0: url = t_file t_file = scrapertools.get_header_from_response(url, header_to_get="location") if len(t_file) > 0: url = t_file # -- Crear dos carpetas en descargas para los archivos ------ save_path_videos = os.path.join( config.get_setting("downloadpath") , "torrent-videos" ) save_path_torrents = os.path.join( config.get_setting("downloadpath") , "torrent-torrents" ) if not os.path.exists( save_path_torrents ): os.mkdir(save_path_torrents) # -- Usar - archivo torrent desde web, meagnet o HD --------- if not os.path.isfile(url) and not url.startswith("magnet"): # -- http - crear archivo torrent ----------------------- data = url_get(url) # -- El nombre del torrent será el que contiene en los -- # -- datos. - re_name = urllib.unquote( scrapertools.get_match(data,':name\d+:(.*?)\d+:') ) #torrent_file = os.path.join(save_path_torrents, re_name+'.torrent') torrent_file = filetools.join(save_path_torrents, unicode(re_name, "'utf-8'", errors="replace")+'.torrent') f = open(torrent_file,'wb') f.write(data) f.close() elif os.path.isfile(url): # -- file - para usar torrens desde el HD --------------- torrent_file = url else: # -- magnet --------------------------------------------- torrent_file = url # ----------------------------------------------------------- # -- MCT - MiniClienteTorrent ------------------------------- ses = lt.session() print "### Init session ########" print lt.version print "#########################" ses.add_dht_router("router.bittorrent.com",6881) ses.add_dht_router("router.utorrent.com",6881) ses.add_dht_router("router.bitcomet.com",554) ses.add_dht_router("dht.transmissionbt.com",6881) trackers = [ "http://exodus.desync.com:6969/announce", "udp://tracker.publicbt.com:80/announce", "udp://tracker.openbittorrent.com:80/announce", "http://tracker.torrentbay.to:6969/announce", "http://fr33dom.h33t.com:3310/announce", "http://tracker.pow7.com/announce", "udp://tracker.ccc.de:80/announce", "http://tracker.bittorrent.am:80/announce", "http://denis.stalker.h3q.com:6969/announce", "udp://tracker.prq.to:80/announce", "udp://tracker.istole.it:80/announce", "udp://open.demonii.com:1337", "http://9.rarbg.com:2710/announce", "http://announce.torrentsmd.com:6969/announce", "http://bt.careland.com.cn:6969/announce", "http://explodie.org:6969/announce", "http://mgtracker.org:2710/announce", "http://tracker.best-torrents.net:6969/announce", "http://tracker.tfile.me/announce", "http://tracker.torrenty.org:6969/announce", "http://tracker1.wasabii.com.tw:6969/announce", "udp://9.rarbg.com:2710/announce", "udp://9.rarbg.me:2710/announce", "udp://coppersurfer.tk:6969/announce", "udp://tracker.btzoo.eu:80/announce", "http://www.spanishtracker.com:2710/announce", "http://www.todotorrents.com:2710/announce", ] video_file = "" # -- magnet2torrent ----------------------------------------- if torrent_file.startswith("magnet"): tempdir = tempfile.mkdtemp() params = { 'save_path': tempdir, 'trackers':trackers, 'storage_mode': lt.storage_mode_t.storage_mode_allocate, 'paused': False, 'auto_managed': True, 'duplicate_is_error': True } h = lt.add_magnet_uri(ses, torrent_file, params) dp = xbmcgui.DialogProgress() dp.create('pelisalacarta-MCT') while not h.has_metadata(): message, porcent, msg_file, s, download = getProgress(h, "Creando torrent desde magnet") dp.update(porcent, message, msg_file) if s.state == 1: download = 1 if dp.iscanceled(): dp.close() remove_files( download, torrent_file, video_file, ses, h ) return dp.close() info = h.get_torrent_info() data = lt.bencode( lt.create_torrent(info).generate() ) #torrent_file = os.path.join(save_path_torrents, info.name() + ".torrent") torrent_file = os.path.join(save_path_torrents, unicode(info.name(), "'utf-8'", errors="replace") + ".torrent") f = open(torrent_file,'wb') f.write(data) f.close() ses.remove_torrent(h) shutil.rmtree(tempdir) # ----------------------------------------------------------- # -- Archivos torrent --------------------------------------- e = lt.bdecode(open(torrent_file, 'rb').read()) info = lt.torrent_info(e) # -- El más gordo o uno de los más gordo se entiende que es - # -- el vídeo o es el vídeo que se usará como referencia - # -- para el tipo de archivo - print "##### Archivos ## %s ##" % len(info.files()) _index_file, _video_file, _size_file = get_video_file(info) _video_file_ext = os.path.splitext( _video_file )[1] if _video_file_ext == ".avi" or _video_file_ext == ".mp4": print "##### storage_mode_t.storage_mode_allocate ("+_video_file_ext+") #####" h = ses.add_torrent( { 'ti':info, 'save_path': save_path_videos, 'trackers':trackers, 'storage_mode':lt.storage_mode_t.storage_mode_allocate } ) else: print "##### storage_mode: none ("+_video_file_ext+") #####" h = ses.add_torrent( { 'ti':info, 'save_path': save_path_videos, 'trackers':trackers, 'storage_mode':lt.storage_mode_t.storage_mode_sparse } ) # ----------------------------------------------------------- # -- Descarga secuencial - trozo 1, trozo 2, ... ------------ h.set_sequential_download(True) h.force_reannounce() h.force_dht_announce() # -- Prioritarizar/Seleccionar archivo----------------------- _index, video_file, video_size = get_video_files_sizes( info ) if _index == -1: _index = _index_file video_file = _video_file video_size = _size_file # -- Inicio de variables para 'pause' automático cuando el - # -- el vídeo se acerca a una pieza sin completar - is_greater_num_pieces = False is_greater_num_pieces_plus = False is_greater_num_pieces_pause = False #porcent4first_pieces = int( video_size / 1073741824 ) porcent4first_pieces = int( video_size * 0.000000005 ) if porcent4first_pieces < 10: porcent4first_pieces = 10 if porcent4first_pieces > 100: porcent4first_pieces = 100 #num_pieces_to_resume = int( video_size / 1610612736 ) num_pieces_to_resume = int( video_size * 0.0000000025 ) if num_pieces_to_resume < 5: num_pieces_to_resume = 5 if num_pieces_to_resume > 25: num_pieces_to_resume = 25 print "##### porcent4first_pieces ## %s ##" % porcent4first_pieces print "##### num_pieces_to_resume ## %s ##" % num_pieces_to_resume # -- Prioritarizar o seleccionar las piezas del archivo que - # -- se desea reproducir con 'file_priorities' - piece_set = set_priority_pieces(h, _index, video_file, video_size) # -- Crear diálogo de progreso para el primer bucle --------- dp = xbmcgui.DialogProgress() dp.create('pelisalacarta-MCT') _pieces_info = {} # -- Doble bucle anidado ------------------------------------ # -- Descarga - Primer bucle - while not h.is_seed(): s = h.status() xbmc.sleep(100) # -- Recuperar los datos del progreso ------------------- message, porcent, msg_file, s, download = getProgress(h, video_file, _pf=_pieces_info) # -- Si hace 'checking' existe descarga ----------------- # -- 'download' Se usará para saber si hay datos - # -- descargados para el diálogo de 'remove_files' - if s.state == 1: download = 1 # -- Player - play -------------------------------------- # -- Comprobar si se han completado las piezas para el - # -- inicio del vídeo ............... - first_pieces = True _p = "" _c = 0 for i in range( piece_set[0], piece_set[porcent4first_pieces] ): _p+= "[%s:%s]" % ( i, h.have_piece(i) ) first_pieces&= h.have_piece(i) if h.have_piece(i): _c+= 1 _pieces_info = {'current': 0, 'continuous': "%s/%s" % (_c,porcent4first_pieces), 'have': h.status().num_pieces, 'len': len(piece_set)} _p = "##### first_pieces [%s/%s][%s]: " % ( _c, porcent4first_pieces, len(piece_set) ) + _p print _p # -- -------------------------------------------------- - if is_view != "Ok" and first_pieces: print "##### porcent [%.2f%%]" % (s.progress * 100) is_view = "Ok" dp.close() # -- Player - Ver el vídeo -------------------------- playlist = xbmc.PlayList( xbmc.PLAYLIST_VIDEO ) playlist.clear() #ren_video_file = os.path.join( save_path_videos, video_file ).replace('\\','\\\\') ren_video_file = os.path.join( save_path_videos, video_file ) playlist.add( ren_video_file, xlistitem ) #playlist.add( os.path.join( save_path_videos, video_file ), xlistitem ) #playlist.add( "http://192.168.0.200/mctplay/" + video_file.replace(' ','%20'), xlistitem ) player = play_video( xbmc.PLAYER_CORE_AUTO ) player.play(playlist) ''' # -- Player - Ver el vídeo -------------------------- player = play_video() #player.play( os.path.join( save_path_videos, video_file ) ) player.play( "http://192.168.0.200/mctplay/" + video_file.replace(' ','%20') ) ''' #player.play( os.path.join( save_path_videos, video_file ) ) # -- Contador de cancelaciones para la ventana de - # -- 'pause' automático - is_greater_num_pieces_canceled = 0 continuous_pieces = 0 porcent_time = 0.00 current_piece = 0 # -- Impedir que kodi haga 'resume' a un archivo ---- # -- que se reprodució con anterioridad y que se - # -- eliminó para impedir que intente la reprucción - # -- en una pieza que aún no se ha completado y se - # -- active 'pause' automático - not_resume = True # -- Bandera subTítulos _sub = False # -- Segundo bucle - Player - Control de eventos ---- while player.isPlaying(): xbmc.sleep(100) # -- Añadir subTítulos if subtitle!="" and not _sub: _sub = True player.setSubtitles(subtitle) # -- Impedir que kodi haga 'resume' al inicio --- # -- de la descarga de un archivo conocido - if not_resume: player.seekTime(0) not_resume = False #xbmc.sleep(1000) # -- Control 'pause' automático - continuous_pieces = count_completed_continuous_pieces(h, piece_set) if xbmc.Player().isPlaying(): # -- Porcentage del progreso del vídeo ------ porcent_time = player.getTime() / player.getTotalTime() * 100 # -- Pieza que se está reproduciendo -------- current_piece = int( porcent_time / 100 * len(piece_set) ) # -- Banderas de control -------------------- is_greater_num_pieces = (current_piece > continuous_pieces - num_pieces_to_resume) is_greater_num_pieces_plus = (current_piece + porcent4first_pieces > continuous_pieces) is_greater_num_pieces_finished = (current_piece + porcent4first_pieces >= len(piece_set)) # -- Activa 'pause' automático -------------- if is_greater_num_pieces and not player.paused and not is_greater_num_pieces_finished: is_greater_num_pieces_pause = True player.pause() # -- Log ------------------------------------ _TotalTime = player.getTotalTime() _Time = player.getTime() _print_log = "\n##### Player ##################################" _print_log+= "\nTamaño del vídeo: %s" % video_size _print_log+= "\nTotal piezas: %s" % len(piece_set) _print_log+= "\nPiezas contiguas: %s" % continuous_pieces _print_log+= "\n-----------------------------------------------" _print_log+= "\nVídeo-Total segundos: %s" % _TotalTime _print_log+= "\nVídeo-Progreso segundos: %s" % _Time _print_log+= "\nVídeo-Progreso porcentaje: %.2f%%" % porcent_time _print_log+= "\n-----------------------------------------------" _print_log+= "\ncurrent_piece: %s" % current_piece _print_log+= "\nis_greater_num_pieces: %s" % is_greater_num_pieces _print_log+= "\nis_greater_num_pieces_plus: %s" % is_greater_num_pieces_plus _print_log+= "\nis_greater_num_pieces_pause: %s" % is_greater_num_pieces_pause _print_log+= "\nis_greater_num_pieces_finished: %s" % is_greater_num_pieces_finished _print_log+= "\nPieza que se está visionando: %.2f" % ( porcent_time / 100 * len(piece_set) ) _print_log+= "\nOffset que se está visionando: %.2f" % ( porcent_time / 100 * video_size ) if is_greater_num_pieces and not player.paused and not is_greater_num_pieces_finished: _print_log+= "\n+++++++++++++++++++++++++++++++++++++++++++++++" _print_log+= "\nPausa con:" _print_log+= "\n current_piece = %s" % current_piece _print_log+= "\n continuous_pieces = %s" % continuous_pieces _print_log+= "\n###############################################" print _print_log # ------------------------------------------- _pieces_info = {'current': current_piece, 'continuous': continuous_pieces, 'have': h.status().num_pieces, 'len': len(piece_set)} # -- Cerrar el diálogo de progreso -------------- if player.resumed: dp.close() # -- Mostrar el diálogo de progreso ------------- if player.paused: # -- Crear diálogo si no existe ------------- if not player.statusDialogoProgress: dp = xbmcgui.DialogProgress() dp.create('pelisalacarta-MCT') player.setDialogoProgress() # -- Diálogos de estado en el visionado ----- if not h.is_seed(): # -- Recuperar los datos del progreso --- message, porcent, msg_file, s, download = getProgress(h, video_file, _pf=_pieces_info) dp.update(porcent, message, msg_file) else: dp.update(100, "Descarga completa: " + video_file) # -- Se canceló el progreso en el visionado - # -- Continuar - if dp.iscanceled(): dp.close() player.pause() # -- Se canceló el progreso en el visionado - # -- en la ventana de 'pause' automático. - # -- Parar si el contador llega a 3 - if dp.iscanceled() and is_greater_num_pieces_pause: is_greater_num_pieces_canceled+= 1 if is_greater_num_pieces_canceled == 3: player.stop() # -- Desactiva 'pause' automático y --------- # -- reinicia el contador de cancelaciones - if not dp.iscanceled() and not is_greater_num_pieces_plus and is_greater_num_pieces_pause: dp.close() player.pause() is_greater_num_pieces_pause = False is_greater_num_pieces_canceled = 0 # -- El usuario cancelo el visionado -------- # -- Terminar - if player.ended: # -- Diálogo eliminar archivos ---------- remove_files( download, torrent_file, video_file, ses, h ) return # -- Kodi - Se cerró el visionado ----------------------- # -- Continuar | Terminar - if is_view == "Ok" and not xbmc.Player().isPlaying(): if info.num_files() == 1: # -- Diálogo continuar o terminar --------------- d = xbmcgui.Dialog() ok = d.yesno('pelisalacarta-MCT', 'XBMC-Kodi Cerró el vídeo.', '¿Continuar con la sesión?') else: ok = False # -- SI --------------------------------------------- if ok: # -- Continuar: --------------------------------- is_view=None else: # -- Terminar: ---------------------------------- # -- Comprobar si el vídeo pertenece a una ------ # -- lista de archivos - _index, video_file, video_size = get_video_files_sizes( info ) if _index == -1 or info.num_files() == 1: # -- Diálogo eliminar archivos -------------- remove_files( download, torrent_file, video_file, ses, h ) return else: # -- Lista de archivos. Diálogo de opciones - piece_set = set_priority_pieces(h, _index, video_file, video_size) is_view=None dp = xbmcgui.DialogProgress() dp.create('pelisalacarta-MCT') # -- Mostar progeso antes del visionado ----------------- if is_view != "Ok" : dp.update(porcent, message, msg_file) # -- Se canceló el progreso antes del visionado --------- # -- Terminar - if dp.iscanceled(): dp.close() # -- Comprobar si el vídeo pertenece a una lista de - # -- archivos - _index, video_file, video_size = get_video_files_sizes( info ) if _index == -1 or info.num_files() == 1: # -- Diálogo eliminar archivos ------------------ remove_files( download, torrent_file, video_file, ses, h ) return else: # -- Lista de archivos. Diálogo de opciones ----- piece_set = set_priority_pieces(h, _index, video_file, video_size) is_view=None dp = xbmcgui.DialogProgress() dp.create('pelisalacarta-MCT') # -- Kodi - Error? - No debería llegar aquí ----------------- if is_view == "Ok" and not xbmc.Player().isPlaying(): dp.close() # -- Diálogo eliminar archivos -------------------------- remove_files( download, torrent_file, video_file, ses, h ) return # -- Progreso de la descarga ------------------------------------ def getProgress(h, video_file, _pf={}): if len(_pf) > 0: #_pf_msg = "[%s] [%s] [%s] [%s][CR]" % (_pf['current'], _pf['continuous'], _pf['have'], _pf['len']) _pf_msg = "[%s] [%s] [%s] [%s]" % (_pf['current'], _pf['continuous'], _pf['have'], _pf['len']) else: _pf_msg = "" s = h.status() state_str = ['queued', 'checking', 'downloading metadata', \ 'downloading', 'finished', 'seeding', 'allocating', 'checking fastresume'] message = '%.2f%% d:%.1f kb/s u:%.1f kb/s p:%d s:%d %s' % \ (s.progress * 100, s.download_rate / 1000, s.upload_rate / 1000, \ s.num_peers, s.num_seeds, state_str[s.state]) porcent = int( s.progress * 100 ) download = ( s.progress * 100 ) if "/" in video_file: video_file = video_file.split("/")[1] #msg_file = "..../"+video_file + " - %.2f MB" % (s.total_wanted/1048576.0) #msg_file = video_file + " - %.2f MB" % (s.total_wanted/1048576.0) msg_file = video_file #msg_file = "[%s] "%len(msg_file)+_pf_msg+msg_file if len(msg_file) > 50: msg_file = msg_file.replace( video_file, os.path.splitext(video_file)[0][:40] + "... " + os.path.splitext(video_file)[1] ) msg_file = msg_file + "[CR]" + "%.2f MB" % (s.total_wanted/1048576.0) + " - " + _pf_msg return (message, porcent, msg_file, s, download) # -- Clase play_video - Controlar eventos ----------------------- class play_video(xbmc.Player): def __init__( self, *args, **kwargs ): self.paused = False self.resumed = True self.statusDialogoProgress = False self.ended = False def onPlayBackPaused(self): self.paused = True self.resumed = False def onPlayBackResumed(self): self.paused = False self.resumed = True self.statusDialogoProgress = False def is_paused(self): return self.paused def setDialogoProgress(self): self.statusDialogoProgress = True def is_started(self): self.ended = False def is_ended(self): self.ended = True # -- Conseguir el nombre un alchivo de vídeo del metadata ------- # -- El más gordo o uno de los más gordo se entiende que es el - # -- vídeo o es vídeo que se usará como referencia para el tipo - # -- de archivo - def get_video_file( info ): size_file = 0 for i, f in enumerate(info.files()): if f.size > size_file: video_file = f.path.replace("\\","/") size_file = f.size index_file = i return index_file, video_file, size_file # -- Listado de selección del vídeo a prioritarizar ------------- def get_video_files_sizes( info ): opciones = [] vfile_name = {} vfile_size = {} for i, f in enumerate( info.files() ): #_title = f.path #try: _title = f.path.encode('iso-8859-1') #except: _title = f.path.decode('utf-8') #_title = f.path.encode('iso-8859-1') _title = unicode(f.path, "iso-8859-1", errors="replace") _title = unicode(f.path, "'utf-8'", errors="replace") _title = re.sub(r'(.*? )- Temporada (\d+) Completa(.*?)', r'\1T\2\3', _title) _title = re.sub(r'\s\([^\)]+\)|\s\-', '', _title) info.rename_file( i, _title ) for i, f in enumerate( info.files() ): _index = int(i) _title = f.path.replace("\\","/") _size = f.size _offset = f.offset _file_name = os.path.splitext( _title )[0] if "/" in _file_name: _file_name = _file_name.split('/')[1] _file_ext = os.path.splitext( _title )[1] _caption = str(i) + \ " - " + \ _file_name + _file_ext + \ " - %.2f MB" % (_size / 1048576.0) vfile_name[i] = _title vfile_size[i] = _size opciones.append(_caption) if len(opciones) > 1: d = xbmcgui.Dialog() seleccion = d.select("pelisalacarta-MCT: Lista de vídeos", opciones) else: seleccion = 0 if seleccion == -1: vfile_name[seleccion] = "" vfile_size[seleccion] = 0 return seleccion, vfile_name[seleccion], vfile_size[seleccion] # -- Preguntar si se desea borrar lo descargado ----------------- def remove_files( download, torrent_file, video_file, ses, h ): dialog_view = False torrent = False if os.path.isfile( torrent_file ): dialog_view = True torrent = True if download > 0: dialog_view = True if "/" in video_file: video_file = video_file.split("/")[0] if dialog_view: d = xbmcgui.Dialog() ok = d.yesno('pelisalacarta-MCT', 'Borrar las descargas del video', video_file) # -- SI ------------------------------------------------- if ok: # -- Borrar archivo - torrent ----------------------- if torrent: os.remove( torrent_file ) # -- Borrar carpeta/archivos y sesión - vídeo ------- ses.remove_torrent( h, 1 ) print "### End session #########" else: # -- Borrar sesión ---------------------------------- ses.remove_torrent( h ) print "### End session #########" else: # -- Borrar sesión -------------------------------------- ses.remove_torrent( h ) print "### End session #########" return # -- Descargar de la web los datos para crear el torrent -------- # -- Si queremos aligerar el script mct.py se puede importar la - # -- función del conentor torrent.py - def url_get(url, params={}, headers={}): from contextlib import closing USER_AGENT = "Mozilla/5.0 (Macintosh; Intel Mac OS X 10.8; rv:20.0) Gecko/20100101 Firefox/20.0" if params: import urllib url = "%s?%s" % (url, urllib.urlencode(params)) req = urllib2.Request(url) req.add_header("User-Agent", USER_AGENT) for k, v in headers.items(): req.add_header(k, v) try: with closing(urllib2.urlopen(req)) as response: data = response.read() if response.headers.get("Content-Encoding", "") == "gzip": import zlib return zlib.decompressobj(16 + zlib.MAX_WBITS).decompress(data) return data except urllib2.HTTPError: return None # -- Procedimiento para log de have_piece en las pruebas -------- def print_have_piece_set(h, piece_set): c = 0 _print = "\n" for i, _set in enumerate(piece_set): if h.have_piece(_set): _print+= "[%s]" % str(_set).zfill(5) else: _print+= "[XXXXX]" c+= 1 if c == 20: c = 0 _print+= "\n" print _print # -- Contar las piezas contiguas completas del vídeo ------------ def count_completed_continuous_pieces(h, piece_set): not_zero = 0 for i, _set in enumerate(piece_set): if not h.have_piece(_set): break else: not_zero = 1 return i + not_zero # -- Prioritarizar o seleccionar las piezas del archivo que se - # -- desea reproducir con 'file_priorities' estableciendo a 1 - # -- el archivo deseado y a 0 el resto de archivos almacenando - # -- en una lista los índices de de las piezas del archivo - def set_priority_pieces(h, _index, video_file, video_size): for i, _set in enumerate(h.file_priorities()): if i != _index: h.file_priority(i,0) else: h.file_priority(i,1) piece_set = [] for i, _set in enumerate(h.piece_priorities()): if _set == 1: piece_set.append(i) return piece_set
MoRgUiJu/morguiju.repo
plugin.video.pelisalacarta/platformcode/mct.py
Python
gpl-2.0
29,761
# -*- coding: utf-8 -*- import re from datetime import datetime from django.apps import apps from django.db.models import Q from django.conf import settings from django.core.exceptions import ObjectDoesNotExist from django.http import QueryDict from django.shortcuts import get_object_or_404 from django.urls import reverse from django.utils.translation import ugettext_lazy as _ from rest_framework import viewsets, exceptions, status, mixins, filters from rest_framework.decorators import action from rest_framework.response import Response from rest_framework_filters import backends from .. import models, serializers from ..filters import ( ComputerFilter, StoreFilter, PropertyFilter, ProjectFilter, AttributeSetFilter, AttributeFilter, PackageFilter, DeploymentFilter, ErrorFilter, FaultDefinitionFilter, FaultFilter, NotificationFilter, MigrationFilter, NodeFilter, SynchronizationFilter, StatusLogFilter, DeviceFilter, DriverFilter, ScheduleDelayFilter, ) from ..tasks import create_repository_metadata class MigasViewSet(viewsets.ViewSet): @action(methods=['get'], detail=True) def relations(self, request, pk=None): app = self.queryset.model._meta.app_label model = self.queryset.model._meta.model_name try: response = apps.get_model(app, model).objects.get(pk=pk).relations(request) return Response(response, status=status.HTTP_200_OK) except ObjectDoesNotExist: return Response(status=status.HTTP_404_NOT_FOUND) @action(methods=['get'], detail=True) def badge(self, request, pk=None): app = self.queryset.model._meta.app_label model = self.queryset.model._meta.model_name try: response = apps.get_model(app, model).objects.get(pk=pk).badge() return Response(response, status=status.HTTP_200_OK) except ObjectDoesNotExist: return Response(status=status.HTTP_404_NOT_FOUND) class AttributeSetViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.AttributeSet.objects.all() serializer_class = serializers.AttributeSetSerializer filter_class = AttributeSetFilter ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.AttributeSetWriteSerializer return serializers.AttributeSetSerializer class AttributeViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Attribute.objects.all() serializer_class = serializers.AttributeSerializer filter_class = AttributeFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['value', 'description'] def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(id__in=user.get_attributes()).distinct() return qs def get_serializer_class(self): if self.action == 'update' or self.action == 'partial_update': return serializers.AttributeWriteSerializer return serializers.AttributeSerializer @action(methods=['get', 'put', 'patch'], detail=True, url_path='logical-devices') def logical_devices(self, request, pk=None): """ GET returns: [ { "id": 112, "device": { "id": 6, "name": "19940" }, "feature": { "id": 2, "name": "Color" }, "name": "" }, { "id": 7, "device": { "id": 6, "name": "19940" }, "feature": { "id": 1, "name": "BN" }, "name": "" } ] PUT, PATCH input: [id1, id2, idN] returns: status code 201 """ attribute = get_object_or_404(models.Attribute, pk=pk) logical_devices = attribute.devicelogical_set.all() if request.method == 'GET': serializer = serializers.LogicalSerializer( logical_devices, many=True ) return Response(serializer.data, status=status.HTTP_200_OK) if request.method == 'PATCH': # append cid attribute to logical devices for device_id in request.data: device = get_object_or_404(models.DeviceLogical, pk=device_id) if device not in logical_devices: device.attributes.add(pk) return Response(status=status.HTTP_201_CREATED) if request.method == 'PUT': # replace cid attribute in logical devices for device in logical_devices: if device in logical_devices: device.attributes.remove(pk) for device_id in request.data: device = get_object_or_404(models.DeviceLogical, pk=device_id) device.attributes.add(pk) return Response(status=status.HTTP_201_CREATED) class ComputerViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Computer.objects.all() serializer_class = serializers.ComputerSerializer filter_class = ComputerFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering = (settings.MIGASFREE_COMPUTER_SEARCH_FIELDS[0],) def get_serializer_class(self): if self.action == 'update' or self.action == 'partial_update': return serializers.ComputerWriteSerializer return serializers.ComputerSerializer def partial_update(self, request, *args, **kwargs): if isinstance(request.data, QueryDict): data = dict(request.data.lists()) else: data = request.data devices = data.get( 'assigned_logical_devices_to_cid[]', data.get('assigned_logical_devices_to_cid', None) ) if devices: computer = get_object_or_404(models.Computer, pk=kwargs['pk']) try: assigned_logical_devices_to_cid = list(map(int, devices)) except ValueError: assigned_logical_devices_to_cid = [] for item in assigned_logical_devices_to_cid: logical_device = models.DeviceLogical.objects.get(pk=item) model = models.DeviceModel.objects.get(device=logical_device.device) if not models.DeviceDriver.objects.filter( feature=logical_device.feature, model=model, project=computer.project ): return Response( _('Error in feature %s for assign computer %s.' ' There is no driver defined for project %s in model %s.') % ( logical_device.feature, computer, computer.project, "<a href='{}'>{}</a>".format( reverse( 'admin:server_devicemodel_change', args=(model.pk,) ), model ) ), status=status.HTTP_400_BAD_REQUEST, content_type='text/plain' ) computer.update_logical_devices(assigned_logical_devices_to_cid) return super(ComputerViewSet, self).partial_update( request, *args, **kwargs ) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(id__in=user.get_computers()) return qs @action(methods=['get'], detail=True, url_name='devices') def devices(self, request, pk=None): computer = get_object_or_404(models.Computer, pk=pk) serializer = serializers.ComputerDevicesSerializer(computer, context={'request': request}) return Response( serializer.data, status=status.HTTP_200_OK ) @action(methods=['get'], detail=True, url_path='software/inventory', url_name='software_inventory') def software_inventory(self, request, pk=None): """ Returns installed packages in a computer """ computer = get_object_or_404(models.Computer, pk=pk) data = [] if computer.software_inventory: data = re.sub(r'^\+', '', computer.software_inventory, flags=re.MULTILINE) data = re.sub(r'^-', '', data, flags=re.MULTILINE) data = data.rstrip().split('\n') return Response( data, status=status.HTTP_200_OK ) @action(methods=['get'], detail=True, url_path='software/history', url_name='software_history') def software_history(self, request, pk=None): """ Returns software history of a computer """ computer = get_object_or_404(models.Computer, pk=pk) return Response( computer.software_history, status=status.HTTP_200_OK ) @action(methods=['post'], detail=True) def status(self, request, pk=None): """ Input: { 'status': 'available' | 'reserved' | 'unsubscribed' | 'unknown' | 'intended' } Changes computer status """ computer = get_object_or_404(models.Computer, pk=pk) ret = computer.change_status(request.data.get('status')) if not ret: raise exceptions.ParseError( _('Status must have one of the values: %s') % ( dict(models.Computer.STATUS_CHOICES).keys() ) ) serializer = serializers.ComputerSerializer(computer, context={'request': request}) return Response( serializer.data, status=status.HTTP_200_OK ) @action(methods=['post'], detail=True) def replacement(self, request, pk=None): """ Input: { 'target': id } Exchanges tags and status """ source = get_object_or_404(models.Computer, pk=pk) target = get_object_or_404( models.Computer, id=request.data.get('target') ) models.Computer.replacement(source, target) return Response(status=status.HTTP_200_OK) @action(methods=['get'], detail=True) def sync(self, request, pk=None): """ :returns { "date": "Y-m-d H:M:s", "user": { "id": x, "name": "xxx", "fullname": "xxxxx" }, "attributes": [ { "id": x, "value": "xxx", "description": "xxxxx", "total_computers"; xx, "property_att": { "id": x, "prefix": "xxx" } }, ... ] } """ computer = get_object_or_404(models.Computer, pk=pk) serializer = serializers.ComputerSyncSerializer(computer, context={'request': request}) return Response(serializer.data, status=status.HTTP_200_OK) @action(methods=['get'], detail=True) def situation(self, request, pk=None): """ :param request date :param pk: computer id :return: { "platform": { "id": x, "name": "xxx" }, "project": { "id": x, "name": "xxx" }, "status": "xxx" } """ user = request.user.userprofile computer = get_object_or_404(models.Computer, pk=pk) date = request.GET.get('date', datetime.now()) migration = models.Migration.situation(computer.id, date, user) status_log = models.StatusLog.situation(computer.id, date, user) response = {} if migration: serializer = serializers.PlatformSerializer(migration.project.platform, context={'request': request}) response['platform'] = serializer.data serializer = serializers.ProjectInfoSerializer(migration.project, context={'request': request}) response['project'] = serializer.data if status_log: response['status'] = status_log.status else: if isinstance(date, str): date = datetime.strptime(date, '%Y-%m-%d') if date >= computer.created_at: response['status'] = settings.MIGASFREE_DEFAULT_COMPUTER_STATUS return Response(response, status=status.HTTP_200_OK) class ErrorViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.UpdateModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.Error.objects.all() serializer_class = serializers.ErrorSerializer filter_class = ErrorFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['created_at', 'description'] ordering_fields = '__all__' ordering = ('-created_at',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter( project_id__in=user.get_projects(), computer_id__in=user.get_computers() ) return qs def get_serializer_class(self): if self.action == 'update' or self.action == 'partial_update': return serializers.ErrorWriteSerializer return serializers.ErrorSerializer class FaultDefinitionViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.FaultDefinition.objects.all() serializer_class = serializers.FaultDefinitionSerializer filter_class = FaultDefinitionFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.FaultDefinitionWriteSerializer return serializers.FaultDefinitionSerializer class FaultViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.UpdateModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.Fault.objects.all() serializer_class = serializers.FaultSerializer filter_class = FaultFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['created_at', 'result'] ordering_fields = '__all__' ordering = ('-created_at',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter( project_id__in=user.get_projects(), computer_id__in=user.get_computers() ) return qs def get_serializer_class(self): if self.action == 'update' or self.action == 'partial_update': return serializers.FaultWriteSerializer return serializers.FaultSerializer class HardwareComputerViewSet(viewsets.ViewSet): queryset = models.HwNode.objects.all() # FIXME @action(methods=['get'], detail=True) def hardware(self, request, pk=None): computer = get_object_or_404(models.Computer, pk=pk) nodes = models.HwNode.objects.filter(computer=computer).order_by('id') serializer = serializers.NodeSerializer(nodes, many=True) return Response( serializer.data, status=status.HTTP_200_OK ) class HardwareViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.HwNode.objects.all() serializer_class = serializers.NodeSerializer filter_class = NodeFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('id',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(computer_id__in=user.get_computers()) return qs class MigrationViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.Migration.objects.all() serializer_class = serializers.MigrationSerializer filter_class = MigrationFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('-created_at',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter( project_id__in=user.get_projects(), computer_id__in=user.get_computers() ) return qs class NotificationViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.UpdateModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.Notification.objects.all() serializer_class = serializers.NotificationSerializer filter_class = NotificationFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['message'] ordering_fields = '__all__' ordering = ('-created_at',) def get_serializer_class(self): if self.action == 'update' or self.action == 'partial_update': return serializers.NotificationWriteSerializer return serializers.NotificationSerializer class PackageViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Package.objects.all() serializer_class = serializers.PackageSerializer filter_class = PackageFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name', 'project__name') def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(project__in=user.get_projects()) return qs def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.PackageWriteSerializer return serializers.PackageSerializer @action(methods=['get'], detail=False) def orphan(self, request): """ Returns packages that are not in any deployment """ serializer = serializers.PackageSerializer( models.Package.objects.filter(deployment__id=None), many=True ) return Response( serializer.data, status=status.HTTP_200_OK ) class PlatformViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Platform.objects.all() serializer_class = serializers.PlatformSerializer ordering_fields = '__all__' ordering = ('name',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(project__in=user.get_projects()).distinct() return qs class PmsViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Pms.objects.all() serializer_class = serializers.PmsSerializer ordering_fields = '__all__' ordering = ('name',) class PropertyViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Property.objects.all() serializer_class = serializers.PropertySerializer filter_class = PropertyFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['name', 'language', 'code'] ordering_fields = '__all__' ordering = ('prefix', 'name') def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.PropertyWriteSerializer return serializers.PropertySerializer class InternalSourceViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.InternalSource.objects.all() serializer_class = serializers.InternalSourceSerializer filter_class = DeploymentFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('-start_date', 'name') def get_queryset(self): user = self.request.user.userprofile qs = self.queryset.filter(source=models.Deployment.SOURCE_INTERNAL) if not user.is_view_all(): qs = qs.filter(project__in=user.get_projects()) if user.domain_preference: qs = qs.filter(domain=user.domain_preference) return qs def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.InternalSourceWriteSerializer return serializers.InternalSourceSerializer @action(methods=['get'], detail=True) def metadata(self, request, pk=None): """ Creates repository metadata """ get_object_or_404(models.InternalSource, pk=pk) ret = create_repository_metadata(pk) return Response( {'detail': ret}, status=status.HTTP_200_OK ) class ExternalSourceViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.ExternalSource.objects.all() serializer_class = serializers.ExternalSourceSerializer filter_class = DeploymentFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('-start_date', 'name') def get_queryset(self): user = self.request.user.userprofile qs = self.queryset.filter(source=models.Deployment.SOURCE_EXTERNAL) if not user.is_view_all(): qs = qs.filter(project__in=user.get_projects()) if user.domain_preference: qs = qs.filter(domain=user.domain_preference) return qs def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ExternalSourceWriteSerializer return serializers.ExternalSourceSerializer class ScheduleDelayViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.ScheduleDelay.objects.all() serializer_class = serializers.ScheduleDelaySerializer filter_class = ScheduleDelayFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('delay',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ScheduleDelayWriteSerializer return serializers.ScheduleDelaySerializer class ScheduleViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Schedule.objects.all() serializer_class = serializers.ScheduleSerializer filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ScheduleWriteSerializer return serializers.ScheduleSerializer class StatusLogViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.StatusLog.objects.all() serializer_class = serializers.StatusLogSerializer filter_class = StatusLogFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['status'] ordering_fields = '__all__' ordering = ('-created_at',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(computer_id__in=user.get_computers()) return qs class StoreViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Store.objects.all() serializer_class = serializers.StoreSerializer filter_class = StoreFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['name'] ordering_fields = '__all__' ordering = ('name', 'project__name') def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(project__in=user.get_projects()) return qs def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.StoreWriteSerializer return serializers.StoreSerializer class SynchronizationViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.Synchronization.objects.all() serializer_class = serializers.SynchronizationSerializer filter_class = SynchronizationFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend, filters.SearchFilter) search_fields = ['user__name', 'user__fullname'] ordering_fields = '__all__' ordering = ('-created_at',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter( project_id__in=user.get_projects(), computer_id__in=user.get_computers() ) return qs class UserViewSet( mixins.ListModelMixin, mixins.RetrieveModelMixin, mixins.DestroyModelMixin, viewsets.GenericViewSet, MigasViewSet ): queryset = models.User.objects.all() serializer_class = serializers.UserSerializer ordering_fields = '__all__' ordering = ('name',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(computer__in=user.get_computers()) return qs class ProjectViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Project.objects.all() serializer_class = serializers.ProjectSerializer filter_class = ProjectFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_queryset(self): user = self.request.user.userprofile qs = self.queryset if not user.is_view_all(): qs = qs.filter(id__in=user.get_projects()) return qs def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ProjectWriteSerializer return serializers.ProjectSerializer class DomainViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Domain.objects.all() serializer_class = serializers.DomainSerializer filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.DomainWriteSerializer return serializers.DomainSerializer class ScopeViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Scope.objects.all() serializer_class = serializers.ScopeSerializer filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ScopeWriteSerializer return serializers.ScopeSerializer class ConnectionViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceConnection.objects.all() serializer_class = serializers.ConnectionSerializer ordering_fields = '__all__' ordering = ('id',) class DeviceViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.Device.objects.all() serializer_class = serializers.DeviceSerializer filter_class = DeviceFilter filter_backends = (filters.OrderingFilter, backends.DjangoFilterBackend) ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.DeviceWriteSerializer return serializers.DeviceSerializer @action(methods=['get'], detail=False) def available(self, request): """ :param request: cid (computer Id) int, q string (name or data contains...), page int :return: DeviceSerializer set """ computer = get_object_or_404(models.Computer, pk=request.GET.get('cid', 0)) query = request.GET.get('q', '') results = models.Device.objects.filter( available_for_attributes__in=computer.sync_attributes.values_list('id', flat=True) ).order_by('name', 'model__name').distinct() if query: results = results.filter(Q(name__icontains=query) | Q(data__icontains=query)) page = self.paginate_queryset(results) if page is not None: serializer = self.get_serializer(page, many=True) return self.get_paginated_response(serializer.data) serializer = self.get_serializer(results, many=True) return Response(serializer.data, status=status.HTTP_200_OK) class DriverViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceDriver.objects.all() serializer_class = serializers.DriverSerializer filter_class = DriverFilter ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.DriverWriteSerializer return serializers.DriverSerializer class FeatureViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceFeature.objects.all() serializer_class = serializers.FeatureSerializer ordering_fields = '__all__' ordering = ('name',) class LogicalViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceLogical.objects.all() serializer_class = serializers.LogicalSerializer ordering_fields = '__all__' ordering = ('device__name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.LogicalWriteSerializer return serializers.LogicalSerializer @action(methods=['get'], detail=False) def available(self, request): """ :param request: cid (computer Id) int, q string (name or data contains...), did (device Id) int, page int :return: DeviceLogicalSerializer set """ computer = get_object_or_404(models.Computer, pk=request.GET.get('cid', 0)) query = request.GET.get('q', '') device = request.GET.get('did', 0) results = models.DeviceLogical.objects.filter( device__available_for_attributes__in=computer.sync_attributes.values_list('id', flat=True) ).order_by('device__name', 'feature__name').distinct() if query: results = results.filter(Q(device__name__icontains=query) | Q(device__data__icontains=query)) if device: results = results.filter(device__id=device) page = self.paginate_queryset(results) if page is not None: serializer = self.get_serializer(page, many=True) return self.get_paginated_response(serializer.data) serializer = self.get_serializer(results, many=True) return Response(serializer.data, status=status.HTTP_200_OK) class ManufacturerViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceManufacturer.objects.all() serializer_class = serializers.ManufacturerSerializer ordering_fields = '__all__' ordering = ('name',) class ModelViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceModel.objects.all() serializer_class = serializers.ModelSerializer ordering_fields = '__all__' ordering = ('name',) def get_serializer_class(self): if self.action == 'create' or self.action == 'update' \ or self.action == 'partial_update': return serializers.ModelWriteSerializer return serializers.ModelSerializer class TypeViewSet(viewsets.ModelViewSet, MigasViewSet): queryset = models.DeviceType.objects.all() serializer_class = serializers.TypeSerializer ordering_fields = '__all__' ordering = ('name',)
migasfree/migasfree
migasfree/server/views/token.py
Python
gpl-3.0
34,742
# # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Implementation of SQLAlchemy backend.""" import datetime import sys from oslo_config import cfg from oslo_db import api as oslo_db_api from oslo_db.sqlalchemy import session as db_session from oslo_db.sqlalchemy import utils from oslo_log import log as logging from oslo_serialization import jsonutils from oslo_utils import encodeutils from oslo_utils import timeutils import osprofiler.sqlalchemy import six import sqlalchemy from sqlalchemy import and_ from sqlalchemy import func from sqlalchemy import orm from sqlalchemy.orm import aliased as orm_aliased from sqlalchemy.orm import session as orm_session from heat.common import crypt from heat.common import exception from heat.common.i18n import _ from heat.common.i18n import _LE from heat.common.i18n import _LI from heat.db.sqlalchemy import filters as db_filters from heat.db.sqlalchemy import migration from heat.db.sqlalchemy import models from heat.db.sqlalchemy import utils as db_utils from heat.engine import environment as heat_environment from heat.rpc import api as rpc_api CONF = cfg.CONF CONF.import_opt('hidden_stack_tags', 'heat.common.config') CONF.import_opt('max_events_per_stack', 'heat.common.config') CONF.import_group('profiler', 'heat.common.config') _facade = None LOG = logging.getLogger(__name__) def get_facade(): global _facade if not _facade: _facade = db_session.EngineFacade.from_config(CONF) if CONF.profiler.enabled: if CONF.profiler.trace_sqlalchemy: osprofiler.sqlalchemy.add_tracing(sqlalchemy, _facade.get_engine(), "db") return _facade def get_engine(): return get_facade().get_engine() def get_session(): return get_facade().get_session() def get_backend(): """The backend is this module itself.""" return sys.modules[__name__] def update_and_save(context, obj, values): with context.session.begin(subtransactions=True): for k, v in six.iteritems(values): setattr(obj, k, v) def delete_softly(context, obj): """Mark this object as deleted.""" update_and_save(context, obj, {'deleted_at': timeutils.utcnow()}) def soft_delete_aware_query(context, *args, **kwargs): """Stack query helper that accounts for context's `show_deleted` field. :param show_deleted: if True, overrides context's show_deleted field. """ query = context.session.query(*args) show_deleted = kwargs.get('show_deleted') or context.show_deleted if not show_deleted: query = query.filter_by(deleted_at=None) return query def raw_template_get(context, template_id): result = context.session.query(models.RawTemplate).get(template_id) if not result: raise exception.NotFound(_('raw template with id %s not found') % template_id) return result def raw_template_create(context, values): raw_template_ref = models.RawTemplate() raw_template_ref.update(values) raw_template_ref.save(context.session) return raw_template_ref def raw_template_update(context, template_id, values): raw_template_ref = raw_template_get(context, template_id) # get only the changed values values = dict((k, v) for k, v in values.items() if getattr(raw_template_ref, k) != v) if values: update_and_save(context, raw_template_ref, values) return raw_template_ref def raw_template_delete(context, template_id): raw_template = raw_template_get(context, template_id) raw_tmpl_files_id = raw_template.files_id session = context.session with session.begin(subtransactions=True): session.delete(raw_template) if raw_tmpl_files_id is None: return # If no other raw_template is referencing the same raw_template_files, # delete that too if session.query(models.RawTemplate).filter_by( files_id=raw_tmpl_files_id).first() is None: raw_tmpl_files = raw_template_files_get(context, raw_tmpl_files_id) session.delete(raw_tmpl_files) def raw_template_files_create(context, values): session = context.session raw_templ_files_ref = models.RawTemplateFiles() raw_templ_files_ref.update(values) with session.begin(): raw_templ_files_ref.save(session) return raw_templ_files_ref def raw_template_files_get(context, files_id): session = context.session if context else get_session() result = session.query(models.RawTemplateFiles).get(files_id) if not result: raise exception.NotFound( _("raw_template_files with files_id %d not found") % files_id) return result def resource_get(context, resource_id, refresh=False): result = context.session.query(models.Resource).get(resource_id) if not result: raise exception.NotFound(_("resource with id %s not found") % resource_id) if refresh: context.session.refresh(result) # ensure data is loaded (lazy or otherwise) result.data return result def resource_get_by_name_and_stack(context, resource_name, stack_id): result = context.session.query( models.Resource ).filter_by( name=resource_name ).filter_by( stack_id=stack_id ).options(orm.joinedload("data")).first() return result def resource_get_by_physical_resource_id(context, physical_resource_id): results = (context.session.query(models.Resource) .filter_by(physical_resource_id=physical_resource_id) .all()) for result in results: if context is None or context.tenant_id in ( result.stack.tenant, result.stack.stack_user_project_id): return result return None def resource_get_all(context): results = context.session.query(models.Resource).all() if not results: raise exception.NotFound(_('no resources were found')) return results def resource_purge_deleted(context, stack_id): filters = {'stack_id': stack_id, 'action': 'DELETE', 'status': 'COMPLETE'} query = context.session.query(models.Resource.id) result = query.filter_by(**filters) result.delete() def resource_update(context, resource_id, values, atomic_key, expected_engine_id=None): session = context.session with session.begin(subtransactions=True): if atomic_key is None: values['atomic_key'] = 1 else: values['atomic_key'] = atomic_key + 1 rows_updated = session.query(models.Resource).filter_by( id=resource_id, engine_id=expected_engine_id, atomic_key=atomic_key).update(values) return bool(rows_updated) def resource_update_and_save(context, resource_id, values): resource = context.session.query(models.Resource).get(resource_id) update_and_save(context, resource, values) def resource_delete(context, resource_id): session = context.session with session.begin(subtransactions=True): resource = session.query(models.Resource).get(resource_id) if resource: session.delete(resource) def resource_data_get_all(context, resource_id, data=None): """Looks up resource_data by resource.id. If data is encrypted, this method will decrypt the results. """ if data is None: data = (context.session.query(models.ResourceData) .filter_by(resource_id=resource_id)).all() if not data: raise exception.NotFound(_('no resource data found')) ret = {} for res in data: if res.redact: ret[res.key] = crypt.decrypt(res.decrypt_method, res.value) else: ret[res.key] = res.value return ret def resource_data_get(context, resource_id, key): """Lookup value of resource's data by key. Decrypts resource data if necessary. """ result = resource_data_get_by_key(context, resource_id, key) if result.redact: return crypt.decrypt(result.decrypt_method, result.value) return result.value def stack_tags_set(context, stack_id, tags): session = context.session with session.begin(): stack_tags_delete(context, stack_id) result = [] for tag in tags: stack_tag = models.StackTag() stack_tag.tag = tag stack_tag.stack_id = stack_id stack_tag.save(session=session) result.append(stack_tag) return result or None def stack_tags_delete(context, stack_id): session = context.session with session.begin(subtransactions=True): result = stack_tags_get(context, stack_id) if result: for tag in result: session.delete(tag) def stack_tags_get(context, stack_id): result = (context.session.query(models.StackTag) .filter_by(stack_id=stack_id) .all()) return result or None def resource_data_get_by_key(context, resource_id, key): """Looks up resource_data by resource_id and key. Does not decrypt resource_data. """ result = (context.session.query(models.ResourceData) .filter_by(resource_id=resource_id) .filter_by(key=key).first()) if not result: raise exception.NotFound(_('No resource data found')) return result def resource_data_set(context, resource_id, key, value, redact=False): """Save resource's key/value pair to database.""" if redact: method, value = crypt.encrypt(value) else: method = '' try: current = resource_data_get_by_key(context, resource_id, key) except exception.NotFound: current = models.ResourceData() current.key = key current.resource_id = resource_id current.redact = redact current.value = value current.decrypt_method = method current.save(session=context.session) return current def resource_exchange_stacks(context, resource_id1, resource_id2): query = context.session.query(models.Resource) session = query.session session.begin() res1 = query.get(resource_id1) res2 = query.get(resource_id2) res1.stack, res2.stack = res2.stack, res1.stack session.commit() def resource_data_delete(context, resource_id, key): result = resource_data_get_by_key(context, resource_id, key) session = context.session with session.begin(subtransactions=True): session.delete(result) def resource_create(context, values): resource_ref = models.Resource() resource_ref.update(values) resource_ref.save(context.session) return resource_ref def resource_get_all_by_stack(context, stack_id, filters=None): query = context.session.query( models.Resource ).filter_by( stack_id=stack_id ).options(orm.joinedload("data")) query = db_filters.exact_filter(query, models.Resource, filters) results = query.all() return dict((res.name, res) for res in results) def resource_get_all_active_by_stack(context, stack_id): filters = {'stack_id': stack_id, 'action': 'DELETE', 'status': 'COMPLETE'} subquery = context.session.query(models.Resource.id).filter_by(**filters) results = context.session.query(models.Resource).filter_by( stack_id=stack_id).filter( models.Resource.id.notin_(subquery.as_scalar()) ).options(orm.joinedload("data")).all() return dict((res.id, res) for res in results) def resource_get_all_by_root_stack(context, stack_id, filters=None): query = context.session.query( models.Resource ).filter_by( root_stack_id=stack_id ).options(orm.joinedload("data")) query = db_filters.exact_filter(query, models.Resource, filters) results = query.all() return dict((res.id, res) for res in results) def stack_get_by_name_and_owner_id(context, stack_name, owner_id): query = soft_delete_aware_query( context, models.Stack ).options(orm.joinedload("raw_template")).filter(sqlalchemy.or_( models.Stack.tenant == context.tenant_id, models.Stack.stack_user_project_id == context.tenant_id) ).filter_by(name=stack_name).filter_by(owner_id=owner_id) return query.first() def stack_get_by_name(context, stack_name): query = soft_delete_aware_query( context, models.Stack ).options(orm.joinedload("raw_template")).filter(sqlalchemy.or_( models.Stack.tenant == context.tenant_id, models.Stack.stack_user_project_id == context.tenant_id) ).filter_by(name=stack_name) return query.first() def stack_get(context, stack_id, show_deleted=False): query = context.session.query(models.Stack).options( orm.joinedload("raw_template")) result = query.get(stack_id) deleted_ok = show_deleted or context.show_deleted if result is None or result.deleted_at is not None and not deleted_ok: return None # One exception to normal project scoping is users created by the # stacks in the stack_user_project_id (in the heat stack user domain) if (result is not None and context is not None and not context.is_admin and context.tenant_id not in (result.tenant, result.stack_user_project_id)): return None return result def stack_get_status(context, stack_id): query = context.session.query(models.Stack) query = query.options( orm.load_only("action", "status", "status_reason", "updated_at")) result = query.filter_by(id=stack_id).first() if result is None: raise exception.NotFound(_('Stack with id %s not found') % stack_id) return (result.action, result.status, result.status_reason, result.updated_at) def stack_get_all_by_owner_id(context, owner_id): results = soft_delete_aware_query( context, models.Stack).filter_by(owner_id=owner_id).all() return results def stack_get_all_by_root_owner_id(context, owner_id): for stack in stack_get_all_by_owner_id(context, owner_id): yield stack for ch_st in stack_get_all_by_root_owner_id(context, stack.id): yield ch_st def _get_sort_keys(sort_keys, mapping): """Returns an array containing only whitelisted keys :param sort_keys: an array of strings :param mapping: a mapping from keys to DB column names :returns: filtered list of sort keys """ if isinstance(sort_keys, six.string_types): sort_keys = [sort_keys] return [mapping[key] for key in sort_keys or [] if key in mapping] def _paginate_query(context, query, model, limit=None, sort_keys=None, marker=None, sort_dir=None): default_sort_keys = ['created_at'] if not sort_keys: sort_keys = default_sort_keys if not sort_dir: sort_dir = 'desc' # This assures the order of the stacks will always be the same # even for sort_key values that are not unique in the database sort_keys = sort_keys + ['id'] model_marker = None if marker: model_marker = context.session.query(model).get(marker) try: query = utils.paginate_query(query, model, limit, sort_keys, model_marker, sort_dir) except utils.InvalidSortKey as exc: err_msg = encodeutils.exception_to_unicode(exc) raise exception.Invalid(reason=err_msg) return query def _query_stack_get_all(context, show_deleted=False, show_nested=False, show_hidden=False, tags=None, tags_any=None, not_tags=None, not_tags_any=None): if show_nested: query = soft_delete_aware_query( context, models.Stack, show_deleted=show_deleted ).filter_by(backup=False) else: query = soft_delete_aware_query( context, models.Stack, show_deleted=show_deleted ).filter_by(owner_id=None) if not context.is_admin: query = query.filter_by(tenant=context.tenant_id) query = query.options(orm.subqueryload("tags")) if tags: for tag in tags: tag_alias = orm_aliased(models.StackTag) query = query.join(tag_alias, models.Stack.tags) query = query.filter(tag_alias.tag == tag) if tags_any: query = query.filter( models.Stack.tags.any( models.StackTag.tag.in_(tags_any))) if not_tags: subquery = soft_delete_aware_query( context, models.Stack, show_deleted=show_deleted ) for tag in not_tags: tag_alias = orm_aliased(models.StackTag) subquery = subquery.join(tag_alias, models.Stack.tags) subquery = subquery.filter(tag_alias.tag == tag) not_stack_ids = [s.id for s in subquery.all()] query = query.filter(models.Stack.id.notin_(not_stack_ids)) if not_tags_any: query = query.filter( ~models.Stack.tags.any( models.StackTag.tag.in_(not_tags_any))) if not show_hidden and cfg.CONF.hidden_stack_tags: query = query.filter( ~models.Stack.tags.any( models.StackTag.tag.in_(cfg.CONF.hidden_stack_tags))) return query def stack_get_all(context, limit=None, sort_keys=None, marker=None, sort_dir=None, filters=None, show_deleted=False, show_nested=False, show_hidden=False, tags=None, tags_any=None, not_tags=None, not_tags_any=None): query = _query_stack_get_all(context, show_deleted=show_deleted, show_nested=show_nested, show_hidden=show_hidden, tags=tags, tags_any=tags_any, not_tags=not_tags, not_tags_any=not_tags_any) query = query.options(orm.joinedload("raw_template")) return _filter_and_page_query(context, query, limit, sort_keys, marker, sort_dir, filters).all() def _filter_and_page_query(context, query, limit=None, sort_keys=None, marker=None, sort_dir=None, filters=None): if filters is None: filters = {} sort_key_map = {rpc_api.STACK_NAME: models.Stack.name.key, rpc_api.STACK_STATUS: models.Stack.status.key, rpc_api.STACK_CREATION_TIME: models.Stack.created_at.key, rpc_api.STACK_UPDATED_TIME: models.Stack.updated_at.key} whitelisted_sort_keys = _get_sort_keys(sort_keys, sort_key_map) query = db_filters.exact_filter(query, models.Stack, filters) return _paginate_query(context, query, models.Stack, limit, whitelisted_sort_keys, marker, sort_dir) def stack_count_all(context, filters=None, show_deleted=False, show_nested=False, show_hidden=False, tags=None, tags_any=None, not_tags=None, not_tags_any=None): query = _query_stack_get_all(context, show_deleted=show_deleted, show_nested=show_nested, show_hidden=show_hidden, tags=tags, tags_any=tags_any, not_tags=not_tags, not_tags_any=not_tags_any) query = db_filters.exact_filter(query, models.Stack, filters) return query.count() def stack_create(context, values): stack_ref = models.Stack() stack_ref.update(values) stack_ref.save(context.session) return stack_ref @oslo_db_api.wrap_db_retry(max_retries=3, retry_on_deadlock=True, retry_interval=0.5, inc_retry_interval=True) def stack_update(context, stack_id, values, exp_trvsl=None): stack = stack_get(context, stack_id) if stack is None: raise exception.NotFound(_('Attempt to update a stack with id: ' '%(id)s %(msg)s') % { 'id': stack_id, 'msg': 'that does not exist'}) if (exp_trvsl is not None and stack.current_traversal != exp_trvsl): # stack updated by another update return False session = context.session with session.begin(subtransactions=True): rows_updated = (session.query(models.Stack) .filter(models.Stack.id == stack.id) .filter(models.Stack.current_traversal == stack.current_traversal) .update(values, synchronize_session=False)) session.expire_all() return (rows_updated is not None and rows_updated > 0) def stack_delete(context, stack_id): s = stack_get(context, stack_id) if not s: raise exception.NotFound(_('Attempt to delete a stack with id: ' '%(id)s %(msg)s') % { 'id': stack_id, 'msg': 'that does not exist'}) session = context.session with session.begin(): for r in s.resources: session.delete(r) delete_softly(context, s) @oslo_db_api.wrap_db_retry(max_retries=3, retry_on_deadlock=True, retry_interval=0.5, inc_retry_interval=True) def stack_lock_create(context, stack_id, engine_id): session = get_session() with session.begin(): lock = session.query(models.StackLock).get(stack_id) if lock is not None: return lock.engine_id session.add(models.StackLock(stack_id=stack_id, engine_id=engine_id)) def stack_lock_get_engine_id(context, stack_id): session = get_session() with session.begin(): lock = session.query(models.StackLock).get(stack_id) if lock is not None: return lock.engine_id def persist_state_and_release_lock(context, stack_id, engine_id, values): session = context.session with session.begin(): rows_updated = (session.query(models.Stack) .filter(models.Stack.id == stack_id) .update(values, synchronize_session=False)) rows_affected = None if rows_updated is not None and rows_updated > 0: rows_affected = session.query( models.StackLock ).filter_by(stack_id=stack_id, engine_id=engine_id).delete() session.expire_all() if not rows_affected: return True def stack_lock_steal(context, stack_id, old_engine_id, new_engine_id): session = get_session() with session.begin(): lock = session.query(models.StackLock).get(stack_id) rows_affected = session.query( models.StackLock ).filter_by(stack_id=stack_id, engine_id=old_engine_id ).update({"engine_id": new_engine_id}) if not rows_affected: return lock.engine_id if lock is not None else True def stack_lock_release(context, stack_id, engine_id): session = get_session() with session.begin(): rows_affected = session.query( models.StackLock ).filter_by(stack_id=stack_id, engine_id=engine_id).delete() if not rows_affected: return True def stack_get_root_id(context, stack_id): s = stack_get(context, stack_id) if not s: return None while s.owner_id: s = stack_get(context, s.owner_id) return s.id def stack_count_total_resources(context, stack_id): # count all resources which belong to the root stack results = context.session.query( models.Resource ).filter(models.Resource.root_stack_id == stack_id).count() return results def user_creds_create(context): values = context.to_dict() user_creds_ref = models.UserCreds() if values.get('trust_id'): method, trust_id = crypt.encrypt(values.get('trust_id')) user_creds_ref.trust_id = trust_id user_creds_ref.decrypt_method = method user_creds_ref.trustor_user_id = values.get('trustor_user_id') user_creds_ref.username = None user_creds_ref.password = None user_creds_ref.tenant = values.get('tenant') user_creds_ref.tenant_id = values.get('tenant_id') user_creds_ref.auth_url = values.get('auth_url') user_creds_ref.region_name = values.get('region_name') else: user_creds_ref.update(values) method, password = crypt.encrypt(values['password']) if len(six.text_type(password)) > 255: raise exception.Error(_("Length of OS_PASSWORD after encryption" " exceeds Heat limit (255 chars)")) user_creds_ref.password = password user_creds_ref.decrypt_method = method user_creds_ref.save(context.session) result = dict(user_creds_ref) if values.get('trust_id'): result['trust_id'] = values.get('trust_id') else: result['password'] = values.get('password') return result def user_creds_get(context, user_creds_id): db_result = context.session.query(models.UserCreds).get(user_creds_id) if db_result is None: return None # Return a dict copy of db results, do not decrypt details into db_result # or it can be committed back to the DB in decrypted form result = dict(db_result) del result['decrypt_method'] result['password'] = crypt.decrypt( db_result.decrypt_method, result['password']) result['trust_id'] = crypt.decrypt( db_result.decrypt_method, result['trust_id']) return result @db_utils.retry_on_stale_data_error def user_creds_delete(context, user_creds_id): creds = context.session.query(models.UserCreds).get(user_creds_id) if not creds: raise exception.NotFound( _('Attempt to delete user creds with id ' '%(id)s that does not exist') % {'id': user_creds_id}) session = orm_session.Session.object_session(creds) with session.begin(): session.delete(creds) def event_get(context, event_id): result = context.session.query(models.Event).get(event_id) return result def event_get_all(context): stacks = soft_delete_aware_query(context, models.Stack) stack_ids = [stack.id for stack in stacks] results = context.session.query( models.Event ).filter(models.Event.stack_id.in_(stack_ids)).all() return results def event_get_all_by_tenant(context, limit=None, marker=None, sort_keys=None, sort_dir=None, filters=None): query = context.session.query(models.Event) query = db_filters.exact_filter(query, models.Event, filters) query = query.join( models.Event.stack ).filter_by(tenant=context.tenant_id).filter_by(deleted_at=None) filters = None return _events_filter_and_page_query(context, query, limit, marker, sort_keys, sort_dir, filters).all() def _query_all_by_stack(context, stack_id): query = context.session.query(models.Event).filter_by(stack_id=stack_id) return query def event_get_all_by_stack(context, stack_id, limit=None, marker=None, sort_keys=None, sort_dir=None, filters=None): query = _query_all_by_stack(context, stack_id) return _events_filter_and_page_query(context, query, limit, marker, sort_keys, sort_dir, filters).all() def _events_paginate_query(context, query, model, limit=None, sort_keys=None, marker=None, sort_dir=None): default_sort_keys = ['created_at'] if not sort_keys: sort_keys = default_sort_keys if not sort_dir: sort_dir = 'desc' # This assures the order of the stacks will always be the same # even for sort_key values that are not unique in the database sort_keys = sort_keys + ['id'] model_marker = None if marker: # not to use context.session.query(model).get(marker), because # user can only see the ID(column 'uuid') and the ID as the marker model_marker = context.session.query( model).filter_by(uuid=marker).first() try: query = utils.paginate_query(query, model, limit, sort_keys, model_marker, sort_dir) except utils.InvalidSortKey as exc: err_msg = encodeutils.exception_to_unicode(exc) raise exception.Invalid(reason=err_msg) return query def _events_filter_and_page_query(context, query, limit=None, marker=None, sort_keys=None, sort_dir=None, filters=None): if filters is None: filters = {} sort_key_map = {rpc_api.EVENT_TIMESTAMP: models.Event.created_at.key, rpc_api.EVENT_RES_TYPE: models.Event.resource_type.key} whitelisted_sort_keys = _get_sort_keys(sort_keys, sort_key_map) query = db_filters.exact_filter(query, models.Event, filters) return _events_paginate_query(context, query, models.Event, limit, whitelisted_sort_keys, marker, sort_dir) def event_count_all_by_stack(context, stack_id): query = context.session.query(func.count(models.Event.id)) return query.filter_by(stack_id=stack_id).scalar() def _delete_event_rows(context, stack_id, limit): # MySQL does not support LIMIT in subqueries, # sqlite does not support JOIN in DELETE. # So we must manually supply the IN() values. # pgsql SHOULD work with the pure DELETE/JOIN below but that must be # confirmed via integration tests. query = _query_all_by_stack(context, stack_id) session = context.session ids = [r.id for r in query.order_by( models.Event.id).limit(limit).all()] q = session.query(models.Event).filter( models.Event.id.in_(ids)) return q.delete(synchronize_session='fetch') def event_create(context, values): if 'stack_id' in values and cfg.CONF.max_events_per_stack: if ((event_count_all_by_stack(context, values['stack_id']) >= cfg.CONF.max_events_per_stack)): # prune _delete_event_rows( context, values['stack_id'], cfg.CONF.event_purge_batch_size) event_ref = models.Event() event_ref.update(values) event_ref.save(context.session) return event_ref def watch_rule_get(context, watch_rule_id): result = context.session.query(models.WatchRule).get(watch_rule_id) return result def watch_rule_get_by_name(context, watch_rule_name): result = context.session.query( models.WatchRule).filter_by(name=watch_rule_name).first() return result def watch_rule_get_all(context): results = context.session.query(models.WatchRule).all() return results def watch_rule_get_all_by_stack(context, stack_id): results = context.session.query( models.WatchRule).filter_by(stack_id=stack_id).all() return results def watch_rule_create(context, values): obj_ref = models.WatchRule() obj_ref.update(values) obj_ref.save(context.session) return obj_ref def watch_rule_update(context, watch_id, values): wr = watch_rule_get(context, watch_id) if not wr: raise exception.NotFound(_('Attempt to update a watch with id: ' '%(id)s %(msg)s') % { 'id': watch_id, 'msg': 'that does not exist'}) wr.update(values) wr.save(context.session) def watch_rule_delete(context, watch_id): wr = watch_rule_get(context, watch_id) if not wr: raise exception.NotFound(_('Attempt to delete watch_rule: ' '%(id)s %(msg)s') % { 'id': watch_id, 'msg': 'that does not exist'}) session = orm_session.Session.object_session(wr) with session.begin(): for d in wr.watch_data: session.delete(d) session.delete(wr) def watch_data_create(context, values): obj_ref = models.WatchData() obj_ref.update(values) obj_ref.save(context.session) return obj_ref def watch_data_get_all(context): results = context.session.query(models.WatchData).all() return results def watch_data_get_all_by_watch_rule_id(context, watch_rule_id): results = context.session.query(models.WatchData).filter_by( watch_rule_id=watch_rule_id).all() return results def software_config_create(context, values): obj_ref = models.SoftwareConfig() obj_ref.update(values) obj_ref.save(context.session) return obj_ref def software_config_get(context, config_id): result = context.session.query(models.SoftwareConfig).get(config_id) if (result is not None and context is not None and result.tenant != context.tenant_id): result = None if not result: raise exception.NotFound(_('Software config with id %s not found') % config_id) return result def software_config_get_all(context, limit=None, marker=None): query = context.session.query(models.SoftwareConfig) if not context.is_admin: query = query.filter_by(tenant=context.tenant_id) return _paginate_query(context, query, models.SoftwareConfig, limit=limit, marker=marker).all() def software_config_delete(context, config_id): config = software_config_get(context, config_id) # Query if the software config has been referenced by deployment. result = context.session.query(models.SoftwareDeployment).filter_by( config_id=config_id).first() if result: msg = (_("Software config with id %s can not be deleted as " "it is referenced.") % config_id) raise exception.InvalidRestrictedAction(message=msg) session = orm_session.Session.object_session(config) with session.begin(): session.delete(config) def software_deployment_create(context, values): obj_ref = models.SoftwareDeployment() obj_ref.update(values) session = context.session session.begin() obj_ref.save(session) session.commit() return obj_ref def software_deployment_get(context, deployment_id): result = context.session.query( models.SoftwareDeployment).get(deployment_id) if (result is not None and context is not None and context.tenant_id not in (result.tenant, result.stack_user_project_id)): result = None if not result: raise exception.NotFound(_('Deployment with id %s not found') % deployment_id) return result def software_deployment_get_all(context, server_id=None): sd = models.SoftwareDeployment query = context.session.query( sd ).filter(sqlalchemy.or_( sd.tenant == context.tenant_id, sd.stack_user_project_id == context.tenant_id) ).order_by(sd.created_at) if server_id: query = query.filter_by(server_id=server_id) return query.all() def software_deployment_update(context, deployment_id, values): deployment = software_deployment_get(context, deployment_id) update_and_save(context, deployment, values) return deployment def software_deployment_delete(context, deployment_id): deployment = software_deployment_get(context, deployment_id) session = context.session with session.begin(subtransactions=True): session.delete(deployment) def snapshot_create(context, values): obj_ref = models.Snapshot() obj_ref.update(values) obj_ref.save(context.session) return obj_ref def snapshot_get(context, snapshot_id): result = context.session.query(models.Snapshot).get(snapshot_id) if (result is not None and context is not None and context.tenant_id != result.tenant): result = None if not result: raise exception.NotFound(_('Snapshot with id %s not found') % snapshot_id) return result def snapshot_get_by_stack(context, snapshot_id, stack): snapshot = snapshot_get(context, snapshot_id) if snapshot.stack_id != stack.id: raise exception.SnapshotNotFound(snapshot=snapshot_id, stack=stack.name) return snapshot def snapshot_update(context, snapshot_id, values): snapshot = snapshot_get(context, snapshot_id) snapshot.update(values) snapshot.save(context.session) return snapshot def snapshot_delete(context, snapshot_id): snapshot = snapshot_get(context, snapshot_id) session = orm_session.Session.object_session(snapshot) with session.begin(): session.delete(snapshot) def snapshot_get_all(context, stack_id): return context.session.query(models.Snapshot).filter_by( stack_id=stack_id, tenant=context.tenant_id) def service_create(context, values): service = models.Service() service.update(values) service.save(context.session) return service def service_update(context, service_id, values): service = service_get(context, service_id) values.update({'updated_at': timeutils.utcnow()}) service.update(values) service.save(context.session) return service def service_delete(context, service_id, soft_delete=True): service = service_get(context, service_id) session = context.session with session.begin(): if soft_delete: delete_softly(context, service) else: session.delete(service) def service_get(context, service_id): result = context.session.query(models.Service).get(service_id) if result is None: raise exception.EntityNotFound(entity='Service', name=service_id) return result def service_get_all(context): return (context.session.query(models.Service). filter_by(deleted_at=None).all()) def service_get_all_by_args(context, host, binary, hostname): return (context.session.query(models.Service). filter_by(host=host). filter_by(binary=binary). filter_by(hostname=hostname).all()) def purge_deleted(age, granularity='days', project_id=None): try: age = int(age) except ValueError: raise exception.Error(_("age should be an integer")) if age < 0: raise exception.Error(_("age should be a positive integer")) if granularity not in ('days', 'hours', 'minutes', 'seconds'): raise exception.Error( _("granularity should be days, hours, minutes, or seconds")) if granularity == 'days': age = age * 86400 elif granularity == 'hours': age = age * 3600 elif granularity == 'minutes': age = age * 60 time_line = timeutils.utcnow() - datetime.timedelta(seconds=age) engine = get_engine() meta = sqlalchemy.MetaData() meta.bind = engine stack = sqlalchemy.Table('stack', meta, autoload=True) stack_lock = sqlalchemy.Table('stack_lock', meta, autoload=True) stack_tag = sqlalchemy.Table('stack_tag', meta, autoload=True) resource = sqlalchemy.Table('resource', meta, autoload=True) resource_data = sqlalchemy.Table('resource_data', meta, autoload=True) event = sqlalchemy.Table('event', meta, autoload=True) raw_template = sqlalchemy.Table('raw_template', meta, autoload=True) raw_template_files = sqlalchemy.Table('raw_template_files', meta, autoload=True) user_creds = sqlalchemy.Table('user_creds', meta, autoload=True) service = sqlalchemy.Table('service', meta, autoload=True) syncpoint = sqlalchemy.Table('sync_point', meta, autoload=True) # find the soft-deleted stacks that are past their expiry if project_id: stack_where = sqlalchemy.select([ stack.c.id, stack.c.raw_template_id, stack.c.prev_raw_template_id, stack.c.user_creds_id]).where(and_( stack.c.tenant == project_id, stack.c.deleted_at < time_line)) else: stack_where = sqlalchemy.select([ stack.c.id, stack.c.raw_template_id, stack.c.prev_raw_template_id, stack.c.user_creds_id]).where( stack.c.deleted_at < time_line) stacks = list(engine.execute(stack_where)) if stacks: stack_ids = [i[0] for i in stacks] # delete stack locks (just in case some got stuck) stack_lock_del = stack_lock.delete().where( stack_lock.c.stack_id.in_(stack_ids)) engine.execute(stack_lock_del) # delete stack tags stack_tag_del = stack_tag.delete().where( stack_tag.c.stack_id.in_(stack_ids)) engine.execute(stack_tag_del) # delete resource_data res_where = sqlalchemy.select([resource.c.id]).where( resource.c.stack_id.in_(stack_ids)) res_data_del = resource_data.delete().where( resource_data.c.resource_id.in_(res_where)) engine.execute(res_data_del) # delete resources res_del = resource.delete().where(resource.c.stack_id.in_(stack_ids)) engine.execute(res_del) # delete events event_del = event.delete().where(event.c.stack_id.in_(stack_ids)) engine.execute(event_del) # clean up any sync_points that may have lingered sync_del = syncpoint.delete().where( syncpoint.c.stack_id.in_(stack_ids)) engine.execute(sync_del) # delete the stacks stack_del = stack.delete().where(stack.c.id.in_(stack_ids)) engine.execute(stack_del) # delete orphaned raw templates raw_template_ids = [i[1] for i in stacks if i[1] is not None] raw_template_ids.extend(i[2] for i in stacks if i[2] is not None) if raw_template_ids: # keep those still referenced raw_tmpl_sel = sqlalchemy.select([stack.c.raw_template_id]).where( stack.c.raw_template_id.in_(raw_template_ids)) raw_tmpl = [i[0] for i in engine.execute(raw_tmpl_sel)] raw_template_ids = set(raw_template_ids) - set(raw_tmpl) raw_tmpl_sel = sqlalchemy.select( [stack.c.prev_raw_template_id]).where( stack.c.prev_raw_template_id.in_(raw_template_ids)) raw_tmpl = [i[0] for i in engine.execute(raw_tmpl_sel)] raw_template_ids = raw_template_ids - set(raw_tmpl) raw_tmpl_file_sel = sqlalchemy.select( [raw_template.c.files_id]).where( raw_template.c.id.in_(raw_template_ids)) raw_tmpl_file_ids = [i[0] for i in engine.execute( raw_tmpl_file_sel)] raw_templ_del = raw_template.delete().where( raw_template.c.id.in_(raw_template_ids)) engine.execute(raw_templ_del) # purge any raw_template_files that are no longer referenced if raw_tmpl_file_ids: raw_tmpl_file_sel = sqlalchemy.select( [raw_template.c.files_id]).where( raw_template.c.files_id.in_(raw_tmpl_file_ids)) raw_tmpl_files = [i[0] for i in engine.execute( raw_tmpl_file_sel)] raw_tmpl_file_ids = set(raw_tmpl_file_ids) \ - set(raw_tmpl_files) raw_tmpl_file_del = raw_template_files.delete().where( raw_template_files.c.id.in_(raw_tmpl_file_ids)) engine.execute(raw_tmpl_file_del) # purge any user creds that are no longer referenced user_creds_ids = [i[3] for i in stacks if i[3] is not None] if user_creds_ids: # keep those still referenced user_sel = sqlalchemy.select([stack.c.user_creds_id]).where( stack.c.user_creds_id.in_(user_creds_ids)) users = [i[0] for i in engine.execute(user_sel)] user_creds_ids = set(user_creds_ids) - set(users) usr_creds_del = user_creds.delete().where( user_creds.c.id.in_(user_creds_ids)) engine.execute(usr_creds_del) # Purge deleted services srvc_del = service.delete().where(service.c.deleted_at < time_line) engine.execute(srvc_del) def sync_point_delete_all_by_stack_and_traversal(context, stack_id, traversal_id): rows_deleted = context.session.query(models.SyncPoint).filter_by( stack_id=stack_id, traversal_id=traversal_id).delete() return rows_deleted @oslo_db_api.wrap_db_retry(max_retries=3, retry_on_deadlock=True, retry_interval=0.5, inc_retry_interval=True) def sync_point_create(context, values): values['entity_id'] = str(values['entity_id']) sync_point_ref = models.SyncPoint() sync_point_ref.update(values) sync_point_ref.save(context.session) return sync_point_ref def sync_point_get(context, entity_id, traversal_id, is_update): entity_id = str(entity_id) return context.session.query(models.SyncPoint).get( (entity_id, traversal_id, is_update) ) def sync_point_update_input_data(context, entity_id, traversal_id, is_update, atomic_key, input_data): entity_id = str(entity_id) rows_updated = context.session.query(models.SyncPoint).filter_by( entity_id=entity_id, traversal_id=traversal_id, is_update=is_update, atomic_key=atomic_key ).update({"input_data": input_data, "atomic_key": atomic_key + 1}) return rows_updated def db_sync(engine, version=None): """Migrate the database to `version` or the most recent version.""" if version is not None and int(version) < db_version(engine): raise exception.Error(_("Cannot migrate to lower schema version.")) return migration.db_sync(engine, version=version) def db_version(engine): """Display the current database version.""" return migration.db_version(engine) def db_encrypt_parameters_and_properties(ctxt, encryption_key, batch_size=50, verbose=False): """Encrypt parameters and properties for all templates in db. :param ctxt: RPC context :param encryption_key: key that will be used for parameter and property encryption :param batch_size: number of templates requested from db in each iteration. 50 means that heat requests 50 templates, encrypt them and proceed with next 50 items. :param verbose: log an INFO message when processing of each raw_template or resource begins or ends :return: list of exceptions encountered during encryption """ from heat.engine import template session = get_session() with session.begin(): query = session.query(models.RawTemplate) excs = [] for raw_template in _get_batch( session=session, ctxt=ctxt, query=query, model=models.RawTemplate, batch_size=batch_size): try: if verbose: LOG.info(_LI("Processing raw_template %(id)d..."), {'id': raw_template.id}) tmpl = template.Template.load( ctxt, raw_template.id, raw_template) param_schemata = tmpl.param_schemata() env = raw_template.environment if (not env or 'parameters' not in env or not param_schemata): continue if 'encrypted_param_names' in env: encrypted_params = env['encrypted_param_names'] else: encrypted_params = [] for param_name, param_val in env['parameters'].items(): if (param_name in encrypted_params or param_name not in param_schemata or not param_schemata[param_name].hidden): continue encrypted_val = crypt.encrypt(six.text_type(param_val), encryption_key) env['parameters'][param_name] = encrypted_val encrypted_params.append(param_name) if encrypted_params: environment = env.copy() environment['encrypted_param_names'] = encrypted_params raw_template_update(ctxt, raw_template.id, {'environment': environment}) except Exception as exc: LOG.exception(_LE('Failed to encrypt parameters of raw ' 'template %(id)d'), {'id': raw_template.id}) excs.append(exc) continue finally: if verbose: LOG.info(_LI("Finished processing raw_template " "%(id)d."), {'id': raw_template.id}) query = session.query(models.Resource).filter( ~models.Resource.properties_data.is_(None), ~models.Resource.properties_data_encrypted.is_(True)) for resource in _get_batch( session=session, ctxt=ctxt, query=query, model=models.Resource, batch_size=batch_size): try: if verbose: LOG.info(_LI("Processing resource %(id)d..."), {'id': resource.id}) result = {} if not resource.properties_data: continue for prop_name, prop_value in resource.properties_data.items(): prop_string = jsonutils.dumps(prop_value) encrypted_value = crypt.encrypt(prop_string, encryption_key) result[prop_name] = encrypted_value resource.properties_data = result resource.properties_data_encrypted = True resource_update(ctxt, resource.id, {'properties_data': result, 'properties_data_encrypted': True}, resource.atomic_key) except Exception as exc: LOG.exception(_LE('Failed to encrypt properties_data of ' 'resource %(id)d'), {'id': resource.id}) excs.append(exc) continue finally: if verbose: LOG.info(_LI("Finished processing resource " "%(id)d."), {'id': resource.id}) return excs def db_decrypt_parameters_and_properties(ctxt, encryption_key, batch_size=50, verbose=False): """Decrypt parameters and properties for all templates in db. :param ctxt: RPC context :param encryption_key: key that will be used for parameter and property decryption :param batch_size: number of templates requested from db in each iteration. 50 means that heat requests 50 templates, encrypt them and proceed with next 50 items. :param verbose: log an INFO message when processing of each raw_template or resource begins or ends :return: list of exceptions encountered during decryption """ session = get_session() excs = [] with session.begin(): query = session.query(models.RawTemplate) for raw_template in _get_batch( session=session, ctxt=ctxt, query=query, model=models.RawTemplate, batch_size=batch_size): try: if verbose: LOG.info(_LI("Processing raw_template %(id)d..."), {'id': raw_template.id}) parameters = raw_template.environment['parameters'] encrypted_params = raw_template.environment[ 'encrypted_param_names'] for param_name in encrypted_params: method, value = parameters[param_name] decrypted_val = crypt.decrypt(method, value, encryption_key) parameters[param_name] = decrypted_val environment = raw_template.environment.copy() environment['encrypted_param_names'] = [] raw_template_update(ctxt, raw_template.id, {'environment': environment}) except Exception as exc: LOG.exception(_LE('Failed to decrypt parameters of raw ' 'template %(id)d'), {'id': raw_template.id}) excs.append(exc) continue finally: if verbose: LOG.info(_LI("Finished processing raw_template " "%(id)d."), {'id': raw_template.id}) query = session.query(models.Resource).filter( ~models.Resource.properties_data.is_(None), models.Resource.properties_data_encrypted.is_(True)) for resource in _get_batch( session=session, ctxt=ctxt, query=query, model=models.Resource, batch_size=batch_size): try: if verbose: LOG.info(_LI("Processing resource %(id)d..."), {'id': resource.id}) result = {} for prop_name, prop_value in resource.properties_data.items(): method, value = prop_value decrypted_value = crypt.decrypt(method, value, encryption_key) prop_string = jsonutils.loads(decrypted_value) result[prop_name] = prop_string resource.properties_data = result resource.properties_data_encrypted = False resource_update(ctxt, resource.id, {'properties_data': result, 'properties_data_encrypted': False}, resource.atomic_key) except Exception as exc: LOG.exception(_LE('Failed to decrypt properties_data of ' 'resource %(id)d'), {'id': resource.id}) excs.append(exc) continue finally: if verbose: LOG.info(_LI("Finished processing resource " "%(id)d."), {'id': resource.id}) return excs def _get_batch(session, ctxt, query, model, batch_size=50): last_batch_marker = None while True: results = _paginate_query( context=ctxt, query=query, model=model, limit=batch_size, marker=last_batch_marker).all() if not results: break else: for result in results: yield result last_batch_marker = results[-1].id def reset_stack_status(context, stack_id, stack=None): if stack is None: stack = context.session.query(models.Stack).get(stack_id) if stack is None: raise exception.NotFound(_('Stack with id %s not found') % stack_id) session = context.session with session.begin(): query = context.session.query(models.Resource).filter_by( status='IN_PROGRESS', stack_id=stack_id) query.update({'status': 'FAILED', 'status_reason': 'Stack status manually reset'}) query = context.session.query(models.ResourceData) query = query.join(models.Resource) query = query.filter_by(stack_id=stack_id) query = query.filter( models.ResourceData.key.in_(heat_environment.HOOK_TYPES)) data_ids = [data.id for data in query] if data_ids: query = context.session.query(models.ResourceData) query = query.filter(models.ResourceData.id.in_(data_ids)) query.delete(synchronize_session='fetch') query = context.session.query(models.Stack).filter_by(owner_id=stack_id) for child in query: reset_stack_status(context, child.id, child) with session.begin(): if stack.status == 'IN_PROGRESS': stack.status = 'FAILED' stack.status_reason = 'Stack status manually reset' session.query( models.StackLock ).filter_by(stack_id=stack_id).delete()
cwolferh/heat-scratch
