code
stringlengths
3
1.05M
repo_name
stringlengths
5
104
path
stringlengths
4
251
language
stringclasses
1 value
license
stringclasses
15 values
size
int64
3
1.05M
#!/usr/bin/env python # Copyright (c) 2012 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """Generate keyboard layout and hotkey data for the keyboard overlay. This script fetches data from the keyboard layout and hotkey data spreadsheet, and output the data depending on the option. --cc: Rewrites a part of C++ code in chrome/browser/chromeos/webui/keyboard_overlay_ui.cc --grd: Rewrites a part of grd messages in chrome/app/generated_resources.grd --js: Rewrites the entire JavaScript code in chrome/browser/resources/keyboard_overlay/keyboard_overlay_data.js These options can be specified at the same time. e.g. python gen_keyboard_overlay_data.py --cc --grd --js The output directory of the generated files can be changed with --outdir. e.g. (This will generate tmp/keyboard_overlay.js) python gen_keyboard_overlay_data.py --outdir=tmp --js """ import cStringIO import datetime import gdata.spreadsheet.service import getpass import json import optparse import os import re import sys MODIFIER_SHIFT = 1 << 0 MODIFIER_CTRL = 1 << 1 MODIFIER_ALT = 1 << 2 KEYBOARD_GLYPH_SPREADSHEET_KEY = '0Ao3KldW9piwEdExLbGR6TmZ2RU9aUjFCMmVxWkVqVmc' HOTKEY_SPREADSHEET_KEY = '0AqzoqbAMLyEPdE1RQXdodk1qVkFyTWtQbUxROVM1cXc' CC_OUTDIR = 'chrome/browser/ui/webui/chromeos' CC_FILENAME = 'keyboard_overlay_ui.cc' GRD_OUTDIR = 'chrome/app' GRD_FILENAME = 'chromeos_strings.grdp' JS_OUTDIR = 'chrome/browser/resources/chromeos' JS_FILENAME = 'keyboard_overlay_data.js' CC_START = r'IDS_KEYBOARD_OVERLAY_INSTRUCTIONS_HIDE },' CC_END = r'};' GRD_START = r' <!-- BEGIN GENERATED KEYBOARD OVERLAY STRINGS -->' GRD_END = r' <!-- END GENERATED KEYBOARD OVERLAY STRINGS -->' LABEL_MAP = { 'glyph_arrow_down': 'down', 'glyph_arrow_left': 'left', 'glyph_arrow_right': 'right', 'glyph_arrow_up': 'up', 'glyph_back': 'back', 'glyph_backspace': 'backspace', 'glyph_brightness_down': 'bright down', 'glyph_brightness_up': 'bright up', 'glyph_enter': 'enter', 'glyph_forward': 'forward', 'glyph_fullscreen': 'maximize', # Kana/Eisu key on Japanese keyboard 'glyph_ime': u'\u304b\u306a\u0020\u002f\u0020\u82f1\u6570', 'glyph_lock': 'lock', 'glyph_overview': 'switch window', 'glyph_power': 'power', 'glyph_right': 'right', 'glyph_reload': 'reload', 'glyph_search': 'search', 'glyph_shift': 'shift', 'glyph_tab': 'tab', 'glyph_tools': 'tools', 'glyph_volume_down': 'vol. down', 'glyph_volume_mute': 'mute', 'glyph_volume_up': 'vol. up', }; INPUT_METHOD_ID_TO_OVERLAY_ID = { 'm17n:ar:kbd': 'ar', 'm17n:fa:isiri': 'ar', 'm17n:hi:itrans': 'hi', 'm17n:th:kesmanee': 'th', 'm17n:th:pattachote': 'th', 'm17n:th:tis820': 'th', 'm17n:vi:tcvn': 'vi', 'm17n:vi:telex': 'vi', 'm17n:vi:viqr': 'vi', 'm17n:vi:vni': 'vi', 'm17n:zh:cangjie': 'zh_TW', 'm17n:zh:quick': 'zh_TW', 'mozc': 'en_US', 'mozc-chewing': 'zh_TW', 'mozc-dv': 'en_US_dvorak', 'mozc-hangul': 'ko', 'mozc-jp': 'ja', 'pinyin': 'zh_CN', 'pinyin-dv': 'en_US_dvorak', 'xkb:be::fra': 'fr', 'xkb:be::ger': 'de', 'xkb:be::nld': 'nl', 'xkb:bg::bul': 'bg', 'xkb:bg:phonetic:bul': 'bg', 'xkb:br::por': 'pt_BR', 'xkb:ca::fra': 'fr_CA', 'xkb:ca:eng:eng': 'ca', 'xkb:ch::ger': 'de', 'xkb:ch:fr:fra': 'fr', 'xkb:cz::cze': 'cs', 'xkb:de::ger': 'de', 'xkb:de:neo:ger': 'de_neo', 'xkb:dk::dan': 'da', 'xkb:ee::est': 'et', 'xkb:es::spa': 'es', 'xkb:es:cat:cat': 'ca', 'xkb:fi::fin': 'fi', 'xkb:fr::fra': 'fr', 'xkb:gb:dvorak:eng': 'en_GB_dvorak', 'xkb:gb:extd:eng': 'en_GB', 'xkb:gr::gre': 'el', 'xkb:hr::scr': 'hr', 'xkb:hu::hun': 'hu', 'xkb:il::heb': 'iw', 'xkb:it::ita': 'it', 'xkb:jp::jpn': 'ja', 'xkb:kr:kr104:kor': 'ko', 'xkb:latam::spa': 'es_419', 'xkb:lt::lit': 'lt', 'xkb:lv:apostrophe:lav': 'lv', 'xkb:no::nob': 'no', 'xkb:pl::pol': 'pl', 'xkb:pt::por': 'pt_PT', 'xkb:ro::rum': 'ro', 'xkb:rs::srp': 'sr', 'xkb:ru::rus': 'ru', 'xkb:ru:phonetic:rus': 'ru', 'xkb:se::swe': 'sv', 'xkb:si::slv': 'sl', 'xkb:sk::slo': 'sk', 'xkb:tr::tur': 'tr', 'xkb:ua::ukr': 'uk', 'xkb:us::eng': 'en_US', 'xkb:us:altgr-intl:eng': 'en_US_altgr_intl', 'xkb:us:colemak:eng': 'en_US_colemak', 'xkb:us:dvorak:eng': 'en_US_dvorak', 'xkb:us:intl:eng': 'en_US_intl', 'zinnia-japanese': 'ja', } # The file was first generated in 2012 and we have a policy of not updating # copyright dates. COPYRIGHT_HEADER=\ """// Copyright (c) 2012 The Chromium Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. """ # A snippet for grd file GRD_SNIPPET_TEMPLATE=""" <message name="%s" desc="%s"> %s </message> """ # A snippet for C++ file CC_SNIPPET_TEMPLATE=""" { "%s", %s }, """ def SplitBehavior(behavior): """Splits the behavior to compose a message or i18n-content value. Examples: 'Activate last tab' => ['Activate', 'last', 'tab'] 'Close tab' => ['Close', 'tab'] """ return [x for x in re.split('[ ()"-.,]', behavior) if len(x) > 0] def ToMessageName(behavior): """Composes a message name for grd file. Examples: 'Activate last tab' => IDS_KEYBOARD_OVERLAY_ACTIVATE_LAST_TAB 'Close tab' => IDS_KEYBOARD_OVERLAY_CLOSE_TAB """ segments = [segment.upper() for segment in SplitBehavior(behavior)] return 'IDS_KEYBOARD_OVERLAY_' + ('_'.join(segments)) def ToMessageDesc(description): """Composes a message description for grd file.""" message_desc = 'The text in the keyboard overlay to explain the shortcut' if description: message_desc = '%s (%s).' % (message_desc, description) else: message_desc += '.' return message_desc def Toi18nContent(behavior): """Composes a i18n-content value for HTML/JavaScript files. Examples: 'Activate last tab' => keyboardOverlayActivateLastTab 'Close tab' => keyboardOverlayCloseTab """ segments = [segment.lower() for segment in SplitBehavior(behavior)] result = 'keyboardOverlay' for segment in segments: result += segment[0].upper() + segment[1:] return result def ToKeys(hotkey): """Converts the action value to shortcut keys used from JavaScript. Examples: 'Ctrl - 9' => '9<>CTRL' 'Ctrl - Shift - Tab' => 'tab<>CTRL<>SHIFT' """ values = hotkey.split(' - ') modifiers = sorted(value.upper() for value in values if value in ['Shift', 'Ctrl', 'Alt', 'Search']) keycode = [value.lower() for value in values if value not in ['Shift', 'Ctrl', 'Alt', 'Search']] # The keys which are highlighted even without modifier keys. base_keys = ['backspace', 'power'] if not modifiers and (keycode and keycode[0] not in base_keys): return None return '<>'.join(keycode + modifiers) def ParseOptions(): """Parses the input arguemnts and returns options.""" # default_username = os.getusername() + '@google.com'; default_username = '%[email protected]' % os.environ.get('USER') parser = optparse.OptionParser() parser.add_option('--key', dest='key', help='The key of the spreadsheet (required).') parser.add_option('--username', dest='username', default=default_username, help='Your user name (default: %s).' % default_username) parser.add_option('--password', dest='password', help='Your password.') parser.add_option('--account_type', default='GOOGLE', dest='account_type', help='Account type used for gdata login (default: GOOGLE)') parser.add_option('--js', dest='js', default=False, action='store_true', help='Output js file.') parser.add_option('--grd', dest='grd', default=False, action='store_true', help='Output resource file.') parser.add_option('--cc', dest='cc', default=False, action='store_true', help='Output cc file.') parser.add_option('--outdir', dest='outdir', default=None, help='Specify the directory files are generated.') (options, unused_args) = parser.parse_args() if not options.username.endswith('google.com'): print 'google.com account is necessary to use this script.' sys.exit(-1) if (not (options.js or options.grd or options.cc)): print 'Either --js, --grd, or --cc needs to be specified.' sys.exit(-1) # Get the password from the terminal, if