heat/db/sqlalchemy/api.py
Python
apache-2.0
57,779
#!/usr/bin/env python # # Copyright 2008, Google Inc. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. r"""Tests the text output of Google C++ Mocking Framework. To update the golden file: gmock_output_test.py --build_dir=BUILD/DIR --gengolden where BUILD/DIR contains the built gmock_output_test_ file. gmock_output_test.py --gengolden gmock_output_test.py """ from io import open # pylint: disable=redefined-builtin, g-importing-member import os import re import sys from googlemock.test import gmock_test_utils # The flag for generating the golden file GENGOLDEN_FLAG = '--gengolden' PROGRAM_PATH = gmock_test_utils.GetTestExecutablePath('gmock_output_test_') COMMAND = [PROGRAM_PATH, '--gtest_stack_trace_depth=0', '--gtest_print_time=0'] GOLDEN_NAME = 'gmock_output_test_golden.txt' GOLDEN_PATH = os.path.join(gmock_test_utils.GetSourceDir(), GOLDEN_NAME) def ToUnixLineEnding(s): """Changes all Windows/Mac line endings in s to UNIX line endings.""" return s.replace('\r\n', '\n').replace('\r', '\n') def RemoveReportHeaderAndFooter(output): """Removes Google Test result report's header and footer from the output.""" output = re.sub(r'.*gtest_main.*\n', '', output) output = re.sub(r'\[.*\d+ tests.*\n', '', output) output = re.sub(r'\[.* test environment .*\n', '', output) output = re.sub(r'\[=+\] \d+ tests .* ran.*', '', output) output = re.sub(r'.* FAILED TESTS\n', '', output) return output def RemoveLocations(output): """Removes all file location info from a Google Test program's output. Args: output: the output of a Google Test program. Returns: output with all file location info (in the form of 'DIRECTORY/FILE_NAME:LINE_NUMBER: 'or 'DIRECTORY\\FILE_NAME(LINE_NUMBER): ') replaced by 'FILE:#: '. """ return re.sub(r'.*[/\\](.+)(\:\d+|\(\d+\))\:', 'FILE:#:', output) def NormalizeErrorMarker(output): """Normalizes the error marker, which is different on Windows vs on Linux.""" return re.sub(r' error: ', ' Failure\n', output) def RemoveMemoryAddresses(output): """Removes memory addresses from the test output.""" return re.sub(r'@\w+', '@0x#', output) def RemoveTestNamesOfLeakedMocks(output): """Removes the test names of leaked mock objects from the test output.""" return re.sub(r'\(used in test .+\) ', '', output) def GetLeakyTests(output): """Returns a list of test names that leak mock objects.""" # findall() returns a list of all matches of the regex in output. # For example, if '(used in test FooTest.Bar)' is in output, the # list will contain 'FooTest.Bar'. return re.findall(r'\(used in test (.+)\)', output) def GetNormalizedOutputAndLeakyTests(output): """Normalizes the output of gmock_output_test_. Args: output: The test output. Returns: A tuple (the normalized test output, the list of test names that have leaked mocks). """ output = ToUnixLineEnding(output) output = RemoveReportHeaderAndFooter(output) output = NormalizeErrorMarker(output) output = RemoveLocations(output) output = RemoveMemoryAddresses(output) return (RemoveTestNamesOfLeakedMocks(output), GetLeakyTests(output)) def GetShellCommandOutput(cmd): """Runs a command in a sub-process, and returns its STDOUT in a string.""" return gmock_test_utils.Subprocess(cmd, capture_stderr=False).output def GetNormalizedCommandOutputAndLeakyTests(cmd): """Runs a command and returns its normalized output and a list of leaky tests. Args: cmd: the shell command. """ # Disables exception pop-ups on Windows. os.environ['GTEST_CATCH_EXCEPTIONS'] = '1' return GetNormalizedOutputAndLeakyTests(GetShellCommandOutput(cmd)) class GMockOutputTest(gmock_test_utils.TestCase): def testOutput(self): (output, leaky_tests) = GetNormalizedCommandOutputAndLeakyTests(COMMAND) golden_file = open(GOLDEN_PATH, 'rb') golden = golden_file.read().decode('utf-8') golden_file.close() # The normalized output should match the golden file. self.assertEquals(golden, output) # The raw output should contain 2 leaked mock object errors for # test GMockOutputTest.CatchesLeakedMocks. self.assertEquals(['GMockOutputTest.CatchesLeakedMocks', 'GMockOutputTest.CatchesLeakedMocks'], leaky_tests) if __name__ == '__main__': if sys.argv[1:] == [GENGOLDEN_FLAG]: (output, _) = GetNormalizedCommandOutputAndLeakyTests(COMMAND) golden_file = open(GOLDEN_PATH, 'wb') golden_file.write(output) golden_file.close() # Suppress the error "googletest was imported but a call to its main() # was never detected." os._exit(0) else: gmock_test_utils.Main()
grpc/grpc-ios
native_src/third_party/googletest/googlemock/test/gmock_output_test.py
Python
apache-2.0
6,175
import numpy as np from nilearn.image.image import check_niimg from nilearn.image.resampling import get_bounds from nilearn.image.image import _crop_img_to as crop_img_to def crop_img(img, rtol=1e-8, copy=True, return_slices=False, pad=True, percentile=None, return_affine=False): """Crops img as much as possible Will crop img, removing as many zero entries as possible without touching non-zero entries. Will leave one voxel of zero padding around the obtained non-zero area in order to avoid sampling issues later on. Parameters ---------- img: Niimg-like object See http://nilearn.github.io/manipulating_images/input_output.html img to be cropped. rtol: float relative tolerance (with respect to maximal absolute value of the image), under which values are considered negligeable and thus croppable. copy: boolean Specifies whether cropped data is copied or not. return_slices: boolean If True, the slices that define the cropped image will be returned. pad: boolean or integer If True, an extra slice in each direction will be added to the image. If integer > 0 then the pad width will be set to that integer. percentile: integer or None If not None, then the image will be crop out slices below the given percentile Returns ------- cropped_img: image Cropped version of the input image """ img = check_niimg(img) data = img.get_data() if percentile is not None: passes_threshold = data > np.percentile(data, percentile) else: infinity_norm = max(-data.min(), data.max()) passes_threshold = np.logical_or(data < -rtol * infinity_norm, data > rtol * infinity_norm) if data.ndim == 4: passes_threshold = np.any(passes_threshold, axis=-1) coords = np.array(np.where(passes_threshold)) start = coords.min(axis=1) end = coords.max(axis=1) + 1 if int(pad) > 0: pad_width = int(pad) # pad with one voxel to avoid resampling problems start = np.maximum(start - pad_width, 0) end = np.minimum(end + pad_width, data.shape[:3]) slices = [slice(s, e) for s, e in zip(start, end)] if return_slices: return slices if return_affine: return image_slices_to_affine(img, slices), end - start return crop_img_to(img, slices, copy=copy) def image_slices_to_affine(image, slices): affine = image.affine linear_part = affine[:3, :3] old_origin = affine[:3, 3] new_origin_voxel = np.array([s.start for s in slices]) new_origin = old_origin + linear_part.dot(new_origin_voxel) new_affine = np.eye(4) new_affine[:3, :3] = linear_part new_affine[:3, 3] = new_origin return new_affine def run_with_background_correction(func, image, background=None, returns_array=False, reset_background=True, axis=(-3, -2, -1), **kwargs): data = image.get_data() if background is None: background = get_background_values(data, axis=axis) # set background to zero data[:] -= background # perform function on image image = func(image, **kwargs) # set the background back to what it was originally if reset_background: if returns_array: # the function called should have returned an array data = image else: # the function called should have returned an image data = image.get_data() data[:] += background return image def get_background_values(data, axis=(-3, -2, -1)): background = data.min(axis=axis) if isinstance(background, np.ndarray): while len(background.shape) < len(data.shape): background = background[..., None] return background def reorder_affine(affine, shape): """ Modified from nilearn.image.resampling.reorder_img and nilearn.image.resampling.resample_img :param affine: :param shape: :return: """ Q, R = np.linalg.qr(affine[:3, :3]) _affine = np.diag(np.abs(np.diag(R))[np.abs(Q).argmax(axis=1)]) target_affine = np.eye(4) target_affine[:3, :3] = _affine transform_affine = np.linalg.inv(target_affine).dot(affine) (xmin, xmax), (ymin, ymax), (zmin, zmax) = get_bounds(shape[:3], transform_affine) offset = target_affine[:3, :3].dot([xmin, ymin, zmin]) target_affine[:3, 3] = offset return target_affine
ellisdg/3DUnetCNN
unet3d/utils/nilearn_custom_utils/nilearn_utils.py
Python
mit
4,512
from cyder.api.v1.tests.base import APITests from cyder.core.system.models import System from cyder.cydns.nameserver.models import Nameserver from cyder.cydns.soa.models import SOA from cyder.cydns.tests.utils import create_zone from cyder.cydhcp.interface.static_intr.models import StaticInterface from cyder.cydhcp.range.models import Range from cyder.cydhcp.network.models import Network from cyder.cydns.domain.models import Domain class StaticInterfaceV4API_Test(APITests): __test__ = True model = StaticInterface def create_data(self): Domain.objects.create(name='arpa') system = System.objects.create(name="TestSystem", ctnr=self.ctnr) Domain.objects.create(name='in-addr.arpa') create_zone('11.in-addr.arpa') net = Network.objects.create( network_str='11.12.14.0/8', ip_type='4') r = Range.objects.create( network=net, range_type='st', ip_type='4', start_str='11.12.14.253', end_str='11.12.14.254') self.ctnr.ranges.add(r) return StaticInterface.objects.create( ctnr=self.ctnr, description='Test Static Interface', ttl=420, mac='11:22:33:44:55:00', system=system, label='stat', domain=self.domain, dhcp_enabled=False, dns_enabled=True, ip_str='11.12.14.253', ip_type='4') class StaticInterfaceV6API_Test(APITests): __test__ = True model = StaticInterface def create_data(self): Domain.objects.create(name='arpa') system = System.objects.create(name="TestSystem", ctnr=self.ctnr) Domain.objects.create(name='ip6.arpa') create_zone('2.ip6.arpa') net = Network.objects.create(network_str='2001::/16', ip_type='6') r = Range.objects.create( network=net, range_type='st', ip_type='6', start_str='2001::1', end_str='2001:ffff:ffff:ffff:ffff:ffff:ffff:fffe') self.ctnr.ranges.add(r) return StaticInterface.objects.create( ctnr=self.ctnr, description='Test Static Interface', ttl=420, mac='11:22:33:44:55:00', system=system, label='stat', domain=self.domain, dhcp_enabled=False, dns_enabled=True, ip_str='2001:0db8:85a3:0000:0000:8a2e:0370:7344', ip_type='6')
murrown/cyder
cyder/api/v1/endpoints/dhcp/static_interface/tests.py
Python
bsd-3-clause
2,278
__author__ = 'RajivSubramanian'
rajivm1991/django-materialize-form
materializeform/templatetags/__init__.py
Python
mit
32
""" DIRECT Nine DoF Manipulation Panel """ __all__ = ['Placer', 'place'] # Import Tkinter, Pmw, and the dial code from this directory tree. from pandac.PandaModules import * from direct.showbase.TkGlobal import * from direct.tkwidgets.AppShell import * from direct.tkwidgets import Dial from direct.tkwidgets import Floater from direct.directtools.DirectGlobals import ZERO_VEC, UNIT_VEC from Tkinter import * import Pmw """ TODO: Task to monitor pose """ class Placer(AppShell): # Override class variables here appname = 'Placer Panel' frameWidth = 625 frameHeight = 215 usecommandarea = 0 usestatusarea = 0 def __init__(self, parent = None, **kw): INITOPT = Pmw.INITOPT optiondefs = ( ('title', self.appname, None), ('nodePath', base.direct.camera, None), ) self.defineoptions(kw, optiondefs) # Call superclass initialization function AppShell.__init__(self) self.initialiseoptions(Placer) def appInit(self): # Initialize state self.tempCS = base.direct.group.attachNewNode('placerTempCS') self.orbitFromCS = base.direct.group.attachNewNode( 'placerOrbitFromCS') self.orbitToCS = base.direct.group.attachNewNode('placerOrbitToCS') self.refCS = self.tempCS # Dictionary keeping track of all node paths manipulated so far self.nodePathDict = {} self.nodePathDict['camera'] = base.direct.camera self.nodePathDict['widget'] = base.direct.widget self.nodePathNames = ['camera', 'widget', 'selected'] self.refNodePathDict = {} self.refNodePathDict['parent'] = self['nodePath'].getParent() self.refNodePathDict['render'] = render self.refNodePathDict['camera'] = base.direct.camera self.refNodePathDict['widget'] = base.direct.widget self.refNodePathNames = ['parent', 'self', 'render', 'camera', 'widget', 'selected'] # Initial state self.initPos = Vec3(0) self.initHpr = Vec3(0) self.initScale = Vec3(1) self.deltaHpr = Vec3(0) # Offset for orbital mode self.posOffset = Vec3(0) # Set up event hooks self.undoEvents = [('DIRECT_undo', self.undoHook), ('DIRECT_pushUndo', self.pushUndoHook), ('DIRECT_undoListEmpty', self.undoListEmptyHook), ('DIRECT_redo', self.redoHook), ('DIRECT_pushRedo', self.pushRedoHook), ('DIRECT_redoListEmpty', self.redoListEmptyHook)] for event, method in self.undoEvents: self.accept(event, method) # Init movement mode self.movementMode = 'Relative To:' def createInterface(self): # The interior of the toplevel panel interior = self.interior() interior['relief'] = FLAT # Add placer commands to menubar self.menuBar.addmenu('Placer', 'Placer Panel Operations') self.menuBar.addmenuitem('Placer', 'command', 'Zero Node Path', label = 'Zero All', command = self.zeroAll) self.menuBar.addmenuitem('Placer', 'command', 'Reset Node Path', label = 'Reset All', command = self.resetAll) self.menuBar.addmenuitem('Placer', 'command', 'Print Node Path Info', label = 'Print Info', command = self.printNodePathInfo) self.menuBar.addmenuitem( 'Placer', 'command', 'Toggle widget visability', label = 'Toggle Widget Vis', command = base.direct.toggleWidgetVis) self.menuBar.addmenuitem( 'Placer', 'command', 'Toggle widget manipulation mode', label = 'Toggle Widget Mode', command = base.direct.manipulationControl.toggleObjectHandlesMode) # Get a handle to the menu frame menuFrame = self.menuFrame self.nodePathMenu = Pmw.ComboBox( menuFrame, labelpos = W, label_text = 'Node Path:', entry_width = 20, selectioncommand = self.selectNodePathNamed, scrolledlist_items = self.nodePathNames) self.nodePathMenu.selectitem('selected') self.nodePathMenuEntry = ( self.nodePathMenu.component('entryfield_entry')) self.nodePathMenuBG = ( self.nodePathMenuEntry.configure('background')[3]) self.nodePathMenu.pack(side = 'left', fill = 'x', expand = 1) self.bind(self.nodePathMenu, 'Select node path to manipulate') modeMenu = Pmw.OptionMenu(menuFrame, items = ('Relative To:', 'Orbit:'), initialitem = 'Relative To:', command = self.setMovementMode, menubutton_width = 8) modeMenu.pack(side = 'left', expand = 0) self.bind(modeMenu, 'Select manipulation mode') self.refNodePathMenu = Pmw.ComboBox( menuFrame, entry_width = 16, selectioncommand = self.selectRefNodePathNamed, scrolledlist_items = self.refNodePathNames) self.refNodePathMenu.selectitem('parent') self.refNodePathMenuEntry = ( self.refNodePathMenu.component('entryfield_entry')) self.refNodePathMenu.pack(side = 'left', fill = 'x', expand = 1) self.bind(self.refNodePathMenu, 'Select relative node path') self.undoButton = Button(menuFrame, text = 'Undo', command = base.direct.undo) if base.direct.undoList: self.undoButton['state'] = 'normal' else: self.undoButton['state'] = 'disabled' self.undoButton.pack(side = 'left', expand = 0) self.bind(self.undoButton, 'Undo last operation') self.redoButton = Button(menuFrame, text = 'Redo', command = base.direct.redo) if base.direct.redoList: self.redoButton['state'] = 'normal' else: self.redoButton['state'] = 'disabled' self.redoButton.pack(side = 'left', expand = 0) self.bind(self.redoButton, 'Redo last operation') # Create and pack the Pos Controls posGroup = Pmw.Group(interior, tag_pyclass = Menubutton, tag_text = 'Position', tag_font=('MSSansSerif', 14), tag_activebackground = '#909090', ring_relief = RIDGE) posMenubutton = posGroup.component('tag') self.bind(posMenubutton, 'Position menu operations') posMenu = Menu(posMenubutton, tearoff = 0) posMenu.add_command(label = 'Set to zero', command = self.zeroPos) posMenu.add_command(label = 'Reset initial', command = self.resetPos) posMenubutton['menu'] = posMenu posGroup.pack(side='left', fill = 'both', expand = 1) posInterior = posGroup.interior() # Create the dials self.posX = self.createcomponent('posX', (), None, Floater.Floater, (posInterior,), text = 'X', relief = FLAT, value = 0.0, label_foreground = 'Red') self.posX['commandData'] = ['x'] self.posX['preCallback'] = self.xformStart self.posX['postCallback'] = self.xformStop self.posX['callbackData'] = ['x'] self.posX.pack(expand=1, fill='both') self.posY = self.createcomponent('posY', (), None, Floater.Floater, (posInterior,), text = 'Y', relief = FLAT, value = 0.0, label_foreground = '#00A000') self.posY['commandData'] = ['y'] self.posY['preCallback'] = self.xformStart self.posY['postCallback'] = self.xformStop self.posY['callbackData'] = ['y'] self.posY.pack(expand=1, fill='both') self.posZ = self.createcomponent('posZ', (), None, Floater.Floater, (posInterior,), text = 'Z', relief = FLAT, value = 0.0, label_foreground = 'Blue') self.posZ['commandData'] = ['z'] self.posZ['preCallback'] = self.xformStart self.posZ['postCallback'] = self.xformStop self.posZ['callbackData'] = ['z'] self.posZ.pack(expand=1, fill='both') # Create and pack the Hpr Controls hprGroup = Pmw.Group(interior, tag_pyclass = Menubutton, tag_text = 'Orientation', tag_font=('MSSansSerif', 14), tag_activebackground = '#909090', ring_relief = RIDGE) hprMenubutton = hprGroup.component('tag') self.bind(hprMenubutton, 'Orientation menu operations') hprMenu = Menu(hprMenubutton, tearoff = 0) hprMenu.add_command(label = 'Set to zero', command = self.zeroHpr) hprMenu.add_command(label = 'Reset initial', command = self.resetHpr) hprMenubutton['menu'] = hprMenu hprGroup.pack(side='left', fill = 'both', expand = 1) hprInterior = hprGroup.interior() # Create the dials self.hprH = self.createcomponent('hprH', (), None, Dial.AngleDial, (hprInterior,), style = 'mini', text = 'H', value = 0.0, relief = FLAT, label_foreground = 'blue') self.hprH['commandData'] = ['h'] self.hprH['preCallback'] = self.xformStart self.hprH['postCallback'] = self.xformStop self.hprH['callbackData'] = ['h'] self.hprH.pack(expand=1, fill='both') self.hprP = self.createcomponent('hprP', (), None, Dial.AngleDial, (hprInterior,), style = 'mini', text = 'P', value = 0.0, relief = FLAT, label_foreground = 'red') self.hprP['commandData'] = ['p'] self.hprP['preCallback'] = self.xformStart self.hprP['postCallback'] = self.xformStop self.hprP['callbackData'] = ['p'] self.hprP.pack(expand=1, fill='both') self.hprR = self.createcomponent('hprR', (), None, Dial.AngleDial, (hprInterior,), style = 'mini', text = 'R', value = 0.0, relief = FLAT, label_foreground = '#00A000') self.hprR['commandData'] = ['r'] self.hprR['preCallback'] = self.xformStart self.hprR['postCallback'] = self.xformStop self.hprR['callbackData'] = ['r'] self.hprR.pack(expand=1, fill='both') # Create and pack the Scale Controls # The available scaling modes self.scalingMode = StringVar() self.scalingMode.set('Scale Uniform') # The scaling widgets scaleGroup = Pmw.Group(interior, tag_text = 'Scale Uniform', tag_pyclass = Menubutton, tag_font=('MSSansSerif', 14), tag_activebackground = '#909090', ring_relief = RIDGE) self.scaleMenubutton = scaleGroup.component('tag') self.bind(self.scaleMenubutton, 'Scale menu operations') self.scaleMenubutton['textvariable'] = self.scalingMode # Scaling menu scaleMenu = Menu(self.scaleMenubutton, tearoff = 0) scaleMenu.add_command(label = 'Set to unity', command = self.unitScale) scaleMenu.add_command(label = 'Reset initial', command = self.resetScale) scaleMenu.add_radiobutton(label = 'Scale Free', variable = self.scalingMode) scaleMenu.add_radiobutton(label = 'Scale Uniform', variable = self.scalingMode) scaleMenu.add_radiobutton(label = 'Scale Proportional', variable = self.scalingMode) self.scaleMenubutton['menu'] = scaleMenu # Pack group widgets scaleGroup.pack(side='left', fill = 'both', expand = 1) scaleInterior = scaleGroup.interior() # Create the dials self.scaleX = self.createcomponent('scaleX', (), None, Floater.Floater, (scaleInterior,), text = 'X Scale', relief = FLAT, min = 0.0001, value = 1.0, resetValue = 1.0, label_foreground = 'Red') self.scaleX['commandData'] = ['sx'] self.scaleX['callbackData'] = ['sx'] self.scaleX['preCallback'] = self.xformStart self.scaleX['postCallback'] = self.xformStop self.scaleX.pack(expand=1, fill='both') self.scaleY = self.createcomponent('scaleY', (), None, Floater.Floater, (scaleInterior,), text = 'Y Scale', relief = FLAT, min = 0.0001, value = 1.0, resetValue = 1.0, label_foreground = '#00A000') self.scaleY['commandData'] = ['sy'] self.scaleY['callbackData'] = ['sy'] self.scaleY['preCallback'] = self.xformStart self.scaleY['postCallback'] = self.xformStop self.scaleY.pack(expand=1, fill='both') self.scaleZ = self.createcomponent('scaleZ', (), None, Floater.Floater, (scaleInterior,), text = 'Z Scale', relief = FLAT, min = 0.0001, value = 1.0, resetValue = 1.0, label_foreground = 'Blue') self.scaleZ['commandData'] = ['sz'] self.scaleZ['callbackData'] = ['sz'] self.scaleZ['preCallback'] = self.xformStart self.scaleZ['postCallback'] = self.xformStop self.scaleZ.pack(expand=1, fill='both') # Make sure appropriate labels are showing self.setMovementMode('Relative To:') # Set up placer for inital node path self.selectNodePathNamed('init') self.selectRefNodePathNamed('parent') # Update place to reflect initial state self.updatePlacer() # Now that you're done setting up, attach commands self.posX['command'] = self.xform self.posY['command'] = self.xform self.posZ['command'] = self.xform self.hprH['command'] = self.xform self.hprP['command'] = self.xform self.hprR['command'] = self.xform self.scaleX['command'] = self.xform self.scaleY['command'] = self.xform self.scaleZ['command'] = self.xform ### WIDGET OPERATIONS ### def setMovementMode(self, movementMode): # Set prefix namePrefix = '' self.movementMode = movementMode if (movementMode == 'Relative To:'): namePrefix = 'Relative ' elif (movementMode == 'Orbit:'): namePrefix = 'Orbit ' # Update pos widgets self.posX['text'] = namePrefix + 'X' self.posY['text'] = namePrefix + 'Y' self.posZ['text'] = namePrefix + 'Z' # Update hpr widgets if (movementMode == 'Orbit:'): namePrefix = 'Orbit delta ' self.hprH['text'] = namePrefix + 'H' self.hprP['text'] = namePrefix + 'P' self.hprR['text'] = namePrefix + 'R' # Update temp cs and initialize widgets self.updatePlacer() def setScalingMode(self): if self['nodePath']: scale = self['nodePath'].getScale() if ((scale[0] != scale[1]) or (scale[0] != scale[2]) or (scale[1] != scale[2])): self.scalingMode.set('Scale Free') def selectNodePathNamed(self, name): nodePath = None if name == 'init': nodePath = self['nodePath'] # Add Combo box entry for the initial node path self.addNodePath(nodePath) elif name == 'selected': nodePath = base.direct.selected.last # Add Combo box entry for this selected object self.addNodePath(nodePath) else: nodePath = self.nodePathDict.get(name, None) if (nodePath == None): # See if this evaluates into a node path try: nodePath = eval(name) if isinstance(nodePath, NodePath): self.addNodePath(nodePath) else: # Good eval but not a node path, give up nodePath = None except: # Bogus eval nodePath = None # Clear bogus entry from listbox listbox = self.nodePathMenu.component('scrolledlist') listbox.setlist(self.nodePathNames) else: if name == 'widget': # Record relationship between selected nodes and widget base.direct.selected.getWrtAll() # Update active node path self.setActiveNodePath(nodePath) def setActiveNodePath(self, nodePath): self['nodePath'] = nodePath if self['nodePath']: self.nodePathMenuEntry.configure( background = self.nodePathMenuBG) # Check to see if node path and ref node path are the same if ((self.refCS != None) and (self.refCS.id() == self['nodePath'].id())): # Yes they are, use temp CS as ref # This calls updatePlacer self.setReferenceNodePath(self.tempCS) # update listbox accordingly self.refNodePathMenu.selectitem('parent') else: # Record initial value and initialize the widgets self.updatePlacer() # Record initial position self.updateResetValues(self['nodePath']) # Set scaling mode based on node path's current scale self.setScalingMode() else: # Flash entry self.nodePathMenuEntry.configure(background = 'Pink') def selectRefNodePathNamed(self, name): nodePath = None if name == 'self': nodePath = self.tempCS elif name == 'selected': nodePath = base.direct.selected.last # Add Combo box entry for this selected object self.addRefNodePath(nodePath) elif name == 'parent': nodePath = self['nodePath'].getParent() else: nodePath = self.refNodePathDict.get(name, None) if (nodePath == None): # See if this evaluates into a node path try: nodePath = eval(name) if isinstance(nodePath, NodePath): self.addRefNodePath(nodePath) else: # Good eval but not a node path, give up nodePath = None except: # Bogus eval nodePath = None # Clear bogus entry from listbox listbox = self.refNodePathMenu.component('scrolledlist') listbox.setlist(self.refNodePathNames) # Check to see if node path and ref node path are the same if (nodePath != None) and (nodePath.id() == self['nodePath'].id()): # Yes they are, use temp CS and update listbox accordingly nodePath = self.tempCS self.refNodePathMenu.selectitem('parent') # Update ref node path self.setReferenceNodePath(nodePath) def setReferenceNodePath(self, nodePath): self.refCS = nodePath if self.refCS: self.refNodePathMenuEntry.configure( background = self.nodePathMenuBG) # Update placer to reflect new state self.updatePlacer() else: # Flash entry self.refNodePathMenuEntry.configure(background = 'Pink') def addNodePath(self, nodePath): self.addNodePathToDict(nodePath, self.nodePathNames, self.nodePathMenu, self.nodePathDict) def addRefNodePath(self, nodePath): self.addNodePathToDict(nodePath, self.refNodePathNames, self.refNodePathMenu, self.refNodePathDict) def addNodePathToDict(self, nodePath, names, menu, dict): if not nodePath: return # Get node path's name name = nodePath.getName() if name in ['parent', 'render', 'camera']: dictName = name else: # Generate a unique name for the dict dictName = name + '-' + repr(nodePath.id()) if dictName not in dict: # Update combo box to include new item names.append(dictName) listbox = menu.component('scrolledlist') listbox.setlist(names) # Add new item to dictionary dict[dictName] = nodePath menu.selectitem(dictName) def updatePlacer(self): pos = Vec3(0) hpr = Vec3(0) scale = Vec3(1) np = self['nodePath'] if (np != None) and isinstance(np, NodePath): # Update temp CS self.updateAuxiliaryCoordinateSystems() # Update widgets if self.movementMode == 'Orbit:': pos.assign(self.posOffset) hpr.assign(ZERO_VEC) scale.assign(np.getScale()) elif self.refCS: pos.assign(np.getPos(self.refCS)) hpr.assign(np.getHpr(self.refCS)) scale.assign(np.getScale()) self.updatePosWidgets(pos) self.updateHprWidgets(hpr) self.updateScaleWidgets(scale) def updateAuxiliaryCoordinateSystems(self): # Temp CS self.tempCS.setPosHpr(self['nodePath'], 0, 0, 0, 0, 0, 0) # Orbit CS # At reference self.orbitFromCS.setPos(self.refCS, 0, 0, 0) # But aligned with target self.orbitFromCS.setHpr(self['nodePath'], 0, 0, 0) # Also update to CS self.orbitToCS.setPosHpr(self.orbitFromCS, 0, 0, 0, 0, 0, 0) # Get offset from origin self.posOffset.assign(self['nodePath'].getPos(self.orbitFromCS)) ### NODE PATH TRANSFORMATION OPERATIONS ### def xform(self, value, axis): if axis in ['sx', 'sy', 'sz']: self.xformScale(value, axis) elif self.movementMode == 'Relative To:': self.xformRelative(value, axis) elif self.movementMode == 'Orbit:': self.xformOrbit(value, axis) if self.nodePathMenu.get() == 'widget': if base.direct.manipulationControl.fSetCoa: # Update coa based on current widget position base.direct.selected.last.mCoa2Dnp.assign( base.direct.widget.getMat(base.direct.selected.last)) else: # Move the objects with the widget base.direct.selected.moveWrtWidgetAll() def xformStart(self, data): # Record undo point self.pushUndo() # If moving widget kill follow task and update wrts if self.nodePathMenu.get() == 'widget': taskMgr.remove('followSelectedNodePath') # Record relationship between selected nodes and widget base.direct.selected.getWrtAll() # Record initial state self.deltaHpr = self['nodePath'].getHpr(self.refCS) # Update placer to reflect new state self.updatePlacer() def xformStop(self, data): # Throw event to signal manipulation done # Send nodepath as a list messenger.send('DIRECT_manipulateObjectCleanup', [[self['nodePath']]]) # Update placer to reflect new state self.updatePlacer() # If moving widget restart follow task if self.nodePathMenu.get() == 'widget': # Restart followSelectedNodePath task base.direct.manipulationControl.spawnFollowSelectedNodePathTask() def xformRelative(self, value, axis): nodePath = self['nodePath'] if (nodePath != None) and (self.refCS != None): if axis == 'x': nodePath.setX(self.refCS, value) elif axis == 'y': nodePath.setY(self.refCS, value) elif axis == 'z': nodePath.setZ(self.refCS, value) else: if axis == 'h': self.deltaHpr.setX(value) elif axis == 'p': self.deltaHpr.setY(value) elif axis == 'r': self.deltaHpr.setZ(value) # Put node path at new hpr nodePath.setHpr(self.refCS, self.deltaHpr) def xformOrbit(self, value, axis): nodePath = self['nodePath'] if ((nodePath != None) and (self.refCS != None) and (self.orbitFromCS != None) and (self.orbitToCS != None)): if axis == 'x': self.posOffset.setX(value) elif axis == 'y': self.posOffset.setY(value) elif axis == 'z': self.posOffset.setZ(value) elif axis == 'h': self.orbitToCS.setH(self.orbitFromCS, value) elif axis == 'p': self.orbitToCS.setP(self.orbitFromCS, value) elif axis == 'r': self.orbitToCS.setR(self.orbitFromCS, value) nodePath.setPosHpr(self.orbitToCS, self.posOffset, ZERO_VEC) def xformScale(self, value, axis): if self['nodePath']: mode = self.scalingMode.get() scale = self['nodePath'].getScale() if mode == 'Scale Free': if axis == 'sx': scale.setX(value) elif axis == 'sy': scale.setY(value) elif axis == 'sz': scale.setZ(value) elif mode == 'Scale Uniform': scale.set(value, value, value) elif mode == 'Scale Proportional': if axis == 'sx': sf = value/scale[0] elif axis == 'sy': sf = value/scale[1] elif axis == 'sz': sf = value/scale[2] scale = scale * sf self['nodePath'].setScale(scale) def updatePosWidgets(self, pos): self.posX.set(pos[0]) self.posY.set(pos[1]) self.posZ.set(pos[2]) def updateHprWidgets(self, hpr): self.hprH.set(hpr[0]) self.hprP.set(hpr[1]) self.hprR.set(hpr[2]) def updateScaleWidgets(self, scale): self.scaleX.set(scale[0]) self.scaleY.set(scale[1]) self.scaleZ.set(scale[2]) def zeroAll(self): self.xformStart(None) self.updatePosWidgets(ZERO_VEC) self.updateHprWidgets(ZERO_VEC) self.updateScaleWidgets(UNIT_VEC) self.xformStop(None) def zeroPos(self): self.xformStart(None) self.updatePosWidgets(ZERO_VEC) self.xformStop(None) def zeroHpr(self): self.xformStart(None) self.updateHprWidgets(ZERO_VEC) self.xformStop(None) def unitScale(self): self.xformStart(None) self.updateScaleWidgets(UNIT_VEC) self.xformStop(None) def updateResetValues(self, nodePath): self.initPos.assign(nodePath.getPos()) self.posX['resetValue'] = self.initPos[0] self.posY['resetValue'] = self.initPos[1] self.posZ['resetValue'] = self.initPos[2] self.initHpr.assign(nodePath.getHpr()) self.hprH['resetValue'] = self.initHpr[0] self.hprP['resetValue'] = self.initHpr[1] self.hprR['resetValue'] = self.initHpr[2] self.initScale.assign(nodePath.getScale()) self.scaleX['resetValue'] = self.initScale[0] self.scaleY['resetValue'] = self.initScale[1] self.scaleZ['resetValue'] = self.initScale[2] def resetAll(self): if self['nodePath']: self.xformStart(None) self['nodePath'].setPosHprScale( self.initPos, self.initHpr, self.initScale) self.xformStop(None) def resetPos(self): if self['nodePath']: self.xformStart(None) self['nodePath'].setPos(self.initPos) self.xformStop(None) def resetHpr(self): if self['nodePath']: self.xformStart(None) self['nodePath'].setHpr(self.initHpr) self.xformStop(None) def resetScale(self): if self['nodePath']: self.xformStart(None) self['nodePath'].setScale(self.initScale) self.xformStop(None) def pushUndo(self, fResetRedo = 1): base.direct.pushUndo([self['nodePath']]) def undoHook(self, nodePathList = []): # Reflect new changes self.updatePlacer() def pushUndoHook(self): # Make sure button is reactivated self.undoButton.configure(state = 'normal') def undoListEmptyHook(self): # Make sure button is deactivated self.undoButton.configure(state = 'disabled') def pushRedo(self): base.direct.pushRedo([self['nodePath']]) def redoHook(self, nodePathList = []): # Reflect new changes self.updatePlacer() def pushRedoHook(self): # Make sure button is reactivated self.redoButton.configure(state = 'normal') def redoListEmptyHook(self): # Make sure button is deactivated self.redoButton.configure(state = 'disabled') def printNodePathInfo(self): np = self['nodePath'] if np: name = np.getName() pos = np.getPos() hpr = np.getHpr() scale = np.getScale() posString = '%.2f, %.2f, %.2f' % (pos[0], pos[1], pos[2]) hprString = '%.2f, %.2f, %.2f' % (hpr[0], hpr[1], hpr[2]) scaleString = '%.2f, %.2f, %.2f' % (scale[0], scale[1], scale[2]) print 'NodePath: %s' % name print 'Pos: %s' % posString print 'Hpr: %s' % hprString print 'Scale: %s' % scaleString print ('%s.setPosHprScale(%s, %s, %s)' % (name, posString, hprString, scaleString)) def onDestroy(self, event): # Remove hooks for event, method in self.undoEvents: self.ignore(event) self.tempCS.removeNode() self.orbitFromCS.removeNode() self.orbitToCS.removeNode() def place(nodePath): return Placer(nodePath = nodePath) ###################################################################### # Create demo in root window for testing. if __name__ == '__main__': root = Pmw.initialise() widget = Placer()
toontownfunserver/Panda3D-1.9.0
direct/tkpanels/Placer.py
Python
bsd-3-clause
32,632
# -*- coding: utf-8 -*- # # PyMW documentation build configuration file, created by # sphinx-quickstart on Tue Jun 30 11:57:17 2009. # # This file is execfile()d with the current directory set to its containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. import sys, os # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. #sys.path.append(os.path.abspath('.')) # -- General configuration ----------------------------------------------------- # Add any Sphinx extension module names here, as strings. They can be extensions # coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = [] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix of source filenames. source_suffix = '.rst' # The encoding of source files. #source_encoding = 'utf-8' # The master toctree document. master_doc = 'index' # General information about the project. project = u'PyMW' copyright = u'2009, Eric Heien' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = '0.3' # The full version, including alpha/beta/rc tags. release = '0.3' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of documents that shouldn't be included in the build. #unused_docs = [] # List of directories, relative to source directory, that shouldn't be searched # for source files. exclude_trees = ['_build'] # The reST default role (used for this markup: `text`) to use for all documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. #add_function_parentheses = True # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # -- Options for HTML output --------------------------------------------------- # The theme to use for HTML and HTML Help pages. Major themes that come with # Sphinx are currently 'default' and 'sphinxdoc'. html_theme = 'default' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. #html_theme_options = {} # Add any paths that contain custom themes here, relative to this directory. #html_theme_path = [] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". #html_title = None # A shorter title for the navigation bar. Default is the same as html_title. #html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. #html_favicon = None # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. #html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. #html_use_smartypants = True # Custom sidebar templates, maps document names to template names. #html_sidebars = {} # Additional templates that should be rendered to pages, maps page names to # template names. #html_additional_pages = {} # If false, no module index is generated. #html_use_modindex = True # If false, no index is generated. #html_use_index = True # If true, the index is split into individual pages for each letter. #html_split_index = False # If true, links to the reST sources are added to the pages. #html_show_sourcelink = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. #html_use_opensearch = '' # If nonempty, this is the file name suffix for HTML files (e.g. ".xhtml"). #html_file_suffix = '' # Output file base name for HTML help builder. htmlhelp_basename = 'PyMWdoc' # -- Options for LaTeX output -------------------------------------------------- # The paper size ('letter' or 'a4'). #latex_paper_size = 'letter' # The font size ('10pt', '11pt' or '12pt'). #latex_font_size = '10pt' # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass [howto/manual]). latex_documents = [ ('index', 'PyMW.tex', u'PyMW Documentation', u'Eric Heien', 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. #latex_logo = None # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = False # Additional stuff for the LaTeX preamble. #latex_preamble = '' # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_use_modindex = True
eheien/pymw
doc/conf.py
Python
mit
6,272
""" Minimal (and limited) RPython version of some functions contained in os.path. """ import os, stat from rpython.rlib import rposix # ____________________________________________________________ # # Generic implementations in RPython for both POSIX and NT # def risdir(s): """Return true if the pathname refers to an existing directory.""" try: st = os.stat(s) except OSError: return False return stat.S_ISDIR(st.st_mode) # ____________________________________________________________ # # POSIX-only implementations # def _posix_risabs(s): """Test whether a path is absolute""" return s.startswith('/') def _posix_rnormpath(path): """Normalize path, eliminating double slashes, etc.""" slash, dot = '/', '.' if path == '': return dot initial_slashes = path.startswith('/') # POSIX allows one or two initial slashes, but treats three or more # as single slash. if (initial_slashes and path.startswith('//') and not path.startswith('///')): initial_slashes = 2 comps = path.split('/') new_comps = [] for comp in comps: if comp == '' or comp == '.': continue if (comp != '..' or (not initial_slashes and not new_comps) or (new_comps and new_comps[-1] == '..')): new_comps.append(comp) elif new_comps: new_comps.pop() comps = new_comps path = slash.join(comps) if initial_slashes: path = slash*initial_slashes + path return path or dot def _posix_rabspath(path): """Return an absolute, **non-normalized** path. **This version does not let exceptions propagate.**""" try: if not _posix_risabs(path): cwd = os.getcwd() path = _posix_rjoin(cwd, path) return _posix_rnormpath(path) except OSError: return path def _posix_rjoin(a, b): """Join two pathname components, inserting '/' as needed. If the second component is an absolute path, the first one will be discarded. An empty last part will result in a path that ends with a separator.""" path = a if b.startswith('/'): path = b elif path == '' or path.endswith('/'): path += b else: path += '/' + b return path # ____________________________________________________________ # # NT-only implementations # def _nt_risabs(s): """Test whether a path is absolute""" s = _nt_rsplitdrive(s)[1] return s.startswith('/') or s.startswith('\\') def _nt_rnormpath(path): """Normalize path, eliminating double slashes, etc.""" backslash, dot = '\\', '.' if path.startswith(('\\\\.\\', '\\\\?\\')): # in the case of paths with these prefixes: # \\.\ -> device names # \\?\ -> literal paths # do not do any normalization, but return the path unchanged return path path = path.replace("/", "\\") prefix, path = _nt_rsplitdrive(path) # We need to be careful here. If the prefix is empty, and the path starts # with a backslash, it could either be an absolute path on the current # drive (\dir1\dir2\file) or a UNC filename (\\server\mount\dir1\file). It # is therefore imperative NOT to collapse multiple backslashes blindly in # that case. # The code below preserves multiple backslashes when there is no drive # letter. This means that the invalid filename \\\a\b is preserved # unchanged, where a\\\b is normalised to a\b. It's not clear that there # is any better behaviour for such edge cases. if prefix == '': # No drive letter - preserve initial backslashes while path.startswith("\\"): prefix = prefix + backslash path = path[1:] else: # We have a drive letter - collapse initial backslashes if path.startswith("\\"): prefix = prefix + backslash path = path.lstrip("\\") comps = path.split("\\") i = 0 while i < len(comps): if comps[i] in ('.', ''): del comps[i] elif comps[i] == '..': if i > 0 and comps[i-1] != '..': del comps[i-1:i+1] i -= 1 elif i == 0 and prefix.endswith("\\"): del comps[i] else: i += 1 else: i += 1 # If the path is now empty, substitute '.' if not prefix and not comps: comps.append(dot) return prefix + backslash.join(comps) def _nt_rabspath(path): try: if path == '': path = os.getcwd() return rposix._getfullpathname(path) except OSError: return path def _nt_rsplitdrive(p): """Split a pathname into drive/UNC sharepoint and relative path specifiers. Returns a 2-tuple (drive_or_unc, path); either part may be empty. """ if len(p) > 1: normp = p.replace(altsep, sep) if normp.startswith('\\\\') and not normp.startswith('\\\\\\'): # is a UNC path: # vvvvvvvvvvvvvvvvvvvv drive letter or UNC path # \\machine\mountpoint\directory\etc\... # directory ^^^^^^^^^^^^^^^ index = normp.find('\\', 2) if index < 0: return '', p index2 = normp.find('\\', index + 1) # a UNC path can't have two slashes in a row # (after the initial two) if index2 == index + 1: return '', p if index2 < 0: index2 = len(p) return p[:index2], p[index2:] if normp[1] == ':': return p[:2], p[2:] return '', p def _nt_rjoin(path, p): """Join two or more pathname components, inserting "\\" as needed.""" result_drive, result_path = _nt_rsplitdrive(path) p_drive, p_path = _nt_rsplitdrive(p) p_is_rel = True if p_path and p_path[0] in '\\/': # Second path is absolute if p_drive or not result_drive: result_drive = p_drive result_path = p_path p_is_rel = False elif p_drive and p_drive != result_drive: if p_drive.lower() != result_drive.lower(): # Different drives => ignore the first path entirely result_drive = p_drive result_path = p_path p_is_rel = False else: # Same drive in different case result_drive = p_drive if p_is_rel: # Second path is relative to the first if result_path and result_path[-1] not in '\\/': result_path = result_path + '\\' result_path = result_path + p_path ## add separator between UNC and non-absolute path if (result_path and result_path[0] not in '\\/' and result_drive and result_drive[-1] != ':'): return result_drive + '\\' + result_path return result_drive + result_path # ____________________________________________________________ if os.name == 'posix': sep = altsep = '/' risabs = _posix_risabs rnormpath = _posix_rnormpath rabspath = _posix_rabspath rjoin = _posix_rjoin elif os.name == 'nt': sep, altsep = '\\', '/' risabs = _nt_risabs rnormpath = _nt_rnormpath rabspath = _nt_rabspath rsplitdrive = _nt_rsplitdrive rjoin = _nt_rjoin else: raise ImportError('Unsupported os: %s' % os.name)
jptomo/rpython-lang-scheme
rpython/rlib/rpath.py
Python
mit
7,407
from mediadrop.lib.auth.group_based_policy import *
kgao/MediaDrop
mediacore/lib/auth/group_based_policy.py
Python
gpl-3.0
52
# Copyright 2016 RedHat, inc # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. ############################################# from __future__ import (absolute_import, division, print_function) __metaclass__ = type import re from ansible import constants as C from ansible.inventory.host import Host from ansible.inventory.group import Group from ansible.inventory.expand_hosts import detect_range from ansible.inventory.expand_hosts import expand_hostname_range from ansible.module_utils.six import string_types from ansible.parsing.utils.addresses import parse_address class InventoryParser(object): """ Takes a YAML-format inventory file and builds a list of groups and subgroups with their associated hosts and variable settings. """ def __init__(self, loader, groups, filename=C.DEFAULT_HOST_LIST): self._loader = loader self.filename = filename # Start with an empty host list and whatever groups we're passed in # (which should include the default 'all' and 'ungrouped' groups). self.hosts = {} self.patterns = {} self.groups = groups # Read in the hosts, groups, and variables defined in the # inventory file. data = loader.load_from_file(filename) self._parse(data) def _parse(self, data): ''' Populates self.groups from the given array of lines. Raises an error on any parse failure. ''' self._compile_patterns() # We expect top level keys to correspond to groups, iterate over them # to get host, vars and subgroups (which we iterate over recursivelly) for group_name in data.keys(): self._parse_groups(group_name, data[group_name]) # Finally, add all top-level groups as children of 'all'. # We exclude ungrouped here because it was already added as a child of # 'all' at the time it was created. for group in self.groups.values(): if group.depth == 0 and group.name not in ('all', 'ungrouped'): self.groups['all'].add_child_group(Group(group_name)) def _parse_groups(self, group, group_data): if group not in self.groups: self.groups[group] = Group(name=group) if isinstance(group_data, dict): #make sure they are dicts for section in ['vars', 'children', 'hosts']: if section in group_data and isinstance(group_data[section], string_types): group_data[section] = { group_data[section]: None} if 'vars' in group_data: for var in group_data['vars']: self.groups[group].set_variable(var, group_data['vars'][var]) if 'children' in group_data: for subgroup in group_data['children']: self._parse_groups(subgroup, group_data['children'][subgroup]) self.groups[group].add_child_group(self.groups[subgroup]) if 'hosts' in group_data: for host_pattern in group_data['hosts']: hosts = self._parse_host(host_pattern, group_data['hosts'][host_pattern]) for h in hosts: self.groups[group].add_host(h) def _parse_host(self, host_pattern, host_data): ''' Each host key can be a pattern, try to process it and add variables as needed ''' (hostnames, port) = self._expand_hostpattern(host_pattern) hosts = self._Hosts(hostnames, port) if isinstance(host_data, dict): for k in host_data: for h in hosts: h.set_variable(k, host_data[k]) if k in ['ansible_host', 'ansible_ssh_host']: h.address = host_data[k] return hosts def _expand_hostpattern(self, hostpattern): ''' Takes a single host pattern and returns a list of hostnames and an optional port number that applies to all of them. ''' # Can the given hostpattern be parsed as a host with an optional port # specification? try: (pattern, port) = parse_address(hostpattern, allow_ranges=True) except: # not a recognizable host pattern pattern = hostpattern port = None # Once we have separated the pattern, we expand it into list of one or # more hostnames, depending on whether it contains any [x:y] ranges. if detect_range(pattern): hostnames = expand_hostname_range(pattern) else: hostnames = [pattern] return (hostnames, port) def _Hosts(self, hostnames, port): ''' Takes a list of hostnames and a port (which may be None) and returns a list of Hosts (without recreating anything in self.hosts). ''' hosts = [] # Note that we decide whether or not to create a Host based solely on # the (non-)existence of its hostname in self.hosts. This means that one # cannot add both "foo:22" and "foo:23" to the inventory. for hn in hostnames: if hn not in self.hosts: self.hosts[hn] = Host(name=hn, port=port) hosts.append(self.hosts[hn]) return hosts def get_host_variables(self, host): return {} def _compile_patterns(self): ''' Compiles the regular expressions required to parse the inventory and stores them in self.patterns. ''' self.patterns['groupname'] = re.compile( r'''^[A-Za-z_][A-Za-z0-9_]*$''')
bjolivot/ansible
lib/ansible/inventory/yaml.py
Python
gpl-3.0
6,240
#!/usr/bin/python from pisi.actionsapi import shelltools, get, autotools, pisitools def setup(): autotools.configure ("--prefix=/usr\ --disable-static\ --disable-docs\ --docdir=/usr/share/doc/fontconfig-2.10.2") def build(): autotools.make () def install(): autotools.rawInstall ("DESTDIR=%s" % get.installDIR())
richard-fisher/repository
system/base/fontconfig/actions.py
Python
gpl-2.0
410
# coding=utf-8 import threading from flask_babel import lazy_gettext from mycodo.databases.models import Actions from mycodo.databases.models import Input from mycodo.function_actions.base_function_action import AbstractFunctionAction from mycodo.utils.database import db_retrieve_table_daemon FUNCTION_ACTION_INFORMATION = { 'name_unique': 'clear_total_volume', 'name': f"{lazy_gettext('Flow Meter')}: {lazy_gettext('Clear Total Volume')}", 'library': None, 'manufacturer': 'Mycodo', 'url_manufacturer': None, 'url_datasheet': None, 'url_product_purchase': None, 'url_additional': None, 'message': 'Clear the total volume saved for a flow meter Input. The Input must have the Clear Total Volume option.', 'usage': 'Executing <strong>self.run_action("{ACTION_ID}")</strong> will clear the total volume for the selected flow meter Input. ' 'Executing <strong>self.run_action("{ACTION_ID}", value={"input_id": "959019d1-c1fa-41fe-a554-7be3366a9c5b"})</strong> will clear the total volume for the flow meter Input with the specified ID.', 'dependencies_module': [], 'custom_options': [ { 'id': 'controller', 'type': 'select_device', 'default_value': '', 'options_select': [ 'Input' ], 'name': lazy_gettext('Controller'), 'phrase': 'Select the flow meter Input' } ] } class ActionModule(AbstractFunctionAction): """Function Action: Clear Total Volume.""" def __init__(self, action_dev, testing=False): super(ActionModule, self).__init__(action_dev, testing=testing, name=__name__) self.controller_id = None action = db_retrieve_table_daemon( Actions, unique_id=self.unique_id) self.setup_custom_options( FUNCTION_ACTION_INFORMATION['custom_options'], action) if not testing: self.setup_action() def setup_action(self): self.action_setup = True def run_action(self, message, dict_vars): try: controller_id = dict_vars["value"]["input_id"] except: controller_id = self.controller_id this_input = db_retrieve_table_daemon( Input, unique_id=controller_id, entry='first') if not this_input: msg = f" Error: Input with ID '{controller_id}' not found." message += msg self.logger.error(msg) return message message += f" Clear total volume of Input {controller_id} ({this_input.name})." clear_volume = threading.Thread( target=self.control.custom_button, args=("Input", this_input.unique_id, "clear_total_volume", {},)) clear_volume.start() self.logger.debug(f"Message: {message}") return message def is_setup(self): return self.action_setup
kizniche/Mycodo
mycodo/function_actions/clear_total_volume.py
Python
gpl-3.0
2,924
"""Array printing function $Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $ """ from __future__ import division, absolute_import, print_function __all__ = ["array2string", "set_printoptions", "get_printoptions"] __docformat__ = 'restructuredtext' # # Written by Konrad Hinsen <[email protected]> # last revision: 1996-3-13 # modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details) # and by Perry Greenfield 2000-4-1 for numarray # and by Travis Oliphant 2005-8-22 for numpy import sys from functools import reduce from . import numerictypes as _nt from .umath import maximum, minimum, absolute, not_equal, isnan, isinf from .multiarray import format_longfloat, datetime_as_string, datetime_data from .fromnumeric import ravel from .numeric import asarray if sys.version_info[0] >= 3: _MAXINT = sys.maxsize _MININT = -sys.maxsize - 1 else: _MAXINT = sys.maxint _MININT = -sys.maxint - 1 def product(x, y): return x*y _summaryEdgeItems = 3 # repr N leading and trailing items of each dimension _summaryThreshold = 1000 # total items > triggers array summarization _float_output_precision = 8 _float_output_suppress_small = False _line_width = 75 _nan_str = 'nan' _inf_str = 'inf' _formatter = None # formatting function for array elements def set_printoptions(precision=None, threshold=None, edgeitems=None, linewidth=None, suppress=None, nanstr=None, infstr=None, formatter=None): """ Set printing options. These options determine the way floating point numbers, arrays and other NumPy objects are displayed. Parameters ---------- precision : int, optional Number of digits of precision for floating point output (default 8). threshold : int, optional Total number of array elements which trigger summarization rather than full repr (default 1000). edgeitems : int, optional Number of array items in summary at beginning and end of each dimension (default 3). linewidth : int, optional The number of characters per line for the purpose of inserting line breaks (default 75). suppress : bool, optional Whether or not suppress printing of small floating point values using scientific notation (default False). nanstr : str, optional String representation of floating point not-a-number (default nan). infstr : str, optional String representation of floating point infinity (default inf). formatter : dict of callables, optional If not None, the keys should indicate the type(s) that the respective formatting function applies to. Callables should return a string. Types that are not specified (by their corresponding keys) are handled by the default formatters. Individual types for which a formatter can be set are:: - 'bool' - 'int' - 'timedelta' : a `numpy.timedelta64` - 'datetime' : a `numpy.datetime64` - 'float' - 'longfloat' : 128-bit floats - 'complexfloat' - 'longcomplexfloat' : composed of two 128-bit floats - 'numpy_str' : types `numpy.string_` and `numpy.unicode_` - 'str' : all other strings Other keys that can be used to set a group of types at once are:: - 'all' : sets all types - 'int_kind' : sets 'int' - 'float_kind' : sets 'float' and 'longfloat' - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' - 'str_kind' : sets 'str' and 'numpystr' See Also -------- get_printoptions, set_string_function, array2string Notes ----- `formatter` is always reset with a call to `set_printoptions`. Examples -------- Floating point precision can be set: >>> np.set_printoptions(precision=4) >>> print np.array([1.123456789]) [ 1.1235] Long arrays can be summarised: >>> np.set_printoptions(threshold=5) >>> print np.arange(10) [0 1 2 ..., 7 8 9] Small results can be suppressed: >>> eps = np.finfo(float).eps >>> x = np.arange(4.) >>> x**2 - (x + eps)**2 array([ -4.9304e-32, -4.4409e-16, 0.0000e+00, 0.0000e+00]) >>> np.set_printoptions(suppress=True) >>> x**2 - (x + eps)**2 array([-0., -0., 0., 0.]) A custom formatter can be used to display array elements as desired: >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)}) >>> x = np.arange(3) >>> x array([int: 0, int: -1, int: -2]) >>> np.set_printoptions() # formatter gets reset >>> x array([0, 1, 2]) To put back the default options, you can use: >>> np.set_printoptions(edgeitems=3,infstr='inf', ... linewidth=75, nanstr='nan', precision=8, ... suppress=False, threshold=1000, formatter=None) """ global _summaryThreshold, _summaryEdgeItems, _float_output_precision, \ _line_width, _float_output_suppress_small, _nan_str, _inf_str, \ _formatter if linewidth is not None: _line_width = linewidth if threshold is not None: _summaryThreshold = threshold if edgeitems is not None: _summaryEdgeItems = edgeitems if precision is not None: _float_output_precision = precision if suppress is not None: _float_output_suppress_small = not not suppress if nanstr is not None: _nan_str = nanstr if infstr is not None: _inf_str = infstr _formatter = formatter def get_printoptions(): """ Return the current print options. Returns ------- print_opts : dict Dictionary of current print options with keys - precision : int - threshold : int - edgeitems : int - linewidth : int - suppress : bool - nanstr : str - infstr : str - formatter : dict of callables For a full description of these options, see `set_printoptions`. See Also -------- set_printoptions, set_string_function """ d = dict(precision=_float_output_precision, threshold=_summaryThreshold, edgeitems=_summaryEdgeItems, linewidth=_line_width, suppress=_float_output_suppress_small, nanstr=_nan_str, infstr=_inf_str, formatter=_formatter) return d def _leading_trailing(a): from . import numeric as _nc if a.ndim == 1: if len(a) > 2*_summaryEdgeItems: b = _nc.concatenate((a[:_summaryEdgeItems], a[-_summaryEdgeItems:])) else: b = a else: if len(a) > 2*_summaryEdgeItems: l = [_leading_trailing(a[i]) for i in range( min(len(a), _summaryEdgeItems))] l.extend([_leading_trailing(a[-i]) for i in range( min(len(a), _summaryEdgeItems), 0, -1)]) else: l = [_leading_trailing(a[i]) for i in range(0, len(a))] b = _nc.concatenate(tuple(l)) return b def _boolFormatter(x): if x: return ' True' else: return 'False' def repr_format(x): return repr(x) def _array2string(a, max_line_width, precision, suppress_small, separator=' ', prefix="", formatter=None): if max_line_width is None: max_line_width = _line_width if precision is None: precision = _float_output_precision if suppress_small is None: suppress_small = _float_output_suppress_small if formatter is None: formatter = _formatter if a.size > _summaryThreshold: summary_insert = "..., " data = _leading_trailing(a) else: summary_insert = "" data = ravel(asarray(a)) formatdict = {'bool' : _boolFormatter, 'int' : IntegerFormat(data), 'float' : FloatFormat(data, precision, suppress_small), 'longfloat' : LongFloatFormat(precision), 'complexfloat' : ComplexFormat(data, precision, suppress_small), 'longcomplexfloat' : LongComplexFormat(precision), 'datetime' : DatetimeFormat(data), 'timedelta' : TimedeltaFormat(data), 'numpystr' : repr_format, 'str' : str} if formatter is not None: fkeys = [k for k in formatter.keys() if formatter[k] is not None] if 'all' in fkeys: for key in formatdict.keys(): formatdict[key] = formatter['all'] if 'int_kind' in fkeys: for key in ['int']: formatdict[key] = formatter['int_kind'] if 'float_kind' in fkeys: for key in ['float', 'longfloat']: formatdict[key] = formatter['float_kind'] if 'complex_kind' in fkeys: for key in ['complexfloat', 'longcomplexfloat']: formatdict[key] = formatter['complex_kind'] if 'str_kind' in fkeys: for key in ['numpystr', 'str']: formatdict[key] = formatter['str_kind'] for key in formatdict.keys(): if key in fkeys: formatdict[key] = formatter[key] try: format_function = a._format msg = "The `_format` attribute is deprecated in Numpy 2.0 and " \ "will be removed in 2.1. Use the `formatter` kw instead." import warnings warnings.warn(msg, DeprecationWarning) except AttributeError: # find the right formatting function for the array dtypeobj = a.dtype.type if issubclass(dtypeobj, _nt.bool_): format_function = formatdict['bool'] elif issubclass(dtypeobj, _nt.integer): if issubclass(dtypeobj, _nt.timedelta64): format_function = formatdict['timedelta'] else: format_function = formatdict['int'] elif issubclass(dtypeobj, _nt.floating): if issubclass(dtypeobj, _nt.longfloat): format_function = formatdict['longfloat'] else: format_function = formatdict['float'] elif issubclass(dtypeobj, _nt.complexfloating): if issubclass(dtypeobj, _nt.clongfloat): format_function = formatdict['longcomplexfloat'] else: format_function = formatdict['complexfloat'] elif issubclass(dtypeobj, (_nt.unicode_, _nt.string_)): format_function = formatdict['numpystr'] elif issubclass(dtypeobj, _nt.datetime64): format_function = formatdict['datetime'] else: format_function = formatdict['numpystr'] # skip over "[" next_line_prefix = " " # skip over array( next_line_prefix += " "*len(prefix) lst = _formatArray(a, format_function, len(a.shape), max_line_width, next_line_prefix, separator, _summaryEdgeItems, summary_insert)[:-1] return lst def _convert_arrays(obj): from . import numeric as _nc newtup = [] for k in obj: if isinstance(k, _nc.ndarray): k = k.tolist() elif isinstance(k, tuple): k = _convert_arrays(k) newtup.append(k) return tuple(newtup) def array2string(a, max_line_width=None, precision=None, suppress_small=None, separator=' ', prefix="", style=repr, formatter=None): """ Return a string representation of an array. Parameters ---------- a : ndarray Input array. max_line_width : int, optional The maximum number of columns the string should span. Newline characters splits the string appropriately after array elements. precision : int, optional Floating point precision. Default is the current printing precision (usually 8), which can be altered using `set_printoptions`. suppress_small : bool, optional Represent very small numbers as zero. A number is "very small" if it is smaller than the current printing precision. separator : str, optional Inserted between elements. prefix : str, optional An array is typically printed as:: 'prefix(' + array2string(a) + ')' The length of the prefix string is used to align the output correctly. style : function, optional A function that accepts an ndarray and returns a string. Used only when the shape of `a` is equal to ``()``, i.e. for 0-D arrays. formatter : dict of callables, optional If not None, the keys should indicate the type(s) that the respective formatting function applies to. Callables should return a string. Types that are not specified (by their corresponding keys) are handled by the default formatters. Individual types for which a formatter can be set are:: - 'bool' - 'int' - 'timedelta' : a `numpy.timedelta64` - 'datetime' : a `numpy.datetime64` - 'float' - 'longfloat' : 128-bit floats - 'complexfloat' - 'longcomplexfloat' : composed of two 128-bit floats - 'numpy_str' : types `numpy.string_` and `numpy.unicode_` - 'str' : all other strings Other keys that can be used to set a group of types at once are:: - 'all' : sets all types - 'int_kind' : sets 'int' - 'float_kind' : sets 'float' and 'longfloat' - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' - 'str_kind' : sets 'str' and 'numpystr' Returns ------- array_str : str String representation of the array. Raises ------ TypeError if a callable in `formatter` does not return a string. See Also -------- array_str, array_repr, set_printoptions, get_printoptions Notes ----- If a formatter is specified for a certain type, the `precision` keyword is ignored for that type. This is a very flexible function; `array_repr` and `array_str` are using `array2string` internally so keywords with the same name should work identically in all three functions. Examples -------- >>> x = np.array([1e-16,1,2,3]) >>> print np.array2string(x, precision=2, separator=',', ... suppress_small=True) [ 0., 1., 2., 3.] >>> x = np.arange(3.) >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) '[0.00 1.00 2.00]' >>> x = np.arange(3) >>> np.array2string(x, formatter={'int':lambda x: hex(x)}) '[0x0L 0x1L 0x2L]' """ if a.shape == (): x = a.item() try: lst = a._format(x) msg = "The `_format` attribute is deprecated in Numpy " \ "2.0 and will be removed in 2.1. Use the " \ "`formatter` kw instead." import warnings warnings.warn(msg, DeprecationWarning) except AttributeError: if isinstance(x, tuple): x = _convert_arrays(x) lst = style(x) elif reduce(product, a.shape) == 0: # treat as a null array if any of shape elements == 0 lst = "[]" else: lst = _array2string(a, max_line_width, precision, suppress_small, separator, prefix, formatter=formatter) return lst def _extendLine(s, line, word, max_line_len, next_line_prefix): if len(line.rstrip()) + len(word.rstrip()) >= max_line_len: s += line.rstrip() + "\n" line = next_line_prefix line += word return s, line def _formatArray(a, format_function, rank, max_line_len, next_line_prefix, separator, edge_items, summary_insert): """formatArray is designed for two modes of operation: 1. Full output 2. Summarized output """ if rank == 0: obj = a.item() if isinstance(obj, tuple): obj = _convert_arrays(obj) return str(obj) if summary_insert and 2*edge_items < len(a): leading_items, trailing_items, summary_insert1 = \ edge_items, edge_items, summary_insert else: leading_items, trailing_items, summary_insert1 = 0, len(a), "" if rank == 1: s = "" line = next_line_prefix for i in range(leading_items): word = format_function(a[i]) + separator s, line = _extendLine(s, line, word, max_line_len, next_line_prefix) if summary_insert1: s, line = _extendLine(s, line, summary_insert1, max_line_len, next_line_prefix) for i in range(trailing_items, 1, -1): word = format_function(a[-i]) + separator s, line = _extendLine(s, line, word, max_line_len, next_line_prefix) word = format_function(a[-1]) s, line = _extendLine(s, line, word, max_line_len, next_line_prefix) s += line + "]\n" s = '[' + s[len(next_line_prefix):] else: s = '[' sep = separator.rstrip() for i in range(leading_items): if i > 0: s += next_line_prefix s += _formatArray(a[i], format_function, rank-1, max_line_len, " " + next_line_prefix, separator, edge_items, summary_insert) s = s.rstrip() + sep.rstrip() + '\n'*max(rank-1, 1) if summary_insert1: s += next_line_prefix + summary_insert1 + "\n" for i in range(trailing_items, 1, -1): if leading_items or i != trailing_items: s += next_line_prefix s += _formatArray(a[-i], format_function, rank-1, max_line_len, " " + next_line_prefix, separator, edge_items, summary_insert) s = s.rstrip() + sep.rstrip() + '\n'*max(rank-1, 1) if leading_items or trailing_items > 1: s += next_line_prefix s += _formatArray(a[-1], format_function, rank-1, max_line_len, " " + next_line_prefix, separator, edge_items, summary_insert).rstrip()+']\n' return s class FloatFormat(object): def __init__(self, data, precision, suppress_small, sign=False): self.precision = precision self.suppress_small = suppress_small self.sign = sign self.exp_format = False self.large_exponent = False self.max_str_len = 0 try: self.fillFormat(data) except (TypeError, NotImplementedError): # if reduce(data) fails, this instance will not be called, just # instantiated in formatdict. pass def fillFormat(self, data): from . import numeric as _nc with _nc.errstate(all='ignore'): special = isnan(data) | isinf(data) valid = not_equal(data, 0) & ~special non_zero = absolute(data.compress(valid)) if len(non_zero) == 0: max_val = 0. min_val = 0. else: max_val = maximum.reduce(non_zero) min_val = minimum.reduce(non_zero) if max_val >= 1.e8: self.exp_format = True if not self.suppress_small and (min_val < 0.0001 or max_val/min_val > 1000.): self.exp_format = True if self.exp_format: self.large_exponent = 0 < min_val < 1e-99 or max_val >= 1e100 self.max_str_len = 8 + self.precision if self.large_exponent: self.max_str_len += 1 if self.sign: format = '%+' else: format = '%' format = format + '%d.%de' % (self.max_str_len, self.precision) else: format = '%%.%df' % (self.precision,) if len(non_zero): precision = max([_digits(x, self.precision, format) for x in non_zero]) else: precision = 0 precision = min(self.precision, precision) self.max_str_len = len(str(int(max_val))) + precision + 2 if _nc.any(special): self.max_str_len = max(self.max_str_len, len(_nan_str), len(_inf_str)+1) if self.sign: format = '%#+' else: format = '%#' format = format + '%d.%df' % (self.max_str_len, precision) self.special_fmt = '%%%ds' % (self.max_str_len,) self.format = format def __call__(self, x, strip_zeros=True): from . import numeric as _nc with _nc.errstate(invalid='ignore'): if isnan(x): if self.sign: return self.special_fmt % ('+' + _nan_str,) else: return self.special_fmt % (_nan_str,) elif isinf(x): if x > 0: if self.sign: return self.special_fmt % ('+' + _inf_str,) else: return self.special_fmt % (_inf_str,) else: return self.special_fmt % ('-' + _inf_str,) s = self.format % x if self.large_exponent: # 3-digit exponent expsign = s[-3] if expsign == '+' or expsign == '-': s = s[1:-2] + '0' + s[-2:] elif self.exp_format: # 2-digit exponent if s[-3] == '0': s = ' ' + s[:-3] + s[-2:] elif strip_zeros: z = s.rstrip('0') s = z + ' '*(len(s)-len(z)) return s def _digits(x, precision, format): s = format % x z = s.rstrip('0') return precision - len(s) + len(z) class IntegerFormat(object): def __init__(self, data): try: max_str_len = max(len(str(maximum.reduce(data))), len(str(minimum.reduce(data)))) self.format = '%' + str(max_str_len) + 'd' except (TypeError, NotImplementedError): # if reduce(data) fails, this instance will not be called, just # instantiated in formatdict. pass except ValueError: # this occurs when everything is NA pass def __call__(self, x): if _MININT < x < _MAXINT: return self.format % x else: return "%s" % x class LongFloatFormat(object): # XXX Have to add something to determine the width to use a la FloatFormat # Right now, things won't line up properly def __init__(self, precision, sign=False): self.precision = precision self.sign = sign def __call__(self, x): if isnan(x): if self.sign: return '+' + _nan_str else: return ' ' + _nan_str elif isinf(x): if x > 0: if self.sign: return '+' + _inf_str else: return ' ' + _inf_str else: return '-' + _inf_str elif x >= 0: if self.sign: return '+' + format_longfloat(x, self.precision) else: return ' ' + format_longfloat(x, self.precision) else: return format_longfloat(x, self.precision) class LongComplexFormat(object): def __init__(self, precision): self.real_format = LongFloatFormat(precision) self.imag_format = LongFloatFormat(precision, sign=True) def __call__(self, x): r = self.real_format(x.real) i = self.imag_format(x.imag) return r + i + 'j' class ComplexFormat(object): def __init__(self, x, precision, suppress_small): self.real_format = FloatFormat(x.real, precision, suppress_small) self.imag_format = FloatFormat(x.imag, precision, suppress_small, sign=True) def __call__(self, x): r = self.real_format(x.real, strip_zeros=False) i = self.imag_format(x.imag, strip_zeros=False) if not self.imag_format.exp_format: z = i.rstrip('0') i = z + 'j' + ' '*(len(i)-len(z)) else: i = i + 'j' return r + i class DatetimeFormat(object): def __init__(self, x, unit=None, timezone=None, casting='same_kind'): # Get the unit from the dtype if unit is None: if x.dtype.kind == 'M': unit = datetime_data(x.dtype)[0] else: unit = 's' # If timezone is default, make it 'local' or 'UTC' based on the unit if timezone is None: # Date units -> UTC, time units -> local if unit in ('Y', 'M', 'W', 'D'): self.timezone = 'UTC' else: self.timezone = 'local' else: self.timezone = timezone self.unit = unit self.casting = casting def __call__(self, x): return "'%s'" % datetime_as_string(x, unit=self.unit, timezone=self.timezone, casting=self.casting) class TimedeltaFormat(object): def __init__(self, data): if data.dtype.kind == 'm': v = data.view('i8') max_str_len = max(len(str(maximum.reduce(v))), len(str(minimum.reduce(v)))) self.format = '%' + str(max_str_len) + 'd' def __call__(self, x): return self.format % x.astype('i8')
tdsmith/numpy
numpy/core/arrayprint.py
Python
bsd-3-clause
26,098
from validate_app import validateApp import os from distutils import spawn import sys from parse_files import parseOutHTseq, bringTogether from bashSub import bashSub def checkPreprocessApplications(): applications = ["spades.py"] source = ["http://bioinf.spbau.ru/spades"] i = 0; for app in applications: if spawn.find_executable(app) is None: sys.stderr.write("It doesn't look like you have app - " + app + "\n") sys.stderr.write("Download it here - " + source[i] + "\n"); exit(0) else: sys.stderr.write(app + " found\n") i += 0 def returnReads(dictSampleSeqFiles): SE = "" PE1 = "" PE2 = "" # data struct # { (sampleKey, seqKey) : [[SE], [SE], [PE1, PE2], [PE1, PE2]] } # diving into each of the sub lists in the dictionary value key for e in dictSampleSeqFiles: # if sublist only has one elment then it is SE read if len(e) == 1: if SE == "": SE = e[0] else: SE += "," + e[0] else: if PE1 == "": PE1 = e[0] PE2 = e[1] else: PE1 += "," + e[0] PE2 += "," + e[1] return [SE, PE1, PE2] def check_dir(Dir): if not os.path.exists(Dir): os.mkdir(Dir) class spadesCMD: def __init__(self): self.metaDataFolder = "MetaData" def execute(self, args): time = 0 checkPreprocessApplications(); logFiles = [] # checkPreprocessApplications() validate = validateApp() validate.setValidation(True) dictSampleSeqFiles = validate.validateSampleSheet(args.readFolder, args.spadesFolder, args.samplesFile, args.force, True) #keys tuple 0 location being input folder #1 location being output folder location for keys in dictSampleSeqFiles.keys(): check_dir(args.spadesFolder) check_dir(keys[1]) terminal = [] #countFile = os.path.join(keys[1], keys[0].split("/")[-1]) + ".counts" print dictSampleSeqFiles[keys] if (len(dictSampleSeqFiles[keys][1]) == 3): terminal.append(bashSub("spades.py", dictSampleSeqFiles[keys][1], ['-1', '-2', '-s'], " --careful -t " + args.threads + " -o " + keys[1] + " -m " + args.memory, '')) elif (len(dictSampleSeqFiles[keys][1]) == 2): terminal.append(bashSub("spades.py", dictSampleSeqFiles[keys][1], ['-1', '-2'], "--careful -t " + args.threads + " -o " + keys[1] + " -m " + args.memory, '')) print terminal[-1].getCommand() terminal[-1].runCmd("") sys.stderr.flush() #time += runSortByName.returnTime() + runView.returnTime() + htseqCmd.returnTime() #logFiles.append(parseOutHTseq(keys[1], keys[1].split("/")[-1])) #bringTogether(logFiles, os.path.join(args.finalDir, "Counts_Summary.log")) print "Total amount of seconds to run all samples" print "Seconds: " + str(time)
msettles/expHTS
expHTS/spadesCMD.py
Python
apache-2.0
3,121
# Copyright 2016 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. import argparse import os.path import sys _SRC_DIR = os.path.abspath(os.path.join( os.path.dirname(__file__), '..', '..', '..')) sys.path.append(os.path.join(_SRC_DIR, 'build', 'android')) from pylib import constants class Options(object): """Global options repository. ParseArgs must be called before use. See _ARGS for common members, these will be available as instance attributes (eg, OPTIONS.clear_cache). """ # Tuples of (argument name, default value, help string). _ARGS = [ ('clear_cache', True, 'clear browser cache before loading'), ('chrome_package_name', 'chrome', 'build/android/pylib/constants package description'), ('devtools_hostname', 'localhost', 'hostname for devtools websocket connection'), ('devtools_port', 9222, 'port for devtools websocket connection'), ('local_binary', os.path.join(_SRC_DIR, 'out/Release/chrome'), 'chrome binary for local runs'), ('local_noisy', False, 'Enable local chrome console output'), ('local_profile_dir', None, 'profile directory to use for local runs'), ('no_sandbox', False, 'pass --no-sandbox to browser (local run only; see also ' 'https://chromium.googlesource.com/chromium/src/+/master/' 'docs/linux_suid_sandbox_development.md)'), ('devices_file', _SRC_DIR + '/third_party/WebKit/Source/devtools' '/front_end/emulated_devices/module.json', 'File containing a' ' list of emulated devices characteristics.'), ('emulate_device', '', 'Name of the device to emulate. Must be ' 'present in --devices_file, or empty for no emulation.'), ('emulate_network', '', 'Type of network emulation. Empty for no' ' emulation.') ] def __init__(self): self._arg_set = set() self._parsed_args = None def AddGlobalArgument(self, arg_name, default, help_str): """Add a global argument. Args: arg_name: the name of the argument. This will be used as an optional -- argument. default: the default value for the argument. The type of this default will be used as the type of the argument. help_str: the argument help string. """ self._ARGS.append((arg_name, default, help_str)) def ParseArgs(self, arg_list, description=None, extra=None): """Parse command line arguments. Args: arg_list: command line argument list. description: description to use in argument parser. extra: additional required arguments to add. These will be exposed as instance attributes. This is either a list of extra arguments, or a single string or tuple. If a tuple, the first item is the argument and the second a default, otherwise the argument is required. Arguments are used as in argparse, ie those beginning with -- are named, and those without a dash are positional. Don't use a single dash. """ parser = self._MakeParser(description, extra) self._parsed_args = parser.parse_args(arg_list) def ExtractArgs(self, arg_list): """Extract arguments from arg_str. Args: arg_list: command line argument list. It will be changed so that arguments used by this options instance are removed. """ parser = self._MakeParser() (self._parsed_args, unused) = parser.parse_known_args(arg_list) del arg_list[:] arg_list.extend(unused) def GetParentParser(self, group_name='Global'): """Returns a parser suitable for passing in as a parent to argparse. Args: group_name: A group name for the parser (see argparse's add_argument_group). Returns: An argparse parser instance. """ return self._MakeParser(group=group_name) def SetParsedArgs(self, parsed_args): """Set parsed args. Used with GetParentParser. Args: parsed_args: the result of argparse.parse_args or similar. """ self._parsed_args = parsed_args def _MakeParser(self, description=None, extra=None, group=None): add_help = True if group is None else False parser = argparse.ArgumentParser( description=description, add_help=add_help) container = parser if group is None else parser.add_argument_group(group) for arg, default, help_str in self._ARGS: # All global options are named. arg = '--' + arg self._AddArg(container, arg, default, help_str=help_str) if extra is not None: if type(extra) is not list: extra = [extra] for arg in extra: if type(arg) is tuple: argname, default = arg self._AddArg(container, argname, default) else: self._AddArg(container, arg, None, required=True) return parser def _AddArg(self, container, arg, default, required=False, help_str=None): assert not arg.startswith('-') or arg.startswith('--'), \ "Single dash arguments aren't supported: %s" % arg arg_name = arg if arg.startswith('--'): arg_name = arg[2:] assert arg_name not in self._arg_set, \ '%s extra arg is a duplicate' % arg_name self._arg_set.add(arg_name) kwargs = {} if required and arg.startswith('--'): kwargs['required'] = required if help_str is not None: kwargs['help'] = help_str if default is not None: if type(default) is bool: # If the default of a switch is true, setting the flag stores false. if default: kwargs['action'] = 'store_false' else: kwargs['action'] = 'store_true' else: kwargs['default'] = default kwargs['type'] = type(default) container.add_argument(arg, **kwargs) def __getattr__(self, name): if name in self._arg_set: assert self._parsed_args, 'Option requested before ParseArgs called' return getattr(self._parsed_args, name) raise AttributeError(name) def ChromePackage(self): return constants.PACKAGE_INFO[self.chrome_package_name] OPTIONS = Options()
junhuac/MQUIC
src/tools/android/loading/options.py
Python
mit
6,296
import datetime import httplib import urllib import os.path import csv import time from datetime import timedelta import pandas as pd import numpy as np def isfloat(value): try: float(value) return True except ValueError: return False def totimestamp(dt, epoch=datetime.date(1970,1,1)): td = dt - epoch # return td.total_seconds() return (td.microseconds + (td.seconds + td.days * 86400) * 10**6) / 10**6 class stockImport(object): def __init__(self ): print ('setup stock importer') def saveDate(self, date=None): date_str = date.strftime("%m/%d/%Y") print('{} finished'.format(date_str)) f = open('./twstock.tmp', 'w') f.write(date_str) def loadDate(self): try: f = open('./twstock.tmp', 'r') date_str = f.readline() #default set to 4 PM return datetime.datetime.strptime(date_str + " 16:00:00", "%m/%d/%Y %H:%M:%S") except IOError: return datetime.datetime.strptime("1/1/2010 16:00:00", "%m/%d/%Y %H:%M:%S") def downloadData(self): start_day = datetime.date(2004, 2, 11); today = datetime.date.today() one_day = timedelta(days=1) y, m, d, h, min, sec, wd, yd, i = datetime.datetime.now().timetuple() end_time = today if h > 16: end_time = today + one_day print "start download missing data" print "checking from " + start_day.strftime("%Y-%m-%d") + " to " + today.strftime("%Y-%m-%d") print "checking end time " + end_time.strftime("%Y-%m-%d") download_date = start_day while download_date < end_time: file_name = "data/" + download_date.strftime("%Y%m%d") + ".csv" if os.path.isfile(file_name): download_date += one_day continue httpreq = httplib.HTTPConnection('www.twse.com.tw') #http://www.twse.com.tw/exchangeReport/MI_INDEX?response=csv&date=20170526&type=ALL #headers = {"Content-type": "application/x-www-form-urlencoded", "Accept": "text/plain"} print date_str = str(download_date.year - 1911 ) + download_date.strftime("/%m/%d") form = urllib.urlencode({'download': 'csv', 'qdate': date_str, 'selectType': 'ALLBUT0999'}) #httpreq.request("POST", "/ch/trading/exchange/MI_INDEX/MI_INDEX.php", form, headers); full_url = "exchangeReport/MI_INDEX?response=csv&date=" + download_date.strftime("%Y%m%d") + "&type=ALL" print full_url httpreq.request("GET", "http://www.twse.com.tw/exchangeReport/MI_INDEX?response=csv&date=" + download_date.strftime("%Y%m%d") + "&type=ALL"); httpres = httpreq.getresponse() stock_csv = httpres.read() print "downloading " + file_name f = open(file_name, "w") f.write(stock_csv) download_date += one_day def insertToStock(self, stockid, row, date): try: date_str = date.strftime("%Y-%m-%d") df = pd.DataFrame.from_csv('bystock/' + stockid + '.csv') #check if there is a key df.loc[date_str].count() #key already exist. skip it except KeyError: #no such key. insert it df = pd.concat([df, row]) df.to_csv('bystock/' + stockid + '.csv') #print df except IOError: print('stock id: {} not exist'.format(stockid)) row.to_csv('bystock/' + stockid + '.csv') def prepcsv(self, csv): ret = [] for i in csv: tmp = i tmp = tmp.replace(',', '') tmp = tmp.replace('\'', '') tmp = tmp.replace('\"', '') tmp = tmp.replace('=', '') ret.append(tmp) return ret def convertCSV(self, file_path=None, date=None): print('convert csv {}'.format(file_path)) with open(file_path, 'rb') as csvfile: spamreader = csv.reader(csvfile, delimiter=',', quotechar='"') for row in spamreader: if len(row) < 16: #abnormal some column missing? continue #if len(row) == 17: #abnormal should not more than 16 column #print(row) if len(row) == 17: stockid=row[0].replace('=', '') stockid=stockid.replace('"', '') stockid=stockid.strip() if stockid.startswith('('): continue checkrow = row[11].replace(',', '') checkrow = checkrow.replace('"', '') checkrow = checkrow.replace('=', '') if not checkrow[0].isdigit(): #skip column title continue row = self.prepcsv(row) TV=int(row[2]) TC=int(row[3]) TO=int(row[4]) RD=row[9] if RD == '+': DF=float(row[10]) RD=1 elif RD == '-': DF=0-float(row[10]) RD=-1 else: DF=0 RD=0 PE=float(row[15]) try: OP=float(row[5]) CP=float(row[8]) HP=float(row[6]) LP=float(row[7]) except ValueError: OP=None CP=None HP=None LP=None #print('OP:{} CP:{} HP:{} LP:{} DF:{} RD:{} TV:{} TC:{} TO:{}\n'.format( OP, CP, HP, LP, DF, RD, TV, TC, TO)) cols = ['OP', 'CP', 'HP', 'LP', 'DF', 'RD', 'TV', 'TC', 'TO'] date_index = pd.date_range(date.strftime("%m/%d/%Y"), periods=1) df1 = pd.DataFrame([[OP, CP, HP, LP, DF, RD, TV, TC, TO]], columns=cols) df1['date'] = date_index df1 = df1.set_index(['date']) #print stockid #print df1 self.insertToStock(stockid, df1, date) self.saveDate(date) def getExpectCP(self, df, date): today = datetime.date.today() one_day = timedelta(days=1) if date > today: #print "over today" #print date.strftime("%Y-%m-%d") return None try: date_str = date.strftime("%Y-%m-%d") return df.loc[date_str, 'CP'] except KeyError as e: return self.getExpectCP(df, date + one_day) def loadTrainDataById(self, stock_id, start_date, days, expect): one_day = timedelta(days=1) stop_date = start_date + one_day * days expect_date = start_date + one_day * (days + expect) today = datetime.date.today() if stop_date > today: return None try: start_date_str = start_date.strftime("%Y-%m-%d") stop_date_str = stop_date.strftime("%Y-%m-%d") expect_date_str = expect_date.strftime("%Y-%m-%d") df = pd.DataFrame.from_csv('bystock/' + stock_id + '.csv') print "from:" + start_date_str + " to:" + stop_date_str dft = df.loc[start_date_str:stop_date_str] #print dft.as_matrix() #print dft.reset_index().values dfcp = df.loc[start_date_str:stop_date_str, 'CP'] #print df.loc[start_date_str:expect_date_str, 'CP'] expcp = self.getExpectCP(df, expect_date) if expcp == None: return #print dfcp print 'max during train:' + str(dfcp.max()) print str(expect) + ' days ' + expect_date_str + ' close price' + str(expcp) if expcp > dfcp.max(): print 'up' else: print 'down' except KeyError as e: print "out of range , try next day" except IOError: print "no such stock id" def loadTrainDataByIdFixedRow(self, stock_id, start_date, days, expect): one_day = timedelta(days=1) stop_date = start_date + one_day * days expect_date = start_date + one_day * (days + expect) today = datetime.date.today() res = 0 if stop_date > today: return None, None try: start_date_str = start_date.strftime("%Y-%m-%d") stop_date_str = stop_date.strftime("%Y-%m-%d") expect_date_str = expect_date.strftime("%Y-%m-%d") today_date_str = datetime.date.today() #read data frame from stock file df = pd.DataFrame.from_csv('bystock/' + stock_id + '.csv') #print "from:" + start_date_str + " to:" + stop_date_str #count total record from start to now, check if data record is enough dft = df.loc[start_date_str:today_date_str] if dft['CP'].count() < days + expect: print 'data is not enough for train or validate' return None, None #retrive enough data record days + expect days dft = dft[:days + expect] #get the expect date data record expcpdf = dft.tail(1) #print dft #print dft[:days] #print dft.as_matrix() #print dft.reset_index().values #first n days data record for training dfcp = dft[:days] #convert to matrix data = dfcp.as_matrix() #get expected close price expcp = expcpdf['CP'].max() #get max close price in training data tmax = dft[:days]['CP'].max() #print 'last price:' + str(expcpdf['CP']) #print 'max during train:' + str(tmax) #print str(expect) + ' days close price:' + str(expcp) if expcp > tmax: res = 1 #print 'up' else: res = 0 #print 'down' return data, res except KeyError as e: print "out of range , try next day" except IOError: print "no such stock id" def loadAllTrainDataByStock(self, stock_id, start_date, days, expect): today = datetime.date.today() one_day = timedelta(days=1) da = start_date X = [] Y = [] while da < today: da = da + one_day d, r = self.loadTrainDataByIdFixedRow(stock_id, da, days, expect) if d is None: break x = sum(d.tolist(), []) X.append(x) Y.append(r) #print("---------------------------------------------") #print x #print("---------------------------------------------") #print r return X,Y
kaija/tw-stock
stock.py
Python
mit
11,215
# encoding: utf-8 from __future__ import absolute_import, division, print_function # Copyright (C) 2005-2007 Carabos Coop. V. All rights reserved # Copyright (C) 2008-2013 Vicent Mas. All rights reserved # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # # Author: Vicent Mas - [email protected] import locale import warnings import sys from liam2 import config from liam2.compat import PY2 from liam2.utils import ExceptionOnGetAttr try: from qtpy import QtWidgets from vitables.vtapp import VTApp except ImportError as e: msg = "the 'view' command is not available because 'vitables' does not seem to be installed correctly (%s)." % e print("Warning:", msg) if not config.debug and not PY2: e = ImportError(msg).with_traceback(sys.exc_info()[2]) VTApp = ExceptionOnGetAttr(e) QtWidgets = ExceptionOnGetAttr(e) def viewhdf(filepaths): app = QtWidgets.QApplication(filepaths) # These imports must be done after the QApplication has been instantiated with warnings.catch_warnings(): # ignore deprecation warnings just for this import warnings.filterwarnings("ignore", category=DeprecationWarning) from vitables.vtapp import VTApp from vitables.preferences import vtconfig # Specify the organization's Internet domain. When the Internet # domain is set, it is used on Mac OS X instead of the organization # name, since Mac OS X applications conventionally use Internet # domains to identify themselves app.setOrganizationDomain('vitables.org') app.setOrganizationName('ViTables') app.setApplicationName('ViTables') app.setApplicationVersion(vtconfig.getVersion()) # Localize the application using the system locale # numpy seems to have problems with decimal separator in some locales # (catalan, german...) so C locale is always used for numbers. locale.setlocale(locale.LC_ALL, '') locale.setlocale(locale.LC_NUMERIC, 'C') # Start the application vtapp = VTApp(mode='a', h5files=filepaths) vtapp.gui.show() app.exec_()
liam2/liam2