needed. if not options.password: options.password = getpass.getpass( 'Application specific password for %s: ' % options.username) return options def InitClient(options): """Initializes the spreadsheet client.""" client = gdata.spreadsheet.service.SpreadsheetsService() client.email = options.username client.password = options.password client.source = 'Spread Sheet' client.account_type = options.account_type print 'Logging in as %s (%s)' % (client.email, client.account_type) client.ProgrammaticLogin() return client def PrintDiffs(message, lhs, rhs): """Prints the differences between |lhs| and |rhs|.""" dif = set(lhs).difference(rhs) if dif: print message, ', '.join(dif) def FetchSpreadsheetFeeds(client, key, sheets, cols): """Fetch feeds from the spreadsheet. Args: client: A spreadsheet client to be used for fetching data. key: A key string of the spreadsheet to be fetched. sheets: A list of the sheet names to read data from. cols: A list of columns to read data from. """ worksheets_feed = client.GetWorksheetsFeed(key) print 'Fetching data from the worksheet: %s' % worksheets_feed.title.text worksheets_data = {} titles = [] for entry in worksheets_feed.entry: worksheet_id = entry.id.text.split('/')[-1] list_feed = client.GetListFeed(key, worksheet_id) list_data = [] # Hack to deal with sheet names like 'sv (Copy of fl)' title = list_feed.title.text.split('(')[0].strip() titles.append(title) if title not in sheets: continue print 'Reading data from the sheet: %s' % list_feed.title.text for i, entry in enumerate(list_feed.entry): line_data = {} for k in entry.custom: if (k not in cols) or (not entry.custom[k].text): continue line_data[k] = entry.custom[k].text list_data.append(line_data) worksheets_data[title] = list_data PrintDiffs('Exist only on the spreadsheet: ', titles, sheets) PrintDiffs('Specified but do not exist on the spreadsheet: ', sheets, titles) return worksheets_data def FetchKeyboardGlyphData(client): """Fetches the keyboard glyph data from the spreadsheet.""" glyph_cols = ['scancode', 'p0', 'p1', 'p2', 'p3', 'p4', 'p5', 'p6', 'p7', 'p8', 'p9', 'label', 'format', 'notes'] keyboard_glyph_data = FetchSpreadsheetFeeds( client, KEYBOARD_GLYPH_SPREADSHEET_KEY, INPUT_METHOD_ID_TO_OVERLAY_ID.values(), glyph_cols) ret = {} for lang in keyboard_glyph_data: ret[lang] = {} keys = {} for line in keyboard_glyph_data[lang]: scancode = line.get('scancode') if (not scancode) and line.get('notes'): ret[lang]['layoutName'] = line['notes'] continue del line['scancode'] if 'notes' in line: del line['notes'] if 'label' in line: line['label'] = LABEL_MAP.get(line['label'], line['label']) keys[scancode] = line # Add a label to space key if '39' not in keys: keys['39'] = {'label': 'space'} ret[lang]['keys'] = keys return ret def FetchLayoutsData(client): """Fetches the keyboard glyph data from the spreadsheet.""" layout_names = ['U_layout', 'J_layout', 'E_layout', 'B_layout'] cols = ['scancode', 'x', 'y', 'w', 'h'] layouts = FetchSpreadsheetFeeds(client, KEYBOARD_GLYPH_SPREADSHEET_KEY, layout_names, cols) ret = {} for layout_name, layout in layouts.items(): ret[layout_name[0]] = [] for row in layout: line = [] for col in cols: value = row.get(col) if not value: line.append('') else: if col != 'scancode': value = float(value) line.append(value) ret[layout_name[0]].append(line) return ret def FetchHotkeyData(client): """Fetches the hotkey data from the spreadsheet.""" hotkey_sheet = ['Cross Platform Behaviors'] hotkey_cols = ['behavior', 'context', 'kind', 'actionctrlctrlcmdonmac', 'chromeos', 'descriptionfortranslation'] hotkey_data = FetchSpreadsheetFeeds(client, HOTKEY_SPREADSHEET_KEY, hotkey_sheet, hotkey_cols) action_to_id = {} id_to_behavior = {} # (behavior, action) result = [] for line in hotkey_data['Cross Platform Behaviors']: if (not line.get('chromeos')) or (line.get('kind') != 'Key'): continue action = ToKeys(line['actionctrlctrlcmdonmac']) if not action: continue behavior = line['behavior'].strip() description = line.get('descriptionfortranslation') result.append((behavior, action, description)) return result def UniqueBehaviors(hotkey_data): """Retrieves a sorted list of unique behaviors from |hotkey_data|.""" return sorted(set((behavior, description) for (behavior, _, description) in hotkey_data), cmp=lambda x, y: cmp(ToMessageName(x[0]), ToMessageName(y[0]))) def GetPath(path_from_src): """Returns the absolute path of the specified path.""" path = os.path.join(os.path.dirname(__file__), '../..', path_from_src) if not os.path.isfile(path): print 'WARNING: %s does not exist. Maybe moved or renamed?' % path return path def OutputFile(outpath, snippet): """Output the snippet into the specified path.""" out = file(outpath, 'w') out.write(COPYRIGHT_HEADER + '\n') out.write(snippet) print 'Output ' + os.path.normpath(outpath) def RewriteFile(start, end, original_dir, original_filename, snippet, outdir=None): """Replaces a part of the specified file with snippet and outputs it.""" original_path = GetPath(os.path.join(original_dir, original_filename)) original = file(original_path, 'r') original_content = original.read() original.close() if outdir: outpath = os.path.join(outdir, original_filename) else: outpath = original_path out = file(outpath, 'w') rx = re.compile(r'%s\n.*?%s\n' % (re.escape(start), re.escape(end)), re.DOTALL) new_content = re.sub(rx, '%s\n%s%s\n' % (start, snippet, end), original_content) out.write(new_content) out.close() print 'Output ' + os.path.normpath(outpath) def OutputJson(keyboard_glyph_data, hotkey_data, layouts, var_name, outdir): """Outputs the keyboard overlay data as a JSON file.""" action_to_id = {} for (behavior, action, _) in hotkey_data: i18nContent = Toi18nContent(behavior) action_to_id[action] = i18nContent data = {'keyboardGlyph': keyboard_glyph_data, 'shortcut': action_to_id, 'layouts': layouts, 'inputMethodIdToOverlayId': INPUT_METHOD_ID_TO_OVERLAY_ID} if not outdir: outdir = JS_OUTDIR outpath = GetPath(os.path.join(outdir, JS_FILENAME)) json_data = json.dumps(data, sort_keys=True, indent=2) # Remove redundant spaces after ',' json_data = json_data.replace(', \n', ',\n') # Replace double quotes with single quotes to avoid lint warnings. json_data = json_data.replace('\"', '\'') snippet = 'var %s = %s;\n' % (var_name, json_data) OutputFile(outpath, snippet) def OutputGrd(hotkey_data, outdir): """Outputs a part of messages in the grd file.""" snippet = cStringIO.StringIO() for (behavior, description) in UniqueBehaviors(hotkey_data): # Do not generate message for 'Show wrench menu'. It is handled manually # based on branding. if behavior == 'Show wrench menu': continue snippet.write(GRD_SNIPPET_TEMPLATE % (ToMessageName(behavior), ToMessageDesc(description), behavior)) RewriteFile(GRD_START, GRD_END, GRD_OUTDIR, GRD_FILENAME, snippet.getvalue(), outdir) def OutputCC(hotkey_data, outdir): """Outputs a part of code in the C++ file.""" snippet = cStringIO.StringIO() for (behavior, _) in UniqueBehaviors(hotkey_data): message_name = ToMessageName(behavior) output = CC_SNIPPET_TEMPLATE % (Toi18nContent(behavior), message_name) # Break the line if the line is longer than 80 characters if len(output) > 80: output = output.replace(' ' + message_name, '\n %s' % message_name) snippet.write(output) RewriteFile(CC_START, CC_END, CC_OUTDIR, CC_FILENAME, snippet.getvalue(), outdir) def main(): options = ParseOptions() client = InitClient(options) hotkey_data = FetchHotkeyData(client) if options.js: keyboard_glyph_data = FetchKeyboardGlyphData(client) if options.js: layouts = FetchLayoutsData(client) OutputJson(keyboard_glyph_data, hotkey_data, layouts, 'keyboardOverlayData', options.outdir) if options.grd: OutputGrd(hotkey_data, options.outdir) if options.cc: OutputCC(hotkey_data, options.outdir) if __name__ == '__main__': main()
codenote/chromium-test