liam2/view.py
Python
gpl-3.0
2,740
from PyQt5.QtCore import * from PyDesignData.PyDesignObject import * from PyDesignModel.PyDesignCalcSheetsItem import PyDesignCalcSheetsItem from PyDesignModel.PyDesignIcons import * from PyDesignModel.PyDesignMaterialsItem import PyDesignMaterialsItem from PyDesignModel.PyDesignModelItem import PyDesignModelItem from PyDesignModel.PyDesignParametersItem import * from PyDesignModel.PyDesignGeometriesItem import * from PyDesignModel.PyDesignMeshesItem import * from PyDesignModel.PyDesignSolversItem import PyDesignSolversItem __author__ = 'magnus' class PyDesignAnalysisItem(PyDesignModelItem): def __init__(self, parent, py_design_analysis): """ :type py_design_analysis: PyDesignAnalysis :param parent: :param py_design_analysis: :return: """ PyDesignModelItem.__init__(self, parent, parent.model) self._data_object = py_design_analysis self._data_dict[PyDesignNamedObject.NAME] = self.data_name self._data_dict[PyDesignCommon.VALUE] = self.data_value '''self._data_dict[PDP.size_temp] = self.data_size_temp self._data_dict[PDP.medium_type] = self.data_medium_type self._data_dict[PDP.size_pres] = self.data_size_pres''' self._set_data_dict[PyDesignNamedObject.NAME] = self.set_data_name self._icon = get_icon("analysis") py_design_analysis.add_listener(self) self._children.append(PyDesignParametersItem(py_design_analysis.properties, self)) self._children.append(PyDesignCalcSheetsItem(py_design_analysis, self)) self._children.append(PyDesignGeometriesItem(py_design_analysis, self)) self._children.append(PyDesignMeshesItem(py_design_analysis, self)) self._children.append(PyDesignMaterialsItem(py_design_analysis, self)) self._children.append(PyDesignSolversItem(py_design_analysis, self)) self._type = "PyDesignAnalysisModelItem" self._context_menu = QMenu() add_prop_menu = self._context_menu.addAction("Add property") add_prop_menu.triggered.connect(self.on_add_property) add_prop_menu = self._context_menu.addAction("Add calculation sheet") add_prop_menu.triggered.connect(self.on_add_sheet) add_prop_menu = self._context_menu.addAction("Add geometry") add_prop_menu.triggered.connect(self.on_add_geometry) add_prop_menu = self._context_menu.addAction("Add mesh") add_prop_menu.triggered.connect(self.on_add_mesh) add_prop_menu = self._context_menu.addAction("Add material") add_prop_menu.triggered.connect(self.on_add_material) add_prop_menu = self._context_menu.addAction("Delete analysis") add_prop_menu.triggered.connect(self.on_delete) def on_add_property(self): PyDesignEventHandlers.on_add_parameter(self._data_object.properties) def on_add_sheet(self): PyDesignEventHandlers.on_add_sheet(self._data_object) def on_add_geometry(self): PyDesignEventHandlers.on_add_geometry(self._data_object, None) def on_add_mesh(self): pass def on_add_material(self): pass def on_delete(self): pass def data_name(self, int_role): if int_role == Qt.DisplayRole or int_role == Qt.EditRole: return self._data_object.name elif int_role == Qt.DecorationRole: return self._icon else: return None def set_data_name(self, int_role, data): if int_role == Qt.EditRole: self._data_object.name = data return True def data_value(self, int_role): if int_role == Qt.DisplayRole: type_name = "Unknown analysis" type_name = "3D analysis" if self._data_object.analysis_type == 0 else type_name type_name = "2D analysis" if self._data_object.analysis_type == 1 else type_name type_name = "2D analysis axis symmetric" if self._data_object.analysis_type == 2 else type_name return type_name else: return None def data_size_pres(self, int_role): if int_role == Qt.DisplayRole: return self._data_object.size_pres else: return None def data_medium_type(self, int_role): if int_role == Qt.DisplayRole: return self._data_object.medium_type else: return None @staticmethod def item_flags(int_pdp): default_flags = Qt.ItemIsSelectable | Qt.ItemIsEnabled if int_pdp == PyDesignNamedObject.NAME: return default_flags | Qt.ItemIsEditable else: return default_flags def on_context_menu(self, point): self._context_menu.exec_(point) def on_event(self, event): """ :type event: PyDesignEvent :param event: :return: """ self._model.on_item_changed(self) if event.type == PyDesignEvent.EndItemAddedEvent: pass #new_item = PyDesignParameterItem(self, event.value) #self.add_child(new_item) return
pracedru/pyDesign
PyDesignModel/PyDesignAnalysisItem.py
Python
mit
5,100
from __future__ import division, print_function, absolute_import import numpy as np import numpy.testing as npt import pytest from pytest import raises as assert_raises from scipy._lib._numpy_compat import suppress_warnings from scipy.integrate import IntegrationWarning from scipy import stats from scipy.special import betainc from. common_tests import (check_normalization, check_moment, check_mean_expect, check_var_expect, check_skew_expect, check_kurt_expect, check_entropy, check_private_entropy, check_entropy_vect_scale, check_edge_support, check_named_args, check_random_state_property, check_meth_dtype, check_ppf_dtype, check_cmplx_deriv, check_pickling, check_rvs_broadcast) from scipy.stats._distr_params import distcont """ Test all continuous distributions. Parameters were chosen for those distributions that pass the Kolmogorov-Smirnov test. This provides safe parameters for each distributions so that we can perform further testing of class methods. These tests currently check only/mostly for serious errors and exceptions, not for numerically exact results. """ # Note that you need to add new distributions you want tested # to _distr_params DECIMAL = 5 # specify the precision of the tests # increased from 0 to 5 # Last four of these fail all around. Need to be checked distcont_extra = [ ['betaprime', (100, 86)], ['fatiguelife', (5,)], ['mielke', (4.6420495492121487, 0.59707419545516938)], ['invweibull', (0.58847112119264788,)], # burr: sample mean test fails still for c<1 ['burr', (0.94839838075366045, 4.3820284068855795)], # genextreme: sample mean test, sf-logsf test fail ['genextreme', (3.3184017469423535,)], ] distslow = ['kappa4', 'rdist', 'gausshyper', 'recipinvgauss', 'genexpon', 'vonmises', 'vonmises_line', 'mielke', 'semicircular', 'cosine', 'invweibull', 'powerlognorm', 'johnsonsu', 'kstwobign'] # distslow are sorted by speed (very slow to slow) # These distributions fail the complex derivative test below. # Here 'fail' mean produce wrong results and/or raise exceptions, depending # on the implementation details of corresponding special functions. # cf https://github.com/scipy/scipy/pull/4979 for a discussion. fails_cmplx = set(['beta', 'betaprime', 'chi', 'chi2', 'dgamma', 'dweibull', 'erlang', 'f', 'gamma', 'gausshyper', 'gengamma', 'gennorm', 'genpareto', 'halfgennorm', 'invgamma', 'ksone', 'kstwobign', 'levy_l', 'loggamma', 'logistic', 'maxwell', 'nakagami', 'ncf', 'nct', 'ncx2', 'norminvgauss', 'pearson3', 'rice', 't', 'skewnorm', 'tukeylambda', 'vonmises', 'vonmises_line', 'rv_histogram_instance']) _h = np.histogram([1, 2, 2, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 5, 6, 6, 6, 6, 7, 7, 7, 8, 8, 9], bins=8) histogram_test_instance = stats.rv_histogram(_h) def cases_test_cont_basic(): for distname, arg in distcont[:] + [(histogram_test_instance, tuple())]: if distname == 'levy_stable': continue elif distname in distslow: yield pytest.param(distname, arg, marks=pytest.mark.slow) else: yield distname, arg @pytest.mark.parametrize('distname,arg', cases_test_cont_basic()) def test_cont_basic(distname, arg): # this test skips slow distributions if distname == 'truncnorm': pytest.xfail(reason=distname) try: distfn = getattr(stats, distname) except TypeError: distfn = distname distname = 'rv_histogram_instance' np.random.seed(765456) sn = 500 with suppress_warnings() as sup: # frechet_l and frechet_r are deprecated, so all their # methods generate DeprecationWarnings. sup.filter(category=DeprecationWarning, message=".*frechet_") rvs = distfn.rvs(size=sn, *arg) sm = rvs.mean() sv = rvs.var() m, v = distfn.stats(*arg) check_sample_meanvar_(distfn, arg, m, v, sm, sv, sn, distname + 'sample mean test') check_cdf_ppf(distfn, arg, distname) check_sf_isf(distfn, arg, distname) check_pdf(distfn, arg, distname) check_pdf_logpdf(distfn, arg, distname) check_cdf_logcdf(distfn, arg, distname) check_sf_logsf(distfn, arg, distname) alpha = 0.01 if distname == 'rv_histogram_instance': check_distribution_rvs(distfn.cdf, arg, alpha, rvs) else: check_distribution_rvs(distname, arg, alpha, rvs) locscale_defaults = (0, 1) meths = [distfn.pdf, distfn.logpdf, distfn.cdf, distfn.logcdf, distfn.logsf] # make sure arguments are within support spec_x = {'frechet_l': -0.5, 'weibull_max': -0.5, 'levy_l': -0.5, 'pareto': 1.5, 'tukeylambda': 0.3, 'rv_histogram_instance': 5.0} x = spec_x.get(distname, 0.5) if distname == 'invweibull': arg = (1,) elif distname == 'ksone': arg = (3,) check_named_args(distfn, x, arg, locscale_defaults, meths) check_random_state_property(distfn, arg) check_pickling(distfn, arg) # Entropy if distname not in ['kstwobign']: check_entropy(distfn, arg, distname) if distfn.numargs == 0: check_vecentropy(distfn, arg) if (distfn.__class__._entropy != stats.rv_continuous._entropy and distname != 'vonmises'): check_private_entropy(distfn, arg, stats.rv_continuous) with suppress_warnings() as sup: sup.filter(IntegrationWarning, "The occurrence of roundoff error") sup.filter(IntegrationWarning, "Extremely bad integrand") sup.filter(RuntimeWarning, "invalid value") check_entropy_vect_scale(distfn, arg) check_edge_support(distfn, arg) check_meth_dtype(distfn, arg, meths) check_ppf_dtype(distfn, arg) if distname not in fails_cmplx: check_cmplx_deriv(distfn, arg) if distname != 'truncnorm': check_ppf_private(distfn, arg, distname) def test_levy_stable_random_state_property(): # levy_stable only implements rvs(), so it is skipped in the # main loop in test_cont_basic(). Here we apply just the test # check_random_state_property to levy_stable. check_random_state_property(stats.levy_stable, (0.5, 0.1)) def cases_test_moments(): fail_normalization = set(['vonmises']) fail_higher = set(['vonmises', 'ncf']) for distname, arg in distcont[:] + [(histogram_test_instance, tuple())]: if distname == 'levy_stable': continue cond1 = distname not in fail_normalization cond2 = distname not in fail_higher yield distname, arg, cond1, cond2, False if not cond1 or not cond2: # Run the distributions that have issues twice, once skipping the # not_ok parts, once with the not_ok parts but marked as knownfail yield pytest.param(distname, arg, True, True, True, marks=pytest.mark.xfail) @pytest.mark.slow @pytest.mark.parametrize('distname,arg,normalization_ok,higher_ok,is_xfailing', cases_test_moments()) def test_moments(distname, arg, normalization_ok, higher_ok, is_xfailing): try: distfn = getattr(stats, distname) except TypeError: distfn = distname distname = 'rv_histogram_instance' with suppress_warnings() as sup: sup.filter(IntegrationWarning, "The integral is probably divergent, or slowly convergent.") sup.filter(category=DeprecationWarning, message=".*frechet_") if is_xfailing: sup.filter(IntegrationWarning) m, v, s, k = distfn.stats(*arg, moments='mvsk') if normalization_ok: check_normalization(distfn, arg, distname) if higher_ok: check_mean_expect(distfn, arg, m, distname) check_skew_expect(distfn, arg, m, v, s, distname) check_var_expect(distfn, arg, m, v, distname) check_kurt_expect(distfn, arg, m, v, k, distname) check_loc_scale(distfn, arg, m, v, distname) check_moment(distfn, arg, m, v, distname) @pytest.mark.parametrize('dist,shape_args', distcont) def test_rvs_broadcast(dist, shape_args): if dist in ['gausshyper', 'genexpon']: pytest.skip("too slow") # If shape_only is True, it means the _rvs method of the # distribution uses more than one random number to generate a random # variate. That means the result of using rvs with broadcasting or # with a nontrivial size will not necessarily be the same as using the # numpy.vectorize'd version of rvs(), so we can only compare the shapes # of the results, not the values. # Whether or not a distribution is in the following list is an # implementation detail of the distribution, not a requirement. If # the implementation the rvs() method of a distribution changes, this # test might also have to be changed. shape_only = dist in ['betaprime', 'dgamma', 'exponnorm', 'norminvgauss', 'nct', 'dweibull', 'rice', 'levy_stable', 'skewnorm'] distfunc = getattr(stats, dist) loc = np.zeros(2) scale = np.ones((3, 1)) nargs = distfunc.numargs allargs = [] bshape = [3, 2] # Generate shape parameter arguments... for k in range(nargs): shp = (k + 4,) + (1,)*(k + 2) allargs.append(shape_args[k]*np.ones(shp)) bshape.insert(0, k + 4) allargs.extend([loc, scale]) # bshape holds the expected shape when loc, scale, and the shape # parameters are all broadcast together. check_rvs_broadcast(distfunc, dist, allargs, bshape, shape_only, 'd') def test_rvs_gh2069_regression(): # Regression tests for gh-2069. In scipy 0.17 and earlier, # these tests would fail. # # A typical example of the broken behavior: # >>> norm.rvs(loc=np.zeros(5), scale=np.ones(5)) # array([-2.49613705, -2.49613705, -2.49613705, -2.49613705, -2.49613705]) np.random.seed(123) vals = stats.norm.rvs(loc=np.zeros(5), scale=1) d = np.diff(vals) npt.assert_(np.all(d != 0), "All the values are equal, but they shouldn't be!") vals = stats.norm.rvs(loc=0, scale=np.ones(5)) d = np.diff(vals) npt.assert_(np.all(d != 0), "All the values are equal, but they shouldn't be!") vals = stats.norm.rvs(loc=np.zeros(5), scale=np.ones(5)) d = np.diff(vals) npt.assert_(np.all(d != 0), "All the values are equal, but they shouldn't be!") vals = stats.norm.rvs(loc=np.array([[0], [0]]), scale=np.ones(5)) d = np.diff(vals.ravel()) npt.assert_(np.all(d != 0), "All the values are equal, but they shouldn't be!") assert_raises(ValueError, stats.norm.rvs, [[0, 0], [0, 0]], [[1, 1], [1, 1]], 1) assert_raises(ValueError, stats.gamma.rvs, [2, 3, 4, 5], 0, 1, (2, 2)) assert_raises(ValueError, stats.gamma.rvs, [1, 1, 1, 1], [0, 0, 0, 0], [[1], [2]], (4,)) def check_sample_meanvar_(distfn, arg, m, v, sm, sv, sn, msg): # this did not work, skipped silently by nose if np.isfinite(m): check_sample_mean(sm, sv, sn, m) if np.isfinite(v): check_sample_var(sv, sn, v) def check_sample_mean(sm, v, n, popmean): # from stats.stats.ttest_1samp(a, popmean): # Calculates the t-obtained for the independent samples T-test on ONE group # of scores a, given a population mean. # # Returns: t-value, two-tailed prob df = n-1 svar = ((n-1)*v) / float(df) # looks redundant t = (sm-popmean) / np.sqrt(svar*(1.0/n)) prob = betainc(0.5*df, 0.5, df/(df + t*t)) # return t,prob npt.assert_(prob > 0.01, 'mean fail, t,prob = %f, %f, m, sm=%f,%f' % (t, prob, popmean, sm)) def check_sample_var(sv, n, popvar): # two-sided chisquare test for sample variance equal to # hypothesized variance df = n-1 chi2 = (n-1)*popvar/float(popvar) pval = stats.distributions.chi2.sf(chi2, df) * 2 npt.assert_(pval > 0.01, 'var fail, t, pval = %f, %f, v, sv=%f, %f' % (chi2, pval, popvar, sv)) def check_cdf_ppf(distfn, arg, msg): values = [0.001, 0.5, 0.999] npt.assert_almost_equal(distfn.cdf(distfn.ppf(values, *arg), *arg), values, decimal=DECIMAL, err_msg=msg + ' - cdf-ppf roundtrip') def check_sf_isf(distfn, arg, msg): npt.assert_almost_equal(distfn.sf(distfn.isf([0.1, 0.5, 0.9], *arg), *arg), [0.1, 0.5, 0.9], decimal=DECIMAL, err_msg=msg + ' - sf-isf roundtrip') npt.assert_almost_equal(distfn.cdf([0.1, 0.9], *arg), 1.0 - distfn.sf([0.1, 0.9], *arg), decimal=DECIMAL, err_msg=msg + ' - cdf-sf relationship') def check_pdf(distfn, arg, msg): # compares pdf at median with numerical derivative of cdf median = distfn.ppf(0.5, *arg) eps = 1e-6 pdfv = distfn.pdf(median, *arg) if (pdfv < 1e-4) or (pdfv > 1e4): # avoid checking a case where pdf is close to zero or # huge (singularity) median = median + 0.1 pdfv = distfn.pdf(median, *arg) cdfdiff = (distfn.cdf(median + eps, *arg) - distfn.cdf(median - eps, *arg))/eps/2.0 # replace with better diff and better test (more points), # actually, this works pretty well msg += ' - cdf-pdf relationship' npt.assert_almost_equal(pdfv, cdfdiff, decimal=DECIMAL, err_msg=msg) def check_pdf_logpdf(distfn, args, msg): # compares pdf at several points with the log of the pdf points = np.array([0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8]) vals = distfn.ppf(points, *args) pdf = distfn.pdf(vals, *args) logpdf = distfn.logpdf(vals, *args) pdf = pdf[pdf != 0] logpdf = logpdf[np.isfinite(logpdf)] msg += " - logpdf-log(pdf) relationship" npt.assert_almost_equal(np.log(pdf), logpdf, decimal=7, err_msg=msg) def check_sf_logsf(distfn, args, msg): # compares sf at several points with the log of the sf points = np.array([0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8]) vals = distfn.ppf(points, *args) sf = distfn.sf(vals, *args) logsf = distfn.logsf(vals, *args) sf = sf[sf != 0] logsf = logsf[np.isfinite(logsf)] msg += " - logsf-log(sf) relationship" npt.assert_almost_equal(np.log(sf), logsf, decimal=7, err_msg=msg) def check_cdf_logcdf(distfn, args, msg): # compares cdf at several points with the log of the cdf points = np.array([0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8]) vals = distfn.ppf(points, *args) cdf = distfn.cdf(vals, *args) logcdf = distfn.logcdf(vals, *args) cdf = cdf[cdf != 0] logcdf = logcdf[np.isfinite(logcdf)] msg += " - logcdf-log(cdf) relationship" npt.assert_almost_equal(np.log(cdf), logcdf, decimal=7, err_msg=msg) def check_distribution_rvs(dist, args, alpha, rvs): # test from scipy.stats.tests # this version reuses existing random variables D, pval = stats.kstest(rvs, dist, args=args, N=1000) if (pval < alpha): D, pval = stats.kstest(dist, '', args=args, N=1000) npt.assert_(pval > alpha, "D = " + str(D) + "; pval = " + str(pval) + "; alpha = " + str(alpha) + "\nargs = " + str(args)) def check_vecentropy(distfn, args): npt.assert_equal(distfn.vecentropy(*args), distfn._entropy(*args)) def check_loc_scale(distfn, arg, m, v, msg): loc, scale = 10.0, 10.0 mt, vt = distfn.stats(loc=loc, scale=scale, *arg) npt.assert_allclose(m*scale + loc, mt) npt.assert_allclose(v*scale*scale, vt) def check_ppf_private(distfn, arg, msg): # fails by design for truncnorm self.nb not defined ppfs = distfn._ppf(np.array([0.1, 0.5, 0.9]), *arg) npt.assert_(not np.any(np.isnan(ppfs)), msg + 'ppf private is nan')
Eric89GXL/scipy
scipy/stats/tests/test_continuous_basic.py
Python
bsd-3-clause
16,318
""" We try to be very hygienic regarding the exceptions we throw: Every Exception mitmproxy raises shall be a subclass of ProxyException. See also: http://lucumr.pocoo.org/2014/10/16/on-error-handling/ """ from __future__ import absolute_import, print_function, division import sys import traceback class ProxyException(Exception): """ Base class for all exceptions thrown by mitmproxy. """ def __init__(self, message=None): super(ProxyException, self).__init__(message) class Kill(ProxyException): """ Signal that both client and server connection(s) should be killed immediately. """ pass class ProtocolException(ProxyException): pass class TlsProtocolException(ProtocolException): pass class ClientHandshakeException(TlsProtocolException): def __init__(self, message, server): super(ClientHandshakeException, self).__init__(message) self.server = server class InvalidServerCertificate(TlsProtocolException): def __repr__(self): # In contrast to most others, this is a user-facing error which needs to look good. return str(self) class Socks5ProtocolException(ProtocolException): pass class HttpProtocolException(ProtocolException): pass class Http2ProtocolException(ProtocolException): pass class ServerException(ProxyException): pass class ContentViewException(ProxyException): pass class ReplayException(ProxyException): pass class ScriptException(ProxyException): @classmethod def from_exception_context(cls, cut_tb=1): """ Must be called while the current stack handles an exception. Args: cut_tb: remove N frames from the stack trace to hide internal calls. """ exc_type, exc_value, exc_traceback = sys.exc_info() while cut_tb > 0: exc_traceback = exc_traceback.tb_next cut_tb -= 1 tb = "".join(traceback.format_exception(exc_type, exc_value, exc_traceback)) return cls(tb) class FlowReadException(ProxyException): pass class ControlException(ProxyException): pass class OptionsError(Exception): pass class AddonError(Exception): pass
jvillacorta/mitmproxy
mitmproxy/exceptions.py
Python
mit
2,225
from mongoWork import MongoWork from flask import Flask, request, session, render_template, url_for, redirect, jsonify from json import loads app = Flask('lc-server') app.secret_key = 'developerkey' config = {} mongo = None @app.route('/', methods=['GET', 'POST']) def index(): if session.get('logged') is not None: return render_template('index.html', computers=mongo.findComputers()) else: return redirect(url_for('login')) @app.route('/login', methods=['GET', 'POST']) def login(): if request.method == 'GET': if session.get('logged') is None: return render_template('login.html') else: return redirect(url_for('index')) elif request.method == 'POST': if request.form.get('user') == config['siteUser']: if request.form.get('pass') == config['sitePass']: session['logged'] = True return redirect(url_for('index')) return render_template('login.html') @app.route('/heartbeat') def heartbeat(): return jsonify(mongo.heartbeatResponse(request.environ.get('HTTP_X_REAL_IP', request.remote_addr))) @app.route('/addtask', methods=['POST']) def addtask(): if session.get('logged') is None: return redirect(url_for('login')) elif 'shell@@@' in request.form.get('task'): return jsonify(mongo.addTask( request.environ.get('HTTP_X_REAL_IP', request.remote_addr), request.form['task'])) @app.route('/dataload', methods=['POST']) def dataload(): req_json = request.get_json() req_json["ip"] = request.environ.get('HTTP_X_REAL_IP', request.remote_addr) try: mongo.saveInfo(req_json) return jsonify({"accepted": True}) except Exception as e: print("[dataload]:{}".format(e)) return jsonify({"accepted": False}) @app.route('/computer', methods=['GET']) def getComputer(): if request.args.get('host') and len(request.args['host'].split('.')) == 4: pcs = mongo.findComputers({'ip': request.args['host']}) if len(pcs) == 0: return redirect(url_for('index')) else: return render_template('computer.html', computer=pcs[0]) else: return redirect(url_for('index')) @app.route('/logout') def logout(): if session.get('logged') is not None: session.pop('logged') return render_template('logout.html') else: return redirect(url_for('login')) def loadConfig(): global config o = open('./data/config.json') data = o.read() o.close() config = loads(data) loadConfig() mongo = MongoWork(config) app.run(host=config['address'], port=config['port'], debug=config['debug'], threaded=config['threaded'])
arseniypetrikor/lc-server
main.py
Python
gpl-3.0
2,557
import _plotly_utils.basevalidators class YcalendarValidator(_plotly_utils.basevalidators.EnumeratedValidator): def __init__(self, plotly_name="ycalendar", parent_name="histogram", **kwargs): super(YcalendarValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop("edit_type", "calc"), role=kwargs.pop("role", "info"), values=kwargs.pop( "values", [ "gregorian", "chinese", "coptic", "discworld", "ethiopian", "hebrew", "islamic", "julian", "mayan", "nanakshahi", "nepali", "persian", "jalali", "taiwan", "thai", "ummalqura", ], ), **kwargs )
plotly/python-api
packages/python/plotly/plotly/validators/histogram/_ycalendar.py
Python
mit
1,058
# Copyright (C) 2016 Red Hat, Inc., Bryn M. Reeves <[email protected]> # This file is part of the sos project: https://github.com/sosreport/sos # # This copyrighted material is made available to anyone wishing to use, # modify, copy, or redistribute it subject to the terms and conditions of # version 2 of the GNU General Public License. # # See the LICENSE file in the source distribution for further information. from sos.plugins import Plugin, RedHatPlugin class Dracut(Plugin, RedHatPlugin): """ Dracut initramfs generator """ plugin_name = "dracut" packages = ("dracut",) def setup(self): self.add_copy_spec([ "/etc/dracut.conf", "/etc/dracut.conf.d" ]) self.add_cmd_output([ "dracut --list-modules", "dracut --print-cmdline" ]) # vim: set et ts=4 sw=4 :
nijinashok/sos
sos/plugins/dracut.py
Python
gpl-2.0
862
#!/usr/bin/env python # -*- coding: utf-8 -*- import sys import re from googletrans import Translator translator = Translator() line = sys.stdin.readline() while line: match = re.search('^:([^\s]+) PRIVMSG (#[^\s]+) :(.+)', line) if not match: line = sys.stdin.readline() continue who = match.group(1) chan = match.group(2) what = match.group(3).strip().strip('\r\n') def reply(text): print("PRIVMSG %s :%s" % (chan, text)) sys.stdout.flush() if what[:10] == ':translate': m2 = re.search('^:translate (.*)', what) if not m2: line = sys.stdin.readline() continue try: reply(translator.translate(m2.group(1), dest='fr').text) except: reply('Oups!') elif what[:4] == ':tr ': m2 = re.search('^:tr ([\w-]+) ([\w-]+) (.+)', what) if not m2: line = sys.stdin.readline() continue try: reply(translator.translate(m2.group(3), src=m2.group(1), dest=m2.group(2)).text) except: reply('Oups!') line = sys.stdin.readline()
fridim/cabot
plugins_examples/translate.py
Python
mit
1,141
""" Hooks to change class:`.PathSimulator` behavior. These hooks group several methods together for use as part of a :class:`.PathSimulator` ``run`` method. They allow for additional calculations or output at several points in the simulation. """ import re import time import logging import openpathsampling as paths from datetime import timedelta from openpathsampling.netcdfplus import StorableNamedObject logger = logging.getLogger(__name__) class SimulationNotFoundError(RuntimeError): """ Raised when a hook tries to access its parent simulation before knowing it. """ pass class GraciousKillError(RuntimeError): """ Raised when a simulation reaches the maximum walltime. """ # makes it easy to catch **only** the max walltime but fail on anything else pass def _self_or_sim_property_or_err(obj, prop_name, sim_prop_name=None): # helper function to get values either from the hook or the parent sim if sim_prop_name is None: # make it possible to have different names for the sim and # self attributes (but default to same name) sim_prop_name = prop_name if getattr(obj, "_" + prop_name) is not None: return getattr(obj, "_" + prop_name) elif obj._simulation is not None: return getattr(obj._simulation, sim_prop_name) else: raise SimulationNotFoundError("'" + prop_name + "' has not " + "been set and no hosting " + "simulation known to get " + "simulation." + sim_prop_name + " ." ) class PathSimulatorHook(StorableNamedObject): """Superclass for PathSimulator hooks. This implementation is a do-nothing hook. Subclasses should subclass the relevant method in order to add hooks PathSimulator objects. """ implemented_for = ['before_simulation', 'before_step', 'after_step', 'after_simulation'] def before_simulation(self, sim, **kwargs): pass # pragma: no-cover def before_step(self, sim, step_number, step_info, state): pass # pragma: no-cover def after_step(self, sim, step_number, step_info, state, results, hook_state): pass # pragma: no-cover def after_simulation(self, sim, hook_state): pass # pragma: no-cover class StorageHook(PathSimulatorHook): """ Standard hook for storage. NOTE: Arguments passed to init take precedence over the corresponding parameters of the PathSimulator this hook is attached to. They can only be accessed through this hook, e.g. as hook.live_visualizer. Parameters ---------- storage : :class:`.Storage` where to save to; default ``None`` uses the simulation's ``storage`` frequency : int save frequency measured in steps; default ``None`` uses the simulation's value for ``save_frequency`` """ implemented_for = ['before_simulation', 'after_step', 'after_simulation'] def __init__(self, storage=None, frequency=None): self.storage = storage self.frequency = frequency self._simulation = None @property def frequency(self): return _self_or_sim_property_or_err(self, "frequency", "save_frequency") @frequency.setter def frequency(self, val): self._frequency = val @property def storage(self): return _self_or_sim_property_or_err(self, "storage") @storage.setter def storage(self, val): self._storage = val def before_simulation(self, sim, **kwargs): self._simulation = sim def after_step(self, sim, step_number, step_info, state, results, hook_state): if self.storage is not None: try: self.storage.stash(results) except AttributeError: self.storage.save(results) if step_number % self.frequency == 0: self.storage.sync_all() def after_simulation(self, sim, hook_state): if self.storage is not None: self.storage.sync_all() class ShootFromSnapshotsOutputHook(PathSimulatorHook): """Default (serial) output for ShootFromSnapshotsSimulation objects. Updates every time a new snapshot is shot from. NOTE: Arguments passed to init take precedence over the corresponding parameters of the PathSimulator this hook is attached to. They can only be accessed through this hook, e.g. as hook.live_visualizer. Parameters ---------- output_stream : stream where to write the results; default ``None`` uses the simulation's ``output_stream`` allow_refresh : bool whether to allow refresh (see :meth:`.refresh_output`); default ``None`` uses the simulation's value """ implemented_for = ['before_simulation', 'before_step'] def __init__(self, output_stream=None, allow_refresh=None): self.output_stream = output_stream self.allow_refresh = allow_refresh self._simulation = None @property def output_stream(self): return _self_or_sim_property_or_err(self, "output_stream") @output_stream.setter def output_stream(self, val): self._output_stream = val @property def allow_refresh(self): return _self_or_sim_property_or_err(self, "allow_refresh") @allow_refresh.setter def allow_refresh(self, val): self._allow_refresh = val def before_simulation(self, sim, **kwargs): self._simulation = sim def before_step(self, sim, step_number, step_info, state): snap_num, n_snapshots, step, n_per_snapshot = step_info paths.tools.refresh_output( "Working on snapshot %d / %d; shot %d / %d" % ( snap_num+1, n_snapshots, step+1, n_per_snapshot ), output_stream=self.output_stream, refresh=self.allow_refresh ) class SampleSetSanityCheckHook(PathSimulatorHook): """ Check sample set sanity. Parameters ---------- frequency : int check frequency measured in steps; default ``None`` uses the simulation's value for ``save_frequency`` """ implemented_for = ['before_simulation', 'after_step'] def __init__(self, frequency=None): self.frequency = frequency self._simulation = None @property def frequency(self): return _self_or_sim_property_or_err(self, "frequency", "save_frequency") @frequency.setter def frequency(self, val): self._frequency = val def before_simulation(self, sim, **kwargs): self._simulation = sim def after_step(self, sim, step_number, step_info, state, results, hook_state): if step_number % self.frequency == 0: if sim.sample_set is not None: # some PathSimulators never set their sample_set # but PathSimulator.__init__ sets it to None sim.sample_set.sanity_check() class LiveVisualizerHook(PathSimulatorHook): """ LiveVisualization using the :class:`openpathsampling.StepVisualizer2D`. Updates every ``simulation.status_update_frequency`` MCSteps, where simulation is the ``PathSimulator`` this hook is attached to. NOTE: You will have to set PathSimulator.allow_refresh = False Otherwise the LiveVisualization will get refreshed away (i.e. deleted) right after creation. NOTE: Arguments passed to init take precedence over the corresponding parameters of the PathSimulator this hook is attached to. They can only be accessed through this hook, e.g. as hook.live_visualizer. Parameters ---------- live_visualizer : :class:`openpathsampling.StepVisualizer2D` default ``None`` uses the simulation's live_visualizer status_update_frequency : int number of steps between two refreshs of the visualization; default ``None`` uses the simulation's value (PathSampling default=1) """ # NOTE: we visualize after step, because otherwise the 'next' MCstep # would depend on the 'previous' one just for viualization # this deviates from the previous implementation but avoids # having to pass the previous MCstep to before_step hooks implemented_for = ['before_simulation', 'after_step'] def __init__(self, live_visualizer=None, status_update_frequency=None): self.live_visualizer = live_visualizer self.status_update_frequency = status_update_frequency self._simulation = None @property def live_visualizer(self): return _self_or_sim_property_or_err(self, "live_visualizer") @live_visualizer.setter def live_visualizer(self, val): self._live_visualizer = val @property def status_update_frequency(self): return _self_or_sim_property_or_err(self, "status_update_frequency") @status_update_frequency.setter def status_update_frequency(self, val): self._status_update_frequency = val def before_simulation(self, sim, **kwargs): self._simulation = sim def after_step(self, sim, step_number, step_info, state, results, hook_state): if step_number % self.status_update_frequency == 0: # do we visualize this step? if self.live_visualizer is not None and results is not None: # do we visualize at all? self.live_visualizer.draw_ipynb(results) class PathSamplingOutputHook(PathSimulatorHook): """ Default (serial) output for PathSamplingSimulation objects. Updates every ``PathSampling.status_update_frequency`` MCSteps. NOTE: Arguments passed to init take precedence over the corresponding parameters of the PathSimulator this hook is attached to. They can only be accessed through this hook, e.g. as hook.output_stream. Parameters ---------- output_stream : stream where to write the results; default ``None`` uses the simulation's ``output_stream`` allow_refresh : bool whether to allow refresh (see :meth:`.refresh_output`); default ``None`` uses the simulation's value status_update_frequency : int number of steps between two refreshs of the visualization; default `None` uses the simulations value (PathSampling default=1) """ implemented_for = ['before_simulation', 'before_step', 'after_simulation'] def __init__(self, output_stream=None, allow_refresh=None, status_update_frequency=None): self.output_stream = output_stream self.allow_refresh = allow_refresh self.status_update_frequency = status_update_frequency self._simulation = None @property def output_stream(self): return _self_or_sim_property_or_err(self, "output_stream") @output_stream.setter def output_stream(self, val): self._output_stream = val @property def allow_refresh(self): return _self_or_sim_property_or_err(self, "allow_refresh") @allow_refresh.setter def allow_refresh(self, val): self._allow_refresh = val @property def status_update_frequency(self): return _self_or_sim_property_or_err(self, "status_update_frequency") @status_update_frequency.setter def status_update_frequency(self, val): self._status_update_frequency = val def before_simulation(self, sim, **kwargs): self._simulation = sim self._initial_time = time.time() def before_step(self, sim, step_number, step_info, state): if step_number % self.status_update_frequency == 0: nn, n_steps = step_info elapsed = time.time() - self._initial_time paths.tools.refresh_output( "Working on Monte Carlo cycle number " + str(step_number) + "\n" + paths.tools.progress_string(nn, n_steps, elapsed), refresh=self.allow_refresh, output_stream=self.output_stream ) def after_simulation(self, sim, hook_state): paths.tools.refresh_output( "DONE! Completed " + str(sim.step) + " Monte Carlo cycles.\n", refresh=False, output_stream=self.output_stream ) class GraciousKillHook(PathSimulatorHook): """ 'Graciously' kill a simulation when the maximum walltime is reached. If this hook is attached to PathSimulator, it will continously estimate the runtime per step. After each step it checks if the next step would exceed the maximum walltime, if so it syncs and closes the storage, then it calls a custom/user provided function (if any) and finally raises a 'GraciousKillError' to end the simulation loop. Example usage ------------- ``` kill_hook = GraciousKillHook("3 minutes 34 seconds") # sampler is a `PathSimulator` sampler.attach_hook(kill_hook) try: sampler.run(2000) except GraciousKillError: print("Simulation ended due to maximum walltime reached") ``` """ implemented_for = ["before_simulation", "after_step"] def __init__(self, max_walltime, fuzziness=1, final_call=None): """ Initialize a GraciousKillHook. Parameters ---------- max_walltime - str, maximum allowed walltime, e.g. `23 hours 20 minutes` fuzziness - float (default=0.9), fraction to add to the time per step when estimating if the next step could exceed the maximum walltime, i.e. the default is to stop when the time left suffices for slighlty less than 2 steps final_call - None or callable (default None), will be called when the simulation is killed, it must take one argument, the hook passes the step number of the step after which it killed the simulation """ self.max_walltime = max_walltime self._timedelta = self._get_timedelta(max_walltime).total_seconds() logger.info("Parsed time string '{:s}' as a ".format(self.max_walltime) + "timedelta of {:d} seconds.".format(int(self._timedelta)) ) self.fuzziness = fuzziness self.final_call = final_call def _get_timedelta(self, time_str): # https://stackoverflow.com/questions/35545140 timespaces = {"days": 0} for timeunit in "year month week day hour minute second".split(): content = re.findall(r"([0-9]*?)\s*?" + timeunit, time_str) if content: timespaces[timeunit + "s"] = int(content[0]) timespaces["days"] += (30 * timespaces.pop("months", 0) + 365 * timespaces.pop("years", 0) ) return timedelta(**timespaces) def before_simulation(self, sim, **kwargs): self._t_start = time.time() def after_step(self, sim, step_number, step_info, state, results, hook_state): now = time.time() current_step, total_steps = step_info running = now - self._t_start # current_step is zero based, i.e. its a 'range' per_step = running / (current_step + 1) if (per_step * (1 + self.fuzziness) + running) > self._timedelta: logger.info("Ending simulation because maximum walltime" + " ({:s}) ".format(self.max_walltime) + "would be surpassed during the next MCstep." ) if sim.storage is not None: sim.storage.sync_all() sim.storage.close() if self.final_call is not None: # call users custom exit function self.final_call(step_number) raise GraciousKillError("Maximum walltime " + "({:s})".format(self.max_walltime) + " reached." )
choderalab/openpathsampling
openpathsampling/beta/hooks.py
Python
lgpl-2.1
16,334
"""Simple script to walk the lights up and down""" import time # exit_event is passed in from the pre/post show script as is required # if an exit_event is generated the pre/post show script can terminate the script # Do not forget to include it, if you do not sms commands will not be able # to end the script and you will have to wait for it to finish def main(exit_event): """ ladder Lights one channel at a time in order Then backs down to the first Then repeat everything 20 times """ # this is a list of all the channels you have access to lights = hc.channels # start with all the lights off hc.turn_off_lights() # pause for 1 second time.sleep(1) # working loop for _ in range(20): # here we just loop over the gpio pins and do something with them # except the last one for light in range(len(lights)-1): # turn off all the lights hc.turn_off_lights() # then turn on one hc.turn_on_light(light) # wait a little bit time.sleep(.04) # to make the transition back smoother we handle the last pin here hc.turn_off_lights() hc.turn_on_light(light + 1) # this loop walks it back the other way for light in range(len(lights)-1, 0, -1): # turn off all the lights hc.turn_off_lights() # then turn on one hc.turn_on_light(light) # wait a little bit time.sleep(.04) # again to make it smoother handle the first pin like the last pin hc.turn_off_lights() hc.turn_on_light(light - 1) # this is required so that an sms play now command will # end your script and any subprocess you have statred if exit_event.is_set(): break # lets make sure we turn off the lights before we go back to the show hc.turn_off_lights()
wheeldog515/lightshowPi
py/examples/ladder.py
Python
bsd-2-clause
1,958
from __future__ import division import numpy import scipy.misc import operator import math from util import memoize_instance import warnings from size_history import ConstantTruncatedSizeHistory import numpy as np from convolution_momi import convolve_chen math_mod = math myint,myfloat = int,float ## UNCOMMENT FOR HIGHER PRECISION # import gmpy2 # math_mod = gmpy2 # gmpy2.get_context().precision=100 # myint,myfloat = gmpy2.mpz, gmpy2.mpfr ''' Formulas from Hua Chen 2012, Theoretical Population Biology Note that for all formulas from that paper, N = diploid population size ''' class _SumProduct_Chen(object): ''' compute sfs of data via Hua Chen's sum-product algorithm ''' def __init__(self, demography): self.G = demography attach_Chen(self.G) def p(self): '''Return the likelihood for the data''' return self.partial_likelihood_bottom(self.G.root)[1] def partial_likelihood_top(self, node): lik, sfs = self.partial_likelihood_bottom(node) return self.G.chen[node].apply_transition(lik), sfs def partial_likelihood_bottom(self, node): sfs = 0.0 if self.G.is_leaf(node): n = self.G.n_lineages_subtended_by[node] n_der = self.G._n_derived_subtended_by[node] lik = np.zeros((len(n_der), n+1, n+1)) lik[range(len(n_der)), n-n_der, n_der] = 1.0 else: children = tuple(self.G[node]) ch_liks, ch_sfs = zip(*[self.partial_likelihood_top(ch) for ch in children]) ch_liks = [l * self.combinatorial_factors(ch) for l,ch in zip(ch_liks, children)] lik = convolve_chen(*ch_liks) / self.combinatorial_factors(node) for ch1, ch2 in ((0,1),(1,0)): sfs += ch_sfs[ch1] * (self.G._n_derived_subtended_by[children[ch2]] == 0) sfs += (lik * self.truncated_sfs(node)).sum(axis=(1,2)) return lik,sfs def combinatorial_factors(self, node): n_node = self.G.n_lineages_subtended_by[node] n_der = np.outer(np.ones(n_node+1), np.arange(n_node+1)) n_anc = np.outer(np.arange(n_node+1), np.ones(n_node+1)) return scipy.misc.comb(n_der + n_anc, n_der) def truncated_sfs(self, node): n_node = self.G.n_lineages_subtended_by[node] sfs = np.zeros((n_node+1,n_node+1)) for n_der in range(1,n_node+1): for n_anc in range(n_node-n_der+1): sfs[n_anc,n_der] = self.G.chen[node].freq(n_der, n_der+n_anc) return sfs def attach_Chen(tree): '''Attach Hua Chen equations to each node of tree. Does nothing if these formulas have already been added.''' if not hasattr(tree, "chen"): tree.chen = {} for node in tree: size_model = tree._node_data[node]['model'] if type(size_model) is not ConstantTruncatedSizeHistory: raise NotImplementedError("Hua Chen's equations only implemented for constant population size along each branch") tree.chen[node] = SFS_Chen(size_model.N / 2.0, size_model.tau, tree.n_lineages_subtended_by[node]) class SFS_Chen(object): def __init__(self, N_diploid, timeLen, max_n): self.timeLen = timeLen self.N_diploid = N_diploid self.max_n = max_n # precompute for n in range(1,max_n+1): for i in range(1,n+1): self.freq(i,n) max_m = n if timeLen == float('inf'): max_m = 1 for m in range(1,max_m+1): self.g(n,m) @memoize_instance def g(self, n, m): return g(n, m, self.N_diploid, self.timeLen) @memoize_instance def ET(self, i, n, m): try: return ET(i, n, m, self.N_diploid, self.timeLen) except ZeroDivisionError: warnings.warn("divide by zero in hua chen formula") return 0.0 @memoize_instance def ES_i(self, i, n, m): '''TPB equation 4''' assert n >= m return math.fsum([p_n_k(i, n, k) * k * self.ET(k, n, m) for k in range(m, n + 1)]) @memoize_instance def freq(self, i, n): max_m = n-i+1 if self.timeLen == float('inf'): max_m = 1 ret = 0.0 for m in range(1,max_m+1): ret += self.ES_i(i, n, m) return ret def apply_transition(self, likelihoods): ## einsum should be faster, but causes memory overflow for our machines/tests # return np.einsum('ijkl,mij->mkl', # self.transition_tensor(), # likelihoods) ## just use for loops n = likelihoods.shape[-1]-1 assert likelihoods.shape[1:] == (n+1,n+1) ret = np.zeros(likelihoods.shape) for n_top in range(1,n+1): for n_bottom in range(n_top,n+1): for n_derived_bottom in range(n_bottom+1): for n_derived_top in range(n_derived_bottom+1): n_ancestral_bottom = n_bottom - n_derived_bottom n_ancestral_top = n_top - n_derived_top tmp = np.array(likelihoods[:,n_ancestral_bottom,n_derived_bottom]) tmp *= self.g(n_bottom, n_top) * math.exp(log_urn_prob(n_derived_top, n_ancestral_top, n_derived_bottom, n_ancestral_bottom)) ret[:,n_ancestral_top,n_derived_top] += tmp return ret @memoize_instance def transition_tensor(self): n = self.max_n ret = np.zeros((n+1,n+1,n+1,n+1)) for n_top in range(1,n+1): for n_bottom in range(n_top,n+1): for n_derived_bottom in range(n_bottom+1): for n_derived_top in range(n_derived_bottom+1): n_ancestral_bottom = n_bottom - n_derived_bottom n_ancestral_top = n_top - n_derived_top ret[n_ancestral_bottom, n_derived_bottom, n_ancestral_top, n_derived_top] = self.g(n_bottom, n_top) * math.exp(log_urn_prob(n_derived_top, n_ancestral_top, n_derived_bottom, n_ancestral_bottom)) return ret def log_factorial(n): return math_mod.lgamma(n+1) def log_rising(n,k): return log_factorial(n+k-1) - log_factorial(n-1) def log_falling(n,k): return log_factorial(n) - log_factorial(n-k) def gcoef(k, n, m, N_diploid, tau): k, n, m = map(myint, [k, n, m]) N_diploid = myfloat(N_diploid) tau = myfloat(tau) return (2*k - 1) * (-1)**(k - m) * math_mod.exp(log_rising(m, k-1) + log_falling(n, k) - log_factorial(m) - log_factorial(k - m) - log_rising(n, k)) #return (2*k - 1) * (-1)**(k - m) * rising(m, k-1) * falling(n, k) / math_mod.factorial(m) / math_mod.factorial(k - m) / rising(n, k) def g_sum(n, m, N_diploid, tau): if tau == float("inf"): if m == 1: return 1.0 return 0.0 tau = myfloat(tau) return float(sum([gcoef(k, n, m, N_diploid, tau) * math_mod.exp(-k * (k - 1) * tau / 4 / N_diploid) for k in range(m, n + 1)])) g = g_sum def formula1(n, m, N_diploid, tau): def expC2(k): return math_mod.exp(-k * (k - 1) / 4 / N_diploid * tau) r = sum(gcoef(k, n, m, N_diploid, tau) * ((expC2(m) - expC2(k)) / (k - m) / (k + m - 1) - (tau / 4 / N_diploid * expC2(m))) for k in range(m + 1, n + 1)) #q = 4 * N_diploid / g(n, m, N_diploid, tau) q = 4 * N_diploid return float(r * q) def formula3(j, n, m, N_diploid, tau): # Switch argument to j here to stay consistent with the paper. j, n, m = map(myint, [j, n, m]) tau, N_diploid = map(myfloat, [tau, N_diploid]) def expC2(kk): return math_mod.exp(-kk * (kk - 1) / 4 / N_diploid * tau) r = sum(gcoef(k, n, j, N_diploid, tau) * # was gcoef(k, n, j + 1, N_diploid, tau) * sum(gcoef(ell, j, m, N_diploid, tau) * ( # was gcoef(ell, j - 1, m, N_diploid, tau) * ( ( expC2(j) * (tau / 4 / N_diploid - ((k - j) * (k + j - 1) + (ell - j)*(ell + j - 1)) / # tau / 4 / N_diploid was 1 in this (k - j) / (k + j- 1) / (ell - j) / (ell + j - 1)) ) + ( expC2(k) * (ell - j) * (ell + j - 1) / (k - j) / (k + j - 1) / (ell - k) / (ell + k - 1) ) - ( expC2(ell) * (k - j) * (k + j - 1) / (ell - k) / (ell + k - 1) / (ell - j) / (ell + j - 1) ) ) for ell in range(m, j) ) for k in range(j + 1, n + 1) ) #q = 4 * N_diploid / myfloat(g(n, m, N_diploid, tau)) q = 4 * N_diploid return float(q * r) def formula2(n, m, N_diploid, tau): def expC2(k): return math_mod.exp(-k * (k - 1) / 4 / N_diploid * tau) r = sum(gcoef(k, n, m, N_diploid, tau) * ((expC2(k) - expC2(n)) / (n - k) / (n + k - 1) - (tau / 4 / N_diploid * expC2(n))) for k in range(m, n)) #q = 4 * N_diploid / g(n, m, N_diploid, tau) q = 4 * N_diploid return float(r * q) def ET(i, n, m, N_diploid, tau): '''Starting with n lineages in a population of size N_diploid, expected time when there are i lineages conditional on there being m lineages at time tau in the past.''' if tau == float("inf"): if m != 1 or i == 1: return 0.0 return 2 * N_diploid / float(nChoose2(i)) * g(n, m, N_diploid, tau) if n == m: return tau * (i == n) * g(n, m, N_diploid, tau) if m == i: return formula1(n, m, N_diploid, tau) elif n == i: return formula2(n, m, N_diploid, tau) else: return formula3(i, n, m, N_diploid, tau) def p_n_k(i, n, k): if k == 1: return int(i == n) else: #return scipy.misc.comb(n-i-1,k-2) / scipy.misc.comb(n-1,k-1) return math.exp(log_binom(n - i - 1, k - 2) - log_binom(n - 1, k - 1)) def nChoose2(n): return (n * (n-1)) / 2 def log_binom(n, k): if k < 0 or k > n: return -float('inf') return log_factorial(n) - log_factorial(n - k) - log_factorial(k) def log_urn_prob(n_parent_derived, n_parent_ancestral, n_child_derived, n_child_ancestral): n_parent = n_parent_derived + n_parent_ancestral n_child = n_child_derived + n_child_ancestral if n_child_derived >= n_parent_derived and n_parent_derived > 0 and n_child_ancestral >= n_parent_ancestral and n_parent_ancestral > 0: return log_binom(n_child_derived - 1, n_parent_derived - 1) + log_binom(n_child_ancestral - 1, n_parent_ancestral - 1) - log_binom(n_child-1, n_parent-1) elif n_child_derived == n_parent_derived == 0 or n_child_ancestral == n_parent_ancestral == 0: return 0.0 else: return float("-inf")
jackkamm/momi
momi/huachen_eqs.py
Python
gpl-3.0
11,877
#!/usr/bin/env python people = 30 cars = 40 trucks = 15 if cars > people: print("We should take the cars.") elif cars < people: print("We should not take the cars") else: print("We can't decide.") if trucks > cars: print("That's too many trucks.") elif trucks < cars: print("Maybe we coudl take the trucks.") else: print("We still can't decide.") if people > trucks: print("Alright, let's just take the trucks.") else: print("Fine, let's stay home then.")
davvi/Hardway3
ex30.py
Python
mit
492
#!/usr/bin/env python3 # -*- coding: utf-8 -*- from __future__ import absolute_import, division, unicode_literals import gpg import os.path import sys del absolute_import, division, unicode_literals # Copyright (C) 2018 Ben McGinnes <[email protected]> # # This program is free software; you can redistribute it and/or modify it under # the terms of the GNU General Public License as published by the Free Software # Foundation; either version 2 of the License, or (at your option) any later # version. # # This program is free software; you can redistribute it and/or modify it under # the terms of the GNU Lesser General Public License as published by the Free # Software Foundation; either version 2.1 of the License, or (at your option) # any later version. # # This program is distributed in the hope that it will be useful, but WITHOUT # ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS # FOR A PARTICULAR PURPOSE. See the GNU General Public License and the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU General Public License and the GNU # Lesser General Public along with this program; if not, see # <https://www.gnu.org/licenses/>. print(""" This script imports one or more public keys from a single file. """) c = gpg.Context(armor=True) if len(sys.argv) >= 3: keyfile = sys.argv[1] homedir = sys.argv[2] elif len(sys.argv) == 2: keyfile = sys.argv[1] homedir = input("Enter the GPG configuration directory path (optional): ") else: keyfile = input("Enter the path and filename to import the key(s) from: ") homedir = input("Enter the GPG configuration directory path (optional): ") if homedir.startswith("~"): if os.path.exists(os.path.expanduser(homedir)) is True: c.home_dir = os.path.expanduser(homedir) else: pass elif os.path.exists(homedir) is True: c.home_dir = homedir else: pass if os.path.isfile(keyfile) is True: with open(keyfile, "rb") as f: incoming = f.read() result = c.key_import(incoming) else: result = None if result is not None and hasattr(result, "considered") is False: print(result) elif result is not None and hasattr(result, "considered") is True: num_keys = len(result.imports) new_revs = result.new_revocations new_sigs = result.new_signatures new_subs = result.new_sub_keys new_uids = result.new_user_ids new_scrt = result.secret_imported nochange = result.unchanged print(""" The total number of keys considered for import was: {0} Number of keys revoked: {1} Number of new signatures: {2} Number of new subkeys: {3} Number of new user IDs: {4} Number of new secret keys: {5} Number of unchanged keys: {6} The key IDs for all considered keys were: """.format(num_keys, new_revs, new_sigs, new_subs, new_uids, new_scrt, nochange)) for i in range(num_keys): print(result.imports[i].fpr) print("") elif result is None: print("You must specify a key file to import.")
gpg/gpgme
lang/python/examples/howto/import-key.py
Python
lgpl-2.1
3,060
# # Copyright (c) 2008--2013 Red Hat, Inc. # # This software is licensed to you under the GNU General Public License, # version 2 (GPLv2). There is NO WARRANTY for this software, express or # implied, including the implied warranties of MERCHANTABILITY or FITNESS # FOR A PARTICULAR PURPOSE. You should have received a copy of GPLv2 # along with this software; if not, see # http://www.gnu.org/licenses/old-licenses/gpl-2.0.txt. # # Red Hat trademarks are not licensed under GPLv2. No permission is # granted to use or replicate Red Hat trademarks that are incorporated # in this software or its documentation. # # # This module defines notification-related functions and constants, for use # with the client-side virtualization code. # import sys import time from up2date_client import up2dateAuth from up2date_client import up2dateErrors from up2date_client import rhnserver from up2date_client import up2dateLog from virtualization.errors import NotRegistered log = up2dateLog.initLog() ############################################################################### # Constants ############################################################################### class EventType: EXISTS = 'exists' REMOVED = 'removed' CRAWL_BEGAN = 'crawl_began' CRAWL_ENDED = 'crawl_ended' class TargetType: SYSTEM = 'system' DOMAIN = 'domain' LOG_MSG = 'log_message' ############################################################################### # Plan Class ############################################################################### class Plan: def __init__(self): self.__items = [] def add(self, event, target = None, properties = {}): """ Creates a new plan item and adds it to the list. """ self.__items.append(self.__make_item(event, target, properties)) def execute(self): """ Sends all items in the plan to the satellite. """ systemid = up2dateAuth.getSystemId() if systemid is None: raise NotRegistered("System ID not found.") server = rhnserver.RhnServer() try: server.registration.virt_notify(systemid, self.__items) except up2dateErrors.CommunicationError: e = sys.exc_info()[1] log.trace_me() log.log_me(e) def __make_item(self, event, target, properties): """ Creates a new plan item. """ # Get the current time. current_time = int(time.time()) return ( current_time, event, target, properties )
mcalmer/spacewalk
client/tools/rhn-virtualization/virtualization/notification.py
Python
gpl-2.0
2,598
from django.shortcuts import resolve_url from django.test import TestCase from InternetSemLimites.core.models import Provider, State class TestGet(TestCase): def setUp(self): sc, *_ = State.objects.get_or_create(abbr='SC', name='Santa Catarina') go, *_ = State.objects.get_or_create(abbr='GO', name='Goiás') sp, *_ = State.objects.get_or_create(abbr='GO', name='São Paulo') props_published = {'name': 'Xpto', 'url': 'http://xp.to', 'source': 'http://twitter.com/xpto', 'category': Provider.FAME, 'other': 'Lorem ipsum', 'status': Provider.PUBLISHED} props_refused= {'name': 'Xpto', 'url': 'http://xp.to', 'source': 'http://twitter.com/xpto', 'category': Provider.FAME, 'other': 'Lorem ipsum', 'status': Provider.REFUSED} provider_published = Provider.objects.create(**props_published) provider_refused = Provider.objects.create(**props_refused) provider_published.coverage.set([sc, go]) provider_refused.coverage.set([sp]) self.resp = self.client.get(resolve_url('markdown:fame')) def test_get(self): self.assertEqual(200, self.resp.status_code) def test_type(self): self.assertEqual('text/markdown; charset=UTF-8', self.resp['Content-Type']) def test_template(self): self.assertTemplateUsed(self.resp, 'markdown/fame.md') def test_contents(self): contents = ['Xpto', 'Goiás', 'Lorem', 'http://xp.to', 'twitter.com'] for content in contents: with self.subTest(): self.assertContains(self.resp, content) self.assertNotContains(self.resp, 'São Paulo')
InternetSemLimites/PublicAPI
InternetSemLimites/markdown/tests/test_readme_view.py
Python
mit
1,892
import click from arrow.cli import pass_context, json_loads from arrow.decorators import custom_exception, list_output @click.command('get_group_creator') @click.argument("group", type=str) @pass_context @custom_exception @list_output def cli(ctx, group): """Get the group's creator Output: creator userId """ return ctx.gi.groups.get_group_creator(group)
galaxy-genome-annotation/python-apollo
arrow/commands/groups/get_group_creator.py
Python
mit
376
# -*- coding: utf-8 -*- # vim: autoindent shiftwidth=4 expandtab textwidth=120 tabstop=4 softtabstop=4 ############################################################################### # OpenLP - Open Source Lyrics Projection # # --------------------------------------------------------------------------- # # Copyright (c) 2008-2013 Raoul Snyman # # Portions copyright (c) 2008-2013 Tim Bentley, Gerald Britton, Jonathan # # Corwin, Samuel Findlay, Michael Gorven, Scott Guerrieri, Matthias Hub, # # Meinert Jordan, Armin Köhler, Erik Lundin, Edwin Lunando, Brian T. Meyer. # # Joshua Miller, Stevan Pettit, Andreas Preikschat, Mattias Põldaru, # # Christian Richter, Philip Ridout, Simon Scudder, Jeffrey Smith, # # Maikel Stuivenberg, Martin Thompson, Jon Tibble, Dave Warnock, # # Frode Woldsund, Martin Zibricky, Patrick Zimmermann # # --------------------------------------------------------------------------- # # This program is free software; you can redistribute it and/or modify it # # under the terms of the GNU General Public License as published by the Free # # Software Foundation; version 2 of the License. # # # # This program is distributed in the hope that it will be useful, but WITHOUT # # ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or # # FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for # # more details. # # # # You should have received a copy of the GNU General Public License along # # with this program; if not, write to the Free Software Foundation, Inc., 59 # # Temple Place, Suite 330, Boston, MA 02111-1307 USA # ############################################################################### """ Provide the theme XML and handling functions for OpenLP v2 themes. """ import os import re import logging from xml.dom.minidom import Document from lxml import etree, objectify from openlp.core.lib import str_to_bool, ScreenList log = logging.getLogger(__name__) BLANK_THEME_XML = \ '''<?xml version="1.0" encoding="utf-8"?> <theme version="1.0"> <name> </name> <background type="image"> <filename></filename> <borderColor>#000000</borderColor> </background> <background type="gradient"> <startColor>#000000</startColor> <endColor>#000000</endColor> <direction>vertical</direction> </background> <background type="solid"> <color>#000000</color> </background> <font type="main"> <name>Arial</name> <color>#FFFFFF</color> <size>40</size> <bold>False</bold> <italics>False</italics> <line_adjustment>0</line_adjustment> <shadow shadowColor="#000000" shadowSize="5">True</shadow> <outline outlineColor="#000000" outlineSize="2">False</outline> <location override="False" x="10" y="10" width="1004" height="690"/> </font> <font type="footer"> <name>Arial</name> <color>#FFFFFF</color> <size>12</size> <bold>False</bold> <italics>False</italics> <line_adjustment>0</line_adjustment> <shadow shadowColor="#000000" shadowSize="5">True</shadow> <outline outlineColor="#000000" outlineSize="2">False</outline> <location override="False" x="10" y="690" width="1004" height="78"/> </font> <display> <horizontalAlign>0</horizontalAlign> <verticalAlign>0</verticalAlign> <slideTransition>False</slideTransition> </display> </theme> ''' class ThemeLevel(object): """ Provides an enumeration for the level a theme applies to """ Global = 1 Service = 2 Song = 3 class BackgroundType(object): """ Type enumeration for backgrounds. """ Solid = 0 Gradient = 1 Image = 2 Transparent = 3 @staticmethod def to_string(background_type): """ Return a string representation of a background type. """ if background_type == BackgroundType.Solid: return u'solid' elif background_type == BackgroundType.Gradient: return u'gradient' elif background_type == BackgroundType.Image: return u'image' elif background_type == BackgroundType.Transparent: return u'transparent' @staticmethod def from_string(type_string): """ Return a background type for the given string. """ if type_string == u'solid': return BackgroundType.Solid elif type_string == u'gradient': return BackgroundType.Gradient elif type_string == u'image': return BackgroundType.Image elif type_string == u'transparent': return BackgroundType.Transparent class BackgroundGradientType(object): """ Type enumeration for background gradients. """ Horizontal = 0 Vertical = 1 Circular = 2 LeftTop = 3 LeftBottom = 4 @staticmethod def to_string(gradient_type): """ Return a string representation of a background gradient type. """ if gradient_type == BackgroundGradientType.Horizontal: return u'horizontal' elif gradient_type == BackgroundGradientType.Vertical: return u'vertical' elif gradient_type == BackgroundGradientType.Circular: return u'circular' elif gradient_type == BackgroundGradientType.LeftTop: return u'leftTop' elif gradient_type == BackgroundGradientType.LeftBottom: return u'leftBottom' @staticmethod def from_string(type_string): """ Return a background gradient type for the given string. """ if type_string == u'horizontal': return BackgroundGradientType.Horizontal elif type_string == u'vertical': return BackgroundGradientType.Vertical elif type_string == u'circular': return BackgroundGradientType.Circular elif type_string == u'leftTop': return BackgroundGradientType.LeftTop elif type_string == u'leftBottom': return BackgroundGradientType.LeftBottom class HorizontalType(object): """ Type enumeration for horizontal alignment. """ Left = 0 Right = 1 Center = 2 Justify = 3 Names = [u'left', u'right', u'center', u'justify'] class VerticalType(object): """ Type enumeration for vertical alignment. """ Top = 0 Middle = 1 Bottom = 2 Names = [u'top', u'middle', u'bottom'] BOOLEAN_LIST = [u'bold', u'italics', u'override', u'outline', u'shadow', u'slide_transition'] INTEGER_LIST = [u'size', u'line_adjustment', u'x', u'height', u'y', u'width', u'shadow_size', u'outline_size', u'horizontal_align', u'vertical_align', u'wrap_style'] class ThemeXML(object): """ A class to encapsulate the Theme XML. """ FIRST_CAMEL_REGEX = re.compile(u'(.)([A-Z][a-z]+)') SECOND_CAMEL_REGEX = re.compile(u'([a-z0-9])([A-Z])') def __init__(self): """ Initialise the theme object. """ # Create the minidom document self.theme_xml = Document() self.parse_xml(BLANK_THEME_XML) def extend_image_filename(self, path): """ Add the path name to the image name so the background can be rendered. ``path`` The path name to be added. """ if self.background_type == u'image': if self.background_filename and path: self.theme_name = self.theme_name.strip() self.background_filename = self.background_filename.strip() self.background_filename = os.path.join(path, self.theme_name, self.background_filename) def _new_document(self, name): """ Create a new theme XML document. """ self.theme_xml = Document() self.theme = self.theme_xml.createElement(u'theme') self.theme_xml.appendChild(self.theme) self.theme.setAttribute(u'version', u'2.0') self.name = self.theme_xml.createElement(u'name') text_node = self.theme_xml.createTextNode(name) self.name.appendChild(text_node) self.theme.appendChild(self.name) def add_background_transparent(self): """ Add a transparent background. """ background = self.theme_xml.createElement(u'background') background.setAttribute(u'type', u'transparent') self.theme.appendChild(background) def add_background_solid(self, bkcolor): """ Add a Solid background. ``bkcolor`` The color of the background. """ background = self.theme_xml.createElement(u'background') background.setAttribute(u'type', u'solid') self.theme.appendChild(background) self.child_element(background, u'color', unicode(bkcolor)) def add_background_gradient(self, startcolor, endcolor, direction): """ Add a gradient background. ``startcolor`` The gradient's starting colour. ``endcolor`` The gradient's ending colour. ``direction`` The direction of the gradient. """ background = self.theme_xml.createElement(u'background') background.setAttribute(u'type', u'gradient') self.theme.appendChild(background) # Create startColor element self.child_element(background, u'startColor', unicode(startcolor)) # Create endColor element self.child_element(background, u'endColor', unicode(endcolor)) # Create direction element self.child_element(background, u'direction', unicode(direction)) def add_background_image(self, filename, borderColor): """ Add a image background. ``filename`` The file name of the image. """ background = self.theme_xml.createElement(u'background') background.setAttribute(u'type', u'image') self.theme.appendChild(background) # Create Filename element self.child_element(background, u'filename', filename) # Create endColor element self.child_element(background, u'borderColor', unicode(borderColor)) def add_font(self, name, color, size, override, fonttype=u'main', bold=u'False', italics=u'False', line_adjustment=0, xpos=0, ypos=0, width=0, height=0, outline=u'False', outline_color=u'#ffffff', outline_pixel=2, shadow=u'False', shadow_color=u'#ffffff', shadow_pixel=5): """ Add a Font. ``name`` The name of the font. ``color`` The colour of the font. ``size`` The size of the font. ``override`` Whether or not to override the default positioning of the theme. ``fonttype`` The type of font, ``main`` or ``footer``. Defaults to ``main``. ``weight`` The weight of then font Defaults to 50 Normal ``italics`` Does the font render to italics Defaults to 0 Normal ``xpos`` The X position of the text block. ``ypos`` The Y position of the text block. ``width`` The width of the text block. ``height`` The height of the text block. ``outline`` Whether or not to show an outline. ``outline_color`` The colour of the outline. ``outline_size`` How big the Shadow is ``shadow`` Whether or not to show a shadow. ``shadow_color`` The colour of the shadow. ``shadow_size`` How big the Shadow is """ background = self.theme_xml.createElement(u'font') background.setAttribute(u'type', fonttype) self.theme.appendChild(background) # Create Font name element self.child_element(background, u'name', name) # Create Font color element self.child_element(background, u'color', unicode(color)) # Create Proportion name element self.child_element(background, u'size', unicode(size)) # Create weight name element self.child_element(background, u'bold', unicode(bold)) # Create italics name element self.child_element(background, u'italics', unicode(italics)) # Create indentation name element self.child_element(background, u'line_adjustment', unicode(line_adjustment)) # Create Location element element = self.theme_xml.createElement(u'location') element.setAttribute(u'override', unicode(override)) element.setAttribute(u'x', unicode(xpos)) element.setAttribute(u'y', unicode(ypos)) element.setAttribute(u'width', unicode(width)) element.setAttribute(u'height', unicode(height)) background.appendChild(element) # Shadow element = self.theme_xml.createElement(u'shadow') element.setAttribute(u'shadowColor', unicode(shadow_color)) element.setAttribute(u'shadowSize', unicode(shadow_pixel)) value = self.theme_xml.createTextNode(unicode(shadow)) element.appendChild(value) background.appendChild(element) # Outline element = self.theme_xml.createElement(u'outline') element.setAttribute(u'outlineColor', unicode(outline_color)) element.setAttribute(u'outlineSize', unicode(outline_pixel)) value = self.theme_xml.createTextNode(unicode(outline)) element.appendChild(value) background.appendChild(element) def add_display(self, horizontal, vertical, transition): """ Add a Display options. ``horizontal`` The horizontal alignment of the text. ``vertical`` The vertical alignment of the text. ``transition`` Whether the slide transition is active. """ background = self.theme_xml.createElement(u'display') self.theme.appendChild(background) # Horizontal alignment element = self.theme_xml.createElement(u'horizontalAlign') value = self.theme_xml.createTextNode(unicode(horizontal)) element.appendChild(value) background.appendChild(element) # Vertical alignment element = self.theme_xml.createElement(u'verticalAlign') value = self.theme_xml.createTextNode(unicode(vertical)) element.appendChild(value) background.appendChild(element) # Slide Transition element = self.theme_xml.createElement(u'slideTransition') value = self.theme_xml.createTextNode(unicode(transition)) element.appendChild(value) background.appendChild(element) def child_element(self, element, tag, value): """ Generic child element creator. """ child = self.theme_xml.createElement(tag) child.appendChild(self.theme_xml.createTextNode(value)) element.appendChild(child) return child def set_default_header_footer(self): """ Set the header and footer size into the current primary screen. 10 px on each side is removed to allow for a border. """ current_screen = ScreenList().current self.font_main_y = 0 self.font_main_width = current_screen[u'size'].width() - 20 self.font_main_height = current_screen[u'size'].height() * 9 / 10 self.font_footer_width = current_screen[u'size'].width() - 20 self.font_footer_y = current_screen[u'size'].height() * 9 / 10 self.font_footer_height = current_screen[u'size'].height() / 10 def dump_xml(self): """ Dump the XML to file used for debugging """ return self.theme_xml.toprettyxml(indent=u' ') def extract_xml(self): """ Print out the XML string. """ self._build_xml_from_attrs() return self.theme_xml.toxml(u'utf-8').decode(u'utf-8') def extract_formatted_xml(self): """ Pull out the XML string formatted for human consumption """ self._build_xml_from_attrs() return self.theme_xml.toprettyxml(indent=u' ', newl=u'\n', encoding=u'utf-8') def parse(self, xml): """ Read in an XML string and parse it. ``xml`` The XML string to parse. """ self.parse_xml(unicode(xml)) def parse_xml(self, xml): """ Parse an XML string. ``xml`` The XML string to parse. """ # remove encoding string line = xml.find(u'?>') if line: xml = xml[line + 2:] try: theme_xml = objectify.fromstring(xml) except etree.XMLSyntaxError: log.exception(u'Invalid xml %s', xml) return xml_iter = theme_xml.getiterator() for element in xml_iter: master = u'' if element.tag == u'background': if element.attrib: for attr in element.attrib: self._create_attr(element.tag, attr, element.attrib[attr]) parent = element.getparent() if parent is not None: if parent.tag == u'font': master = parent.tag + u'_' + parent.attrib[u'type'] # set up Outline and Shadow Tags and move to font_main if parent.tag == u'display': if element.tag.startswith(u'shadow') or element.tag.startswith(u'outline'): self._create_attr(u'font_main', element.tag, element.text) master = parent.tag if parent.tag == u'background': master = parent.tag if master: self._create_attr(master, element.tag, element.text) if element.attrib: for attr in element.attrib: base_element = attr # correction for the shadow and outline tags if element.tag == u'shadow' or element.tag == u'outline': if not attr.startswith(element.tag): base_element = element.tag + u'_' + attr self._create_attr(master, base_element, element.attrib[attr]) else: if element.tag == u'name': self._create_attr(u'theme', element.tag, element.text) def _translate_tags(self, master, element, value): """ Clean up XML removing and redefining tags """ master = master.strip().lstrip() element = element.strip().lstrip() value = unicode(value).strip().lstrip() if master == u'display': if element == u'wrapStyle': return True, None, None, None if element.startswith(u'shadow') or element.startswith(u'outline'): master = u'font_main' # fix bold font if element == u'weight': element = u'bold' if value == u'Normal': value = False else: value = True if element == u'proportion': element = u'size' return False, master, element, value def _create_attr(self, master, element, value): """ Create the attributes with the correct data types and name format """ reject, master, element, value = self._translate_tags(master, element, value) if reject: return field = self._de_hump(element) tag = master + u'_' + field if field in BOOLEAN_LIST: setattr(self, tag, str_to_bool(value)) elif field in INTEGER_LIST: setattr(self, tag, int(value)) else: # make string value unicode if not isinstance(value, unicode): value = unicode(str(value), u'utf-8') # None means an empty string so lets have one. if value == u'None': value = u'' setattr(self, tag, unicode(value).strip().lstrip()) def __str__(self): """ Return a string representation of this object. """ theme_strings = [] for key in dir(self): if key[0:1] != u'_': theme_strings.append(u'%30s: %s' % (key, getattr(self, key))) return u'\n'.join(theme_strings) def _de_hump(self, name): """ Change Camel Case string to python string """ sub_name = ThemeXML.FIRST_CAMEL_REGEX.sub(r'\1_\2', name) return ThemeXML.SECOND_CAMEL_REGEX.sub(r'\1_\2', sub_name).lower() def _build_xml_from_attrs(self): """ Build the XML from the varables in the object """ self._new_document(self.theme_name) if self.background_type == BackgroundType.to_string(BackgroundType.Solid): self.add_background_solid(self.background_color) elif self.background_type == BackgroundType.to_string(BackgroundType.Gradient): self.add_background_gradient( self.background_start_color, self.background_end_color, self.background_direction ) elif self.background_type == BackgroundType.to_string(BackgroundType.Image): filename = os.path.split(self.background_filename)[1] self.add_background_image(filename, self.background_border_color) elif self.background_type == BackgroundType.to_string(BackgroundType.Transparent): self.add_background_transparent() self.add_font( self.font_main_name, self.font_main_color, self.font_main_size, self.font_main_override, u'main', self.font_main_bold, self.font_main_italics, self.font_main_line_adjustment, self.font_main_x, self.font_main_y, self.font_main_width, self.font_main_height, self.font_main_outline, self.font_main_outline_color, self.font_main_outline_size, self.font_main_shadow, self.font_main_shadow_color, self.font_main_shadow_size ) self.add_font( self.font_footer_name, self.font_footer_color, self.font_footer_size, self.font_footer_override, u'footer', self.font_footer_bold, self.font_footer_italics, 0, # line adjustment self.font_footer_x, self.font_footer_y, self.font_footer_width, self.font_footer_height, self.font_footer_outline, self.font_footer_outline_color, self.font_footer_outline_size, self.font_footer_shadow, self.font_footer_shadow_color, self.font_footer_shadow_size ) self.add_display( self.display_horizontal_align, self.display_vertical_align, self.display_slide_transition )
marmyshev/transitions
openlp/core/lib/theme.py
Python
gpl-2.0
23,608
# -*- coding: utf-8 -*- """ Tests for auth manager PKI access to postgres. This is an integration test for QGIS Desktop Auth Manager postgres provider that checks if QGIS can use a stored auth manager auth configuration to access a PKI protected postgres. Configuration from the environment: * QGIS_POSTGRES_SERVER_PORT (default: 55432) * QGIS_POSTGRES_EXECUTABLE_PATH (default: /usr/lib/postgresql/9.4/bin) From build dir, run: ctest -R PyQgsAuthManagerPKIPostgresTest -V or, if your PostgreSQL path differs from the default: QGIS_POSTGRES_EXECUTABLE_PATH=/usr/lib/postgresql/<your_version_goes_here>/bin \ ctest -R PyQgsAuthManagerPKIPostgresTest -V .. note:: This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. """ import os import time import signal import stat import subprocess import tempfile import glob from shutil import rmtree from utilities import unitTestDataPath from qgis.core import ( QgsApplication, QgsAuthManager, QgsAuthMethodConfig, QgsVectorLayer, QgsDataSourceUri, QgsWkbTypes, ) from qgis.PyQt.QtNetwork import QSslCertificate from qgis.PyQt.QtCore import QFile from qgis.testing import ( start_app, unittest, ) __author__ = 'Alessandro Pasotti' __date__ = '25/10/2016' __copyright__ = 'Copyright 2016, The QGIS Project' # This will get replaced with a git SHA1 when you do a git archive __revision__ = '$Format:%H$' QGIS_POSTGRES_SERVER_PORT = os.environ.get('QGIS_POSTGRES_SERVER_PORT', '55432') QGIS_POSTGRES_EXECUTABLE_PATH = os.environ.get('QGIS_POSTGRES_EXECUTABLE_PATH', '/usr/lib/postgresql/9.4/bin') assert os.path.exists(QGIS_POSTGRES_EXECUTABLE_PATH) QGIS_AUTH_DB_DIR_PATH = tempfile.mkdtemp() # Postgres test path QGIS_PG_TEST_PATH = tempfile.mkdtemp() os.environ['QGIS_AUTH_DB_DIR_PATH'] = QGIS_AUTH_DB_DIR_PATH qgis_app = start_app() QGIS_POSTGRES_CONF_TEMPLATE = """ hba_file = '%(tempfolder)s/pg_hba.conf' listen_addresses = '*' port = %(port)s max_connections = 100 unix_socket_directories = '%(tempfolder)s' ssl = true ssl_ciphers = 'DEFAULT:!LOW:!EXP:!MD5:@STRENGTH' # allowed SSL ciphers ssl_cert_file = '%(server_cert)s' ssl_key_file = '%(server_key)s' ssl_ca_file = '%(sslrootcert_path)s' password_encryption = on """ QGIS_POSTGRES_HBA_TEMPLATE = """ hostssl all all 0.0.0.0/0 cert clientcert=1 hostssl all all ::1/0 cert clientcert=1 host all all 127.0.0.1/32 trust host all all ::1/32 trust """ class TestAuthManager(unittest.TestCase): @classmethod def setUpAuth(cls): """Run before all tests and set up authentication""" authm = QgsApplication.authManager() assert (authm.setMasterPassword('masterpassword', True)) cls.pg_conf = os.path.join(cls.tempfolder, 'postgresql.conf') cls.pg_hba = os.path.join(cls.tempfolder, 'pg_hba.conf') # Client side cls.sslrootcert_path = os.path.join(cls.certsdata_path, 'chains_subissuer-issuer-root_issuer2-root2.pem') cls.sslcert = os.path.join(cls.certsdata_path, 'gerardus_cert.pem') cls.sslkey = os.path.join(cls.certsdata_path, 'gerardus_key.pem') assert os.path.isfile(cls.sslcert) assert os.path.isfile(cls.sslkey) assert os.path.isfile(cls.sslrootcert_path) os.chmod(cls.sslcert, stat.S_IRUSR) os.chmod(cls.sslkey, stat.S_IRUSR) os.chmod(cls.sslrootcert_path, stat.S_IRUSR) cls.auth_config = QgsAuthMethodConfig("PKI-Paths") cls.auth_config.setConfig('certpath', cls.sslcert) cls.auth_config.setConfig('keypath', cls.sslkey) cls.auth_config.setName('test_pki_auth_config') cls.username = 'Gerardus' cls.sslrootcert = QSslCertificate.fromPath(cls.sslrootcert_path) assert cls.sslrootcert is not None authm.storeCertAuthorities(cls.sslrootcert) authm.rebuildCaCertsCache() authm.rebuildTrustedCaCertsCache() authm.rebuildCertTrustCache() assert (authm.storeAuthenticationConfig(cls.auth_config)[0]) assert cls.auth_config.isValid() # Server side cls.server_cert = os.path.join(cls.certsdata_path, 'localhost_ssl_cert.pem') cls.server_key = os.path.join(cls.certsdata_path, 'localhost_ssl_key.pem') cls.server_rootcert = cls.sslrootcert_path os.chmod(cls.server_cert, stat.S_IRUSR) os.chmod(cls.server_key, stat.S_IRUSR) os.chmod(cls.server_rootcert, stat.S_IRUSR) # Place conf in the data folder with open(cls.pg_conf, 'w+') as f: f.write(QGIS_POSTGRES_CONF_TEMPLATE % { 'port': cls.port, 'tempfolder': cls.tempfolder, 'server_cert': cls.server_cert, 'server_key': cls.server_key, 'sslrootcert_path': cls.sslrootcert_path, }) with open(cls.pg_hba, 'w+') as f: f.write(QGIS_POSTGRES_HBA_TEMPLATE) @classmethod def setUpClass(cls): """Run before all tests: Creates an auth configuration""" cls.port = QGIS_POSTGRES_SERVER_PORT cls.dbname = 'test_pki' cls.tempfolder = QGIS_PG_TEST_PATH cls.certsdata_path = os.path.join(unitTestDataPath('auth_system'), 'certs_keys') cls.hostname = 'localhost' cls.data_path = os.path.join(cls.tempfolder, 'data') os.mkdir(cls.data_path) cls.setUpAuth() subprocess.check_call([os.path.join(QGIS_POSTGRES_EXECUTABLE_PATH, 'initdb'), '-D', cls.data_path]) cls.server = subprocess.Popen([os.path.join(QGIS_POSTGRES_EXECUTABLE_PATH, 'postgres'), '-D', cls.data_path, '-c', "config_file=%s" % cls.pg_conf], env=os.environ, stdout=subprocess.PIPE, stderr=subprocess.PIPE) # Wait max 10 secs for the server to start end = time.time() + 10 while True: line = cls.server.stderr.readline() print(line) if line.find(b"database system is ready to accept") != -1: break if time.time() > end: raise Exception("Timeout connecting to PostgreSQL") # Create a DB subprocess.check_call([os.path.join(QGIS_POSTGRES_EXECUTABLE_PATH, 'createdb'), '-h', 'localhost', '-p', cls.port, 'test_pki']) # Inject test SQL from test path test_sql = os.path.join(unitTestDataPath('provider'), 'testdata_pg.sql') subprocess.check_call([os.path.join(QGIS_POSTGRES_EXECUTABLE_PATH, 'psql'), '-h', 'localhost', '-p', cls.port, '-f', test_sql, cls.dbname]) # Create a role subprocess.check_call([os.path.join(QGIS_POSTGRES_EXECUTABLE_PATH, 'psql'), '-h', 'localhost', '-p', cls.port, '-c', 'CREATE ROLE "%s" WITH SUPERUSER LOGIN' % cls.username, cls.dbname]) @classmethod def tearDownClass(cls): """Run after all tests""" cls.server.terminate() os.kill(cls.server.pid, signal.SIGABRT) del cls.server time.sleep(2) rmtree(QGIS_AUTH_DB_DIR_PATH) rmtree(cls.tempfolder) def setUp(self): """Run before each test.""" pass def tearDown(self): """Run after each test.""" pass @classmethod def _getPostGISLayer(cls, type_name, layer_name=None, authcfg=None): """ PG layer factory """ if layer_name is None: layer_name = 'pg_' + type_name uri = QgsDataSourceUri() uri.setWkbType(QgsWkbTypes.Point) uri.setConnection("localhost", cls.port, cls.dbname, "", "", QgsDataSourceUri.SslVerifyFull, authcfg) uri.setKeyColumn('pk') uri.setSrid('EPSG:4326') uri.setDataSource('qgis_test', 'someData', "geom", "", "pk") # Note: do not expand here! layer = QgsVectorLayer(uri.uri(False), layer_name, 'postgres') return layer def testValidAuthAccess(self): """ Access the protected layer with valid credentials """ pg_layer = self._getPostGISLayer('testlayer_èé', authcfg=self.auth_config.id()) self.assertTrue(pg_layer.isValid()) def testInvalidAuthAccess(self): """ Access the protected layer with not valid credentials """ pg_layer = self._getPostGISLayer('testlayer_èé') self.assertFalse(pg_layer.isValid()) def testRemoveTemporaryCerts(self): """ Check that no temporary cert remain after connection with postgres provider """ def cleanTempPki(): pkies = glob.glob(os.path.join(tempfile.gettempdir(), 'tmp*_{*}.pem')) for fn in pkies: f = QFile(fn) f.setPermissions(QFile.WriteOwner) f.remove() # remove any temppki in temprorary path to check that no # other pki remain after connection cleanTempPki() # connect using postgres provider pg_layer = self._getPostGISLayer('testlayer_èé', authcfg=self.auth_config.id()) self.assertTrue(pg_layer.isValid()) # do test no certs remained pkies = glob.glob(os.path.join(tempfile.gettempdir(), 'tmp*_{*}.pem')) self.assertEqual(len(pkies), 0) if __name__ == '__main__': unittest.main()
geopython/QGIS
tests/src/python/test_authmanager_pki_postgres.py
Python
gpl-2.0
9,727
#!/usr/bin/python # This script looks up every pair team that exists. # It then,for each pair team # (4) creates a repo for the team (if it doesn't already exist) # (5) populates it, but only if it was JUST created. import getpass import argparse import os import sys from github_acadwf import addPyGithubToPath from github_acadwf import updatePairsForLab from github_acadwf import getenvOrDie from github_acadwf import getCSVFromURL addPyGithubToPath() from github import Github from github import GithubException import getpass import sys import argparse from github_acadwf import makeUserDict from github_acadwf import getUserList sys.path.append("./PyGithub"); from github import Github from github import GithubException GHA_GITHUB_ORG = getenvOrDie("GHA_GITHUB_ORG", "Error: please set GHA_GITHUB_ORG to name of github organization for the course, e.g. UCSB-CS56-W14") GHA_WORKDIR = getenvOrDie('GHA_WORKDIR', "Error: please set GHA_WORKDIR to a writeable scratch directory") GHA_STARTPOINT_DIR = getenvOrDie('GHA_STARTPOINT_DIR', "Error: please set GHA_STARTPOINT_DIR to a readable directory") # Now try to get the Google Spreadsheet Data parser = argparse.ArgumentParser(description='Update lab for pairs') parser.add_argument('lab',metavar='labxx', help="which lab (e.g. lab00, lab01, etc.)") parser.add_argument('-u','--githubUsername', help="github username, default is current OS user", default=getpass.getuser()) parser.add_argument('-t','--teamPrefix', help="prefix of teams to create", default="") args = parser.parse_args() if not os.access(GHA_WORKDIR, os.W_OK): print(GHA_WORKDIR + " is not a writable directory.") sys.exit(1) pw = getpass.getpass() g = Github(args.githubUsername, pw, user_agent="PyGithub") org= g.get_organization(GHA_GITHUB_ORG) updatePairsForLab(g,org,args.lab,GHA_WORKDIR, GHA_STARTPOINT_DIR, args.teamPrefix)
UCSB-CS-Using-GitHub-In-Courses/github-acad-scripts
updatePairsForLab.py
Python
mit
2,129
# -*- coding: utf-8 -*- """ Auxiliary functions for light curve file handling. Contains functions to extract Kepler PDCSAP and user-provided K2SFF light curves. """ import numpy as np from astropy.table import Table from astropy.io import fits, ascii import warnings from astropy.utils.exceptions import AstropyUserWarning def open_fits(filename): """ Open a light curve file in the usual Kepler FITS format and extract the PDCSAP light curve. Parameters ---------- filename : str file name of the FITS file containing the light curve data Returns ------- EPICno : int EPIC number ('KEPLERID' in the hdu header) photometry : Astropy table Columns are time in BJD - 2454833, PDCSAP flux, PDCSAP flux error Example ------- >>> filename = 'tests/ktwo205919993-c03_llc.fits' >>> EPICno, photometry = open_fits(filename) """ try: hdulist = fits.open(filename) except IOError: warnings.warn("Could not open FITS file.", AstropyUserWarning) return None EPICno = hdulist[1].header['KEPLERID'] tbdata = hdulist[1].data hdulist.close() # extract light curve data from hdu time = tbdata['TIME'] flux = tbdata['PDCSAP_FLUX'] flux_err = tbdata['PDCSAP_FLUX_ERR'] photometry = Table([time, flux, flux_err], names = ('TIME', 'FLUX','FLUX_ERR')) # remove nans photometry = photometry[~np.isnan(photometry['FLUX'])] return EPICno, photometry def open_csv(filename): """ Open a light curve file in csv format and extract from it flux time series. Parameters ---------- filename : str file name of the ascii file containing the photometry Returns ------- filename : str The filename serves as a unique identifier for the object photometry : Astropy table Columns are named after the file header and contain time, flux """ photometry = ascii.read(filename, format='csv') return filename, photometry def open_k2sff(filename): """ Extract a light curve from a 'K2SFF' ascii file. The default aperture light curve data of this product are not strictly 'comma-separated' and lead to crashes when opened by standard Astropy ascii I/O functions. Parameters ---------- filename : str file name of the ascii file containing the photometry Returns ------- filename : str The filename serves as a unique identifier for the object photometry : Astropy table Columns contain time, flux Example ------- >>> filename = 'tests/220132548' >>> filename, photometry = open_k2sff(filename) """ with open(filename, 'r') as infile: lines = infile.readlines() phot = np.zeros([len(lines) - 1, 2]) for i, line in enumerate(lines[1:]): # strip trailing comma and '\n' and save to a table line = line.rstrip(',\n') line = line.split(',') phot[i][:] = line photometry = Table(phot, names = ('TIME', 'FLUX')) # remove nans photometry = photometry[~np.isnan(photometry['FLUX'])] return filename.split('/')[-1], photometry if __name__ == "__main__": import doctest doctest.testmod()
matiscke/lcps
lcps/lcps_io.py
Python
mit
3,351
from django.conf.urls import url from apps.comment import views urlpatterns = [ url(r'^$', views.index, name='index'), url(r'^captcha/$', views.captcha, name='captcha'), url(r'^(\d+)/$', views.comment, name='comment'), ]
blackholll/loonblog
apps/comment/urls.py
Python
mit
234
import importlib import os import re import socket import sys from django.utils.termcolors import colorize def log(s): sys.stdout.write(colorize(s, fg='cyan') + '\n') # The normal scenario is that we use the hostname, but let's make it # overridable, this is useful for dev and debugging. IDEASCUBE_HOSTNAME = socket.gethostname() # Store it for later use. IDEASCUBE_ID = os.environ.get('IDEASCUBE_ID', IDEASCUBE_HOSTNAME) IDEASCUBE_ID = re.sub('[^\w_]', '', IDEASCUBE_ID) log('IDEASCUBE_ID={}'.format(IDEASCUBE_ID)) # Every box will have some edge specific needs, such as a specific user model, # we manage this with per box settings, but we want those specific settings # to be versionned, for two reasons: easier to debug when there is no hidden # local config, and easier to manage code upgrade. _SETTINGS_PACKAGE = os.environ.get('IDEASCUBE_SETTINGS_PACKAGE', 'ideascube') _SETTINGS_MODULE = '.conf.' + IDEASCUBE_ID try: sub = importlib.import_module(_SETTINGS_MODULE, package=_SETTINGS_PACKAGE) except (ImportError, SystemError): # No specific config for this box log('Could not import settings from %s%s' % (_SETTINGS_PACKAGE, _SETTINGS_MODULE)) from .conf import base as sub log('Importing settings from %s' % sub.__name__) ldict = locals() for k in sub.__dict__: if k.isupper() and not k.startswith('__') or not k.endswith('__'): ldict[k] = sub.__dict__[k] USER_DATA_FIELDS = [] for section, fields in USER_FORM_FIELDS: # pragma: no flakes USER_DATA_FIELDS.extend(fields) # Allow server settings to only define STORAGE_ROOT without needing to # redefine all ROOTS like settings. BACKUPED_ROOT = ldict.get('BACKUPED_ROOT') or os.path.join(STORAGE_ROOT, 'main') # pragma: no flakes MEDIA_ROOT = ldict.get('MEDIA_ROOT') or os.path.join(BACKUPED_ROOT, 'media') # noqa STATIC_ROOT = ldict.get('STATIC_ROOT') or os.path.join(STORAGE_ROOT, 'static') # pragma: no flakes CATALOG_CACHE_ROOT = ( ldict.get('CATALOG_CACHE_ROOT') or '/var/cache/ideascube/catalog') CATALOG_STORAGE_ROOT = ( ldict.get('CATALOG_STORAGE_ROOT') or os.path.join(BACKUPED_ROOT, 'catalog')) if not getattr(ldict, 'DATABASES', None): DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BACKUPED_ROOT, 'default.sqlite'), }, 'transient': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(STORAGE_ROOT, 'transient.sqlite'), # pragma: no flakes } } FILE_UPLOAD_PERMISSIONS = 0o644
ideascube/ideascube
ideascube/settings.py
Python
agpl-3.0
2,561
#!/usr/bin/python # -*- coding: utf-8 -*- # # Gruik coded by GuiguiAbloc # http://blog.guiguiabloc.fr # http://api.domogeek.fr # import web, sys, time import json,hashlib,socket from datetime import datetime,date,timedelta import urllib, urllib2 from Daemon import Daemon from xml.dom.minidom import parseString import Holiday import ClassTempo import ClassSchoolCalendar import ClassVigilance import ClassGeoLocation import ClassDawnDusk import ClassWeather import ClassEJP # timeout in seconds timeout = 10 socket.setdefaulttimeout(timeout) school = ClassSchoolCalendar.schoolcalendar() dayrequest = Holiday.jourferie() temporequest = ClassTempo.EDFTempo() vigilancerequest = ClassVigilance.vigilance() geolocationrequest = ClassGeoLocation.geolocation() dawnduskrequest = ClassDawnDusk.sunriseClass() weatherrequest = ClassWeather.weather() ejprequest = ClassEJP.EDFejp() ########## # CONFIG # ########## listenip = "0.0.0.0" listenport = "80" localapiurl= "http://api.domogeek.fr" googleapikey = '' bingmapapikey = '' geonameskey = '' worldweatheronlineapikey = '' redis_host = "127.0.0.1" redis_port = 6379 ############## # END CONFIG # ############## ############## # Test REDIS # ############## try: import redis except: print "No Redis module : https://pypi.python.org/pypi/redis/" sys.exit(1) rc= redis.Redis(host=redis_host, port=redis_port) rc.set("test", "ok") rc.expire("test" ,10) value = rc.get("test") if value is None: print "Could not connect to Redis " + redis_host + " port " + redis_port web.config.debug = False urls = ( '/holiday/(.*)', 'holiday', '/tempoedf/(.*)', 'tempoedf', '/ejpedf/(.*)', 'ejpedf', '/schoolholiday/(.*)', 'schoolholiday', '/weekend/(.*)', 'weekend', '/holidayall/(.*)', 'holidayall', '/vigilance/(.*)', 'vigilance', '/geolocation/(.*)', 'geolocation', '/sun/(.*)', 'dawndusk', '/weather/(.*)', 'weather', '/season(.*)', 'season', '/myip(.*)', 'myip', '/feastedsaint/(.*)', 'feastedsaint', '/', 'index' ) app = web.application(urls, globals()) class index: def GET(self): # redirect to the static file ... raise web.seeother('/static/index.html') """ @api {get} /holiday/:date/:responsetype Holiday Status Request @apiName GetHoliday @apiGroup Domogeek @apiDescription Ask to know if :date is a holiday @apiParam {String} now Ask for today. @apiParam {String} tomorrow Ask for tomorrow. @apiParam {String} all Ask for all entry. @apiParam {Datetime} D-M-YYYY Ask for specific date. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK Jour de Noel HTTP/1.1 200 OK no @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/holiday/now curl http://api.domogeek.fr/holiday/now/json curl http://api.domogeek.fr/holiday/all curl http://api.domogeek.fr/holiday/25-12-2014/json """ class holiday: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /holiday/{now|tomorrow|date(D-M-YYYY)}\n" try: format = request[1] except: format = None if request[0] == "now": datenow = datetime.now() year = datenow.year month = datenow.month day = datenow.day result = dayrequest.estferie([day,month,year]) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"holiday": result}) else: return result if request[0] == "tomorrow": datenow = datetime.now() datetomorrow = datenow + timedelta(days=1) year = datetomorrow.year month = datetomorrow.month day = datetomorrow.day result = dayrequest.estferie([day,month,year]) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"holiday": result}) else: return result if request[0] == "all": datenow = datetime.now() year = datenow.year listvalue = [] F, J, L = dayrequest.joursferies(year,1,'/') for i in xrange(0,len(F)): result = F[i], "%10s" % (J[i]), L[i] listvalue.append(result) response = json.dumps(listvalue) return response if request[0] != "now" and request[0] != "all" and request[0] != "tomorrow": try: daterequest = request[0] result = daterequest.split('-') except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" try: day = int(result[0]) month = int(result[1]) year = int(result[2]) except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" if day > 31 or month > 12: web.badrequest() return "Incorrect date format : D-M-YYYY\n" result = dayrequest.estferie([day,month,year]) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"holiday": result}) else: return result """ @api {get} /weekend/:daterequest/:responsetype Week-end Status Request @apiName GetWeekend @apiGroup Domogeek @apiDescription Ask to know if :daterequest is a week-end day @apiParam {String} daterequest Ask for specific date {now | tomorrow | D-M-YYYY}. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK True HTTP/1.1 200 OK False @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/weekend/now curl http://api.domogeek.fr/weekend/tomorrow curl http://api.domogeek.fr/weekend/now/json curl http://api.domogeek.fr/weekend/16-07-2014/json """ class weekend: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /weekend/{now|tomorrow|date(D-M-YYYY)}\n" try: format = request[1] except: format = None if request[0] == "now": datenow = datetime.now() daynow = datetime.now().weekday() day = datenow.day if daynow == 5 or daynow == 6: result = "True" else: result = "False" if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"weekend": result}) else: return result if request[0] == "tomorrow": today = date.today() datetomorrow = today + timedelta(days=1) day = datetomorrow.weekday() if day == 5 or day == 6: result = "True" else: result = "False" if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"weekend": result}) else: return result if request[0] != "now" and request[0] != "tomorrow": try: daterequest = request[0] day,month,year = daterequest.split('-') except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" try: int(day) int(month) int(year) except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" requestday = date(int(year),int(month),int(day)).weekday() if requestday == 5 or requestday == 6: result = "True" else: result = "False" if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"weekend": result}) else: return result """ @api {get} /holidayall/:zone/:daterequest All Holidays Status Request @apiName GetHolidayall @apiGroup Domogeek @apiDescription Ask to know if :daterequest is a holiday, school holiday and week-end day @apiParam {String} zone School Zone (A, B or C). @apiParam {String} daterequest Ask for specific date {now | tomorrow | D-M-YYYY}. @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"holiday": "False", "weekend": "False", "schoolholiday": "Vacances de printemps - Zone A"} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/holidayall/A/now curl http://api.domogeek.fr/holidayall/A/tomorrow curl http://api.domogeek.fr/holidayall/B/25-02-2014 """ class holidayall: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /holidayall/{zone}/{now|tomorrow|date(D-M-YYYY)}\n" try: zone = request[0] except: return "Incorrect request : /holidayall/{zone}/{now|tomorrow|date(D-M-YYYY)}\n" try: zoneok = str(zone.upper()) except: return "Wrong Zone (must be A, B or C)" if len(zoneok) > 1: return "Wrong Zone (must be A, B or C)" if zoneok not in ["A","B","C"]: return "Incorrect request : /holidayall/{zone}/{now|tomorrow|date(D-M-YYYY)}\n" try: daterequest = request[1] except: return "Incorrect request : /holidayall/{zone}/{now|tomorrow|date(D-M-YYYY)}\n" if request[1] == "now": try: responseholiday = urllib2.urlopen(localapiurl+'/holiday/now') responseschoolholiday = urllib2.urlopen(localapiurl+'/schoolholiday/'+zoneok+'/now') responseweekend = urllib2.urlopen(localapiurl+'/weekend/now') resultholiday = responseholiday.read() resultschoolholiday = responseschoolholiday.read() resultschoolholidays = resultschoolholiday.decode('utf-8') resultweekend = responseweekend.read() except: return "no data available" web.header('Content-Type', 'application/json') return json.dumps({"holiday": resultholiday, "schoolholiday": resultschoolholidays, "weekend": resultweekend}, ensure_ascii=False).encode('utf8') if request[1] == "tomorrow": try: responseholiday = urllib2.urlopen(localapiurl+'/holiday/tomorrow') responseschoolholiday = urllib2.urlopen(localapiurl+'/schoolholiday/'+zoneok+'/tomorrow') responseweekend = urllib2.urlopen(localapiurl+'/weekend/tomorrow') resultholiday = responseholiday.read() resultschoolholiday = responseschoolholiday.read() resultschoolholidays = resultschoolholiday.decode('utf-8') resultweekend = responseweekend.read() except: return "no data available" web.header('Content-Type', 'application/json') return json.dumps({"holiday": resultholiday, "schoolholiday": resultschoolholidays, "weekend": resultweekend}, ensure_ascii=False).encode('utf8') if request[1] != "now" and request[1] != "tomorrow": try: daterequest = request[1] day,month,year = daterequest.split('-') except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" try: int(day) int(month) int(year) except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" try: responseholiday = urllib2.urlopen(localapiurl+'/holiday/'+daterequest) responseschoolholiday = urllib2.urlopen(localapiurl+'/schoolholiday/'+zoneok+'/'+daterequest) responseweekend = urllib2.urlopen(localapiurl+'/weekend/'+daterequest) resultholiday = responseholiday.read() resultschoolholiday = responseschoolholiday.read() resultschoolholidays = resultschoolholiday.decode('utf-8') resultweekend = responseweekend.read() except: return "no data available" web.header('Content-Type', 'application/json') return json.dumps({"holiday": resultholiday, "schoolholiday": resultschoolholidays, "weekend": resultweekend}, ensure_ascii=False).encode('utf8') """ @api {get} /tempoedf/:date/:responsetype Tempo EDF color Request @apiName GetTempo @apiGroup Domogeek @apiDescription Ask the EDF Tempo color @apiParam {String} now Ask for today. @apiParam {String} tomorrow Ask for tomorrow. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK Content-Type: application/json Transfer-Encoding: chunked Date: Thu, 03 Jul 2014 17:16:47 GMT Server: localhost {"tempocolor": "bleu"} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/tempoedf/now curl http://api.domogeek.fr/tempoedf/now/json curl http://api.domogeek.fr/tempoedf/tomorrow curl http://api.domogeek.fr/tempoedf/tomorrow/json """ class tempoedf: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /tempoedf/{now | tomorrow}\n" try: format = request[1] except: format = None if request[0] == "now": try: rediskeytemponow = hashlib.md5("temponow").hexdigest() gettemponow = rc.get(rediskeytemponow) if gettemponow is None: result = temporequest.TempoToday() rediskeytemponow = hashlib.md5("temponow").hexdigest() rc.set(rediskeytemponow, result, 1800) rc.expire(rediskeytemponow ,1800) print "SET TEMPO NOW IN REDIS" else: result = gettemponow print "FOUND TEMPO NOW IN REDIS" except: result = temporequest.TempoToday() if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"tempocolor": result}) else: return result if request[0] == "tomorrow": try: rediskeytempotomorrow = hashlib.md5("tempotomorrow").hexdigest() gettempotomorrow = rc.get(rediskeytempotomorrow) if gettempotomorrow is None: result = temporequest.TempoTomorrow() rediskeytempotomorrow = hashlib.md5("tempotomorrow").hexdigest() rc.set(rediskeytempotomorrow, result, 1800) rc.expire(rediskeytempotomorrow ,1800) print "SET TEMPO TOMORROW IN REDIS" else: result = gettempotomorrow print "FOUND TEMPO TOMORROW IN REDIS" except: result = temporequest.TempoTomorrow() if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"tempocolor": result}) else: return result web.badrequest() return "Incorrect request : /tempoedf/{now | tomorrow}\n" """ @api {get} /schoolholiday/:zone/:daterequest/:responsetype School Holiday Status Request @apiName GetSchoolHoliday @apiGroup Domogeek @apiDescription Ask to know if :daterequest is a school holiday (UTF-8 response) @apiParam {String} zone School Zone (A, B or C). @apiParam {String} daterequest Ask for specific date {now | all | D-M-YYYY}. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK Vacances de la Toussaint HTTP/1.1 200 OK False @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/schoolholiday/A/now curl http://api.domogeek.fr/schoolholiday/A/now/json curl http://api.domogeek.fr/schoolholiday/A/all curl http://api.domogeek.fr/schoolholiday/A/25-12-2014/json """ class schoolholiday: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /schoolholiday/{zone}/{now|tomorrow|all|date(D-M-YYYY)}\n" try: zone = request[0] except: return "Incorrect request : /schoolholiday/{zone}/{now|tomorrow|all|date(D-M-YYYY)}\n" try: zoneok = str(zone.upper()) except: return "Wrong Zone (must be A, B or C)" if len(zoneok) > 1: return "Wrong Zone (must be A, B or C)" if zoneok not in ["A","B","C"]: return "Incorrect request : /schoolholiday/{zone}/{now|tomorrow|all|date(D-M-YYYY)}\n" try: daterequest = request[1] except: return "Incorrect request : /schoolholiday/{zone}/{now|tomorrow|all|date(D-M-YYYY)}\n" try: format = request[2] except: format = None datenow = datetime.now() year = datenow.year month = datenow.month day = datenow.day if daterequest == "now": try: rediskeyschoolholidaynow = hashlib.md5("schoolholidaynow"+zoneok).hexdigest() getschoolholidaynow = rc.get(rediskeyschoolholidaynow) if getschoolholidaynow is None: result = school.isschoolcalendar(zoneok,day,month,year) rediskeyschoolholidaynow = hashlib.md5("schoolholidaynow"+zoneok).hexdigest() rc.set(rediskeyschoolholidaynow, result, 1800) rc.expire(rediskeyschoolholidaynow ,1800) print "SET SCHOOL HOLIDAY "+zoneok+ " NOW IN REDIS" else: result = getschoolholidaynow print "FOUND SCHOOL HOLIDAY "+zoneok+" NOW IN REDIS" except: result = school.isschoolcalendar(zoneok,day,month,year) if result == None or result == "None": result = "False" try: description = result.decode('utf-8') except: description = result if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"schoolholiday": description}, ensure_ascii=False).encode('utf8') else: return description if daterequest == "tomorrow": datenow = datetime.now() datetomorrow = datenow + timedelta(days=1) yeartomorrow = datetomorrow.year monthtomorrow = datetomorrow.month daytomorrow = datetomorrow.day try: rediskeyschoolholidaytomorrow = hashlib.md5("schoolholidaytomorrow"+zoneok).hexdigest() getschoolholidaytomorrow = rc.get(rediskeyschoolholidaytomorrow) if getschoolholidaytomorrow is None: result = school.isschoolcalendar(zoneok,daytomorrow,monthtomorrow,yeartomorrow) rediskeyschoolholidaytomorrow = hashlib.md5("schoolholidaytomorrow"+zoneok).hexdigest() rc.set(rediskeyschoolholidaytomorrow, result, 1800) rc.expire(rediskeyschoolholidaytomorrow ,1800) print "SET SCHOOL HOLIDAY "+zoneok+ " TOMORROW IN REDIS" else: result = getschoolholidaytomorrow print "FOUND SCHOOL HOLIDAY "+zoneok+" TOMORROW IN REDIS" except: result = school.isschoolcalendar(zoneok,daytomorrow,monthtomorrow,yeartomorrow) if result == None or result == "None": result = "False" try: description = result.decode('utf-8') except: description = result if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"schoolholiday": description}, ensure_ascii=False).encode('utf8') else: return description if daterequest == "all": result = school.getschoolcalendar(zone) try: description = result.decode('unicode_escape') except: description = result web.header('Content-Type', 'application/json') return description if daterequest != "now" and daterequest != "all" and daterequest != "tomorrow": try: result = daterequest.split('-') except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" try: day = int(result[0]) month = int(result[1]) year = int(result[2]) except: web.badrequest() return "Incorrect date format : D-M-YYYY\n" if day > 31 or month > 12: web.badrequest() return "Incorrect date format : D-M-YYYY\n" result = school.isschoolcalendar(zoneok,day,month,year) if result == None : result = "False" try: description = result.decode('utf-8') except: description = result if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"schoolholiday": description}, ensure_ascii=False).encode('utf8') else: return description """ @api {get} /vigilance/:department/:vigilancerequest/:responsetype Vigilance MeteoFrance @apiName GetVigilance @apiGroup Domogeek @apiDescription Ask Vigilance MeteoFrance for :department @apiParam {String} department Department number (France Metropolitan). @apiParam {String} vigilancerequest Vigilance request {color|risk|flood|all}. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"vigilanceflood": "jaune", "vigilancecolor": "orange", "vigilancerisk": "orages"} HTTP/1.1 200 OK vert @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/vigilance/29/color curl http://api.domogeek.fr/vigilance/29/color/json curl http://api.domogeek.fr/vigilance/29/risk/json curl http://api.domogeek.fr/vigilance/29/all """ class vigilance: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /vigilance/{department}/{color|risk|flood|all}\n" try: dep = request[0] except: web.badrequest() return "Incorrect request : /vigilance/{department}/{color|risk|flood|all}\n" try: vigilancequery = request[1] except: web.badrequest() return "Incorrect request : /vigilance/{department}/{color|risk|flood|all}\n" try: format = request[2] except: format = None if len(dep) > 2: web.badrequest() return "Incorrect request : /vigilance/{department number}/{color|risk|flood|all}\n" if vigilancequery not in ["color","risk","flood", "all"]: web.badrequest() return "Incorrect request : /vigilance/{department}/{color|risk|flood|all}\n" if dep == "92" or dep == "93" or dep == "94": dep = "75" if dep == "20": dep = "2A" try: rediskeyvigilance = hashlib.md5(dep+"vigilance").hexdigest() getvigilance = rc.get(rediskeyvigilance) if getvigilance is None: result = vigilancerequest.getvigilance(dep) rediskeyvigilance = hashlib.md5(dep+"vigilance").hexdigest() rc.set(rediskeyvigilance, result, 1800) rc.expire(rediskeyvigilance ,1800) print "SET VIGILANCE "+dep+" IN REDIS" else: tr1 = getvigilance.replace("(","") tr2 = tr1.replace(")","") tr3 = tr2.replace("'","") tr4 = tr3.replace(" ","") result = tr4.split(',') print "FOUND VIGILANCE "+dep+" IN REDIS" except: result = vigilancerequest.getvigilance(dep) color = result[0] risk = result[1] flood = result[2] if vigilancequery == "color": if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"vigilancecolor": color}) else: return color if vigilancequery == "risk": if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"vigilancerisk": risk}) else: return risk if vigilancequery == "flood": if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"vigilanceflood": flood}) else: return flood if vigilancequery == "all": web.header('Content-Type', 'application/json') return json.dumps({"vigilancecolor": color, "vigilancerisk": risk, "vigilanceflood": flood}) """ @api {get} /geolocation/:city City Geolocation @apiName GetGeolocation @apiGroup Domogeek @apiDescription Ask geolocation (latitude/longitude) :city @apiParam {String} city City name (avoid accents, no space, no guarantee works other than France Metropolitan). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"latitude": 48.390394000000001, "longitude": -4.4860759999999997} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/geolocation/brest """ class geolocation: def GET(self,uri): checkgoogle = False checkbing = False checkgeonames = False inredis = False request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /geolocation/{city}\n" try: city = request[0] except: return "Incorrect request : /geolocation/{city}\n" try: rediskey = hashlib.md5(city).hexdigest() getlocation = rc.get(rediskey) if getlocation is None: pass else: print "FOUND LOCATION IN REDIS !!!" inredis = "ok" tr1 = getlocation.replace("(","") tr2 = tr1.replace(")","") data = tr2.split(',') web.header('Content-Type', 'application/json') return json.dumps({"latitude": float(data[0]), "longitude": float(data[1])}) except: pass if googleapikey == '' or inredis == "ok": pass else: try: data = geolocationrequest.geogoogle(city, googleapikey) checkgoogle = True rediskey = hashlib.md5(city).hexdigest() rc.set(rediskey, (data[0], data[1])) web.header('Content-Type', 'application/json') return json.dumps({"latitude": data[0], "longitude": data[1]}) except: print "NO VALUE FROM GOOGLE" if bingmapapikey == '' or inredis == "ok": pass else: if checkgoogle: pass else: try: data = geolocationrequest.geobing(city, bingmapapikey) except: print "NO VALUE FROM BING" data = False if not data : print "NO BING" else: checkbing = True rediskey = hashlib.md5(city).hexdigest() rc.set(rediskey, (data[0], data[1])) web.header('Content-Type', 'application/json') return json.dumps({"latitude": data[0], "longitude": data[1]}) if geonameskey == '' or inredis == "ok": pass else: if checkbing: pass else: try: data = geolocationrequest.geonames(city, geonameskey) except: print "NO VALUE FROM GEONAMES" data = False if not data : print "NO VALUE FROM GEONAMES" else: checkgeonames = True rediskey = hashlib.md5(city).hexdigest() rc.set(rediskey, (data[0], data[1])) web.header('Content-Type', 'application/json') return json.dumps({"latitude": data[0], "longitude": data[1]}) if not checkgoogle and not checkbing and not checkgeonames and not inredis: return "NO GEOLOCATION DATA AVAILABLE\n" """ @api {get} /sun/:city/:sunrequest/:date/:responsetype Sun Status Request @apiName GetSun @apiGroup Domogeek @apiDescription Ask to know sunrise, sunset, zenith, day duration for :date in :city (France) @apiParam {String} city City name (avoid accents, no space, France Metropolitan). @apiParam {String} sunrequest Ask for {sunrise | sunset | zenith | dayduration | all}. @apiParam {String} date Date request {now | tomorrow}. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"sunset": "20:59"} HTTP/1.1 200 OK {"dayduration": "15:06", "sunset": "21:18", "zenith": "13:44", "sunrise": "6:11"} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/sun/brest/all/now curl http://api.domogeek.fr/sun/bastia/sunset/now/json curl http://api.domogeek.fr/sun/strasbourg/sunrise/tomorrow """ class dawndusk: def GET(self,uri): getutc = float(time.strftime("%z")[:3]) request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: city = request[0] except: web.badrequest() return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" if len(city) < 1: web.badrequest() return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: print str(city) except UnicodeEncodeError: web.badrequest() return "Incorrect city format : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: dawnduskrequestelement = request[1] except: web.badrequest() return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: daterequest = request[2] except: web.badrequest() return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: format = request[3] except: format = None if dawnduskrequestelement not in ["sunrise", "sunset", "zenith", "dayduration", "all"]: return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" try: rediskey = hashlib.md5(city).hexdigest() getlocation = rc.get(rediskey) if getlocation is None: print "NO KEY IN REDIS" responsegeolocation = urllib2.urlopen(localapiurl+'/geolocation/'+city) resultgeolocation = json.load(responsegeolocation) latitude = resultgeolocation["latitude"] longitude = resultgeolocation["longitude"] else: print "FOUND LOCATION IN REDIS !!!" tr1 = getlocation.replace("(","") tr2 = tr1.replace(")","") data = tr2.split(',') latitude = float(data[0]) longitude = float(data[1]) except: return "no data available" if request[2] == "now": today=date.today() elif request[2] == "tomorrow": today = date.today() + timedelta(days=1) else: return "Incorrect request : /sun/city/{sunrise|sunset|zenith|dayduration|all}/{now|tomorrow}\n" dawnduskrequest.setNumericalDate(today.day,today.month,today.year) dawnduskrequest.setLocation(latitude, longitude) dawnduskrequest.calculateWithUTC(getutc) sunrise = dawnduskrequest.sunriseTime zenith = dawnduskrequest.meridianTime sunset = dawnduskrequest.sunsetTime dayduration =dawnduskrequest.durationTime if request[2] == "now" and dawnduskrequestelement == "all" : web.header('Content-Type', 'application/json') return json.dumps({"sunrise": sunrise, "zenith": zenith, "sunset": sunset, "dayduration": dayduration}) if request[2] == "now" and dawnduskrequestelement == "sunrise" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"sunrise": sunrise}) else: return sunrise if request[2] == "now" and dawnduskrequestelement == "sunset" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"sunset": sunset}) else: return sunset if request[2] == "now" and dawnduskrequestelement == "zenith" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"zenith": zenith}) else: return zenith if request[2] == "now" and dawnduskrequestelement == "dayduration" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"dayduration": dayduration}) else: return dayduration if request[2] == "tomorrow" and dawnduskrequestelement == "all" : web.header('Content-Type', 'application/json') return json.dumps({"sunrise": sunrise, "zenith": zenith, "sunset": sunset, "dayduration": dayduration}) if request[2] == "tomorrow" and dawnduskrequestelement == "sunrise" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"sunrise": sunrise}) else: return sunrise if request[2] == "tomorrow" and dawnduskrequestelement == "sunset" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"sunset": sunset}) else: return sunset if request[2] == "tomorrow" and dawnduskrequestelement == "zenith" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"zenith": zenith}) else: return zenith if request[2] == "tomorrow" and dawnduskrequestelement == "dayduration" : if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"dayduration": dayduration}) else: return dayduration """ @api {get} /weather/:city/:weatherrequest/:date/:responsetype Weather Status Request @apiName GetWeather @apiGroup Domogeek @apiDescription Ask for weather (temperature, humidity, pressure, windspeed...) for :date in :city (France) @apiParam {String} city City name (avoid accents, no space, France Metropolitan). @apiParam {String} weatherrequest Ask for {temperature|humidity[pressure|windspeed|weather|rain|all}. @apiParam {String} date Date request {today | tomorrow}. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {u'min': 15.039999999999999, u'max': 20.34, u'eve': 19.989999999999998, u'morn': 20.34, u'night': 15.039999999999999, u'day': 20.34} HTTP/1.1 200 OK {"pressure": 1031.0799999999999} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/weather/brest/all/today curl http://api.domogeek.fr/weather/brest/pressure/today/json curl http://api.domogeek.fr/weather/brest/weather/tomorrow curl http://api.domogeek.fr/weather/brest/rain/today """ class weather: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /weather/city/{temperature|humidity|pressure|weather|windspeed|rain|all}/{today|tomorrow}\n" try: city = request[0] except: return "Incorrect request : /weather/city/{temperature|humidity|pressure|weather|windspeed|rain|all}/{today|tomorrow}\n" try: weatherrequestelement = request[1] except: return "Incorrect request : /weather/city/{temperature|humidity|pressure|weather|windspeed|rain|all}/{today|tomorrow}\n" try: daterequest = request[2] except: return "Incorrect request : /weather/city/{temperature|humidity|pressure|weather|windspeed|rain|all}/{today|tomorrow}\n" try: format = request[3] except: format = None if weatherrequestelement not in ["temperature", "humidity", "pressure", "weather", "windspeed", "rain", "all"]: return "Incorrect request : /weather/city/{temperature|humidity|pressure|weather|windspeed|rain|all}/{today|tomorrow}\n" try: rediskey = hashlib.md5(city).hexdigest() getlocation = rc.get(rediskey) if getlocation is None: print "NO KEY IN REDIS" responsegeolocation = urllib2.urlopen(localapiurl+'/geolocation/'+city) resultgeolocation = json.load(responsegeolocation) latitude = resultgeolocation["latitude"] longitude = resultgeolocation["longitude"] else: print "FOUND LOCATION IN REDIS !!!" tr1 = getlocation.replace("(","") tr2 = tr1.replace(")","") data = tr2.split(',') latitude = float(data[0]) longitude = float(data[1]) except: return "no data available" if request[2] == "today": todayweather = weatherrequest.todayopenweathermap(latitude, longitude, weatherrequestelement) datenow = datetime.now() datetoday = datenow.strftime('%Y-%m-%d') try: rediskeytodayrain = hashlib.md5(str(latitude)+str(longitude)+str(datetoday)).hexdigest() gettodayrain = rc.get(rediskeytodayrain) if gettodayrain is None: todayrain = weatherrequest.getrain(latitude, longitude, worldweatheronlineapikey, datetoday) rediskeytodayrain = hashlib.md5(str(latitude)+str(longitude)+str(datetoday)).hexdigest() rc.set(rediskeytodayrain, todayrain) rc.expire(rediskeytodayrain, 3600) print "SET RAIN IN REDIS" else: todayrain = gettodayrain print "FOUND RAIN IN REDIS" except: todayrain = weatherrequest.getrain(latitude, longitude, worldweatheronlineapikey, datetoday) if weatherrequestelement != "all" or weatherrequestelement != "temperature" or weatherrequestelement != "weather": if format == "json": web.header('Content-Type', 'application/json') if weatherrequestelement == "humidity": return json.dumps({"humidity": todayweather}) if weatherrequestelement == "pressure": return json.dumps({"pressure": todayweather}) if weatherrequestelement == "windspeed": return json.dumps({"windspeed": todayweather}) if weatherrequestelement == "rain": return json.dumps({"rain": todayrain}) else: if weatherrequestelement == "rain": return todayrain else: return todayweather else: return todayweather if request[2] == "tomorrow": tomorrowweather = weatherrequest.tomorrowopenweathermap(latitude, longitude, weatherrequestelement) datenow = datetime.now() tomorrow = datenow + timedelta(days=1) datetomorrow = tomorrow.strftime('%Y-%m-%d') try: rediskeytomorrowrain = hashlib.md5(str(latitude)+str(longitude)+str(datetomorrow)).hexdigest() gettomorrowrain = rc.get(rediskeytomorrowrain) if gettomorrowrain is None: tomorrowrain = weatherrequest.getrain(latitude, longitude, worldweatheronlineapikey, datetomorrow) rediskeytomorrowrain = hashlib.md5(str(latitude)+str(longitude)+str(datetomorrow)).hexdigest() rc.set(rediskeytomorrowrain, tomorrowrain) rc.expire(rediskeytomorrowrain, 3600) print "SET RAIN IN REDIS" else: tomorrowrain = gettomorrowrain print "FOUND RAIN IN REDIS" except: tomorrowrain = weatherrequest.getrain(latitude, longitude, worldweatheronlineapikey, datetomorrow) if weatherrequestelement != "all" or weatherrequestelement != "temperature" or weatherrequestelement != "weather": if format == "json": web.header('Content-Type', 'application/json') if weatherrequestelement == "humidity": return json.dumps({"humidity": tomorrowweather}) if weatherrequestelement == "pressure": return json.dumps({"pressure": tomorrowweather}) if weatherrequestelement == "windspeed": return json.dumps({"windspeed": tomorrowweather}) if weatherrequestelement == "rain": return json.dumps({"rain": tomorrowrain}) else: if weatherrequestelement == "rain": return tomorrowrain else: return tomorrowweather else: return tomorrowweather """ @api {get} /myip/:responsetype Display Public IP @apiName GetMyPublicIP @apiGroup Domogeek @apiDescription Display your public IP @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"myip": "1.1.1.1"} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/myip curl http://api.domogeek.fr/myip/json """ class myip: def GET(self,uri,ip=None): try: request = uri.split('/') except: pass try: format = request[1] print format except: format = None ip = web.ctx.env.get('HTTP_X_FORWARDED_FOR', web.ctx.get('ip', '')) for ip in ip.split(','): ip = ip.strip() try: socket.inet_aton(ip) if format == "json": web.header('Cache-control', 'public,max-age=0') web.header('Content-Type', 'application/json') return json.dumps({"myip": ip}) else: web.header('Cache-control', 'public,max-age=0') return ip except socket.error: web.badrequest() pass """ @api {get} /season/:responsetype Display Current Season @apiName GetSeason @apiGroup Domogeek @apiDescription Display current season @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"season": "winter"} @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/season curl http://api.domogeek.fr/season/json """ class season: def GET(self,uri): try: request = uri.split('/') except: pass try: format = request[1] except: format = None today = datetime.today().timetuple().tm_yday spring = range(80, 172) summer = range(172, 264) autumn = range(264, 355) if today in spring: season = 'spring' elif today in summer: season = 'summer' elif today in autumn: season = 'autumn' else: season = 'winter' if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"season": season}) else: return season """ @api {get} /ejpedf/:zone/:date/:responsetype EJP EDF Status Request @apiName GetEJP @apiGroup Domogeek @apiDescription Ask for EJP EDF Status @apiParam {String} zone Specify Zone Request {nord|sud|ouest|paca} @apiParam {String} date Ask for today or tomorrow {today|tomorrow} @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK {"ejp": "False"} Return "True" : EJP day Return "False": No EJP day Return "ND" : Non Specified @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/ejpedf/nord/today curl http://api.domogeek.fr/ejpedf/sud/tomorrow curl http://api.domogeek.fr/ejpedf/paca/today/json """ class ejpedf: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /edfejp/{nord|sud|ouest|paca}/{today|tomorrow}\n" try: zone = request[0] except: web.badrequest() return "Incorrect request : /edfejp/{nord|sud|ouest|paca}/{today|tomorrow}\n" try: daterequest = request[1] except: web.badrequest() return "Incorrect request : /edfejp/{nord|sud|ouest|paca}/{today|tomorrow}\n" try: format = request[2] except: format = None try: zoneok = str(zone.lower()) except: web.badrequest() return "Incorrect request : /edfejp/{nord|sud|ouest|paca}/{today|tomorrow}\n" if zoneok not in ["nord", "sud", "paca", "ouest"]: web.badrequest() return "Incorrect request : /edfejp/{nord|sud|ouest|paca}/{today|tomorrow}\n" if request[1] == "today": try: rediskeyejptoday = hashlib.md5("ejptoday"+zoneok).hexdigest() getejptoday = rc.get(rediskeyejptoday) if getejptoday is None: result = ejprequest.EJPToday(zoneok) rediskeyejptoday = hashlib.md5("ejptoday"+zoneok).hexdigest() rc.set(rediskeyejptoday, result) rc.expire(rediskeyejptoday, 1800) print "SET EJP "+zoneok+" TODAY IN REDIS" else: result = getejptoday print "FOUND EJP "+zoneok+ " TODAY IN REDIS" except: result = ejprequest.EJPToday(zoneok) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"ejp": result}) else: return result if request[1] == "tomorrow": try: rediskeyejptomorrow = hashlib.md5("ejptomorrow"+zoneok).hexdigest() getejptomorrow = rc.get(rediskeyejptomorrow) if getejptomorrow is None: result = ejprequest.EJPTomorrow(zoneok) rediskeyejptomorrow = hashlib.md5("ejptomorrow"+zoneok).hexdigest() rc.set(rediskeyejptomorrow, result) rc.expire(rediskeyejptomorrow, 1800) print "SET EJP "+zoneok+" TOMORROW IN REDIS" else: result = getejptomorrow print "FOUND EJP "+zoneok+ " TOMORROW IN REDIS" except: result = ejprequest.EJPTomorrow(zoneok) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"ejp": result}) else: return result """ @api {get} /feastedsaint/:date/:responsetype Feasted Day of Saint Request @apiName GetFeastedSaintDay @apiGroup Domogeek @apiDescription Ask to know feasted Saint for :date or date for :name @apiParam {String} now Ask for today. @apiParam {String} tomorrow Ask for tomorrow. @apiParam {String} name Search feasted saint day for name. @apiParam {Datetime} D-M Ask for specific date. @apiParam {String} [responsetype] Specify Response Type (raw by default or specify json, only for single element). @apiSuccessExample Success-Response: HTTP/1.1 200 OK Guillaume 10-1 @apiErrorExample Error-Response: HTTP/1.1 400 Bad Request 400 Bad Request @apiExample Example usage: curl http://api.domogeek.fr/feastedsaint/guillaume curl http://api.domogeek.fr/feastedsaint/now curl http://api.domogeek.fr/feastedsaint/now/json curl http://api.domogeek.fr/feastedsaint/1-5 curl http://api.domogeek.fr/feastedsaint/2-12/json """ class feastedsaint: def GET(self,uri): request = uri.split('/') if request == ['']: web.badrequest() return "Incorrect request : /feastedsaint/{now|tomorrow|date(D-M)|name}\n" try: format = request[1] except: format = None if request[0] == "now": datenow = datetime.now() month = datenow.month day = datenow.day todayrequest = str(day)+"-"+str(month) rediskeyfeastedsaint = hashlib.md5(todayrequest+"feastedsaint").hexdigest() result = rc.get(rediskeyfeastedsaint) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"feastedsaint": result}) else: return result if request[0] == "tomorrow": datenow = datetime.now() datetomorrow = datenow + timedelta(days=1) month = datetomorrow.month day = datetomorrow.day todayrequest = str(day)+"-"+str(month) rediskeyfeastedsaint = hashlib.md5(todayrequest+"feastedsaint").hexdigest() result = rc.get(rediskeyfeastedsaint) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"feastedsaint": result}) else: return result if request[0] != "now" and request[0] != "tomorrow": try: daterequest = request[0] result = daterequest.split('-') except: web.badrequest() return "Incorrect date format : D-M\n" try: day = int(result[0]) month = int(result[1]) except: try: namerequest = request[0] namesearch = namerequest.lower() rediskeynamefeastedsaint = hashlib.md5(namesearch+"feastedsaint").hexdigest() result = rc.get(rediskeynamefeastedsaint) if result is None: result = "no name found or incorrect date format" if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"feastedsaint": result}) else: return result except: web.badrequest() return "Incorrect date format : D-M\n" if day > 31 or month > 12: web.badrequest() return "Incorrect date format : D-M\n" todayrequest = str(day)+"-"+str(month) rediskeyfeastedsaint = hashlib.md5(todayrequest+"feastedsaint").hexdigest() result = rc.get(rediskeyfeastedsaint) if format == "json": web.header('Content-Type', 'application/json') return json.dumps({"feastedsaint": result}) else: return result class MyDaemon(Daemon): def run(self): app.run() if __name__ == "__main__": service = MyDaemon('/tmp/apidomogeek.pid') if len(sys.argv) == 2: if 'start' == sys.argv[1]: sys.argv[1] = listenip+':'+listenport service.start() elif 'stop' == sys.argv[1]: service.stop() elif 'restart' == sys.argv[1]: service.restart() elif 'console' == sys.argv[1]: sys.argv[1] = listenip+':'+listenport service.console() else: print "Unknown command" sys.exit(2) sys.exit(0) else: print "usage: %s start|stop|restart|console" % sys.argv[0] sys.exit(2)
guiguiabloc/api-domogeek
apidomogeek.py
Python
gpl-2.0
51,860
from setuptools import setup, find_packages setup( name = "dwpwg", use_scm_version = True, author = "Raspberry Aether", author_email = "[email protected]", description = "(d)ice(w)are (p)ass(w)ord (g)enerator", keywords = ("diceware password passwords passphrase passphrases " + "security bitcoins monero crypto cryptocurrency " + "key keys keyphrase keyphrases encryption nsa " + "surveillance privacy private secret secrecy " + "generate generator dice d20 brainwallet wallet").split(), url = "https://github.com/raspberryaether/dwpwg", packages = find_packages(), include_package_data=True, entry_points = { 'console_scripts': [ 'dwpwg = dwpwg.pwgen:main' ] }, classifiers = [ "Development Status :: 3 - Alpha", "Environment :: Console", "License :: OSI Approved :: GNU General Public License v2 (GPLv2)", "Natural Language :: English", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.7", "Topic :: Security", "Topic :: Security :: Cryptography", "Topic :: Utilities" ], install_requires = [ "pyparsing" ], setup_requires = [ "setuptools_scm" ] )
raspberryaether/dwpwg
setup.py
Python
gpl-2.0
1,336
# -*- coding: utf-8 -*- """ Plex Server Who is watching what? """ import os from plexapi.server import PlexServer from plexapi.exceptions import NotFound, Unauthorized from plexapi.myplex import MyPlexAccount from pkm import log, utils, SHAREDIR from pkm.decorators import never_raise, threaded_method from pkm.exceptions import ValidationError from pkm.plugin import BasePlugin, BaseConfig from pkm.filters import register_filter from plexapi.video import Episode NAME = 'Plex Server' class Plugin(BasePlugin): DEFAULT_INTERVAL = 60 @threaded_method def enable(self): try: self.plex = fetch_plex_instance(self.pkmeter) super(Plugin, self).enable() except NotFound: log.warning('Plex server not available.') return self.disable() @never_raise def update(self): self.data.update(plex_dict(self.plex)) self.data['videos'] = [] for video in self.plex.sessions(): vinfo = { 'user': video.usernames[0], 'type': video.type, 'thumb': video.thumbUrl, 'year': video.year, 'duration': video.duration, 'viewoffset': video.viewOffset, 'percent': round((video.viewOffset / video.duration) * 100), 'player': video.players[0].device if video.players else 'NA', 'state': video.players[0].state if video.players else 'NA', 'title': self._video_title(video), # keep this last } if vinfo['state'] != 'paused': self.data['videos'].append(vinfo) super(Plugin, self).update() def _plex_address(self): return 'http://%s:%s' % (self.plex.address, self.plex.port) def _video_title(self, video): if video.type == Episode.TYPE: return '%s s%se%s' % (video.grandparentTitle, video.seasonNumber, video.index) return video.title class Config(BaseConfig): TEMPLATE = os.path.join(SHAREDIR, 'templates', 'plexserver_config.html') FIELDS = utils.Bunch(BaseConfig.FIELDS, host={}, username={'save_to_keyring':True}, password={'save_to_keyring':True}) def validate_password(self, field, value): if not value: return value try: MyPlexAccount.signin(self.fields.username.value, value) return value except Unauthorized: raise ValidationError('Invalid username or password.') def validate_host(self, field, value): if not value: return value try: username = self.fields.username.value password = self.fields.password.value fetch_plex_instance(self.pkmeter, username, password, value) return value except Unauthorized: raise ValidationError('Invalid username or password.') except NotFound: raise ValidationError('Server host or name not found.') except: raise ValidationError('Invalid server.') def fetch_plex_instance(pkmeter, username=None, password=None, host=None): username = username or pkmeter.config.get('plexserver', 'username', from_keyring=True) password = password or pkmeter.config.get('plexserver', 'password', from_keyring=True) host = host or pkmeter.config.get('plexserver', 'host', '') if username: log.info('Logging into MyPlex with user %s', username) user = MyPlexAccount.signin(username, password) return user.resource(host).connect() log.info('Connecting to Plex host: %s', host) return PlexServer(host) def plex_dict(plex): data = {} data['baseurl'] = plex._baseurl data['friendlyName'] = plex.friendlyName data['machineIdentifier'] = plex.machineIdentifier data['myPlex'] = plex.myPlex data['myPlexMappingState'] = plex.myPlexMappingState data['myPlexSigninState'] = plex.myPlexSigninState data['myPlexSubscription'] = plex.myPlexSubscription data['myPlexUsername'] = plex.myPlexUsername data['platform'] = plex.platform data['platformVersion'] = plex.platformVersion data['updatedAt'] = plex.updatedAt data['version'] = plex.version return data @register_filter() def plexserver_length(value): hours = int(value / 3600000) minutes = int((value - (hours * 3600000)) / 60000) return '%s:%02d' % (hours, minutes)
mjs7231/pkmeter
pkm/plugins/plexserver.py
Python
bsd-3-clause
4,435
import numpy as np import os import pandas as pd import rpc import sys from sklearn_cifar_container import SklearnCifarContainer from sklearn.metrics import accuracy_score classes = [ 'airplane', 'automobile', 'bird', 'cat', 'deer', 'dog', 'frog', 'horse', 'ship', 'truck' ] positive_class = classes.index('airplane') negative_class = classes.index('bird') def load_cifar(cifar_location, cifar_filename="train.data", norm=False): cifar_path = cifar_location + "/" + cifar_filename print("Source file: %s" % cifar_path) df = pd.read_csv(cifar_path, sep=",", header=None) data = df.values print("Number of image files: %d" % len(data)) y = data[:, 0] X = data[:, 1:] Z = X if norm: mu = np.mean(X.T, 0) sigma = np.var(X.T, 0) Z = (X.T - mu) / np.array([np.sqrt(z) if z > 0 else 1. for z in sigma]) Z = Z.T return (Z, y) def filter_data(X, y): X_train, y_train = [], [] for (example, label) in zip(X, y): if label == positive_class: X_train.append(example) y_train.append(1.0) elif label == negative_class: X_train.append(example) y_train.append(-1.0) X_train = np.array(X_train) y_train = np.array(y_train) return X_train, y_train if __name__ == '__main__': model_path = os.environ["CLIPPER_MODEL_PATH"] pkl_names = [ l for l in os.listdir(model_path) if os.path.splitext(l)[1] == ".pkl" ] assert len(pkl_names) == 1 pkl_path = os.path.join(model_path, pkl_names[0]) print(pkl_path) model = SklearnCifarContainer(pkl_path) X_test, y_test = load_cifar('data', 'test.data') X_test, y_test = filter_data(X_test, y_test) y_test[np.where(y_test == -1)] = 0 preds = model.predict_ints(X_test) print("Test accuracy: %f" % accuracy_score(y_test, preds))
dubeyabhi07/clipper
containers/python/test_sklearn_cifar_container.py
Python
apache-2.0
1,871
#!/usr/bin/env python2 # -*- coding: utf-8 -*- from __future__ import print_function """Script to checkout a sprout appliance Usage: sprout.py checkout """ import click import os import signal import sys import time import yaml from cfme.test_framework.sprout.client import AuthException from cfme.test_framework.sprout.plugin import SproutManager, SproutProvisioningRequest from cfme.utils.path import conf_path @click.group(help='Functions for interacting with sprout') def main(): pass @main.command('checkout', help='Checkout appliance and start keepalive daemon') @click.option('--appliances', envvar="SPROUT_APPLIANCES", default=1, help='How many appliances to provision') @click.option('--timeout', default=60, help='How many minutes is the lease timeout') @click.option('--provision-timeout', default=60, help='How many minutes to wait for appliances provisioned') @click.option('--group', required=True, envvar='SPROUT_GROUP', help='Which stream to use') @click.option('--version', default=None, help='Which version to use') @click.option('--date', default=None, help='Which date to use') @click.option('--desc', default=None, envvar='SPROUT_DESC', help='Set description of the pool') @click.option('--override-ram', default=0, help='Override RAM (MB). 0 means no override') @click.option('--override-cpu', default=0, help='Override CPU core count. 0 means no override') @click.option('--populate-yaml', is_flag=True, default=False, help="Populate the yaml with the appliance") @click.option('--provider', default=None, help="Which provider to use") @click.option('--provider-type', 'provider_type', default=None, help='A provider type to select from') @click.option('--template-type', 'template_type', default=None, help='A template type') @click.option('--preconfigured/--notconfigured', default=True, help='Whether the appliance is configured') @click.option('--user-key', 'sprout_user_key', default=None, help='Key for sprout user in credentials yaml, ' 'alternatively set SPROUT_USER and SPROUT_PASSWORD env vars') def checkout(appliances, timeout, provision_timeout, group, version, date, desc, override_ram, override_cpu, populate_yaml, provider, provider_type, template_type, preconfigured, sprout_user_key): """checks out a sprout provisioning request, and returns it on exit""" override_cpu = override_cpu or None override_ram = override_ram or None sr = SproutProvisioningRequest(group=group, count=appliances, version=version, date=date, lease_time=timeout, provision_timeout=provision_timeout, desc=desc, cpu=override_cpu, ram=override_ram, provider=provider, provider_type=provider_type, template_type=template_type, preconfigured=preconfigured) print(sr) sm = SproutManager(sprout_user_key=sprout_user_key) def exit_gracefully(signum, frame): sm.destroy_pool() sys.exit(0) signal.signal(signal.SIGINT, exit_gracefully) signal.signal(signal.SIGTERM, exit_gracefully) try: appliance_data = sm.request_appliances(sr) while not sm.check_fullfilled(): print("waiting...") time.sleep(10) sm.reset_timer() for app in appliance_data: print("{}: {}".format(app['name'], app['ip_address'])) if populate_yaml: populate_config_from_appliances(appliance_data) print("Appliance checked out, hit ctrl+c to checkin") while True: time.sleep(10) except KeyboardInterrupt: try: sm.destroy_pool() except Exception: print("Error in pool destroy") except AuthException: print('\nERROR: Sprout client unauthenticated, please provide env vars or --user-key') def populate_config_from_appliances(appliance_data): """populates env.local.yaml with the appliances just obtained args: appliance_data: the data of the appliances as taken from sprout """ file_name = conf_path.join('env.local.yaml').strpath if os.path.exists(file_name): with open(file_name) as f: y_data = yaml.load(f) if not y_data: y_data = {} else: y_data = {} if y_data: with open(conf_path.join('env.local.backup').strpath, 'w') as f: yaml.dump(y_data, f, default_flow_style=False) y_data['appliances'] = [] for app in appliance_data: app_config = dict( hostname=app['ip_address'], ui_protocol="https", version=str(app['template_version']), ) y_data['appliances'].append(app_config) with open(file_name, 'w') as f: # Use safe dump to avoid !!python/unicode tags yaml.safe_dump(y_data, f, default_flow_style=False) if __name__ == "__main__": main()
anurag03/integration_tests
cfme/scripting/sprout.py
Python
gpl-2.0
5,048
from __future__ import print_function from __future__ import absolute_import from __future__ import unicode_literals from .utils import SubdueTestCase, TempSub class TestCommandExecution(SubdueTestCase): def test_simple_command(self): with TempSub(self, name='simple', thin=False) as s: s.create_subcommand('status', 'sh', '''echo "I am status"''' ).run_it( ).assertSucess( ).stdout.matches(r'^I am status$') def test_two_level_command(self): with TempSub(self, name='ex', thin=False) as sub: sub.create_subcommand('server/status', 'sh', '''echo "I am server status"''' ).run_it( ).assertSucess( ).stdout.matches(r'^I am server status$') def test_arguments(self): with TempSub(self, name='ex', thin=False) as sub: sub.create_subcommand('example/arguments', 'sh', '''echo "My arguments: $@"''' ).run_it('foo', 'bar', '-a', 'baz' ).assertSucess( ).stdout.matches(r'^My arguments: foo bar -a baz')
jdevera/subdue
test/test_command_execution.py
Python
mit
1,116
import sys try: from django.conf import settings from django.test.utils import get_runner settings.configure( DEBUG=True, USE_TZ=True, DATABASES={ "default": { "ENGINE": "django.db.backends.sqlite3", } }, ROOT_URLCONF="cbh_datastore_model.urls", INSTALLED_APPS=[ "django.contrib.auth", "django.contrib.contenttypes", "django.contrib.sites", "cbh_datastore_model", ], SITE_ID=1, MIDDLEWARE_CLASSES=(), ) try: import django setup = django.setup except AttributeError: pass else: setup() except ImportError: import traceback traceback.print_exc() raise ImportError( "To fix this error, run: pip install -r requirements-test.txt") def run_tests(*test_args): if not test_args: test_args = ['tests'] # Run tests TestRunner = get_runner(settings) test_runner = TestRunner() failures = test_runner.run_tests(test_args) if failures: sys.exit(bool(failures)) if __name__ == '__main__': run_tests(*sys.argv[1:])
thesgc/cbh_datastore_model
runtests.py
Python
mit
1,196
# -*- coding: utf-8 -*- from __future__ import print_function import warnings from datetime import timedelta import operator import pytest from string import ascii_lowercase from numpy import nan from numpy.random import randn import numpy as np from pandas.compat import lrange, PY35 from pandas import (compat, isna, notna, DataFrame, Series, MultiIndex, date_range, Timestamp, Categorical, _np_version_under1p12, to_datetime, to_timedelta) import pandas as pd import pandas.core.nanops as nanops import pandas.core.algorithms as algorithms import pandas.util.testing as tm import pandas.util._test_decorators as td from pandas.tests.frame.common import TestData class TestDataFrameAnalytics(TestData): # ---------------------------------------------------------------------= # Correlation and covariance @td.skip_if_no_scipy def test_corr_pearson(self): self.frame['A'][:5] = nan self.frame['B'][5:10] = nan self._check_method('pearson') @td.skip_if_no_scipy def test_corr_kendall(self): self.frame['A'][:5] = nan self.frame['B'][5:10] = nan self._check_method('kendall') @td.skip_if_no_scipy def test_corr_spearman(self): self.frame['A'][:5] = nan self.frame['B'][5:10] = nan self._check_method('spearman') def _check_method(self, method='pearson', check_minp=False): if not check_minp: correls = self.frame.corr(method=method) exp = self.frame['A'].corr(self.frame['C'], method=method) tm.assert_almost_equal(correls['A']['C'], exp) else: result = self.frame.corr(min_periods=len(self.frame) - 8) expected = self.frame.corr() expected.loc['A', 'B'] = expected.loc['B', 'A'] = nan tm.assert_frame_equal(result, expected) @td.skip_if_no_scipy def test_corr_non_numeric(self): self.frame['A'][:5] = nan self.frame['B'][5:10] = nan # exclude non-numeric types result = self.mixed_frame.corr() expected = self.mixed_frame.loc[:, ['A', 'B', 'C', 'D']].corr() tm.assert_frame_equal(result, expected) @td.skip_if_no_scipy def test_corr_nooverlap(self): # nothing in common for meth in ['pearson', 'kendall', 'spearman']: df = DataFrame({'A': [1, 1.5, 1, np.nan, np.nan, np.nan], 'B': [np.nan, np.nan, np.nan, 1, 1.5, 1], 'C': [np.nan, np.nan, np.nan, np.nan, np.nan, np.nan]}) rs = df.corr(meth) assert isna(rs.loc['A', 'B']) assert isna(rs.loc['B', 'A']) assert rs.loc['A', 'A'] == 1 assert rs.loc['B', 'B'] == 1 assert isna(rs.loc['C', 'C']) @td.skip_if_no_scipy def test_corr_constant(self): # constant --> all NA for meth in ['pearson', 'spearman']: df = DataFrame({'A': [1, 1, 1, np.nan, np.nan, np.nan], 'B': [np.nan, np.nan, np.nan, 1, 1, 1]}) rs = df.corr(meth) assert isna(rs.values).all() def test_corr_int(self): # dtypes other than float64 #1761 df3 = DataFrame({"a": [1, 2, 3, 4], "b": [1, 2, 3, 4]}) df3.cov() df3.corr() @td.skip_if_no_scipy def test_corr_int_and_boolean(self): # when dtypes of pandas series are different # then ndarray will have dtype=object, # so it need to be properly handled df = DataFrame({"a": [True, False], "b": [1, 0]}) expected = DataFrame(np.ones((2, 2)), index=[ 'a', 'b'], columns=['a', 'b']) for meth in ['pearson', 'kendall', 'spearman']: # RuntimeWarning with warnings.catch_warnings(record=True): result = df.corr(meth) tm.assert_frame_equal(result, expected) def test_corr_cov_independent_index_column(self): # GH 14617 df = pd.DataFrame(np.random.randn(4 * 10).reshape(10, 4), columns=list("abcd")) for method in ['cov', 'corr']: result = getattr(df, method)() assert result.index is not result.columns assert result.index.equals(result.columns) def test_cov(self): # min_periods no NAs (corner case) expected = self.frame.cov() result = self.frame.cov(min_periods=len(self.frame)) tm.assert_frame_equal(expected, result) result = self.frame.cov(min_periods=len(self.frame) + 1) assert isna(result.values).all() # with NAs frame = self.frame.copy() frame['A'][:5] = nan frame['B'][5:10] = nan result = self.frame.cov(min_periods=len(self.frame) - 8) expected = self.frame.cov() expected.loc['A', 'B'] = np.nan expected.loc['B', 'A'] = np.nan # regular self.frame['A'][:5] = nan self.frame['B'][:10] = nan cov = self.frame.cov() tm.assert_almost_equal(cov['A']['C'], self.frame['A'].cov(self.frame['C'])) # exclude non-numeric types result = self.mixed_frame.cov() expected = self.mixed_frame.loc[:, ['A', 'B', 'C', 'D']].cov() tm.assert_frame_equal(result, expected) # Single column frame df = DataFrame(np.linspace(0.0, 1.0, 10)) result = df.cov() expected = DataFrame(np.cov(df.values.T).reshape((1, 1)), index=df.columns, columns=df.columns) tm.assert_frame_equal(result, expected) df.loc[0] = np.nan result = df.cov() expected = DataFrame(np.cov(df.values[1:].T).reshape((1, 1)), index=df.columns, columns=df.columns) tm.assert_frame_equal(result, expected) def test_corrwith(self): a = self.tsframe noise = Series(randn(len(a)), index=a.index) b = self.tsframe.add(noise, axis=0) # make sure order does not matter b = b.reindex(columns=b.columns[::-1], index=b.index[::-1][10:]) del b['B'] colcorr = a.corrwith(b, axis=0) tm.assert_almost_equal(colcorr['A'], a['A'].corr(b['A'])) rowcorr = a.corrwith(b, axis=1) tm.assert_series_equal(rowcorr, a.T.corrwith(b.T, axis=0)) dropped = a.corrwith(b, axis=0, drop=True) tm.assert_almost_equal(dropped['A'], a['A'].corr(b['A'])) assert 'B' not in dropped dropped = a.corrwith(b, axis=1, drop=True) assert a.index[-1] not in dropped.index # non time-series data index = ['a', 'b', 'c', 'd', 'e'] columns = ['one', 'two', 'three', 'four'] df1 = DataFrame(randn(5, 4), index=index, columns=columns) df2 = DataFrame(randn(4, 4), index=index[:4], columns=columns) correls = df1.corrwith(df2, axis=1) for row in index[:4]: tm.assert_almost_equal(correls[row], df1.loc[row].corr(df2.loc[row])) def test_corrwith_with_objects(self): df1 = tm.makeTimeDataFrame() df2 = tm.makeTimeDataFrame() cols = ['A', 'B', 'C', 'D'] df1['obj'] = 'foo' df2['obj'] = 'bar' result = df1.corrwith(df2) expected = df1.loc[:, cols].corrwith(df2.loc[:, cols]) tm.assert_series_equal(result, expected) result = df1.corrwith(df2, axis=1) expected = df1.loc[:, cols].corrwith(df2.loc[:, cols], axis=1) tm.assert_series_equal(result, expected) def test_corrwith_series(self): result = self.tsframe.corrwith(self.tsframe['A']) expected = self.tsframe.apply(self.tsframe['A'].corr) tm.assert_series_equal(result, expected) def test_corrwith_matches_corrcoef(self): df1 = DataFrame(np.arange(10000), columns=['a']) df2 = DataFrame(np.arange(10000) ** 2, columns=['a']) c1 = df1.corrwith(df2)['a'] c2 = np.corrcoef(df1['a'], df2['a'])[0][1] tm.assert_almost_equal(c1, c2) assert c1 < 1 def test_corrwith_mixed_dtypes(self): # GH 18570 df = pd.DataFrame({'a': [1, 4, 3, 2], 'b': [4, 6, 7, 3], 'c': ['a', 'b', 'c', 'd']}) s = pd.Series([0, 6, 7, 3]) result = df.corrwith(s) corrs = [df['a'].corr(s), df['b'].corr(s)] expected = pd.Series(data=corrs, index=['a', 'b']) tm.assert_series_equal(result, expected) def test_bool_describe_in_mixed_frame(self): df = DataFrame({ 'string_data': ['a', 'b', 'c', 'd', 'e'], 'bool_data': [True, True, False, False, False], 'int_data': [10, 20, 30, 40, 50], }) # Integer data are included in .describe() output, # Boolean and string data are not. result = df.describe() expected = DataFrame({'int_data': [5, 30, df.int_data.std(), 10, 20, 30, 40, 50]}, index=['count', 'mean', 'std', 'min', '25%', '50%', '75%', 'max']) tm.assert_frame_equal(result, expected) # Top value is a boolean value that is False result = df.describe(include=['bool']) expected = DataFrame({'bool_data': [5, 2, False, 3]}, index=['count', 'unique', 'top', 'freq']) tm.assert_frame_equal(result, expected) def test_describe_bool_frame(self): # GH 13891 df = pd.DataFrame({ 'bool_data_1': [False, False, True, True], 'bool_data_2': [False, True, True, True] }) result = df.describe() expected = DataFrame({'bool_data_1': [4, 2, True, 2], 'bool_data_2': [4, 2, True, 3]}, index=['count', 'unique', 'top', 'freq']) tm.assert_frame_equal(result, expected) df = pd.DataFrame({ 'bool_data': [False, False, True, True, False], 'int_data': [0, 1, 2, 3, 4] }) result = df.describe() expected = DataFrame({'int_data': [5, 2, df.int_data.std(), 0, 1, 2, 3, 4]}, index=['count', 'mean', 'std', 'min', '25%', '50%', '75%', 'max']) tm.assert_frame_equal(result, expected) df = pd.DataFrame({ 'bool_data': [False, False, True, True], 'str_data': ['a', 'b', 'c', 'a'] }) result = df.describe() expected = DataFrame({'bool_data': [4, 2, True, 2], 'str_data': [4, 3, 'a', 2]}, index=['count', 'unique', 'top', 'freq']) tm.assert_frame_equal(result, expected) def test_describe_categorical(self): df = DataFrame({'value': np.random.randint(0, 10000, 100)}) labels = ["{0} - {1}".format(i, i + 499) for i in range(0, 10000, 500)] cat_labels = Categorical(labels, labels) df = df.sort_values(by=['value'], ascending=True) df['value_group'] = pd.cut(df.value, range(0, 10500, 500), right=False, labels=cat_labels) cat = df # Categoricals should not show up together with numerical columns result = cat.describe() assert len(result.columns) == 1 # In a frame, describe() for the cat should be the same as for string # arrays (count, unique, top, freq) cat = Categorical(["a", "b", "b", "b"], categories=['a', 'b', 'c'], ordered=True) s = Series(cat) result = s.describe() expected = Series([4, 2, "b", 3], index=['count', 'unique', 'top', 'freq']) tm.assert_series_equal(result, expected) cat = Series(Categorical(["a", "b", "c", "c"])) df3 = DataFrame({"cat": cat, "s": ["a", "b", "c", "c"]}) res = df3.describe() tm.assert_numpy_array_equal(res["cat"].values, res["s"].values) def test_describe_categorical_columns(self): # GH 11558 columns = pd.CategoricalIndex(['int1', 'int2', 'obj'], ordered=True, name='XXX') df = DataFrame({'int1': [10, 20, 30, 40, 50], 'int2': [10, 20, 30, 40, 50], 'obj': ['A', 0, None, 'X', 1]}, columns=columns) result = df.describe() exp_columns = pd.CategoricalIndex(['int1', 'int2'], categories=['int1', 'int2', 'obj'], ordered=True, name='XXX') expected = DataFrame({'int1': [5, 30, df.int1.std(), 10, 20, 30, 40, 50], 'int2': [5, 30, df.int2.std(), 10, 20, 30, 40, 50]}, index=['count', 'mean', 'std', 'min', '25%', '50%', '75%', 'max'], columns=exp_columns) tm.assert_frame_equal(result, expected) tm.assert_categorical_equal(result.columns.values, expected.columns.values) def test_describe_datetime_columns(self): columns = pd.DatetimeIndex(['2011-01-01', '2011-02-01', '2011-03-01'], freq='MS', tz='US/Eastern', name='XXX') df = DataFrame({0: [10, 20, 30, 40, 50], 1: [10, 20, 30, 40, 50], 2: ['A', 0, None, 'X', 1]}) df.columns = columns result = df.describe() exp_columns = pd.DatetimeIndex(['2011-01-01', '2011-02-01'], freq='MS', tz='US/Eastern', name='XXX') expected = DataFrame({0: [5, 30, df.iloc[:, 0].std(), 10, 20, 30, 40, 50], 1: [5, 30, df.iloc[:, 1].std(), 10, 20, 30, 40, 50]}, index=['count', 'mean', 'std', 'min', '25%', '50%', '75%', 'max']) expected.columns = exp_columns tm.assert_frame_equal(result, expected) assert result.columns.freq == 'MS' assert result.columns.tz == expected.columns.tz def test_describe_timedelta_values(self): # GH 6145 t1 = pd.timedelta_range('1 days', freq='D', periods=5) t2 = pd.timedelta_range('1 hours', freq='H', periods=5) df = pd.DataFrame({'t1': t1, 't2': t2}) expected = DataFrame({'t1': [5, pd.Timedelta('3 days'), df.iloc[:, 0].std(), pd.Timedelta('1 days'), pd.Timedelta('2 days'), pd.Timedelta('3 days'), pd.Timedelta('4 days'), pd.Timedelta('5 days')], 't2': [5, pd.Timedelta('3 hours'), df.iloc[:, 1].std(), pd.Timedelta('1 hours'), pd.Timedelta('2 hours'), pd.Timedelta('3 hours'), pd.Timedelta('4 hours'), pd.Timedelta('5 hours')]}, index=['count', 'mean', 'std', 'min', '25%', '50%', '75%', 'max']) res = df.describe() tm.assert_frame_equal(res, expected) exp_repr = (" t1 t2\n" "count 5 5\n" "mean 3 days 00:00:00 0 days 03:00:00\n" "std 1 days 13:56:50.394919 0 days 01:34:52.099788\n" "min 1 days 00:00:00 0 days 01:00:00\n" "25% 2 days 00:00:00 0 days 02:00:00\n" "50% 3 days 00:00:00 0 days 03:00:00\n" "75% 4 days 00:00:00 0 days 04:00:00\n" "max 5 days 00:00:00 0 days 05:00:00") assert repr(res) == exp_repr def test_describe_tz_values(self, tz_naive_fixture): # GH 21332 tz = tz_naive_fixture s1 = Series(range(5)) start = Timestamp(2018, 1, 1) end = Timestamp(2018, 1, 5) s2 = Series(date_range(start, end, tz=tz)) df = pd.DataFrame({'s1': s1, 's2': s2}) expected = DataFrame({'s1': [5, np.nan, np.nan, np.nan, np.nan, np.nan, 2, 1.581139, 0, 1, 2, 3, 4], 's2': [5, 5, s2.value_counts().index[0], 1, start.tz_localize(tz), end.tz_localize(tz), np.nan, np.nan, np.nan, np.nan, np.nan, np.nan, np.nan]}, index=['count', 'unique', 'top', 'freq', 'first', 'last', 'mean', 'std', 'min', '25%', '50%', '75%', 'max'] ) res = df.describe(include='all') tm.assert_frame_equal(res, expected) def test_reduce_mixed_frame(self): # GH 6806 df = DataFrame({ 'bool_data': [True, True, False, False, False], 'int_data': [10, 20, 30, 40, 50], 'string_data': ['a', 'b', 'c', 'd', 'e'], }) df.reindex(columns=['bool_data', 'int_data', 'string_data']) test = df.sum(axis=0) tm.assert_numpy_array_equal(test.values, np.array([2, 150, 'abcde'], dtype=object)) tm.assert_series_equal(test, df.T.sum(axis=1)) def test_count(self): f = lambda s: notna(s).sum() self._check_stat_op('count', f, has_skipna=False, has_numeric_only=True, check_dtype=False, check_dates=True) # corner case frame = DataFrame() ct1 = frame.count(1) assert isinstance(ct1, Series) ct2 = frame.count(0) assert isinstance(ct2, Series) # GH #423 df = DataFrame(index=lrange(10)) result = df.count(1) expected = Series(0, index=df.index) tm.assert_series_equal(result, expected) df = DataFrame(columns=lrange(10)) result = df.count(0) expected = Series(0, index=df.columns) tm.assert_series_equal(result, expected) df = DataFrame() result = df.count() expected = Series(0, index=[]) tm.assert_series_equal(result, expected) def test_nunique(self): f = lambda s: len(algorithms.unique1d(s.dropna())) self._check_stat_op('nunique', f, has_skipna=False, check_dtype=False, check_dates=True) df = DataFrame({'A': [1, 1, 1], 'B': [1, 2, 3], 'C': [1, np.nan, 3]}) tm.assert_series_equal(df.nunique(), Series({'A': 1, 'B': 3, 'C': 2})) tm.assert_series_equal(df.nunique(dropna=False), Series({'A': 1, 'B': 3, 'C': 3})) tm.assert_series_equal(df.nunique(axis=1), Series({0: 1, 1: 2, 2: 2})) tm.assert_series_equal(df.nunique(axis=1, dropna=False), Series({0: 1, 1: 3, 2: 2})) def test_sum(self): self._check_stat_op('sum', np.sum, has_numeric_only=True, skipna_alternative=np.nansum) # mixed types (with upcasting happening) self._check_stat_op('sum', np.sum, frame=self.mixed_float.astype('float32'), has_numeric_only=True, check_dtype=False, check_less_precise=True) @pytest.mark.parametrize( "method", ['sum', 'mean', 'prod', 'var', 'std', 'skew', 'min', 'max']) def test_stat_operators_attempt_obj_array(self, method): # GH #676 data = { 'a': [-0.00049987540199591344, -0.0016467257772919831, 0.00067695870775883013], 'b': [-0, -0, 0.0], 'c': [0.00031111847529610595, 0.0014902627951905339, -0.00094099200035979691] } df1 = DataFrame(data, index=['foo', 'bar', 'baz'], dtype='O') df2 = DataFrame({0: [np.nan, 2], 1: [np.nan, 3], 2: [np.nan, 4]}, dtype=object) for df in [df1, df2]: assert df.values.dtype == np.object_ result = getattr(df, method)(1) expected = getattr(df.astype('f8'), method)(1) if method in ['sum', 'prod']: tm.assert_series_equal(result, expected) def test_mean(self): self._check_stat_op('mean', np.mean, check_dates=True) def test_product(self): self._check_stat_op('product', np.prod) def test_median(self): def wrapper(x): if isna(x).any(): return np.nan return np.median(x) self._check_stat_op('median', wrapper, check_dates=True) def test_min(self): with warnings.catch_warnings(record=True): self._check_stat_op('min', np.min, check_dates=True) self._check_stat_op('min', np.min, frame=self.intframe) def test_cummin(self): self.tsframe.loc[5:10, 0] = nan self.tsframe.loc[10:15, 1] = nan self.tsframe.loc[15:, 2] = nan # axis = 0 cummin = self.tsframe.cummin() expected = self.tsframe.apply(Series.cummin) tm.assert_frame_equal(cummin, expected) # axis = 1 cummin = self.tsframe.cummin(axis=1) expected = self.tsframe.apply(Series.cummin, axis=1) tm.assert_frame_equal(cummin, expected) # it works df = DataFrame({'A': np.arange(20)}, index=np.arange(20)) result = df.cummin() # noqa # fix issue cummin_xs = self.tsframe.cummin(axis=1) assert np.shape(cummin_xs) == np.shape(self.tsframe) def test_cummax(self): self.tsframe.loc[5:10, 0] = nan self.tsframe.loc[10:15, 1] = nan self.tsframe.loc[15:, 2] = nan # axis = 0 cummax = self.tsframe.cummax() expected = self.tsframe.apply(Series.cummax) tm.assert_frame_equal(cummax, expected) # axis = 1 cummax = self.tsframe.cummax(axis=1) expected = self.tsframe.apply(Series.cummax, axis=1) tm.assert_frame_equal(cummax, expected) # it works df = DataFrame({'A': np.arange(20)}, index=np.arange(20)) result = df.cummax() # noqa # fix issue cummax_xs = self.tsframe.cummax(axis=1) assert np.shape(cummax_xs) == np.shape(self.tsframe) def test_max(self): with warnings.catch_warnings(record=True): self._check_stat_op('max', np.max, check_dates=True) self._check_stat_op('max', np.max, frame=self.intframe) def test_mad(self): f = lambda x: np.abs(x - x.mean()).mean() self._check_stat_op('mad', f) def test_var_std(self): alt = lambda x: np.var(x, ddof=1) self._check_stat_op('var', alt) alt = lambda x: np.std(x, ddof=1) self._check_stat_op('std', alt) result = self.tsframe.std(ddof=4) expected = self.tsframe.apply(lambda x: x.std(ddof=4)) tm.assert_almost_equal(result, expected) result = self.tsframe.var(ddof=4) expected = self.tsframe.apply(lambda x: x.var(ddof=4)) tm.assert_almost_equal(result, expected) arr = np.repeat(np.random.random((1, 1000)), 1000, 0) result = nanops.nanvar(arr, axis=0) assert not (result < 0).any() with pd.option_context('use_bottleneck', False): result = nanops.nanvar(arr, axis=0) assert not (result < 0).any() @pytest.mark.parametrize( "meth", ['sem', 'var', 'std']) def test_numeric_only_flag(self, meth): # GH #9201 df1 = DataFrame(np.random.randn(5, 3), columns=['foo', 'bar', 'baz']) # set one entry to a number in str format df1.loc[0, 'foo'] = '100' df2 = DataFrame(np.random.randn(5, 3), columns=['foo', 'bar', 'baz']) # set one entry to a non-number str df2.loc[0, 'foo'] = 'a' result = getattr(df1, meth)(axis=1, numeric_only=True) expected = getattr(df1[['bar', 'baz']], meth)(axis=1) tm.assert_series_equal(expected, result) result = getattr(df2, meth)(axis=1, numeric_only=True) expected = getattr(df2[['bar', 'baz']], meth)(axis=1) tm.assert_series_equal(expected, result) # df1 has all numbers, df2 has a letter inside pytest.raises(TypeError, lambda: getattr(df1, meth)( axis=1, numeric_only=False)) pytest.raises(TypeError, lambda: getattr(df2, meth)( axis=1, numeric_only=False)) def test_mixed_ops(self): # GH 16116 df = DataFrame({'int': [1, 2, 3, 4], 'float': [1., 2., 3., 4.], 'str': ['a', 'b', 'c', 'd']}) for op in ['mean', 'std', 'var', 'skew', 'kurt', 'sem']: result = getattr(df, op)() assert len(result) == 2 with pd.option_context('use_bottleneck', False): result = getattr(df, op)() assert len(result) == 2 def test_cumsum(self): self.tsframe.loc[5:10, 0] = nan self.tsframe.loc[10:15, 1] = nan self.tsframe.loc[15:, 2] = nan # axis = 0 cumsum = self.tsframe.cumsum() expected = self.tsframe.apply(Series.cumsum) tm.assert_frame_equal(cumsum, expected) # axis = 1 cumsum = self.tsframe.cumsum(axis=1) expected = self.tsframe.apply(Series.cumsum, axis=1) tm.assert_frame_equal(cumsum, expected) # works df = DataFrame({'A': np.arange(20)}, index=np.arange(20)) result = df.cumsum() # noqa # fix issue cumsum_xs = self.tsframe.cumsum(axis=1) assert np.shape(cumsum_xs) == np.shape(self.tsframe) def test_cumprod(self): self.tsframe.loc[5:10, 0] = nan self.tsframe.loc[10:15, 1] = nan self.tsframe.loc[15:, 2] = nan # axis = 0 cumprod = self.tsframe.cumprod() expected = self.tsframe.apply(Series.cumprod) tm.assert_frame_equal(cumprod, expected) # axis = 1 cumprod = self.tsframe.cumprod(axis=1) expected = self.tsframe.apply(Series.cumprod, axis=1) tm.assert_frame_equal(cumprod, expected) # fix issue cumprod_xs = self.tsframe.cumprod(axis=1) assert np.shape(cumprod_xs) == np.shape(self.tsframe) # ints df = self.tsframe.fillna(0).astype(int) df.cumprod(0) df.cumprod(1) # ints32 df = self.tsframe.fillna(0).astype(np.int32) df.cumprod(0) df.cumprod(1) def test_sem(self): alt = lambda x: np.std(x, ddof=1) / np.sqrt(len(x)) self._check_stat_op('sem', alt) result = self.tsframe.sem(ddof=4) expected = self.tsframe.apply( lambda x: x.std(ddof=4) / np.sqrt(len(x))) tm.assert_almost_equal(result, expected) arr = np.repeat(np.random.random((1, 1000)), 1000, 0) result = nanops.nansem(arr, axis=0) assert not (result < 0).any() with pd.option_context('use_bottleneck', False): result = nanops.nansem(arr, axis=0) assert not (result < 0).any() @td.skip_if_no_scipy def test_skew(self): from scipy.stats import skew def alt(x): if len(x) < 3: return np.nan return skew(x, bias=False) self._check_stat_op('skew', alt) @td.skip_if_no_scipy def test_kurt(self): from scipy.stats import kurtosis def alt(x): if len(x) < 4: return np.nan return kurtosis(x, bias=False) self._check_stat_op('kurt', alt) index = MultiIndex(levels=[['bar'], ['one', 'two', 'three'], [0, 1]], labels=[[0, 0, 0, 0, 0, 0], [0, 1, 2, 0, 1, 2], [0, 1, 0, 1, 0, 1]]) df = DataFrame(np.random.randn(6, 3), index=index) kurt = df.kurt() kurt2 = df.kurt(level=0).xs('bar') tm.assert_series_equal(kurt, kurt2, check_names=False) assert kurt.name is None assert kurt2.name == 'bar' def _check_stat_op(self, name, alternative, frame=None, has_skipna=True, has_numeric_only=False, check_dtype=True, check_dates=False, check_less_precise=False, skipna_alternative=None): if frame is None: frame = self.frame # set some NAs frame.loc[5:10] = np.nan frame.loc[15:20, -2:] = np.nan f = getattr(frame, name) if check_dates: df = DataFrame({'b': date_range('1/1/2001', periods=2)}) _f = getattr(df, name) result = _f() assert isinstance(result, Series) df['a'] = lrange(len(df)) result = getattr(df, name)() assert isinstance(result, Series) assert len(result) if has_skipna: def wrapper(x): return alternative(x.values) skipna_wrapper = tm._make_skipna_wrapper(alternative, skipna_alternative) result0 = f(axis=0, skipna=False) result1 = f(axis=1, skipna=False) tm.assert_series_equal(result0, frame.apply(wrapper), check_dtype=check_dtype, check_less_precise=check_less_precise) # HACK: win32 tm.assert_series_equal(result1, frame.apply(wrapper, axis=1), check_dtype=False, check_less_precise=check_less_precise) else: skipna_wrapper = alternative wrapper = alternative result0 = f(axis=0) result1 = f(axis=1) tm.assert_series_equal(result0, frame.apply(skipna_wrapper), check_dtype=check_dtype, check_less_precise=check_less_precise) if name in ['sum', 'prod']: exp = frame.apply(skipna_wrapper, axis=1) tm.assert_series_equal(result1, exp, check_dtype=False, check_less_precise=check_less_precise) # check dtypes if check_dtype: lcd_dtype = frame.values.dtype assert lcd_dtype == result0.dtype assert lcd_dtype == result1.dtype # result = f(axis=1) # comp = frame.apply(alternative, axis=1).reindex(result.index) # assert_series_equal(result, comp) # bad axis tm.assert_raises_regex(ValueError, 'No axis named 2', f, axis=2) # make sure works on mixed-type frame getattr(self.mixed_frame, name)(axis=0) getattr(self.mixed_frame, name)(axis=1) if has_numeric_only: getattr(self.mixed_frame, name)(axis=0, numeric_only=True) getattr(self.mixed_frame, name)(axis=1, numeric_only=True) getattr(self.frame, name)(axis=0, numeric_only=False) getattr(self.frame, name)(axis=1, numeric_only=False) # all NA case if has_skipna: all_na = self.frame * np.NaN r0 = getattr(all_na, name)(axis=0) r1 = getattr(all_na, name)(axis=1) if name in ['sum', 'prod']: unit = int(name == 'prod') expected = pd.Series(unit, index=r0.index, dtype=r0.dtype) tm.assert_series_equal(r0, expected) expected = pd.Series(unit, index=r1.index, dtype=r1.dtype) tm.assert_series_equal(r1, expected) @pytest.mark.parametrize("dropna, expected", [ (True, {'A': [12], 'B': [10.0], 'C': [1.0], 'D': ['a'], 'E': Categorical(['a'], categories=['a']), 'F': to_datetime(['2000-1-2']), 'G': to_timedelta(['1 days'])}), (False, {'A': [12], 'B': [10.0], 'C': [np.nan], 'D': np.array([np.nan], dtype=object), 'E': Categorical([np.nan], categories=['a']), 'F': [pd.NaT], 'G': to_timedelta([pd.NaT])}), (True, {'H': [8, 9, np.nan, np.nan], 'I': [8, 9, np.nan, np.nan], 'J': [1, np.nan, np.nan, np.nan], 'K': Categorical(['a', np.nan, np.nan, np.nan], categories=['a']), 'L': to_datetime(['2000-1-2', 'NaT', 'NaT', 'NaT']), 'M': to_timedelta(['1 days', 'nan', 'nan', 'nan']), 'N': [0, 1, 2, 3]}), (False, {'H': [8, 9, np.nan, np.nan], 'I': [8, 9, np.nan, np.nan], 'J': [1, np.nan, np.nan, np.nan], 'K': Categorical([np.nan, 'a', np.nan, np.nan], categories=['a']), 'L': to_datetime(['NaT', '2000-1-2', 'NaT', 'NaT']), 'M': to_timedelta(['nan', '1 days', 'nan', 'nan']), 'N': [0, 1, 2, 3]}) ]) def test_mode_dropna(self, dropna, expected): df = DataFrame({"A": [12, 12, 19, 11], "B": [10, 10, np.nan, 3], "C": [1, np.nan, np.nan, np.nan], "D": [np.nan, np.nan, 'a', np.nan], "E": Categorical([np.nan, np.nan, 'a', np.nan]), "F": to_datetime(['NaT', '2000-1-2', 'NaT', 'NaT']), "G": to_timedelta(['1 days', 'nan', 'nan', 'nan']), "H": [8, 8, 9, 9], "I": [9, 9, 8, 8], "J": [1, 1, np.nan, np.nan], "K": Categorical(['a', np.nan, 'a', np.nan]), "L": to_datetime(['2000-1-2', '2000-1-2', 'NaT', 'NaT']), "M": to_timedelta(['1 days', 'nan', '1 days', 'nan']), "N": np.arange(4, dtype='int64')}) result = df[sorted(list(expected.keys()))].mode(dropna=dropna) expected = DataFrame(expected) tm.assert_frame_equal(result, expected) @pytest.mark.skipif(not compat.PY3, reason="only PY3") def test_mode_sortwarning(self): # Check for the warning that is raised when the mode # results cannot be sorted df = DataFrame({"A": [np.nan, np.nan, 'a', 'a']}) expected = DataFrame({'A': ['a', np.nan]}) with tm.assert_produces_warning(UserWarning, check_stacklevel=False): result = df.mode(dropna=False) result = result.sort_values(by='A').reset_index(drop=True) tm.assert_frame_equal(result, expected) def test_operators_timedelta64(self): from datetime import timedelta df = DataFrame(dict(A=date_range('2012-1-1', periods=3, freq='D'), B=date_range('2012-1-2', periods=3, freq='D'), C=Timestamp('20120101') - timedelta(minutes=5, seconds=5))) diffs = DataFrame(dict(A=df['A'] - df['C'], B=df['A'] - df['B'])) # min result = diffs.min() assert result[0] == diffs.loc[0, 'A'] assert result[1] == diffs.loc[0, 'B'] result = diffs.min(axis=1) assert (result == diffs.loc[0, 'B']).all() # max result = diffs.max() assert result[0] == diffs.loc[2, 'A'] assert result[1] == diffs.loc[2, 'B'] result = diffs.max(axis=1) assert (result == diffs['A']).all() # abs result = diffs.abs() result2 = abs(diffs) expected = DataFrame(dict(A=df['A'] - df['C'], B=df['B'] - df['A'])) tm.assert_frame_equal(result, expected) tm.assert_frame_equal(result2, expected) # mixed frame mixed = diffs.copy() mixed['C'] = 'foo' mixed['D'] = 1 mixed['E'] = 1. mixed['F'] = Timestamp('20130101') # results in an object array from pandas.core.tools.timedeltas import ( _coerce_scalar_to_timedelta_type as _coerce) result = mixed.min() expected = Series([_coerce(timedelta(seconds=5 * 60 + 5)), _coerce(timedelta(days=-1)), 'foo', 1, 1.0, Timestamp('20130101')], index=mixed.columns) tm.assert_series_equal(result, expected) # excludes numeric result = mixed.min(axis=1) expected = Series([1, 1, 1.], index=[0, 1, 2]) tm.assert_series_equal(result, expected) # works when only those columns are selected result = mixed[['A', 'B']].min(1) expected = Series([timedelta(days=-1)] * 3) tm.assert_series_equal(result, expected) result = mixed[['A', 'B']].min() expected = Series([timedelta(seconds=5 * 60 + 5), timedelta(days=-1)], index=['A', 'B']) tm.assert_series_equal(result, expected) # GH 3106 df = DataFrame({'time': date_range('20130102', periods=5), 'time2': date_range('20130105', periods=5)}) df['off1'] = df['time2'] - df['time'] assert df['off1'].dtype == 'timedelta64[ns]' df['off2'] = df['time'] - df['time2'] df._consolidate_inplace() assert df['off1'].dtype == 'timedelta64[ns]' assert df['off2'].dtype == 'timedelta64[ns]' def test_sum_corner(self): axis0 = self.empty.sum(0) axis1 = self.empty.sum(1) assert isinstance(axis0, Series) assert isinstance(axis1, Series) assert len(axis0) == 0 assert len(axis1) == 0 @pytest.mark.parametrize('method, unit', [ ('sum', 0), ('prod', 1), ]) def test_sum_prod_nanops(self, method, unit): idx = ['a', 'b', 'c'] df = pd.DataFrame({"a": [unit, unit], "b": [unit, np.nan], "c": [np.nan, np.nan]}) # The default result = getattr(df, method) expected = pd.Series([unit, unit, unit], index=idx, dtype='float64') # min_count=1 result = getattr(df, method)(min_count=1) expected = pd.Series([unit, unit, np.nan], index=idx) tm.assert_series_equal(result, expected) # min_count=0 result = getattr(df, method)(min_count=0) expected = pd.Series([unit, unit, unit], index=idx, dtype='float64') tm.assert_series_equal(result, expected) result = getattr(df.iloc[1:], method)(min_count=1) expected = pd.Series([unit, np.nan, np.nan], index=idx) tm.assert_series_equal(result, expected) # min_count > 1 df = pd.DataFrame({"A": [unit] * 10, "B": [unit] * 5 + [np.nan] * 5}) result = getattr(df, method)(min_count=5) expected = pd.Series(result, index=['A', 'B']) tm.assert_series_equal(result, expected) result = getattr(df, method)(min_count=6) expected = pd.Series(result, index=['A', 'B']) tm.assert_series_equal(result, expected) def test_sum_nanops_timedelta(self): # prod isn't defined on timedeltas idx = ['a', 'b', 'c'] df = pd.DataFrame({"a": [0, 0], "b": [0, np.nan], "c": [np.nan, np.nan]}) df2 = df.apply(pd.to_timedelta) # 0 by default result = df2.sum() expected = pd.Series([0, 0, 0], dtype='m8[ns]', index=idx) tm.assert_series_equal(result, expected) # min_count=0 result = df2.sum(min_count=0) tm.assert_series_equal(result, expected) # min_count=1 result = df2.sum(min_count=1) expected = pd.Series([0, 0, np.nan], dtype='m8[ns]', index=idx) tm.assert_series_equal(result, expected) def test_sum_object(self): values = self.frame.values.astype(int) frame = DataFrame(values, index=self.frame.index, columns=self.frame.columns) deltas = frame * timedelta(1) deltas.sum() def test_sum_bool(self): # ensure this works, bug report bools = np.isnan(self.frame) bools.sum(1) bools.sum(0) def test_mean_corner(self): # unit test when have object data the_mean = self.mixed_frame.mean(axis=0) the_sum = self.mixed_frame.sum(axis=0, numeric_only=True) tm.assert_index_equal(the_sum.index, the_mean.index) assert len(the_mean.index) < len(self.mixed_frame.columns) # xs sum mixed type, just want to know it works... the_mean = self.mixed_frame.mean(axis=1) the_sum = self.mixed_frame.sum(axis=1, numeric_only=True) tm.assert_index_equal(the_sum.index, the_mean.index) # take mean of boolean column self.frame['bool'] = self.frame['A'] > 0 means = self.frame.mean(0) assert means['bool'] == self.frame['bool'].values.mean() def test_stats_mixed_type(self): # don't blow up self.mixed_frame.std(1) self.mixed_frame.var(1) self.mixed_frame.mean(1) self.mixed_frame.skew(1) def test_median_corner(self): def wrapper(x): if isna(x).any(): return np.nan return np.median(x) self._check_stat_op('median', wrapper, frame=self.intframe, check_dtype=False, check_dates=True) # Miscellanea def test_count_objects(self): dm = DataFrame(self.mixed_frame._series) df = DataFrame(self.mixed_frame._series) tm.assert_series_equal(dm.count(), df.count()) tm.assert_series_equal(dm.count(1), df.count(1)) def test_cumsum_corner(self): dm = DataFrame(np.arange(20).reshape(4, 5), index=lrange(4), columns=lrange(5)) # ?(wesm) result = dm.cumsum() # noqa def test_sum_bools(self): df = DataFrame(index=lrange(1), columns=lrange(10)) bools = isna(df) assert bools.sum(axis=1)[0] == 10 # Index of max / min def test_idxmin(self): frame = self.frame frame.loc[5:10] = np.nan frame.loc[15:20, -2:] = np.nan for skipna in [True, False]: for axis in [0, 1]: for df in [frame, self.intframe]: result = df.idxmin(axis=axis, skipna=skipna) expected = df.apply(Series.idxmin, axis=axis, skipna=skipna) tm.assert_series_equal(result, expected) pytest.raises(ValueError, frame.idxmin, axis=2) def test_idxmax(self): frame = self.frame frame.loc[5:10] = np.nan frame.loc[15:20, -2:] = np.nan for skipna in [True, False]: for axis in [0, 1]: for df in [frame, self.intframe]: result = df.idxmax(axis=axis, skipna=skipna) expected = df.apply(Series.idxmax, axis=axis, skipna=skipna) tm.assert_series_equal(result, expected) pytest.raises(ValueError, frame.idxmax, axis=2) # ---------------------------------------------------------------------- # Logical reductions def test_any_all(self): self._check_bool_op('any', np.any, has_skipna=True, has_bool_only=True) self._check_bool_op('all', np.all, has_skipna=True, has_bool_only=True) def test_any_all_extra(self): df = DataFrame({ 'A': [True, False, False], 'B': [True, True, False], 'C': [True, True, True], }, index=['a', 'b', 'c']) result = df[['A', 'B']].any(1) expected = Series([True, True, False], index=['a', 'b', 'c']) tm.assert_series_equal(result, expected) result = df[['A', 'B']].any(1, bool_only=True) tm.assert_series_equal(result, expected) result = df.all(1) expected = Series([True, False, False], index=['a', 'b', 'c']) tm.assert_series_equal(result, expected) result = df.all(1, bool_only=True) tm.assert_series_equal(result, expected) # Axis is None result = df.all(axis=None).item() assert result is False result = df.any(axis=None).item() assert result is True result = df[['C']].all(axis=None).item() assert result is True # skip pathological failure cases # class CantNonzero(object): # def __nonzero__(self): # raise ValueError # df[4] = CantNonzero() # it works! # df.any(1) # df.all(1) # df.any(1, bool_only=True) # df.all(1, bool_only=True) # df[4][4] = np.nan # df.any(1) # df.all(1) # df.any(1, bool_only=True) # df.all(1, bool_only=True) @pytest.mark.parametrize('func, data, expected', [ (np.any, {}, False), (np.all, {}, True), (np.any, {'A': []}, False), (np.all, {'A': []}, True), (np.any, {'A': [False, False]}, False), (np.all, {'A': [False, False]}, False), (np.any, {'A': [True, False]}, True), (np.all, {'A': [True, False]}, False), (np.any, {'A': [True, True]}, True), (np.all, {'A': [True, True]}, True), (np.any, {'A': [False], 'B': [False]}, False), (np.all, {'A': [False], 'B': [False]}, False), (np.any, {'A': [False, False], 'B': [False, True]}, True), (np.all, {'A': [False, False], 'B': [False, True]}, False), # other types (np.all, {'A': pd.Series([0.0, 1.0], dtype='float')}, False), (np.any, {'A': pd.Series([0.0, 1.0], dtype='float')}, True), (np.all, {'A': pd.Series([0, 1], dtype=int)}, False), (np.any, {'A': pd.Series([0, 1], dtype=int)}, True), pytest.param(np.all, {'A': pd.Series([0, 1], dtype='M8[ns]')}, False, marks=[td.skip_if_np_lt_115]), pytest.param(np.any, {'A': pd.Series([0, 1], dtype='M8[ns]')}, True, marks=[td.skip_if_np_lt_115]), pytest.param(np.all, {'A': pd.Series([1, 2], dtype='M8[ns]')}, True, marks=[td.skip_if_np_lt_115]), pytest.param(np.any, {'A': pd.Series([1, 2], dtype='M8[ns]')}, True, marks=[td.skip_if_np_lt_115]), pytest.param(np.all, {'A': pd.Series([0, 1], dtype='m8[ns]')}, False, marks=[td.skip_if_np_lt_115]), pytest.param(np.any, {'A': pd.Series([0, 1], dtype='m8[ns]')}, True, marks=[td.skip_if_np_lt_115]), pytest.param(np.all, {'A': pd.Series([1, 2], dtype='m8[ns]')}, True, marks=[td.skip_if_np_lt_115]), pytest.param(np.any, {'A': pd.Series([1, 2], dtype='m8[ns]')}, True, marks=[td.skip_if_np_lt_115]), (np.all, {'A': pd.Series([0, 1], dtype='category')}, False), (np.any, {'A': pd.Series([0, 1], dtype='category')}, True), (np.all, {'A': pd.Series([1, 2], dtype='category')}, True), (np.any, {'A': pd.Series([1, 2], dtype='category')}, True), # # Mix # GH-21484 # (np.all, {'A': pd.Series([10, 20], dtype='M8[ns]'), # 'B': pd.Series([10, 20], dtype='m8[ns]')}, True), ]) def test_any_all_np_func(self, func, data, expected): # https://github.com/pandas-dev/pandas/issues/19976 data = DataFrame(data) result = func(data) assert isinstance(result, np.bool_) assert result.item() is expected # method version result = getattr(DataFrame(data), func.