tools/gen_keyboard_overlay_data/gen_keyboard_overlay_data.py
Python
bsd-3-clause
17,272
from PyQt5 import QtCore, QtWidgets import os class Welcome(QtWidgets.QWidget): """ This class contains content of dock area part of initial esim Window. It creates Welcome page of eSim. """ def __init__(self): QtWidgets.QWidget.__init__(self) self.vlayout = QtWidgets.QVBoxLayout() self.browser = QtWidgets.QTextBrowser() init_path = '../../' if os.name == 'nt': init_path = '' self.browser.setSource(QtCore.QUrl( init_path + "library/browser/welcome.html") ) self.browser.setOpenExternalLinks(True) self.browser.setVerticalScrollBarPolicy(QtCore.Qt.ScrollBarAlwaysOff) self.vlayout.addWidget(self.browser) self.setLayout(self.vlayout) self.show()
FOSSEE/eSim
src/browser/Welcome.py
Python
gpl-3.0
795
# -*- coding: utf-8 -*- # Generated by Django 1.11.29 on 2021-04-25 20:19 from __future__ import unicode_literals from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('programs', '0016_add_allowed_language'), ] operations = [ migrations.RenameField( model_name='programsconfig', old_name='execuction_mode', new_name='execution_mode', ), ]
sio2project/oioioi
oioioi/programs/migrations/0017_auto_20210425_2019.py
Python
gpl-3.0
457
"""Implement Prometheus statistics.""" # Copyright (C) 2013 Nippon Telegraph and Telephone Corporation. # Copyright (C) 2015 Brad Cowie, Christopher Lorier and Joe Stringer. # Copyright (C) 2015 Research and Education Advanced Network New Zealand Ltd. # Copyright (C) 2015--2018 The Contributors # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. from prometheus_client import Gauge as PromGauge from prometheus_client import Counter, Histogram from faucet.prom_client import PromClient class FaucetMetrics(PromClient): """Container class for objects that can be exported to Prometheus.""" _dpid_counters = None # type: dict _dpid_gauges = None # type: dict def __init__(self, reg=None): super(FaucetMetrics, self).__init__(reg=reg) self.PORT_REQUIRED_LABELS = self.REQUIRED_LABELS + ['port'] self._dpid_counters = {} self._dpid_gauges = {} self.faucet_config_reload_requests = self._counter( 'faucet_config_reload_requests', 'number of config reload requests', []) self.faucet_event_id = self._gauge( 'faucet_event_id', 'highest/most recent event ID to be sent', []) self.faucet_config_reload_warm = self._dpid_counter( 'faucet_config_reload_warm', 'number of warm, differences only config reloads executed') self.faucet_config_reload_cold = self._dpid_counter( 'faucet_config_reload_cold', 'number of cold, complete reprovision config reloads executed') self.of_ignored_packet_ins = self._dpid_counter( 'of_ignored_packet_ins', 'number of OF packet_ins received but ignored from DP') self.of_packet_ins = self._dpid_counter( 'of_packet_ins', 'number of OF packet_ins received from DP') self.of_non_vlan_packet_ins = self._dpid_counter( 'of_non_vlan_packet_ins', 'number of OF packet_ins received from DP, not associated with a FAUCET VLAN') self.of_vlan_packet_ins = self._dpid_counter( 'of_vlan_packet_ins', 'number of OF packet_ins received from DP, associated with a FAUCET VLAN') self.of_flowmsgs_sent = self._dpid_counter( 'of_flowmsgs_sent', 'number of OF flow messages (and packet outs) sent to DP') self.of_errors = self._dpid_counter( 'of_errors', 'number of OF errors received from DP') self.of_dp_connections = self._dpid_counter( 'of_dp_connections', 'number of OF connections from a DP') self.of_dp_disconnections = self._dpid_counter( 'of_dp_disconnections', 'number of OF connections from a DP') self.vlan_hosts_learned = self._gauge( 'vlan_hosts_learned', 'number of hosts learned on a VLAN', self.REQUIRED_LABELS + ['vlan']) self.port_vlan_hosts_learned = self._gauge( 'port_vlan_hosts_learned', 'number of hosts learned on a port and VLAN', self.PORT_REQUIRED_LABELS + ['vlan']) self.vlan_neighbors = self._gauge( 'vlan_neighbors', 'number of L3 neighbors on a VLAN (whether resolved to L2 addresses, or not)', self.REQUIRED_LABELS + ['vlan', 'ipv']) self.vlan_learn_bans = self._gauge( 'vlan_learn_bans', 'number of times learning was banned on a VLAN', self.REQUIRED_LABELS + ['vlan']) self.faucet_config_table_names = self._gauge( 'faucet_config_table_names', 'number to names map of FAUCET pipeline tables', self.REQUIRED_LABELS + ['table_name']) self.faucet_packet_in_secs = self._histogram( 'faucet_packet_in_secs', 'FAUCET packet in processing time', self.REQUIRED_LABELS, (0.0001, 0.001, 0.01, 0.1, 1)) self.faucet_valve_service_secs = self._histogram( 'faucet_valve_service_secs', 'FAUCET valve service processing time', self.REQUIRED_LABELS + ['valve_service'], (0.0001, 0.001, 0.01, 0.1, 1)) self.bgp_neighbor_uptime_seconds = self._gauge( 'bgp_neighbor_uptime', 'BGP neighbor uptime in seconds', self.REQUIRED_LABELS + ['vlan', 'neighbor']) self.bgp_neighbor_routes = self._gauge( 'bgp_neighbor_routes', 'BGP neighbor route count', self.REQUIRED_LABELS + ['vlan', 'neighbor', 'ipv']) self.learned_macs = self._gauge( 'learned_macs', ('MAC address stored as 64bit number to DP ID, port, VLAN, ' 'and n (discrete index)'), self.PORT_REQUIRED_LABELS + ['vlan', 'n']) self.port_status = self._gauge( 'port_status', 'status of switch ports', self.PORT_REQUIRED_LABELS) self.port_stack_state = self._gauge( 'port_stack_state', 'state of stacking on a port', self.PORT_REQUIRED_LABELS) self.port_learn_bans = self._gauge( 'port_learn_bans', 'number of times learning was banned on a port', self.PORT_REQUIRED_LABELS) self.port_lacp_status = self._gauge( 'port_lacp_status', 'status of LACP on port', self.PORT_REQUIRED_LABELS) self.dp_status = self._dpid_gauge( 'dp_status', 'status of datapaths') self.of_dp_desc_stats = self._gauge( 'of_dp_desc_stats', 'DP description (OFPDescStatsReply)', self.REQUIRED_LABELS + ['mfr_desc', 'hw_desc', 'sw_desc', 'serial_num', 'dp_desc']) self.stack_cabling_errors = self._dpid_counter( 'stack_cabling_errors', 'number of cabling errors detected in all FAUCET stacks') self.stack_probes_received = self._dpid_counter( 'stack_probes_received', 'number of stacking messages received') self.dp_dot1x_success = self._dpid_counter( 'dp_dot1x_success', 'number of successful authentications on dp') self.dp_dot1x_failure = self._dpid_counter( 'dp_dot1x_failure', 'number of authentications attempts failed on dp') self.dp_dot1x_logoff = self._dpid_counter( 'dp_dot1x_logoff', 'number of eap-logoff events on dp') self.port_dot1x_success = self._counter( 'port_dot1x_success', 'number of successful authentications on port', self.PORT_REQUIRED_LABELS) self.port_dot1x_failure = self._counter( 'port_dot1x_failure', 'number of authentications attempts failed on port', self.PORT_REQUIRED_LABELS) self.port_dot1x_logoff = self._counter( 'port_dot1x_logoff', 'number of eap-logoff events on port', self.PORT_REQUIRED_LABELS) def _counter(self, var, var_help, labels): return Counter(var, var_help, labels, registry=self._reg) # pylint: disable=unexpected-keyword-arg def _gauge(self, var, var_help, labels): return PromGauge(var, var_help, labels, registry=self._reg) # pylint: disable=unexpected-keyword-arg def _histogram(self, var, var_help, labels, buckets): return Histogram(var, var_help, labels, buckets=buckets, registry=self._reg) # pylint: disable=unexpected-keyword-arg def _dpid_counter(self, var, var_help): counter = self._counter(var, var_help, self.REQUIRED_LABELS) self._dpid_counters[var] = counter return counter def _dpid_gauge(self, var, var_help): gauge = self._gauge(var, var_help, self.REQUIRED_LABELS) self._dpid_gauges[var] = gauge return gauge def reset_dpid(self, dp_labels): """Set all DPID-only counter/gauges to 0.""" for counter in list(self._dpid_counters.values()): counter.labels(**dp_labels).inc(0) for gauge in list(self._dpid_gauges.values()): gauge.labels(**dp_labels).set(0) def inc_var(self, var, labels, val=1): assert labels is not None metrics_var = getattr(self, var) metrics_var.labels(**labels).inc(val)
trentindav/faucet
faucet/faucet_metrics.py
Python
apache-2.0
8,839
# Spawn Area file created with PSWG Planetary Spawn Tool import sys def addSpawnArea(core): core.spawnService.addLairSpawnArea('mixed_lair_group_1', -4014, -1966, 1024, 'dantooine') return
agry/NGECore2
scripts/mobiles/spawnareas/dantooine_imperial_op_lair.py
Python
lgpl-3.0
192
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations from decimal import Decimal from oscar_docdata import appsettings class Migration(migrations.Migration): dependencies = [ ('contenttypes', '0001_initial'), ] operations = [ migrations.CreateModel( name='DocdataOrder', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('merchant_name', models.CharField(default=appsettings.DOCDATA_MERCHANT_NAME, max_length=100, verbose_name='Docdata account')), ('merchant_order_id', models.CharField(default='', max_length=100, verbose_name='Order ID')), ('order_key', models.CharField(default='', unique=True, max_length=200, verbose_name='Payment cluster ID')), ('status', models.CharField(default='new', max_length=50, verbose_name='Status', choices=[('new', 'New'), ('in_progress', 'In Progress'), ('pending', 'Pending'), ('paid', 'Paid'), ('paid_refunded', 'Paid, part refunded'), ('cancelled', 'Cancelled'), ('charged_back', 'Charged back'), ('refunded', 'Refunded'), ('expired', 'Expired'), ('unknown', 'Unknown')])), ('language', models.CharField(default='en', max_length=5, verbose_name='Language', blank=True)), ('total_gross_amount', models.DecimalField(verbose_name='Total gross amount', max_digits=15, decimal_places=2)), ('currency', models.CharField(max_length=10, verbose_name='Currency')), ('country', models.CharField(max_length=2, null=True, verbose_name='Country_code', blank=True)), ('total_registered', models.DecimalField(default=Decimal('0.00'), verbose_name='Total registered', max_digits=15, decimal_places=2)), ('total_shopper_pending', models.DecimalField(default=Decimal('0.00'), verbose_name='Total shopper pending', max_digits=15, decimal_places=2)), ('total_acquirer_pending', models.DecimalField(default=Decimal('0.00'), verbose_name='Total acquirer pending', max_digits=15, decimal_places=2)), ('total_acquirer_approved', models.DecimalField(default=Decimal('0.00'), verbose_name='Total acquirer approved', max_digits=15, decimal_places=2)), ('total_captured', models.DecimalField(default=Decimal('0.00'), verbose_name='Total captured', max_digits=15, decimal_places=2)), ('total_refunded', models.DecimalField(default=Decimal('0.00'), verbose_name='Total refunded', max_digits=15, decimal_places=2)), ('total_charged_back', models.DecimalField(default=Decimal('0.00'), verbose_name='Total changed back', max_digits=15, decimal_places=2)), ('created', models.DateTimeField(auto_now_add=True, verbose_name='created')), ('updated', models.DateTimeField(auto_now=True, verbose_name='updated')), ], options={ 'ordering': ('-created', '-updated'), 'verbose_name': 'Docdata Order', 'verbose_name_plural': 'Docdata Orders', }, bases=(models.Model,), ), migrations.CreateModel( name='DocdataPayment', fields=[ ('payment_id', models.CharField(primary_key=True, default='', serialize=False, max_length=100, blank=True, verbose_name='Payment id')), ('status', models.CharField(default='NEW', max_length=30, verbose_name='status')), ('payment_method', models.CharField(default='', max_length=60, blank=True)), ('confidence_level', models.CharField(default='', verbose_name='Confidence level', max_length=30, editable=False)), ('amount_allocated', models.DecimalField(default=Decimal('0.00'), verbose_name='Amount Allocated', editable=False, max_digits=12, decimal_places=2)), ('amount_debited', models.DecimalField(default=Decimal('0.00'), verbose_name='Amount Debited', editable=False, max_digits=12, decimal_places=2)), ('amount_refunded', models.DecimalField(default=Decimal('0.00'), verbose_name='Amount Refunded', editable=False, max_digits=12, decimal_places=2)), ('amount_chargeback', models.DecimalField(default=Decimal('0.00'), verbose_name='Amount Changed back', editable=False, max_digits=12, decimal_places=2)), ('created', models.DateTimeField(auto_now_add=True, verbose_name='created')), ('updated', models.DateTimeField(auto_now=True, verbose_name='updated')), ], options={ 'ordering': ('payment_id',), 'verbose_name': 'Payment', 'verbose_name_plural': 'Payments', }, bases=(models.Model,), ), migrations.CreateModel( name='DocdataDirectDebitPayment', fields=[ ('docdatapayment_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, on_delete=models.CASCADE, to='oscar_docdata.DocdataPayment')), ('holder_name', models.CharField(max_length=35)), ('holder_city', models.CharField(max_length=35)), ('holder_country_code', models.CharField(max_length=2, null=True, verbose_name='Country_code', blank=True)), ('iban', models.CharField(max_length=34)), ('bic', models.CharField(max_length=11)), ], options={ 'ordering': ('-created', '-updated'), 'verbose_name': 'Direct Debit Payment', 'verbose_name_plural': 'Derect Debit Payments', }, bases=('oscar_docdata.docdatapayment',), ), migrations.AddField( model_name='docdatapayment', name='docdata_order', field=models.ForeignKey(related_name='payments', on_delete=models.deletion.PROTECT, to='oscar_docdata.DocdataOrder'), preserve_default=True, ), migrations.AddField( model_name='docdatapayment', name='polymorphic_ctype', field=models.ForeignKey(related_name='polymorphic_oscar_docdata.docdatapayment_set+', on_delete=models.CASCADE, editable=False, to='contenttypes.ContentType', null=True), preserve_default=True, ), ]
edoburu/django-oscar-docdata
oscar_docdata/migrations/0001_initial.py
Python
apache-2.0
6,455
"""This module extends the generic mainline code to add periodic query for availability of spiders and caches the resutls of the query for use both other services. """ import datetime import logging import tornado.ioloop from . import __api_version__ from async_actions import AsyncGetAndCacheSpiderMetadataForAllRepos from ..tor_async_google_container_registry import AsyncGenerateContainerRegistryAccessToken from config import Config from .. import main import request_handlers _logger = logging.getLogger(__name__) class Main(main.Main): @classmethod def description(cls): return ( 'This service periodically queries for availability ' 'of spiders and updates the spider metadata cache ' 'as required.' ) @classmethod def config_class(cls): return Config @classmethod def api_version(cls): return __api_version__ @classmethod def handler_classes(cls): return [ request_handlers.HealthRequestHandler, ] def listen(self, *args, **kwargs): self._generate_google_container_registry_access_token() # this call to 'listen()' doesn't return main.Main.listen(self, *args, **kwargs) def _generate_google_container_registry_access_token(self): filename = self.config.google_container_registry_service_account_credentials_filename async_action = AsyncGenerateContainerRegistryAccessToken(filename) async_action.generate(self._on_access_token_gen_done) def _on_access_token_gen_done(self, google_container_registry_access_token, async_action): # this is only called if an access token has been generated assert google_container_registry_access_token is not None assert self.config.google_container_registry_access_token is None self.config.google_container_registry_access_token = google_container_registry_access_token self._discovery() def _discovery(self): if self.process_targetted_for_termination: """A SIGTERM has been sent to the process by Kubernetes indicating that the process is going to be terminated so let's not start another sync in case the termination happens right in the middle of the sync. """ _logger.info('process is targetted for termiation - not starting and not rescheduling sync') return _logger.info('starting discovery