__name__)(axis=None) assert isinstance(result, np.bool_) assert result.item() is expected def test_any_all_object(self): # https://github.com/pandas-dev/pandas/issues/19976 result = np.all(DataFrame(columns=['a', 'b'])).item() assert result is True result = np.any(DataFrame(columns=['a', 'b'])).item() assert result is False @pytest.mark.parametrize('method', ['any', 'all']) def test_any_all_level_axis_none_raises(self, method): df = DataFrame( {"A": 1}, index=MultiIndex.from_product([['A', 'B'], ['a', 'b']], names=['out', 'in']) ) xpr = "Must specify 'axis' when aggregating by level." with tm.assert_raises_regex(ValueError, xpr): getattr(df, method)(axis=None, level='out') def _check_bool_op(self, name, alternative, frame=None, has_skipna=True, has_bool_only=False): if frame is None: frame = self.frame > 0 # set some NAs frame = DataFrame(frame.values.astype(object), frame.index, frame.columns) frame.loc[5:10] = np.nan frame.loc[15:20, -2:] = np.nan f = getattr(frame, name) if has_skipna: def skipna_wrapper(x): nona = x.dropna().values return alternative(nona) def wrapper(x): return alternative(x.values) result0 = f(axis=0, skipna=False) result1 = f(axis=1, skipna=False) tm.assert_series_equal(result0, frame.apply(wrapper)) tm.assert_series_equal(result1, frame.apply(wrapper, axis=1), check_dtype=False) # HACK: win32 else: skipna_wrapper = alternative wrapper = alternative result0 = f(axis=0) result1 = f(axis=1) tm.assert_series_equal(result0, frame.apply(skipna_wrapper)) tm.assert_series_equal(result1, frame.apply(skipna_wrapper, axis=1), check_dtype=False) # result = f(axis=1) # comp = frame.apply(alternative, axis=1).reindex(result.index) # assert_series_equal(result, comp) # bad axis pytest.raises(ValueError, f, axis=2) # make sure works on mixed-type frame mixed = self.mixed_frame mixed['_bool_'] = np.random.randn(len(mixed)) > 0 getattr(mixed, name)(axis=0) getattr(mixed, name)(axis=1) class NonzeroFail(object): def __nonzero__(self): raise ValueError mixed['_nonzero_fail_'] = NonzeroFail() if has_bool_only: getattr(mixed, name)(axis=0, bool_only=True) getattr(mixed, name)(axis=1, bool_only=True) getattr(frame, name)(axis=0, bool_only=False) getattr(frame, name)(axis=1, bool_only=False) # all NA case if has_skipna: all_na = frame * np.NaN r0 = getattr(all_na, name)(axis=0) r1 = getattr(all_na, name)(axis=1) if name == 'any': assert not r0.any() assert not r1.any() else: assert r0.all() assert r1.all() # ---------------------------------------------------------------------- # Isin def test_isin(self): # GH #4211 df = DataFrame({'vals': [1, 2, 3, 4], 'ids': ['a', 'b', 'f', 'n'], 'ids2': ['a', 'n', 'c', 'n']}, index=['foo', 'bar', 'baz', 'qux']) other = ['a', 'b', 'c'] result = df.isin(other) expected = DataFrame([df.loc[s].isin(other) for s in df.index]) tm.assert_frame_equal(result, expected) @pytest.mark.parametrize("empty", [[], Series(), np.array([])]) def test_isin_empty(self, empty): # see gh-16991 df = DataFrame({'A': ['a', 'b', 'c'], 'B': ['a', 'e', 'f']}) expected = DataFrame(False, df.index, df.columns) result = df.isin(empty) tm.assert_frame_equal(result, expected) def test_isin_dict(self): df = DataFrame({'A': ['a', 'b', 'c'], 'B': ['a', 'e', 'f']}) d = {'A': ['a']} expected = DataFrame(False, df.index, df.columns) expected.loc[0, 'A'] = True result = df.isin(d) tm.assert_frame_equal(result, expected) # non unique columns df = DataFrame({'A': ['a', 'b', 'c'], 'B': ['a', 'e', 'f']}) df.columns = ['A', 'A'] expected = DataFrame(False, df.index, df.columns) expected.loc[0, 'A'] = True result = df.isin(d) tm.assert_frame_equal(result, expected) def test_isin_with_string_scalar(self): # GH4763 df = DataFrame({'vals': [1, 2, 3, 4], 'ids': ['a', 'b', 'f', 'n'], 'ids2': ['a', 'n', 'c', 'n']}, index=['foo', 'bar', 'baz', 'qux']) with pytest.raises(TypeError): df.isin('a') with pytest.raises(TypeError): df.isin('aaa') def test_isin_df(self): df1 = DataFrame({'A': [1, 2, 3, 4], 'B': [2, np.nan, 4, 4]}) df2 = DataFrame({'A': [0, 2, 12, 4], 'B': [2, np.nan, 4, 5]}) expected = DataFrame(False, df1.index, df1.columns) result = df1.isin(df2) expected['A'].loc[[1, 3]] = True expected['B'].loc[[0, 2]] = True tm.assert_frame_equal(result, expected) # partial overlapping columns df2.columns = ['A', 'C'] result = df1.isin(df2) expected['B'] = False tm.assert_frame_equal(result, expected) def test_isin_tuples(self): # GH16394 df = pd.DataFrame({'A': [1, 2, 3], 'B': ['a', 'b', 'f']}) df['C'] = list(zip(df['A'], df['B'])) result = df['C'].isin([(1, 'a')]) tm.assert_series_equal(result, Series([True, False, False], name="C")) def test_isin_df_dupe_values(self): df1 = DataFrame({'A': [1, 2, 3, 4], 'B': [2, np.nan, 4, 4]}) # just cols duped df2 = DataFrame([[0, 2], [12, 4], [2, np.nan], [4, 5]], columns=['B', 'B']) with pytest.raises(ValueError): df1.isin(df2) # just index duped df2 = DataFrame([[0, 2], [12, 4], [2, np.nan], [4, 5]], columns=['A', 'B'], index=[0, 0, 1, 1]) with pytest.raises(ValueError): df1.isin(df2) # cols and index: df2.columns = ['B', 'B'] with pytest.raises(ValueError): df1.isin(df2) def test_isin_dupe_self(self): other = DataFrame({'A': [1, 0, 1, 0], 'B': [1, 1, 0, 0]}) df = DataFrame([[1, 1], [1, 0], [0, 0]], columns=['A', 'A']) result = df.isin(other) expected = DataFrame(False, index=df.index, columns=df.columns) expected.loc[0] = True expected.iloc[1, 1] = True tm.assert_frame_equal(result, expected) def test_isin_against_series(self): df = pd.DataFrame({'A': [1, 2, 3, 4], 'B': [2, np.nan, 4, 4]}, index=['a', 'b', 'c', 'd']) s = pd.Series([1, 3, 11, 4], index=['a', 'b', 'c', 'd']) expected = DataFrame(False, index=df.index, columns=df.columns) expected['A'].loc['a'] = True expected.loc['d'] = True result = df.isin(s) tm.assert_frame_equal(result, expected) def test_isin_multiIndex(self): idx = MultiIndex.from_tuples([(0, 'a', 'foo'), (0, 'a', 'bar'), (0, 'b', 'bar'), (0, 'b', 'baz'), (2, 'a', 'foo'), (2, 'a', 'bar'), (2, 'c', 'bar'), (2, 'c', 'baz'), (1, 'b', 'foo'), (1, 'b', 'bar'), (1, 'c', 'bar'), (1, 'c', 'baz')]) df1 = DataFrame({'A': np.ones(12), 'B': np.zeros(12)}, index=idx) df2 = DataFrame({'A': [1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1], 'B': [1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1]}) # against regular index expected = DataFrame(False, index=df1.index, columns=df1.columns) result = df1.isin(df2) tm.assert_frame_equal(result, expected) df2.index = idx expected = df2.values.astype(np.bool) expected[:, 1] = ~expected[:, 1] expected = DataFrame(expected, columns=['A', 'B'], index=idx) result = df1.isin(df2) tm.assert_frame_equal(result, expected) def test_isin_empty_datetimelike(self): # GH 15473 df1_ts = DataFrame({'date': pd.to_datetime(['2014-01-01', '2014-01-02'])}) df1_td = DataFrame({'date': [pd.Timedelta(1, 's'), pd.Timedelta(2, 's')]}) df2 = DataFrame({'date': []}) df3 = DataFrame() expected = DataFrame({'date': [False, False]}) result = df1_ts.isin(df2) tm.assert_frame_equal(result, expected) result = df1_ts.isin(df3) tm.assert_frame_equal(result, expected) result = df1_td.isin(df2) tm.assert_frame_equal(result, expected) result = df1_td.isin(df3) tm.assert_frame_equal(result, expected) # ---------------------------------------------------------------------- # Row deduplication def test_drop_duplicates(self): df = DataFrame({'AAA': ['foo', 'bar', 'foo', 'bar', 'foo', 'bar', 'bar', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1, 1, 2, 2, 2, 2, 1, 2], 'D': lrange(8)}) # single column result = df.drop_duplicates('AAA') expected = df[:2] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('AAA', keep='last') expected = df.loc[[6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('AAA', keep=False) expected = df.loc[[]] tm.assert_frame_equal(result, expected) assert len(result) == 0 # multi column expected = df.loc[[0, 1, 2, 3]] result = df.drop_duplicates(np.array(['AAA', 'B'])) tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['AAA', 'B']) tm.assert_frame_equal(result, expected) result = df.drop_duplicates(('AAA', 'B'), keep='last') expected = df.loc[[0, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(('AAA', 'B'), keep=False) expected = df.loc[[0]] tm.assert_frame_equal(result, expected) # consider everything df2 = df.loc[:, ['AAA', 'B', 'C']] result = df2.drop_duplicates() # in this case only expected = df2.drop_duplicates(['AAA', 'B']) tm.assert_frame_equal(result, expected) result = df2.drop_duplicates(keep='last') expected = df2.drop_duplicates(['AAA', 'B'], keep='last') tm.assert_frame_equal(result, expected) result = df2.drop_duplicates(keep=False) expected = df2.drop_duplicates(['AAA', 'B'], keep=False) tm.assert_frame_equal(result, expected) # integers result = df.drop_duplicates('C') expected = df.iloc[[0, 2]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('C', keep='last') expected = df.iloc[[-2, -1]] tm.assert_frame_equal(result, expected) df['E'] = df['C'].astype('int8') result = df.drop_duplicates('E') expected = df.iloc[[0, 2]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('E', keep='last') expected = df.iloc[[-2, -1]] tm.assert_frame_equal(result, expected) # GH 11376 df = pd.DataFrame({'x': [7, 6, 3, 3, 4, 8, 0], 'y': [0, 6, 5, 5, 9, 1, 2]}) expected = df.loc[df.index != 3] tm.assert_frame_equal(df.drop_duplicates(), expected) df = pd.DataFrame([[1, 0], [0, 2]]) tm.assert_frame_equal(df.drop_duplicates(), df) df = pd.DataFrame([[-2, 0], [0, -4]]) tm.assert_frame_equal(df.drop_duplicates(), df) x = np.iinfo(np.int64).max / 3 * 2 df = pd.DataFrame([[-x, x], [0, x + 4]]) tm.assert_frame_equal(df.drop_duplicates(), df) df = pd.DataFrame([[-x, x], [x, x + 4]]) tm.assert_frame_equal(df.drop_duplicates(), df) # GH 11864 df = pd.DataFrame([i] * 9 for i in range(16)) df = df.append([[1] + [0] * 8], ignore_index=True) for keep in ['first', 'last', False]: assert df.duplicated(keep=keep).sum() == 0 @pytest.mark.parametrize('subset', ['a', ['a'], ['a', 'B']]) def test_duplicated_with_misspelled_column_name(self, subset): # GH 19730 df = pd.DataFrame({'A': [0, 0, 1], 'B': [0, 0, 1], 'C': [0, 0, 1]}) with pytest.raises(KeyError): df.duplicated(subset) with pytest.raises(KeyError): df.drop_duplicates(subset) @pytest.mark.slow def test_duplicated_do_not_fail_on_wide_dataframes(self): # gh-21524 # Given the wide dataframe with a lot of columns # with different (important!) values data = {'col_{0:02d}'.format(i): np.random.randint(0, 1000, 30000) for i in range(100)} df = pd.DataFrame(data).T result = df.duplicated() # Then duplicates produce the bool pd.Series as a result # and don't fail during calculation. # Actual values doesn't matter here, though usually # it's all False in this case assert isinstance(result, pd.Series) assert result.dtype == np.bool def test_drop_duplicates_with_duplicate_column_names(self): # GH17836 df = DataFrame([ [1, 2, 5], [3, 4, 6], [3, 4, 7] ], columns=['a', 'a', 'b']) result0 = df.drop_duplicates() tm.assert_frame_equal(result0, df) result1 = df.drop_duplicates('a') expected1 = df[:2] tm.assert_frame_equal(result1, expected1) def test_drop_duplicates_for_take_all(self): df = DataFrame({'AAA': ['foo', 'bar', 'baz', 'bar', 'foo', 'bar', 'qux', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1, 1, 2, 2, 2, 2, 1, 2], 'D': lrange(8)}) # single column result = df.drop_duplicates('AAA') expected = df.iloc[[0, 1, 2, 6]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('AAA', keep='last') expected = df.iloc[[2, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('AAA', keep=False) expected = df.iloc[[2, 6]] tm.assert_frame_equal(result, expected) # multiple columns result = df.drop_duplicates(['AAA', 'B']) expected = df.iloc[[0, 1, 2, 3, 4, 6]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['AAA', 'B'], keep='last') expected = df.iloc[[0, 1, 2, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['AAA', 'B'], keep=False) expected = df.iloc[[0, 1, 2, 6]] tm.assert_frame_equal(result, expected) def test_drop_duplicates_tuple(self): df = DataFrame({('AA', 'AB'): ['foo', 'bar', 'foo', 'bar', 'foo', 'bar', 'bar', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1, 1, 2, 2, 2, 2, 1, 2], 'D': lrange(8)}) # single column result = df.drop_duplicates(('AA', 'AB')) expected = df[:2] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(('AA', 'AB'), keep='last') expected = df.loc[[6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(('AA', 'AB'), keep=False) expected = df.loc[[]] # empty df assert len(result) == 0 tm.assert_frame_equal(result, expected) # multi column expected = df.loc[[0, 1, 2, 3]] result = df.drop_duplicates((('AA', 'AB'), 'B')) tm.assert_frame_equal(result, expected) def test_drop_duplicates_NA(self): # none df = DataFrame({'A': [None, None, 'foo', 'bar', 'foo', 'bar', 'bar', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1.0, np.nan, np.nan, np.nan, 1., 1., 1, 1.], 'D': lrange(8)}) # single column result = df.drop_duplicates('A') expected = df.loc[[0, 2, 3]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('A', keep='last') expected = df.loc[[1, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('A', keep=False) expected = df.loc[[]] # empty df tm.assert_frame_equal(result, expected) assert len(result) == 0 # multi column result = df.drop_duplicates(['A', 'B']) expected = df.loc[[0, 2, 3, 6]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['A', 'B'], keep='last') expected = df.loc[[1, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['A', 'B'], keep=False) expected = df.loc[[6]] tm.assert_frame_equal(result, expected) # nan df = DataFrame({'A': ['foo', 'bar', 'foo', 'bar', 'foo', 'bar', 'bar', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1.0, np.nan, np.nan, np.nan, 1., 1., 1, 1.], 'D': lrange(8)}) # single column result = df.drop_duplicates('C') expected = df[:2] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('C', keep='last') expected = df.loc[[3, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('C', keep=False) expected = df.loc[[]] # empty df tm.assert_frame_equal(result, expected) assert len(result) == 0 # multi column result = df.drop_duplicates(['C', 'B']) expected = df.loc[[0, 1, 2, 4]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['C', 'B'], keep='last') expected = df.loc[[1, 3, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates(['C', 'B'], keep=False) expected = df.loc[[1]] tm.assert_frame_equal(result, expected) def test_drop_duplicates_NA_for_take_all(self): # none df = DataFrame({'A': [None, None, 'foo', 'bar', 'foo', 'baz', 'bar', 'qux'], 'C': [1.0, np.nan, np.nan, np.nan, 1., 2., 3, 1.]}) # single column result = df.drop_duplicates('A') expected = df.iloc[[0, 2, 3, 5, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('A', keep='last') expected = df.iloc[[1, 4, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('A', keep=False) expected = df.iloc[[5, 7]] tm.assert_frame_equal(result, expected) # nan # single column result = df.drop_duplicates('C') expected = df.iloc[[0, 1, 5, 6]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('C', keep='last') expected = df.iloc[[3, 5, 6, 7]] tm.assert_frame_equal(result, expected) result = df.drop_duplicates('C', keep=False) expected = df.iloc[[5, 6]] tm.assert_frame_equal(result, expected) def test_drop_duplicates_inplace(self): orig = DataFrame({'A': ['foo', 'bar', 'foo', 'bar', 'foo', 'bar', 'bar', 'foo'], 'B': ['one', 'one', 'two', 'two', 'two', 'two', 'one', 'two'], 'C': [1, 1, 2, 2, 2, 2, 1, 2], 'D': lrange(8)}) # single column df = orig.copy() df.drop_duplicates('A', inplace=True) expected = orig[:2] result = df tm.assert_frame_equal(result, expected) df = orig.copy() df.drop_duplicates('A', keep='last', inplace=True) expected = orig.loc[[6, 7]] result = df tm.assert_frame_equal(result, expected) df = orig.copy() df.drop_duplicates('A', keep=False, inplace=True) expected = orig.loc[[]] result = df tm.assert_frame_equal(result, expected) assert len(df) == 0 # multi column df = orig.copy() df.drop_duplicates(['A', 'B'], inplace=True) expected = orig.loc[[0, 1, 2, 3]] result = df tm.assert_frame_equal(result, expected) df = orig.copy() df.drop_duplicates(['A', 'B'], keep='last', inplace=True) expected = orig.loc[[0, 5, 6, 7]] result = df tm.assert_frame_equal(result, expected) df = orig.copy() df.drop_duplicates(['A', 'B'], keep=False, inplace=True) expected = orig.loc[[0]] result = df tm.assert_frame_equal(result, expected) # consider everything orig2 = orig.loc[:, ['A', 'B', 'C']].copy() df2 = orig2.copy() df2.drop_duplicates(inplace=True) # in this case only expected = orig2.drop_duplicates(['A', 'B']) result = df2 tm.assert_frame_equal(result, expected) df2 = orig2.copy() df2.drop_duplicates(keep='last', inplace=True) expected = orig2.drop_duplicates(['A', 'B'], keep='last') result = df2 tm.assert_frame_equal(result, expected) df2 = orig2.copy() df2.drop_duplicates(keep=False, inplace=True) expected = orig2.drop_duplicates(['A', 'B'], keep=False) result = df2 tm.assert_frame_equal(result, expected) # Rounding def test_round(self): # GH 2665 # Test that rounding an empty DataFrame does nothing df = DataFrame() tm.assert_frame_equal(df, df.round()) # Here's the test frame we'll be working with df = DataFrame({'col1': [1.123, 2.123, 3.123], 'col2': [1.234, 2.234, 3.234]}) # Default round to integer (i.e. decimals=0) expected_rounded = DataFrame( {'col1': [1., 2., 3.], 'col2': [1., 2., 3.]}) tm.assert_frame_equal(df.round(), expected_rounded) # Round with an integer decimals = 2 expected_rounded = DataFrame({'col1': [1.12, 2.12, 3.12], 'col2': [1.23, 2.23, 3.23]}) tm.assert_frame_equal(df.round(decimals), expected_rounded) # This should also work with np.round (since np.round dispatches to # df.round) tm.assert_frame_equal(np.round(df, decimals), expected_rounded) # Round with a list round_list = [1, 2] with pytest.raises(TypeError): df.round(round_list) # Round with a dictionary expected_rounded = DataFrame( {'col1': [1.1, 2.1, 3.1], 'col2': [1.23, 2.23, 3.23]}) round_dict = {'col1': 1, 'col2': 2} tm.assert_frame_equal(df.round(round_dict), expected_rounded) # Incomplete dict expected_partially_rounded = DataFrame( {'col1': [1.123, 2.123, 3.123], 'col2': [1.2, 2.2, 3.2]}) partial_round_dict = {'col2': 1} tm.assert_frame_equal(df.round(partial_round_dict), expected_partially_rounded) # Dict with unknown elements wrong_round_dict = {'col3': 2, 'col2': 1} tm.assert_frame_equal(df.round(wrong_round_dict), expected_partially_rounded) # float input to `decimals` non_int_round_dict = {'col1': 1, 'col2': 0.5} with pytest.raises(TypeError): df.round(non_int_round_dict) # String input non_int_round_dict = {'col1': 1, 'col2': 'foo'} with pytest.raises(TypeError): df.round(non_int_round_dict) non_int_round_Series = Series(non_int_round_dict) with pytest.raises(TypeError): df.round(non_int_round_Series) # List input non_int_round_dict = {'col1': 1, 'col2': [1, 2]} with pytest.raises(TypeError): df.round(non_int_round_dict) non_int_round_Series = Series(non_int_round_dict) with pytest.raises(TypeError): df.round(non_int_round_Series) # Non integer Series inputs non_int_round_Series = Series(non_int_round_dict) with pytest.raises(TypeError): df.round(non_int_round_Series) non_int_round_Series = Series(non_int_round_dict) with pytest.raises(TypeError): df.round(non_int_round_Series) # Negative numbers negative_round_dict = {'col1': -1, 'col2': -2} big_df = df * 100 expected_neg_rounded = DataFrame( {'col1': [110., 210, 310], 'col2': [100., 200, 300]}) tm.assert_frame_equal(big_df.round(negative_round_dict), expected_neg_rounded) # nan in Series round nan_round_Series = Series({'col1': nan, 'col2': 1}) # TODO(wesm): unused? expected_nan_round = DataFrame({ # noqa 'col1': [1.123, 2.123, 3.123], 'col2': [1.2, 2.2, 3.2]}) with pytest.raises(TypeError): df.round(nan_round_Series) # Make sure this doesn't break existing Series.round tm.assert_series_equal(df['col1'].round(1), expected_rounded['col1']) # named columns # GH 11986 decimals = 2 expected_rounded = DataFrame( {'col1': [1.12, 2.12, 3.12], 'col2': [1.23, 2.23, 3.23]}) df.columns.name = "cols" expected_rounded.columns.name = "cols" tm.assert_frame_equal(df.round(decimals), expected_rounded) # interaction of named columns & series tm.assert_series_equal(df['col1'].round(decimals), expected_rounded['col1']) tm.assert_series_equal(df.round(decimals)['col1'], expected_rounded['col1']) def test_numpy_round(self): # See gh-12600 df = DataFrame([[1.53, 1.36], [0.06, 7.01]]) out = np.round(df, decimals=0) expected = DataFrame([[2., 1.], [0., 7.]]) tm.assert_frame_equal(out, expected) msg = "the 'out' parameter is not supported" with tm.assert_raises_regex(ValueError, msg): np.round(df, decimals=0, out=df) def test_round_mixed_type(self): # GH11885 df = DataFrame({'col1': [1.1, 2.2, 3.3, 4.4], 'col2': ['1', 'a', 'c', 'f'], 'col3': date_range('20111111', periods=4)}) round_0 = DataFrame({'col1': [1., 2., 3., 4.], 'col2': ['1', 'a', 'c', 'f'], 'col3': date_range('20111111', periods=4)}) tm.assert_frame_equal(df.round(), round_0) tm.assert_frame_equal(df.round(1), df) tm.assert_frame_equal(df.round({'col1': 1}), df) tm.assert_frame_equal(df.round({'col1': 0}), round_0) tm.assert_frame_equal(df.round({'col1': 0, 'col2': 1}), round_0) tm.assert_frame_equal(df.round({'col3': 1}), df) def test_round_issue(self): # GH11611 df = pd.DataFrame(np.random.random([3, 3]), columns=['A', 'B', 'C'], index=['first', 'second', 'third']) dfs = pd.concat((df, df), axis=1) rounded = dfs.round() tm.assert_index_equal(rounded.index, dfs.index) decimals = pd.Series([1, 0, 2], index=['A', 'B', 'A']) pytest.raises(ValueError, df.round, decimals) def test_built_in_round(self): if not compat.PY3: pytest.skip("build in round cannot be overridden " "prior to Python 3") # GH11763 # Here's the test frame we'll be working with df = DataFrame( {'col1': [1.123, 2.123, 3.123], 'col2': [1.234, 2.234, 3.234]}) # Default round to integer (i.e. decimals=0) expected_rounded = DataFrame( {'col1': [1., 2., 3.], 'col2': [1., 2., 3.]}) tm.assert_frame_equal(round(df), expected_rounded) def test_pct_change(self): # GH 11150 pnl = DataFrame([np.arange(0, 40, 10), np.arange(0, 40, 10), np.arange( 0, 40, 10)]).astype(np.float64) pnl.iat[1, 0] = np.nan pnl.iat[1, 1] = np.nan pnl.iat[2, 3] = 60 for axis in range(2): expected = pnl.ffill(axis=axis) / pnl.ffill(axis=axis).shift( axis=axis) - 1 result = pnl.pct_change(axis=axis, fill_method='pad') tm.assert_frame_equal(result, expected) # Clip def test_clip(self): median = self.frame.median().median() original = self.frame.copy() capped = self.frame.clip_upper(median) assert not (capped.values > median).any() floored = self.frame.clip_lower(median) assert not (floored.values < median).any() double = self.frame.clip(upper=median, lower=median) assert not (double.values != median).any() # Verify that self.frame was not changed inplace assert (self.frame.values == original.values).all() def test_inplace_clip(self): # GH #15388 median = self.frame.median().median() frame_copy = self.frame.copy() frame_copy.clip_upper(median, inplace=True) assert not (frame_copy.values > median).any() frame_copy = self.frame.copy() frame_copy.clip_lower(median, inplace=True) assert not (frame_copy.values < median).any() frame_copy = self.frame.copy() frame_copy.clip(upper=median, lower=median, inplace=True) assert not (frame_copy.values != median).any() def test_dataframe_clip(self): # GH #2747 df = DataFrame(np.random.randn(1000, 2)) for lb, ub in [(-1, 1), (1, -1)]: clipped_df = df.clip(lb, ub) lb, ub = min(lb, ub), max(ub, lb) lb_mask = df.values <= lb ub_mask = df.values >= ub mask = ~lb_mask & ~ub_mask assert (clipped_df.values[lb_mask] == lb).all() assert (clipped_df.values[ub_mask] == ub).all() assert (clipped_df.values[mask] == df.values[mask]).all() def test_clip_mixed_numeric(self): # TODO(jreback) # clip on mixed integer or floats # with integer clippers coerces to float df = DataFrame({'A': [1, 2, 3], 'B': [1., np.nan, 3.]}) result = df.clip(1, 2) expected = DataFrame({'A': [1, 2, 2.], 'B': [1., np.nan, 2.]}) tm.assert_frame_equal(result, expected, check_like=True) @pytest.mark.parametrize("inplace", [True, False]) def test_clip_against_series(self, inplace): # GH #6966 df = DataFrame(np.random.randn(1000, 2)) lb = Series(np.random.randn(1000)) ub = lb + 1 original = df.copy() clipped_df = df.clip(lb, ub, axis=0, inplace=inplace) if inplace: clipped_df = df for i in range(2): lb_mask = original.iloc[:, i] <= lb ub_mask = original.iloc[:, i] >= ub mask = ~lb_mask & ~ub_mask result = clipped_df.loc[lb_mask, i] tm.assert_series_equal(result, lb[lb_mask], check_names=False) assert result.name == i result = clipped_df.loc[ub_mask, i] tm.assert_series_equal(result, ub[ub_mask], check_names=False) assert result.name == i tm.assert_series_equal(clipped_df.loc[mask, i], df.loc[mask, i]) @pytest.mark.parametrize("inplace", [True, False]) @pytest.mark.parametrize("lower", [[2, 3, 4], np.asarray([2, 3, 4])]) @pytest.mark.parametrize("axis,res", [ (0, [[2., 2., 3.], [4., 5., 6.], [7., 7., 7.]]), (1, [[2., 3., 4.], [4., 5., 6.], [5., 6., 7.]]) ]) def test_clip_against_list_like(self, inplace, lower, axis, res): # GH #15390 original = self.simple.copy(deep=True) result = original.clip(lower=lower, upper=[5, 6, 7], axis=axis, inplace=inplace) expected = pd.DataFrame(res, columns=original.columns, index=original.index) if inplace: result = original tm.assert_frame_equal(result, expected, check_exact=True) @pytest.mark.parametrize("axis", [0, 1, None]) def test_clip_against_frame(self, axis): df = DataFrame(np.random.randn(1000, 2)) lb = DataFrame(np.random.randn(1000, 2)) ub = lb + 1 clipped_df = df.clip(lb, ub, axis=axis) lb_mask = df <= lb ub_mask = df >= ub mask = ~lb_mask & ~ub_mask tm.assert_frame_equal(clipped_df[lb_mask], lb[lb_mask]) tm.assert_frame_equal(clipped_df[ub_mask], ub[ub_mask]) tm.assert_frame_equal(clipped_df[mask], df[mask]) def test_clip_with_na_args(self): """Should process np.nan argument as None """ # GH # 17276 tm.assert_frame_equal(self.frame.clip(np.nan), self.frame) tm.assert_frame_equal(self.frame.clip(upper=[1, 2, np.nan]), self.frame) tm.assert_frame_equal(self.frame.clip(lower=[1, np.nan, 3]), self.frame) tm.assert_frame_equal(self.frame.clip(upper=np.nan, lower=np.nan), self.frame) # Matrix-like def test_dot(self): a = DataFrame(np.random.randn(3, 4), index=['a', 'b', 'c'], columns=['p', 'q', 'r', 's']) b = DataFrame(np.random.randn(4, 2), index=['p', 'q', 'r', 's'], columns=['one', 'two']) result = a.dot(b) expected = DataFrame(np.dot(a.values, b.values), index=['a', 'b', 'c'], columns=['one', 'two']) # Check alignment b1 = b.reindex(index=reversed(b.index)) result = a.dot(b) tm.assert_frame_equal(result, expected) # Check series argument result = a.dot(b['one']) tm.assert_series_equal(result, expected['one'], check_names=False) assert result.name is None result = a.dot(b1['one']) tm.assert_series_equal(result, expected['one'], check_names=False) assert result.name is None # can pass correct-length arrays row = a.iloc[0].values result = a.dot(row) exp = a.dot(a.iloc[0]) tm.assert_series_equal(result, exp) with tm.assert_raises_regex(ValueError, 'Dot product shape mismatch'): a.dot(row[:-1]) a = np.random.rand(1, 5) b = np.random.rand(5, 1) A = DataFrame(a) # TODO(wesm): unused B = DataFrame(b) # noqa # it works result = A.dot(b) # unaligned df = DataFrame(randn(3, 4), index=[1, 2, 3], columns=lrange(4)) df2 = DataFrame(randn(5, 3), index=lrange(5), columns=[1, 2, 3]) with tm.assert_raises_regex(ValueError, 'aligned'): df.dot(df2) @pytest.mark.skipif(not PY35, reason='matmul supported for Python>=3.5') @pytest.mark.xfail( _np_version_under1p12, reason="unpredictable return types under numpy < 1.12") def test_matmul(self): # matmul test is for GH #10259 a = DataFrame(np.random.randn(3, 4), index=['a', 'b', 'c'], columns=['p', 'q', 'r', 's']) b = DataFrame(np.random.randn(4, 2), index=['p', 'q', 'r', 's'], columns=['one', 'two']) # DataFrame @ DataFrame result = operator.matmul(a, b) expected = DataFrame(np.dot(a.values, b.values), index=['a', 'b', 'c'], columns=['one', 'two']) tm.assert_frame_equal(result, expected) # DataFrame @ Series result = operator.matmul(a, b.one) expected = Series(np.dot(a.values, b.one.values), index=['a', 'b', 'c']) tm.assert_series_equal(result, expected) # np.array @ DataFrame result = operator.matmul(a.values, b) expected = np.dot(a.values, b.values) tm.assert_almost_equal(result, expected) # nested list @ DataFrame (__rmatmul__) result = operator.matmul(a.values.tolist(), b) expected = DataFrame(np.dot(a.values, b.values), index=['a', 'b', 'c'], columns=['one', 'two']) tm.assert_almost_equal(result.values, expected.values) # mixed dtype DataFrame @ DataFrame a['q'] = a.q.round().astype(int) result = operator.matmul(a, b) expected = DataFrame(np.dot(a.values, b.values), index=['a', 'b', 'c'], columns=['one', 'two']) tm.assert_frame_equal(result, expected) # different dtypes DataFrame @ DataFrame a = a.astype(int) result = operator.matmul(a, b) expected = DataFrame(np.dot(a.values, b.values), index=['a', 'b', 'c'], columns=['one', 'two']) tm.assert_frame_equal(result, expected) # unaligned df = DataFrame(randn(3, 4), index=[1, 2, 3], columns=lrange(4)) df2 = DataFrame(randn(5, 3), index=lrange(5), columns=[1, 2, 3]) with tm.assert_raises_regex(ValueError, 'aligned'): operator.matmul(df, df2) @pytest.fixture def df_duplicates(): return pd.DataFrame({'a': [1, 2, 3, 4, 4], 'b': [1, 1, 1, 1, 1], 'c': [0, 1, 2, 5, 4]}, index=[0, 0, 1, 1, 1]) @pytest.fixture def df_strings(): return pd.DataFrame({'a': np.random.permutation(10), 'b': list(ascii_lowercase[:10]), 'c': np.random.permutation(10).astype('float64')}) @pytest.fixture def df_main_dtypes(): return pd.DataFrame( {'group': [1, 1, 2], 'int': [1, 2, 3], 'float': [4., 5., 6.], 'string': list('abc'), 'category_string': pd.Series(list('abc')).astype('category'), 'category_int': [7, 8, 9], 'datetime': pd.date_range('20130101', periods=3), 'datetimetz': pd.date_range('20130101', periods=3, tz='US/Eastern'), 'timedelta': pd.timedelta_range('1 s', periods=3, freq='s')}, columns=['group', 'int', 'float', 'string', 'category_string', 'category_int', 'datetime', 'datetimetz', 'timedelta']) class TestNLargestNSmallest(object): dtype_error_msg_template = ("Column {column!r} has dtype {dtype}, cannot " "use method {method!r} with this dtype") # ---------------------------------------------------------------------- # Top / bottom @pytest.mark.parametrize('order', [ ['a'], ['c'], ['a', 'b'], ['a', 'c'], ['b', 'a'], ['b', 'c'], ['a', 'b', 'c'], ['c', 'a', 'b'], ['c', 'b', 'a'], ['b', 'c', 'a'], ['b', 'a', 'c'], # dups! ['b', 'c', 'c']]) @pytest.mark.parametrize('n', range(1, 11)) def test_n(self, df_strings, nselect_method, n, order): # GH10393 df = df_strings if 'b' in order: error_msg = self.dtype_error_msg_template.format( column='b', method=nselect_method, dtype='object') with tm.assert_raises_regex(TypeError, error_msg): getattr(df, nselect_method)(n, order) else: ascending = nselect_method == 'nsmallest' result = getattr(df, nselect_method)(n, order) expected = df.sort_values(order, ascending=ascending).head(n) tm.assert_frame_equal(result, expected) @pytest.mark.parametrize('columns', [ ('group', 'category_string'), ('group', 'string')]) def test_n_error(self, df_main_dtypes, nselect_method, columns): df = df_main_dtypes col = columns[1] error_msg = self.dtype_error_msg_template.format( column=col, method=nselect_method, dtype=df[col].dtype) # escape some characters that may be in the repr error_msg = (error_msg.replace('(', '\\(').replace(")", "\\)") .replace("[", "\\[").replace("]", "\\]")) with tm.assert_raises_regex(TypeError, error_msg): getattr(df, nselect_method)(2, columns) def test_n_all_dtypes(self, df_main_dtypes): df = df_main_dtypes df.nsmallest(2, list(set(df) - {'category_string', 'string'})) df.nlargest(2, list(set(df) - {'category_string', 'string'})) def test_n_identical_values(self): # GH15297 df = pd.DataFrame({'a': [1] * 5, 'b': [1, 2, 3, 4, 5]}) result = df.nlargest(3, 'a') expected = pd.DataFrame( {'a': [1] * 3, 'b': [1, 2, 3]}, index=[0, 1, 2] ) tm.assert_frame_equal(result, expected) result = df.nsmallest(3, 'a') expected = pd.DataFrame({'a': [1] * 3, 'b': [1, 2, 3]}) tm.assert_frame_equal(result, expected) @pytest.mark.parametrize('order', [ ['a', 'b', 'c'], ['c', 'b', 'a'], ['a'], ['b'], ['a', 'b'], ['c', 'b']]) @pytest.mark.parametrize('n', range(1, 6)) def test_n_duplicate_index(self, df_duplicates, n, order): # GH 13412 df = df_duplicates result = df.nsmallest(n, order) expected = df.sort_values(order).head(n) tm.assert_frame_equal(result, expected) result = df.nlargest(n, order) expected = df.sort_values(order, ascending=False).head(n) tm.assert_frame_equal(result, expected) def test_duplicate_keep_all_ties(self): # see gh-16818 df = pd.DataFrame({'a': [5, 4, 4, 2, 3, 3, 3, 3], 'b': [10, 9, 8, 7, 5, 50, 10, 20]}) result = df.nlargest(4, 'a', keep='all') expected = pd.DataFrame({'a': {0: 5, 1: 4, 2: 4, 4: 3, 5: 3, 6: 3, 7: 3}, 'b': {0: 10, 1: 9, 2: 8, 4: 5, 5: 50, 6: 10, 7: 20}}) tm.assert_frame_equal(result, expected) result = df.nsmallest(2, 'a', keep='all') expected = pd.DataFrame({'a': {3: 2, 4: 3, 5: 3, 6: 3, 7: 3}, 'b': {3: 7, 4: 5, 5: 50, 6: 10, 7: 20}}) tm.assert_frame_equal(result, expected) def test_series_broadcasting(self): # smoke test for numpy warnings # GH 16378, GH 16306 df = DataFrame([1.0, 1.0, 1.0]) df_nan = DataFrame({'A': [np.nan, 2.0, np.nan]}) s = Series([1, 1, 1]) s_nan = Series([np.nan, np.nan, 1]) with tm.assert_produces_warning(None): df_nan.clip_lower(s, axis=0) for op in ['lt', 'le', 'gt', 'ge', 'eq', 'ne']: getattr(df, op)(s_nan, axis=0) def test_series_nat_conversion(self): # GH 18521 # Check rank does not mutate DataFrame df = DataFrame(np.random.randn(10, 3), dtype='float64') expected = df.copy() df.rank() result = df tm.assert_frame_equal(result, expected)
pratapvardhan/pandas
pandas/tests/frame/test_analytics.py
Python
bsd-3-clause
94,264
#!/usr/bin/python # Copyright (c) 2014 Wladmir J. van der Laan # Distributed under the MIT/X11 software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. ''' Script to generate list of seed nodes for chainparams.cpp. This script expects two text files in the directory that is passed as an argument: nodes_main.txt nodes_test.txt These files must consist of lines in the format <ip> <ip>:<port> [<ipv6>] [<ipv6>]:<port> <onion>.onion 0xDDBBCCAA (IPv4 little-endian old pnSeeds format) The output will be two data structures with the peers in binary format: static SeedSpec6 pnSeed6_main[]={ ... } static SeedSpec6 pnSeed6_test[]={ ... } These should be pasted into `src/chainparamsseeds.h`. ''' from __future__ import print_function, division from base64 import b32decode from binascii import a2b_hex import sys, os import re # ipv4 in ipv6 prefix pchIPv4 = bytearray([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0xff, 0xff]) # tor-specific ipv6 prefix pchOnionCat = bytearray([0xFD,0x87,0xD8,0x7E,0xEB,0x43]) def name_to_ipv6(addr): if len(addr)>6 and addr.endswith('.onion'): vchAddr = b32decode(addr[0:-6], True) if len(vchAddr) != 16-len(pchOnionCat): raise ValueError('Invalid onion %s' % s) return pchOnionCat + vchAddr elif '.' in addr: # IPv4 return pchIPv4 + bytearray((int(x) for x in addr.split('.'))) elif ':' in addr: # IPv6 sub = [[], []] # prefix, suffix x = 0 addr = addr.split(':') for i,comp in enumerate(addr): if comp == '': if i == 0 or i == (len(addr)-1): # skip empty component at beginning or end continue x += 1 # :: skips to suffix assert(x < 2) else: # two bytes per component val = int(comp, 16) sub[x].append(val >> 8) sub[x].append(val & 0xff) nullbytes = 16 - len(sub[0]) - len(sub[1]) assert((x == 0 and nullbytes == 0) or (x == 1 and nullbytes > 0)) return bytearray(sub[0] + ([0] * nullbytes) + sub[1]) elif addr.startswith('0x'): # IPv4-in-little-endian return pchIPv4 + bytearray(reversed(a2b_hex(addr[2:]))) else: raise ValueError('Could not parse address %s' % addr) def parse_spec(s, defaultport): match = re.match('\[([0-9a-fA-F:]+)\](?::([0-9]+))?$', s) if match: # ipv6 host = match.group(1) port = match.group(2) else: (host,_,port) = s.partition(':') if not port: port = defaultport else: port = int(port) host = name_to_ipv6(host) return (host,port) def process_nodes(g, f, structname, defaultport): g.write('static SeedSpec6 %s[] = {\n' % structname) first = True for line in f: comment = line.find('#') if comment != -1: line = line[0:comment] line = line.strip() if not line: continue if not first: g.write(',\n') first = False (host,port) = parse_spec(line, defaultport) hoststr = ','.join(('0x%02x' % b) for b in host) g.write(' {{%s}, %i}' % (hoststr, port)) g.write('\n};\n') def main(): if len(sys.argv)<2: print(('Usage: %s <path_to_nodes_txt>' % sys.argv[0]), file=sys.stderr) exit(1) g = sys.stdout indir = sys.argv[1] g.write('#ifndef H_CHAINPARAMSSEEDS\n') g.write('#define H_CHAINPARAMSSEEDS\n') g.write('// List of fixed seed nodes for the bitcoin network\n') g.write('// AUTOGENERATED by contrib/devtools/generate-seeds.py\n\n') g.write('// Each line contains a 16-byte IPv6 address and a port.\n') g.write('// IPv4 as well as onion addresses are wrapped inside a IPv6 address accordingly.\n') with open(os.path.join(indir,'nodes_main.txt'),'r') as f: process_nodes(g, f, 'pnSeed6_main', 18154) g.write('\n') with open(os.path.join(indir,'nodes_test.txt'),'r') as f: process_nodes(g, f, 'pnSeed6_test', 25714) g.write('#endif\n') if __name__ == '__main__': main()
VsyncCrypto/Vsync
share/seeds/generate-seeds.py
Python
mit
4,187
import logging from pyvisdk.exceptions import InvalidArgumentError ######################################## # Automatically generated, do not edit. ######################################## log = logging.getLogger(__name__) def DVSNameArrayUplinkPortPolicy(vim, *args, **kwargs): '''The uplink port policy specifies an array of uniform names for the uplink ports across the hosts. The size of the array indicates the number of uplink ports that will be created for each host in the switch.When the names in this array change, the uplink ports on all the hosts are automatically renamed accordingly. Increasing the number of names in the array automatically creates additional uplink ports bearing the added name on each host. Decreasing the number of name automatically deletes the unused uplink ports on each host. Decreasing beyond the number of unused uplink port raises a fault.This policy overrides the portgroup's port naming format, if both are defined and the uplink ports are created in a uplink portgroup.''' obj = vim.client.factory.create('ns0:DVSNameArrayUplinkPortPolicy') # do some validation checking... if (len(args) + len(kwargs)) < 1: raise IndexError('Expected at least 2 arguments got: %d' % len(args)) required = [ 'uplinkPortName' ] optional = [ 'dynamicProperty', 'dynamicType' ] for name, arg in zip(required+optional, args): setattr(obj, name, arg) for name, value in kwargs.items(): if name in required + optional: setattr(obj, name, value) else: raise InvalidArgumentError("Invalid argument: %s. Expected one of %s" % (name, ", ".join(required + optional))) return obj
xuru/pyvisdk
pyvisdk/do/dvs_name_array_uplink_port_policy.py
Python
mit
1,743
# Copyright 2016 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Utility module that contains APIs usable in the generated code.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function from tensorflow.contrib.autograph.utils.builtins import dynamic_builtin from tensorflow.contrib.autograph.utils.builtins import dynamic_print from tensorflow.contrib.autograph.utils.builtins import dynamic_range from tensorflow.contrib.autograph.utils.context_managers import control_dependency_on_returns from tensorflow.contrib.autograph.utils.misc import alias_tensors from tensorflow.contrib.autograph.utils.multiple_dispatch import dynamic_is from tensorflow.contrib.autograph.utils.multiple_dispatch import dynamic_is_not from tensorflow.contrib.autograph.utils.multiple_dispatch import run_cond from tensorflow.contrib.autograph.utils.py_func import wrap_py_func from tensorflow.contrib.autograph.utils.tensor_list import dynamic_list_append from tensorflow.contrib.autograph.utils.testing import fake_tf from tensorflow.contrib.autograph.utils.type_check import is_tensor from tensorflow.contrib.autograph.utils.type_hints import set_element_type
nburn42/tensorflow
tensorflow/contrib/autograph/utils/__init__.py
Python
apache-2.0
1,825
import struct import sys import tempfile import unittest from mock import Mock, patch from nose.tools import eq_ from beehive.formatter import formatters from beehive.formatter import pretty # from beehive.formatter import tags from beehive.formatter.base import StreamOpener from beehive.model import Tag, Feature, Match, Scenario, Step class TestGetTerminalSize(unittest.TestCase): def setUp(self): try: self.ioctl_patch = patch('fcntl.ioctl') self.ioctl = self.ioctl_patch.start() except ImportError: self.ioctl_patch = None self.ioctl = None self.zero_struct = struct.pack('HHHH', 0, 0, 0, 0) def tearDown(self): if self.ioctl_patch: self.ioctl_patch.stop() def test_windows_fallback(self): platform = sys.platform sys.platform = 'windows' eq_(pretty.get_terminal_size(), (80, 24)) sys.platform = platform def test_termios_fallback(self): try: import termios assert termios return except ImportError: pass eq_(pretty.get_terminal_size(), (80, 24)) def test_exception_in_ioctl(self): try: import termios except ImportError: return def raiser(*args, **kwargs): raise Exception('yeehar!') self.ioctl.side_effect = raiser eq_(pretty.get_terminal_size(), (80, 24)) self.ioctl.assert_called_with(0, termios.TIOCGWINSZ, self.zero_struct) def test_happy_path(self): try: import termios except ImportError: return self.ioctl.return_value = struct.pack('HHHH', 17, 23, 5, 5) eq_(pretty.get_terminal_size(), (23, 17)) self.ioctl.assert_called_with(0, termios.TIOCGWINSZ, self.zero_struct) def test_zero_size_fallback(self): try: import termios except ImportError: return self.ioctl.return_value = self.zero_struct eq_(pretty.get_terminal_size(), (80, 24)) self.ioctl.assert_called_with(0, termios.TIOCGWINSZ, self.zero_struct) def _tf(): '''Open a temp file that looks a bunch like stdout. ''' if sys.version_info[0] == 3: # in python3 it's got an encoding and accepts new-style strings return tempfile.TemporaryFile(mode='w', encoding='UTF-8') # pre-python3 it's not got an encoding and accepts encoded data # (old-style strings) return tempfile.TemporaryFile(mode='w') class FormatterTests(unittest.TestCase): formatter_name = "plain" # SANE DEFAULT, overwritten by concrete classes def setUp(self): self.config = Mock() self.config.color = True self.config.outputs = [StreamOpener(stream=sys.stdout)] self.config.format = [self.formatter_name] _line = 0 @property def line(self): self._line += 1 return self._line def _formatter(self, file, config): stream_opener = StreamOpener(stream=file) f = formatters.get_formatter(config, [stream_opener])[0] f.uri('<string>') return f def _feature(self, keyword=u'k\xe9yword', name=u'name', tags=[u'spam', u'ham'], location=u'location', description=[u'description'], scenarios=[], background=None): line = self.line tags = [Tag(tag_name, line) for tag_name in tags] return Feature('<string>', line, keyword, name, tags=tags, description=description, scenarios=scenarios, background=background) def _scenario(self, keyword=u'k\xe9yword', name=u'name', tags=[], steps=[]): line = self.line tags = [Tag(tag_name, line) for tag_name in tags] return Scenario('<string>', line, keyword, name, tags=tags, steps=steps) def _step(self, keyword=u'k\xe9yword', step_type='given', name=u'name', text=None, table=None): line = self.line return Step('<string>', line, keyword, step_type, name, text=text, table=table) def _match(self, arguments=None): def dummy(): pass return Match(dummy, arguments) def test_feature(self): # this test does not actually check the result of the formatting; it # just exists to make sure that formatting doesn't explode in the face of # unicode and stuff p = self._formatter(_tf(), self.config) f = self._feature() p.feature(f) def test_scenario(self): p = self._formatter(_tf(), self.config) f = self._feature() p.feature(f) s = self._scenario() p.scenario(s) def test_step(self): p = self._formatter(_tf(), self.config) f = self._feature() p.feature(f) s = self._scenario() p.scenario(s) s = self._step() p.step(s) p.match(self._match([])) s.status = u'passed' p.result(s) class TestPretty(FormatterTests): formatter_name = 'pretty' class TestPlain(FormatterTests): formatter_name = 'plain' class TestJson(FormatterTests): formatter_name = 'json' class TestTagsCount(FormatterTests): formatter_name = 'tags' def test_tag_counts(self): p = self._formatter(_tf(), self.config) s = self._scenario(tags=[u'ham', u'foo']) f = self._feature(scenarios=[s]) # feature.tags= ham, spam p.feature(f) p.scenario(s) eq_(p.tag_counts, {'ham': [f, s], 'spam': [f], 'foo': [s]}) class MultipleFormattersTests(FormatterTests): formatters = [] def setUp(self): self.config = Mock() self.config.color = True self.config.outputs = [StreamOpener(stream=sys.stdout) for i in self.formatters] self.config.format = self.formatters def _formatters(self, file, config): stream_opener = StreamOpener(stream=file) fs = formatters.get_formatter(config, [stream_opener]) for f in fs: f.uri('<string>') return fs def test_feature(self): # this test does not actually check the result of the formatting; it # just exists to make sure that formatting doesn't explode in the face of # unicode and stuff ps = self._formatters(_tf(), self.config) f = self._feature() for p in ps: p.feature(f) def test_scenario(self): ps = self._formatters(_tf(), self.config) f = self._feature() for p in ps: p.feature(f) s = self._scenario() p.scenario(s) def test_step(self): ps = self._formatters(_tf(), self.config) f = self._feature() for p in ps: p.feature(f) s = self._scenario() p.scenario(s) s = self._step() p.step(s) p.match(self._match([])) s.status = u'passed' p.result(s) class TestPrettyAndPlain(MultipleFormattersTests): formatters = ['pretty', 'plain'] class TestPrettyAndJSON(MultipleFormattersTests): formatters = ['pretty', 'json'] class TestJSONAndPlain(MultipleFormattersTests): formatters = ['json', 'plain']
vrutkovs/beehive
test/test_formatter.py
Python
bsd-2-clause
7,335
# uncompyle6 version 2.9.10 # Python bytecode 2.7 (62211) # Decompiled from: Python 3.6.0b2 (default, Oct 11 2016, 05:27:10) # [GCC 6.2.0 20161005] # Embedded file name: tasking_ur.py import mcl.framework import mcl.tasking class ur: LP_MODULE_ID = 34825 TARGET_MODULE_ID = 34824 LP_RPC_INFO_LIST_DRIVERS = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 1} LP_RPC_INFO_LIST_DATASOURCES = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 2} LP_RPC_INFO_CONNECT = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 3} LP_RPC_INFO_LIST_SERVERS = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 4} LP_RPC_INFO_LIST_DATABASES = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 5} LP_RPC_INFO_LIST_TABLES = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 6} LP_RPC_INFO_LIST_COLUMNS = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 7} LP_RPC_INFO_EXEC = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 8} LP_RPC_INFO_LIST_HANDLES = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 9} LP_RPC_INFO_DISCONNECT = {'buildType': 'Lp','moduleId': LP_MODULE_ID,'ppcId': 10} TARGET_RPC_INFO_LIST_DRIVERS = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 1} TARGET_RPC_INFO_LIST_DATASOURCES = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 2} TARGET_RPC_INFO_CONNECT = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 3} TARGET_RPC_INFO_LIST_SERVERS = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 4} TARGET_RPC_INFO_LIST_DATABASES = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 5} TARGET_RPC_INFO_LIST_TABLES = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 6} TARGET_RPC_INFO_LIST_COLUMNS = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 7} TARGET_RPC_INFO_EXEC = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 8} TARGET_RPC_INFO_LIST_HANDLES = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 9} TARGET_RPC_INFO_DISCONNECT = {'buildType': 'Target','moduleId': TARGET_MODULE_ID,'ppcId': 10} RPC_INFO_DISCONNECT = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_DISCONNECT, LP_RPC_INFO_DISCONNECT]) RPC_INFO_EXEC = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_EXEC, LP_RPC_INFO_EXEC]) RPC_INFO_LIST_COLUMNS = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_COLUMNS, LP_RPC_INFO_LIST_COLUMNS]) RPC_INFO_LIST_DATASOURCES = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_DATASOURCES, LP_RPC_INFO_LIST_DATASOURCES]) RPC_INFO_LIST_SERVERS = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_SERVERS, LP_RPC_INFO_LIST_SERVERS]) RPC_INFO_LIST_DRIVERS = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_DRIVERS, LP_RPC_INFO_LIST_DRIVERS]) RPC_INFO_LIST_DATABASES = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_DATABASES, LP_RPC_INFO_LIST_DATABASES]) RPC_INFO_LIST_TABLES = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_TABLES, LP_RPC_INFO_LIST_TABLES]) RPC_INFO_LIST_HANDLES = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_LIST_HANDLES, LP_RPC_INFO_LIST_HANDLES]) RPC_INFO_CONNECT = mcl.tasking.RpcInfo(mcl.framework.UR, [TARGET_RPC_INFO_CONNECT, LP_RPC_INFO_CONNECT])
DarthMaulware/EquationGroupLeaks
Leak #5 - Lost In Translation/windows/Resources/ScRe/PyScripts/Lib/scre/mca/scre/cmd/sql/tasking_ur.py
Python
unlicense
3,341
#task_H def dijkstra(start, graph): n = len(graph) D = [None] * n D[start] = 0 index = 0 Q = [start] while index < len(Q): v = Q[index] index += 1 for u in graph[v]: if D[u] == None or D[v] + min(graph[v][u]) < D[u]: D[u] = D[v] + min(graph[v][u]) Q.append(u) return D def reverse(graph): n = len(graph) graph_reversed = {x: {} for x, y in zip(range(n), range(n))} for i in range(n): for v in graph[i]: for w in graph[i][v]: add(graph_reversed, v, i, w) def add(graph, a, b, w): if b in graph[a]: grph[a][b].append(w) else: graph[a][b] = [w] def min_vertex(x, D, graph): A = {v: w + D[v] for v, w in zip([u for u in graph[x].keys if D[u] != None], [min(graph[x][u]) for u in graph[x].keys if D[u] != None])} L = list(A.items) min_i = L[0][0] min_v = L[0][1] for v in A: if A[v] < min_v: min_v = A[v] min_i = v return min_i def path(graph, D, s, f): graph = reverse(graph) x = f P = [f] while x != s: x = min_vertex(x, D, graph) P.append(x) return P[-1::-1] n, m, s, f = tuple(map(int, input().split())) graph = {x: {} for x, y in zip(range(n), range(n))} for i in range(m): a, b, w = tuple(map(int, input().split())) add(graph, a, b, w) add(graph, b, a, w) D = dijkstra(s, graph) print(*path(graph, D, s, f))
Senbjorn/mipt_lab_2016
lab_19/task_H.py
Python
gpl-3.0
1,281
from microbit import uart # global constants NOTE_OFF = 0x80 NOTE_ON = 0x90 CONTROLLER_CHANGE = 0xB0 PROGRAM_CHANGE = 0xC0 class MidiOut: def __init__(self, device=None, channel=1): if device is None: self.device = uart self.device.init(baudrate=31250) elif not hasattr(device, 'write'): raise TypeError("device instance must have a 'write' method.") else: self.device = device if channel < 1 or channel > 16: raise ValueError('channel must be an integer between 1..16.') self.channel = channel def send(self, msg): return self.device.write(bytes(msg)) def channel_message(self, command, *data, ch=None): command = (command & 0xf0) | ((ch if ch else self.channel) - 1 & 0xf) msg = [command] + [value & 0x7f for value in data] self.send(msg) def note_off(self, note, velocity=0, ch=None): self.channel_message(NOTE_OFF, note, velocity, ch=ch) def note_on(self, note, velocity=127, ch=None): self.channel_message(NOTE_ON, note, velocity, ch=ch) def control_change(self, control, value, lsb=False, ch=None): self.channel_message(CONTROLLER_CHANGE, control, value >> 7 if lsb else value, ch=ch) if lsb and control < 20: self.channel_message(CONTROLLER_CHANGE, control + 32, value, ch=ch) def program_change(self, program, ch=None): self.channel_message(PROGRAM_CHANGE, program, ch=ch) # ----------------------------------------------------------------------------- # Main script from microbit import button_a, display, sleep while True: if button_a.is_pressed(): display.set_pixel(0, 0, 0) break display.set_pixel(0, 0, 5) sleep(100) display.set_pixel(0, 0, 0) sleep(100) # Initialize UART for MIDI midi = MidiOut() while True: # send NOTE ON for middle C (60) at velocity 100 midi.note_on(60, 100) display.set_pixel(0, 0, 5) sleep(500) display.set_pixel(0, 0, 0) # send NOTE OFF midi.note_off(60) sleep(500)
SpotlightKid/microbit-worldtour-monifa
test_midiout.py
Python
mit
2,125
# -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # -------------------------------------------------------------------------- """ FILE: sample_publish_events_to_a_topic_using_sas_credential_async.py DESCRIPTION: These samples demonstrate sending an EventGrid Event using a shared access signature for authentication. USAGE: python sample_publish_events_to_a_topic_using_sas_credential_async.py Set the environment variables with your own values before running the sample: 1) EVENTGRID_SAS - The access key of your eventgrid account. 2) EVENTGRID_TOPIC_ENDPOINT - The topic hostname. Typically it exists in the format "https://<YOUR-TOPIC-NAME>.<REGION-NAME>.eventgrid.azure.net/api/events". """ import os import asyncio from azure.eventgrid import EventGridEvent from azure.eventgrid.aio import EventGridPublisherClient from azure.core.credentials import AzureSasCredential sas = os.environ["EVENTGRID_SAS"] endpoint = os.environ["EVENTGRID_TOPIC_ENDPOINT"] async def publish(): credential = AzureSasCredential(sas) client = EventGridPublisherClient(endpoint, credential) async with client: await client.send([ EventGridEvent( event_type="Contoso.Items.ItemReceived", data={ "itemSku": "Contoso Item SKU #1" }, subject="Door1", data_version="2.0" ) ]) if __name__ == '__main__': loop = asyncio.get_event_loop() loop.run_until_complete(publish())
Azure/azure-sdk-for-python
sdk/eventgrid/azure-eventgrid/samples/async_samples/sample_publish_events_to_a_topic_using_sas_credential_async.py
Python
mit
1,719
class UserNotFoundException(Exception): ...
SamR1/FitTrackee
fittrackee/users/exceptions.py
Python
agpl-3.0
48
#!/usr/bin/env python # 12.01.2007, c import os.path as op import shutil from optparse import OptionParser import sfepy from sfepy.base.base import * from sfepy.base.conf import ProblemConf, get_standard_keywords from sfepy.fem import ProblemDefinition from sfepy.fem.evaluate import assemble_by_blocks from sfepy.homogenization.phono import transform_plot_data, plot_logs, \ plot_gaps, detect_band_gaps, compute_cat, compute_polarization_angles from sfepy.homogenization.engine import HomogenizationEngine from sfepy.applications import SimpleApp from sfepy.solvers import Solver, eig from sfepy.base.plotutils import plt def make_save_hook( base_name, post_process_hook = None, file_per_var = None ): def save_phono_correctors( state, problem, ir, ic ): problem.save_state( (base_name % (ir, ic)) + '.vtk', state, post_process_hook = post_process_hook, file_per_var = file_per_var ) return save_phono_correctors def try_set_defaults( obj, attr, defaults ): try: values = getattr( obj, attr ) set_defaults( values, defaults ) except: values = defaults return values def report_iw_cat( iw_dir, christoffel ): output( 'incident wave direction:' ) output( iw_dir ) output( 'Christoffel acoustic tensor:' ) output( christoffel ) class AcousticBandGapsApp( SimpleApp ): def process_options( options ): """Application options setup. Sets default values for missing non-compulsory options.""" get = options.get_default_attr clear_cache = get( 'clear_cache', {} ) eigensolver = get( 'eigensolver', 'eig.sgscipy' ) eig_problem = get( 'eig_problem', 'simple' ) schur = get( 'schur', None ) elasticity_contrast = get( 'elasticity_contrast', 1.0 ) scale_epsilon = get( 'scale_epsilon', 1.0 ) incident_wave_dir = get( 'incident_wave_dir', None ) dispersion = get( 'dispersion', 'simple' ) dispersion_conf = get( 'dispersion_conf', None ) homogeneous = get( 'homogeneous', False ) save = get( 'save_eig_vectors', (0, 0) ) eig_range = get( 'eig_range', None ) freq_margins = get( 'freq_margins', (5, 5) ) # Given in per cent. freq_margins = 0.01 * nm.array( freq_margins, dtype = nm.float64 ) fixed_eig_range = get( 'fixed_eig_range', None ) # Given in per cent. freq_step = 0.01 * get( 'freq_step', 5 ) feps = get( 'feps', 1e-8 ) zeps = get( 'zeps', 1e-8 ) teps = get( 'teps', 1e-4 ) teps_rel = get( 'teps_rel', True ) eig_vector_transform = get( 'eig_vector_transform', None ) plot_transform = get( 'plot_transform', None ) plot_transform_wave = get( 'plot_transform_wave', None ) plot_transform_angle = get( 'plot_transform_angle', None ) plot_options = get( 'plot_options', {'show' : True,'legend' : False,} ) fig_name = get( 'fig_name', None ) fig_name_wave = get( 'fig_name_wave', None ) fig_name_angle = get( 'fig_name_angle', None ) aux = { 'resonance' : 'eigenfrequencies', 'masked' : 'masked eigenfrequencies', 'eig_min' : 'min eig($M^*$)', 'eig_mid' : 'mid eig($M^*$)', 'eig_max' : 'max eig($M^*$)', 'y_axis' : 'eigenvalues of mass matrix $M^*$', } plot_labels = try_set_defaults( options, 'plot_labels', aux ) aux = { 'resonance' : 'eigenfrequencies', 'masked' : 'masked eigenfrequencies', 'eig_min' : r'$\kappa$(min)', 'eig_mid' : r'$\kappa$(mid)', 'eig_max' : r'$\kappa$(max)', 'y_axis' : 'polarization angles', } plot_labels_angle = try_set_defaults( options, 'plot_labels_angle', aux ) aux = { 'resonance' : 'eigenfrequencies', 'masked' : 'masked eigenfrequencies', 'eig_min' : r'wave number (min)', 'eig_mid' : r'wave number (mid)', 'eig_max' : r'wave number (max)', 'y_axis' : 'wave numbers', } plot_labels_wave = try_set_defaults( options, 'plot_labels_wave', aux ) plot_rsc = { 'resonance' : {'linewidth' : 0.5, 'color' : 'r', 'linestyle' : '-' }, 'masked' : {'linewidth' : 0.5, 'color' : 'r', 'linestyle' : ':' }, 'x_axis' : {'linewidth' : 0.5, 'color' : 'k', 'linestyle' : '--' }, 'eig_min' : {'linewidth' : 0.5, 'color' : 'b', 'linestyle' : '--' }, 'eig_mid' : {'linewidth' : 0.5, 'color' : 'b', 'linestyle' : '-.' }, 'eig_max' : {'linewidth' : 0.5, 'color' : 'b', 'linestyle' : '-' }, 'strong_gap' : {'linewidth' : 0, 'facecolor' : (1, 1, 0.5) }, 'weak_gap' : {'linewidth' : 0, 'facecolor' : (1, 1, 1) }, 'propagation' : {'linewidth' : 0, 'facecolor' : (0.5, 1, 0.5) }, 'params' : {'axes.labelsize': 'large', 'text.fontsize': 'large', 'legend.fontsize': 'large', 'xtick.labelsize': 'large', 'ytick.labelsize': 'large', 'text.usetex': False}, } plot_rsc = try_set_defaults( options, 'plot_rsc', plot_rsc ) eigenmomentum = get( 'eigenmomentum', None, 'missing "eigenmomentum" in options!' ) region_to_material = get( 'region_to_material', None, 'missing "region_to_material" in options!' ) tensor_names = get( 'tensor_names', None, 'missing "tensor_names" in options!' ) volume = get( 'volume', None, 'missing "volume" in options!' ) if eig_problem == 'simple_liquid': liquid_region = get('liquid_region', None, 'missing "liquid_region" in options!') else: liquid_region = None return Struct( **locals() ) process_options = staticmethod( process_options ) def process_options_pv( options ): """Application options setup for phase velocity computation. Sets default values for missing non-compulsory options.""" get = options.get_default_attr clear_cache = get( 'clear_cache', {} ) eigensolver = get( 'eigensolver', 'eig.sgscipy' ) incident_wave_dir = get( 'incident_wave_dir', None ) dispersion = get( 'dispersion', 'simple' ) dispersion_conf = get( 'dispersion_conf', None ) homogeneous = get( 'homogeneous', False ) fig_suffix = get( 'fig_suffix', '.pdf' ) region_to_material = get( 'region_to_material', None, 'missing "region_to_material" in options!' ) tensor_names = get( 'tensor_names', None, 'missing "tensor_names" in options!' ) volume = get( 'volume', None, 'missing "volume" in options!' ) return Struct( **locals() ) process_options_pv = staticmethod( process_options_pv ) def __init__( self, conf, options, output_prefix, **kwargs ): SimpleApp.__init__( self, conf, options, output_prefix, init_equations = False ) self.setup_options() self.cached_coefs = None self.cached_iw_dir = None self.cached_christoffel = None self.cached_evp = None output_dir = self.problem.output_dir shutil.copyfile( conf._filename, op.join( output_dir, op.basename( conf._filename ) ) ) def setup_options( self ): SimpleApp.setup_options( self ) if self.options.phase_velocity: process_options = AcousticBandGapsApp.process_options_pv else: process_options = AcousticBandGapsApp.process_options self.app_options += process_options( self.conf.options ) def call( self ): """In parametric runs, cached data (homogenized coefficients, Christoffel acoustic tensor and eigenvalue problem solution) are cleared according to 'clear_cache' aplication options. Example: clear_cache = {'cached_christoffel' : True, 'cached_evp' : True} """ options = self.options for key, val in self.app_options.clear_cache.iteritems(): if val and key.startswith('cached_'): setattr(self, key, None) if options.phase_velocity: # No band gaps in this case. return self.compute_phase_velocity() evp = self.solve_eigen_problem() self.fix_eig_range( evp.eigs.shape[0] ) if options.detect_band_gaps: bg = detect_band_gaps( self.problem, evp.kind, evp.eigs_rescaled, evp.eig_vectors, self.app_options, self.conf.funmod ) if options.plot: plot_range, teigs = transform_plot_data( bg.logs.eigs, bg.opts.plot_transform, self.conf.funmod ) plot_rsc = bg.opts.plot_rsc plot_opts = bg.opts.plot_options plot_labels = bg.opts.plot_labels plt.rcParams.update( plot_rsc['params'] ) fig = plot_gaps( 1, plot_rsc, bg.gaps, bg.kinds, bg.freq_range_margins, plot_range, clear = True ) fig = plot_logs( 1, plot_rsc, plot_labels, bg.logs.freqs, teigs, bg.valid[bg.eig_range], bg.freq_range_initial, plot_range, False, show_legend = plot_opts['legend'], new_axes = True ) fig_name = bg.opts.fig_name if fig_name is not None: fig.savefig( fig_name ) if plot_opts['show']: plt.show() elif options.analyze_dispersion: christoffel, iw_dir = self.compute_cat(ret_iw_dir=True) bg = detect_band_gaps( self.problem, evp.kind, evp.eigs_rescaled, evp.eig_vectors, self.app_options, self.conf.funmod, christoffel = christoffel ) output( 'computing polarization angles...' ) pas = compute_polarization_angles( iw_dir, bg.logs.eig_vectors ) output( '...done' ) bg.polarization_angles = pas output( 'computing phase velocity...' ) bg.phase_velocity = self.compute_phase_velocity() output( '...done' ) if options.plot: plot_rsc = bg.opts.plot_rsc plot_opts = bg.opts.plot_options plt.rcParams.update( plot_rsc['params'] ) aux = transform_plot_data( pas, bg.opts.plot_transform_angle, self.conf.funmod ) plot_range, pas = aux plot_labels = bg.opts.plot_labels_angle fig = plot_gaps( 1, plot_rsc, bg.gaps, bg.kinds, bg.freq_range_margins, plot_range, clear = True ) fig = plot_logs( 1, plot_rsc, plot_labels, bg.logs.freqs, pas, bg.valid[bg.eig_range], bg.freq_range_initial, plot_range, False, show_legend = plot_opts['legend'], new_axes = True ) fig_name = bg.opts.fig_name_angle if fig_name is not None: fig.savefig( fig_name ) aux = transform_plot_data( bg.logs.eigs, bg.opts.plot_transform_wave, self.conf.funmod ) plot_range, teigs = aux plot_labels = bg.opts.plot_labels_wave fig = plot_gaps( 2, plot_rsc, bg.gaps, bg.kinds, bg.freq_range_margins, plot_range, clear = True ) fig = plot_logs( 2, plot_rsc, plot_labels, bg.logs.freqs, teigs, bg.valid[bg.eig_range], bg.freq_range_initial, plot_range, False, show_legend = plot_opts['legend'], new_axes = True ) fig_name = bg.opts.fig_name_wave if fig_name is not None: fig.savefig( fig_name ) if plot_opts['show']: plt.show() else: bg = None return evp, bg def fix_eig_range( self, n_eigs ): eig_range = get_default( self.app_options.eig_range, (0, n_eigs) ) if eig_range[-1] < 0: eig_range[-1] += n_eigs + 1 assert_( eig_range[0] < (eig_range[1] - 1) ) assert_( eig_range[1] <= n_eigs ) self.app_options.eig_range = eig_range def solve_eigen_problem( self, ofn_trunk = None, post_process_hook = None ): if self.cached_evp is not None: return self.cached_evp problem = self.problem ofn_trunk = get_default( ofn_trunk, problem.ofn_trunk, 'output file name trunk missing!' ) post_process_hook = get_default( post_process_hook, self.post_process_hook ) conf = self.conf eig_problem = self.app_options.eig_problem if eig_problem in ['simple', 'simple_liquid']: problem.set_equations( conf.equations ) problem.time_update() mtx_a = problem.evaluate(conf.equations['lhs'], mode='weak', auto_init=True, dw_mode='matrix') mtx_m = problem.evaluate(conf.equations['rhs'], mode='weak', dw_mode='matrix') elif eig_problem == 'schur': # A = K + B^T D^{-1} B. mtx = assemble_by_blocks( conf.equations, self.problem, ebcs = conf.ebcs, epbcs = conf.epbcs ) problem.set_equations( conf.equations ) problem.time_update() ls = Solver.any_from_conf( problem.ls_conf, presolve = True, mtx = mtx['D'] ) mtx_b, mtx_m = mtx['B'], mtx['M'] mtx_dib = nm.empty( mtx_b.shape, dtype = mtx_b.dtype ) for ic in xrange( mtx_b.shape[1] ): mtx_dib[:,ic] = ls( mtx_b[:,ic].toarray().squeeze() ) mtx_a = mtx['K'] + mtx_b.T * mtx_dib else: raise NotImplementedError ## from sfepy.base.plotutils import spy, plt ## spy( mtx_b, eps = 1e-12 ) ## plt.show() ## mtx_a.save( 'a.txt', format='%d %d %.12f\n' ) ## mtx_b.save( 'b.txt', format='%d %d %.12f\n' ) ## pause() output( 'computing resonance frequencies...' ) tt = [0] if isinstance( mtx_a, sc.sparse.spmatrix ): mtx_a = mtx_a.toarray() if isinstance( mtx_m, sc.sparse.spmatrix ): mtx_m = mtx_m.toarray() eigs, mtx_s_phi = eig(mtx_a, mtx_m, return_time=tt, method=self.app_options.eigensolver) eigs[eigs<0.0] = 0.0 output( '...done in %.2f s' % tt[0] ) output( 'original eigenfrequencies:' ) output( eigs ) opts = self.app_options epsilon2 = opts.scale_epsilon * opts.scale_epsilon eigs_rescaled = (opts.elasticity_contrast / epsilon2) * eigs output( 'rescaled eigenfrequencies:' ) output( eigs_rescaled ) output( 'number of eigenfrequencies: %d' % eigs.shape[0] ) try: assert_( nm.isfinite( eigs ).all() ) except ValueError: debug() # B-orthogonality check. ## print nm.dot( mtx_s_phi[:,5], nm.dot( mtx_m, mtx_s_phi[:,5] ) ) ## print nm.dot( mtx_s_phi[:,5], nm.dot( mtx_m, mtx_s_phi[:,0] ) ) ## debug() n_eigs = eigs.shape[0] variables = problem.get_variables() mtx_phi = nm.empty( (variables.di.ptr[-1], mtx_s_phi.shape[1]), dtype = nm.float64 ) make_full = variables.make_full_vec if eig_problem in ['simple', 'simple_liquid']: for ii in xrange( n_eigs ): mtx_phi[:,ii] = make_full( mtx_s_phi[:,ii] ) eig_vectors = mtx_phi elif eig_problem == 'schur': # Update also eliminated variables. schur = self.app_options.schur primary_var = schur['primary_var'] eliminated_var = schur['eliminated_var'] mtx_s_phi_schur = - sc.dot( mtx_dib, mtx_s_phi ) aux = nm.empty( (variables.adi.ptr[-1],), dtype = nm.float64 ) set = variables.set_state_part for ii in xrange( n_eigs ): set( aux, mtx_s_phi[:,ii], primary_var, stripped = True ) set( aux, mtx_s_phi_schur[:,ii], eliminated_var, stripped = True ) mtx_phi[:,ii] = make_full( aux ) indx = variables.get_indx( primary_var ) eig_vectors = mtx_phi[indx,:] save = self.app_options.save out = {} for ii in xrange( n_eigs ): if (ii >= save[0]) and (ii < (n_eigs - save[1])): continue aux = problem.state_to_output( mtx_phi[:,ii] ) for name, val in aux.iteritems(): out[name+'%03d' % ii] = val if post_process_hook is not None: out = post_process_hook( out, problem, mtx_phi ) problem.domain.mesh.write( ofn_trunk + '.vtk', io = 'auto', out = out ) fd = open( ofn_trunk + '_eigs.txt', 'w' ) eigs.tofile( fd, ' ' ) fd.close() evp = Struct( kind = eig_problem, eigs = eigs, eigs_rescaled = eigs_rescaled, eig_vectors = eig_vectors ) self.cached_evp = evp return evp def eval_homogenized_coefs( self ): if self.cached_coefs is not None: return self.cached_coefs opts = self.app_options if opts.homogeneous: rtm = opts.region_to_material mat_region = rtm.keys()[0] mat_name = rtm[mat_region] self.problem.update_materials() mat = self.problem.materials[mat_name] coefs = mat.get_data( mat_region, 0, opts.tensor_names ) else: dc = opts.dispersion_conf dconf = ProblemConf.from_dict( dc['input'], dc['module'] ) dconf.materials = self.conf.materials dconf.fe = self.conf.fe dconf.regions.update( self.conf.regions ) dconf.options['output_dir'] = self.problem.output_dir volume = opts.volume(self.problem, 'Y') problem = ProblemDefinition.from_conf(dconf, init_equations=False) he = HomogenizationEngine( problem, self.options, volume = volume ) coefs = he() ## print coefs ## pause() output.prefix = self.output_prefix self.cached_coefs = coefs return coefs def compute_cat( self, ret_iw_dir=False ): """Compute the Christoffel acoustic tensor, given the incident wave direction.""" opts = self.app_options iw_dir = nm.array( opts.incident_wave_dir, dtype = nm.float64 ) dim = self.problem.get_dim() assert_( dim == iw_dir.shape[0] ) iw_dir = iw_dir / nla.norm( iw_dir ) if self.cached_christoffel is not None: christoffel = self.cached_christoffel else: coefs = self.eval_homogenized_coefs() christoffel = compute_cat( coefs, iw_dir, self.app_options.dispersion ) report_iw_cat( iw_dir, christoffel ) self.cached_christoffel = christoffel if ret_iw_dir: return christoffel, iw_dir else: return christoffel def compute_phase_velocity( self ): from sfepy.homogenization.phono import compute_density_volume_info opts = self.app_options dim = self.problem.domain.mesh.dim christoffel = self.compute_cat() self.problem.update_materials() dv_info = compute_density_volume_info( self.problem, opts.volume, opts.region_to_material ) output( 'average density:', dv_info.average_density ) eye = nm.eye( dim, dim, dtype = nm.float64 ) mtx_mass = eye * dv_info.average_density meigs, mvecs = eig( mtx_mass, mtx_b = christoffel, eigenvectors = True, method = opts.eigensolver ) phase_velocity = 1.0 / nm.sqrt( meigs ) return phase_velocity usage = """%prog [options] filename_in""" help = { 'filename' : 'basename of output file(s) [default: <basename of input file>]', 'detect_band_gaps' : 'detect frequency band gaps', 'analyze_dispersion' : 'analyze dispersion properties (low frequency domain)', 'plot' : 'plot frequency band gaps, assumes -b', 'phase_velocity' : 'compute phase velocity (frequency-independet mass only)' } def main(): parser = OptionParser(usage = usage, version = "%prog " + sfepy.__version__) parser.add_option( "-o", "", metavar = 'filename', action = "store", dest = "output_filename_trunk", default = None, help = help['filename'] ) parser.add_option( "-b", "--band-gaps", action = "store_true", dest = "detect_band_gaps", default = False, help = help['detect_band_gaps'] ) parser.add_option( "-d", "--dispersion", action = "store_true", dest = "analyze_dispersion", default = False, help = help['analyze_dispersion'] ) parser.add_option( "-p", "--plot", action = "store_true", dest = "plot", default = False, help = help['plot'] ) parser.add_option( "--phase-velocity", action = "store_true", dest = "phase_velocity", default = False, help = help['phase_velocity'] ) options, args = parser.parse_args() if options.plot: if plt is None: output( 'matplotlib.pyplot cannot be imported, ignoring option -p!' ) options.plot = False elif options.analyze_dispersion == False: options.detect_band_gaps = True if (len( args ) == 1): filename_in = args[0]; else: parser.print_help(), return required, other = get_standard_keywords() required.remove( 'solver_[0-9]+|solvers' ) if options.phase_velocity: required.remove( 'ebc_[0-9]+|ebcs' ) required.remove( 'equations' ) conf = ProblemConf.from_file( filename_in, required, other ) app = AcousticBandGapsApp( conf, options, 'eigen:' ) opts = conf.options if hasattr( opts, 'parametric_hook' ): # Parametric study. parametric_hook = getattr( conf, opts.parametric_hook ) app.parametrize( parametric_hook ) app() if __name__ == '__main__': ## mtx_k = io.read_sparse_matrix_hdf5( '1todo/K.h5', output_format = 'csr' ) ## print mtx_k.__repr__() ## mtx_m = io.read_sparse_matrix_hdf5( '1todo/M.h5', output_format = 'csr' ) ## print mtx_m.__repr__() ## mtx_k.save( 'k.txt', format='%d %d %.12f\n' ) ## mtx_m.save( 'm.txt', format='%d %d %.12f\n' ) ## eigs, mtx_s_phi = eig( mtx_k.toarray(), mtx_m.toarray(), ## print_time = True ) ## print eigs ## eigs, aux = eig( mtx_m.toarray(), ## print_time = True ) ## print eigs ## pause() main()
olivierverdier/sfepy
eigen.py
Python
bsd-3-clause
24,663
#!/usr/bin/python # # Copyright (C) 2011 Google Inc. # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, but # WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA # 02110-1301, USA. """Script for testing ganeti.hypervisor.hv_lxc""" import unittest from ganeti import constants from ganeti import objects from ganeti import hypervisor from ganeti.hypervisor import hv_lxc import testutils class TestConsole(unittest.TestCase): def test(self): instance = objects.Instance(name="lxc.example.com", primary_node="node199-uuid") node = objects.Node(name="node199", uuid="node199-uuid", ndparams={}) group = objects.NodeGroup(name="group991", ndparams={}) cons = hv_lxc.LXCHypervisor.GetInstanceConsole(instance, node, group, {}, {}) self.assertTrue(cons.Validate()) self.assertEqual(cons.kind, constants.CONS_SSH) self.assertEqual(cons.host, node.name) self.assertEqual(cons.command[-1], instance.name) if __name__ == "__main__": testutils.GanetiTestProgram()
badp/ganeti
test/py/ganeti.hypervisor.hv_lxc_unittest.py
Python
gpl-2.0
1,688
# # Vagoth Cluster Management Framework # Copyright (C) 2013 Robert Thomson # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA # """ Actions are called by the job scheduler to perform tasks. They contain a dictionary of arguments, but will be called with an instance of Vagoth's Manager as the first argument. """ from ..exceptions import ActionException from .. import get_manager from .. import transaction import logging Manager = get_manager() Allocator = Manager.config.make_factory("virt/allocator", context=Manager) def log_vm_action(vm_name, action, msg=None): """ Call logging.info(), using transaction.get_txid() and .get_source() along with the VM name and the message, if any. """ txid = transaction.get_txid() source = transaction.get_source() if msg: logging.info("vagoth: txid={0} source={1} action={2} vm={3}: {4}".format(txid, source, action, vm_name, msg)) else: logging.info("vagoth: txid={0} source={1} action={2} vm={3}".format(txid, source, action, vm_name)) def vm_define(manager, vm_name, hint=None, **kwargs): """ If a VM isn't allocated to a hypervisor node, it will allocate it to a hypervisor node using the `Allocator`, and call driver.define(hypervisor, vm) """ global Allocator log_vm_action(vm_name, "define") vm = manager.get_node(vm_name) node = vm.parent if node: return Allocator.allocate(vm, hint) vm.refresh() node = vm.parent if node: vm.state = "defined" node.driver.define(node, vm) def vm_provision(manager, vm_name, hint=None, **kwargs): """ If a VM isn't allocated to a hypervisor node, it will allocate it to a hypervisor node using the `Allocator`, and call driver.provision(hypervisor, vm) """ global Allocator log_vm_action(vm_name, "provision") vm = manager.get_node(vm_name) node = vm.parent if node: return Allocator.allocate(vm, hint) vm.refresh() node = vm.parent if node: vm.state = "defined" node.driver.define(node, vm) def vm_start(manager, vm_name, **kwargs): """ If a VM isn't allocated to a hypervisor node, it will call the vm_define action, and if that worked, call driver.start(hypervisor, vm) """ log_vm_action(vm_name, "start") vm = manager.get_node(vm_name) node = vm.parent if not node: manager.action("vm_define", vm_name=vm_name, **kwargs) vm.refresh() # pick up state change node = vm.parent if node: vm.state = "starting" node.driver.start(node, vm) else: raise ActionException("VM not assigned") def vm_stop(manager, vm_name, **kwargs): """ call driver.stop(hypervisor, vm) """ log_vm_action(vm_name, "stop") vm = manager.get_node(vm_name) node = vm.parent if node: vm.state = "stopping" node.driver.stop(node, vm) def vm_shutdown(manager, vm_name, **kwargs): """ call driver.stop(hypervisor, vm) """ log_vm_action(vm_name, "stop") vm = manager.get_node(vm_name) node = vm.parent if node: vm.state = "shutting down" node.driver.shutdown(node, vm) def vm_reboot(manager, vm_name, **kwargs): """ call driver.reboot(hypervisor, vm) """ log_vm_action(vm_name, "reboot") vm = manager.get_node(vm_name) node = vm.parent if node: vm.state = "rebooting" node.driver.reboot(node, vm) def vm_undefine(manager, vm_name): """ call driver.undefine(hypervisor, vm) """ log_vm_action(vm_name, "undefine") vm = manager.get_node(vm_name) node = vm.parent if not node: return node.driver.undefine(node, vm) def vm_deprovision(manager, vm_name): """ call driver.deprovision(hypervisor, vm) """ log_vm_action(vm_name, "deprovision") vm = manager.get_node(vm_name) node = vm.parent if not node: return node.driver.deprovision(node, vm) def vm_poll(manager, **kwargs): """ instantiate the monitor and poll all nodes """ monitor = Manager.config.make_factory("virt/monitor", context=Manager) monitor.poll_nodes()
sippeproject/vagoth
vagoth/virt/actions.py
Python
lgpl-2.1
4,887
# This file is part of Tryton. The COPYRIGHT file at the top level of # this repository contains the full copyright notices and license terms. from trytond.pool import Pool, PoolMeta __metaclass__ = PoolMeta __all__ = ['Sale'] class Sale: __name__ = 'sale.sale' @property def invoice_grouping_method(self): return self.party.sale_invoice_grouping_method @property def _invoice_grouping_fields(self): return ('state', 'company', 'type', 'journal', 'party', 'invoice_address', 'currency', 'account', 'payment_term') def _get_grouped_invoice_order(self): "Returns the order clause used to find invoice that should be grouped" return None def _get_grouped_invoice_domain(self, invoice): "Returns a domain that will find invoices that should be grouped" Invoice = Pool().get('account.invoice') invoice_domain = [ ('lines.origin', 'like', 'sale.line,%'), ] defaults = Invoice.default_get(self._invoice_grouping_fields, with_rec_name=False) for field in self._invoice_grouping_fields: invoice_domain.append( (field, '=', getattr(invoice, field, defaults.get(field))) ) return invoice_domain def _get_invoice_sale(self, invoice_type): Invoice = Pool().get('account.invoice') invoice = super(Sale, self)._get_invoice_sale(invoice_type) if self.invoice_grouping_method: domain = self._get_grouped_invoice_domain(invoice) order = self._get_grouped_invoice_order() grouped_invoices = Invoice.search(domain, order=order, limit=1) if grouped_invoices: invoice, = grouped_invoices return invoice
kret0s/gnuhealth-live
tryton/server/trytond-3.8.3/trytond/modules/sale_invoice_grouping/sale.py
Python
gpl-3.0
1,791
# coding: utf-8 """ Qc API Qc API # noqa: E501 The version of the OpenAPI document: 3.0.0 Contact: [email protected] Generated by: https://openapi-generator.tech """ import pprint import re # noqa: F401 import six from telestream_cloud_qc.configuration import Configuration class AudioChannelsTest(object): """NOTE: This class is auto generated by OpenAPI Generator. Ref: https://openapi-generator.tech Do not edit the class manually. """ """ Attributes: openapi_types (dict): The key is attribute name and the value is attribute type. attribute_map (dict): The key is attribute name and the value is json key in definition. """ openapi_types = { 'number_of_channels': 'int', 'reject_on_error': 'bool', 'checked': 'bool' } attribute_map = { 'number_of_channels': 'number_of_channels', 'reject_on_error': 'reject_on_error', 'checked': 'checked' } def __init__(self, number_of_channels=None, reject_on_error=None, checked=None, local_vars_configuration=None): # noqa: E501 """AudioChannelsTest - a model defined in OpenAPI""" # noqa: E501 if local_vars_configuration is None: local_vars_configuration = Configuration() self.local_vars_configuration = local_vars_configuration self._number_of_channels = None self._reject_on_error = None self._checked = None self.discriminator = None if number_of_channels is not None: self.number_of_channels = number_of_channels if reject_on_error is not None: self.reject_on_error = reject_on_error if checked is not None: self.checked = checked @property def number_of_channels(self): """Gets the number_of_channels of this AudioChannelsTest. # noqa: E501 :return: The number_of_channels of this AudioChannelsTest. # noqa: E501 :rtype: int """ return self._number_of_channels @number_of_channels.setter def number_of_channels(self, number_of_channels): """Sets the number_of_channels of this AudioChannelsTest. :param number_of_channels: The number_of_channels of this AudioChannelsTest. # noqa: E501 :type: int """ self._number_of_channels = number_of_channels @property def reject_on_error(self): """Gets the reject_on_error of this AudioChannelsTest. # noqa: E501 :return: The reject_on_error of this AudioChannelsTest. # noqa: E501 :rtype: bool """ return self._reject_on_error @reject_on_error.setter def reject_on_error(self, reject_on_error): """Sets the reject_on_error of this AudioChannelsTest. :param reject_on_error: The reject_on_error of this AudioChannelsTest. # noqa: E501 :type: bool """ self._reject_on_error = reject_on_error @property def checked(self): """Gets the checked of this AudioChannelsTest. # noqa: E501 :return: The checked of this AudioChannelsTest. # noqa: E501 :rtype: bool """ return self._checked @checked.setter def checked(self, checked): """Sets the checked of this AudioChannelsTest. :param checked: The checked of this AudioChannelsTest. # noqa: E501 :type: bool """ self._checked = checked def to_dict(self): """Returns the model properties as a dict""" result = {} for attr, _ in six.iteritems(self.openapi_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value return result def to_str(self): """Returns the string representation of the model""" return pprint.pformat(self.to_dict()) def __repr__(self): """For `print` and `pprint`""" return self.to_str() def __eq__(self, other): """Returns true if both objects are equal""" if not isinstance(other, AudioChannelsTest): return False return self.to_dict() == other.to_dict() def __ne__(self, other): """Returns true if both objects are not equal""" if not isinstance(other, AudioChannelsTest): return True return self.to_dict() != other.to_dict()
Telestream/telestream-cloud-python-sdk
telestream_cloud_qc_sdk/telestream_cloud_qc/models/audio_channels_test.py
Python
mit
5,000