and caching process') async_action = AsyncGetAndCacheSpiderMetadataForAllRepos(datetime.datetime.now()) async_action.discover_and_cache(self._on_discover_and_cache_done) def _on_discover_and_cache_done(self, is_ok, async_action): duration = datetime.datetime.now() - async_action.async_state duration_in_seconds = duration.total_seconds() if is_ok: _logger.info( 'successfully finished discovering and caching spiders - took in %.0f seconds to complete', duration_in_seconds) else: _logger.error( 'error discovering and caching spiders - failed after %.0f seconds', duration_in_seconds) self._schedule_discovery() def _schedule_discovery(self): if not self.config.discovery_frequency_in_seconds: return if self.process_targetted_for_termination: """A SIGTERM has been sent to the process by Kubernetes indicating that the process is going to be terminated so let's not start another sync in case the termination happens right in the middle of the sync. """ _logger.info('process is targetted for termiation - not rescheduling sync') return tornado.ioloop.IOLoop.current().add_timeout( datetime.timedelta(0, self.config.discovery_frequency_in_seconds, 0), self._discovery) _logger.info( 'spider discovery process scheduled to run in %d seconds', self.config.discovery_frequency_in_seconds)
simonsdave/cloudfeaster_infrastructure
cloudfeaster_services/discovery/main.py
Python
mit
4,090
import SASModels.sas_models as sas_models import numpy as np import matplotlib.pyplot as plt import matplotlib.colors as mcolors import sys, lmfit from mpl_toolkits.axes_grid1 import make_axes_locatable sas_models.math.n_integration_cuts = 1 I0 = 0.00002 RL = 3000 R0 = 600 phi = 90 SLDspindle = 42.209e-6 #a-Fe2O3 at 1.3414 A SLDmatrix = 9.459e-6 #H2O at 1.3414 A sigRL = 0.0 B = 0.1 # T Ms = 1642 # A/m V = 4.6e-22 k = 1.3807e-23 T = 300 MsVperKT = Ms*V/k/T def get_custom_cmap(): def make_colormap(seq): """Return a LinearSegmentedColormap seq: a sequence of floats and RGB-tuples. The floats should be increasing and in the interval (0,1). """ cdict = {'red': [], 'green': [], 'blue': []} for i, item in enumerate(seq): pos, r, g, b = item cdict['red'].append([pos, r, r]) cdict['green'].append([pos, g, g]) cdict['blue'].append([pos, b, b]) return mcolors.LinearSegmentedColormap('CustomMap', cdict) #Nice Coloring: c = mcolors.ColorConverter().to_rgb custom_colors = [(0, 0, 0, 0),\ (0.18, 0.05, 0.05, 0.2),\ (0.28, 0, 0, 1),\ (0.4, 0.7, 0.85, 0.9),\ (0.45, 0, 0.75, 0),\ (0.6, 1, 1, 0),\ (0.75, 1, 0, 0),\ (0.92 , 0.6, 0.6, 0.6),\ (1 , 0.95, 0.95, 0.95)] custom_cmap = make_colormap(custom_colors) custom_cmap.set_bad(color='black') return custom_cmap if False: psi_range = np.linspace(0, np.pi/2, 90) prob=[] for psi in psi_range: prob_val = sas_models.math.langevin_prob(psi, B*MsVperKT, 0.) prob.append(prob_val) fig, ax = plt.subplots() ax.plot(psi_range, prob) plt.show() pix_size = 100 qy = np.linspace(-0.005, 0.005, pix_size) qz = np.linspace(-0.005, 0.005, pix_size) Imodel = sas_models.spindle.get_2dimage_langevin(qy, qz, RL, R0, phi,\ SLDspindle, SLDmatrix,\ sigRL, B, MsVperKT) Imodel = I0*Imodel fig, ax = plt.subplots() cmap = get_custom_cmap() pcm = ax.pcolormesh(qy, qz, Imodel.T,\ norm=mcolors.LogNorm(), cmap=cmap) ax.set_xlabel('$q_y \, / \, \AA^{-1}$') ax.set_ylabel('$q_z \, / \, \AA^{-1}$') ax.set_xlim(min(qy), max(qy)) ax.set_ylim(min(qz), max(qz)) divider3 = make_axes_locatable(ax) cax = divider3.append_axes('right', size="5%", pad=0.05) cbar = fig.colorbar(pcm, cax=cax) fig.tight_layout() fig.savefig('Spindle.png') plt.show()
DomiDre/SASModels
tests/sabrina_simulations.py
Python
gpl-3.0
2,566
import os from gevent import spawn from logging import INFO from tuntap import Tun from utils import create_logger from net import VPNServerConnection from config import VPNClientConfig import traceback client_logger = create_logger(name="PyVPN Client Logger", file=os.path.join(".", "client.log"), level=INFO) class VPNClient(object): args_config = ["tun_name"] def __init__(self, **kwargs): self.logger = client_logger self.config = VPNClientConfig(path_to_config="./client.conf") overrides = ( (k,v) for k,v in kwargs.iteritems() if k in VPNClient.args_config ) overrides = dict(overrides) self.config.update(overrides) def _forward_data_from_net(self): self.logger.info("start forwarder from net") while True: self.tt.write_packet(self.net.read_packet()) def _forward_data_from_tun(self): self.logger.info("start forwarder from tun") while True: self.net.write_packet(self.tt.read_packet()) def _connect_and_configure(self): self.net = VPNServerConnection(host=self.config.server["host"], port=self.config.server["port"], app=self) self.tt = Tun(name=self.config.tun_name) self.tt.configure(ip=self.config.ip, mask=self.config.mask) def start(self): self._connect_and_configure() self.logger.info("connect and configure ok") g1 = spawn(self._forward_data_from_net) g2 = spawn(self._forward_data_from_tun) self.logger.info("client ok") print "client ok" g1.join() g2.join() if __name__ == "__main__": client = None try: client = VPNClient(config="./client.conf", tun_name="tun0") client.start() except Exception as e: client_logger.error("client failed: %s" % e) client_logger.error(traceback.format_exc()) traceback.print_exc() exit(-1)
mitin123/PyVPN
src/client.py
Python
apache-2.0
1,920
# -*- coding: utf-8 -*- import datetime from south.db import db from south.v2 import SchemaMigration from django.db import models class Migration(SchemaMigration): def forwards(self, orm): # Adding model 'Vote' db.create_table('event_vote', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('note', self.gf('django.db.models.fields.CharField')(default='', max_length=255, blank=True)), ('voter', self.gf('django.db.models.fields.related.ForeignKey')(related_name='+', to=orm['auth.User'])), ('content_type', self.gf('django.db.models.fields.related.ForeignKey')(related_name='votes', to=orm['contenttypes.ContentType'])), ('entity_id', self.gf('django.db.models.fields.PositiveIntegerField')()), ('status', self.gf('django.db.models.fields.CharField')(default='neutral', max_length=20)), )) db.send_create_signal('event', ['Vote']) # Adding model 'Activity' db.create_table('event_activity', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('title', self.gf('django.db.models.fields.CharField')(max_length=255)), ('description', self.gf('django.db.models.fields.CharField')(default='', max_length=255, blank=True)), ('create_user', self.gf('django.db.models.fields.related.ForeignKey')(related_name='hostedActivities', to=orm['auth.User'])), ('create_time', self.gf('django.db.models.fields.DateTimeField')(default=datetime.datetime.now)), ('start_time', self.gf('django.db.models.fields.DateTimeField')(default=datetime.datetime.now)), ('end_time', self.gf('django.db.models.fields.DateTimeField')(default=datetime.datetime.now)), ('vote_time', self.gf('django.db.models.fields.DateTimeField')(default=datetime.datetime.now)), )) db.send_create_signal('event', ['Activity']) # Adding model 'Campaign' db.create_table('event_campaign', ( ('activity_ptr', self.gf('django.db.models.fields.related.OneToOneField')(to=orm['event.Activity'], unique=True, primary_key=True)), ('status', self.gf('django.db.models.fields.CharField')(default='preparing', max_length=20)), )) db.send_create_signal('event', ['Campaign']) # Adding model 'Participation' db.create_table('event_participation', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('note', self.gf('django.db.models.fields.CharField')(default='', max_length=255, blank=True)), ('participant', self.gf('django.db.models.fields.related.ForeignKey')(related_name='+', to=orm['auth.User'])), ('activity', self.gf('django.db.models.fields.related.ForeignKey')(related_name='+', to=orm['event.Activity'])), ('status', self.gf('django.db.models.fields.CharField')(default='invited', max_length=20)), )) db.send_create_signal('event', ['Participation']) def