from __future__ import division, print_function, absolute_import import itertools from numpy.testing import (assert_, assert_equal, assert_almost_equal, assert_array_almost_equal, assert_array_equal, assert_allclose) from pytest import raises as assert_raises from numpy import mgrid, pi, sin, ogrid, poly1d, linspace import numpy as np from scipy._lib.six import xrange from scipy._lib._numpy_compat import _assert_warns, suppress_warnings from scipy.interpolate import (interp1d, interp2d, lagrange, PPoly, BPoly, splrep, splev, splantider, splint, sproot, Akima1DInterpolator, RegularGridInterpolator, LinearNDInterpolator, NearestNDInterpolator, RectBivariateSpline, interpn, NdPPoly, BSpline) from scipy.special import poch, gamma from scipy.interpolate import _ppoly from scipy._lib._gcutils import assert_deallocated from scipy.integrate import nquad from scipy.special import binom class TestInterp2D(object): def test_interp2d(self): y, x = mgrid[0:2:20j, 0:pi:21j] z = sin(x+0.5*y) I = interp2d(x, y, z) assert_almost_equal(I(1.0, 2.0), sin(2.0), decimal=2) v,u = ogrid[0:2:24j, 0:pi:25j] assert_almost_equal(I(u.ravel(), v.ravel()), sin(u+0.5*v), decimal=2) def test_interp2d_meshgrid_input(self): # Ticket #703 x = linspace(0, 2, 16) y = linspace(0, pi, 21) z = sin(x[None,:] + y[:,None]/2.) I = interp2d(x, y, z) assert_almost_equal(I(1.0, 2.0), sin(2.0), decimal=2) def test_interp2d_meshgrid_input_unsorted(self): np.random.seed(1234) x = linspace(0, 2, 16) y = linspace(0, pi, 21) z = sin(x[None,:] + y[:,None]/2.) ip1 = interp2d(x.copy(), y.copy(), z, kind='cubic') np.random.shuffle(x) z = sin(x[None,:] + y[:,None]/2.) ip2 = interp2d(x.copy(), y.copy(), z, kind='cubic') np.random.shuffle(x) np.random.shuffle(y) z = sin(x[None,:] + y[:,None]/2.) ip3 = interp2d(x, y, z, kind='cubic') x = linspace(0, 2, 31) y = linspace(0, pi, 30) assert_equal(ip1(x, y), ip2(x, y)) assert_equal(ip1(x, y), ip3(x, y)) def test_interp2d_eval_unsorted(self): y, x = mgrid[0:2:20j, 0:pi:21j] z = sin(x + 0.5*y) func = interp2d(x, y, z) xe = np.array([3, 4, 5]) ye = np.array([5.3, 7.1]) assert_allclose(func(xe, ye), func(xe, ye[::-1])) assert_raises(ValueError, func, xe, ye[::-1], 0, 0, True) def test_interp2d_linear(self): # Ticket #898 a = np.zeros([5, 5]) a[2, 2] = 1.0 x = y = np.arange(5) b = interp2d(x, y, a, 'linear') assert_almost_equal(b(2.0, 1.5), np.array([0.5]), decimal=2) assert_almost_equal(b(2.0, 2.5), np.array([0.5]), decimal=2) def test_interp2d_bounds(self): x = np.linspace(0, 1, 5) y = np.linspace(0, 2, 7) z = x[None, :]**2 + y[:, None] ix = np.linspace(-1, 3, 31) iy = np.linspace(-1, 3, 33) b = interp2d(x, y, z, bounds_error=True) assert_raises(ValueError, b, ix, iy) b = interp2d(x, y, z, fill_value=np.nan) iz = b(ix, iy) mx = (ix < 0) | (ix > 1) my = (iy < 0) | (iy > 2) assert_(np.isnan(iz[my,:]).all()) assert_(np.isnan(iz[:,mx]).all()) assert_(np.isfinite(iz[~my,:][:,~mx]).all()) class TestInterp1D(object): def setup_method(self): self.x5 = np.arange(5.) self.x10 = np.arange(10.) self.y10 = np.arange(10.) self.x25 = self.x10.reshape((2,5)) self.x2 = np.arange(2.) self.y2 = np.arange(2.) self.x1 = np.array([0.]) self.y1 = np.array([0.]) self.y210 = np.arange(20.).reshape((2, 10)) self.y102 = np.arange(20.).reshape((10, 2)) self.y225 = np.arange(20.).reshape((2, 2, 5)) self.y25 = np.arange(10.).reshape((2, 5)) self.y235 = np.arange(30.).reshape((2, 3, 5)) self.y325 = np.arange(30.).reshape((3, 2, 5)) self.fill_value = -100.0 def test_validation(self): # Make sure that appropriate exceptions are raised when invalid values # are given to the constructor. # These should all work. for kind in ('nearest', 'zero', 'linear', 'slinear', 'quadratic', 'cubic'): interp1d(self.x10, self.y10, kind=kind) interp1d(self.x10, self.y10, kind=kind, fill_value="extrapolate") interp1d(self.x10, self.y10, kind='linear', fill_value=(-1, 1)) interp1d(self.x10, self.y10, kind='linear', fill_value=np.array([-1])) interp1d(self.x10, self.y10, kind='linear', fill_value=(-1,)) interp1d(self.x10, self.y10, kind='linear', fill_value=-1) interp1d(self.x10, self.y10, kind='linear', fill_value=(-1, -1)) interp1d(self.x10, self.y10, kind=0) interp1d(self.x10, self.y10, kind=1) interp1d(self.x10, self.y10, kind=2) interp1d(self.x10, self.y10, kind=3) interp1d(self.x10, self.y210, kind='linear', axis=-1, fill_value=(-1, -1)) interp1d(self.x2, self.y210, kind='linear', axis=0, fill_value=np.ones(10)) interp1d(self.x2, self.y210, kind='linear', axis=0, fill_value=(np.ones(10), np.ones(10))) interp1d(self.x2, self.y210, kind='linear', axis=0, fill_value=(np.ones(10), -1)) # x array must be 1D. assert_raises(ValueError, interp1d, self.x25, self.y10) # y array cannot be a scalar. assert_raises(ValueError, interp1d, self.x10, np.array(0)) # Check for x and y arrays having the same length. assert_raises(ValueError, interp1d, self.x10, self.y2) assert_raises(ValueError, interp1d, self.x2, self.y10) assert_raises(ValueError, interp1d, self.x10, self.y102) interp1d(self.x10, self.y210) interp1d(self.x10, self.y102, axis=0) # Check for x and y having at least 1 element. assert_raises(ValueError, interp1d, self.x1, self.y10) assert_raises(ValueError, interp1d, self.x10, self.y1) assert_raises(ValueError, interp1d, self.x1, self.y1) # Bad fill values assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=(-1, -1, -1)) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=[-1, -1, -1]) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=np.array((-1, -1, -1))) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=[[-1]]) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=[-1, -1]) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=np.array([])) # doesn't broadcast assert_raises(ValueError, interp1d, self.x10, self.y10, kind='linear', fill_value=()) # doesn't broadcast assert_raises(ValueError, interp1d, self.x2, self.y210, kind='linear', axis=0, fill_value=[-1, -1]) # doesn't broadcast assert_raises(ValueError, interp1d, self.x2, self.y210, kind='linear', axis=0, fill_value=(0., [-1, -1])) # above doesn't bc def test_init(self): # Check that the attributes are initialized appropriately by the # constructor. assert_(interp1d(self.x10, self.y10).copy) assert_(not interp1d(self.x10, self.y10, copy=False).copy) assert_(interp1d(self.x10, self.y10).bounds_error) assert_(not interp1d(self.x10, self.y10, bounds_error=False).bounds_error) assert_(np.isnan(interp1d(self.x10, self.y10).fill_value)) assert_equal(interp1d(self.x10, self.y10, fill_value=3.0).fill_value, 3.0) assert_equal(interp1d(self.x10, self.y10, fill_value=(1.0, 2.0)).fill_value, (1.0, 2.0)) assert_equal(interp1d(self.x10, self.y10).axis, 0) assert_equal(interp1d(self.x10, self.y210).axis, 1) assert_equal(interp1d(self.x10, self.y102, axis=0).axis, 0) assert_array_equal(interp1d(self.x10, self.y10).x, self.x10) assert_array_equal(interp1d(self.x10, self.y10).y, self.y10) assert_array_equal(interp1d(self.x10, self.y210).y, self.y210) def test_assume_sorted(self): # Check for unsorted arrays interp10 = interp1d(self.x10, self.y10) interp10_unsorted = interp1d(self.x10[::-1], self.y10[::-1]) assert_array_almost_equal(interp10_unsorted(self.x10), self.y10) assert_array_almost_equal(interp10_unsorted(1.2), np.array([1.2])) assert_array_almost_equal(interp10_unsorted([2.4, 5.6, 6.0]), interp10([2.4, 5.6, 6.0])) # Check assume_sorted keyword (defaults to False) interp10_assume_kw = interp1d(self.x10[::-1], self.y10[::-1], assume_sorted=False) assert_array_almost_equal(interp10_assume_kw(self.x10), self.y10) interp10_assume_kw2 = interp1d(self.x10[::-1], self.y10[::-1], assume_sorted=True) # Should raise an error for unsorted input if assume_sorted=True assert_raises(ValueError, interp10_assume_kw2, self.x10) # Check that if y is a 2-D array, things are still consistent interp10_y_2d = interp1d(self.x10, self.y210) interp10_y_2d_unsorted = interp1d(self.x10[::-1], self.y210[:, ::-1]) assert_array_almost_equal(interp10_y_2d(self.x10), interp10_y_2d_unsorted(self.x10)) def test_linear(self): for kind in ['linear', 'slinear']: self._check_linear(kind) def _check_linear(self, kind): # Check the actual implementation of linear interpolation. interp10 = interp1d(self.x10, self.y10, kind=kind) assert_array_almost_equal(interp10(self.x10), self.y10) assert_array_almost_equal(interp10(1.2), np.array([1.2])) assert_array_almost_equal(interp10([2.4, 5.6, 6.0]), np.array([2.4, 5.6, 6.0])) # test fill_value="extrapolate" extrapolator = interp1d(self.x10, self.y10, kind=kind, fill_value='extrapolate') assert_allclose(extrapolator([-1., 0, 9, 11]), [-1, 0, 9, 11], rtol=1e-14) opts = dict(kind=kind, fill_value='extrapolate', bounds_error=True) assert_raises(ValueError, interp1d, self.x10, self.y10, **opts) def test_linear_dtypes(self): # regression test for gh-5898, where 1D linear interpolation has been # delegated to numpy.interp for all float dtypes, and the latter was # not handling e.g. np.float128. for dtyp in np.sctypes["float"]: x = np.arange(8, dtype=dtyp) y = x yp = interp1d(x, y, kind='linear')(x) assert_equal(yp.dtype, dtyp) assert_allclose(yp, y, atol=1e-15) def test_slinear_dtypes(self): # regression test for gh-7273: 1D slinear interpolation fails with # float32 inputs dt_r = [np.float16, np.float32, np.float64] dt_rc = dt_r + [np.complex64, np.complex128] spline_kinds = ['slinear', 'zero', 'quadratic', 'cubic'] for dtx in dt_r: x = np.arange(0, 10, dtype=dtx) for dty in dt_rc: y = np.exp(-x/3.0).astype(dty) for dtn in dt_r: xnew = x.astype(dtn) for kind in spline_kinds: f = interp1d(x, y, kind=kind, bounds_error=False) assert_allclose(f(xnew), y, atol=1e-7, err_msg="%s, %s %s" % (dtx, dty, dtn)) def test_cubic(self): # Check the actual implementation of spline interpolation. interp10 = interp1d(self.x10, self.y10, kind='cubic') assert_array_almost_equal(interp10(self.x10), self.y10) assert_array_almost_equal(interp10(1.2), np.array([1.2])) assert_array_almost_equal(interp10([2.4, 5.6, 6.0]), np.array([2.4, 5.6, 6.0]),) def test_nearest(self): # Check the actual implementation of nearest-neighbour interpolation. interp10 = interp1d(self.x10, self.y10, kind='nearest') assert_array_almost_equal(interp10(self.x10), self.y10) assert_array_almost_equal(interp10(1.2), np.array(1.)) assert_array_almost_equal(interp10([2.4, 5.6, 6.0]), np.array([2., 6., 6.]),) # test fill_value="extrapolate" extrapolator = interp1d(self.x10, self.y10, kind='nearest', fill_value='extrapolate') assert_allclose(extrapolator([-1., 0, 9, 11]), [0, 0, 9, 9], rtol=1e-14) opts = dict(kind='nearest', fill_value='extrapolate', bounds_error=True) assert_raises(ValueError, interp1d, self.x10, self.y10, **opts) def test_zero(self): # Check the actual implementation of zero-order spline interpolation. interp10 = interp1d(self.x10, self.y10, kind='zero') assert_array_almost_equal(interp10(self.x10), self.y10) assert_array_almost_equal(interp10(1.2), np.array(1.)) assert_array_almost_equal(interp10([2.4, 5.6, 6.0]), np.array([2., 5., 6.])) def _bounds_check(self, kind='linear'): # Test that our handling of out-of-bounds input is correct. extrap10 = interp1d(self.x10, self.y10, fill_value=self.fill_value, bounds_error=False, kind=kind) assert_array_equal(extrap10(11.2), np.array(self.fill_value)) assert_array_equal(extrap10(-3.4), np.array(self.fill_value)) assert_array_equal(extrap10([[[11.2], [-3.4], [12.6], [19.3]]]), np.array(self.fill_value),) assert_array_equal(extrap10._check_bounds( np.array([-1.0, 0.0, 5.0, 9.0, 11.0])), np.array([[True, False, False, False, False], [False, False, False, False, True]])) raises_bounds_error = interp1d(self.x10, self.y10, bounds_error=True, kind=kind) assert_raises(ValueError, raises_bounds_error, -1.0) assert_raises(ValueError, raises_bounds_error, 11.0) raises_bounds_error([0.0, 5.0, 9.0]) def _bounds_check_int_nan_fill(self, kind='linear'): x = np.arange(10).astype(np.int_) y = np.arange(10).astype(np.int_) c = interp1d(x, y, kind=kind, fill_value=np.nan, bounds_error=False) yi = c(x - 1) assert_(np.isnan(yi[0])) assert_array_almost_equal(yi, np.r_[np.nan, y[:-1]]) def test_bounds(self): for kind in ('linear', 'cubic', 'nearest', 'slinear', 'zero', 'quadratic'): self._bounds_check(kind) self._bounds_check_int_nan_fill(kind) def _check_fill_value(self, kind): interp = interp1d(self.x10, self.y10, kind=kind, fill_value=(-100, 100), bounds_error=False) assert_array_almost_equal(interp(10), 100) assert_array_almost_equal(interp(-10), -100) assert_array_almost_equal(interp([-10, 10]), [-100, 100]) # Proper broadcasting: # interp along axis of length 5 # other dim=(2, 3), (3, 2), (2, 2), or (2,) # one singleton fill_value (works for all) for y in (self.y235, self.y325, self.y225, self.y25): interp = interp1d(self.x5, y, kind=kind, axis=-1, fill_value=100, bounds_error=False) assert_array_almost_equal(interp(10), 100) assert_array_almost_equal(interp(-10), 100) assert_array_almost_equal(interp([-10, 10]), 100) # singleton lower, singleton upper interp = interp1d(self.x5, y, kind=kind, axis=-1, fill_value=(-100, 100), bounds_error=False) assert_array_almost_equal(interp(10), 100) assert_array_almost_equal(interp(-10), -100) if y.ndim == 3: result = [[[-100, 100]] * y.shape[1]] * y.shape[0] else: result = [[-100, 100]] * y.shape[0] assert_array_almost_equal(interp([-10, 10]), result) # one broadcastable (3,) fill_value fill_value = [100, 200, 300] for y in (self.y325, self.y225): assert_raises(ValueError, interp1d, self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) interp = interp1d(self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), [[100, 200, 300]] * 2) assert_array_almost_equal(interp(-10), [[100, 200, 300]] * 2) assert_array_almost_equal(interp([-10, 10]), [[[100, 100], [200, 200], [300, 300]]] * 2) # one broadcastable (2,) fill_value fill_value = [100, 200] assert_raises(ValueError, interp1d, self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for y in (self.y225, self.y325, self.y25): interp = interp1d(self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) result = [100, 200] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp(10), result) assert_array_almost_equal(interp(-10), result) result = [[100, 100], [200, 200]] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp([-10, 10]), result) # broadcastable (3,) lower, singleton upper fill_value = (np.array([-100, -200, -300]), 100) for y in (self.y325, self.y225): assert_raises(ValueError, interp1d, self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) interp = interp1d(self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), 100) assert_array_almost_equal(interp(-10), [[-100, -200, -300]] * 2) assert_array_almost_equal(interp([-10, 10]), [[[-100, 100], [-200, 100], [-300, 100]]] * 2) # broadcastable (2,) lower, singleton upper fill_value = (np.array([-100, -200]), 100) assert_raises(ValueError, interp1d, self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for y in (self.y225, self.y325, self.y25): interp = interp1d(self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), 100) result = [-100, -200] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp(-10), result) result = [[-100, 100], [-200, 100]] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp([-10, 10]), result) # broadcastable (3,) lower, broadcastable (3,) upper fill_value = ([-100, -200, -300], [100, 200, 300]) for y in (self.y325, self.y225): assert_raises(ValueError, interp1d, self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for ii in range(2): # check ndarray as well as list here if ii == 1: fill_value = tuple(np.array(f) for f in fill_value) interp = interp1d(self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), [[100, 200, 300]] * 2) assert_array_almost_equal(interp(-10), [[-100, -200, -300]] * 2) assert_array_almost_equal(interp([-10, 10]), [[[-100, 100], [-200, 200], [-300, 300]]] * 2) # broadcastable (2,) lower, broadcastable (2,) upper fill_value = ([-100, -200], [100, 200]) assert_raises(ValueError, interp1d, self.x5, self.y235, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for y in (self.y325, self.y225, self.y25): interp = interp1d(self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) result = [100, 200] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp(10), result) result = [-100, -200] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp(-10), result) result = [[-100, 100], [-200, 200]] if y.ndim == 3: result = [result] * y.shape[0] assert_array_almost_equal(interp([-10, 10]), result) # one broadcastable (2, 2) array-like fill_value = [[100, 200], [1000, 2000]] for y in (self.y235, self.y325, self.y25): assert_raises(ValueError, interp1d, self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for ii in range(2): if ii == 1: fill_value = np.array(fill_value) interp = interp1d(self.x5, self.y225, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), [[100, 200], [1000, 2000]]) assert_array_almost_equal(interp(-10), [[100, 200], [1000, 2000]]) assert_array_almost_equal(interp([-10, 10]), [[[100, 100], [200, 200]], [[1000, 1000], [2000, 2000]]]) # broadcastable (2, 2) lower, broadcastable (2, 2) upper fill_value = ([[-100, -200], [-1000, -2000]], [[100, 200], [1000, 2000]]) for y in (self.y235, self.y325, self.y25): assert_raises(ValueError, interp1d, self.x5, y, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) for ii in range(2): if ii == 1: fill_value = (np.array(fill_value[0]), np.array(fill_value[1])) interp = interp1d(self.x5, self.y225, kind=kind, axis=-1, fill_value=fill_value, bounds_error=False) assert_array_almost_equal(interp(10), [[100, 200], [1000, 2000]]) assert_array_almost_equal(interp(-10), [[-100, -200], [-1000, -2000]]) assert_array_almost_equal(interp([-10, 10]), [[[-100, 100], [-200, 200]], [[-1000, 1000], [-2000, 2000]]]) def test_fill_value(self): # test that two-element fill value works for kind in ('linear', 'nearest', 'cubic', 'slinear', 'quadratic', 'zero'): self._check_fill_value(kind) def test_fill_value_writeable(self): # backwards compat: fill_value is a public writeable attribute interp = interp1d(self.x10, self.y10, fill_value=123.0) assert_equal(interp.fill_value, 123.0) interp.fill_value = 321.0 assert_equal(interp.fill_value, 321.0) def _nd_check_interp(self, kind='linear'): # Check the behavior when the inputs and outputs are multidimensional. # Multidimensional input. interp10 = interp1d(self.x10, self.y10, kind=kind) assert_array_almost_equal(interp10(np.array([[3., 5.], [2., 7.]])), np.array([[3., 5.], [2., 7.]])) # Scalar input -> 0-dim scalar array output assert_(isinstance(interp10(1.2), np.ndarray)) assert_equal(interp10(1.2).shape, ()) # Multidimensional outputs. interp210 = interp1d(self.x10, self.y210, kind=kind) assert_array_almost_equal(interp210(1.), np.array([1., 11.])) assert_array_almost_equal(interp210(np.array([1., 2.])), np.array([[1., 2.], [11., 12.]])) interp102 = interp1d(self.x10, self.y102, axis=0, kind=kind) assert_array_almost_equal(interp102(1.), np.array([2.0, 3.0])) assert_array_almost_equal(interp102(np.array([1., 3.])), np.array([[2., 3.], [6., 7.]])) # Both at the same time! x_new = np.array([[3., 5.], [2., 7.]]) assert_array_almost_equal(interp210(x_new), np.array([[[3., 5.], [2., 7.]], [[13., 15.], [12., 17.]]])) assert_array_almost_equal(interp102(x_new), np.array([[[6., 7.], [10., 11.]], [[4., 5.], [14., 15.]]])) def _nd_check_shape(self, kind='linear'): # Check large ndim output shape a = [4, 5, 6, 7] y = np.arange(np.prod(a)).reshape(*a) for n, s in enumerate(a): x = np.arange(s) z = interp1d(x, y, axis=n, kind=kind) assert_array_almost_equal(z(x), y, err_msg=kind) x2 = np.arange(2*3*1).reshape((2,3,1)) / 12. b = list(a) b[n:n+1] = [2,3,1] assert_array_almost_equal(z(x2).shape, b, err_msg=kind) def test_nd(self): for kind in ('linear', 'cubic', 'slinear', 'quadratic', 'nearest', 'zero'): self._nd_check_interp(kind) self._nd_check_shape(kind) def _check_complex(self, dtype=np.complex_, kind='linear'): x = np.array([1, 2.5, 3, 3.1, 4, 6.4, 7.9, 8.0, 9.5, 10]) y = x * x ** (1 + 2j) y = y.astype(dtype) # simple test c = interp1d(x, y, kind=kind) assert_array_almost_equal(y[:-1], c(x)[:-1]) # check against interpolating real+imag separately xi = np.linspace(1, 10, 31) cr = interp1d(x, y.real, kind=kind) ci = interp1d(x, y.imag, kind=kind) assert_array_almost_equal(c(xi).real, cr(xi)) assert_array_almost_equal(c(xi).imag, ci(xi)) def test_complex(self): for kind in ('linear', 'nearest', 'cubic', 'slinear', 'quadratic', 'zero'): self._check_complex(np.complex64, kind) self._check_complex(np.complex128, kind) def test_circular_refs(self): # Test interp1d can be automatically garbage collected x = np.linspace(0, 1) y = np.linspace(0, 1) # Confirm interp can be released from memory after use with assert_deallocated(interp1d, x, y) as interp: new_y = interp([0.1, 0.2]) del interp def test_overflow_nearest(self): # Test that the x range doesn't overflow when given integers as input x = np.array([0, 50, 127], dtype=np.int8) ii = interp1d(x, x, kind='nearest') assert_array_almost_equal(ii(x), x) def test_local_nans(self): # check that for local interpolation kinds (slinear, zero) a single nan # only affects its local neighborhood x = np.arange(10).astype(float) y = x.copy() y[6] = np.nan for kind in ('zero', 'slinear'): ir = interp1d(x, y, kind=kind) vals = ir([4.9, 7.0]) assert_(np.isfinite(vals).all()) def test_spline_nans(self): # Backwards compat: a single nan makes the whole spline interpolation # return nans in an array of the correct shape. And it doesn't raise, # just quiet nans because of backcompat. x = np.arange(8).astype(float) y = x.copy() yn = y.copy() yn[3] = np.nan for kind in ['quadratic', 'cubic']: ir = interp1d(x, y, kind=kind) irn = interp1d(x, yn, kind=kind) for xnew in (6, [1, 6], [[1, 6], [3, 5]]): xnew = np.asarray(xnew) out, outn = ir(x), irn(x) assert_(np.isnan(outn).all()) assert_equal(out.shape, outn.shape) class TestLagrange(object): def test_lagrange(self): p = poly1d([5,2,1,4,3]) xs = np.arange(len(p.coeffs)) ys = p(xs) pl = lagrange(xs,ys) assert_array_almost_equal(p.coeffs,pl.coeffs) class TestAkima1DInterpolator(object): def test_eval(self): x = np.arange(0., 11.) y = np.array([0., 2., 1., 3., 2., 6., 5.5, 5.5, 2.7, 5.1, 3.]) ak = Akima1DInterpolator(x, y) xi = np.array([0., 0.5, 1., 1.5, 2.5, 3.5, 4.5, 5.1, 6.5, 7.2, 8.6, 9.9, 10.]) yi = np.array([0., 1.375, 2., 1.5, 1.953125, 2.484375, 4.1363636363636366866103344, 5.9803623910336236590978842, 5.5067291516462386624652936, 5.2031367459745245795943447, 4.1796554159017080820603951, 3.4110386597938129327189927, 3.]) assert_allclose(ak(xi), yi) def test_eval_2d(self): x = np.arange(0., 11.) y = np.array([0., 2., 1., 3., 2., 6., 5.5, 5.5, 2.7, 5.1, 3.]) y = np.column_stack((y, 2. * y)) ak = Akima1DInterpolator(x, y) xi = np.array([0., 0.5, 1., 1.5, 2.5, 3.5, 4.5, 5.1, 6.5, 7.2, 8.6, 9.9, 10.]) yi = np.array([0., 1.375, 2., 1.5, 1.953125, 2.484375, 4.1363636363636366866103344, 5.9803623910336236590978842, 5.5067291516462386624652936, 5.2031367459745245795943447, 4.1796554159017080820603951, 3.4110386597938129327189927, 3.]) yi = np.column_stack((yi, 2. * yi)) assert_allclose(ak(xi), yi) def test_eval_3d(self): x = np.arange(0., 11.) y_ = np.array([0., 2., 1., 3., 2., 6., 5.5, 5.5, 2.7, 5.1, 3.]) y = np.empty((11, 2, 2)) y[:, 0, 0] = y_ y[:, 1, 0] = 2. * y_ y[:, 0, 1] = 3. * y_ y[:, 1, 1] = 4. * y_ ak = Akima1DInterpolator(x, y) xi = np.array([0., 0.5, 1., 1.5, 2.5, 3.5, 4.5, 5.1, 6.5, 7.2, 8.6, 9.9, 10.]) yi = np.empty((13, 2, 2)) yi_ = np.array([0., 1.375, 2., 1.5, 1.953125, 2.484375, 4.1363636363636366866103344, 5.9803623910336236590978842, 5.5067291516462386624652936, 5.2031367459745245795943447, 4.1796554159017080820603951, 3.4110386597938129327189927, 3.]) yi[:, 0, 0] = yi_ yi[:, 1, 0] = 2. * yi_ yi[:, 0, 1] = 3. * yi_ yi[:, 1, 1] = 4. * yi_ assert_allclose(ak(xi), yi) def test_degenerate_case_multidimensional(self): # This test is for issue #5683. x = np.array([0, 1, 2]) y = np.vstack((x, x**2)).T ak = Akima1DInterpolator(x, y) x_eval = np.array([0.5, 1.5]) y_eval = ak(x_eval) assert_allclose(y_eval, np.vstack((x_eval, x_eval**2)).T) def test_extend(self): x = np.arange(0., 11.) y = np.array([0., 2., 1., 3., 2., 6., 5.5, 5.5, 2.7, 5.1, 3.]) ak = Akima1DInterpolator(x, y) try: ak.extend(None, None) except NotImplementedError as e: if str(e) != ("Extending a 1D Akima interpolator is not " "yet implemented"): raise except: raise class TestPPolyCommon(object): # test basic functionality for PPoly and BPoly def test_sort_check(self): c = np.array([[1, 4], [2, 5], [3, 6]]) x = np.array([0, 1, 0.5]) assert_raises(ValueError, PPoly, c, x) assert_raises(ValueError, BPoly, c, x) def test_ctor_c(self): # wrong shape: `c` must be at least 2-dimensional with assert_raises(ValueError): PPoly([1, 2], [0, 1]) def test_extend(self): # Test adding new points to the piecewise polynomial np.random.seed(1234) order = 3 x = np.unique(np.r_[0, 10 * np.random.rand(30), 10]) c = 2*np.random.rand(order+1, len(x)-1, 2, 3) - 1 for cls in (PPoly, BPoly): pp = cls(c[:,:9], x[:10]) pp.extend(c[:,9:], x[10:]) pp2 = cls(c[:, 10:], x[10:]) pp2.extend(c[:, :10], x[:10]) pp3 = cls(c, x) assert_array_equal(pp.c, pp3.c) assert_array_equal(pp.x, pp3.x) assert_array_equal(pp2.c, pp3.c) assert_array_equal(pp2.x, pp3.x) def test_extend_diff_orders(self): # Test extending polynomial with different order one np.random.seed(1234) x = np.linspace(0, 1, 6) c = np.random.rand(2, 5) x2 = np.linspace(1, 2, 6) c2 = np.random.rand(4, 5) for cls in (PPoly, BPoly): pp1 = cls(c, x) pp2 = cls(c2, x2) pp_comb = cls(c, x) pp_comb.extend(c2, x2[1:]) # NB. doesn't match to pp1 at the endpoint, because pp1 is not # continuous with pp2 as we took random coefs. xi1 = np.linspace(0, 1, 300, endpoint=False) xi2 = np.linspace(1, 2, 300) assert_allclose(pp1(xi1), pp_comb(xi1)) assert_allclose(pp2(xi2), pp_comb(xi2)) def test_extend_descending(self): np.random.seed(0) order = 3 x = np.sort(np.random.uniform(0, 10, 20)) c = np.random.rand(order + 1, x.shape[0] - 1, 2, 3) for cls in (PPoly, BPoly): p = cls(c, x) p1 = cls(c[:, :9], x[:10]) p1.extend(c[:, 9:], x[10:]) p2 = cls(c[:, 10:], x[10:]) p2.extend(c[:, :10], x[:10]) assert_array_equal(p1.c, p.c) assert_array_equal(p1.x, p.x) assert_array_equal(p2.c, p.c) assert_array_equal(p2.x, p.x) def test_shape(self): np.random.seed(1234) c = np.random.rand(8, 12, 5, 6, 7) x = np.sort(np.random.rand(13)) xp = np.random.rand(3, 4) for cls in (PPoly, BPoly): p = cls(c, x) assert_equal(p(xp).shape, (3, 4, 5, 6, 7)) # 'scalars' for cls in (PPoly, BPoly): p = cls(c[..., 0, 0, 0], x) assert_equal(np.shape(p(0.5)), ()) assert_equal(np.shape(p(np.array(0.5))), ()) # can't use dtype=object (with any numpy; what fails is # constructing the object array here for old numpy) assert_raises(ValueError, p, np.array([[0.1, 0.2], [0.4]])) def test_complex_coef(self): np.random.seed(12345) x = np.sort(np.random.random(13)) c = np.random.random((8, 12)) * (1. + 0.3j) c_re, c_im = c.real, c.imag xp = np.random.random(5) for cls in (PPoly, BPoly): p, p_re, p_im = cls(c, x), cls(c_re, x), cls(c_im, x) for nu in [0, 1, 2]: assert_allclose(p(xp, nu).real, p_re(xp, nu)) assert_allclose(p(xp, nu).imag, p_im(xp, nu)) def test_axis(self): np.random.seed(12345) c = np.random.rand(3, 4, 5, 6, 7, 8) c_s = c.shape xp = np.random.random((1, 2)) for axis in (0, 1, 2, 3): k, m = c.shape[axis], c.shape[axis+1] x = np.sort(np.random.rand(m+1)) for cls in (PPoly, BPoly): p = cls(c, x, axis=axis) assert_equal(p.c.shape, c_s[axis:axis+2] + c_s[:axis] + c_s[axis+2:]) res = p(xp) targ_shape = c_s[:axis] + xp.shape + c_s[2+axis:] assert_equal(res.shape, targ_shape) # deriv/antideriv does not drop the axis for p1 in [cls(c, x, axis=axis).derivative(), cls(c, x, axis=axis).derivative(2), cls(c, x, axis=axis).antiderivative(), cls(c, x, axis=axis).antiderivative(2)]: assert_equal(p1.axis, p.axis) # c array needs two axes for the coefficients and intervals, so # 0 <= axis < c.ndim-1; raise otherwise for axis in (-1, 4, 5, 6): for cls in (BPoly, PPoly): assert_raises(ValueError, cls, **dict(c=c, x=x, axis=axis)) class TestPolySubclassing(object): class P(PPoly): pass class B(BPoly): pass def _make_polynomials(self): np.random.seed(1234) x = np.sort(np.random.random(3)) c = np.random.random((4, 2)) return self.P(c, x), self.B(c, x) def test_derivative(self): pp, bp = self._make_polynomials() for p in (pp, bp): pd = p.derivative() assert_equal(p.__class__, pd.__class__) ppa = pp.antiderivative() assert_equal(pp.__class__, ppa.__class__) def test_from_spline(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0) pp = self.P.from_spline(spl) assert_equal(pp.__class__, self.P) def test_conversions(self): pp, bp = self._make_polynomials() pp1 = self.P.from_bernstein_basis(bp) assert_equal(pp1.__class__, self.P) bp1 = self.B.from_power_basis(pp) assert_equal(bp1.__class__, self.B) def test_from_derivatives(self): x = [0, 1, 2] y = [[1], [2], [3]] bp = self.B.from_derivatives(x, y) assert_equal(bp.__class__, self.B) class TestPPoly(object): def test_simple(self): c = np.array([[1, 4], [2, 5], [3, 6]]) x = np.array([0, 0.5, 1]) p = PPoly(c, x) assert_allclose(p(0.3), 1*0.3**2 + 2*0.3 + 3) assert_allclose(p(0.7), 4*(0.7-0.5)**2 + 5*(0.7-0.5) + 6) def test_periodic(self): c = np.array([[1, 4], [2, 5], [3, 6]]) x = np.array([0, 0.5, 1]) p = PPoly(c, x, extrapolate='periodic') assert_allclose(p(1.3), 1 * 0.3 ** 2 + 2 * 0.3 + 3) assert_allclose(p(-0.3), 4 * (0.7 - 0.5) ** 2 + 5 * (0.7 - 0.5) + 6) assert_allclose(p(1.3, 1), 2 * 0.3 + 2) assert_allclose(p(-0.3, 1), 8 * (0.7 - 0.5) + 5) def test_descending(self): def binom_matrix(power): n = np.arange(power + 1).reshape(-1, 1) k = np.arange(power + 1) B = binom(n, k) return B[::-1, ::-1] np.random.seed(0) power = 3 for m in [10, 20, 30]: x = np.sort(np.random.uniform(0, 10, m + 1)) ca = np.random.uniform(-2, 2, size=(power + 1, m)) h = np.diff(x) h_powers = h[None, :] ** np.arange(power + 1)[::-1, None] B = binom_matrix(power) cap = ca * h_powers cdp = np.dot(B.T, cap) cd = cdp / h_powers pa = PPoly(ca, x, extrapolate=True) pd = PPoly(cd[:, ::-1], x[::-1], extrapolate=True) x_test = np.random.uniform(-10, 20, 100) assert_allclose(pa(x_test), pd(x_test), rtol=1e-13) assert_allclose(pa(x_test, 1), pd(x_test, 1), rtol=1e-13) pa_d = pa.derivative() pd_d = pd.derivative() assert_allclose(pa_d(x_test), pd_d(x_test), rtol=1e-13) # Antiderivatives won't be equal because fixing continuity is # done in the reverse order, but surely the differences should be # equal. pa_i = pa.antiderivative() pd_i = pd.antiderivative() for a, b in np.random.uniform(-10, 20, (5, 2)): int_a = pa.integrate(a, b) int_d = pd.integrate(a, b) assert_allclose(int_a, int_d, rtol=1e-13) assert_allclose(pa_i(b) - pa_i(a), pd_i(b) - pd_i(a), rtol=1e-13) roots_d = pd.roots() roots_a = pa.roots() assert_allclose(roots_a, np.sort(roots_d), rtol=1e-12) def test_multi_shape(self): c = np.random.rand(6, 2, 1, 2, 3) x = np.array([0, 0.5, 1]) p = PPoly(c, x) assert_equal(p.x.shape, x.shape) assert_equal(p.c.shape, c.shape) assert_equal(p(0.3).shape, c.shape[2:]) assert_equal(p(np.random.rand(5, 6)).shape, (5, 6) + c.shape[2:]) dp = p.derivative() assert_equal(dp.c.shape, (5, 2, 1, 2, 3)) ip = p.antiderivative() assert_equal(ip.c.shape, (7, 2, 1, 2, 3)) def test_construct_fast(self): np.random.seed(1234) c = np.array([[1, 4], [2, 5], [3, 6]], dtype=float) x = np.array([0, 0.5, 1]) p = PPoly.construct_fast(c, x) assert_allclose(p(0.3), 1*0.3**2 + 2*0.3 + 3) assert_allclose(p(0.7), 4*(0.7-0.5)**2 + 5*(0.7-0.5) + 6) def test_vs_alternative_implementations(self): np.random.seed(1234) c = np.random.rand(3, 12, 22) x = np.sort(np.r_[0, np.random.rand(11), 1]) p = PPoly(c, x) xp = np.r_[0.3, 0.5, 0.33, 0.6] expected = _ppoly_eval_1(c, x, xp) assert_allclose(p(xp), expected) expected = _ppoly_eval_2(c[:,:,0], x, xp) assert_allclose(p(xp)[:,0], expected) def test_from_spline(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0) pp = PPoly.from_spline(spl) xi = np.linspace(0, 1, 200) assert_allclose(pp(xi), splev(xi, spl)) # make sure .from_spline accepts BSpline objects b = BSpline(*spl) ppp = PPoly.from_spline(b) assert_allclose(ppp(xi), b(xi)) # BSpline's extrapolate attribute propagates unless overridden t, c, k = spl for extrap in (None, True, False): b = BSpline(t, c, k, extrapolate=extrap) p = PPoly.from_spline(b) assert_equal(p.extrapolate, b.extrapolate) def test_derivative_simple(self): np.random.seed(1234) c = np.array([[4, 3, 2, 1]]).T dc = np.array([[3*4, 2*3, 2]]).T ddc = np.array([[2*3*4, 1*2*3]]).T x = np.array([0, 1]) pp = PPoly(c, x) dpp = PPoly(dc, x) ddpp = PPoly(ddc, x) assert_allclose(pp.derivative().c, dpp.c) assert_allclose(pp.derivative(2).c, ddpp.c) def test_derivative_eval(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0) pp = PPoly.from_spline(spl) xi = np.linspace(0, 1, 200) for dx in range(0, 3): assert_allclose(pp(xi, dx), splev(xi, spl, dx)) def test_derivative(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0, k=5) pp = PPoly.from_spline(spl) xi = np.linspace(0, 1, 200) for dx in range(0, 10): assert_allclose(pp(xi, dx), pp.derivative(dx)(xi), err_msg="dx=%d" % (dx,)) def test_antiderivative_of_constant(self): # https://github.com/scipy/scipy/issues/4216 p = PPoly([[1.]], [0, 1]) assert_equal(p.antiderivative().c, PPoly([[1], [0]], [0, 1]).c) assert_equal(p.antiderivative().x, PPoly([[1], [0]], [0, 1]).x) def test_antiderivative_regression_4355(self): # https://github.com/scipy/scipy/issues/4355 p = PPoly([[1., 0.5]], [0, 1, 2]) q = p.antiderivative() assert_equal(q.c, [[1, 0.5], [0, 1]]) assert_equal(q.x, [0, 1, 2]) assert_allclose(p.integrate(0, 2), 1.5) assert_allclose(q(2) - q(0), 1.5) def test_antiderivative_simple(self): np.random.seed(1234) # [ p1(x) = 3*x**2 + 2*x + 1, # p2(x) = 1.6875] c = np.array([[3, 2, 1], [0, 0, 1.6875]]).T # [ pp1(x) = x**3 + x**2 + x, # pp2(x) = 1.6875*(x - 0.25) + pp1(0.25)] ic = np.array([[1, 1, 1, 0], [0, 0, 1.6875, 0.328125]]).T # [ ppp1(x) = (1/4)*x**4 + (1/3)*x**3 + (1/2)*x**2, # ppp2(x) = (1.6875/2)*(x - 0.25)**2 + pp1(0.25)*x + ppp1(0.25)] iic = np.array([[1/4, 1/3, 1/2, 0, 0], [0, 0, 1.6875/2, 0.328125, 0.037434895833333336]]).T x = np.array([0, 0.25, 1]) pp = PPoly(c, x) ipp = pp.antiderivative() iipp = pp.antiderivative(2) iipp2 = ipp.antiderivative() assert_allclose(ipp.x, x) assert_allclose(ipp.c.T, ic.T) assert_allclose(iipp.c.T, iic.T) assert_allclose(iipp2.c.T, iic.T) def test_antiderivative_vs_derivative(self): np.random.seed(1234) x = np.linspace(0, 1, 30)**2 y = np.random.rand(len(x)) spl = splrep(x, y, s=0, k=5) pp = PPoly.from_spline(spl) for dx in range(0, 10): ipp = pp.antiderivative(dx) # check that derivative is inverse op pp2 = ipp.derivative(dx) assert_allclose(pp.c, pp2.c) # check continuity for k in range(dx): pp2 = ipp.derivative(k) r = 1e-13 endpoint = r*pp2.x[:-1] + (1 - r)*pp2.x[1:] assert_allclose(pp2(pp2.x[1:]), pp2(endpoint), rtol=1e-7, err_msg="dx=%d k=%d" % (dx, k)) def test_antiderivative_vs_spline(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0, k=5) pp = PPoly.from_spline(spl) for dx in range(0, 10): pp2 = pp.antiderivative(dx) spl2 = splantider(spl, dx) xi = np.linspace(0, 1, 200) assert_allclose(pp2(xi), splev(xi, spl2), rtol=1e-7) def test_antiderivative_continuity(self): c = np.array([[2, 1, 2, 2], [2, 1, 3, 3]]).T x = np.array([0, 0.5, 1]) p = PPoly(c, x) ip = p.antiderivative() # check continuity assert_allclose(ip(0.5 - 1e-9), ip(0.5 + 1e-9), rtol=1e-8) # check that only lowest order coefficients were changed p2 = ip.derivative() assert_allclose(p2.c, p.c) def test_integrate(self): np.random.seed(1234) x = np.sort(np.r_[0, np.random.rand(11), 1]) y = np.random.rand(len(x)) spl = splrep(x, y, s=0, k=5) pp = PPoly.from_spline(spl) a, b = 0.3, 0.9 ig = pp.integrate(a, b) ipp = pp.antiderivative() assert_allclose(ig, ipp(b) - ipp(a)) assert_allclose(ig, splint(a, b, spl)) a, b = -0.3, 0.9 ig = pp.integrate(a, b, extrapolate=True) assert_allclose(ig, ipp(b) - ipp(a)) assert_(np.isnan(pp.integrate(a, b, extrapolate=False)).all()) def test_integrate_periodic(self): x = np.array([1, 2, 4]) c = np.array([[0., 0.], [-1., -1.], [2., -0.], [1., 2.]]) P = PPoly(c, x, extrapolate='periodic') I = P.antiderivative() period_int = I(4) - I(1) assert_allclose(P.integrate(1, 4), period_int) assert_allclose(P.integrate(-10, -7), period_int) assert_allclose(P.integrate(-10, -4), 2 * period_int) assert_allclose(P.integrate(1.5, 2.5), I(2.5) - I(1.5)) assert_allclose(P.integrate(3.5, 5), I(2) - I(1) + I(4) - I(3.5)) assert_allclose(P.integrate(3.5 + 12, 5 + 12), I(2) - I(1) + I(4) - I(3.5)) assert_allclose(P.integrate(3.5, 5 + 12), I(2) - I(1) + I(4) - I(3.5) + 4 * period_int) assert_allclose(P.integrate(0, -1), I(2) - I(3)) assert_allclose(P.integrate(-9, -10), I(2) - I(3)) assert_allclose(P.integrate(0, -10), I(2) - I(3) - 3 * period_int) def test_roots(self): x = np.linspace(0, 1, 31)**2 y = np.sin(30*x) spl = splrep(x, y, s=0, k=3) pp = PPoly.from_spline(spl) r = pp.roots() r = r[(r >= 0 - 1e-15) & (r <= 1 + 1e-15)] assert_allclose(r, sproot(spl), atol=1e-15) def test_roots_idzero(self): # Roots for piecewise polynomials with identically zero # sections. c = np.array([[-1, 0.25], [0, 0], [-1, 0.25]]).T x = np.array([0, 0.4, 0.6, 1.0]) pp = PPoly(c, x) assert_array_equal(pp.roots(), [0.25, 0.4, np.nan, 0.6 + 0.25]) # ditto for p.solve(const) with sections identically equal const const = 2. c1 = c.copy() c1[1, :] += const pp1 = PPoly(c1, x) assert_array_equal(pp1.solve(const), [0.25, 0.4, np.nan, 0.6 + 0.25]) def test_roots_all_zero(self): # test the code path for the polynomial being identically zero everywhere c = [[0], [0]] x = [0, 1] p = PPoly(c, x) assert_array_equal(p.roots(), [0, np.nan]) assert_array_equal(p.solve(0), [0, np.nan]) assert_array_equal(p.solve(1), []) c = [[0, 0], [0, 0]] x = [0, 1, 2] p = PPoly(c, x) assert_array_equal(p.roots(), [0, np.nan, 1, np.nan]) assert_array_equal(p.solve(0), [0, np.nan, 1, np.nan]) assert_array_equal(p.solve(1), []) def test_roots_repeated(self): # Check roots repeated in multiple sections are reported only # once. # [(x + 1)**2 - 1, -x**2] ; x == 0 is a repeated root c = np.array([[1, 0, -1], [-1, 0, 0]]).T x = np.array([-1, 0, 1]) pp = PPoly(c, x) assert_array_equal(pp.roots(), [-2, 0]) assert_array_equal(pp.roots(extrapolate=False), [0]) def test_roots_discont(self): # Check that a discontinuity across zero is reported as root c = np.array([[1], [-1]]).T x = np.array([0, 0.5, 1]) pp = PPoly(c, x) assert_array_equal(pp.roots(), [0.5]) assert_array_equal(pp.roots(discontinuity=False), []) # ditto for a discontinuity across y: assert_array_equal(pp.solve(0.5), [0.5]) assert_array_equal(pp.solve(0.5, discontinuity=False), []) assert_array_equal(pp.solve(1.5), []) assert_array_equal(pp.solve(1.5, discontinuity=False), []) def test_roots_random(self): # Check high-order polynomials with random coefficients np.random.seed(1234) num = 0 for extrapolate in (True, False): for order in range(0, 20): x = np.unique(np.r_[0, 10 * np.random.rand(30), 10]) c = 2*np.random.rand(order+1, len(x)-1, 2, 3) - 1 pp = PPoly(c, x) for y in [0, np.random.random()]: r = pp.solve(y, discontinuity=False, extrapolate=extrapolate) for i in range(2): for j in range(3): rr = r[i,j] if rr.size > 0: # Check that the reported roots indeed are roots num += rr.size val = pp(rr, extrapolate=extrapolate)[:,i,j] cmpval = pp(rr, nu=1, extrapolate=extrapolate)[:,i,j] msg = "(%r) r = %s" % (extrapolate, repr(rr),) assert_allclose((val-y) / cmpval, 0, atol=1e-7, err_msg=msg) # Check that we checked a number of roots assert_(num > 100, repr(num)) def test_roots_croots(self): # Test the complex root finding algorithm np.random.seed(1234) for k in range(1, 15): c = np.random.rand(k, 1, 130) if k == 3: # add a case with zero discriminant c[:,0,0] = 1, 2, 1 for y in [0, np.random.random()]: w = np.empty(c.shape, dtype=complex) _ppoly._croots_poly1(c, w) if k == 1: assert_(np.isnan(w).all()) continue res = 0 cres = 0 for i in range(k): res += c[i,None] * w**(k-1-i) cres += abs(c[i,None] * w**(k-1-i)) with np.errstate(invalid='ignore'): res /= cres res = res.ravel() res = res[~np.isnan(res)] assert_allclose(res, 0, atol=1e-10) def test_extrapolate_attr(self): # [ 1 - x**2 ] c = np.array([[-1, 0, 1]]).T x = np.array([0, 1]) for extrapolate in [True, False, None]: pp = PPoly(c, x, extrapolate=extrapolate) pp_d = pp.derivative() pp_i = pp.antiderivative() if extrapolate is False: assert_(np.isnan(pp([-0.1, 1.1])).all()) assert_(np.isnan(pp_i([-0.1, 1.1])).all()) assert_(np.isnan(pp_d([-0.1, 1.1])).all()) assert_equal(pp.roots(), [1]) else: assert_allclose(pp([-0.1, 1.1]), [1-0.1**2, 1-1.1**2]) assert_(not np.isnan(pp_i([-0.1, 1.1])).any()) assert_(not np.isnan(pp_d([-0.1, 1.1])).any()) assert_allclose(pp.roots(), [1, -1]) class TestBPoly(object): def test_simple(self): x = [0, 1] c = [[3]] bp = BPoly(c, x) assert_allclose(bp(0.1), 3.) def test_simple2(self): x = [0, 1] c = [[3], [1]] bp = BPoly(c, x) # 3*(1-x) + 1*x assert_allclose(bp(0.1), 3*0.9 + 1.*0.1) def test_simple3(self): x = [0, 1] c = [[3], [1], [4]] bp = BPoly(c, x) # 3 * (1-x)**2 + 2 * x (1-x) + 4 * x**2 assert_allclose(bp(0.2), 3 * 0.8*0.8 + 1 * 2*0.2*0.8 + 4 * 0.2*0.2) def test_simple4(self): x = [0, 1] c = [[1], [1], [1], [2]] bp = BPoly(c, x) assert_allclose(bp(0.3), 0.7**3 + 3 * 0.7**2 * 0.3 + 3 * 0.7 * 0.3**2 + 2 * 0.3**3) def test_simple5(self): x = [0, 1] c = [[1], [1], [8], [2], [1]] bp = BPoly(c, x) assert_allclose(bp(0.3), 0.7**4 + 4 * 0.7**3 * 0.3 + 8 * 6 * 0.7**2 * 0.3**2 + 2 * 4 * 0.7 * 0.3**3 + 0.3**4) def test_periodic(self): x = [0, 1, 3] c = [[3, 0], [0, 0], [0, 2]] # [3*(1-x)**2, 2*((x-1)/2)**2] bp = BPoly(c, x, extrapolate='periodic') assert_allclose(bp(3.4), 3 * 0.6**2) assert_allclose(bp(-1.3), 2 * (0.7/2)**2) assert_allclose(bp(3.4, 1), -6 * 0.6) assert_allclose(bp(-1.3, 1), 2 * (0.7/2)) def test_descending(self): np.random.seed(0) power = 3 for m in [10, 20, 30]: x = np.sort(np.random.uniform(0, 10, m + 1)) ca = np.random.uniform(-0.1, 0.1, size=(power + 1, m)) # We need only to flip coefficients to get it right! cd = ca[::-1].copy() pa = BPoly(ca, x, extrapolate=True) pd = BPoly(cd[:, ::-1], x[::-1], extrapolate=True) x_test = np.random.uniform(-10, 20, 100) assert_allclose(pa(x_test), pd(x_test), rtol=1e-13) assert_allclose(pa(x_test, 1), pd(x_test, 1), rtol=1e-13) pa_d = pa.derivative() pd_d = pd.derivative() assert_allclose(pa_d(x_test), pd_d(x_test), rtol=1e-13) # Antiderivatives won't be equal because fixing continuity is # done in the reverse order, but surely the differences should be # equal. pa_i = pa.antiderivative() pd_i = pd.antiderivative() for a, b in np.random.uniform(-10, 20, (5, 2)): int_a = pa.integrate(a, b) int_d = pd.integrate(a, b) assert_allclose(int_a, int_d, rtol=1e-12) assert_allclose(pa_i(b) - pa_i(a), pd_i(b) - pd_i(a), rtol=1e-12) def test_multi_shape(self): c = np.random.rand(6, 2, 1, 2, 3) x = np.array([0, 0.5, 1]) p = BPoly(c, x) assert_equal(p.x.shape, x.shape) assert_equal(p.c.shape, c.shape) assert_equal(p(0.3).shape, c.shape[2:]) assert_equal(p(np.random.rand(5,6)).shape, (5,6)+c.shape[2:]) dp = p.derivative() assert_equal(dp.c.shape, (5, 2, 1, 2, 3)) def test_interval_length(self): x = [0, 2] c = [[3], [1], [4]] bp = BPoly(c, x) xval = 0.1 s = xval / 2 # s = (x - xa) / (xb - xa) assert_allclose(bp(xval), 3 * (1-s)*(1-s) + 1 * 2*s*(1-s) + 4 * s*s) def test_two_intervals(self): x = [0, 1, 3] c = [[3, 0], [0, 0], [0, 2]] bp = BPoly(c, x) # [3*(1-x)**2, 2*((x-1)/2)**2] assert_allclose(bp(0.4), 3 * 0.6*0.6) assert_allclose(bp(1.7), 2 * (0.7/2)**2) def test_extrapolate_attr(self): x = [0, 2] c = [[3], [1], [4]] bp = BPoly(c, x) for extrapolate in (True, False, None): bp = BPoly(c, x, extrapolate=extrapolate) bp_d = bp.derivative() if extrapolate is False: assert_(np.isnan(bp([-0.1, 2.1])).all()) assert_(np.isnan(bp_d([-0.1, 2.1])).all()) else: assert_(not np.isnan(bp([-0.1, 2.1])).any()) assert_(not np.isnan(bp_d([-0.1, 2.1])).any()) class TestBPolyCalculus(object): def test_derivative(self): x = [0, 1, 3] c = [[3, 0], [0, 0], [0, 2]] bp = BPoly(c, x) # [3*(1-x)**2, 2*((x-1)/2)**2] bp_der = bp.derivative() assert_allclose(bp_der(0.4), -6*(0.6)) assert_allclose(bp_der(1.7), 0.7) # derivatives in-place assert_allclose([bp(0.4, nu=1), bp(0.4, nu=2), bp(0.4, nu=3)], [-6*(1-0.4), 6., 0.]) assert_allclose([bp(1.7, nu=1), bp(1.7, nu=2), bp(1.7, nu=3)], [0.7, 1., 0]) def test_derivative_ppoly(self): # make sure it's consistent w/ power basis np.random.seed(1234) m, k = 5, 8 # number of intervals, order x = np.sort(np.random.random(m)) c = np.random.random((k, m-1)) bp = BPoly(c, x) pp = PPoly.from_bernstein_basis(bp) for d in range(k): bp = bp.derivative() pp = pp.derivative() xp = np.linspace(x[0], x[-1], 21) assert_allclose(bp(xp), pp(xp)) def test_deriv_inplace(self): np.random.seed(1234) m, k = 5, 8 # number of intervals, order x = np.sort(np.random.random(m)) c = np.random.random((k, m-1)) # test both real and complex coefficients for cc in [c.copy(), c*(1. + 2.j)]: bp = BPoly(cc, x) xp = np.linspace(x[0], x[-1], 21) for i in range(k): assert_allclose(bp(xp, i), bp.derivative(i)(xp)) def test_antiderivative_simple(self): # f(x) = x for x \in [0, 1), # (x-1)/2 for x \in [1, 3] # # antiderivative is then # F(x) = x**2 / 2 for x \in [0, 1), # 0.5*x*(x/2 - 1) + A for x \in [1, 3] # where A = 3/4 for continuity at x = 1. x = [0, 1, 3] c = [[0, 0], [1, 1]] bp = BPoly(c, x) bi = bp.antiderivative() xx = np.linspace(0, 3, 11) assert_allclose(bi(xx), np.where(xx < 1, xx**2 / 2., 0.5 * xx * (xx/2. - 1) + 3./4), atol=1e-12, rtol=1e-12) def test_der_antider(self): np.random.seed(1234) x = np.sort(np.random.random(11)) c = np.random.random((4, 10, 2, 3)) bp = BPoly(c, x) xx = np.linspace(x[0], x[-1], 100) assert_allclose(bp.antiderivative().derivative()(xx), bp(xx), atol=1e-12, rtol=1e-12) def test_antider_ppoly(self): np.random.seed(1234) x = np.sort(np.random.random(11)) c = np.random.random((4, 10, 2, 3)) bp = BPoly(c, x) pp = PPoly.from_bernstein_basis(bp) xx = np.linspace(x[0], x[-1], 10) assert_allclose(bp.antiderivative(2)(xx), pp.antiderivative(2)(xx), atol=1e-12, rtol=1e-12) def test_antider_continuous(self): np.random.seed(1234) x = np.sort(np.random.random(11)) c = np.random.random((4, 10)) bp = BPoly(c, x).antiderivative() xx = bp.x[1:-1] assert_allclose(bp(xx - 1e-14), bp(xx + 1e-14), atol=1e-12, rtol=1e-12) def test_integrate(self): np.random.seed(1234) x = np.sort(np.random.random(11)) c = np.random.random((4, 10)) bp = BPoly(c, x) pp = PPoly.from_bernstein_basis(bp) assert_allclose(bp.integrate(0, 1), pp.integrate(0, 1), atol=1e-12, rtol=1e-12) def test_integrate_extrap(self): c = [[1]] x = [0, 1] b = BPoly(c, x) # default is extrapolate=True assert_allclose(b.integrate(0, 2), 2., atol=1e-14) # .integrate argument overrides self.extrapolate b1 = BPoly(c, x, extrapolate=False) assert_(np.isnan(b1.integrate(0, 2))) assert_allclose(b1.integrate(0, 2, extrapolate=True), 2., atol=1e-14) def test_integrate_periodic(self): x = np.array([1, 2, 4]) c = np.array([[0., 0.], [-1., -1.], [2., -0.], [1., 2.]]) P = BPoly.from_power_basis(PPoly(c, x), extrapolate='periodic') I = P.antiderivative() period_int = I(4) - I(1) assert_allclose(P.integrate(1, 4), period_int) assert_allclose(P.integrate(-10, -7), period_int) assert_allclose(P.integrate(-10, -4), 2 * period_int) assert_allclose(P.integrate(1.5, 2.5), I(2.5) - I(1.5)) assert_allclose(P.integrate(3.5, 5), I(2) - I(1) + I(4) - I(3.5)) assert_allclose(P.integrate(3.5 + 12, 5 + 12), I(2) - I(1) + I(4) - I(3.5)) assert_allclose(P.integrate(3.5, 5 + 12), I(2) - I(1) + I(4) - I(3.5) + 4 * period_int) assert_allclose(P.integrate(0, -1), I(2) - I(3)) assert_allclose(P.integrate(-9, -10), I(2) - I(3)) assert_allclose(P.integrate(0, -10), I(2) - I(3) - 3 * period_int) def test_antider_neg(self): # .derivative(-nu) ==> .andiderivative(nu) and vice versa c = [[1]] x = [0, 1] b = BPoly(c, x) xx = np.linspace(0, 1, 21) assert_allclose(b.derivative(-1)(xx), b.antiderivative()(xx), atol=1e-12, rtol=1e-12) assert_allclose(b.derivative(1)(xx), b.antiderivative(-1)(xx), atol=1e-12, rtol=1e-12) class TestPolyConversions(object): def test_bp_from_pp(self): x = [0, 1, 3] c = [[3, 2], [1, 8], [4, 3]] pp = PPoly(c, x) bp = BPoly.from_power_basis(pp) pp1 = PPoly.from_bernstein_basis(bp) xp = [0.1, 1.4] assert_allclose(pp(xp), bp(xp)) assert_allclose(pp(xp), pp1(xp)) def test_bp_from_pp_random(self): np.random.seed(1234) m, k = 5, 8 # number of intervals, order x = np.sort(np.random.random(m)) c = np.random.random((k, m-1)) pp = PPoly(c, x) bp = BPoly.from_power_basis(pp) pp1 = PPoly.from_bernstein_basis(bp) xp = np.linspace(x[0], x[-1], 21) assert_allclose(pp(xp), bp(xp)) assert_allclose(pp(xp), pp1(xp)) def test_pp_from_bp(self): x = [0, 1, 3] c = [[3, 3], [1, 1], [4, 2]] bp = BPoly(c, x) pp = PPoly.from_bernstein_basis(bp) bp1 = BPoly.from_power_basis(pp) xp = [0.1, 1.4] assert_allclose(bp(xp), pp(xp)) assert_allclose(bp(xp), bp1(xp)) class TestBPolyFromDerivatives(object): def test_make_poly_1(self): c1 = BPoly._construct_from_derivatives(0, 1, [2], [3]) assert_allclose(c1, [2., 3.]) def test_make_poly_2(self): c1 = BPoly._construct_from_derivatives(0, 1, [1, 0], [1]) assert_allclose(c1, [1., 1., 1.]) # f'(0) = 3 c2 = BPoly._construct_from_derivatives(0, 1, [2, 3], [1]) assert_allclose(c2, [2., 7./2, 1.]) # f'(1) = 3 c3 = BPoly._construct_from_derivatives(0, 1, [2], [1, 3]) assert_allclose(c3, [2., -0.5, 1.]) def test_make_poly_3(self): # f'(0)=2, f''(0)=3 c1 = BPoly._construct_from_derivatives(0, 1, [1, 2, 3], [4]) assert_allclose(c1, [1., 5./3, 17./6, 4.]) # f'(1)=2, f''(1)=3 c2 = BPoly._construct_from_derivatives(0, 1, [1], [4, 2, 3]) assert_allclose(c2, [1., 19./6, 10./3, 4.]) # f'(0)=2, f'(1)=3 c3 = BPoly._construct_from_derivatives(0, 1, [1, 2], [4, 3]) assert_allclose(c3, [1., 5./3, 3., 4.]) def test_make_poly_12(self): np.random.seed(12345) ya = np.r_[0, np.random.random(5)] yb = np.r_[0, np.random.random(5)] c = BPoly._construct_from_derivatives(0, 1, ya, yb) pp = BPoly(c[:, None], [0, 1]) for j in range(6): assert_allclose([pp(0.), pp(1.)], [ya[j], yb[j]]) pp = pp.derivative() def test_raise_degree(self): np.random.seed(12345) x = [0, 1] k, d = 8, 5 c = np.random.random((k, 1, 2, 3, 4)) bp = BPoly(c, x) c1 = BPoly._raise_degree(c, d) bp1 = BPoly(c1, x) xp = np.linspace(0, 1, 11) assert_allclose(bp(xp), bp1(xp)) def test_xi_yi(self): assert_raises(ValueError, BPoly.from_derivatives, [0, 1], [0]) def test_coords_order(self): xi = [0, 0, 1] yi = [[0], [0], [0]] assert_raises(ValueError, BPoly.from_derivatives, xi, yi) def test_zeros(self): xi = [0, 1, 2, 3] yi = [[0, 0], [0], [0, 0], [0, 0]] # NB: will have to raise the degree pp = BPoly.from_derivatives(xi, yi) assert_(pp.c.shape == (4, 3)) ppd = pp.derivative() for xp in [0., 0.1, 1., 1.1, 1.9, 2., 2.5]: assert_allclose([pp(xp), ppd(xp)], [0., 0.]) def _make_random_mk(self, m, k): # k derivatives at each breakpoint np.random.seed(1234) xi = np.asarray([1. * j**2 for j in range(m+1)]) yi = [np.random.random(k) for j in range(m+1)] return xi, yi def test_random_12(self): m, k = 5, 12 xi, yi = self._make_random_mk(m, k) pp = BPoly.from_derivatives(xi, yi) for order in range(k//2): assert_allclose(pp(xi), [yy[order] for yy in yi]) pp = pp.derivative() def test_order_zero(self): m, k = 5, 12 xi, yi = self._make_random_mk(m, k) assert_raises(ValueError, BPoly.from_derivatives, **dict(xi=xi, yi=yi, orders=0)) def test_orders_too_high(self): m, k = 5, 12 xi, yi = self._make_random_mk(m, k) pp = BPoly.from_derivatives(xi, yi, orders=2*k-1) # this is still ok assert_raises(ValueError, BPoly.from_derivatives, # but this is not **dict(xi=xi, yi=yi, orders=2*k)) def test_orders_global(self): m, k = 5, 12 xi, yi = self._make_random_mk(m, k) # ok, this is confusing. Local polynomials will be of the order 5 # which means that up to the 2nd derivatives will be used at each point order = 5 pp = BPoly.from_derivatives(xi, yi, orders=order) for j in range(order//2+1): assert_allclose(pp(xi[1:-1] - 1e-12), pp(xi[1:-1] + 1e-12)) pp = pp.derivative() assert_(not np.allclose(pp(xi[1:-1] - 1e-12), pp(xi[1:-1] + 1e-12))) # now repeat with `order` being even: on each interval, it uses # order//2 'derivatives' @ the right-hand endpoint and # order//2+1 @ 'derivatives' the left-hand endpoint order = 6 pp = BPoly.from_derivatives(xi, yi, orders=order) for j in range(order//2): assert_allclose(pp(xi[1:-1] - 1e-12), pp(xi[1:-1] + 1e-12)) pp = pp.derivative() assert_(not np.allclose(pp(xi[1:-1] - 1e-12), pp(xi[1:-1] + 1e-12))) def test_orders_local(self): m, k = 7, 12 xi, yi = self._make_random_mk(m, k) orders = [o + 1 for o in range(m)] for i, x in enumerate(xi[1:-1]): pp = BPoly.from_derivatives(xi, yi, orders=orders) for j in range(orders[i] // 2 + 1): assert_allclose(pp(x - 1e-12), pp(x + 1e-12)) pp = pp.derivative() assert_(not np.allclose(pp(x - 1e-12), pp(x + 1e-12))) def test_yi_trailing_dims(self): m, k = 7, 5 xi = np.sort(np.random.random(m+1)) yi = np.random.random((m+1, k, 6, 7, 8)) pp = BPoly.from_derivatives(xi, yi) assert_equal(pp.c.shape, (2*k, m, 6, 7, 8)) def test_gh_5430(self): # At least one of these raises an error unless gh-5430 is # fixed. In py2k an int is implemented using a C long, so # which one fails depends on your system. In py3k there is only # one arbitrary precision integer type, so both should fail. orders = np.int32(1) p = BPoly.from_derivatives([0, 1], [[0], [0]], orders=orders) assert_almost_equal(p(0), 0) orders = np.int64(1) p = BPoly.from_derivatives([0, 1], [[0], [0]], orders=orders) assert_almost_equal(p(0), 0) orders = 1 # This worked before; make sure it still works p = BPoly.from_derivatives([0, 1], [[0], [0]], orders=orders) assert_almost_equal(p(0), 0) orders = 1 class TestNdPPoly(object): def test_simple_1d(self): np.random.seed(1234) c = np.random.rand(4, 5) x = np.linspace(0, 1, 5+1) xi = np.random.rand(200) p = NdPPoly(c, (x,)) v1 = p((xi,)) v2 = _ppoly_eval_1(c[:,:,None], x, xi).ravel() assert_allclose(v1, v2) def test_simple_2d(self): np.random.seed(1234) c = np.random.rand(4, 5, 6, 7) x = np.linspace(0, 1, 6+1) y = np.linspace(0, 1, 7+1)**2 xi = np.random.rand(200) yi = np.random.rand(200) v1 = np.empty([len(xi), 1], dtype=c.dtype) v1.fill(np.nan) _ppoly.evaluate_nd(c.reshape(4*5, 6*7, 1), (x, y), np.array([4, 5], dtype=np.intc), np.c_[xi, yi], np.array([0, 0], dtype=np.intc), 1, v1) v1 = v1.ravel() v2 = _ppoly2d_eval(c, (x, y), xi, yi) assert_allclose(v1, v2) p = NdPPoly(c, (x, y)) for nu in (None, (0, 0), (0, 1), (1, 0), (2, 3), (9, 2)): v1 = p(np.c_[xi, yi], nu=nu) v2 = _ppoly2d_eval(c, (x, y), xi, yi, nu=nu) assert_allclose(v1, v2, err_msg=repr(nu)) def test_simple_3d(self): np.random.seed(1234) c = np.random.rand(4, 5, 6, 7, 8, 9) x = np.linspace(0, 1, 7+1) y = np.linspace(0, 1, 8+1)**2 z = np.linspace(0, 1, 9+1)**3 xi = np.random.rand(40) yi = np.random.rand(40) zi = np.random.rand(40) p = NdPPoly(c, (x, y, z)) for nu in (None, (0, 0, 0), (0, 1, 0), (1, 0, 0), (2, 3, 0), (6, 0, 2)): v1 = p((xi, yi, zi), nu=nu) v2 = _ppoly3d_eval(c, (x, y, z), xi, yi, zi, nu=nu) assert_allclose(v1, v2, err_msg=repr(nu)) def test_simple_4d(self): np.random.seed(1234) c = np.random.rand(4, 5, 6, 7, 8, 9, 10, 11) x = np.linspace(0, 1, 8+1) y = np.linspace(0, 1, 9+1)**2 z = np.linspace(0, 1, 10+1)**3 u = np.linspace(0, 1, 11+1)**4 xi = np.random.rand(20) yi = np.random.rand(20) zi = np.random.rand(20) ui = np.random.rand(20) p = NdPPoly(c, (x, y, z, u)) v1 = p((xi, yi, zi, ui)) v2 = _ppoly4d_eval(c, (x, y, z, u), xi, yi, zi, ui) assert_allclose(v1, v2) def test_deriv_1d(self): np.random.seed(1234) c = np.random.rand(4, 5) x = np.linspace(0, 1, 5+1) p = NdPPoly(c, (x,)) # derivative dp = p.derivative(nu=[1]) p1 = PPoly(c, x) dp1 = p1.derivative() assert_allclose(dp.c, dp1.c) # antiderivative dp = p.antiderivative(nu=[2]) p1 = PPoly(c, x) dp1 = p1.antiderivative(2) assert_allclose(dp.c, dp1.c) def test_deriv_3d(self): np.random.seed(1234) c = np.random.rand(4, 5, 6, 7, 8, 9) x = np.linspace(0, 1, 7+1) y = np.linspace(0, 1, 8+1)**2 z = np.linspace(0, 1, 9+1)**3 p = NdPPoly(c, (x, y, z)) # differentiate vs x p1 = PPoly(c.transpose(0, 3, 1, 2, 4, 5), x) dp = p.derivative(nu=[2]) dp1 = p1.derivative(2) assert_allclose(dp.c, dp1.c.transpose(0, 2, 3, 1, 4, 5)) # antidifferentiate vs y p1 = PPoly(c.transpose(1, 4, 0, 2, 3, 5), y) dp = p.antiderivative(nu=[0, 1, 0]) dp1 = p1.antiderivative(1) assert_allclose(dp.c, dp1.c.transpose(2, 0, 3, 4, 1, 5)) # differentiate vs z p1 = PPoly(c.transpose(2, 5, 0, 1, 3, 4), z) dp = p.derivative(nu=[0, 0, 3]) dp1 = p1.derivative(3) assert_allclose(dp.c, dp1.c.transpose(2, 3, 0, 4, 5, 1)) def test_deriv_3d_simple(self): # Integrate to obtain function x y**2 z**4 / (2! 4!) c = np.ones((1, 1, 1, 3, 4, 5)) x = np.linspace(0, 1, 3+1)**1 y = np.linspace(0, 1, 4+1)**2 z = np.linspace(0, 1, 5+1)**3 p = NdPPoly(c, (x, y, z)) ip = p.antiderivative((1, 0, 4)) ip = ip.antiderivative((0, 2, 0)) xi = np.random.rand(20) yi = np.random.rand(20) zi = np.random.rand(20) assert_allclose(ip((xi, yi, zi)), xi * yi**2 * zi**4 / (gamma(3)*gamma(5))) def test_integrate_2d(self): np.random.seed(1234) c = np.random.rand(4, 5, 16, 17) x = np.linspace(0, 1, 16+1)**1 y = np.linspace(0, 1, 17+1)**2 # make continuously differentiable so that nquad() has an # easier time c = c.transpose(0, 2, 1, 3) cx = c.reshape(c.shape[0], c.shape[1], -1).copy() _ppoly.fix_continuity(cx, x, 2) c = cx.reshape(c.shape) c = c.transpose(0, 2, 1, 3) c = c.transpose(1, 3, 0, 2) cx = c.reshape(c.shape[0], c.shape[1], -1).copy() _ppoly.fix_continuity(cx, y, 2) c = cx.reshape(c.shape) c = c.transpose(2, 0, 3, 1).copy() # Check integration p = NdPPoly(c, (x, y)) for ranges in [[(0, 1), (0, 1)], [(0, 0.5), (0, 1)], [(0, 1), (0, 0.5)], [(0.3, 0.7), (0.6, 0.2)]]: ig = p.integrate(ranges) ig2, err2 = nquad(lambda x, y: p((x, y)), ranges, opts=[dict(epsrel=1e-5, epsabs=1e-5)]*2) assert_allclose(ig, ig2, rtol=1e-5, atol=1e-5, err_msg=repr(ranges)) def test_integrate_1d(self): np.random.seed(1234) c = np.random.rand(4, 5, 6, 16, 17, 18) x = np.linspace(0, 1, 16+1)**1 y = np.linspace(0, 1, 17+1)**2 z = np.linspace(0, 1, 18+1)**3 # Check 1D integration p = NdPPoly(c, (x, y, z)) u = np.random.rand(200) v = np.random.rand(200) a, b = 0.2, 0.7 px = p.integrate_1d(a, b, axis=0) pax = p.antiderivative((1, 0, 0)) assert_allclose(px((u, v)), pax((b, u, v)) - pax((a, u, v))) py = p.integrate_1d(a, b, axis=1) pay = p.antiderivative((0, 1, 0)) assert_allclose(py((u, v)), pay((u, b, v)) - pay((u, a, v))) pz = p.integrate_1d(a, b, axis=2) paz = p.antiderivative((0, 0, 1)) assert_allclose(pz((u, v)), paz((u, v, b)) - paz((u, v, a))) def _ppoly_eval_1(c, x, xps): """Evaluate piecewise polynomial manually""" out = np.zeros((len(xps), c.shape[2])) for i, xp in enumerate(xps): if xp < 0 or xp > 1: out[i,:] = np.nan continue j = np.searchsorted(x, xp) - 1 d = xp - x[j] assert_(x[j] <= xp < x[j+1]) r = sum(c[k,j] * d**(c.shape[0]-k-1) for k in range(c.shape[0])) out[i,:] = r return out def _ppoly_eval_2(coeffs, breaks, xnew, fill=np.nan): """Evaluate piecewise polynomial manually (another way)""" a = breaks[0] b = breaks[-1] K = coeffs.shape[0] saveshape = np.shape(xnew) xnew = np.ravel(xnew) res = np.empty_like(xnew) mask = (xnew >= a) & (xnew <= b) res[~mask] = fill xx = xnew.compress(mask) indxs = np.searchsorted(breaks, xx)-1 indxs = indxs.clip(0, len(breaks)) pp = coeffs diff = xx - breaks.take(indxs) V = np.vander(diff, N=K) values = np.array([np.dot(V[k, :], pp[:, indxs[k]]) for k in xrange(len(xx))]) res[mask] = values res.shape = saveshape return res def _dpow(x, y, n): """ d^n (x**y) / dx^n """ if n < 0: raise ValueError("invalid derivative order") elif n > y: return 0 else: return poch(y - n + 1, n) * x**(y - n) def _ppoly2d_eval(c, xs, xnew, ynew, nu=None): """ Straightforward evaluation of 2D piecewise polynomial """ if nu is None: nu = (0, 0) out = np.empty((len(xnew),), dtype=c.dtype) nx, ny = c.shape[:2] for jout, (x, y) in enumerate(zip(xnew, ynew)): if not ((xs[0][0] <= x <= xs[0][-1]) and (xs[1][0] <= y <= xs[1][-1])): out[jout] = np.nan continue j1 = np.searchsorted(xs[0], x) - 1 j2 = np.searchsorted(xs[1], y) - 1 s1 = x - xs[0][j1] s2 = y - xs[1][j2] val = 0 for k1 in range(c.shape[0]): for k2 in range(c.shape[1]): val += (c[nx-k1-1,ny-k2-1,j1,j2] * _dpow(s1, k1, nu[0]) * _dpow(s2, k2, nu[1])) out[jout] = val return out def _ppoly3d_eval(c, xs, xnew, ynew, znew, nu=None): """ Straightforward evaluation of 3D piecewise polynomial """ if nu is None: nu = (0, 0, 0) out = np.empty((len(xnew),), dtype=c.dtype) nx, ny, nz = c.shape[:3] for jout, (x, y, z) in enumerate(zip(xnew, ynew, znew)): if not ((xs[0][0] <= x <= xs[0][-1]) and (xs[1][0] <= y <= xs[1][-1]) and (xs[2][0] <= z <= xs[2][-1])): out[jout] = np.nan continue j1 = np.searchsorted(xs[0], x) - 1 j2 = np.searchsorted(xs[1], y) - 1 j3 = np.searchsorted(xs[2], z) - 1 s1 = x - xs[0][j1] s2 = y - xs[1][j2] s3 = z - xs[2][j3] val = 0 for k1 in range(c.shape[0]): for k2 in range(c.shape[1]): for k3 in range(c.shape[2]): val += (c[nx-k1-1,ny-k2-1,nz-k3-1,j1,j2,j3] * _dpow(s1, k1, nu[0]) * _dpow(s2, k2, nu[1]) * _dpow(s3, k3, nu[2])) out[jout] = val return out def _ppoly4d_eval(c, xs, xnew, ynew, znew, unew, nu=None): """ Straightforward evaluation of 4D piecewise polynomial """ if nu is None: nu = (0, 0, 0, 0) out = np.empty((len(xnew),), dtype=c.dtype) mx, my, mz, mu = c.shape[:4] for jout, (x, y, z, u) in enumerate(zip(xnew, ynew, znew, unew)): if not ((xs[0][0] <= x <= xs[0][-1]) and (xs[1][0] <= y <= xs[1][-1]) and (xs[2][0] <= z <= xs[2][-1]) and (xs[3][0] <= u <= xs[3][-1])): out[jout] = np.nan continue j1 = np.searchsorted(xs[0], x) - 1 j2 = np.searchsorted(xs[1], y) - 1 j3 = np.searchsorted(xs[2], z) - 1 j4 = np.searchsorted(xs[3], u) - 1 s1 = x - xs[0][j1] s2 = y - xs[1][j2] s3 = z - xs[2][j3] s4 = u - xs[3][j4] val = 0 for k1 in range(c.shape[0]): for k2 in range(c.shape[1]): for k3 in range(c.shape[2]): for k4 in range(c.shape[3]): val += (c[mx-k1-1,my-k2-1,mz-k3-1,mu-k4-1,j1,j2,j3,j4] * _dpow(s1, k1, nu[0]) * _dpow(s2, k2, nu[1]) * _dpow(s3, k3, nu[2]) * _dpow(s4, k4, nu[3])) out[jout] = val return out class TestRegularGridInterpolator(object): def _get_sample_4d(self): # create a 4d grid of 3 points in each dimension points = [(0., .5, 1.)] * 4 values = np.asarray([0., .5, 1.]) values0 = values[:, np.newaxis, np.newaxis, np.newaxis] values1 = values[np.newaxis, :, np.newaxis, np.newaxis] values2 = values[np.newaxis, np.newaxis, :, np.newaxis] values3 = values[np.newaxis, np.newaxis, np.newaxis, :] values = (values0 + values1 * 10 + values2 * 100 + values3 * 1000) return points, values def _get_sample_4d_2(self): # create another 4d grid of 3 points in each dimension points = [(0., .5, 1.)] * 2 + [(0., 5., 10.)] * 2 values = np.asarray([0., .5, 1.]) values0 = values[:, np.newaxis, np.newaxis, np.newaxis] values1 = values[np.newaxis, :, np.newaxis, np.newaxis] values2 = values[np.newaxis, np.newaxis, :, np.newaxis] values3 = values[np.newaxis, np.newaxis, np.newaxis, :] values = (values0 + values1 * 10 + values2 * 100 + values3 * 1000) return points, values def test_list_input(self): points, values = self._get_sample_4d() sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) for method in ['linear', 'nearest']: interp = RegularGridInterpolator(points, values.tolist(), method=method) v1 = interp(sample.tolist()) interp = RegularGridInterpolator(points, values, method=method) v2 = interp(sample) assert_allclose(v1, v2) def test_complex(self): points, values = self._get_sample_4d() values = values - 2j*values sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) for method in ['linear', 'nearest']: interp = RegularGridInterpolator(points, values, method=method) rinterp = RegularGridInterpolator(points, values.real, method=method) iinterp = RegularGridInterpolator(points, values.imag, method=method) v1 = interp(sample) v2 = rinterp(sample) + 1j*iinterp(sample) assert_allclose(v1, v2) def test_linear_xi1d(self): points, values = self._get_sample_4d_2() interp = RegularGridInterpolator(points, values) sample = np.asarray([0.1, 0.1, 10., 9.]) wanted = 1001.1 assert_array_almost_equal(interp(sample), wanted) def test_linear_xi3d(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values) sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) wanted = np.asarray([1001.1, 846.2, 555.5]) assert_array_almost_equal(interp(sample), wanted) def test_nearest(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values, method="nearest") sample = np.asarray([0.1, 0.1, .9, .9]) wanted = 1100. assert_array_almost_equal(interp(sample), wanted) sample = np.asarray([0.1, 0.1, 0.1, 0.1]) wanted = 0. assert_array_almost_equal(interp(sample), wanted) sample = np.asarray([0., 0., 0., 0.]) wanted = 0. assert_array_almost_equal(interp(sample), wanted) sample = np.asarray([1., 1., 1., 1.]) wanted = 1111. assert_array_almost_equal(interp(sample), wanted) sample = np.asarray([0.1, 0.4, 0.6, 0.9]) wanted = 1055. assert_array_almost_equal(interp(sample), wanted) def test_linear_edges(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values) sample = np.asarray([[0., 0., 0., 0.], [1., 1., 1., 1.]]) wanted = np.asarray([0., 1111.]) assert_array_almost_equal(interp(sample), wanted) def test_valid_create(self): # create a 2d grid of 3 points in each dimension points = [(0., .5, 1.), (0., 1., .5)] values = np.asarray([0., .5, 1.]) values0 = values[:, np.newaxis] values1 = values[np.newaxis, :] values = (values0 + values1 * 10) assert_raises(ValueError, RegularGridInterpolator, points, values) points = [((0., .5, 1.), ), (0., .5, 1.)] assert_raises(ValueError, RegularGridInterpolator, points, values) points = [(0., .5, .75, 1.), (0., .5, 1.)] assert_raises(ValueError, RegularGridInterpolator, points, values) points = [(0., .5, 1.), (0., .5, 1.), (0., .5, 1.)] assert_raises(ValueError, RegularGridInterpolator, points, values) points = [(0., .5, 1.), (0., .5, 1.)] assert_raises(ValueError, RegularGridInterpolator, points, values, method="undefmethod") def test_valid_call(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values) sample = np.asarray([[0., 0., 0., 0.], [1., 1., 1., 1.]]) assert_raises(ValueError, interp, sample, "undefmethod") sample = np.asarray([[0., 0., 0.], [1., 1., 1.]]) assert_raises(ValueError, interp, sample) sample = np.asarray([[0., 0., 0., 0.], [1., 1., 1., 1.1]]) assert_raises(ValueError, interp, sample) def test_out_of_bounds_extrap(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values, bounds_error=False, fill_value=None) sample = np.asarray([[-.1, -.1, -.1, -.1], [1.1, 1.1, 1.1, 1.1], [21, 2.1, -1.1, -11], [2.1, 2.1, -1.1, -1.1]]) wanted = np.asarray([0., 1111., 11., 11.]) assert_array_almost_equal(interp(sample, method="nearest"), wanted) wanted = np.asarray([-111.1, 1222.1, -11068., -1186.9]) assert_array_almost_equal(interp(sample, method="linear"), wanted) def test_out_of_bounds_extrap2(self): points, values = self._get_sample_4d_2() interp = RegularGridInterpolator(points, values, bounds_error=False, fill_value=None) sample = np.asarray([[-.1, -.1, -.1, -.1], [1.1, 1.1, 1.1, 1.1], [21, 2.1, -1.1, -11], [2.1, 2.1, -1.1, -1.1]]) wanted = np.asarray([0., 11., 11., 11.]) assert_array_almost_equal(interp(sample, method="nearest"), wanted) wanted = np.asarray([-12.1, 133.1, -1069., -97.9]) assert_array_almost_equal(interp(sample, method="linear"), wanted) def test_out_of_bounds_fill(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values, bounds_error=False, fill_value=np.nan) sample = np.asarray([[-.1, -.1, -.1, -.1], [1.1, 1.1, 1.1, 1.1], [2.1, 2.1, -1.1, -1.1]]) wanted = np.asarray([np.nan, np.nan, np.nan]) assert_array_almost_equal(interp(sample, method="nearest"), wanted) assert_array_almost_equal(interp(sample, method="linear"), wanted) sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) wanted = np.asarray([1001.1, 846.2, 555.5]) assert_array_almost_equal(interp(sample), wanted) def test_nearest_compare_qhull(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values, method="nearest") points_qhull = itertools.product(*points) points_qhull = [p for p in points_qhull] points_qhull = np.asarray(points_qhull) values_qhull = values.reshape(-1) interp_qhull = NearestNDInterpolator(points_qhull, values_qhull) sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) assert_array_almost_equal(interp(sample), interp_qhull(sample)) def test_linear_compare_qhull(self): points, values = self._get_sample_4d() interp = RegularGridInterpolator(points, values) points_qhull = itertools.product(*points) points_qhull = [p for p in points_qhull] points_qhull = np.asarray(points_qhull) values_qhull = values.reshape(-1) interp_qhull = LinearNDInterpolator(points_qhull, values_qhull) sample = np.asarray([[0.1, 0.1, 1., .9], [0.2, 0.1, .45, .8], [0.5, 0.5, .5, .5]]) assert_array_almost_equal(interp(sample), interp_qhull(sample)) def test_duck_typed_values(self): x = np.linspace(0, 2, 5) y = np.linspace(0, 1, 7) values = MyValue((5, 7)) for method in ('nearest', 'linear'): interp = RegularGridInterpolator((x, y), values, method=method) v1 = interp([0.4, 0.7]) interp = RegularGridInterpolator((x, y), values._v, method=method) v2 = interp([0.4, 0.7]) assert_allclose(v1, v2) def test_invalid_fill_value(self): np.random.seed(1234) x = np.linspace(0, 2, 5) y = np.linspace(0, 1, 7) values = np.random.rand(5, 7) # integers can be cast to floats RegularGridInterpolator((x, y), values, fill_value=1) # complex values cannot assert_raises(ValueError, RegularGridInterpolator, (x, y), values, fill_value=1+2j) def test_fillvalue_type(self): # from #3703; test that interpolator object construction succeeds values = np.ones((10, 20, 30), dtype='>f4') points = [np.arange(n) for n in values.shape] xi = [(1, 1, 1)] interpolator = RegularGridInterpolator(points, values) interpolator = RegularGridInterpolator(points, values, fill_value=0.) class MyValue(object): """ Minimal indexable object """ def __init__(self, shape): self.ndim = 2 self.shape = shape self._v = np.arange(np.prod(shape)).reshape(shape) def __getitem__(self, idx): return self._v[idx] def __array_interface__(self): return None def __array__(self): raise RuntimeError("No array representation") class TestInterpN(object): def _sample_2d_data(self): x = np.arange(1, 6) x = np.array([.5, 2., 3., 4., 5.5]) y = np.arange(1, 6) y = np.array([.5, 2., 3., 4., 5.5]) z = np.array([[1, 2, 1, 2, 1], [1, 2, 1, 2, 1], [1, 2, 3, 2, 1], [1, 2, 2, 2, 1], [1, 2, 1, 2, 1]]) return x, y, z def test_spline_2d(self): x, y, z = self._sample_2d_data() lut = RectBivariateSpline(x, y, z) xi = np.array([[1, 2.3, 5.3, 0.5, 3.3, 1.2, 3], [1, 3.3, 1.2, 4.0, 5.0, 1.0, 3]]).T assert_array_almost_equal(interpn((x, y), z, xi, method="splinef2d"), lut.ev(xi[:, 0], xi[:, 1])) def test_list_input(self): x, y, z = self._sample_2d_data() xi = np.array([[1, 2.3, 5.3, 0.5, 3.3, 1.2, 3], [1, 3.3, 1.2, 4.0, 5.0, 1.0, 3]]).T for method in ['nearest', 'linear', 'splinef2d']: v1 = interpn((x, y), z, xi, method=method) v2 = interpn((x.tolist(), y.tolist()), z.tolist(), xi.tolist(), method=method) assert_allclose(v1, v2, err_msg=method) def test_spline_2d_outofbounds(self): x = np.array([.5, 2., 3., 4., 5.5]) y = np.array([.5, 2., 3., 4., 5.5]) z = np.array([[1, 2, 1, 2, 1], [1, 2, 1, 2, 1], [1, 2, 3, 2, 1], [1, 2, 2, 2, 1], [1, 2, 1, 2, 1]]) lut = RectBivariateSpline(x, y, z) xi = np.array([[1, 2.3, 6.3, 0.5, 3.3, 1.2, 3], [1, 3.3, 1.2, -4.0, 5.0, 1.0, 3]]).T actual = interpn((x, y), z, xi, method="splinef2d", bounds_error=False, fill_value=999.99) expected = lut.ev(xi[:, 0], xi[:, 1]) expected[2:4] = 999.99 assert_array_almost_equal(actual, expected) # no extrapolation for splinef2d assert_raises(ValueError, interpn, (x, y), z, xi, method="splinef2d", bounds_error=False, fill_value=None) def _sample_4d_data(self): points = [(0., .5, 1.)] * 2 + [(0., 5., 10.)] * 2 values = np.asarray([0., .5, 1.]) values0 = values[:, np.newaxis, np.newaxis, np.newaxis] values1 = values[np.newaxis, :, np.newaxis, np.newaxis] values2 = values[np.newaxis, np.newaxis, :, np.newaxis] values3 = values[np.newaxis, np.newaxis, np.newaxis, :] values = (values0 + values1 * 10 + values2 * 100 + values3 * 1000) return points, values def test_linear_4d(self): # create a 4d grid of 3 points in each dimension points, values = self._sample_4d_data() interp_rg = RegularGridInterpolator(points, values) sample = np.asarray([[0.1, 0.1, 10., 9.]]) wanted = interpn(points, values, sample, method="linear") assert_array_almost_equal(interp_rg(sample), wanted) def test_4d_linear_outofbounds(self): # create a 4d grid of 3 points in each dimension points, values = self._sample_4d_data() sample = np.asarray([[0.1, -0.1, 10.1, 9.]]) wanted = 999.99 actual = interpn(points, values, sample, method="linear", bounds_error=False, fill_value=999.99) assert_array_almost_equal(actual, wanted) def test_nearest_4d(self): # create a 4d grid of 3 points in each dimension points, values = self._sample_4d_data() interp_rg = RegularGridInterpolator(points, values, method="nearest") sample = np.asarray([[0.1, 0.1, 10., 9.]]) wanted = interpn(points, values, sample, method="nearest") assert_array_almost_equal(interp_rg(sample), wanted) def test_4d_nearest_outofbounds(self): # create a 4d grid of 3 points in each dimension points, values = self._sample_4d_data() sample = np.asarray([[0.1, -0.1, 10.1, 9.]]) wanted = 999.99 actual = interpn(points, values, sample, method="nearest", bounds_error=False, fill_value=999.99) assert_array_almost_equal(actual, wanted) def test_xi_1d(self): # verify that 1D xi works as expected points, values = self._sample_4d_data() sample = np.asarray([0.1, 0.1, 10., 9.]) v1 = interpn(points, values, sample, bounds_error=False) v2 = interpn(points, values, sample[None,:], bounds_error=False) assert_allclose(v1, v2) def test_xi_nd(self): # verify that higher-d xi works as expected points, values = self._sample_4d_data() np.random.seed(1234) sample = np.random.rand(2, 3, 4) v1 = interpn(points, values, sample, method='nearest', bounds_error=False) assert_equal(v1.shape, (2, 3)) v2 = interpn(points, values, sample.reshape(-1, 4), method='nearest', bounds_error=False) assert_allclose(v1, v2.reshape(v1.shape)) def test_xi_broadcast(self): # verify that the interpolators broadcast xi x, y, values = self._sample_2d_data() points = (x, y) xi = np.linspace(0, 1, 2) yi = np.linspace(0, 3, 3) for method in ['nearest', 'linear', 'splinef2d']: sample = (xi[:,None], yi[None,:]) v1 = interpn(points, values, sample, method=method, bounds_error=False) assert_equal(v1.shape, (2, 3)) xx, yy = np.meshgrid(xi, yi) sample = np.c_[xx.T.ravel(), yy.T.ravel()] v2 = interpn(points, values, sample, method=method, bounds_error=False) assert_allclose(v1, v2.reshape(v1.shape)) def test_nonscalar_values(self): # Verify that non-scalar valued values also works points, values = self._sample_4d_data() np.random.seed(1234) values = np.random.rand(3, 3, 3, 3, 6) sample = np.random.rand(7, 11, 4) for method in ['nearest', 'linear']: v = interpn(points, values, sample, method=method, bounds_error=False) assert_equal(v.shape, (7, 11, 6), err_msg=method) vs = [interpn(points, values[...,j], sample, method=method, bounds_error=False) for j in range(6)] v2 = np.array(vs).transpose(1, 2, 0) assert_allclose(v, v2, err_msg=method) # Vector-valued splines supported with fitpack assert_raises(ValueError, interpn, points, values, sample, method='splinef2d') def test_complex(self): x, y, values = self._sample_2d_data() points = (x, y) values = values - 2j*values sample = np.array([[1, 2.3, 5.3, 0.5, 3.3, 1.2, 3], [1, 3.3, 1.2, 4.0, 5.0, 1.0, 3]]).T for method in ['linear', 'nearest']: v1 = interpn(points, values, sample, method=method) v2r = interpn(points, values.real, sample, method=method) v2i = interpn(points, values.imag, sample, method=method) v2 = v2r + 1j*v2i assert_allclose(v1, v2) # Complex-valued data not supported by spline2fd _assert_warns(np.ComplexWarning, interpn, points, values, sample, method='splinef2d') def test_duck_typed_values(self): x = np.linspace(0, 2, 5) y = np.linspace(0, 1, 7) values = MyValue((5, 7)) for method in ('nearest', 'linear'): v1 = interpn((x, y), values, [0.4, 0.7], method=method) v2 = interpn((x, y), values._v, [0.4, 0.7], method=method) assert_allclose(v1, v2) def test_matrix_input(self): x = np.linspace(0, 2, 5) y = np.linspace(0, 1, 7) values = np.matrix(np.random.rand(5, 7)) sample = np.random.rand(3, 7, 2) for method in ('nearest', 'linear', 'splinef2d'): v1 = interpn((x, y), values, sample, method=method) v2 = interpn((x, y), np.asarray(values), sample, method=method) assert_allclose(v1, np.asmatrix(v2))
mbayon/TFG-MachineLearning
venv/lib/python3.6/site-packages/scipy/interpolate/tests/test_interpolate.py
Python
mit
102,313
# -*- coding: utf-8 -*- # # Rule # # Blueprint for rule administration. # # Created by dp on 2014-12-25. # ================================================================================ # from flask.blueprints import Blueprint from flask.globals import g from wtforms.fields.core import SelectField from wtforms.fields.simple import TextField from wtforms.validators import DataRequired from core.navigation.menu import menubar, contextmenu from core.security.role import Role from core.security.rule import Rule from core.rendering import DefaultForm, render, create_form, mismatch, delete_form, \ update_form from core.utility.localization import localize blueprint = Blueprint("rule-controller", __name__) # Forms # -------------------------------------------------------------------------------- # class FormRule(DefaultForm): route = TextField(localize("core", "rules.field_route"), validators = [DataRequired()]) role_id = SelectField(localize("core", "rules.field_role"), coerce = int) insert = SelectField(localize("core", "rules.field_insert"), choices = [(item, item) for item in Rule.permissions]) remove = SelectField(localize("core", "rules.field_remove"), choices = [(item, item) for item in Rule.permissions]) change = SelectField(localize("core", "rules.field_change"), choices = [(item, item) for item in Rule.permissions]) view = SelectField(localize("core", "rules.field_view"), choices = [(item, item) for item in Rule.permissions]) # Default route: View a list of all rules # -------------------------------------------------------------------------------- # @blueprint.route("/rules", methods = ["GET"]) def entries(): navigation = menubar("administration", g.role.id) items = Rule.all() actions = menubar("rule", g.role.id) for item in items: item.actions = contextmenu("rule", g.role.id) return render("core/administration/rule-list.html", navigation = navigation, items = items, actions = actions) # Create Rule # -------------------------------------------------------------------------------- # @blueprint.route("/rules/create", methods = ["GET", "POST"]) def create(): navigation = menubar("administration", g.role.id) item = Rule() form = FormRule() form.role_id.choices = [(role.id, role.name) for role in Role.all()] headline = localize("core", "rules.create_headline") message = localize("core", "rules.create_success") return create_form(item, form, headline, message, "/rules", template = "core/administration/rule-form.html", navigation = navigation) # Delete Rule # -------------------------------------------------------------------------------- # @blueprint.route("/rules/<identifier>/delete", methods = ["GET", "POST"]) def delete(identifier): navigation = menubar("administration", g.role.id) item = Rule.get(int(identifier)) if not item: return mismatch() headline = localize("core", "rules.delete_headline") text = localize("core", "rules.delete_description") % (item.route) message = localize("core", "rules.delete_success") return delete_form(item, headline, text, message, "/rules", template = "core/administration/confirm.html", navigation = navigation) # Edit Rule # -------------------------------------------------------------------------------- # @blueprint.route("/rules/<identifier>/update", methods = ["GET", "POST"]) def update(identifier): navigation = menubar("administration", g.role.id) item = Rule.get(int(identifier)) if not item: return mismatch() form = FormRule(obj = item) form.role_id.choices = [(role.id, role.name) for role in Role.all()] headline = localize("core", "rules.update_headline") message = localize("core", "rules.update_success") return update_form(item, form, headline, message, "/rules", template = "core/administration/rule-form.html", navigation = navigation)
dpetter/Eowyne
src/core/administration/rules.py
Python
gpl-2.0
4,258
"""Functions to plot M/EEG data e.g. topographies """ from __future__ import print_function # Authors: Alexandre Gramfort <[email protected]> # Denis Engemann <[email protected]> # Martin Luessi <[email protected]> # Eric Larson <[email protected]> # # License: Simplified BSD import math import copy from functools import partial import numpy as np from scipy import linalg from ..baseline import rescale from ..io.constants import FIFF from ..io.pick import pick_types from ..utils import _clean_names, _time_mask, verbose, logger from .utils import (tight_layout, _setup_vmin_vmax, _prepare_trellis, _check_delayed_ssp, _draw_proj_checkbox, figure_nobar, plt_show) from ..time_frequency import compute_epochs_psd from ..defaults import _handle_default from ..channels.layout import _find_topomap_coords from ..fixes import _get_argrelmax from ..externals.six import string_types def _prepare_topo_plot(inst, ch_type, layout): """"Aux Function""" info = copy.deepcopy(inst.info) if layout is None and ch_type is not 'eeg': from ..channels import find_layout layout = find_layout(info) elif layout == 'auto': layout = None info['ch_names'] = _clean_names(info['ch_names']) for ii, this_ch in enumerate(info['chs']): this_ch['ch_name'] = info['ch_names'][ii] # special case for merging grad channels if (ch_type == 'grad' and FIFF.FIFFV_COIL_VV_PLANAR_T1 in np.unique([ch['coil_type'] for ch in info['chs']])): from ..channels.layout import _pair_grad_sensors picks, pos = _pair_grad_sensors(info, layout) merge_grads = True else: merge_grads = False if ch_type == 'eeg': picks = pick_types(info, meg=False, eeg=True, ref_meg=False, exclude='bads') else: picks = pick_types(info, meg=ch_type, ref_meg=False, exclude='bads') if len(picks) == 0: raise ValueError("No channels of type %r" % ch_type) if layout is None: pos = _find_topomap_coords(info, picks) else: names = [n.upper() for n in layout.names] pos = list() for pick in picks: this_name = info['ch_names'][pick].upper() if this_name in names: pos.append(layout.pos[names.index(this_name)]) else: logger.warning('Failed to locate %s channel positions from' ' layout. Inferring channel positions from ' 'data.' % ch_type) pos = _find_topomap_coords(info, picks) break ch_names = [info['ch_names'][k] for k in picks] if merge_grads: # change names so that vectorview combined grads appear as MEG014x # instead of MEG0142 or MEG0143 which are the 2 planar grads. ch_names = [ch_names[k][:-1] + 'x' for k in range(0, len(ch_names), 2)] pos = np.array(pos)[:, :2] # 2D plot, otherwise interpolation bugs return picks, pos, merge_grads, ch_names, ch_type def _plot_update_evoked_topomap(params, bools): """ Helper to update topomaps """ projs = [proj for ii, proj in enumerate(params['projs']) if ii in np.where(bools)[0]] params['proj_bools'] = bools new_evoked = params['evoked'].copy() new_evoked.info['projs'] = [] new_evoked.add_proj(projs) new_evoked.apply_proj() data = new_evoked.data[np.ix_(params['picks'], params['time_idx'])] * params['scale'] if params['merge_grads']: from ..channels.layout import _merge_grad_data data = _merge_grad_data(data) image_mask = params['image_mask'] pos_x, pos_y = np.asarray(params['pos'])[:, :2].T xi = np.linspace(pos_x.min(), pos_x.max(), params['res']) yi = np.linspace(pos_y.min(), pos_y.max(), params['res']) Xi, Yi = np.meshgrid(xi, yi) for ii, im in enumerate(params['images']): Zi = _griddata(pos_x, pos_y, data[:, ii], Xi, Yi) Zi[~image_mask] = np.nan im.set_data(Zi) for cont in params['contours']: cont.set_array(np.c_[Xi, Yi, Zi]) params['fig'].canvas.draw() def plot_projs_topomap(projs, layout=None, cmap='RdBu_r', sensors=True, colorbar=False, res=64, size=1, show=True, outlines='head', contours=6, image_interp='bilinear', axes=None): """Plot topographic maps of SSP projections Parameters ---------- projs : list of Projection The projections layout : None | Layout | list of Layout Layout instance specifying sensor positions (does not need to be specified for Neuromag data). Or a list of Layout if projections are from different sensor types. cmap : matplotlib colormap Colormap. sensors : bool | str Add markers for sensor locations to the plot. Accepts matplotlib plot format string (e.g., 'r+' for red plusses). If True, a circle will be used (via .add_artist). Defaults to True. colorbar : bool Plot a colorbar. res : int The resolution of the topomap image (n pixels along each side). size : scalar Side length of the topomaps in inches (only applies when plotting multiple topomaps at a time). show : bool Show figure if True. outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. contours : int | False | None The number of contour lines to draw. If 0, no contours will be drawn. image_interp : str The image interpolation to be used. All matplotlib options are accepted. axes : instance of Axes | list | None The axes to plot to. If list, the list must be a list of Axes of the same length as the number of projectors. If instance of Axes, there must be only one projector. Defaults to None. Returns ------- fig : instance of matplotlib figure Figure distributing one image per channel across sensor topography. Notes ----- .. versionadded:: 0.9.0 """ import matplotlib.pyplot as plt if layout is None: from ..channels import read_layout layout = read_layout('Vectorview-all') if not isinstance(layout, list): layout = [layout] n_projs = len(projs) nrows = math.floor(math.sqrt(n_projs)) ncols = math.ceil(n_projs / nrows) if axes is None: plt.figure() axes = list() for idx in range(len(projs)): ax = plt.subplot(nrows, ncols, idx + 1) axes.append(ax) elif isinstance(axes, plt.Axes): axes = [axes] if len(axes) != len(projs): raise RuntimeError('There must be an axes for each picked projector.') for proj_idx, proj in enumerate(projs): axes[proj_idx].set_title(proj['desc'][:10] + '...') ch_names = _clean_names(proj['data']['col_names']) data = proj['data']['data'].ravel() idx = [] for l in layout: is_vv = l.kind.startswith('Vectorview') if is_vv: from ..channels.layout import _pair_grad_sensors_from_ch_names grad_pairs = _pair_grad_sensors_from_ch_names(ch_names) if grad_pairs: ch_names = [ch_names[i] for i in grad_pairs] idx = [l.names.index(c) for c in ch_names if c in l.names] if len(idx) == 0: continue pos = l.pos[idx] if is_vv and grad_pairs: from ..channels.layout import _merge_grad_data shape = (len(idx) // 2, 2, -1) pos = pos.reshape(shape).mean(axis=1) data = _merge_grad_data(data[grad_pairs]).ravel() break if len(idx): plot_topomap(data, pos[:, :2], vmax=None, cmap=cmap, sensors=sensors, res=res, axis=axes[proj_idx], outlines=outlines, contours=contours, image_interp=image_interp, show=False) if colorbar: plt.colorbar() else: raise RuntimeError('Cannot find a proper layout for projection %s' % proj['desc']) tight_layout(fig=axes[0].get_figure()) plt_show(show) return axes[0].get_figure() def _check_outlines(pos, outlines, head_pos=None): """Check or create outlines for topoplot """ pos = np.array(pos, float)[:, :2] # ensure we have a copy head_pos = dict() if head_pos is None else head_pos if not isinstance(head_pos, dict): raise TypeError('head_pos must be dict or None') head_pos = copy.deepcopy(head_pos) for key in head_pos.keys(): if key not in ('center', 'scale'): raise KeyError('head_pos must only contain "center" and ' '"scale"') head_pos[key] = np.array(head_pos[key], float) if head_pos[key].shape != (2,): raise ValueError('head_pos["%s"] must have shape (2,), not ' '%s' % (key, head_pos[key].shape)) if outlines in ('head', 'skirt', None): radius = 0.5 l = np.linspace(0, 2 * np.pi, 101) head_x = np.cos(l) * radius head_y = np.sin(l) * radius nose_x = np.array([0.18, 0, -0.18]) * radius nose_y = np.array([radius - .004, radius * 1.15, radius - .004]) ear_x = np.array([.497, .510, .518, .5299, .5419, .54, .547, .532, .510, .489]) ear_y = np.array([.0555, .0775, .0783, .0746, .0555, -.0055, -.0932, -.1313, -.1384, -.1199]) # shift and scale the electrode positions if 'center' not in head_pos: head_pos['center'] = 0.5 * (pos.max(axis=0) + pos.min(axis=0)) pos -= head_pos['center'] if outlines is not None: # Define the outline of the head, ears and nose outlines_dict = dict(head=(head_x, head_y), nose=(nose_x, nose_y), ear_left=(ear_x, ear_y), ear_right=(-ear_x, ear_y)) else: outlines_dict = dict() if outlines == 'skirt': if 'scale' not in head_pos: # By default, fit electrodes inside the head circle head_pos['scale'] = 1.0 / (pos.max(axis=0) - pos.min(axis=0)) pos *= head_pos['scale'] # Make the figure encompass slightly more than all points mask_scale = 1.25 * (pos.max(axis=0) - pos.min(axis=0)) outlines_dict['autoshrink'] = False outlines_dict['mask_pos'] = (mask_scale[0] * head_x, mask_scale[1] * head_y) outlines_dict['clip_radius'] = (mask_scale / 2.) else: if 'scale' not in head_pos: # The default is to make the points occupy a slightly smaller # proportion (0.85) of the total width and height # this number was empirically determined (seems to work well) head_pos['scale'] = 0.85 / (pos.max(axis=0) - pos.min(axis=0)) pos *= head_pos['scale'] outlines_dict['autoshrink'] = True outlines_dict['mask_pos'] = head_x, head_y outlines_dict['clip_radius'] = (0.5, 0.5) outlines = outlines_dict elif isinstance(outlines, dict): if 'mask_pos' not in outlines: raise ValueError('You must specify the coordinates of the image' 'mask') else: raise ValueError('Invalid value for `outlines') return pos, outlines def _griddata(x, y, v, xi, yi): """Aux function""" xy = x.ravel() + y.ravel() * -1j d = xy[None, :] * np.ones((len(xy), 1)) d = np.abs(d - d.T) n = d.shape[0] d.flat[::n + 1] = 1. g = (d * d) * (np.log(d) - 1.) g.flat[::n + 1] = 0. weights = linalg.solve(g, v.ravel()) m, n = xi.shape zi = np.zeros_like(xi) xy = xy.T g = np.empty(xy.shape) for i in range(m): for j in range(n): d = np.abs(xi[i, j] + -1j * yi[i, j] - xy) mask = np.where(d == 0)[0] if len(mask): d[mask] = 1. np.log(d, out=g) g -= 1. g *= d * d if len(mask): g[mask] = 0. zi[i, j] = g.dot(weights) return zi def _plot_sensors(pos_x, pos_y, sensors, ax): """Aux function""" from matplotlib.patches import Circle if sensors is True: for x, y in zip(pos_x, pos_y): ax.add_artist(Circle(xy=(x, y), radius=0.003, color='k')) else: ax.plot(pos_x, pos_y, sensors) def plot_topomap(data, pos, vmin=None, vmax=None, cmap='RdBu_r', sensors=True, res=64, axis=None, names=None, show_names=False, mask=None, mask_params=None, outlines='head', image_mask=None, contours=6, image_interp='bilinear', show=True, head_pos=None, onselect=None): """Plot a topographic map as image Parameters ---------- data : array, length = n_points The data values to plot. pos : array, shape = (n_points, 2) For each data point, the x and y coordinates. vmin : float | callable | None The value specifying the lower bound of the color range. If None, and vmax is None, -vmax is used. Else np.min(data). If callable, the output equals vmin(data). Defaults to None. vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum absolute value is used. If callable, the output equals vmax(data). Defaults to None. cmap : matplotlib colormap Colormap. sensors : bool | str Add markers for sensor locations to the plot. Accepts matplotlib plot format string (e.g., 'r+' for red plusses). If True, a circle will be used (via .add_artist). Defaults to True. res : int The resolution of the topomap image (n pixels along each side). axis : instance of Axis | None The axis to plot to. If None, the current axis will be used. names : list | None List of channel names. If None, channel names are not plotted. show_names : bool | callable If True, show channel names on top of the map. If a callable is passed, channel names will be formatted using the callable; e.g., to delete the prefix 'MEG ' from all channel names, pass the function lambda x: x.replace('MEG ', ''). If `mask` is not None, only significant sensors will be shown. mask : ndarray of bool, shape (n_channels, n_times) | None The channels to be marked as significant at a given time point. Indices set to `True` will be considered. Defaults to None. mask_params : dict | None Additional plotting parameters for plotting significant sensors. Default (None) equals:: dict(marker='o', markerfacecolor='w', markeredgecolor='k', linewidth=0, markersize=4) outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. image_mask : ndarray of bool, shape (res, res) | None The image mask to cover the interpolated surface. If None, it will be computed from the outline. contours : int | False | None The number of contour lines to draw. If 0, no contours will be drawn. image_interp : str The image interpolation to be used. All matplotlib options are accepted. show : bool Show figure if True. head_pos : dict | None If None (default), the sensors are positioned such that they span the head circle. If dict, can have entries 'center' (tuple) and 'scale' (tuple) for what the center and scale of the head should be relative to the electrode locations. onselect : callable | None Handle for a function that is called when the user selects a set of channels by rectangle selection (matplotlib ``RectangleSelector``). If None interactive selection is disabled. Defaults to None. Returns ------- im : matplotlib.image.AxesImage The interpolated data. cn : matplotlib.contour.ContourSet The fieldlines. """ import matplotlib.pyplot as plt from matplotlib.widgets import RectangleSelector data = np.asarray(data) if data.ndim > 1: raise ValueError("Data needs to be array of shape (n_sensors,); got " "shape %s." % str(data.shape)) # Give a helpful error message for common mistakes regarding the position # matrix. pos_help = ("Electrode positions should be specified as a 2D array with " "shape (n_channels, 2). Each row in this matrix contains the " "(x, y) position of an electrode.") if pos.ndim != 2: error = ("{ndim}D array supplied as electrode positions, where a 2D " "array was expected").format(ndim=pos.ndim) raise ValueError(error + " " + pos_help) elif pos.shape[1] == 3: error = ("The supplied electrode positions matrix contains 3 columns. " "Are you trying to specify XYZ coordinates? Perhaps the " "mne.channels.create_eeg_layout function is useful for you.") raise ValueError(error + " " + pos_help) # No error is raised in case of pos.shape[1] == 4. In this case, it is # assumed the position matrix contains both (x, y) and (width, height) # values, such as Layout.pos. elif pos.shape[1] == 1 or pos.shape[1] > 4: raise ValueError(pos_help) if len(data) != len(pos): raise ValueError("Data and pos need to be of same length. Got data of " "length %s, pos of length %s" % (len(data), len(pos))) vmin, vmax = _setup_vmin_vmax(data, vmin, vmax) pos, outlines = _check_outlines(pos, outlines, head_pos) pos_x = pos[:, 0] pos_y = pos[:, 1] ax = axis if axis else plt.gca() ax.set_xticks([]) ax.set_yticks([]) ax.set_frame_on(False) if any([not pos_y.any(), not pos_x.any()]): raise RuntimeError('No position information found, cannot compute ' 'geometries for topomap.') if outlines is None: xmin, xmax = pos_x.min(), pos_x.max() ymin, ymax = pos_y.min(), pos_y.max() else: xlim = np.inf, -np.inf, ylim = np.inf, -np.inf, mask_ = np.c_[outlines['mask_pos']] xmin, xmax = (np.min(np.r_[xlim[0], mask_[:, 0]]), np.max(np.r_[xlim[1], mask_[:, 0]])) ymin, ymax = (np.min(np.r_[ylim[0], mask_[:, 1]]), np.max(np.r_[ylim[1], mask_[:, 1]])) # interpolate data xi = np.linspace(xmin, xmax, res) yi = np.linspace(ymin, ymax, res) Xi, Yi = np.meshgrid(xi, yi) Zi = _griddata(pos_x, pos_y, data, Xi, Yi) if outlines is None: _is_default_outlines = False elif isinstance(outlines, dict): _is_default_outlines = any(k.startswith('head') for k in outlines) if _is_default_outlines and image_mask is None: # prepare masking image_mask, pos = _make_image_mask(outlines, pos, res) mask_params = _handle_default('mask_params', mask_params) # plot outline linewidth = mask_params['markeredgewidth'] patch = None if 