backwards(self, orm): # Deleting model 'Vote' db.delete_table('event_vote') # Deleting model 'Activity' db.delete_table('event_activity') # Deleting model 'Campaign' db.delete_table('event_campaign') # Deleting model 'Participation' db.delete_table('event_participation') models = { 'auth.group': { 'Meta': {'object_name': 'Group'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, 'auth.permission': { 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, 'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, 'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, 'event.activity': { 'Meta': {'object_name': 'Activity'}, 'create_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'create_user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'hostedActivities'", 'to': "orm['auth.User']"}), 'description': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '255', 'blank': 'True'}), 'end_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'participants': ('django.db.models.fields.related.ManyToManyField', [], {'related_name': "'activities'", 'symmetrical': 'False', 'through': "orm['event.Participation']", 'to': "orm['auth.User']"}), 'start_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'title': ('django.db.models.fields.CharField', [], {'max_length': '255'}), 'vote_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}) }, 'event.campaign': { 'Meta': {'object_name': 'Campaign', '_ormbases': ['event.Activity']}, 'activity_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['event.Activity']", 'unique': 'True', 'primary_key': 'True'}), 'status': ('django.db.models.fields.CharField', [], {'default': "'preparing'", 'max_length': '20'}) }, 'event.event': { 'Meta': {'object_name': 'Event'}, 'create_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'create_user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'events'", 'to': "orm['auth.User']"}), 'description': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '255', 'blank': 'True'}), 'end_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'latitude': ('django.db.models.fields.FloatField', [], {'null': 'True'}), 'location': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '255', 'blank': 'True'}), 'longitude': ('django.db.models.fields.FloatField', [], {'null': 'True'}), 'num_of_ppl': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'start_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'status': ('django.db.models.fields.CharField', [], {'default': "'normal'", 'max_length': '20'}), 'title': ('django.db.models.fields.CharField', [], {'max_length': '255'}) }, 'event.participation': { 'Meta': {'object_name': 'Participation'}, 'activity': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'+'", 'to': "orm['event.Activity']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'note': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '255', 'blank': 'True'}), 'participant': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'+'", 'to': "orm['auth.User']"}), 'status': ('django.db.models.fields.CharField', [], {'default': "'invited'", 'max_length': '20'}) }, 'event.vote': { 'Meta': {'object_name': 'Vote'}, 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'votes'", 'to': "orm['contenttypes.ContentType']"}), 'entity_id': ('django.db.models.fields.PositiveIntegerField', [], {}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'note': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '255', 'blank': 'True'}), 'status': ('django.db.models.fields.CharField', [], {'default': "'neutral'", 'max_length': '20'}), 'voter': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'+'", 'to': "orm['auth.User']"}) }, 'upload.imageupload': { 'Meta': {'object_name': 'ImageUpload'}, 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'images'", 'to': "orm['contenttypes.ContentType']"}), 'create_time': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'create_user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'+'", 'to': "orm['auth.User']"}), 'description': ('django.db.models.fields.CharField', [], {'max_length': '255'}), 'entity_id': ('django.db.models.fields.PositiveIntegerField', [], {}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'image_large': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'db_index': 'True'}), 'image_large_height': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'image_large_width': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'image_medium': ('django.db.models.fields.files.ImageField', [], {'db_index': 'True', 'max_length': '255', 'null': 'True', 'blank': 'True'}), 'image_medium_height': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'image_medium_width': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'image_small': ('django.db.models.fields.files.ImageField', [], {'db_index': 'True', 'max_length': '255', 'null': 'True', 'blank': 'True'}), 'image_small_height': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'image_small_width': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'status': ('django.db.models.fields.CharField', [], {'default': "'normal'", 'max_length': '20'}), 'usage': ('django.db.models.fields.CharField', [], {'default': "'original'", 'max_length': '20'}) } } complete_apps = ['event']
elin-moco/ffclub
ffclub/event/migrations/0002_added_activity_campaign_participation_vote_models.py
Python
bsd-3-clause
13,005
"Interactions with the Juju environment" # Copyright 2013 Canonical Ltd. # # Authors: # Charm Helpers Developers <[email protected]> import os import json import yaml import subprocess import sys import UserDict from subprocess import CalledProcessError CRITICAL = "CRITICAL" ERROR = "ERROR" WARNING = "WARNING" INFO = "INFO" DEBUG = "DEBUG" MARKER = object() cache = {} def cached(func): """Cache return values for multiple executions of func + args For example:: @cached def unit_get(attribute): pass unit_get('test') will cache the result of unit_get + 'test' for future calls. """ def wrapper(*args, **kwargs): global cache key = str((func, args, kwargs)) try: return cache[key] except KeyError: res = func(*args, **kwargs) cache[key] = res return res return wrapper def flush(key): """Flushes any entries from function cache where the key is found in the function+args """ flush_list = [] for item in cache: if key in item: flush_list.append(item) for item in flush_list: del cache[item] def log(message, level=None): """Write a message to the juju log""" command = ['juju-log'] if level: command += ['-l', level] command += [message] subprocess.call(command) class Serializable(UserDict.IterableUserDict): """Wrapper, an object that can be serialized to yaml or json""" def __init__(self, obj): # wrap the object UserDict.IterableUserDict.__init__(self) self.data = obj def __getattr__(self, attr): # See if this object has attribute. if attr in ("json", "yaml", "data"): return self.__dict__[attr] # Check for attribute in wrapped object. got = getattr(self.data, attr, MARKER) if got is not MARKER: return got # Proxy to the wrapped object via dict interface. try: return self.data[attr] except KeyError: raise AttributeError(attr) def __getstate__(self): # Pickle as a standard dictionary. return self.data def __setstate__(self, state): # Unpickle into our wrapper. self.data = state def json(self): """Serialize the object to json""" return json.dumps(self.data) def yaml(self): """Serialize the object to yaml""" return yaml.dump(self.data) def execution_environment(): """A convenient bundling of the current execution context""" context = {} context['conf'] = config() if relation_id(): context['reltype'] = relation_type() context['relid'] = relation_id() context['rel'] = relation_get() context['unit'] = local_unit() context['rels'] = relations() context['env'] = os.environ return context def in_relation_hook(): """Determine whether we're running in a relation hook""" return 'JUJU_RELATION' in os.environ def relation_type(): """The scope for the current relation hook""" return os.environ.get('JUJU_RELATION', None) def relation_id(): """The relation ID for the current relation hook""" return os.environ.get('JUJU_RELATION_ID', None) def local_unit(): """Local unit ID""" return os.environ['JUJU_UNIT_NAME'] def remote_unit(): """The remote unit for the current relation hook""" return os.environ['JUJU_REMOTE_UNIT'] def service_name(): """The name service group this unit belongs to""" return local_unit().split('/')[0] def hook_name(): """The name of the currently executing hook""" return os.path.basename(sys.argv[0]) class Config(dict): """A dictionary representation of the charm's config.yaml, with some extra features: - See which values in the dictionary have changed since the previous hook. - For values that have changed, see what the previous value was. - Store arbitrary data for use in a later hook. NOTE: Do not instantiate this object directly - instead call ``hookenv.config()``, which will return an instance of :class:`Config`. Example usage:: >>> # inside a hook >>> from charmhelpers.core import hookenv >>> config = hookenv.config() >>> config['foo'] 'bar' >>> # store a new key/value for later use >>> config['mykey'] = 'myval' >>> # user runs `juju set mycharm foo=baz` >>> # now we're inside subsequent config-changed hook >>> config = hookenv.config() >>> config['foo'] 'baz' >>> # test to see if this val has changed since last hook >>> config.changed('foo') True >>> # what was the previous value? >>> config.previous('foo') 'bar' >>> # keys/values that we add are preserved across hooks >>> config['mykey'] 'myval' """ CONFIG_FILE_NAME = '.juju-persistent-config' def __init__(self, *args, **kw): super(Config, self).__init__(*args, **kw) self.implicit_save = True self._prev_dict = None self.path = os.path.join(charm_dir(), Config.CONFIG_FILE_NAME) if os.path.exists(self.path): self.load_previous() def __getitem__(self, key): """For regular dict lookups, check the current juju config first, then the previous (saved) copy. This ensures that user-saved values will be returned by a dict lookup. """ try: return dict.__getitem__(self, key) except KeyError: return (self._prev_dict or {})[key] def load_previous(self, path=None): """Load previous copy of config from disk. In normal usage you don't need to call this method directly - it is called automatically at object initialization. :param path: File path from which to load the previous config. If `None`, config is loaded from the default location. If `path` is specified, subsequent `save()` calls will write to the same path. """ self.path = path or self.path with open(self.path) as f: self._prev_dict = json.load(f) def changed(self, key): """Return True if the current value for this key is different from the previous value. """ if self._prev_dict is None: return True return self.previous(key) != self.get(key) def previous(self, key): """Return previous value for this key, or None if there is no previous value. """ if self._prev_dict: return self._prev_dict.get(key) return None def save(self): """Save this config to disk. If the charm is using the :mod:`Services Framework <services.base>` or :meth:'@hook <Hooks.hook>' decorator, this is called automatically at the end of successful hook execution. Otherwise, it should be called directly by user code. To disable automatic saves, set ``implicit_save=False`` on this instance. """ if self._prev_dict: for k, v in self._prev_dict.iteritems(): if k not in self: self[k] = v with open(self.path, 'w') as f: json.dump(self, f) @cached def config(scope=None): """Juju charm configuration""" config_cmd_line = ['config-get'] if scope is not None: config_cmd_line.append(scope) config_cmd_line.append('--format=json') try: config_data = json.loads(subprocess.check_output(config_cmd_line)) if scope is not None: return config_data return Config(config_data) except ValueError: return None @cached def relation_get(attribute=None, unit=None, rid=None): """Get relation information""" _args = ['relation-get', '--format=json'] if rid: _args.append('-r') _args.append(rid) _args.append(attribute or '-') if unit: _args.append(unit) try: return json.loads(subprocess.check_output(_args)) except ValueError: return None except CalledProcessError, e: if e.returncode == 2: return None raise def relation_set(relation_id=None, relation_settings=None, **kwargs): """Set relation information for the current unit""" relation_settings = relation_settings if relation_settings else {} relation_cmd_line = ['relation-set'] if relation_id is not None: relation_cmd_line.extend(('-r', relation_id)) for k, v in (relation_settings.items() + kwargs.items()): if v is None: relation_cmd_line.append('{}='.format(k)) else: relation_cmd_line.append('{}={}'.format(k, v)) subprocess.check_call(relation_cmd_line) # Flush cache of any relation-gets for local unit flush(local_unit()) @cached def relation_ids(reltype=None): """A list of relation_ids""" reltype = reltype or relation_type() relid_cmd_line = ['relation-ids', '--format=json'] if reltype is not None: relid_cmd_line.append(reltype) return json.loads(subprocess.check_output(relid_cmd_line)) or [] return [] @cached def related_units(relid=None): """A list of related units""" relid = relid or relation_id() units_cmd_line = ['relation-list', '--format=json'] if relid is not None: units_cmd_line.extend(('-r', relid)) return json.loads(subprocess.check_output(units_cmd_line)) or [] @cached def relation_for_unit(unit=None, rid=None): """Get the json represenation of a unit's relation""" unit = unit or remote_unit() relation = relation_get(unit=unit, rid=rid) for key in relation: if key.endswith('-list'): relation[key] = relation[key].split() relation['__unit__'] = unit return relation @cached def relations_for_id(relid=None): """Get relations of a specific relation ID""" relation_data = [] relid = relid or relation_ids() for unit in related_units(relid): unit_data = relation_for_unit(unit, relid) unit_data['__relid__'] = relid relation_data.append(unit_data) return relation_data @cached def relations_of_type(reltype=None): """Get relations of a specific type""" relation_data = [] reltype = reltype or relation_type() for relid in relation_ids(reltype): for relation in relations_for_id(relid): relation['__relid__'] = relid relation_data.append(relation) return relation_data @cached def relation_types(): """Get a list of relation types supported by this charm""" charmdir = os.environ.get('CHARM_DIR', '') mdf = open(os.path.join(charmdir, 'metadata.yaml')) md = yaml.safe_load(mdf) rel_types = [] for key in ('provides', 'requires', 'peers'): section = md.get(key) if section: rel_types.extend(section.keys()) mdf.close() return rel_types @cached def relations(): """Get a nested dictionary of relation data for all related units""" rels = {} for reltype in relation_types(): relids = {} for relid in relation_ids(reltype): units = {local_unit(): relation_get(unit=local_unit(), rid=relid)} for unit in related_units(relid): reldata = relation_get(unit=unit, rid=relid) units[unit] = reldata relids[relid] = units rels[reltype] = relids return rels @cached def is_relation_made(relation, keys='private-address'): ''' Determine whether a relation is established by checking for presence of key(s). If a list of keys is provided, they must all be present for the relation to be identified as made ''' if isinstance(keys, str): keys = [keys] for r_id in relation_ids(relation): for unit in related_units(r_id): context = {} for k in keys: context[k] = relation_get(k, rid=r_id, unit=unit) if None not in context.values(): return True return False def open_port(port, protocol="TCP"): """Open a service network port""" _args = ['open-port'] _args.append('{}/{}'.format(port, protocol)) subprocess.check_call(_args) def close_port(port, protocol="TCP"): """Close a service network port""" _args = ['close-port'] _args.append('{}/{}'.format(port, protocol)) subprocess.check_call(_args) @cached def unit_get(attribute): """Get the unit ID for the remote unit""" _args = ['unit-get', '--format=json', attribute] try: return json.loads(subprocess.check_output(_args)) except ValueError: return None def unit_private_ip(): """Get this unit's private IP address""" return unit_get('private-address') class UnregisteredHookError(Exception): """Raised when an undefined hook is called""" pass class Hooks(object): """A convenient handler for hook functions. Example:: hooks = Hooks() # register a hook, taking its name from the function name @hooks.hook() def install(): pass # your code here # register a hook, providing a custom hook name @hooks.hook("config-changed") def config_changed(): pass # your code here if __name__ == "__main__": # execute a hook based on the name the program is called by hooks.execute(sys.argv) """ def __init__(self): super(Hooks, self).