'patch' in outlines: patch = outlines['patch'] patch_ = patch() if callable(patch) else patch patch_.set_clip_on(False) ax.add_patch(patch_) ax.set_transform(ax.transAxes) ax.set_clip_path(patch_) # plot map and countour im = ax.imshow(Zi, cmap=cmap, vmin=vmin, vmax=vmax, origin='lower', aspect='equal', extent=(xmin, xmax, ymin, ymax), interpolation=image_interp) # This tackles an incomprehensible matplotlib bug if no contours are # drawn. To avoid rescalings, we will always draw contours. # But if no contours are desired we only draw one and make it invisible . no_contours = False if contours in (False, None): contours, no_contours = 1, True cont = ax.contour(Xi, Yi, Zi, contours, colors='k', linewidths=linewidth) if no_contours is True: for col in cont.collections: col.set_visible(False) if _is_default_outlines: from matplotlib import patches patch_ = patches.Ellipse((0, 0), 2 * outlines['clip_radius'][0], 2 * outlines['clip_radius'][1], clip_on=True, transform=ax.transData) if _is_default_outlines or patch is not None: im.set_clip_path(patch_) # ax.set_clip_path(patch_) if cont is not None: for col in cont.collections: col.set_clip_path(patch_) if sensors is not False and mask is None: _plot_sensors(pos_x, pos_y, sensors=sensors, ax=ax) elif sensors and mask is not None: idx = np.where(mask)[0] ax.plot(pos_x[idx], pos_y[idx], **mask_params) idx = np.where(~mask)[0] _plot_sensors(pos_x[idx], pos_y[idx], sensors=sensors, ax=ax) elif not sensors and mask is not None: idx = np.where(mask)[0] ax.plot(pos_x[idx], pos_y[idx], **mask_params) if isinstance(outlines, dict): outlines_ = dict([(k, v) for k, v in outlines.items() if k not in ['patch', 'autoshrink']]) for k, (x, y) in outlines_.items(): if 'mask' in k: continue ax.plot(x, y, color='k', linewidth=linewidth, clip_on=False) if show_names: if show_names is True: def _show_names(x): return x else: _show_names = show_names show_idx = np.arange(len(names)) if mask is None else np.where(mask)[0] for ii, (p, ch_id) in enumerate(zip(pos, names)): if ii not in show_idx: continue ch_id = _show_names(ch_id) ax.text(p[0], p[1], ch_id, horizontalalignment='center', verticalalignment='center', size='x-small') plt.subplots_adjust(top=.95) if onselect is not None: ax.RS = RectangleSelector(ax, onselect=onselect) plt_show(show) return im, cont def _make_image_mask(outlines, pos, res): """Aux function """ mask_ = np.c_[outlines['mask_pos']] xmin, xmax = (np.min(np.r_[np.inf, mask_[:, 0]]), np.max(np.r_[-np.inf, mask_[:, 0]])) ymin, ymax = (np.min(np.r_[np.inf, mask_[:, 1]]), np.max(np.r_[-np.inf, mask_[:, 1]])) if outlines.get('autoshrink', False) is not False: inside = _inside_contour(pos, mask_) outside = np.invert(inside) outlier_points = pos[outside] while np.any(outlier_points): # auto shrink pos *= 0.99 inside = _inside_contour(pos, mask_) outside = np.invert(inside) outlier_points = pos[outside] image_mask = np.zeros((res, res), dtype=bool) xi_mask = np.linspace(xmin, xmax, res) yi_mask = np.linspace(ymin, ymax, res) Xi_mask, Yi_mask = np.meshgrid(xi_mask, yi_mask) pos_ = np.c_[Xi_mask.flatten(), Yi_mask.flatten()] inds = _inside_contour(pos_, mask_) image_mask[inds.reshape(image_mask.shape)] = True return image_mask, pos def _inside_contour(pos, contour): """Aux function""" npos = len(pos) x, y = pos[:, :2].T check_mask = np.ones((npos), dtype=bool) check_mask[((x < np.min(x)) | (y < np.min(y)) | (x > np.max(x)) | (y > np.max(y)))] = False critval = 0.1 sel = np.where(check_mask)[0] for this_sel in sel: contourx = contour[:, 0] - pos[this_sel, 0] contoury = contour[:, 1] - pos[this_sel, 1] angle = np.arctan2(contoury, contourx) angle = np.unwrap(angle) total = np.sum(np.diff(angle)) check_mask[this_sel] = np.abs(total) > critval return check_mask def plot_ica_components(ica, picks=None, ch_type=None, res=64, layout=None, vmin=None, vmax=None, cmap='RdBu_r', sensors=True, colorbar=False, title=None, show=True, outlines='head', contours=6, image_interp='bilinear', head_pos=None): """Project unmixing matrix on interpolated sensor topogrpahy. Parameters ---------- ica : instance of mne.preprocessing.ICA The ICA solution. picks : int | array-like | None The indices of the sources to be plotted. If None all are plotted in batches of 20. ch_type : 'mag' | 'grad' | 'planar1' | 'planar2' | 'eeg' | None The channel type to plot. For 'grad', the gradiometers are collected in pairs and the RMS for each pair is plotted. If None, then channels are chosen in the order given above. res : int The resolution of the topomap image (n pixels along each side). layout : None | Layout Layout instance specifying sensor positions (does not need to be specified for Neuromag data). If possible, the correct layout is inferred from the data. vmin : float | callable | None The value specifying the lower bound of the color range. If None, and vmax is None, -vmax is used. Else np.min(data). If callable, the output equals vmin(data). Defaults to None. vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum absolute value is used. If callable, the output equals vmax(data). Defaults to None. cmap : matplotlib colormap Colormap. sensors : bool | str Add markers for sensor locations to the plot. Accepts matplotlib plot format string (e.g., 'r+' for red plusses). If True, a circle will be used (via .add_artist). Defaults to True. colorbar : bool Plot a colorbar. title : str | None Title to use. show : bool Show figure if True. outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. contours : int | False | None The number of contour lines to draw. If 0, no contours will be drawn. image_interp : str The image interpolation to be used. All matplotlib options are accepted. head_pos : dict | None If None (default), the sensors are positioned such that they span the head circle. If dict, can have entries 'center' (tuple) and 'scale' (tuple) for what the center and scale of the head should be relative to the electrode locations. Returns ------- fig : instance of matplotlib.pyplot.Figure or list The figure object(s). """ import matplotlib.pyplot as plt from mpl_toolkits.axes_grid import make_axes_locatable from ..channels import _get_ch_type if picks is None: # plot components by sets of 20 ch_type = _get_ch_type(ica, ch_type) n_components = ica.mixing_matrix_.shape[1] p = 20 figs = [] for k in range(0, n_components, p): picks = range(k, min(k + p, n_components)) fig = plot_ica_components(ica, picks=picks, ch_type=ch_type, res=res, layout=layout, vmax=vmax, cmap=cmap, sensors=sensors, colorbar=colorbar, title=title, show=show, outlines=outlines, contours=contours, image_interp=image_interp) figs.append(fig) return figs elif np.isscalar(picks): picks = [picks] ch_type = _get_ch_type(ica, ch_type) data = np.dot(ica.mixing_matrix_[:, picks].T, ica.pca_components_[:ica.n_components_]) if ica.info is None: raise RuntimeError('The ICA\'s measurement info is missing. Please ' 'fit the ICA or add the corresponding info object.') data_picks, pos, merge_grads, names, _ = _prepare_topo_plot(ica, ch_type, layout) pos, outlines = _check_outlines(pos, outlines, head_pos) if outlines not in (None, 'head'): image_mask, pos = _make_image_mask(outlines, pos, res) else: image_mask = None data = np.atleast_2d(data) data = data[:, data_picks] # prepare data for iteration fig, axes = _prepare_trellis(len(data), max_col=5) if title is None: title = 'ICA components' fig.suptitle(title) if merge_grads: from ..channels.layout import _merge_grad_data for ii, data_, ax in zip(picks, data, axes): ax.set_title('IC #%03d' % ii, fontsize=12) data_ = _merge_grad_data(data_) if merge_grads else data_ vmin_, vmax_ = _setup_vmin_vmax(data_, vmin, vmax) im = plot_topomap(data_.flatten(), pos, vmin=vmin_, vmax=vmax_, res=res, axis=ax, cmap=cmap, outlines=outlines, image_mask=image_mask, contours=contours, image_interp=image_interp, show=False)[0] if colorbar: divider = make_axes_locatable(ax) cax = divider.append_axes("right", size="5%", pad=0.05) cbar = plt.colorbar(im, cax=cax, format='%3.2f', cmap=cmap) cbar.ax.tick_params(labelsize=12) cbar.set_ticks((vmin_, vmax_)) cbar.ax.set_title('AU', fontsize=10) ax.set_yticks([]) ax.set_xticks([]) ax.set_frame_on(False) tight_layout(fig=fig) fig.subplots_adjust(top=0.95) fig.canvas.draw() plt_show(show) return fig def plot_tfr_topomap(tfr, tmin=None, tmax=None, fmin=None, fmax=None, ch_type=None, baseline=None, mode='mean', layout=None, vmin=None, vmax=None, cmap=None, sensors=True, colorbar=True, unit=None, res=64, size=2, cbar_fmt='%1.1e', show_names=False, title=None, axes=None, show=True, outlines='head', head_pos=None): """Plot topographic maps of specific time-frequency intervals of TFR data Parameters ---------- tfr : AvereageTFR The AvereageTFR object. tmin : None | float The first time instant to display. If None the first time point available is used. tmax : None | float The last time instant to display. If None the last time point available is used. fmin : None | float The first frequency to display. If None the first frequency available is used. fmax : None | float The last frequency to display. If None the last frequency available is used. ch_type : 'mag' | 'grad' | 'planar1' | 'planar2' | 'eeg' | None The channel type to plot. For 'grad', the gradiometers are collected in pairs and the RMS for each pair is plotted. If None, then channels are chosen in the order given above. baseline : tuple or list of length 2 The time interval to apply rescaling / baseline correction. If None do not apply it. If baseline is (a, b) the interval is between "a (s)" and "b (s)". If a is None the beginning of the data is used and if b is None then b is set to the end of the interval. If baseline is equal to (None, None) all the time interval is used. mode : 'logratio' | 'ratio' | 'zscore' | 'mean' | 'percent' Do baseline correction with ratio (power is divided by mean power during baseline) or z-score (power is divided by standard deviation of power during baseline after subtracting the mean, power = [power - mean(power_baseline)] / std(power_baseline)) If None, baseline no correction will be performed. layout : None | Layout Layout instance specifying sensor positions (does not need to be specified for Neuromag data). If possible, the correct layout file is inferred from the data; if no appropriate layout file was found, the layout is automatically generated from the sensor locations. vmin : float | callable | None The value specifying the lower bound of the color range. If None, and vmax is None, -vmax is used. Else np.min(data) or in case data contains only positive values 0. If callable, the output equals vmin(data). Defaults to None. vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum value is used. If callable, the output equals vmax(data). Defaults to None. cmap : matplotlib colormap | None Colormap. If None and the plotted data is all positive, defaults to 'Reds'. If None and data contains also negative values, defaults to 'RdBu_r'. Defaults to None. sensors : bool | str Add markers for sensor locations to the plot. Accepts matplotlib plot format string (e.g., 'r+' for red plusses). If True, a circle will be used (via .add_artist). Defaults to True. colorbar : bool Plot a colorbar. unit : str | None The unit of the channel type used for colorbar labels. res : int The resolution of the topomap image (n pixels along each side). size : float Side length per topomap in inches. cbar_fmt : str String format for colorbar values. show_names : bool | callable If True, show channel names on top of the map. If a callable is passed, channel names will be formatted using the callable; e.g., to delete the prefix 'MEG ' from all channel names, pass the function lambda x: x.replace('MEG ', ''). If `mask` is not None, only significant sensors will be shown. title : str | None Title. If None (default), no title is displayed. axes : instance of Axis | None The axes to plot to. If None the axes is defined automatically. show : bool Show figure if True. outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. head_pos : dict | None If None (default), the sensors are positioned such that they span the head circle. If dict, can have entries 'center' (tuple) and 'scale' (tuple) for what the center and scale of the head should be relative to the electrode locations. Returns ------- fig : matplotlib.figure.Figure The figure containing the topography. """ from ..channels import _get_ch_type ch_type = _get_ch_type(tfr, ch_type) import matplotlib.pyplot as plt from mpl_toolkits.axes_grid1 import make_axes_locatable picks, pos, merge_grads, names, _ = _prepare_topo_plot(tfr, ch_type, layout) if not show_names: names = None data = tfr.data if mode is not None and baseline is not None: data = rescale(data, tfr.times, baseline, mode, copy=True) # crop time itmin, itmax = None, None idx = np.where(_time_mask(tfr.times, tmin, tmax))[0] if tmin is not None: itmin = idx[0] if tmax is not None: itmax = idx[-1] + 1 # crop freqs ifmin, ifmax = None, None idx = np.where(_time_mask(tfr.freqs, fmin, fmax))[0] if fmin is not None: ifmin = idx[0] if fmax is not None: ifmax = idx[-1] + 1 data = data[picks, ifmin:ifmax, itmin:itmax] data = np.mean(np.mean(data, axis=2), axis=1)[:, np.newaxis] if merge_grads: from ..channels.layout import _merge_grad_data data = _merge_grad_data(data) norm = False if np.min(data) < 0 else True vmin, vmax = _setup_vmin_vmax(data, vmin, vmax, norm) if cmap is None: cmap = 'Reds' if norm else 'RdBu_r' if axes is None: fig = plt.figure() ax = fig.gca() else: fig = axes.figure ax = axes ax.set_yticks([]) ax.set_xticks([]) ax.set_frame_on(False) if title is not None: ax.set_title(title) fig_wrapper = list() selection_callback = partial(_onselect, tfr=tfr, pos=pos, ch_type=ch_type, itmin=itmin, itmax=itmax, ifmin=ifmin, ifmax=ifmax, cmap=cmap, fig=fig_wrapper, layout=layout) im, _ = plot_topomap(data[:, 0], pos, vmin=vmin, vmax=vmax, axis=ax, cmap=cmap, image_interp='bilinear', contours=False, names=names, show_names=show_names, show=False, onselect=selection_callback) if colorbar: divider = make_axes_locatable(ax) cax = divider.append_axes("right", size="5%", pad=0.05) cbar = plt.colorbar(im, cax=cax, format=cbar_fmt, cmap=cmap) cbar.set_ticks((vmin, vmax)) cbar.ax.tick_params(labelsize=12) cbar.ax.set_title('AU') plt_show(show) return fig def plot_evoked_topomap(evoked, times="auto", ch_type=None, layout=None, vmin=None, vmax=None, cmap='RdBu_r', sensors=True, colorbar=True, scale=None, scale_time=1e3, unit=None, res=64, size=1, cbar_fmt='%3.1f', time_format='%01d ms', proj=False, show=True, show_names=False, title=None, mask=None, mask_params=None, outlines='head', contours=6, image_interp='bilinear', average=None, head_pos=None, axes=None): """Plot topographic maps of specific time points of evoked data Parameters ---------- evoked : Evoked The Evoked object. times : float | array of floats | "auto" | "peaks". The time point(s) to plot. If "auto", the number of ``axes`` determines the amount of time point(s). If ``axes`` is also None, 10 topographies will be shown with a regular time spacing between the first and last time instant. If "peaks", finds time points automatically by checking for local maxima in global field power. ch_type : 'mag' | 'grad' | 'planar1' | 'planar2' | 'eeg' | None The channel type to plot. For 'grad', the gradiometers are collected in pairs and the RMS for each pair is plotted. If None, then channels are chosen in the order given above. layout : None | Layout Layout instance specifying sensor positions (does not need to be specified for Neuromag data). If possible, the correct layout file is inferred from the data; if no appropriate layout file was found, the layout is automatically generated from the sensor locations. vmin : float | callable | None The value specifying the lower bound of the color range. If None, and vmax is None, -vmax is used. Else np.min(data). If callable, the output equals vmin(data). Defaults to None. vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum absolute value is used. If callable, the output equals vmax(data). Defaults to None. cmap : matplotlib colormap Colormap. For magnetometers and eeg defaults to 'RdBu_r', else 'Reds'. sensors : bool | str Add markers for sensor locations to the plot. Accepts matplotlib plot format string (e.g., 'r+' for red plusses). If True, a circle will be used (via .add_artist). Defaults to True. colorbar : bool Plot a colorbar. scale : dict | float | None Scale the data for plotting. If None, defaults to 1e6 for eeg, 1e13 for grad and 1e15 for mag. scale_time : float | None Scale the time labels. Defaults to 1e3 (ms). unit : dict | str | None The unit of the channel type used for colorbar label. If scale is None the unit is automatically determined. res : int The resolution of the topomap image (n pixels along each side). size : float Side length per topomap in inches. cbar_fmt : str String format for colorbar values. time_format : str String format for topomap values. Defaults to "%01d ms" proj : bool | 'interactive' If true SSP projections are applied before display. If 'interactive', a check box for reversible selection of SSP projection vectors will be show. show : bool Show figure if True. show_names : bool | callable If True, show channel names on top of the map. If a callable is passed, channel names will be formatted using the callable; e.g., to delete the prefix 'MEG ' from all channel names, pass the function lambda x: x.replace('MEG ', ''). If `mask` is not None, only significant sensors will be shown. title : str | None Title. If None (default), no title is displayed. mask : ndarray of bool, shape (n_channels, n_times) | None The channels to be marked as significant at a given time point. Indicies set to `True` will be considered. Defaults to None. mask_params : dict | None Additional plotting parameters for plotting significant sensors. Default (None) equals:: dict(marker='o', markerfacecolor='w', markeredgecolor='k', linewidth=0, markersize=4) outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. contours : int | False | None The number of contour lines to draw. If 0, no contours will be drawn. image_interp : str The image interpolation to be used. All matplotlib options are accepted. average : float | None The time window around a given time to be used for averaging (seconds). For example, 0.01 would translate into window that starts 5 ms before and ends 5 ms after a given time point. Defaults to None, which means no averaging. head_pos : dict | None If None (default), the sensors are positioned such that they span the head circle. If dict, can have entries 'center' (tuple) and 'scale' (tuple) for what the center and scale of the head should be relative to the electrode locations. axes : instance of Axes | list | None The axes to plot to. If list, the list must be a list of Axes of the same length as ``times`` (unless ``times`` is None). If instance of Axes, ``times`` must be a float or a list of one float. Defaults to None. Returns ------- fig : instance of matplotlib.figure.Figure The figure. """ from ..channels import _get_ch_type ch_type = _get_ch_type(evoked, ch_type) import matplotlib.pyplot as plt from mpl_toolkits.axes_grid1 import make_axes_locatable # noqa mask_params = _handle_default('mask_params', mask_params) mask_params['markersize'] *= size / 2. mask_params['markeredgewidth'] *= size / 2. if isinstance(axes, plt.Axes): axes = [axes] if isinstance(times, string_types): if times == "peaks": npeaks = 10 if axes is None else len(axes) times = _find_peaks(evoked, npeaks) elif times == "auto": if axes is None: times = np.linspace(evoked.times[0], evoked.times[-1], 10) else: times = np.linspace(evoked.times[0], evoked.times[-1], len(axes)) elif np.isscalar(times): times = [times] times = np.array(times) if times.ndim != 1: raise ValueError('times must be 1D, got %d dimensions' % times.ndim) if len(times) > 20: raise RuntimeError('Too many plots requested. Please pass fewer ' 'than 20 time instants.') n_times = len(times) nax = n_times + bool(colorbar) width = size * nax height = size + max(0, 0.1 * (4 - size)) + bool(title) * 0.5 if axes is None: plt.figure(figsize=(width, height)) axes = list() for ax_idx in range(len(times)): if colorbar: # Make room for the colorbar axes.append(plt.subplot(1, n_times + 1, ax_idx + 1)) else: axes.append(plt.subplot(1, n_times, ax_idx + 1)) elif colorbar: logger.warning('Colorbar is drawn to the rightmost column of the ' 'figure.\nBe sure to provide enough space for it ' 'or turn it off with colorbar=False.') if len(axes) != n_times: raise RuntimeError('Axes and times must be equal in sizes.') tmin, tmax = evoked.times[[0, -1]] _time_comp = _time_mask(times=times, tmin=tmin, tmax=tmax) if not np.all(_time_comp): raise ValueError('Times should be between {0:0.3f} and {1:0.3f}. (Got ' '{2}).'.format(tmin, tmax, ['%03.f' % t for t in times[_time_comp]])) picks, pos, merge_grads, names, ch_type = _prepare_topo_plot( evoked, ch_type, layout) if ch_type.startswith('planar'): key = 'grad' else: key = ch_type scale = _handle_default('scalings', scale)[key] unit = _handle_default('units', unit)[key] if not show_names: names = None w_frame = plt.rcParams['figure.subplot.wspace'] / (2 * nax) top_frame = max((0.05 if title is None else 0.25), .2 / size) fig = axes[0].get_figure() fig.subplots_adjust(left=w_frame, right=1 - w_frame, bottom=0, top=1 - top_frame) time_idx = [np.where(evoked.times >= t)[0][0] for t in times] if proj is True and evoked.proj is not True: data = evoked.copy().apply_proj().data else: data = evoked.data if average is None: data = data[np.ix_(picks, time_idx)] elif isinstance(average, float): if not average > 0: raise ValueError('The average parameter must be positive. You ' 'passed a negative value') data_ = np.zeros((len(picks), len(time_idx))) ave_time = float(average) / 2. iter_times = evoked.times[time_idx] for ii, (idx, tmin_, tmax_) in enumerate(zip(time_idx, iter_times - ave_time, iter_times + ave_time)): my_range = (tmin_ < evoked.times) & (evoked.times < tmax_) data_[:, ii] = data[picks][:, my_range].mean(-1) data = data_ else: raise ValueError('The average parameter must be None or a float.' 'Check your input.') data *= scale if merge_grads: from ..channels.layout import _merge_grad_data data = _merge_grad_data(data) vmin, vmax = _setup_vmin_vmax(data, vmin, vmax) images, contours_ = [], [] if mask is not None: _picks = picks[::2 if ch_type not in ['mag', 'eeg'] else 1] mask_ = mask[np.ix_(_picks, time_idx)] pos, outlines = _check_outlines(pos, outlines, head_pos) if outlines is not None: image_mask, pos = _make_image_mask(outlines, pos, res) else: image_mask = None for idx, time in enumerate(times): tp, cn = plot_topomap(data[:, idx], pos, vmin=vmin, vmax=vmax, sensors=sensors, res=res, names=names, show_names=show_names, cmap=cmap, mask=mask_[:, idx] if mask is not None else None, mask_params=mask_params, axis=axes[idx], outlines=outlines, image_mask=image_mask, contours=contours, image_interp=image_interp, show=False) images.append(tp) if cn is not None: contours_.append(cn) if time_format is not None: axes[idx].set_title(time_format % (time * scale_time)) if title is not None: plt.suptitle(title, verticalalignment='top', size='x-large') if colorbar: cax = plt.subplot(1, n_times + 1, n_times + 1) # resize the colorbar (by default the color fills the whole axes) cpos = cax.get_position() if size <= 1: cpos.x0 = 1 - (.7 + .1 / size) / nax cpos.x1 = cpos.x0 + .1 / nax cpos.y0 = .2 cpos.y1 = .7 cax.set_position(cpos) if unit is not None: cax.set_title(unit) cbar = fig.colorbar(images[-1], ax=cax, cax=cax, format=cbar_fmt) cbar.set_ticks([vmin, 0, vmax]) if proj == 'interactive': _check_delayed_ssp(evoked) params = dict(evoked=evoked, fig=fig, projs=evoked.info['projs'], picks=picks, images=images, contours=contours_, time_idx=time_idx, scale=scale, merge_grads=merge_grads, res=res, pos=pos, image_mask=image_mask, plot_update_proj_callback=_plot_update_evoked_topomap) _draw_proj_checkbox(None, params) plt_show(show) return fig def _plot_topomap_multi_cbar(data, pos, ax, title=None, unit=None, vmin=None, vmax=None, cmap='RdBu_r', colorbar=False, cbar_fmt='%3.3f'): """Aux Function""" import matplotlib.pyplot as plt from mpl_toolkits.axes_grid1 import make_axes_locatable ax.set_yticks([]) ax.set_xticks([]) ax.set_frame_on(False) vmin = np.min(data) if vmin is None else vmin vmax = np.max(data) if vmax is None else vmax if title is not None: ax.set_title(title, fontsize=10) im, _ = plot_topomap(data, pos, vmin=vmin, vmax=vmax, axis=ax, cmap=cmap, image_interp='bilinear', contours=False, show=False) if colorbar is True: divider = make_axes_locatable(ax) cax = divider.append_axes("right", size="10%", pad=0.25) cbar = plt.colorbar(im, cax=cax, format=cbar_fmt) cbar.set_ticks((vmin, vmax)) if unit is not None: cbar.ax.set_title(unit, fontsize=8) cbar.ax.tick_params(labelsize=8) @verbose def plot_epochs_psd_topomap(epochs, bands=None, vmin=None, vmax=None, tmin=None, tmax=None, proj=False, n_fft=256, ch_type=None, n_overlap=0, layout=None, cmap='RdBu_r', agg_fun=None, dB=False, n_jobs=1, normalize=False, cbar_fmt='%0.3f', outlines='head', show=True, verbose=None): """Plot the topomap of the power spectral density across epochs Parameters ---------- epochs : instance of Epochs The epochs object bands : list of tuple | None The lower and upper frequency and the name for that band. If None, (default) expands to: bands = [(0, 4, 'Delta'), (4, 8, 'Theta'), (8, 12, 'Alpha'), (12, 30, 'Beta'), (30, 45, 'Gamma')] vmin : float | callable | None The value specifying the lower bound of the color range. If None np.min(data) is used. If callable, the output equals vmin(data). vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum absolute value is used. If callable, the output equals vmax(data). Defaults to None. tmin : float | None Start time to consider. tmax : float | None End time to consider. proj : bool Apply projection. n_fft : int Number of points to use in Welch FFT calculations. ch_type : 'mag' | 'grad' | 'planar1' | 'planar2' | 'eeg' | None The channel type to plot. For 'grad', the gradiometers are collected in pairs and the RMS for each pair is plotted. If None, then channels are chosen in the order given above. n_overlap : int The number of points of overlap between blocks. layout : None | Layout Layout instance specifying sensor positions (does not need to be specified for Neuromag data). If possible, the correct layout file is inferred from the data; if no appropriate layout file was found, the layout is automatically generated from the sensor locations. cmap : matplotlib colormap Colormap. For magnetometers and eeg defaults to 'RdBu_r', else 'Reds'. agg_fun : callable The function used to aggregate over frequencies. Defaults to np.sum. if normalize is True, else np.mean. dB : bool If True, transform data to decibels (with ``10 * np.log10(data)``) following the application of `agg_fun`. Only valid if normalize is False. n_jobs : int Number of jobs to run in parallel. normalize : bool If True, each band will be devided by the total power. Defaults to False. cbar_fmt : str The colorbar format. Defaults to '%0.3f'. outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. show : bool Show figure if True. verbose : bool, str, int, or None If not None, override default verbose level (see mne.verbose). Returns ------- fig : instance of matplotlib figure Figure distributing one image per channel across sensor topography. """ from ..channels import _get_ch_type ch_type = _get_ch_type(epochs, ch_type) picks, pos, merge_grads, names, ch_type = _prepare_topo_plot( epochs, ch_type, layout) psds, freqs = compute_epochs_psd(epochs, picks=picks, n_fft=n_fft, tmin=tmin, tmax=tmax, n_overlap=n_overlap, proj=proj, n_jobs=n_jobs) psds = np.mean(psds, axis=0) if merge_grads: from ..channels.layout import _merge_grad_data psds = _merge_grad_data(psds) return plot_psds_topomap( psds=psds, freqs=freqs, pos=pos, agg_fun=agg_fun, vmin=vmin, vmax=vmax, bands=bands, cmap=cmap, dB=dB, normalize=normalize, cbar_fmt=cbar_fmt, outlines=outlines, show=show) def plot_psds_topomap( psds, freqs, pos, agg_fun=None, vmin=None, vmax=None, bands=None, cmap='RdBu_r', dB=True, normalize=False, cbar_fmt='%0.3f', outlines='head', show=True): """Plot spatial maps of PSDs Parameters ---------- psds : np.ndarray of float, shape (n_channels, n_freqs) Power spectral densities freqs : np.ndarray of float, shape (n_freqs) Frequencies used to compute psds. pos : numpy.ndarray of float, shape (n_sensors, 2) The positions of the sensors. agg_fun : callable The function used to aggregate over frequencies. Defaults to np.sum. if normalize is True, else np.mean. vmin : float | callable | None The value specifying the lower bound of the color range. If None np.min(data) is used. If callable, the output equals vmin(data). vmax : float | callable | None The value specifying the upper bound of the color range. If None, the maximum absolute value is used. If callable, the output equals vmax(data). Defaults to None. bands : list of tuple | None The lower and upper frequency and the name for that band. If None, (default) expands to: bands = [(0, 4, 'Delta'), (4, 8, 'Theta'), (8, 12, 'Alpha'), (12, 30, 'Beta'), (30, 45, 'Gamma')] cmap : matplotlib colormap Colormap. For magnetometers and eeg defaults to 'RdBu_r', else 'Reds'. dB : bool If True, transform data to decibels (with ``10 * np.log10(data)``) following the application of `agg_fun`. Only valid if normalize is False. normalize : bool If True, each band will be devided by the total power. Defaults to False. cbar_fmt : str The colorbar format. Defaults to '%0.3f'. outlines : 'head' | 'skirt' | dict | None The outlines to be drawn. If 'head', the default head scheme will be drawn. If 'skirt' the head scheme will be drawn, but sensors are allowed to be plotted outside of the head circle. If dict, each key refers to a tuple of x and y positions, the values in 'mask_pos' will serve as image mask, and the 'autoshrink' (bool) field will trigger automated shrinking of the positions due to points outside the outline. Alternatively, a matplotlib patch object can be passed for advanced masking options, either directly or as a function that returns patches (required for multi-axis plots). If None, nothing will be drawn. Defaults to 'head'. show : bool Show figure if True. Returns ------- fig : instance of matplotlib figure Figure distributing one image per channel across sensor topography. """ import matplotlib.pyplot as plt if bands is None: bands = [(0, 4, 'Delta'), (4, 8, 'Theta'), (8, 12, 'Alpha'), (12, 30, 'Beta'), (30, 45, 'Gamma')] if agg_fun is None: agg_fun = np.sum if normalize is True else np.mean if normalize is True: psds /= psds.sum(axis=-1)[..., None] assert np.allclose(psds.sum(axis=-1), 1.) n_axes = len(bands) fig, axes = plt.subplots(1, n_axes, figsize=(2 * n_axes, 1.5)) if n_axes == 1: axes = [axes] for ax, (fmin, fmax, title) in zip(axes, bands): freq_mask = (fmin < freqs) & (freqs < fmax) if freq_mask.sum() == 0: raise RuntimeError('No frequencies in band "%s" (%s, %s)' % (title, fmin, fmax)) data = agg_fun(psds[:, freq_mask], axis=1) if dB is True and normalize is False: data = 10 * np.log10(data) unit = 'dB' else: unit = 'power' _plot_topomap_multi_cbar(data, pos, ax, title=title, vmin=vmin, vmax=vmax, cmap=cmap, colorbar=True, unit=unit, cbar_fmt=cbar_fmt) tight_layout(fig=fig) fig.canvas.draw() plt_show(show) return fig def _onselect(eclick, erelease, tfr, pos, ch_type, itmin, itmax, ifmin, ifmax, cmap, fig, layout=None): """Callback called from topomap for drawing average tfr over channels.""" import matplotlib.pyplot as plt pos, _ = _check_outlines(pos, outlines='head', head_pos=None) ax = eclick.inaxes xmin = min(eclick.xdata, erelease.xdata) xmax = max(eclick.xdata, erelease.xdata) ymin = min(eclick.ydata, erelease.ydata) ymax = max(eclick.ydata, erelease.ydata) indices = [i for i in range(len(pos)) if pos[i][0] < xmax and pos[i][0] > xmin and pos[i][1] < ymax and pos[i][1] > ymin] for idx, circle in enumerate(ax.artists): if idx in indices: circle.set_color('r') else: circle.set_color('black') plt.gcf().canvas.draw() if not indices: return data = tfr.data if ch_type == 'mag': picks = pick_types(tfr.info, meg=ch_type, ref_meg=False) data = np.mean(data[indices, ifmin:ifmax, itmin:itmax], axis=0) chs = [tfr.ch_names[picks[x]] for x in indices] elif ch_type == 'grad': picks = pick_types(tfr.info, meg=ch_type, ref_meg=False) from ..channels.layout import _pair_grad_sensors grads = _pair_grad_sensors(tfr.info, layout=layout, topomap_coords=False) idxs = list() for idx in indices: idxs.append(grads[idx * 2]) idxs.append(grads[idx * 2 + 1]) # pair of grads data = np.mean(data[idxs, ifmin:ifmax, itmin:itmax], axis=0) chs = [tfr.ch_names[x] for x in idxs] elif ch_type == 'eeg': picks = pick_types(tfr.info, meg=False, eeg=True, ref_meg=False) data = np.mean(data[indices, ifmin:ifmax, itmin:itmax], axis=0) chs = [tfr.ch_names[picks[x]] for x in indices] logger.info('Averaging TFR over channels ' + str(chs)) if len(fig) == 0: fig.append(figure_nobar()) if not plt.fignum_exists(fig[0].number): fig[0] = figure_nobar() ax = fig[0].add_subplot(111) itmax = min(itmax, len(tfr.times) - 1) ifmax = min(ifmax, len(tfr.freqs) - 1) extent = (tfr.times[itmin] * 1e3, tfr.times[itmax] * 1e3, tfr.freqs[ifmin], tfr.freqs[ifmax]) title = 'Average over %d %s channels.' % (len(chs), ch_type) ax.set_title(title) ax.set_xlabel('Time (ms)') ax.set_ylabel('Frequency (Hz)') img = ax.imshow(data, extent=extent, aspect="auto", origin="lower", cmap=cmap) if len(fig[0].get_axes()) < 2: fig[0].get_axes()[1].cbar = fig[0].colorbar(mappable=img) else: fig[0].get_axes()[1].cbar.on_mappable_changed(mappable=img) fig[0].canvas.draw() plt.figure(fig[0].number) plt_show(True) def _find_peaks(evoked, npeaks): """Helper function for finding peaks from evoked data Returns ``npeaks`` biggest peaks as a list of time points. """ argrelmax = _get_argrelmax() gfp = evoked.data.std(axis=0) order = len(evoked.times) // 30 if order < 1: order = 1 peaks = argrelmax(gfp, order=order, axis=0)[0] if len(peaks) > npeaks: max_indices = np.argsort(gfp[peaks])[-npeaks:] peaks = np.sort(peaks[max_indices]) times = evoked.times[peaks] if len(times) == 0: times = [evoked.times[gfp.argmax()]] return times
yousrabk/mne-python
mne/viz/topomap.py
Python
bsd-3-clause
66,755
from floyd.client.base import FloydHttpClient from floyd.model.version import CliVersion from floyd.log import logger as floyd_logger class VersionClient(FloydHttpClient): """ Client to get API version from the server """ def __init__(self): self.url = "/cli_version" super(VersionClient, self).__init__(skip_auth=True) def get_cli_version(self): response = self.request("GET", self.url) data_dict = response.json() floyd_logger.debug("CLI Version info: %s", data_dict) return CliVersion.from_dict(data_dict)
houqp/floyd-cli
floyd/client/version.py
Python
apache-2.0
580
import sqlalchemy as sa from sqlalchemy_utils import table_name from tests import TestCase class TestTableName(TestCase): def create_models(self): class Building(self.Base): __tablename__ = 'building' id = sa.Column(sa.Integer, primary_key=True) name = sa.Column(sa.Unicode(255)) self.Building = Building def test_class(self): assert table_name(self.Building) == 'building' del self.Building.__tablename__ assert table_name(self.Building) == 'building' def test_attribute(self): assert table_name(self.Building.id) == 'building' assert table_name(self.Building.name) == 'building' def test_target(self): assert table_name(self.Building()) == 'building'
tonyseek/sqlalchemy-utils
tests/functions/test_table_name.py
Python
bsd-3-clause
775
import logging import six from ray.tune.error import TuneError from ray.tune.experiment import convert_to_experiment_list, Experiment from ray.tune.analysis import ExperimentAnalysis from ray.tune.suggest import BasicVariantGenerator from ray.tune.trial import Trial from ray.tune.trainable import Trainable from ray.tune.ray_trial_executor import RayTrialExecutor from ray.tune.registry import get_trainable_cls from ray.tune.syncer import wait_for_sync from ray.tune.trial_runner import TrialRunner from ray.tune.progress_reporter import CLIReporter, JupyterNotebookReporter from ray.tune.schedulers import (HyperBandScheduler, AsyncHyperBandScheduler, FIFOScheduler, MedianStoppingRule) from ray.tune.web_server import TuneServer logger = logging.getLogger(__name__) _SCHEDULERS = { "FIFO": FIFOScheduler, "MedianStopping": MedianStoppingRule, "HyperBand": HyperBandScheduler, "AsyncHyperBand": AsyncHyperBandScheduler, } try: class_name = get_ipython().__class__.__name__ IS_NOTEBOOK = True if "Terminal" not in class_name else False except NameError: IS_NOTEBOOK = False def _make_scheduler(args): if args.scheduler in _SCHEDULERS: return _SCHEDULERS[args.scheduler](**args.scheduler_config) else: raise TuneError("Unknown scheduler: {}, should be one of {}".format( args.scheduler, _SCHEDULERS.keys())) def _check_default_resources_override(run_identifier): if not isinstance(run_identifier, six.string_types): # If obscure dtype, assume it is overriden. return True trainable_cls = get_trainable_cls(run_identifier) return hasattr(trainable_cls, "default_resource_request") and ( trainable_cls.default_resource_request.__code__ != Trainable.default_resource_request.__code__) def _report_progress(runner, reporter, done=False): """Reports experiment progress. Args: runner (TrialRunner): Trial runner to report on. reporter (ProgressReporter): Progress reporter. done (bool): Whether this is the last progress report attempt. """ trials = runner.get_trials() if reporter.should_report(trials, done=done): sched_debug_str = runner.scheduler_alg.debug_string() executor_debug_str = runner.trial_executor.debug_string() reporter.report(trials, sched_debug_str, executor_debug_str) def run(run_or_experiment, name=None, stop=None, config=None, resources_per_trial=None, num_samples=1, local_dir=None, upload_dir=None, trial_name_creator=None, loggers=None, sync_to_cloud=None, sync_to_driver=None, checkpoint_freq=0, checkpoint_at_end=False, sync_on_checkpoint=True, keep_checkpoints_num=None, checkpoint_score_attr=None, global_checkpoint_period=10, export_formats=None, max_failures=0, restore=None, search_alg=None, scheduler=None, with_server=False, server_port=TuneServer.DEFAULT_PORT, verbose=2, progress_reporter=None, resume=False, queue_trials=False, reuse_actors=False, trial_executor=None, raise_on_failed_trial=True, return_trials=False, ray_auto_init=True, sync_function=None): """Executes training. Args: run_or_experiment (function|class|str|Experiment): If function|class|str, this is the algorithm or model to train. This may refer to the name of a built-on algorithm (e.g. RLLib's DQN or PPO), a user-defined trainable function or class, or the string identifier of a trainable function or class registered in the tune registry. If Experiment, then Tune will execute training based on Experiment.spec. name (str): Name of experiment. stop (dict|callable): The stopping criteria. If dict, the keys may be any field in the return result of 'train()', whichever is reached first. If function, it must take (trial_id, result) as arguments and return a boolean (True if trial should be stopped, False otherwise). This can also be a subclass of ``ray.tune.Stopper``, which allows users to implement custom experiment-wide stopping (i.e., stopping an entire Tune run based on some time constraint). config (dict): Algorithm-specific configuration for Tune variant generation (e.g. env, hyperparams). Defaults to empty dict. Custom search algorithms may ignore this. resources_per_trial (dict): Machine resources to allocate per trial, e.g. ``{"cpu": 64, "gpu": 8}``. Note that GPUs will not be assigned unless you specify them here. Defaults to 1 CPU and 0 GPUs in ``Trainable.default_resource_request()``. num_samples (int): Number of times to sample from the hyperparameter space. Defaults to 1. If `grid_search` is provided as an argument, the grid will be repeated `num_samples` of times. local_dir (str): Local dir to save training results to. Defaults to ``~/ray_results``. upload_dir (str): Optional URI to sync training results and checkpoints to (e.g. ``s3://bucket`` or ``gs://bucket``). trial_name_creator (func): Optional function for generating the trial string representation. loggers (list): List of logger creators to be used with each Trial. If None, defaults to ray.tune.logger.DEFAULT_LOGGERS. See `ray/tune/logger.py`. sync_to_cloud (func|str): Function for syncing the local_dir to and from upload_dir. If string, then it must be a string template that includes `{source}` and `{target}` for the syncer to run. If not provided, the sync command defaults to standard S3 or gsutil sync commands. sync_to_driver (func|str|bool): Function for syncing trial logdir from remote node to local. If string, then it must be a string template that includes `{source}` and `{target}` for the syncer to run. If True or not provided, it defaults to using rsync. If False, syncing to driver is disabled. checkpoint_freq (int): How many training iterations between checkpoints. A value of 0 (default) disables checkpointing. checkpoint_at_end (bool): Whether to checkpoint at the end of the experiment regardless of the checkpoint_freq. Default is False. sync_on_checkpoint (bool): Force sync-down of trial checkpoint to driver. If set to False, checkpoint syncing from worker to driver is asynchronous and best-effort. This does not affect persistent storage syncing. Defaults to True. keep_checkpoints_num (int): Number of checkpoints to keep. A value of `None` keeps all checkpoints. Defaults to `None`. If set, need to provide `checkpoint_score_attr`. checkpoint_score_attr (str): Specifies by which attribute to rank the best checkpoint. Default is increasing order. If attribute starts with `min-` it will rank attribute in decreasing order, i.e. `min-validation_loss`. global_checkpoint_period (int): Seconds between global checkpointing. This does not affect `checkpoint_freq`, which specifies frequency for individual trials. export_formats (list): List of formats that exported at the end of the experiment. Default is None. max_failures (int): Try to recover a trial at least this many times. Ray will recover from the latest checkpoint if present. Setting to -1 will lead to infinite recovery retries. Setting to 0 will disable retries. Defaults to 3. restore (str): Path to checkpoint. Only makes sense to set if running 1 trial. Defaults to None. search_alg (SearchAlgorithm): Search Algorithm. Defaults to BasicVariantGenerator. scheduler (TrialScheduler): Scheduler for executing the experiment. Choose among FIFO (default), MedianStopping, AsyncHyperBand, HyperBand and PopulationBasedTraining. Refer to ray.tune.schedulers for more options. with_server (bool): Starts a background Tune server. Needed for using the Client API. server_port (int): Port number for launching TuneServer. verbose (int): 0, 1, or 2. Verbosity mode. 0 = silent, 1 = only status updates, 2 = status and trial results. progress_reporter (ProgressReporter): Progress reporter for reporting intermediate experiment progress. Defaults to CLIReporter if running in command-line, or JupyterNotebookReporter if running in a Jupyter notebook. resume (str|bool): One of "LOCAL", "REMOTE", "PROMPT", or bool. LOCAL/True restores the checkpoint from the local_checkpoint_dir. REMOTE restores the checkpoint from remote_checkpoint_dir. PROMPT provides CLI feedback. False forces a new experiment. If resume is set but checkpoint does not exist, ValueError will be thrown. queue_trials (bool): Whether to queue trials when the cluster does not currently have enough resources to launch one. This should be set to True when running on an autoscaling cluster to enable automatic scale-up. reuse_actors (bool): Whether to reuse actors between different trials when possible. This can drastically speed up experiments that start and stop actors often (e.g., PBT in time-multiplexing mode). This requires trials to have the same resource requirements. trial_executor (TrialExecutor): Manage the execution of trials. raise_on_failed_trial (bool): Raise TuneError if there exists failed trial (of ERROR state) when the experiments complete. ray_auto_init (bool): Automatically starts a local Ray cluster if using a RayTrialExecutor (which is the default) and if Ray is not initialized. Defaults to True. sync_function: Deprecated. See `sync_to_cloud` and `sync_to_driver`. Returns: List of Trial objects. Raises: TuneError if any trials failed and `raise_on_failed_trial` is True. Examples: >>> tune.run(mytrainable, scheduler=PopulationBasedTraining()) >>> tune.run(mytrainable, num_samples=5, reuse_actors=True) >>> tune.run( >>> "PG", >>> num_samples=5, >>> config={ >>> "env": "CartPole-v0", >>> "lr": tune.sample_from(lambda _: np.random.rand()) >>> } >>> ) """ trial_executor = trial_executor or RayTrialExecutor( queue_trials=queue_trials, reuse_actors=reuse_actors, ray_auto_init=ray_auto_init) if isinstance(run_or_experiment, list): experiments = run_or_experiment else: experiments = [run_or_experiment] if len(experiments) > 1: logger.info( "Running multiple concurrent experiments is experimental and may " "not work with certain features.") for i, exp in enumerate(experiments): if not isinstance(exp, Experiment): run_identifier = Experiment.register_if_needed(exp) experiments[i] = Experiment( name=name, run=run_identifier, stop=stop, config=config, resources_per_trial=resources_per_trial, num_samples=num_samples, local_dir=local_dir, upload_dir=upload_dir, sync_to_driver=sync_to_driver, trial_name_creator=trial_name_creator, loggers=loggers, checkpoint_freq=checkpoint_freq, checkpoint_at_end=checkpoint_at_end, sync_on_checkpoint=sync_on_checkpoint, keep_checkpoints_num=keep_checkpoints_num, checkpoint_score_attr=checkpoint_score_attr, export_formats=export_formats, max_failures=max_failures, restore=restore, sync_function=sync_function) else: logger.debug("Ignoring some parameters passed into tune.run.") if sync_to_cloud: for exp in experiments: assert exp.remote_checkpoint_dir, ( "Need `upload_dir` if `sync_to_cloud` given.") runner = TrialRunner( search_alg=search_alg or BasicVariantGenerator(), scheduler=scheduler or FIFOScheduler(), local_checkpoint_dir=experiments[0].checkpoint_dir, remote_checkpoint_dir=experiments[0].remote_checkpoint_dir, sync_to_cloud=sync_to_cloud, stopper=experiments[0].stopper, checkpoint_period=global_checkpoint_period, resume=resume, launch_web_server=with_server, server_port=server_port, verbose=bool(verbose > 1), trial_executor=trial_executor) for exp in experiments: runner.add_experiment(exp) if progress_reporter is None: if IS_NOTEBOOK: progress_reporter = JupyterNotebookReporter(overwrite=verbose < 2) else: progress_reporter = CLIReporter() # User Warning for GPUs if trial_executor.has_gpus(): if isinstance(resources_per_trial, dict) and "gpu" in resources_per_trial: # "gpu" is manually set. pass elif _check_default_resources_override(experiments[0].run_identifier): # "default_resources" is manually overriden. pass else: logger.warning("Tune detects GPUs, but no trials are using GPUs. " "To enable trials to use GPUs, set " "tune.run(resources_per_trial={'gpu': 1}...) " "which allows Tune to expose 1 GPU to each trial. " "You can also override " "`Trainable.default_resource_request` if using the " "Trainable API.") while not runner.is_finished(): runner.step() if verbose: _report_progress(runner, progress_reporter) try: runner.checkpoint(force=True) except Exception: logger.exception("Trial Runner checkpointing failed.") if verbose: _report_progress(runner, progress_reporter, done=True) wait_for_sync() errored_trials = [] for trial in runner.get_trials(): if trial.status != Trial.TERMINATED: errored_trials += [trial] if errored_trials: if raise_on_failed_trial: raise TuneError("Trials did not complete", errored_trials) else: logger.error("Trials did not complete: %s", errored_trials) trials = runner.get_trials() if return_trials: return trials logger.info("Returning an analysis object by default. You can call " "`analysis.trials` to retrieve a list of trials. " "This message will be removed in future versions of Tune.") return ExperimentAnalysis(runner.checkpoint_file, trials=trials) def run_experiments(experiments, search_alg=None, scheduler=None, with_server=False, server_port=TuneServer.DEFAULT_PORT, verbose=2, progress_reporter=None, resume=False, queue_trials=False, reuse_actors=False, trial_executor=None, raise_on_failed_trial=True, concurrent=True): """Runs and blocks until all trials finish. Examples: >>> experiment_spec = Experiment("experiment", my_func) >>> run_experiments(experiments=experiment_spec) >>> experiment_spec = {"experiment": {"run": my_func}} >>> run_experiments(experiments=experiment_spec) >>> run_experiments( >>> experiments=experiment_spec, >>> scheduler=MedianStoppingRule(...)) >>> run_experiments( >>> experiments=experiment_spec, >>> search_alg=SearchAlgorithm(), >>> scheduler=MedianStoppingRule(...)) Returns: List of Trial objects, holding data for each executed trial. """ # This is important to do this here # because it schematize the experiments # and it conducts the implicit registration. experiments = convert_to_experiment_list(experiments) if concurrent: return run( experiments, search_alg=search_alg, scheduler=scheduler, with_server=with_server, server_port=server_port, verbose=verbose, progress_reporter=progress_reporter, resume=resume, queue_trials=queue_trials, reuse_actors=reuse_actors, trial_executor=trial_executor, raise_on_failed_trial=raise_on_failed_trial, return_trials=True) else: trials = [] for exp in experiments: trials += run( exp, search_alg=search_alg, scheduler=scheduler, with_server=with_server, server_port=server_port, verbose=verbose, progress_reporter=progress_reporter, resume=resume, queue_trials=queue_trials, reuse_actors=reuse_actors, trial_executor=trial_executor, raise_on_failed_trial=raise_on_failed_trial, return_trials=True) return trials
stephanie-wang/ray
python/ray/tune/tune.py
Python
apache-2.0
18,227
import sys, os import subprocess nw_exe = os.path.normpath(sys.argv[1]) nw_dll = os.path.normpath(sys.argv[2]) node_dll = os.path.normpath(sys.argv[3]) out_file = os.path.normpath(sys.argv[4]) sym_file = nw_exe + ".sym" dll_sym_file = nw_dll + ".sym" node_sym_file = node_dll + ".sym" dump_exe = os.path.join(os.path.dirname(os.path.realpath(__file__)), 'dump_syms.exe') subprocess.call([dump_exe, nw_exe], stdout=open(sym_file, 'w')) subprocess.call([dump_exe, nw_dll], stdout=open(dll_sym_file, 'w')) subprocess.call([dump_exe, node_dll], stdout=open(node_sym_file, 'w')) lzma_exe = os.path.join(os.path.dirname(os.path.realpath(__file__)), '..', '..', '..', 'third_party', 'lzma_sdk', 'Executable', '7za.exe') subprocess.call([lzma_exe, 'a', '-t7z', out_file, sym_file, dll_sym_file, node_sym_file])
nwjs/nw.js
tools/dump_win_syms.py
Python
mit
804
# ICE Revision: $Id$ """Watches output and analyzes it""" from .BasicWatcher import BasicWatcher from .AnalyzedCommon import AnalyzedCommon class AnalyzedWatcher(BasicWatcher,AnalyzedCommon): def __init__(self,filename,analyzer,silent=False,tailLength=1000,sleep=0.1): """@param analyzer: analyzer @param filename: name of the logfile to watch @param silent: if True no output is sent to stdout @param tailLength: number of bytes at the end of the fail that should be output. Because data is output on a per-line-basis @param sleep: interval to sleep if no line is returned""" BasicWatcher.__init__(self,filename,silent=silent,tailLength=tailLength,sleep=sleep) AnalyzedCommon.__init__(self,self.filename,analyzer) # Should work with Python3 and Python2
takaakiaoki/PyFoam
PyFoam/Execution/AnalyzedWatcher.py
Python
gpl-2.0
827
#!/usr/bin/env python """ Loads a json molecule and draws atoms in Blender. Blender scripts are weird. Either run this inside of Blender or in a shell with blender foo.blend -P molecule_to_blender.py The script expects an input file named "molecule.json" and should be in the same directory as "atoms.json" Written by Patrick Fuller, [email protected], 28 Nov 12 """ import bpy from math import acos from mathutils import Vector import json import os import sys # Atomic radii from wikipedia, scaled to Blender radii (C = 0.4 units) # http://en.wikipedia.org/wiki/Atomic_radii_of_the_elements_(data_page) # Atomic colors from cpk # http://jmol.sourceforge.net/jscolors/ PATH = os.path.dirname(os.path.realpath(__file__)) with open(os.path.join(PATH, 'atoms.json')) as in_file: atom_data = json.load(in_file) def draw_molecule(molecule, center=(0, 0, 0), show_bonds=True, join=True, name='molecule'): """Draw a JSON-formatted molecule in Blender. This method uses a couple of tricks from [1] to improve rendering speed. In particular, it minimizes the amount of unique meshes and materials, and doesn't draw until all objects are initialized. [1] https://blenderartists.org/forum/showthread.php ?273149-Generating-a-large-number-of-mesh-primitives Args: molecule: The molecule to be drawn, as a python object following the JSON convention set in this project. center: (Optional, default (0, 0, 0)) Cartesian center of molecule. Use to draw multiple molecules in different locations. show_bonds: (Optional, default True) Draws a ball-and-stick model if True, and a space-filling model if False. join: (Optional, default True) Joins the molecule into a single object. Set to False if you want to individually manipulate atoms/bonds. name: (Optional, default "molecule") Collection name for this molecule. Returns: If run in a blender context, will return a visual object of the molecule. """ collection = bpy.data.collections.new(name) bpy.context.scene.collection.children.link(collection) shapes = [] # If using space-filling model, scale up atom size and remove bonds # Add atom primitive bpy.ops.object.select_all(action='DESELECT') bpy.ops.mesh.primitive_uv_sphere_add() sphere = bpy.context.object # Initialize bond material if it's going to be used. if show_bonds: bpy.data.materials.new(name='bond') bpy.data.materials['bond'].diffuse_color = atom_data['bond']['color'] + [1] bpy.data.materials['bond'].specular_intensity = 0.2 bpy.ops.mesh.primitive_cylinder_add() cylinder = bpy.context.object cylinder.active_material = bpy.data.materials['bond'] for atom in molecule['atoms']: if atom['element'] not in atom_data: atom['element'] = 'undefined' if atom['element'] not in bpy.data.materials: key = atom['element'] bpy.data.materials.new(name=key) bpy.data.materials[key].diffuse_color = atom_data[key]['color'] + [1] bpy.data.materials[key].specular_intensity = 0.2 atom_sphere = sphere.copy() atom_sphere.data = sphere.data.copy() atom_sphere.location = [l + c for l, c in zip(atom['location'], center)] scale = 1 if show_bonds else 2.5 atom_sphere.dimensions = [atom_data[atom['element']]['radius'] * scale * 2] * 3 atom_sphere.active_material = bpy.data.materials[atom['element']] collection.objects.link(atom_sphere) shapes.append(atom_sphere) for bond in (molecule['bonds'] if show_bonds else []): start = molecule['atoms'][bond['atoms'][0]]['location'] end = molecule['atoms'][bond['atoms'][1]]['location'] diff = [c2 - c1 for c2, c1 in zip(start, end)] cent = [(c2 + c1) / 2 for c2, c1 in zip(start, end)] mag = sum([(c2 - c1) ** 2 for c1, c2 in zip(start, end)]) ** 0.5 v_axis = Vector(diff).normalized() v_obj = Vector((0, 0, 1)) v_rot = v_obj.cross(v_axis) # This check prevents gimbal lock (ie. weird behavior when v_axis is # close to (0, 0, 1)) if v_rot.length > 0.01: v_rot = v_rot.normalized() axis_angle = [acos(v_obj.dot(v_axis))] + list(v_rot) else: v_rot = Vector((1, 0, 0)) axis_angle = [0] * 4 if bond['order'] not in range(1, 4): sys.stderr.write("Improper number of bonds! Defaulting to 1.\n") bond['order'] = 1 if bond['order'] == 1: trans = [[0] * 3] elif bond['order'] == 2: trans = [[1.4 * atom_data['bond']['radius'] * x for x in v_rot], [-1.4 * atom_data['bond']['radius'] * x for x in v_rot]] elif bond['order'] == 3: trans = [[0] * 3, [2.2 * atom_data['bond']['radius'] * x for x in v_rot], [-2.2 * atom_data['bond']['radius'] * x for x in v_rot]] for i in range(bond['order']): bond_cylinder = cylinder.copy() bond_cylinder.data = cylinder.data.copy() bond_cylinder.dimensions = [atom_data['bond']['radius'] * scale * 2] * 2 + [mag] bond_cylinder.location = [c + scale * v for c, v in zip(cent, trans[i])] bond_cylinder.rotation_mode = 'AXIS_ANGLE' bond_cylinder.rotation_axis_angle = axis_angle collection.objects.link(bond_cylinder) shapes.append(bond_cylinder) # Remove primitive meshes bpy.ops.object.select_all(action='DESELECT') sphere.select_set(True) if show_bonds: cylinder.select_set(True) # If the starting cube is there, remove it if 'Cube' in bpy.data.objects.keys(): bpy.data.objects.get('Cube').select_set(True) bpy.ops.object.delete() for shape in shapes: shape.select_set(True) bpy.context.view_layer.objects.active = shapes[0] bpy.ops.object.shade_smooth() if join: bpy.ops.object.join() for obj in bpy.context.selected_objects: obj.name = name bpy.ops.object.origin_set(type='ORIGIN_GEOMETRY', center='MEDIAN') if __name__ == '__main__': """Uses Blender's limited argv interface to pass args from main script.""" args = sys.argv[sys.argv.index('--') + 1:] show_bonds, join = True, True if '--space-filling' in args: show_bonds = False args.remove('--space-filling') if '--no-join' in args: join = False args.remove('--no-join') try: with open(args[0]) as in_file: molecule = json.load(in_file) except IOError: molecule = json.loads(args[0]) draw_molecule(molecule, show_bonds=show_bonds, join=join)
patrickfuller/blender-chemicals
blender_chemicals/draw.py
Python
mit
7,037
'''Class for pickling and encrypting data''' __title__ = 'EncryptedPickle' __version__ = '0.1.4' __author__ = 'Vingd, Inc.' __author_email__ = '[email protected]' __url__ = 'https://github.com/vingd/encrypted-pickle-python' __copyright__ = 'Copyright 2013 Vingd, Inc.' __license__ = 'MIT License'
vingd/encrypted-pickle-python
encryptedpickle/__init__.py
Python
mit
301
import _plotly_utils.basevalidators class BgcolorValidator(_plotly_utils.basevalidators.ColorValidator): def __init__(self, plotly_name="bgcolor", parent_name="ohlc.hoverlabel", **kwargs): super(BgcolorValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, array_ok=kwargs.pop("array_ok", True), edit_type=kwargs.pop("edit_type", "none"), role=kwargs.pop("role", "style"), **kwargs )
plotly/python-api
packages/python/plotly/plotly/validators/ohlc/hoverlabel/_bgcolor.py
Python
mit
500
#!/usr/bin/env python3 import argparse import matplotlib.pyplot as plot import matplotlib.ticker as ticker import re import scipy import wells.publisher as publisher parser = argparse.ArgumentParser() parser.add_argument("-i", "--interactive", help="Interactive mode", action="store_true") parser.add_argument("-e", "--ext", help="Output image extension", type=str, default="png") parser.add_argument("-s", "--figsize", help="Figure size", type=str, default=("2.8, 2.8")) parser.add_argument("-c", "--colorbar", help="Show colorbar", action="store_true") parser.add_argument("--nx", "--xn", help="Number of x ticks", type=int, default=5) parser.add_argument("--ny", "--yn", help="Number of y ticks", type=int, default=6) parser.add_argument("--nc", "--cn", help="Number of colorbar ticks", type=int, default=4) parser.add_argument("--dx", help="Major x-axis tick step", type=float, default=None) parser.add_argument("--dy", help="Major y-axis tick step", type=float, default=None) parser.add_argument("--mdx", help="Minor x-axis tick step", type=float, default=None) parser.add_argument("--mdy", help="Minor y-axis tick step", type=float, default=None) parser.add_argument("--minx", "--xmin", help="Minimum x coordinate", type=float) parser.add_argument("--maxx", "--xmax", help="Maximum x coordinate", type=float) parser.add_argument("--miny", "--ymin", help="Minimum y coordinate", type=float) parser.add_argument("--maxy", "--ymax", help="Maximum y coordinate", type=float) parser.add_argument("--dbmin", "--mindb", help="Minimum decibels level to display", type=float, default=-60) parser.add_argument("--ssx", help="Subsample in x", type=int) parser.add_argument("--ssy", help="Subsample in y", type=int) parser.add_argument("-p", "--physical-units", help="Use physical units for plot labels", action="store_true") parser.add_argument("input", help="Input file", type=str, nargs="+") args = parser.parse_args() workspace = scipy.load(args.input[0]) t = workspace["t"] x = workspace["x"] bg = workspace["background"] delta = workspace["delta"] pump = workspace["pump"] loss = workspace["loss"] if args.physical_units: # This is very ad-hoc. delta0 = 1E11 # Hardcoded, but what? beta0 = 250 # ... and this too. xu = scipy.sqrt(beta0/delta0) x = xu * x t = 2*scipy.pi/delta0 * t mm = 1.0 ns = 1.0 if args.physical_units: mm = 1E-3 ns = 1E-9 x = x/mm t = t/ns miny = args.miny if args.miny is not None else x.min() maxy = args.maxy if args.maxy is not None else x.max() minc = args.dbmin maxc = 0 window = (x > miny) & (x < maxy) x = x[window] if args.ssy: x = x[::args.ssy] pattern = re.compile(r"mint=(.*?)_") def mint(filename): match = pattern.search(filename) if match: return float(match.group(1)) ts = [] yss = [] for n, filename in enumerate(sorted(args.input, key=mint)): print("%d/%d: %s" % (n+1, len(args.input), filename)) workspace = scipy.load(filename) t = workspace["t"] ys = workspace["states"] ys = ys[:, window] if args.ssy: ys = ys[:, ::args.ssy] if args.ssx: t = t[::args.ssx] ys = ys[::args.ssx, :] ts.append(t) yss.append(ys) if t.max() >= args.maxx: break t = scipy.hstack(ts) ys = scipy.vstack(yss) print("Resulting image shape:", ys.shape) minx = args.minx if args.minx is not None else t.min() maxx = args.maxx if args.maxx is not None else t.max() ys = abs(ys) ys = ys / ys.max() ys = 20 * scipy.log10(ys) if args.physical_units: xlabel = "$t,~\mathrm{ns}$" ylabel = "$z,~\mathrm{mm}$" else: xlabel = "$t$" ylabel = "$z$" if not args.interactive: figsize = [float(x) for x in args.figsize.split(",")] filename = ("delta=%.2f_" "pump=%.2E_" "loss=%.2E_" "mint=%.2f_" "maxt=%.2f_timedomain2" % (delta, pump, loss, minx, maxx)) publisher.init({"figure.figsize": figsize}) plot.figure() axs = plot.subplot(1, 1, 1) plot.pcolormesh(t, x, ys.T, cmap="magma", rasterized=True) plot.xlim(minx, maxx) plot.ylim(miny, maxy) plot.clim(minc, maxc) plot.xlabel(xlabel) plot.ylabel(ylabel) if args.nx is not None: axs.xaxis.set_major_locator( ticker.MaxNLocator(args.nx)) if args.ny is not None: axs.yaxis.set_major_locator( ticker.MaxNLocator(args.ny)) if args.dx is not None: axs.xaxis.set_major_locator( ticker.MultipleLocator(args.dx)) if args.dy is not None: axs.yaxis.set_major_locator( ticker.MultipleLocator(args.dy)) if args.mdx is not None: axs.xaxis.set_minor_locator( ticker.MultipleLocator(args.mdx)) if args.mdy is not None: axs.yaxis.set_minor_locator( ticker.MultipleLocator(args.mdy)) axs.tick_params(which="both", direction="out") if args.colorbar: cb = plot.colorbar() cb.set_label("dB") if args.interactive: plot.show() else: publisher.publish(filename, args.ext)
ioreshnikov/wells
timedomain2.py
Python
mit
5,970
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations from django.conf import settings class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Group', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('created', models.DateTimeField(auto_now_add=True)), ('modified', models.DateTimeField(auto_now=True)), ('name', models.CharField(default=b'', max_length=255)), ('rules', models.TextField()), ('notes', models.TextField(blank=True)), ], options={ 'db_table': 'groups', }, bases=(models.Model,), ), migrations.CreateModel( name='GroupUser', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('group', models.ForeignKey(to='access.Group')), ('user', models.ForeignKey(to=settings.AUTH_USER_MODEL)), ], options={ 'db_table': 'groups_users', }, bases=(models.Model,), ), migrations.AlterUniqueTogether( name='groupuser', unique_together=set([('group', 'user')]), ), migrations.AddField( model_name='group', name='users', field=models.ManyToManyField(related_name='groups', through='access.GroupUser', to=settings.AUTH_USER_MODEL), preserve_default=True, ), ]
ingenioustechie/zamboni
mkt/access/migrations/0001_initial.py
Python
bsd-3-clause
1,814
#!/usr/bin/python import os, subprocess, datetime, time class zxinghost: __java_host__ = "zxingHost" def __init__(self, loc = './', zxing_libs = ["core.jar", "javase.jar"]): libs = [loc + l for l in zxing_libs] libs.insert(0, loc) cmd = ["java", "-cp", os.pathsep.join(libs), self.__java_host__] try: self.__zxing_process = subprocess.Popen(cmd, shell=False, stdin=subprocess.PIPE, stdout=subprocess.PIPE, universal_newlines=True) time.sleep(1) except Exception as error: ptint(error) raise error def __del__(self): self.close() def decodeBase64(self, base64): if self.__zxing_process: cmd = 'base64 {0}\n'.format(base64) return self.__sendCommand(cmd) def decodeFile(self, file): if self.__zxing_process: cmd = 'file {0}\n'.format(file) return self.__sendCommand(cmd) def encode(self, text, file): if self.__zxing_process: cmd = 'create {0} {1}\n'.format(text, file) return self.__sendCommand(cmd) def close(self): if self.__zxing_process: self.__zxing_process.communicate(input='q\n') del(self.__zxing_process) def __sendCommand(self, command): self.__zxing_process.stdin.write(command) self.__zxing_process.stdin.flush() out = self.__zxing_process.stdout.readline() if hasattr(out, 'strip'): out = out.strip(os.linesep) return out if __name__ == '__main__': zxing_loc = "zxing2.2/" zxing = zxinghost('./', [zxing_loc + "core.jar", zxing_loc + "javase.jar"]) for i in range(10): print("{0} - {1}".format(datetime.datetime.now().time(), i)) out = zxing.encode('"Welcome to Python.org"', 'test.png') print("{0} - {1}".format(datetime.datetime.now().time(), out)) out = zxing.decodeBase64( 'iVBORw0KGgoAAAANSUhEUgAAAMgAAADIAQAAAACFI5MzAAAA10lEQVR42u3XOw7DIAwGYDNxDG6ahptyDKa4fmV'\ 'I2sz8kYyiiuZbLGwMIX4alJKS8g6ZJKNM+sy267QhiU47D5F+/sWRnVqf/kj4iHJURhUqjCiWbY5fLPFdoov6f/'\ '8slBijPPWdhSJRaw0228TXbCMIyRbR1760QGJtr1jIW+WDkCRe6IkhscscS2Ql65Cn3HfwavFh9bhbSQKJF6DlP'\ 'FoLkMQtQHyrZ4+BET3N2GtQco4nfkMBFe15eklhLNFsW2vRSvy5HyyVOChUblEvl/yeS0l5qXwBYfaE7gyTgqsA'\ 'AAAASUVORK5CYII=') print("{0} - {1}".format(datetime.datetime.now().time(), out)) out = zxing.decodeFile('test.png') print("{0} - {1}".format(datetime.datetime.now().time(), out)) del(zxing)
Jarrey/python-ipc-zxing
zxinghost.py
Python
apache-2.0
2,827
# -*- coding: utf-8 -*- import os import re import sys import time import shutil import select import subprocess import nixops.util import nixops.resources class MachineDefinition(nixops.resources.ResourceDefinition): """Base class for NixOps machine definitions.""" def __init__(self, xml): nixops.resources.ResourceDefinition.__init__(self, xml) self.encrypted_links_to = set([e.get("value") for e in xml.findall("attrs/attr[@name='encryptedLinksTo']/list/string")]) self.store_keys_on_machine = xml.find("attrs/attr[@name='storeKeysOnMachine']/bool").get("value") == "true" self.keys = {k.get("name"): k.find("string").get("value") for k in xml.findall("attrs/attr[@name='keys']/attrs/attr")} self.owners = [e.get("value") for e in xml.findall("attrs/attr[@name='owners']/list/string")] class SSHMaster(object): def __init__(self, tempdir, name, ssh_name, ssh_flags): self._tempdir = tempdir self._control_socket = tempdir + "/ssh-master-" + name self._ssh_name = ssh_name res = subprocess.call( ["ssh", "-x", "root@" + self._ssh_name, "-S", self._control_socket, "-M", "-N", "-f", '-oNumberOfPasswordPrompts=0', '-oServerAliveInterval=60'] + ssh_flags) if res != 0: raise SSHConnectionFailed("unable to start SSH master connection to ‘{0}’".format(name)) self.opts = ["-S", self._control_socket] def __del__(self): subprocess.call( ["ssh", "root@" + self._ssh_name, "-S", self._control_socket, "-O", "exit"], stderr=nixops.util.devnull) class MachineState(nixops.resources.ResourceState): """Base class for NixOps machine state objects.""" vm_id = nixops.util.attr_property("vmId", None) ssh_pinged = nixops.util.attr_property("sshPinged", False, bool) public_vpn_key = nixops.util.attr_property("publicVpnKey", None) store_keys_on_machine = nixops.util.attr_property("storeKeysOnMachine", True, bool) keys = nixops.util.attr_property("keys", [], 'json') owners = nixops.util.attr_property("owners", [], 'json') # Nix store path of the last global configuration deployed to this # machine. Used to check whether this machine is up to date with # respect to the global configuration. cur_configs_path = nixops.util.attr_property("configsPath", None) # Nix store path of the last machine configuration deployed to # this machine. cur_toplevel = nixops.util.attr_property("toplevel", None) def __init__(self, depl, name, id): nixops.resources.ResourceState.__init__(self, depl, name, id) self._ssh_pinged_this_time = False self.ssh_master = None self._ssh_private_key_file = None def get_definition_prefix(self): return "" @property def started(self): state = self.state return state == self.STARTING or state == self.UP def set_common_state(self, defn): self.store_keys_on_machine = defn.store_keys_on_machine self.keys = defn.keys def stop(self): """Stop this machine, if possible.""" self.warn("don't know how to stop machine ‘{0}’".format(self.name)) def start(self): """Start this machine, if possible.""" pass def get_load_avg(self): """Get the load averages on the machine.""" try: res = self.run_command("cat /proc/loadavg", capture_stdout=True, timeout=15).rstrip().split(' ') assert len(res) >= 3 return res except SSHConnectionFailed: return None except SSHCommandFailed: return None # FIXME: Move this to ResourceState so that other kinds of # resources can be checked. def check(self): """Check machine state.""" res = CheckResult() self._check(res) return res def _check(self, res): avg = self.get_load_avg() if avg == None: if self.state == self.UP: self.state = self.UNREACHABLE res.is_reachable = False else: self.state = self.UP self.ssh_pinged = True self._ssh_pinged_this_time = True res.is_reachable = True res.load = avg # Get the systemd units that are in a failed state. out = self.run_command("systemctl --all --full", capture_stdout=True).split('\n') res.failed_units = [] for l in out: match = re.match("^([^ ]+) .* failed .*$", l) if match: res.failed_units.append(match.group(1)) # Currently in systemd, failed mounts enter the # "inactive" rather than "failed" state. So check for # that. Hack: ignore special filesystems like # /sys/kernel/config. Systemd tries to mount these # even when they don't exist. match = re.match("^([^\.]+\.mount) .* inactive .*$", l) if match and not match.group(1).startswith("sys-") and not match.group(1).startswith("dev-"): res.failed_units.append(match.group(1)) def restore(self, defn, backup_id, devices=[]): """Restore persistent disks to a given backup, if possible.""" self.warn("don't know how to restore disks from backup for machine ‘{0}’".format(self.name)) def remove_backup(self, backup_id): """Remove a given backup of persistent disks, if possible.""" self.warn("don't know how to remove a backup for machine ‘{0}’".format(self.name)) def backup(self, defn, backup_id): """Make backup of persistent disks, if possible.""" self.warn("don't know how to make backup of disks for machine ‘{0}’".format(self.name)) def reboot(self): """Reboot this machine.""" self.log("rebooting...") # The sleep is to prevent the reboot from causing the SSH # session to hang. self.run_command("(sleep 2; reboot) &") self.state = self.STARTING def reboot_sync(self): """Reboot this machine and wait until it's up again.""" self.reboot() self.log_start("waiting for the machine to finish rebooting...") nixops.util.wait_for_tcp_port(self.get_ssh_name(), 22, open=False, callback=lambda: self.log_continue(".")) self.log_continue("[down]") nixops.util.wait_for_tcp_port(self.get_ssh_name(), 22, callback=lambda: self.log_continue(".")) self.log_end("[up]") self.state = self.UP self.ssh_pinged = True self._ssh_pinged_this_time = True self.send_keys() def send_keys(self): if self.store_keys_on_machine: return self.run_command("mkdir -m 0700 -p /run/keys") for k, v in self.get_keys().items(): self.log("uploading key ‘{0}’...".format(k)) tmp = self.depl.tempdir + "/key-" + self.name f = open(tmp, "w+"); f.write(v); f.close() self.upload_file(tmp, "/run/keys/" + k) os.remove(tmp) self.run_command("touch /run/keys/done") def get_keys(self): return self.keys def get_ssh_name(self): assert False def get_ssh_flags(self): return [] @property def public_ipv4(self): return None @property def private_ipv4(self): return None def address_to(self, m): """Return the IP address to be used to access machone "m" from this machine.""" ip = m.public_ipv4 if ip: return ip return None def wait_for_ssh(self, check=False): """Wait until the SSH port is open on this machine.""" if self.ssh_pinged and (not check or self._ssh_pinged_this_time): return self.log_start("waiting for SSH...") nixops.util.wait_for_tcp_port(self.get_ssh_name(), 22, callback=lambda: self.log_continue(".")) self.log_end("") self.state = self.UP self.ssh_pinged = True self._ssh_pinged_this_time = True def _open_ssh_master(self, timeout=None): """Start an SSH master connection to speed up subsequent SSH sessions.""" if self.ssh_master is not None: return tries = 1 if timeout else 5 while True: try: self.ssh_master = SSHMaster(self.depl.tempdir, self.name, self.get_ssh_name(), self.get_ssh_flags() + (["-o", "ConnectTimeout={0}".format(timeout)] if timeout else [])) break except Exception: tries = tries - 1 if tries == 0: raise pass def write_ssh_private_key(self, private_key): key_file = "{0}/id_nixops-{1}".format(self.depl.tempdir, self.name) with os.fdopen(os.open(key_file, os.O_CREAT | os.O_WRONLY, 0600), "w") as f: f.write(private_key) self._ssh_private_key_file = key_file return key_file def get_ssh_private_key_file(self): return None def _logged_exec(self, command, check=True, capture_stdout=False, stdin_string=None, env=None): stdin = subprocess.PIPE if stdin_string != None else nixops.util.devnull if capture_stdout: process = subprocess.Popen(command, stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.PIPE, env=env) fds = [process.stdout, process.stderr] log_fd = process.stderr else: process = subprocess.Popen(command, stdin=stdin, stdout=subprocess.PIPE, stderr=subprocess.STDOUT, env=env) fds = [process.stdout] log_fd = process.stdout # FIXME: this can deadlock if stdin_string doesn't fit in the # kernel pipe buffer. if stdin_string != None: process.stdin.write(stdin_string) for fd in fds: nixops.util.make_non_blocking(fd) at_new_line = True stdout = "" while len(fds) > 0: # The timeout/poll is to deal with processes (like # VBoxManage) that start children that go into the # background but keep the parent's stdout/stderr open, # preventing an EOF. FIXME: Would be better to catch # SIGCHLD. (r, w, x) = select.select(fds, [], [], 1) if len(r) == 0 and process.poll() != None: break if capture_stdout and process.stdout in r: data = process.stdout.read() if data == "": fds.remove(process.stdout) else: stdout += data if log_fd in r: data = log_fd.read() if data == "": if not at_new_line: self.log_end("") fds.remove(log_fd) else: start = 0 while start < len(data): end = data.find('\n', start) if end == -1: self.log_start(data[start:]) at_new_line = False else: s = data[start:end] if at_new_line: self.log(s) else: self.log_end(s) at_new_line = True if end == -1: break start = end + 1 res = process.wait() if stdin_string != None: process.stdin.close() if check and res != 0: raise SSHCommandFailed("command ‘{0}’ failed on machine ‘{1}’".format(command, self.name)) return stdout if capture_stdout else res def run_command(self, command, check=True, capture_stdout=False, stdin_string=None, timeout=None): """Execute a command on the machine via SSH.""" # Note that the timeout is only respected if this is the first # call to _open_ssh_master(). self._open_ssh_master(timeout=timeout) cmdline = ( ["ssh", "-x", "root@" + self.get_ssh_name()] + self.ssh_master.opts + self.get_ssh_flags() + [command]) return self._logged_exec(cmdline, check=check, capture_stdout=capture_stdout, stdin_string=stdin_string) def copy_closure_to(self, path): """Copy a closure to this machine.""" # !!! Implement copying between cloud machines, as in the Perl # version. # It's usually faster to let the target machine download # substitutes from nixos.org, so try that first. if not self.has_really_fast_connection(): closure = subprocess.check_output(["nix-store", "-qR", path]).splitlines() self.run_command("nix-store -j 4 -r --ignore-unknown " + ' '.join(closure), check=False) # Any remaining paths are copied from the local machine. env = dict(os.environ) env['NIX_SSHOPTS'] = ' '.join(self.get_ssh_flags()); self._logged_exec( ["nix-copy-closure", "--to", "root@" + self.get_ssh_name(), path] + ([] if self.has_really_fast_connection() else ["--gzip"]), env=env) def has_really_fast_connection(self): return False def generate_vpn_key(self): try: self.run_command("test -f /root/.ssh/id_charon_vpn") _vpn_key_exists = True except SSHCommandFailed: _vpn_key_exists = False if self.public_vpn_key and _vpn_key_exists: return (private, public) = nixops.util.create_key_pair(key_name="NixOps VPN key of {0}".format(self.name)) f = open(self.depl.tempdir + "/id_vpn-" + self.name, "w+") f.write(private) f.seek(0) # FIXME: use run_command res = subprocess.call( ["ssh", "-x", "root@" + self.get_ssh_name()] + self.get_ssh_flags() + ["umask 077 && mkdir -p /root/.ssh && cat > /root/.ssh/id_charon_vpn"], stdin=f) f.close() if res != 0: raise Exception("unable to upload VPN key to ‘{0}’".format(self.name)) self.public_vpn_key = public def upload_file(self, source, target, recursive=False): self._open_ssh_master() # FIXME: use ssh master if recursive: recursive_cmdline = [ '-r' ] else: recursive_cmdline = [ ] cmdline = ["scp"] + self.get_ssh_flags() + recursive_cmdline + [source, "root@" + self.get_ssh_name() + ":" + target] return self._logged_exec(cmdline) def download_file(self, source, target, recursive=False): self._open_ssh_master() # FIXME: use ssh master if recursive: recursive_cmdline = [ '-r' ] else: recursive_cmdline = [ ] cmdline = ["scp"] + self.get_ssh_flags() + recursive_cmdline + ["root@" + self.get_ssh_name() + ":" + source, target] return self._logged_exec(cmdline) def get_console_output(self): return "(not available for this machine type)\n" class SSHConnectionFailed(Exception): pass class SSHCommandFailed(Exception): pass class CheckResult(object): def __init__(self): # Whether the resource exists. self.exists = None # Whether the resource is "up". Generally only meaningful for # machines. self.is_up = None # Whether the resource is reachable via SSH. self.is_reachable = None # Whether the disks that should be attached to a machine are # in fact properly attached. self.disks_ok = None # List of systemd units that are in a failed state. self.failed_units = None # Load average on the machine. self.load = None # Error messages. self.messages = [] # FIXME: add a check whether the active NixOS config on the # machine is correct. import nixops.backends.none import nixops.backends.virtualbox import nixops.backends.ec2 import nixops.resources.ec2_keypair import nixops.resources.sqs_queue import nixops.resources.s3_bucket import nixops.resources.iam_role def create_definition(xml): """Create a machine definition object from the given XML representation of the machine's attributes.""" target_env = xml.find("attrs/attr[@name='targetEnv']/string").get("value") for i in [nixops.backends.none.NoneDefinition, nixops.backends.virtualbox.VirtualBoxDefinition, nixops.backends.ec2.EC2Definition]: if target_env == i.get_type(): return i(xml) raise nixops.deployment.UnknownBackend("unknown backend type ‘{0}’".format(target_env)) def create_state(depl, type, name, id): """Create a machine state object of the desired backend type.""" for i in [nixops.backends.none.NoneState, nixops.backends.virtualbox.VirtualBoxState, nixops.backends.ec2.EC2State, nixops.resources.ec2_keypair.EC2KeyPairState, nixops.resources.sqs_queue.SQSQueueState, nixops.resources.iam_role.IAMRoleState, nixops.resources.s3_bucket.S3BucketState]: if type == i.get_type(): return i(depl, name, id) raise nixops.deployment.UnknownBackend("unknown backend type ‘{0}’".format(type))
garbas/nixops
nixops/backends/__init__.py
Python
lgpl-3.0
17,426
# # Copyright 2016 The BigDL Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # from bigdl.orca.automl.model.base_keras_model import KerasBaseModel from collections.abc import Iterable import numpy as np def model_creator(config): from tensorflow.keras.models import Model from tensorflow.keras.layers import Input, Dense, LSTM, Dropout import tensorflow as tf inp = Input(shape=(None, config["input_dim"])) if "lstm_1_units" in config and "lstm_2_units" in config: lstm_units = (config["lstm_1_units"], config["lstm_2_units"]) else: lstm_units = config.get("lstm_units", [32, 32]) if "dropout_1" in config and "dropout_2" in config: dropout_rates = (config["dropout_1"], config["dropout_2"]) else: dropout_rates = config.get("dropouts", 0.2) lstm_units = [lstm_units] if not isinstance(lstm_units, Iterable) else lstm_units for i, unit in enumerate(lstm_units): return_sequences = True if i != len(lstm_units) - 1 else False dropout_rate = dropout_rates[i] if isinstance(dropout_rates, Iterable) else dropout_rates lstm_input = inp if i == 0 else dropout lstm = LSTM(units=unit, return_sequences=return_sequences)(lstm_input) dropout = Dropout(rate=dropout_rate)(lstm) out = Dense(config["output_dim"])(dropout) model = Model(inputs=inp, outputs=out) model.compile(loss=config.get("loss", "mse"), optimizer=getattr(tf.keras.optimizers, config.get("optim", "Adam")) (learning_rate=config.get("lr", 0.001)), metrics=[config.get("metric", "mse")]) return model def check_iter_type(obj, type): return isinstance(obj, type) or \ (isinstance(obj, Iterable) and all(isinstance(o, type) for o in obj)) class VanillaLSTM(KerasBaseModel): def __init__(self, check_optional_config=False, future_seq_len=1): super(VanillaLSTM, self).__init__(model_creator=model_creator, check_optional_config=check_optional_config) def _check_config(self, **config): super()._check_config(**config) assert isinstance(config["input_dim"], int), "'input_dim' should be int" assert isinstance(config["output_dim"], int), "'output_dim' should be int" lstm_name = "lstm_units" dropout_name = "dropouts" if lstm_name in config: if not check_iter_type(config[lstm_name], (int, np.integer)): raise ValueError(f"{lstm_name} should be int or an list/tuple of ints. " f"Got {config[lstm_name]}") if dropout_name in config: if not check_iter_type(config[dropout_name], (float, np.float)): raise ValueError(f"{dropout_name} should be float or a list/tuple of floats. " f"Got {config[dropout_name]}") if lstm_name in config and dropout_name in config: if (isinstance(config[lstm_name], int) and isinstance(config[dropout_name], Iterable)) \ or (isinstance(config[lstm_name], Iterable) and isinstance(config[dropout_name], Iterable) and len(config[lstm_name]) != len(config[dropout_name])): raise ValueError(f"{lstm_name} should have the same elements num as {dropout_name}") def _get_required_parameters(self): return {"input_dim", "output_dim" } | super()._get_required_parameters() def _get_optional_parameters(self): return {"lstm_units", "dropouts", "optim", "lr" } | super()._get_optional_parameters()
intel-analytics/BigDL
python/chronos/src/bigdl/chronos/model/VanillaLSTM.py
Python
apache-2.0
4,224
SUB_PACKET_SIZE = 5 # [ax, ay, az, pressure, t] PACKET_DELIMINATOR = "<>" SUB_PACKET_DELIMINATOR = " " SAMPLE_MEMORY = 21 PRESSURE_NORMALIZER = 2.3 * 14.0 WINDOW_SIZE = 1000 # FIFO_SAMPLE_PERIOD = 1.0 / 100.0 SEND_POSITION_THRESHOLD = 60 ACCEL_G = 9.832 # LSB_G = 16384.0 / 2.0 LSB_G = 4096.0 / 8.0 # I think KILL_THRESHOLD_LOW = 0.01 KILL_THRESHOLD_HIGH = 10.0 DYNAMIC_LENGTH = 1000
GEverding/touchVision
io/cleaner/constants.py
Python
mit
390
# -*- coding: utf-8 -*- # Copyright (C) 2010-2013 Tobias Weber <[email protected]> # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import logging from .baseServer import BaseServer from levitas.lib import utils log = logging.getLogger("levitas.server.eventletServer") class EventletServer(BaseServer): """ Eventlet WSGI Server. Example SETTINGS entry ====================== # Server address httpserver_address = ("127.0.0.1", 8080) """ def start(self): try: import eventlet from eventlet import wsgi wsgi.server(eventlet.listen(self.server_address, backlog=500), self.app, max_size=8000) except Exception as err: log.error(str(err), exc_info=True) finally: log.info("HTTPD stopped")
tobi-weber/levitas
src/levitas/server/eventletServer.py
Python
apache-2.0
1,391
# Copyright 2018 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Contains definitions for the post-activation form of Residual Networks. Residual networks (ResNets) were proposed in: [1] Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun Deep Residual Learning for Image Recognition. arXiv:1512.03385 """ from __future__ import absolute_import from __future__ import division from __future__ import print_function import tensorflow as tf from mlperf_compliance import mlperf_log from mlperf_compliance import resnet_log_helper BATCH_NORM_DECAY = 0.9 BATCH_NORM_EPSILON = 1e-5 def batch_norm_relu(inputs, is_training, relu=True, init_zero=False, data_format='channels_first'): """Performs a batch normalization followed by a ReLU. Args: inputs: `Tensor` of shape `[batch, channels, ...]`. is_training: `bool` for whether the model is training. relu: `bool` if False, omits the ReLU operation. init_zero: `bool` if True, initializes scale parameter of batch normalization with 0 instead of 1 (default). data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: A normalized `Tensor` with the same `data_format`. """ if init_zero: gamma_initializer = tf.zeros_initializer() else: gamma_initializer = tf.ones_initializer() if data_format == 'channels_first': axis = 1 else: axis = 3 outputs = tf.layers.batch_normalization( inputs=inputs, axis=axis, momentum=BATCH_NORM_DECAY, epsilon=BATCH_NORM_EPSILON, center=True, scale=True, training=is_training, fused=True, gamma_initializer=gamma_initializer) if is_training: resnet_log_helper.log_batch_norm( input_tensor=inputs, output_tensor=outputs, momentum=BATCH_NORM_DECAY, epsilon=BATCH_NORM_EPSILON, center=True, scale=True, training=is_training) if relu: if is_training: mlperf_log.resnet_print(key=mlperf_log.MODEL_HP_RELU) outputs = tf.nn.relu(outputs) return outputs def fixed_padding(inputs, kernel_size, data_format='channels_first'): """Pads the input along the spatial dimensions independently of input size. Args: inputs: `Tensor` of size `[batch, channels, height, width]` or `[batch, height, width, channels]` depending on `data_format`. kernel_size: `int` kernel size to be used for `conv2d` or max_pool2d` operations. Should be a positive integer. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: A padded `Tensor` of the same `data_format` with size either intact (if `kernel_size == 1`) or padded (if `kernel_size > 1`). """ pad_total = kernel_size - 1 pad_beg = pad_total // 2 pad_end = pad_total - pad_beg if data_format == 'channels_first': padded_inputs = tf.pad(inputs, [[0, 0], [0, 0], [pad_beg, pad_end], [pad_beg, pad_end]]) else: padded_inputs = tf.pad(inputs, [[0, 0], [pad_beg, pad_end], [pad_beg, pad_end], [0, 0]]) return padded_inputs def conv2d_fixed_padding(inputs, filters, kernel_size, strides, is_training, data_format='channels_first'): """Strided 2-D convolution with explicit padding. The padding is consistent and is based only on `kernel_size`, not on the dimensions of `inputs` (as opposed to using `tf.layers.conv2d` alone). Args: inputs: `Tensor` of size `[batch, channels, height_in, width_in]`. filters: `int` number of filters in the convolution. kernel_size: `int` size of the kernel to be used in the convolution. strides: `int` strides of the convolution. is_training: `bool` for whether the model is in training. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: A `Tensor` of shape `[batch, filters, height_out, width_out]`. """ inputs_for_logging = inputs if strides > 1: inputs = fixed_padding(inputs, kernel_size, data_format=data_format) outputs = tf.layers.conv2d( inputs=inputs, filters=filters, kernel_size=kernel_size, strides=strides, padding=('SAME' if strides == 1 else 'VALID'), use_bias=False, kernel_initializer=tf.variance_scaling_initializer(), data_format=data_format) if is_training: resnet_log_helper.log_conv2d( input_tensor=inputs_for_logging, output_tensor=outputs, stride=strides, filters=filters, initializer=mlperf_log.TRUNCATED_NORMAL, use_bias=False) return outputs def residual_block(inputs, filters, is_training, strides, use_projection=False, data_format='channels_first'): """Standard building block for residual networks with BN after convolutions. Args: inputs: `Tensor` of size `[batch, channels, height, width]`. filters: `int` number of filters for the first two convolutions. Note that the third and final convolution will use 4 times as many filters. is_training: `bool` for whether the model is in training. strides: `int` block stride. If greater than 1, this block will ultimately downsample the input. use_projection: `bool` for whether this block should use a projection shortcut (versus the default identity shortcut). This is usually `True` for the first block of a block group, which may change the number of filters and the resolution. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: The output `Tensor` of the block. """ shortcut = inputs if use_projection: # Projection shortcut in first layer to match filters and strides shortcut = conv2d_fixed_padding( inputs=inputs, filters=filters, kernel_size=1, strides=strides, is_training=is_training, data_format=data_format) shortcut = batch_norm_relu(shortcut, is_training, relu=False, data_format=data_format) inputs = conv2d_fixed_padding( inputs=inputs, filters=filters, kernel_size=3, strides=strides, is_training=is_training, data_format=data_format) inputs = batch_norm_relu(inputs, is_training, data_format=data_format) inputs = conv2d_fixed_padding( inputs=inputs, filters=filters, kernel_size=3, strides=1, is_training=is_training, data_format=data_format) inputs = batch_norm_relu(inputs, is_training, relu=False, init_zero=True, data_format=data_format) return tf.nn.relu(inputs + shortcut) def bottleneck_block(inputs, filters, is_training, strides, use_projection=False, data_format='channels_first'): """Bottleneck block variant for residual networks with BN after convolutions. Args: inputs: `Tensor` of size `[batch, channels, height, width]`. filters: `int` number of filters for the first two convolutions. Note that the third and final convolution will use 4 times as many filters. is_training: `bool` for whether the model is in training. strides: `int` block stride. If greater than 1, this block will ultimately downsample the input. use_projection: `bool` for whether this block should use a projection shortcut (versus the default identity shortcut). This is usually `True` for the first block of a block group, which may change the number of filters and the resolution. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: The output `Tensor` of the block. """ if is_training: mlperf_log.resnet_print( key=mlperf_log.MODEL_HP_BLOCK_TYPE, value=mlperf_log.BOTTLENECK_BLOCK) resnet_log_helper.log_begin_block( input_tensor=inputs, block_type=mlperf_log.BOTTLENECK_BLOCK) shortcut = inputs if use_projection: # Projection shortcut only in first block within a group. Bottleneck blocks # end with 4 times the number of filters. filters_out = 4 * filters shortcut = conv2d_fixed_padding( inputs=inputs, filters=filters_out, kernel_size=1, strides=strides, is_training=is_training, data_format=data_format) shortcut = batch_norm_relu(shortcut, is_training, relu=False, data_format=data_format) if is_training: resnet_log_helper.log_projection( input_tensor=inputs, output_tensor=shortcut) inputs = conv2d_fixed_padding( inputs=inputs, filters=filters, kernel_size=1, strides=1, is_training=is_training, data_format=data_format) inputs = batch_norm_relu(inputs, is_training, data_format=data_format) inputs = conv2d_fixed_padding( inputs=inputs, filters=filters, kernel_size=3, strides=strides, is_training=is_training, data_format=data_format) inputs = batch_norm_relu(inputs, is_training, data_format=data_format) inputs = conv2d_fixed_padding( inputs=inputs, filters=4 * filters, kernel_size=1, strides=1, is_training=is_training, data_format=data_format) inputs = batch_norm_relu(inputs, is_training, relu=False, init_zero=True, data_format=data_format) output = tf.nn.relu(inputs + shortcut) if is_training: mlperf_log.resnet_print(key=mlperf_log.MODEL_HP_SHORTCUT_ADD) mlperf_log.resnet_print(key=mlperf_log.MODEL_HP_RELU) resnet_log_helper.log_end_block(output_tensor=output) return output def block_group(inputs, filters, block_fn, blocks, strides, is_training, name, data_format='channels_first'): """Creates one group of blocks for the ResNet model. Args: inputs: `Tensor` of size `[batch, channels, height, width]`. filters: `int` number of filters for the first convolution of the layer. block_fn: `function` for the block to use within the model blocks: `int` number of blocks contained in the layer. strides: `int` stride to use for the first convolution of the layer. If greater than 1, this layer will downsample the input. is_training: `bool` for whether the model is training. name: `str`name for the Tensor output of the block layer. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: The output `Tensor` of the block layer. """ # Drop batch size from shape logging. if is_training: mlperf_log.resnet_print( key=mlperf_log.MODEL_HP_INITIAL_SHAPE, value=inputs.shape.as_list()[1:]) # Only the first block per block_group uses projection shortcut and strides. inputs = block_fn(inputs, filters, is_training, strides, use_projection=True, data_format=data_format) for _ in range(1, blocks): inputs = block_fn(inputs, filters, is_training, 1, data_format=data_format) return tf.identity(inputs, name) def resnet_v1_generator(block_fn, layers, num_classes, data_format='channels_first'): """Generator for ResNet v1 models. Args: block_fn: `function` for the block to use within the model. Either `residual_block` or `bottleneck_block`. layers: list of 4 `int`s denoting the number of blocks to include in each of the 4 block groups. Each group consists of blocks that take inputs of the same resolution. num_classes: `int` number of possible classes for image classification. data_format: `str` either "channels_first" for `[batch, channels, height, width]` or "channels_last for `[batch, height, width, channels]`. Returns: Model `function` that takes in `inputs` and `is_training` and returns the output `Tensor` of the ResNet model. """ def model(inputs, is_training): """Creation of the model graph.""" inputs = conv2d_fixed_padding( inputs=inputs, filters=64, kernel_size=7, strides=2, is_training=is_training, data_format=data_format) inputs = tf.identity(inputs, 'initial_conv') inputs = batch_norm_relu(inputs, is_training, data_format=data_format) pooled_inputs = tf.layers.max_pooling2d( inputs=inputs, pool_size=3, strides=2, padding='SAME', data_format=data_format) if is_training: resnet_log_helper.log_max_pool(input_tensor=inputs, output_tensor=pooled_inputs) inputs = tf.identity(pooled_inputs, 'initial_max_pool') inputs = block_group( inputs=inputs, filters=64, block_fn=block_fn, blocks=layers[0], strides=1, is_training=is_training, name='block_group1', data_format=data_format) inputs = block_group( inputs=inputs, filters=128, block_fn=block_fn, blocks=layers[1], strides=2, is_training=is_training, name='block_group2', data_format=data_format) inputs = block_group( inputs=inputs, filters=256, block_fn=block_fn, blocks=layers[2], strides=2, is_training=is_training, name='block_group3', data_format=data_format) inputs = block_group( inputs=inputs, filters=512, block_fn=block_fn, blocks=layers[3], strides=2, is_training=is_training, name='block_group4', data_format=data_format) # The activation is 7x7 so this is a global average pool. # TODO(huangyp): reduce_mean will be faster. pool_size = (inputs.shape[1], inputs.shape[2]) inputs = tf.layers.average_pooling2d( inputs=inputs, pool_size=pool_size, strides=1, padding='VALID', data_format=data_format) inputs = tf.identity(inputs, 'final_avg_pool') inputs = tf.reshape( inputs, [-1, 2048 if block_fn is bottleneck_block else 512]) if is_training: mlperf_log.resnet_print(key=mlperf_log.MODEL_HP_DENSE, value=num_classes) inputs = tf.layers.dense( inputs=inputs, units=num_classes, kernel_initializer=tf.random_normal_initializer(stddev=.01)) inputs = tf.identity(inputs, 'final_dense') if is_training: mlperf_log.resnet_print( key=mlperf_log.MODEL_HP_FINAL_SHAPE, value=inputs.shape.as_list()[1:]) return inputs model.default_image_size = 224 return model def resnet_v1(resnet_depth, num_classes, data_format='channels_first'): """Returns the ResNet model for a given size and number of output classes.""" model_params = { 18: {'block': residual_block, 'layers': [2, 2, 2, 2]}, 34: {'block': residual_block, 'layers': [3, 4, 6, 3]}, 50: {'block': bottleneck_block, 'layers': [3, 4, 6, 3]}, 101: {'block': bottleneck_block, 'layers': [3, 4, 23, 3]}, 152: {'block': bottleneck_block, 'layers': [3, 8, 36, 3]}, 200: {'block': bottleneck_block, 'layers': [3, 24, 36, 3]} } if resnet_depth not in model_params: raise ValueError('Not a valid resnet_depth:', resnet_depth) params = model_params[resnet_depth] return resnet_v1_generator( params['block'], params['layers'], num_classes, data_format)
mlperf/training_results_v0.5
v0.5.0/google/cloud_v3.8/resnet-tpuv3-8/code/resnet/model/staging/models/rough/resnet/resnet_model.py
Python
apache-2.0
16,310
"""Basic checks for HomeKitSwitch.""" from tests.components.homekit_controller.common import ( setup_test_component) async def test_switch_change_outlet_state(hass, utcnow): """Test that we can turn a HomeKit outlet on and off again.""" from homekit.model.services import OutletService helper = await setup_test_component(hass, [OutletService()]) await hass.services.async_call('switch', 'turn_on', { 'entity_id': 'switch.testdevice', }, blocking=True) assert helper.characteristics[('outlet', 'on')].value == 1 await hass.services.async_call('switch', 'turn_off', { 'entity_id': 'switch.testdevice', }, blocking=True) assert helper.characteristics[('outlet', 'on')].value == 0 async def test_switch_read_outlet_state(hass, utcnow): """Test that we can read the state of a HomeKit outlet accessory.""" from homekit.model.services import OutletService helper = await setup_test_component(hass, [OutletService()]) # Initial state is that the switch is off and the outlet isn't in use switch_1 = await helper.poll_and_get_state() assert switch_1.state == 'off' assert switch_1.attributes['outlet_in_use'] is False # Simulate that someone switched on the device in the real world not via HA helper.characteristics[('outlet', 'on')].set_value(True) switch_1 = await helper.poll_and_get_state() assert switch_1.state == 'on' assert switch_1.attributes['outlet_in_use'] is False # Simulate that device switched off in the real world not via HA helper.characteristics[('outlet', 'on')].set_value(False) switch_1 = await helper.poll_and_get_state() assert switch_1.state == 'off' # Simulate that someone plugged something into the device helper.characteristics[('outlet', 'outlet-in-use')].value = True switch_1 = await helper.poll_and_get_state() assert switch_1.state == 'off' assert switch_1.attributes['outlet_in_use'] is True
MartinHjelmare/home-assistant
tests/components/homekit_controller/test_switch.py
Python
apache-2.0
1,974
import random from testcases.testcases_base import TestcasesBase import unittest, time class TestStoragepoolsAPI(TestcasesBase): def setUp(self): super().setUp() self.freeDisks = [x['name'] for x in self.core0_client.getFreeDisks()] if self.freeDisks == []: self.skipTest(' [*] No free disks on node {}'.format(self.nodeid)) self.lg.info(' [*] Create storagepool (SP0) on node (N0)') self.response, self.data = self.storagepools_api.post_storagepools(node_id=self.nodeid, free_devices=self.freeDisks) self.assertEqual(self.response.status_code, 201) if self.id().split('.')[-1] in ['test009_get_storagepool_filessystem', 'test010_list_storagepool_filesystems', 'test011_post_storagepool_filesystem', 'test012_delete_storagepool_filesystem']: self.setUp_plus_fileSystem() elif self.id().split('.')[-1] in ['test013_get_storagepool_filessystem_snapshot', 'test014_list_storagepool_filesystems_snapshots', 'test015_post_storagepool_filesystem_snapshot', 'test016_delete_storagepool_filesystem_snapshot', 'test017_post_storagepool_filesystem_snapshot_rollback']: self.setUp_plus_fileSystem_plus_snapShots() def tearDown(self): self.storagepools_api.delete_storagepools_storagepoolname(self.nodeid, self.data['name']) super().tearDown() def setUp_plus_fileSystem(self, **kwargs): self.lg.info(' [*] Create filesystem (FS0) on storagepool {}'.format(self.data['name'])) self.response_filesystem, self.data_filesystem = self.storagepools_api.post_storagepools_storagepoolname_filesystems( node_id=self.nodeid, storagepoolname=self.data['name'], **kwargs) self.assertEqual(self.response_filesystem.status_code, 201, " [*] Can't create filesystem on storagepool.") def setUp_plus_fileSystem_plus_snapShots(self): self.setUp_plus_fileSystem() self.lg.info(' [*] Create snapshot (SS0) of filesystem {}'.format(self.data_filesystem['name'])) self.response_snapshot, self.data_snapshot = self.storagepools_api.post_filesystems_snapshots(self.nodeid, self.data['name'], self.data_filesystem[ 'name']) self.assertEqual(self.response_snapshot.status_code, 201, " [*] can't create new snapshot.") def test001_get_storagepool(self): """ GAT-045 **Test Scenario:** #. Create storagepool (SP0) on node (N0), should succeed. #. Get storagepool (SP0), should succeed with 200. #. Get storagepool (SP0) using python client, should be listed #. Get nonexisting storagepool, should fail with 404. """ self.lg.info(' [*] Get storagepool (SP0), should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) for key in self.data.keys(): if key == 'devices': continue self.assertEqual(response.json()[key], self.data[key]) self.lg.info(' [*] Get storagepool (SP0) using python client, should be listed') storagepools = self.core0_client.client.btrfs.list() storagepool_sp0 = [x for x in storagepools if x['label'] == 'sp_{}'.format(self.data['name'])] self.assertNotEqual(storagepool_sp0, []) for device in self.data['devices']: self.assertIn(device, [x['path'][:-1] for x in storagepool_sp0[0]['devices']]) self.lg.info(' [*] Get nonexisting storagepool, should fail with 404') response = self.storagepools_api.get_storagepools_storagepoolname(self.nodeid, 'fake_storagepool') self.assertEqual(response.status_code, 404) def test002_list_storagepool(self): """ GAT-046 **Test Scenario:** #. Create Storagepool (SP0) on node (N0). #. list node (N0) storagepools, storagepool (SP0) should be listed. """ self.lg.info(' [*] list node (N0) storagepools, storagepool (SP0) should be listed') response = self.storagepools_api.get_storagepools(self.nodeid) self.assertEqual(response.status_code, 200) self.assertIn(self.data['name'], [x['name'] for x in response.json()]) def test003_post_storagepool(self): """ GAT-047 **Test Scenario:** #. Get random nodid (N0). #. Create storagepool (SP0) on node (N0). #. Get storagepool (SP0), should succeed with 200. #. Get storagepool (SP1) using python client, should be listed #. Delete Storagepool (SP0), should succeed with 204. #. Create invalid storagepool (missing required params), should fail with 400. """ self.lg.info(' [*] Get Storagepool (SP1), should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) for key in self.data.keys(): if key == 'devices': continue self.assertEqual(response.json()[key], self.data[key]) self.lg.info(' [*] Get storagepool (SP0) using python client, should be listed') storagepools = self.core0_client.client.btrfs.list() storagepool_sp1 = [x for x in storagepools if x['label'] == 'sp_{}'.format(self.data['name'])] self.assertNotEqual(storagepool_sp1, []) for device in self.data['devices']: self.assertIn(device, [x['path'][:-1] for x in storagepool_sp1[0]['devices']]) self.lg.info(' [*] Delete Storagepool (SP0), should succeed with 204') response = self.storagepools_api.delete_storagepools_storagepoolname(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] Create invalid storagepool, should fail with 400') response, data = self.storagepools_api.post_storagepools(self.nodeid, free_devices=self.freeDisks, name='', devices='') self.assertEqual(response.status_code, 400) def test004_delete_storagepool(self): """ GAT-048 **Test Scenario:** #. Create Storagepool (SP0) on node (N0). #. Delete Storagepool (SP0), should succeed with 204. #. list node (N0) storagepools, storagepool (SP0) should be gone. #. Delete nonexisting storagepool, should fail with 204. """ self.lg.info(' [*] Delete storagepool (SP0), should succeed with 204') response = self.storagepools_api.delete_storagepools_storagepoolname(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] list node (N0) storagepools, storagepool (SP0) should be gone') response = self.storagepools_api.get_storagepools(self.nodeid) self.assertEqual(response.status_code, 200) self.assertNotIn(self.data['name'], [x['name'] for x in response.json()]) self.lg.info(' [*] Delete nonexisting storagepool, should fail with 204') response = self.storagepools_api.delete_storagepools_storagepoolname(self.nodeid, self.rand_str()) self.assertEqual(response.status_code, 204) def test005_get_storagepool_device(self): """ GAT-049 **Test Scenario:** #. Create storagepool (SP0) with device (DV0) on node (N0). #. Get device (DV0), should succeed with 200. #. Get nonexisting device, should fail with 404. """ self.lg.info(' [*] Get device (DV0), should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname_devices(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertNotEqual(response.json(), []) device_uuid = response.json()[0]['uuid'] response = self.storagepools_api.get_storagepools_storagepoolname_devices_deviceid(self.nodeid, self.data['name'], device_uuid) self.assertEqual(response.status_code, 200) self.assertEqual(response.json()['deviceName'][:-1], self.data['devices'][0]) self.assertEqual(response.json()['uuid'], device_uuid) self.assertEqual(response.json()['status'], 'healthy') self.lg.info(' [*] Get nonexisting device, should fail with 404') response = self.storagepools_api.get_storagepools_storagepoolname_devices_deviceid(self.nodeid, self.data['name'], self.rand_str()) self.assertEqual(response.status_code, 404) def test006_list_storagepool_devices(self): """ GAT-050 **Test Scenario:** #. Create storagepool (SP0) with device (DV0) on node (N0). #. list storagepool (SP0) devices, should succeed with 200. """ self.lg.info(' [*] list storagepool (SP0) devices, should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname_devices(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertNotEqual(response.json(), []) self.assertEqual(len(response.json()), len(self.data['devices'])) self.assertEqual(response.json()[0]['status'], 'healthy') def test007_post_storagepool_device(self): """ GAT-051 **Test Scenario:** #. Get random nodid (N0). #. Create storagepool (SP0) with device (DV0) on node (N0). #. Create device (DV1) on storagepool (SP0), should succeed with 201. #. list storagepool (SP0) devices, device (DV1) should be listed. #. Create device with invalid body, should fail with 400. """ self.lg.info(' [*] Create device (DV1) on storagepool (SP0), should succeed with 201') free_devices = [x['name'] for x in self.core0_client.getFreeDisks()] if free_devices == []: self.skipTest('no free disks on node {}'.format(self.nodeid)) device = random.choice(free_devices) body = [device] response = self.storagepools_api.post_storagepools_storagepoolname_devices(self.nodeid, self.data['name'], body) self.assertEqual(response.status_code, 201) for _ in range(30): free_devices = [x['name'] for x in self.core0_client.getFreeDisks()] if device not in free_devices: break else: time.sleep(1) self.lg.info(' [*] list storagepool (SP0) devices, should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname_devices(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertIn(device, [x['deviceName'][:-1] for x in response.json()]) # issue https://github.com/zero-os/0-orchestrator/issues/398 # self.lg.info(' [*] Create device with invalid body, should fail with 400') # body = "" # response = self.storagepools_api.post_storagepools_storagepoolname_devices(self.nodeid, storagepool['name'], body) # self.assertEqual(response.status_code, 400) def test008_delete_storagepool_device(self): """ GAT-052 **Test Scenario:** #. Create storagepool (SP0) with device (DV0) on node (N1), should succeed with 201. #. Delete device (DV0), should succeed with 204. #. list storagepool (SP0) devices, device (DV0) should be gone. #. Delete nonexisting device, should fail with 204. """ self.lg.info(' [*] Create device (DV1) on storagepool (SP0), should succeed with 201') free_devices = [x['name'] for x in self.core0_client.getFreeDisks()] if free_devices == []: self.skipTest('no free disks on node {}'.format(self.nodeid)) device = random.choice(free_devices) body = [device] response = self.storagepools_api.post_storagepools_storagepoolname_devices(self.nodeid, self.data['name'], body) self.assertEqual(response.status_code, 201) for _ in range(30): free_devices = [x['name'] for x in self.core0_client.getFreeDisks()] if device not in free_devices: break else: time.sleep(1) self.lg.info(' [*] list storagepool (SP0) devices, device (DV0) should be gone') response = self.storagepools_api.get_storagepools_storagepoolname_devices(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) deviceuuid = [x['uuid'] for x in response.json() if x['deviceName'][:-1] == device] self.assertNotEqual(deviceuuid, [], 'device was not added to storagepool') self.lg.info(' [*] Delete device (DV1), should succeed with 204') response = self.storagepools_api.delete_storagepools_storagepoolname_devices_deviceid(self.nodeid, self.data['name'], deviceuuid[0]) self.assertEqual(response.status_code, 204) for _ in range(30): free_devices = [x['name'] for x in self.core0_client.getFreeDisks()] if device in free_devices: break else: time.sleep(1) self.lg.info(' [*] list storagepool (SP0) devices, device (DV0) should be gone') response = self.storagepools_api.get_storagepools_storagepoolname_devices(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertNotIn(device, [x['deviceName'][:-1] for x in response.json()]) self.lg.info(' [*] Delete nonexisting device, should fail with 204') response = self.storagepools_api.delete_storagepools_storagepoolname_devices_deviceid(self.nodeid, self.data['name'], self.rand_str()) self.assertEqual(response.status_code, 204) def test009_get_storagepool_filessystem(self): """ GAT-053 **Test Scenario:** #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Get filesystem (FS0), should succeed with 200. #. Get nonexisting filesystem, should fail with 404. """ self.lg.info(' [*] Get filesystem (FS0), should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data['name'], self.data_filesystem[ 'name']) self.assertEqual(response.status_code, 200) for key in self.data_filesystem.keys(): self.assertEqual(response.json()[key], self.data_filesystem[key]) self.lg.info(' [*] Get nonexisting filesystem, should fail with 404') response = self.storagepools_api.get_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data['name'], self.rand_str()) self.assertEqual(response.status_code, 404) def test010_list_storagepool_filesystems(self): """ GAT-054 **Test Scenario:** #. Create Storagepool (SP0) on node (N0). #. Create filesystem (FS0) on storagepool (SP0). #. list storagepools (SP0) filesystems, filesystem (FS0) should be listed. """ self.lg.info(' [*] list storagepools (SP0) filesystems, filesystem (FS0) should be listed') response = self.storagepools_api.get_storagepools_storagepoolname_filesystems(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertIn(self.data_filesystem['name'], response.json()) def test011_post_storagepool_filesystem(self): """ GAT-055 **Test Scenario:** #. Get random nodid (N0). #. Create storagepool (SP0) on node (N0). #. Create filesystem (FS1) on storagepool (SP0), should succeed with 201. #. Get filesystem (FS1), should succeed with 200. #. Delete filesystem (FS1), should succeed with 204. #. Create invalid filesystem (missing required params), should fail with 400. """ self.lg.info(' [*] Get filesystem (FS1), should succeed with 200') response = self.storagepools_api.get_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data['name'], self.data_filesystem[ 'name']) self.assertEqual(response.status_code, 200) for key in self.data_filesystem.keys(): self.assertEqual(response.json()[key], self.data_filesystem[key]) self.lg.info(' [*] Delete filesystem (FS1), should succeed with 204') response = self.storagepools_api.delete_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data[ 'name'], self.data_filesystem[ 'name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] Create filesystem with invalid body, should fail with 400') response, data = self.storagepools_api.post_storagepools_storagepoolname_filesystems(node_id=self.nodeid, storagepoolname=self.data[ 'name'], name=123456) self.assertEqual(response.status_code, 400) def test012_delete_storagepool_filesystem(self): """ GAT-056 **Test Scenario:** #. Create Storagepool (SP0) on node (N0). #. Create filesystem (FS0) on storagepool (SP0). #. Delete filesystem (FS0), should succeed with 204. #. list storagepool (SP0) filesystems, filesystem (FS0) should be gone. #. Delete nonexisting filesystems, should fail with 204. """ self.lg.info(' [*] Delete filesystem (FS0), should succeed with 204') response = self.storagepools_api.delete_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data[ 'name'], self.data_filesystem[ 'name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] list storagepool (SP0) filesystems, filesystem (FS0) should be gone') response = self.storagepools_api.get_storagepools_storagepoolname_filesystems(self.nodeid, self.data['name']) self.assertEqual(response.status_code, 200) self.assertNotIn(self.data_filesystem['name'], response.json()) self.lg.info(' [*] Delete nonexisting filesystems, should fail with 204') response = self.storagepools_api.delete_storagepools_storagepoolname_filesystems_filesystemname(self.nodeid, self.data[ 'name'], 'fake_filesystem') self.assertEqual(response.status_code, 204) def test013_get_storagepool_filessystem_snapshot(self): """ GAT-057 **Test Scenario:** #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Create snapshot (SS0) on filesystem (FS0). #. Get snapshot (SS0), should succeed with 200. #. Get nonexisting snapshot, should fail with 404. """ self.lg.info(' [*] Get snapshot (SS0), should succeed with 200') response = self.storagepools_api.get_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], self.data_snapshot['name']) self.assertEqual(response.status_code, 200) for key in self.data_snapshot.keys(): self.assertEqual(response.json()[key], self.data_snapshot[key]) self.lg.info(' [*] Get nonexisting snapshot, should fail with 404') response = self.storagepools_api.get_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], self.rand_str()) self.assertEqual(response.status_code, 404) def test014_list_storagepool_filesystems_snapshots(self): """ GAT-058 **Test Scenario:** #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Create snapshot (SS0) on filesystem (FS0). #. list snapshots of filesystems (FS0), snapshot (SS0) should be listed. """ self.lg.info(' [*] list snapshots of filesystems (FS0), snapshot (SS0) should be listed') response = self.storagepools_api.get_filesystem_snapshots(self.nodeid, self.data['name'], self.data_filesystem['name']) self.assertEqual(response.status_code, 200) self.assertIn(self.data_snapshot['name'], response.json()) def test015_post_storagepool_filesystem_snapshot(self): """ GAT-059 **Test Scenario:** #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Create snapshot (SS1) on filesystem (FS0). #. Get snapshot (SS1), should succeed with 200. #. Delete snapshot (SS1), should succeed with 204. #. Create snapshot with missing required params, should fail with 400. """ self.lg.info(' [*] Get snapshot (SS1), should succeed with 200') response = self.storagepools_api.get_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], self.data_snapshot['name']) self.assertEqual(response.status_code, 200) self.assertEqual(response.json()['name'], self.data_snapshot['name']) self.lg.info(' [*] Delete snapshot (SS1), should succeed with 204') response = self.storagepools_api.delete_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], self.data_snapshot['name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] Create snapshot with missing required params, should fail with 400') response, data = self.storagepools_api.post_filesystems_snapshots(self.nodeid, self.data['name'], self.data_filesystem['name'], name='') self.assertEqual(response.status_code, 400) def test016_delete_storagepool_filesystem_snapshot(self): """ GAT-060 **Test Scenario:** #. Get random nodid (N0), should succeed. #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Create snapshot (SS0) on filesystem (FS0). #. Delete snapshot (SS0), should succeed with 204. #. list filesystem (FS0) snapshots, snapshot (SS0) should be gone. #. Delete nonexisting snapshot, should fail with 204. """ self.lg.info(' [*] Delete snapshot (SS0), should succeed with 204') response = self.storagepools_api.delete_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], self.data_snapshot['name']) self.assertEqual(response.status_code, 204) self.lg.info(' [*] list filesystem (FS0) snapshots, snapshot (SS0) should be gone') response = self.storagepools_api.get_filesystem_snapshots(self.nodeid, self.data['name'], self.data_filesystem['name']) self.assertEqual(response.status_code, 200) self.assertNotIn(self.data_snapshot['name'], response.json()) self.lg.info(' [*] Delete nonexisting snapshot, should fail with 204') response = self.storagepools_api.delete_filesystem_snapshots_snapshotname(self.nodeid, self.data['name'], self.data_filesystem['name'], 'fake_filesystem') self.assertEqual(response.status_code, 204) def test017_post_storagepool_filesystem_snapshot_rollback(self): """ GAT-152 **Test Scenario:** #. Get random nodid (N0), should succeed. #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0). #. Create snapshot (SS0) on filesystem (FS0). #. Create file test.txt on filesystem (FS0). #. Take a new snapshot (SS1). #. Rollback filesystem to snapshot (SS0), should succeed. #. Check that file test.txt doesn\'t exist, should succeed. #. Rollback filesystem to snapshot (SS1), should succeed. #. Check file test.txt exists and its data is correct, should succeed. """ filesystem_path = '/mnt/storagepools/{}/filesystems/{}'.format( self.data['name'], self.data_filesystem['name'] ) self.lg.info("Create file test.txt on filesystem (FS0)") cmd = 'echo "test" > {}/test.txt'.format(filesystem_path) response = self.core0_client.client.bash(cmd).get() self.assertEqual(response.state, 'SUCCESS') self.lg.info('Take a new snapshot (SS1)') response, new_snapshot_data = self.storagepools_api.post_filesystems_snapshots( nodeid=self.nodeid, storagepoolname=self.data['name'], filesystemname=self.data_filesystem['name'] ) self.assertEqual(response.status_code, 201) self.lg.info("Rollback filesystem to snapshot (SS0), should succeed") response = self.storagepools_api.post_filesystem_snapshots_snapshotname_rollback( nodeid=self.nodeid, storagepoolname=self.data['name'], filesystemname=self.data_filesystem['name'], snapshotname=self.data_snapshot['name'] ) self.assertEqual(response.status_code, 204) time.sleep(5) self.lg.info("Check that file test.txt doesn\'t exist, should succeed") cmd = 'ls {} | grep test.txt'.format(filesystem_path) response = self.core0_client.client.bash(cmd).get() self.assertNotIn('test.txt', response.stdout) self.lg.info("Rollback filesystem to snapshot (SS1), should succeed") response = self.storagepools_api.post_filesystem_snapshots_snapshotname_rollback( nodeid=self.nodeid, storagepoolname=self.data['name'], filesystemname=self.data_filesystem['name'], snapshotname=new_snapshot_data['name'] ) self.assertEqual(response.status_code, 204) time.sleep(5) self.lg.info("Check file test.txt exists and its data is correct, should succeed") cmd = 'ls {} | grep test.txt'.format(filesystem_path) response = self.core0_client.client.bash(cmd).get() self.assertEqual(response.state, 'SUCCESS') self.assertIn('test.txt', response.stdout) cmd = 'cat {}/test.txt'.format(filesystem_path) response = self.core0_client.client.bash(cmd).get() self.assertEqual(response.state, 'SUCCESS') self.assertIn('test', response.stdout.strip()) @unittest.skip("https://github.com/zero-os/0-orchestrator/issues/1246") def test018_remove_storagepoole_last_device(self): """ GAT-151 **Test Scenario:** #. Get random nodid (N0). #. Create storagepool (SP0) with single device (D0). #. Get device (D0) uuid, should succeed. #. Delete device (D0), should fail with 400 #. Delete storagepool (SP0), should succeed. """ if not self.freeDisks: self.skipTest(' [*] No free disks on node {}'.format(self.nodeid)) self.lg.info('Create storagepool (SP0) with single device (D0)') response, data = self.storagepools_api.post_storagepools(node_id=self.nodeid, free_devices=[self.freeDisks[0]]) self.assertEqual(response.status_code, 201) self.lg.info('Get device (D0) uuid, should succeed') response = self.storagepools_api.get_storagepools_storagepoolname_devices(nodeid=self.nodeid, storagepoolname=data['name']) self.assertEqual(response.status_code, 200) deviceuuid = response.json()[0]['uuid'] self.lg.info('Delete device (D0), should fail with 400') response = self.storagepools_api.delete_storagepools_storagepoolname_devices_deviceid( nodeid=self.nodeid, storagepoolname=data['name'], deviceuuid=deviceuuid ) self.assertEqual(response.status_code, 400) self.lg.info('Delete storagepool (SP0)') response = self.storagepools_api.delete_storagepools_storagepoolname(self.nodeid, data['name']) self.assertEqual(response.status_code, 204) @unittest.skip("https://github.com/zero-os/0-orchestrator/issues/1257/1258") def test019_create_storagepool_filesystem_different_parameters(self): """ GAT-153 **Test Scenario:** #. Get random nodid (N0), should succeed. #. Create storagepool (SP0) on node (N0), should succeed. #. Create filesystem (FS0) on storagepool (SP0) with specific quota. #. Write a file on (FS0) with size above the quota limit, should fail #. Write a file on (FS0) with size under the quota limit, should succeed #. Create readonly filesystem (FS1) on storagepool (SP0). #. Write a file on (FS1), should fail """ self.lg.info('Create filesystem (FS0) on storagepool (SP0) with specific quota') self.setUp_plus_fileSystem(quota=10) self.lg.info('Write a file on (FS0) with size above the quota limit, should fail') filesystem_path = '/mnt/storagepools/{}/filesystems/{}'.format( self.data['name'], self.data_filesystem['name']) response = self.core0_client.client.bash('cd {}; fallocate -l 20M {}'.format(filesystem_path, self.rand_str())).get() self.assertEqual(response.state, 'ERROR') self.lg.info('Write a file on (FS0) with size under the quota limit, should succeed') response = self.core0_client.client.bash('cd {}; fallocate -l 5M {}'.format(filesystem_path, self.rand_str())).get() self.assertEqual(response.state, 'SUCCESS') self.lg.info('Create readonly filesystem (FS1) on storagepool (SP0)') self.setUp_plus_fileSystem(quota=5, readOnly=True) self.lg.info('Write a file on (FS1), should fail') filesystem_path = '/mnt/storagepools/{}/filesystems/{}'.format( self.data['name'], self.data_filesystem['name']) response = self.core0_client.client.bash('cd {}; fallocate -l 3M {}'.format(filesystem_path, self.rand_str())).get() self.assertEqual(response.state, 'ERROR')
zero-os/0-orchestrator
tests/0_orchestrator/test_suite/testcases/basic_tests/test05_storagepools_apis.py
Python
apache-2.0
34,991
# # Plot dimuon mass distribution for SWC HEP 2015 # from ROOT import TFile, TBrowser, TH1D file_events = TFile("test_data/events.root") tree = file_events.Get("events") nEvents = tree.GetEntries() print 'Number of events = '+ str(nEvents) # xrange(n) = 0,1,2,...,n-1 #for iEv in xrange(nEvents): # tree.GetEntry(iEv) # nParticles = tree.nPart # print 'Number of particle = ' + str(nParticles) hist_dimuon_mass_nBins = 100 hist_dimuon_mass_massMin = 0 hist_dimuon_mass_massMax = 500 h = TH1D("histo_dimuon_mass","di-muon mass spectrum;m [GeV^{2}/c];Entries", hist_dimuon_mass_nBins, hist_dimuon_mass_massMin, hist_dimuon_mass_massMax ) h.Draw() #raw_input("Press return to exit.")
denglert/dimuon
dimuon.py
Python
mit
695
#!/usr/bin/python from aws_client import AWSClient import json class BasicDiscoverer(AWSClient): def get_instances(self, *args): "Runs discovery method and packs result into JSON" data = self.discovery(*args) return json.dumps({"data": data}) def discovery(self, *args): "Method that should be overriden inside inherited classes" pass
wawastein/zabbix-cloudwatch
zabbix-scripts/scripts/discovery/basic_discovery.py
Python
gpl-3.0
386
# coding: utf-8 # Copyright (c) Pymatgen Development Team. # Distributed under the terms of the MIT License. """ This module contains the class describing the coordination geometries that can exist in a given structure. These "model" coordination geometries are described in the following articles : - Pure Appl. Chem., Vol. 79, No. 10, pp. 1779--1799, 2007. - Acta Cryst. A, Vol. 46, No. 1, pp. 1--11, 1990. The module also contains descriptors of part of these geometries (plane of separation, ...) that are used in the identification algorithms. """ __author__ = "David Waroquiers" __copyright__ = "Copyright 2012, The Materials Project" __credits__ = "Geoffroy Hautier" __version__ = "2.0" __maintainer__ = "David Waroquiers" __email__ = "[email protected]" __date__ = "Feb 20, 2016" import numpy as np from scipy.special import factorial import itertools import abc from monty.json import MSONable, MontyDecoder import json import os module_dir = os.path.dirname(os.path.abspath(__file__)) UNKNOWN_ENVIRONMENT_SYMBOL = 'UNKNOWN' UNCLEAR_ENVIRONMENT_SYMBOL = 'UNCLEAR' EXPLICIT_PERMUTATIONS = 'EXPLICIT_PERMUTATIONS' SEPARATION_PLANE = 'SEPARATION_PLANE' class AbstractChemenvAlgorithm(MSONable, metaclass=abc.ABCMeta): """ Class used to define a Chemenv strategy for the neighbors and coordination environment to be applied to a StructureEnvironments object """ def __init__(self, algorithm_type): self._algorithm_type = algorithm_type @abc.abstractmethod def as_dict(self): """ A JSON serializable dict representation of the algorithm """ pass @property def algorithm_type(self): return self._algorithm_type @abc.abstractmethod def __str__(self): return class ExplicitPermutationsAlgorithm(AbstractChemenvAlgorithm): def __init__(self, permutations): """ Initializes a separation plane for a given perfect coordination geometry """ super().__init__( algorithm_type=EXPLICIT_PERMUTATIONS) self._permutations = permutations def __str__(self): return self.algorithm_type @property def permutations(self): return self._permutations @property def as_dict(self): return {"@module": self.__class__.__module__, "@class": self.__class__.__name__, "permutations": self._permutations} @classmethod def from_dict(cls, dd): return cls(dd['permutations']) class SeparationPlane(AbstractChemenvAlgorithm): def __init__(self, plane_points, mirror_plane=False, ordered_plane=False, point_groups=None, ordered_point_groups=None, # include_inverted_plane=False, point_groups_permutations=None, # do_inverse_pt_gp_permutations=False, plane_type='MIRROR', explicit_permutations=None, minimum_number_of_points=None, explicit_optimized_permutations=None, multiplicity=None, other_plane_points=None): # , plane_safe_permutations=False): """ Initializes a separation plane for a given perfect coordination geometry :param mirror_plane: True if the separation plane is a mirror plane, in which case there is a correspondence of the points in each point_group (can reduce the number of permutations) :param ordered_plane : True if the order of the points in the plane can be taken into account to reduce the number of permutations :param plane_points: Indices of the points that are in the plane in the perfect structure (and should be found in the defective one as well) :param point_groups: The two groups of points separated by the plane :param plane_type: can be "MIRROR", if the plane is a mirror plane going through the central site, 'BASAL_THROUGH_CENTER', if the plane is a basal plane (no point on the "left" side) going through the central site, 'BASAL', if the is a basal plane not going through the central site, 'UNEQUILIBRATED_THROUGH_CENTER', if the plane cuts the geometry in two groups of points with different numbers of points on each side, and is going through the centre, 'UNEQUILIBRATED', if the plane cuts the geometry in two groups of points with different numbers of points on each side, and is not going through the centre, 'EQUILIBRATED_THROUGH_CENTER', if the plane cuts the geometry in two groups of points of the same size, is going through the centre but is not a mirror plane, 'EQUILIBRATED', if the plane cuts the geometry in two groups of points of the same size, is not going through the centre but is not a mirror plane. """ super().__init__(algorithm_type=SEPARATION_PLANE) self.mirror_plane = mirror_plane self.plane_points = plane_points self.point_groups = point_groups if len(point_groups[0]) > len(point_groups[1]): raise RuntimeError( "The number of points in the first group should be\n" "less than or equal to the number of points in the second group") self._hash = 10000 * len(plane_points) + 100 * len( point_groups[0]) + len(point_groups[1]) self.ordered_plane = ordered_plane self.ordered_point_groups = [False, False] if ordered_point_groups is None else ordered_point_groups self._ordered_indices = list(point_groups[0]) self._ordered_indices.extend(plane_points) self._ordered_indices.extend(point_groups[1]) self._inv_ordered_indices = np.argsort(self._ordered_indices) self._point_groups_permutations = point_groups_permutations self.explicit_permutations = explicit_permutations self.explicit_optimized_permutations = explicit_optimized_permutations self._safe_permutations = None if self.explicit_optimized_permutations is not None: self._permutations = self.explicit_optimized_permutations elif self.explicit_permutations is not None: self._permutations = self.explicit_permutations self.multiplicity = multiplicity self.other_plane_points = other_plane_points self.minimum_number_of_points = minimum_number_of_points self.maximum_number_of_points = len(self.plane_points) self._ref_separation_perm = list(self.point_groups[0]) self._ref_separation_perm.extend(list(self.plane_points)) self._ref_separation_perm.extend(list(self.point_groups[1])) self._argsorted_ref_separation_perm = list( np.argsort(self._ref_separation_perm)) self.separation = (len(point_groups[0]), len(plane_points), len(point_groups[1])) @property def ordered_indices(self): return self._ordered_indices @property def inv_ordered_indices(self): return self._inv_ordered_indices @property def permutations(self): return self._permutations @property def ref_separation_perm(self): return self._ref_separation_perm @property def argsorted_ref_separation_perm(self): return self._argsorted_ref_separation_perm # def safe_plane_permutations(self, ordered_plane=False, # ordered_point_groups=None): # ordered_point_groups = [False, # False] if ordered_point_groups is None else ordered_point_groups # rotate = lambda s, n: s[-n:] + s[:-n] # if ordered_plane and self.ordered_plane: # plane_perms = [rotate(self.plane_points, ii) for ii in # range(len(self.plane_points))] # invplanepoints = self.plane_points[::-1] # plane_perms.extend([rotate(invplanepoints, ii) for ii in # range(len(self.plane_points) - 1, -1, -1)]) # else: # plane_perms = list(itertools.permutations(self.plane_points)) # if ordered_point_groups[0] and self.ordered_point_groups[0]: # s0_perms = [rotate(self.point_groups[0], ii) for ii in # range(len(self.point_groups[0]))] # invpg0 = self.point_groups[0][::-1] # s0_perms.extend([rotate(invpg0, ii) for ii in range(len(invpg0))]) # else: # s0_perms = list(itertools.permutations(self.point_groups[0])) # if ordered_point_groups[1] and self.ordered_point_groups[1]: # s2_perms = [rotate(self.point_groups[1], ii) for ii in # range(len(self.point_groups[1]))] # invpg2 = self.point_groups[1][::-1] # s2_perms.extend([rotate(invpg2, ii) for ii in range(len(invpg2))]) # else: # s2_perms = list(itertools.permutations(self.point_groups[1])) # add_opposite = False # if self._safe_permutations is None: # self._safe_permutations = [] # for perm_side1 in s0_perms: # for perm_sep_plane in plane_perms: # for perm_side2 in s2_perms: # perm = list(perm_side1) # perm.extend(list(perm_sep_plane)) # perm.extend(list(perm_side2)) # self._safe_permutations.append(perm) # if add_opposite: # perm = list(perm_side2) # perm.extend(list(perm_sep_plane)) # perm.extend(list(perm_side1)) # self._safe_permutations.append(perm) # return self._safe_permutations def safe_separation_permutations(self, ordered_plane=False, ordered_point_groups=None, add_opposite=False): s0 = range(len(self.point_groups[0])) plane = range(len(self.point_groups[0]), len(self.point_groups[0]) + len(self.plane_points)) s1 = range(len(self.point_groups[0]) + len(self.plane_points), len(self.point_groups[0]) + len(self.plane_points) + len( self.point_groups[1])) ordered_point_groups = [False, False] if ordered_point_groups is None else ordered_point_groups rotate = lambda s, n: s[-n:] + s[:-n] if ordered_plane and self.ordered_plane: plane_perms = [rotate(plane, ii) for ii in range(len(plane))] inv_plane = plane[::-1] plane_perms.extend( [rotate(inv_plane, ii) for ii in range(len(inv_plane))]) else: plane_perms = list(itertools.permutations(plane)) if ordered_point_groups[0] and self.ordered_point_groups[0]: s0_perms = [rotate(s0, ii) for ii in range(len(s0))] inv_s0 = s0[::-1] s0_perms.extend([rotate(inv_s0, ii) for ii in range(len(inv_s0))]) else: s0_perms = list(itertools.permutations(s0)) if ordered_point_groups[1] and self.ordered_point_groups[1]: s1_perms = [rotate(s1, ii) for ii in range(len(s1))] inv_s1 = s1[::-1] s1_perms.extend([rotate(inv_s1, ii) for ii in range(len(inv_s1))]) else: s1_perms = list(itertools.permutations(s1)) if self._safe_permutations is None: self._safe_permutations = [] for perm_side1 in s0_perms: for perm_sep_plane in plane_perms: for perm_side2 in s1_perms: perm = list(perm_side1) perm.extend(list(perm_sep_plane)) perm.extend(list(perm_side2)) self._safe_permutations.append(perm) if add_opposite: perm = list(perm_side2) perm.extend(list(perm_sep_plane)) perm.extend(list(perm_side1)) self._safe_permutations.append(perm) return self._safe_permutations @property def as_dict(self): return {"@module": self.__class__.__module__, "@class": self.__class__.__name__, "plane_points": self.plane_points, "mirror_plane": self.mirror_plane, "ordered_plane": self.ordered_plane, "point_groups": self.point_groups, "ordered_point_groups": self.ordered_point_groups, "point_groups_permutations": self._point_groups_permutations, "explicit_permutations": [eperm.tolist() for eperm in self.explicit_permutations] if self.explicit_permutations is not None else None, "explicit_optimized_permutations": [eoperm.tolist() for eoperm in self.explicit_optimized_permutations] if self.explicit_optimized_permutations is not None else None, "multiplicity": self.multiplicity, "other_plane_points": self.other_plane_points, "minimum_number_of_points": self.minimum_number_of_points} @classmethod def from_dict(cls, dd): eop = [np.array(eoperm) for eoperm in dd[ 'explicit_optimized_permutations']] if 'explicit_optimized_permutations' in dd else None return cls(plane_points=dd['plane_points'], mirror_plane=dd['mirror_plane'], ordered_plane=dd['ordered_plane'], point_groups=dd['point_groups'], ordered_point_groups=dd['ordered_point_groups'], point_groups_permutations=dd['point_groups_permutations'], explicit_permutations=[np.array(eperm) for eperm in dd['explicit_permutations']], explicit_optimized_permutations=eop, multiplicity=dd[ 'multiplicity'] if 'multiplicity' in dd else None, other_plane_points=dd[ 'other_plane_points'] if 'other_plane_points' in dd else None, minimum_number_of_points=dd['minimum_number_of_points']) def __str__(self): out = 'Separation plane algorithm with the following reference separation :\n' out += '[{}] | [{}] | [{}]'.format( '-'.join(str(pp) for pp in [self.point_groups[0]]), '-'.join(str(pp) for pp in [self.plane_points]), '-'.join(str(pp) for pp in [self.point_groups[1]]), ) return out class CoordinationGeometry: """ Class used to store the ideal representation of a chemical environment or "coordination geometry" """ CSM_SKIP_SEPARATION_PLANE_ALGO = 10.0 # Default value of continuous symmetry measure below which no further # search is performed for the separation plane algorithms class NeighborsSetsHints: ALLOWED_HINTS_TYPES = ['single_cap', 'double_cap', 'triple_cap'] def __init__(self, hints_type, options): if hints_type not in self.ALLOWED_HINTS_TYPES: raise ValueError('Type "{}" for NeighborsSetsHints is not allowed'.format(type)) self.hints_type = hints_type self.options = options def hints(self, hints_info): if hints_info['csm'] > self.options['csm_max']: return [] return object.__getattribute__(self, '{}_hints'.format(self.hints_type))(hints_info) def single_cap_hints(self, hints_info): cap_index_perfect = self.options['cap_index'] nb_set = hints_info['nb_set'] permutation = hints_info['permutation'] nb_set_voronoi_indices_perfect_aligned = nb_set.get_neighb_voronoi_indices(permutation=permutation) cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[cap_index_perfect] new_site_voronoi_indices = list(nb_set.site_voronoi_indices) new_site_voronoi_indices.remove(cap_voronoi_index) return [new_site_voronoi_indices] def double_cap_hints(self, hints_info): first_cap_index_perfect = self.options['first_cap_index'] second_cap_index_perfect = self.options['second_cap_index'] nb_set = hints_info['nb_set'] permutation = hints_info['permutation'] nb_set_voronoi_indices_perfect_aligned = nb_set.get_neighb_voronoi_indices(permutation=permutation) first_cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[first_cap_index_perfect] second_cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[second_cap_index_perfect] new_site_voronoi_indices1 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices2 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices3 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices1.remove(first_cap_voronoi_index) new_site_voronoi_indices2.remove(second_cap_voronoi_index) new_site_voronoi_indices3.remove(first_cap_voronoi_index) new_site_voronoi_indices3.remove(second_cap_voronoi_index) return [new_site_voronoi_indices1, new_site_voronoi_indices2, new_site_voronoi_indices3] def triple_cap_hints(self, hints_info): first_cap_index_perfect = self.options['first_cap_index'] second_cap_index_perfect = self.options['second_cap_index'] third_cap_index_perfect = self.options['third_cap_index'] nb_set = hints_info['nb_set'] permutation = hints_info['permutation'] nb_set_voronoi_indices_perfect_aligned = nb_set.get_neighb_voronoi_indices(permutation=permutation) first_cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[first_cap_index_perfect] second_cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[second_cap_index_perfect] third_cap_voronoi_index = nb_set_voronoi_indices_perfect_aligned[third_cap_index_perfect] new_site_voronoi_indices1 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices2 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices3 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices4 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices5 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices6 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices7 = list(nb_set.site_voronoi_indices) new_site_voronoi_indices1.remove(first_cap_voronoi_index) new_site_voronoi_indices2.remove(second_cap_voronoi_index) new_site_voronoi_indices3.remove(third_cap_voronoi_index) new_site_voronoi_indices4.remove(second_cap_voronoi_index) new_site_voronoi_indices4.remove(third_cap_voronoi_index) new_site_voronoi_indices5.remove(first_cap_voronoi_index) new_site_voronoi_indices5.remove(third_cap_voronoi_index) new_site_voronoi_indices6.remove(first_cap_voronoi_index) new_site_voronoi_indices6.remove(second_cap_voronoi_index) new_site_voronoi_indices7.remove(first_cap_voronoi_index) new_site_voronoi_indices7.remove(second_cap_voronoi_index) new_site_voronoi_indices7.remove(third_cap_voronoi_index) return [new_site_voronoi_indices1, new_site_voronoi_indices2, new_site_voronoi_indices3, new_site_voronoi_indices4, new_site_voronoi_indices5, new_site_voronoi_indices6, new_site_voronoi_indices7] def as_dict(self): return {'hints_type': self.hints_type, 'options': self.options} @classmethod def from_dict(cls, dd): return cls(hints_type=dd['hints_type'], options=dd['options']) def __init__(self, mp_symbol, name, alternative_names=None, IUPAC_symbol=None, IUCr_symbol=None, coordination=None, central_site=np.zeros(3), points=None, solid_angles=None, permutations_safe_override=False, plane_ordering_override=True, deactivate=False, faces=None, edges=None, plane_safe_permutations=False, algorithms=None, equivalent_indices=None, neighbors_sets_hints=None): """ Initializes one "coordination geometry" according to [Pure Appl. Chem., Vol. 79, No. 10, pp. 1779--1799, 2007] and [Acta Cryst. A, Vol. 46, No. 1, pp. 1--11, 1990]. :param mp_symbol: Symbol used internally for the coordination geometry. :param name: Name of the coordination geometry. :param alternative_names: Alternative names for this coordination geometry. :param IUPAC_symbol: The IUPAC symbol of this coordination geometry. :param IUCr_symbol: The IUCr symbol of this coordination geometry. :param coordination: The coordination number of this coordination geometry (number of neighboring atoms). :param central_site: The coordinates of the central site of this coordination geometry. :param points: The list of the coordinates of all the points of this coordination geometry. :param separation_planes: List of separation facets to help set up the permutations :param permutation_safe_override: Computes all the permutations if set to True (overrides the plane separation algorithms or any other algorithm, for testing purposes) :param plane_ordering_override: Computes all the permutations of the plane separation algorithm if set to False otherwise, uses the anticlockwise ordering of the separation facets (for testing purposes) :param deactivate: deactivates this coordination geometry in the search :param faces : list of the faces with their vertices given in a clockwise or anticlockwise order, for drawing purposes :param : list of edges, for drawing purposes """ self._mp_symbol = mp_symbol self.name = name self.alternative_names = alternative_names if alternative_names is not None else [] self.IUPACsymbol = IUPAC_symbol self.IUCrsymbol = IUCr_symbol self.coordination = coordination self.central_site = np.array(central_site) self.points = points self._solid_angles = solid_angles self.permutations_safe_override = permutations_safe_override self.plane_ordering_override = plane_ordering_override self.plane_safe_permutations = plane_safe_permutations # self.setup_permutations(permutations) self.deactivate = deactivate self._faces = faces self._edges = edges self._algorithms = algorithms if points is not None: self.centroid = np.mean(np.array(points), axis=0) else: self.centroid = None self.equivalent_indices = equivalent_indices self.neighbors_sets_hints = neighbors_sets_hints self._pauling_stability_ratio = None def as_dict(self): return {'mp_symbol': self._mp_symbol, 'name': self.name, 'alternative_names': self.alternative_names, 'IUPAC_symbol': self.IUPACsymbol, 'IUCr_symbol': self.IUCrsymbol, 'coordination': self.coordination, 'central_site': [float(xx) for xx in self.central_site], 'points': [[float(xx) for xx in pp] for pp in self.points] if self.points is not None else None, 'solid_angles': [float(ang) for ang in self._solid_angles] if self._solid_angles is not None else None, 'deactivate': self.deactivate, '_faces': self._faces, '_edges': self._edges, '_algorithms': [algo.as_dict for algo in self._algorithms] if self._algorithms is not None else None, 'equivalent_indices': self.equivalent_indices, 'neighbors_sets_hints': [nbsh.as_dict() for nbsh in self.neighbors_sets_hints] if self.neighbors_sets_hints is not None else None} @classmethod def from_dict(cls, dd): dec = MontyDecoder() return cls(mp_symbol=dd['mp_symbol'], name=dd['name'], alternative_names=dd['alternative_names'], IUPAC_symbol=dd['IUPAC_symbol'], IUCr_symbol=dd['IUCr_symbol'], coordination=dd['coordination'], central_site=dd['central_site'], points=dd['points'], solid_angles=(dd['solid_angles'] if 'solid_angles' in dd else [4.0 * np.pi / dd['coordination']] * dd[ 'coordination']), deactivate=dd['deactivate'], faces=dd['_faces'], edges=dd['_edges'], algorithms=[dec.process_decoded(algo_d) for algo_d in dd['_algorithms']] if dd['_algorithms'] is not None else None, equivalent_indices=dd[ 'equivalent_indices'] if 'equivalent_indices' in dd else None, neighbors_sets_hints=[cls.NeighborsSetsHints.from_dict(nbshd) for nbshd in dd['neighbors_sets_hints']] if ('neighbors_sets_hints' in dd and dd['neighbors_sets_hints'] is not None) else None) def __str__(self): symbol = '' if self.IUPAC_symbol is not None: symbol += ' (IUPAC: {s}'.format(s=self.IUPAC_symbol) if self.IUCr_symbol is not None: symbol += ' || IUCr: {s})'.format(s=self.IUCr_symbol) else: symbol += ')' elif self.IUCr_symbol is not None: symbol += ' (IUCr: {s})'.format(s=self.IUCr_symbol) outs = ['Coordination geometry type : {n}{s}\n'.format(n=self.name, s=symbol), ' - coordination number : {c}'.format(c=self.coordination)] if self.points is None: outs.append('... not yet implemented') else: outs.append(' - list of points :') for pp in self.points: outs.append(' - {p}'.format(p=pp)) outs.append( '------------------------------------------------------------') outs.append('') return '\n'.join(outs) def __repr__(self): symbol = '' if self.IUPAC_symbol is not None: symbol += ' (IUPAC: {s}'.format(s=self.IUPAC_symbol) if self.IUCr_symbol is not None: symbol += ' || IUCr: {s})'.format(s=self.IUCr_symbol) else: symbol += ')' elif self.IUCr_symbol is not None: symbol += ' (IUCr: {s})'.format(s=self.IUCr_symbol) outs = ['Coordination geometry type : {n}{s}\n'.format(n=self.name, s=symbol), ' - coordination number : {c}'.format(c=self.coordination)] outs.append( '------------------------------------------------------------') outs.append('') return '\n'.join(outs) def __len__(self): return self.coordination def set_permutations_safe_override(self, permutations_safe_override): self.permutations_safe_override = permutations_safe_override # self.setup_permutations() @property def csm_skip_algo(self): return self.CSM_SKIP_SEPARATION_PLANE_ALGO @property def distfactor_max(self): dists = [np.linalg.norm(pp - self.central_site) for pp in self.points] return np.max(dists) / np.min(dists) @property def coordination_number(self): """ Returns the coordination number of this coordination geometry. """ return self.coordination @property def pauling_stability_ratio(self): """ Returns the theoretical Pauling stability ratio (rC/rA) for this environment. """ if self._pauling_stability_ratio is None: if self.ce_symbol in ['S:1', 'L:2']: self._pauling_stability_ratio = 0.0 else: mindist_anions = 1000000.0 mindist_cation_anion = 1000000.0 for ipt1 in range(len(self.points)): pt1 = np.array(self.points[ipt1]) mindist_cation_anion = min(mindist_cation_anion, np.linalg.norm(pt1-self.central_site)) for ipt2 in range(ipt1+1, len(self.points)): pt2 = np.array(self.points[ipt2]) mindist_anions = min(mindist_anions, np.linalg.norm(pt1-pt2)) anion_radius = mindist_anions / 2.0 cation_radius = mindist_cation_anion - anion_radius self._pauling_stability_ratio = cation_radius / anion_radius return self._pauling_stability_ratio @property def mp_symbol(self): """ Returns the MP symbol of this coordination geometry. """ return self._mp_symbol @property def ce_symbol(self): """ Returns the symbol of this coordination geometry. """ return self._mp_symbol def get_coordination_number(self): """ Returns the coordination number of this coordination geometry. """ return self.coordination def is_implemented(self): """ Returns True if this coordination geometry is implemented. """ return bool(self.points) def get_name(self): """ Returns the name of this coordination geometry. """ return self.name @property def IUPAC_symbol(self): """ Returns the IUPAC symbol of this coordination geometry. """ return self.IUPACsymbol @property def IUPAC_symbol_str(self): """ Returns a string representation of the IUPAC symbol of this coordination geometry. """ return str(self.IUPACsymbol) @property def IUCr_symbol(self): """ Returns the IUCr symbol of this coordination geometry. """ return self.IUCrsymbol @property def IUCr_symbol_str(self): """ Returns a string representation of the IUCr symbol of this coordination geometry. """ return str(self.IUCrsymbol) @property def number_of_permutations(self): """ Returns the number of permutations of this coordination geometry. """ if self.permutations_safe_override: return factorial(self.coordination) elif self.permutations is None: return factorial(self.coordination) return len(self.permutations) def ref_permutation(self, permutation): perms = [] for eqv_indices in self.equivalent_indices: perms.append(tuple([permutation[ii] for ii in eqv_indices])) perms.sort() return perms[0] @property def algorithms(self): """ Returns the list of algorithms that are used to identify this coordination geometry. """ return self._algorithms def get_central_site(self): """ Returns the central site of this coordination geometry. """ return self.central_site def faces(self, sites, permutation=None): """ Returns the list of faces of this coordination geometry. Each face is given as a list of its vertices coordinates. """ if permutation is None: coords = [site.coords for site in sites] else: coords = [sites[ii].coords for ii in permutation] return [[coords[ii] for ii in f] for f in self._faces] def edges(self, sites, permutation=None, input='sites'): """ Returns the list of edges of this coordination geometry. Each edge is given as a list of its end vertices coordinates. """ if input == 'sites': coords = [site.coords for site in sites] elif input == 'coords': coords = sites # if permutation is None: # coords = [site.coords for site in sites] # else: # coords = [sites[ii].coords for ii in permutation] if permutation is not None: coords = [coords[ii] for ii in permutation] return [[coords[ii] for ii in e] for e in self._edges] def solid_angles(self, permutation=None): """ Returns the list of "perfect" solid angles Each edge is given as a list of its end vertices coordinates. """ if permutation is None: return self._solid_angles else: return [self._solid_angles[ii] for ii in permutation] def get_pmeshes(self, sites, permutation=None): """ Returns the pmesh strings used for jmol to show this geometry. """ pmeshes = [] # _vertices = [site.coords for site in sites] if permutation is None: _vertices = [site.coords for site in sites] else: _vertices = [sites[ii].coords for ii in permutation] _face_centers = [] number_of_faces = 0 for face in self._faces: if len(face) in [3, 4]: number_of_faces += 1 else: number_of_faces += len(face) _face_centers.append(np.array([np.mean([_vertices[face_vertex][ii] for face_vertex in face]) for ii in range(3)])) out = '{}\n'.format(len(_vertices) + len(_face_centers)) for vv in _vertices: out += '{:15.8f} {:15.8f} {:15.8f}\n'.format(vv[0], vv[1], vv[2]) for fc in _face_centers: out += '{:15.8f} {:15.8f} {:15.8f}\n'.format(fc[0], fc[1], fc[2]) out += '{:d}\n'.format(number_of_faces) for iface, face in enumerate(self._faces): if len(face) == 3: out += '4\n' elif len(face) == 4: out += '5\n' else: for ii in range(len(face)): out += '4\n' out += '{:d}\n'.format(len(_vertices) + iface) out += '{:d}\n'.format(face[ii]) out += '{:d}\n'.format(face[np.mod(ii + 1, len(face))]) out += '{:d}\n'.format(len(_vertices) + iface) if len(face) in [3, 4]: for face_vertex in face: out += '{:d}\n'.format(face_vertex) out += '{:d}\n'.format(face[0]) pmeshes.append({"pmesh_string": out}) return pmeshes class AllCoordinationGeometries(dict): """ Class used to store all the reference "coordination geometries" (list with instances of the CoordinationGeometry classes) """ def __init__(self, permutations_safe_override=False, only_symbols=None): """ Initializes the list of Coordination Geometries :param permutations_safe_override: :param only_symbols: """ dict.__init__(self) self.cg_list = list() if only_symbols is None: f = open( '{}/coordination_geometries_files/allcg.txt'.format(module_dir), 'r') data = f.readlines() f.close() for line in data: cg_file = '{}/{}'.format(module_dir, line.strip()) f = open(cg_file, 'r') dd = json.load(f) f.close() self.cg_list.append(CoordinationGeometry.from_dict(dd)) else: for symbol in only_symbols: fsymbol = symbol.replace(':', '#') cg_file = '{}/coordination_geometries_files/{}.json'.format( module_dir, fsymbol) f = open(cg_file, 'r') dd = json.load(f) f.close() self.cg_list.append(CoordinationGeometry.from_dict(dd)) self.cg_list.append(CoordinationGeometry(UNKNOWN_ENVIRONMENT_SYMBOL, "Unknown environment", deactivate=True)) self.cg_list.append(CoordinationGeometry(UNCLEAR_ENVIRONMENT_SYMBOL, "Unclear environment", deactivate=True)) if permutations_safe_override: for cg in self.cg_list: cg.set_permutations_safe_override(True) self.minpoints = {} self.maxpoints = {} self.separations_cg = {} for cn in range(6, 14): for cg in self.get_implemented_geometries(coordination=cn): if only_symbols is not None and cg.ce_symbol not in only_symbols: continue if cn not in self.separations_cg: self.minpoints[cn] = 1000 self.maxpoints[cn] = 0 self.separations_cg[cn] = {} for algo in cg.algorithms: sep = (len(algo.point_groups[0]), len(algo.plane_points), len(algo.point_groups[1])) if sep not in self.separations_cg[cn]: self.separations_cg[cn][sep] = [] self.separations_cg[cn][sep].append(cg.mp_symbol) self.minpoints[cn] = min(self.minpoints[cn], algo.minimum_number_of_points) self.maxpoints[cn] = max(self.maxpoints[cn], algo.maximum_number_of_points) self.maxpoints_inplane = {cn: max([sep[1] for sep in seps.keys()]) for cn, seps in self.separations_cg.items()} def __getitem__(self, key): return self.get_geometry_from_mp_symbol(key) def __repr__(self): """ Returns a string with the list of coordination geometries. """ outs = ['', '#=================================#', '# List of coordination geometries #', '#=================================#', ''] for cg in self.cg_list: outs.append(repr(cg)) return '\n'.join(outs) def __str__(self): """ Returns a string with the list of coordination geometries that are implemented. """ outs = ['', '#=======================================================#', '# List of coordination geometries currently implemented #', '#=======================================================#', ''] for cg in self.cg_list: if cg.is_implemented(): outs.append(str(cg)) return '\n'.join(outs) def get_geometries(self, coordination=None, returned='cg'): """ Returns a list of coordination geometries with the given coordination number. :param coordination: The coordination number of which the list of coordination geometries are returned. """ geom = list() if coordination is None: for gg in self.cg_list: if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) else: for gg in self.cg_list: if gg.get_coordination_number() == coordination: if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) return geom def get_symbol_name_mapping(self, coordination=None): geom = {} if coordination is None: for gg in self.cg_list: geom[gg.mp_symbol] = gg.name else: for gg in self.cg_list: if gg.get_coordination_number() == coordination: geom[gg.mp_symbol] = gg.name return geom def get_symbol_cn_mapping(self, coordination=None): geom = {} if coordination is None: for gg in self.cg_list: geom[gg.mp_symbol] = gg.coordination_number else: for gg in self.cg_list: if gg.get_coordination_number() == coordination: geom[gg.mp_symbol] = gg.coordination_number return geom def get_implemented_geometries(self, coordination=None, returned='cg', include_deactivated=False): """ Returns a list of the implemented coordination geometries with the given coordination number. :param coordination: The coordination number of which the list of implemented coordination geometries are returned. """ geom = list() if coordination is None: for gg in self.cg_list: if gg.points is not None and ( (not gg.deactivate) or include_deactivated): if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) else: for gg in self.cg_list: if gg.get_coordination_number() == coordination and gg.points is not None and \ ((not gg.deactivate) or include_deactivated): if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) return geom def get_not_implemented_geometries(self, coordination=None, returned='mp_symbol'): """ Returns a list of the implemented coordination geometries with the given coordination number. :param coordination: The coordination number of which the list of implemented coordination geometries are returned. """ geom = list() if coordination is None: for gg in self.cg_list: if gg.points is None: if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) else: for gg in self.cg_list: if gg.get_coordination_number() == coordination and gg.points is None: if returned == 'cg': geom.append(gg) elif returned == 'mp_symbol': geom.append(gg.mp_symbol) return geom def get_geometry_from_name(self, name): """ Returns the coordination geometry of the given name. :param name: The name of the coordination geometry. """ for gg in self.cg_list: if gg.name == name or name in gg.alternative_names: return gg raise LookupError( 'No coordination geometry found with name "{name}"'.format( name=name)) def get_geometry_from_IUPAC_symbol(self, IUPAC_symbol): """ Returns the coordination geometry of the given IUPAC symbol. :param IUPAC_symbol: The IUPAC symbol of the coordination geometry. """ for gg in self.cg_list: if gg.IUPAC_symbol == IUPAC_symbol: return gg raise LookupError( 'No coordination geometry found with IUPAC symbol "{symbol}"'.format( symbol=IUPAC_symbol)) def get_geometry_from_IUCr_symbol(self, IUCr_symbol): """ Returns the coordination geometry of the given IUCr symbol. :param IUCr_symbol: The IUCr symbol of the coordination geometry. """ for gg in self.cg_list: if gg.IUCr_symbol == IUCr_symbol: return gg raise LookupError( 'No coordination geometry found with IUCr symbol "{symbol}"'.format( symbol=IUCr_symbol)) def get_geometry_from_mp_symbol(self, mp_symbol): """ Returns the coordination geometry of the given mp_symbol. :param mp_symbol: The mp_symbol of the coordination geometry. """ for gg in self.cg_list: if gg.mp_symbol == mp_symbol: return gg raise LookupError( 'No coordination geometry found with mp_symbol "{symbol}"'.format( symbol=mp_symbol)) def is_a_valid_coordination_geometry(self, mp_symbol=None, IUPAC_symbol=None, IUCr_symbol=None, name=None, cn=None): """ Checks whether a given coordination geometry is valid (exists) and whether the parameters are coherent with each other. :param IUPAC_symbol: :param IUCr_symbol: :param name: :param cn: :param mp_symbol: The mp_symbol of the coordination geometry. """ if name is not None: raise NotImplementedError( 'is_a_valid_coordination_geometry not implemented for the name') if mp_symbol is None and IUPAC_symbol is None and IUCr_symbol is None: raise SyntaxError( 'missing argument for is_a_valid_coordination_geometry : at least one of mp_symbol, ' 'IUPAC_symbol and IUCr_symbol must be passed to the function') if mp_symbol is not None: try: cg = self.get_geometry_from_mp_symbol(mp_symbol) if IUPAC_symbol is not None: if IUPAC_symbol != cg.IUPAC_symbol: return False if IUCr_symbol is not None: if IUCr_symbol != cg.IUCr_symbol: return False if cn is not None: if int(cn) != int(cg.coordination_number): return False return True except LookupError: return False elif IUPAC_symbol is not None: try: cg = self.get_geometry_from_IUPAC_symbol(IUPAC_symbol) if IUCr_symbol is not None: if IUCr_symbol != cg.IUCr_symbol: return False if cn is not None: if cn != cg.coordination_number: return False return True except LookupError: return False elif IUCr_symbol is not None: try: cg = self.get_geometry_from_IUCr_symbol(IUCr_symbol) if cn is not None: if cn != cg.coordination_number: return False return True except LookupError: return True raise Exception('Should not be here !') def pretty_print(self, type='implemented_geometries', maxcn=8, additional_info=None): if type == 'all_geometries_latex_images': mystring = '' for cn in range(1, maxcn + 1): mystring += '\\section*{{Coordination {cn}}}\n\n'.format(cn=cn) for cg in self.get_implemented_geometries(coordination=cn, returned='cg'): mystring += '\\subsubsection*{{{mp} : {name}}}\n\n'.format( mp=cg.mp_symbol, name=cg.get_name()) mystring += 'IUPAC : {iupac}\n\nIUCr : {iucr}\n\n'.format( iupac=cg.IUPAC_symbol, iucr=cg.IUCr_symbol) mystring += '\\begin{center}\n' mystring += '\\includegraphics[scale=0.15]{{images/{let}_{cif}.png}}\n'.format( let=cg.mp_symbol.split(':')[0], cif=cg.mp_symbol.split(':')[1]) mystring += '\\end{center}\n\n' for cg in self.get_not_implemented_geometries(cn, returned='cg'): mystring += '\\subsubsection*{{{mp} : {name}}}\n\n'.format( mp=cg.mp_symbol, name=cg.get_name()) mystring += 'IUPAC : {iupac}\n\nIUCr : {iucr}\n\n'.format( iupac=cg.IUPAC_symbol, iucr=cg.IUCr_symbol) elif type == 'all_geometries_latex': mystring = '' for cn in range(1, maxcn + 1): mystring += '\\subsection*{{Coordination {cn}}}\n\n'.format( cn=cn) mystring += '\\begin{itemize}\n' for cg in self.get_implemented_geometries(coordination=cn, returned='cg'): mystring += '\\item {mp} $\\rightarrow$ {name} '.format( mp=cg.mp_symbol.replace('_', '\\_'), name=cg.get_name()) mystring += '(IUPAC : {iupac} - IUCr : {iucr})\n'.format( iupac=cg.IUPAC_symbol_str, iucr=cg.IUCr_symbol_str.replace('[', '$[$').replace(']', '$]$')) for cg in self.get_not_implemented_geometries(cn, returned='cg'): mystring += '\\item {mp} $\\rightarrow$ {name} '.format( mp=cg.mp_symbol.replace('_', '\\_'), name=cg.get_name()) mystring += '(IUPAC : {iupac} - IUCr : {iucr})\n'.format( iupac=cg.IUPAC_symbol_str, iucr=cg.IUCr_symbol_str.replace('[', '$[$').replace(']', '$]$')) mystring += '\\end{itemize}\n\n' else: mystring = '+-------------------------+\n| Coordination geometries |\n+-------------------------+\n\n' for cn in range(1, maxcn + 1): mystring += '==>> CN = {cn} <<==\n'.format(cn=cn) if type == 'implemented_geometries': for cg in self.get_implemented_geometries(coordination=cn): if additional_info is not None: if 'nb_hints' in additional_info: if cg.neighbors_sets_hints is not None: addinfo = ' *' else: addinfo = '' else: addinfo = '' else: addinfo = '' mystring += ' - {mp} : {name}{addinfo}\n'.format(mp=cg.mp_symbol, name=cg.get_name(), addinfo=addinfo) elif type == 'all_geometries': for cg in self.get_geometries(coordination=cn): mystring += ' - {mp} : {name}\n'.format(mp=cg.mp_symbol, name=cg.get_name()) mystring += '\n' return mystring
dongsenfo/pymatgen
pymatgen/analysis/chemenv/coordination_environments/coordination_geometries.py
Python
mit
52,397
"""ControlPrestamo URL Configuration The `urlpatterns` list routes URLs to views. For more information please see: https://docs.djangoproject.com/en/1.10/topics/http/urls/ Examples: Function views 1. Add an import: from my_app import views 2. Add a URL to urlpatterns: url(r'^$', views.home, name='home') Class-based views 1. Add an import: from other_app.views import Home 2. Add a URL to urlpatterns: url(r'^$', Home.as_view(), name='home') Including another URLconf 1. Import the include() function: from django.conf.urls import url, include 2. Add a URL to urlpatterns: url(r'^blog/', include('blog.urls')) """ from django.conf.urls import url, include from django.contrib import admin from prestamoapp import views urlpatterns = [ url(r'^admin/', admin.site.urls), url(r'^prestamos/', include('prestamoapp.urls')) ]
marvinAlvarenga/ControlPrestamo
ControlPrestamo/urls.py
Python
gpl-2.0
865
# -*- coding: utf-8 -*- # Copyright 2020 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import proto # type: ignore from google.ads.googleads.v8.enums.types import ( response_content_type as gage_response_content_type, ) from google.ads.googleads.v8.resources.types import ( feed_mapping as gagr_feed_mapping, ) from google.rpc import status_pb2 # type: ignore __protobuf__ = proto.module( package="google.ads.googleads.v8.services", marshal="google.ads.googleads.v8", manifest={ "GetFeedMappingRequest", "MutateFeedMappingsRequest", "FeedMappingOperation", "MutateFeedMappingsResponse", "MutateFeedMappingResult", }, ) class GetFeedMappingRequest(proto.Message): r"""Request message for [FeedMappingService.GetFeedMapping][google.ads.googleads.v8.services.FeedMappingService.GetFeedMapping]. Attributes: resource_name (str): Required. The resource name of the feed mapping to fetch. """ resource_name = proto.Field(proto.STRING, number=1,) class MutateFeedMappingsRequest(proto.Message): r"""Request message for [FeedMappingService.MutateFeedMappings][google.ads.googleads.v8.services.FeedMappingService.MutateFeedMappings]. Attributes: customer_id (str): Required. The ID of the customer whose feed mappings are being modified. operations (Sequence[google.ads.googleads.v8.services.types.FeedMappingOperation]): Required. The list of operations to perform on individual feed mappings. partial_failure (bool): If true, successful operations will be carried out and invalid operations will return errors. If false, all operations will be carried out in one transaction if and only if they are all valid. Default is false. validate_only (bool): If true, the request is validated but not executed. Only errors are returned, not results. response_content_type (google.ads.googleads.v8.enums.types.ResponseContentTypeEnum.ResponseContentType): The response content type setting. Determines whether the mutable resource or just the resource name should be returned post mutation. """ customer_id = proto.Field(proto.STRING, number=1,) operations = proto.RepeatedField( proto.MESSAGE, number=2, message="FeedMappingOperation", ) partial_failure = proto.Field(proto.BOOL, number=3,) validate_only = proto.Field(proto.BOOL, number=4,) response_content_type = proto.Field( proto.ENUM, number=5, enum=gage_response_content_type.ResponseContentTypeEnum.ResponseContentType, ) class FeedMappingOperation(proto.Message): r"""A single operation (create, remove) on a feed mapping. Attributes: create (google.ads.googleads.v8.resources.types.FeedMapping): Create operation: No resource name is expected for the new feed mapping. remove (str): Remove operation: A resource name for the removed feed mapping is expected, in this format: ``customers/{customer_id}/feedMappings/{feed_id}~{feed_mapping_id}`` """ create = proto.Field( proto.MESSAGE, number=1, oneof="operation", message=gagr_feed_mapping.FeedMapping, ) remove = proto.Field(proto.STRING, number=3, oneof="operation",) class MutateFeedMappingsResponse(proto.Message): r"""Response message for a feed mapping mutate. Attributes: partial_failure_error (google.rpc.status_pb2.Status): Errors that pertain to operation failures in the partial failure mode. Returned only when partial_failure = true and all errors occur inside the operations. If any errors occur outside the operations (e.g. auth errors), we return an RPC level error. results (Sequence[google.ads.googleads.v8.services.types.MutateFeedMappingResult]): All results for the mutate. """ partial_failure_error = proto.Field( proto.MESSAGE, number=3, message=status_pb2.Status, ) results = proto.RepeatedField( proto.MESSAGE, number=2, message="MutateFeedMappingResult", ) class MutateFeedMappingResult(proto.Message): r"""The result for the feed mapping mutate. Attributes: resource_name (str): Returned for successful operations. feed_mapping (google.ads.googleads.v8.resources.types.FeedMapping): The mutated feed mapping with only mutable fields after mutate. The field will only be returned when response_content_type is set to "MUTABLE_RESOURCE". """ resource_name = proto.Field(proto.STRING, number=1,) feed_mapping = proto.Field( proto.MESSAGE, number=2, message=gagr_feed_mapping.FeedMapping, ) __all__ = tuple(sorted(__protobuf__.manifest))
googleads/google-ads-python
google/ads/googleads/v8/services/types/feed_mapping_service.py
Python
apache-2.0
5,553
from .service import Fullcontact
ducksboard/libsaas
libsaas/services/fullcontact/__init__.py
Python
mit
33
# Copyright 2016 Casey Jaymes # This file is part of PySCAP. # # PySCAP is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # PySCAP is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with PySCAP. If not, see <http://www.gnu.org/licenses/>. import logging from scap.model.oval_5.defs.windows.ObjectType import ObjectType logger = logging.getLogger(__name__) class RegKeyEffectiveRights53ObjectElement(ObjectType): MODEL_MAP = { 'tag_name': 'regkeyeffectiverights53_object', 'elements': [ {'tag_name': 'behaviors', 'class': 'RegkeyEffectiveRights53Behaviors', 'min': 0}, {'tag_name': 'hive', 'class': 'EntityObjectRegistryHiveType', 'min': 0}, {'tag_name': 'key', 'class': 'scap.model.oval_5.defs.EntityObjectType', 'nillable': True, 'min': 0}, {'tag_name': 'trustee_sid', 'class': 'scap.model.oval_5.defs.EntityObjectType', 'min': 0}, ], }
cjaymes/pyscap
src/scap/model/oval_5/defs/windows/RegKeyEffectiveRights53ObjectElement.py
Python
gpl-3.0
1,362
import os import sys import pandas as pd import numpy as np from numpy.random import poisson, uniform from numpy import mean import time import math po = True teamsheetpath = sys.path[0] + '/teamcsvs/' compstat = {'TDF': 'TDA', 'TDA': 'TDF', #Dictionary to use to compare team stats with opponent stats 'FGF': 'FGA', 'FGA': 'FGF', 'SFF': 'SFA', 'SFA': 'SFF', 'PAT1%F': 'PAT1%A', 'PAT1%A': 'PAT1%F', 'PAT2%F': 'PAT2%A', 'PAT2%A': 'PAT2%F'} def get_opponent_stats(opponent): #Gets summaries of statistics for opponent each week opponent_stats = {} global teamsheetpath opp_stats = pd.DataFrame.from_csv(teamsheetpath + opponent + '.csv') for stat in opp_stats.columns: if stat in ['TDF', 'FGF', 'SFF', 'TDA', 'FGA', 'SFA']: opponent_stats.update({stat: opp_stats[stat].mean()}) try: opponent_stats.update({'PAT1%F': float(opp_stats['PAT1FS'].sum()) / opp_stats['PAT1FA'].sum()}) except ZeroDivisionError: opponent_stats.update({'PAT1%F': .99}) try: opponent_stats.update({'PAT2%F': float(opp_stats['PAT2FS'].sum()) / opp_stats['PAT2FA'].sum()}) except ZeroDivisionError: opponent_stats.update({'PAT2%F': .5}) try: opponent_stats.update({'PAT1%A': float(opp_stats['PAT1AS'].sum()) / opp_stats['PAT1AA'].sum()}) except ZeroDivisionError: opponent_stats.update({'PAT1%A': .99}) try: opponent_stats.update({'PAT2%A': float(opp_stats['PAT2AS'].sum()) / opp_stats['PAT2AA'].sum()}) except ZeroDivisionError: opponent_stats.update({'PAT2%A': .5}) return opponent_stats def get_residual_performance(team): #Get how each team has done compared to the average performance of their opponents global teamsheetpath score_df = pd.DataFrame.from_csv(teamsheetpath + team + '.csv') residual_stats = {} score_df['PAT1%F'] = np.nan score_df['PAT2%F'] = np.nan score_df['PAT1%A'] = np.nan score_df['PAT2%A'] = np.nan for week in score_df.index: try: score_df['PAT1%F'][week] = float(score_df['PAT1FS'][week]) / score_df['PAT1FA'][week] except ZeroDivisionError: score_df['PAT1%F'][week] = 0.99 #print ('For: ' + str(score_df['PAT1%F'][week])) try: score_df['PAT2%F'][week] = float(score_df['PAT2FS'][week]) / score_df['PAT2FA'][week] except ZeroDivisionError: score_df['PAT2%F'][week] = 0.5 try: score_df['PAT1%A'][week] = float(score_df['PAT1AS'][week]) / score_df['PAT1AA'][week] except ZeroDivisionError: score_df['PAT1%A'][week] = 0.99 #print ('Against: ' + str(score_df['PAT1%F'][week])) try: score_df['PAT2%A'][week] = float(score_df['PAT2AS'][week]) / score_df['PAT2AA'][week] except ZeroDivisionError: score_df['PAT2%A'][week] = 0.5 opponent_stats = get_opponent_stats(score_df['OPP'][week]) for stat in opponent_stats: if week == 1: score_df['OPP_' + stat] = np.nan score_df['OPP_' + stat][week] = opponent_stats[stat] for stat in opponent_stats: score_df['R_' + stat] = score_df[stat] - score_df['OPP_' + compstat[stat]] if stat in ['TDF', 'FGF', 'SFF', 'TDA', 'FGA', 'SFA']: residual_stats.update({stat: score_df['R_' + stat].mean()}) elif stat == 'PAT1%F': residual_stats.update({stat: (score_df['R_PAT1%F'].multiply(score_df['PAT1FA'])).sum() / score_df['PAT1FA'].sum()}) elif stat == 'PAT2%F': residual_stats.update({stat: (score_df['R_PAT2%F'].multiply(score_df['PAT2FA'])).sum() / score_df['PAT2FA'].sum()}) elif stat == 'PAT1%A': residual_stats.update({stat: (score_df['R_PAT1%A'].multiply(score_df['PAT1AA'])).sum() / score_df['PAT1AA'].sum()}) elif stat == 'PAT2%A': residual_stats.update({stat: (score_df['R_PAT2%A'].multiply(score_df['PAT2AA'])).sum() / score_df['PAT2AA'].sum()}) try: residual_stats.update({'GOFOR2': float(score_df['PAT2FA'].sum()) / score_df['TDF'].sum()}) except ZeroDivisionError: residual_stats.update({'GOFOR2': .1}) #print team #print residual_stats return residual_stats def get_score(expected_scores): #Get the score for a team based on expected scores score = 0 if expected_scores['TD'] > 0: tds = poisson(expected_scores['TD']) else: tds = poisson(0.01) score = score + 6 * tds if expected_scores['FG'] > 0: fgs = poisson(expected_scores['FG']) else: fgs = poisson(0.01) score = score + 3 * fgs if expected_scores['S'] > 0: sfs = poisson(expected_scores['S']) else: sfs = poisson(0.01) score = score + 2 * sfs for td in range(tds): go_for_2_determinant = uniform(0, 1) if go_for_2_determinant <= expected_scores['GOFOR2']: #Going for 2 successful_pat_determinant = uniform(0, 1) if successful_pat_determinant <= expected_scores['PAT2PROB']: score = score + 2 else: continue else: #Going for 1 #print(expected_scores['PAT1PROB']) successful_pat_determinant = uniform(0, 1) if successful_pat_determinant <= expected_scores['PAT1PROB']: score = score + 1 else: continue return score def game(team_1, team_2, expected_scores_1, expected_scores_2, playoff): #Get two scores and determine a winner score_1 = get_score(expected_scores_1) score_2 = get_score(expected_scores_2) if score_1 > score_2: win_1 = 1 win_2 = 0 draw_1 = 0 draw_2 = 0 elif score_2 > score_1: win_1 = 0 win_2 = 1 draw_1 = 0 draw_2 = 0 else: if playoff: win_1 = 0.5 win_2 = 0.5 draw_1 = 0 draw_2 = 0 else: win_1 = 0 win_2 = 0 draw_1 = 1 draw_2 = 1 summary = {team_1: [win_1, draw_1, score_1]} summary.update({team_2: [win_2, draw_2, score_2]}) return summary def get_expected_scores(team_1_stats, team_2_stats, team_1_df, team_2_df): #Get the expected scores for a matchup based on the previous teams' performances expected_scores = {} for stat in team_1_stats: expected_scores.update({'TD': mean([team_1_stats['TDF'] + team_2_df['TDA'].mean(), team_2_stats['TDA'] + team_1_df['TDF'].mean()])}) expected_scores.update({'FG': mean([team_1_stats['FGF'] + team_2_df['FGA'].mean(), team_2_stats['FGA'] + team_1_df['FGF'].mean()])}) expected_scores.update({'S': mean([team_1_stats['SFF'] + team_2_df['SFA'].mean(), team_2_stats['SFA'] + team_1_df['SFF'].mean()])}) #print mean([team_1_stats['PAT1%F'] + team_2_df['PAT1AS'].astype('float').sum() / team_2_df['PAT1AA'].sum(), # team_2_stats['PAT1%A'] + team_1_df['PAT1FS'].astype('float').sum() / team_1_df['PAT1FA'].sum()]) expected_scores.update({'GOFOR2': team_1_stats['GOFOR2']}) pat1prob = mean([team_1_stats['PAT1%F'] + team_2_df['PAT1AS'].astype('float').sum() / team_2_df['PAT1AA'].sum(), team_2_stats['PAT1%A'] + team_1_df['PAT1FS'].astype('float').sum() / team_1_df['PAT1FA'].sum()]) if not math.isnan(pat1prob): expected_scores.update({'PAT1PROB': pat1prob}) else: expected_scores.update({'PAT1PROB': 0.99}) #print(expected_scores['PAT1PROB']) pat2prob = mean([team_1_stats['PAT2%F'] + team_2_df['PAT2AS'].astype('float').sum() / team_2_df['PAT2AA'].sum(), team_2_stats['PAT2%A'] + team_1_df['PAT2FS'].astype('float').sum() / team_1_df['PAT2FA'].sum()]) if not math.isnan(pat2prob): expected_scores.update({'PAT2PROB': pat2prob}) else: expected_scores.update({'PAT2PROB': 0.5}) #print(expected_scores) return expected_scores def matchup(team_1, team_2): ts = time.time() team_1_season = pd.DataFrame.from_csv(teamsheetpath + team_1 + '.csv') team_2_season = pd.DataFrame.from_csv(teamsheetpath + team_2 + '.csv') stats_1 = get_residual_performance(team_1) stats_2 = get_residual_performance(team_2) expected_scores_1 = get_expected_scores(stats_1, stats_2, team_1_season, team_2_season) expected_scores_2 = get_expected_scores(stats_2, stats_1, team_2_season, team_1_season) team_1_wins = 0 team_2_wins = 0 team_1_draws = 0 team_2_draws = 0 team_1_scores = [] team_2_scores = [] i = 0 error = 1 while error > 0.000001 or i < 5000000: #Run until convergence after 5 million iterations summary = game(team_1, team_2, expected_scores_1, expected_scores_2, po) team_1_prev_wins = team_1_wins team_1_wins += summary[team_1][0] team_2_wins += summary[team_2][0] team_1_draws += summary[team_1][1] team_2_draws += summary[team_2][1] team_1_scores.append(summary[team_1][2]) team_2_scores.append(summary[team_2][2]) team_1_prob = float(team_1_wins) / len(team_1_scores) team_2_prob = float(team_2_wins) / len(team_2_scores) if i > 0: team_1_prev_prob = float(team_1_prev_wins) / i error = team_1_prob - team_1_prev_prob i = i + 1 if i == 5000000: print('Probability converged within 5 million iterations') else: print('Probability converged after ' + str(i) + ' iterations') games = pd.DataFrame.from_items([(team_1, team_1_scores), (team_2, team_2_scores)]) summaries = games.describe(percentiles = [0.025, 0.1, 0.25, 0.5, 0.75, 0.9, 0.975]) output = {'ProbWin': {team_1: team_1_prob, team_2: team_2_prob}, 'Scores': summaries} print(team_1 + '/' + team_2 + ' score distributions computed in ' + str(round(time.time() - ts, 1)) + ' seconds') return output
JoeJimFlood/NFLPrediction2014
matchup.py
Python
mit
10,272