__init__() self._hooks = {} def register(self, name, function): """Register a hook""" self._hooks[name] = function def execute(self, args): """Execute a registered hook based on args[0]""" hook_name = os.path.basename(args[0]) if hook_name in self._hooks: self._hooks[hook_name]() cfg = config() if cfg.implicit_save: cfg.save() else: raise UnregisteredHookError(hook_name) def hook(self, *hook_names): """Decorator, registering them as hooks""" def wrapper(decorated): for hook_name in hook_names: self.register(hook_name, decorated) else: self.register(decorated.__name__, decorated) if '_' in decorated.__name__: self.register( decorated.__name__.replace('_', '-'), decorated) return decorated return wrapper def charm_dir(): """Return the root directory of the current charm""" return os.environ.get('CHARM_DIR')
chuckbutler/shoutcast-charm
lib/charmhelpers/core/hookenv.py
Python
mit
14,883
# pylint: disable=redefined-outer-name,protected-access import pickle from collections import OrderedDict import pytest import matplotlib.pyplot as plt from dtocean_core.core import OrderedSim, Project from dtocean_core.data import CoreMetaData from dtocean_core.extensions import StrategyManager from dtocean_core.strategies import Strategy class MockStrategy(Strategy): @classmethod def get_name(cls): '''A class method for the common name of the strategy. Returns: str: A unique string ''' return "Mock" def configure(self): '''The configure method is collect information required for executing the strategy. ''' return def get_variables(self): '''The get_variables method returns the list of any variables that will be set by the strategy ''' return None def execute(self, core, project): '''The execute method is used to execute the strategy. It should always take a Core and a Project class as the only inputs. ''' return @pytest.fixture() def manager(): return StrategyManager() def test_get_available(manager): result = manager.get_available() assert len(result) > 0 def test_get_strategy(manager): strategies = manager.get_available() for strategy_name in strategies: manager.get_strategy(strategy_name) assert True def test_get_level_values_project(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) core = mocker.Mock() core.get_level_values.return_value = level_values project = Project("mock") project.add_simulation(OrderedSim("Default")) project.add_simulation(OrderedSim("Default Clone 1")) active_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] mocker.patch.object(manager._module_menu, 'get_active', return_value=active_levels, autospec=True) level_values = manager.get_level_values(core, project, None) assert level_values == level_values def test_get_level_values_strategy(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) core = mocker.Mock() core.get_level_values.return_value = level_values project = Project("mock") project.add_simulation(OrderedSim("Default")) project.add_simulation(OrderedSim("Default Clone 1")) project.add_simulation(OrderedSim("Default Clone 2")) strategy = MockStrategy() strategy.add_simulation_title('Default') strategy.add_simulation_title('Default Clone 1') active_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] mocker.patch.object(manager._module_menu, 'get_active', return_value=active_levels, autospec=True) level_values = manager.get_level_values(core, project, None, strategy=strategy) assert level_values == level_values def test_get_level_values_sim_titles(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) core = mocker.Mock() core.get_level_values.return_value = level_values project = Project("mock") project.add_simulation(OrderedSim("Default")) project.add_simulation(OrderedSim("Default Clone 1")) project.add_simulation(OrderedSim("Default Clone 2")) sim_titles = ["Default", "Default Clone 1"] active_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] mocker.patch.object(manager._module_menu, 'get_active', return_value=active_levels, autospec=True) level_values = manager.get_level_values(core, project, None, sim_titles=sim_titles) assert level_values == level_values def test_get_level_values_df(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) completed_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] meta = CoreMetaData({"identifier": "test", "structure": "test", "title": "test"}) mocker.patch.object(manager, 'get_level_values', return_value=level_values, autospec=True) mocker.patch.object(manager._module_menu, 'get_completed', return_value=completed_levels, autospec=True) core = mocker.Mock() core.get_metadata.return_value = meta df = manager.get_level_values_df(core, None, None) assert set(df['Simulation Name'].values) == \ set(['Default', 'Default Clone 1']) def test_get_level_values_plot(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) completed_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] meta = CoreMetaData({"identifier": "test", "structure": "test", "title": "test"}) mocker.patch.object(manager, 'get_level_values', return_value=level_values, autospec=True) mocker.patch.object(manager._module_menu, 'get_completed', return_value=completed_levels, autospec=True) core = mocker.Mock() core.get_metadata.return_value = meta manager.get_level_values_plot(core, None, None) assert len(plt.get_fignums()) == 1 ax = plt.gca() _, labels = ax.get_legend_handles_labels() assert len(labels) == 2 plt.close("all") def test_get_level_values_plot_max_lines(mocker, manager): level_values = OrderedDict([ ('Default', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 28263096.852039404), ('installation global output', 31673780.41058045), ('operations and maintenance global output', 31673780.41058045)])), ('Default Clone 1', OrderedDict([('hydrodynamics global output', 20000000.0), ('electrical sub-systems global output', 23065408.054377057), ('mooring and foundations global output', 119195335.02247664), ('installation global output', 123875364.39132734), ('operations and maintenance global output', 123875364.39132734)]))]) completed_levels = ['Hydrodynamics', 'Electrical Sub-Systems', 'Mooring and Foundations', 'Installation', 'Operations and Maintenance'] meta = CoreMetaData({"identifier": "test", "structure": "test", "title": "test"}) mocker.patch.object(manager, 'get_level_values', return_value=level_values, autospec=True) mocker.patch.object(manager._module_menu, 'get_completed', return_value=completed_levels, autospec=True) core = mocker.Mock() core.get_metadata.return_value = meta manager.get_level_values_plot(core, None, None, max_lines=1) assert len(plt.get_fignums()) == 1 ax = plt.gca() _, labels = ax.get_legend_handles_labels() assert len(labels) == 1 plt.close("all") def test_load_strategy(mocker, manager): strategy = MockStrategy() mocker.patch.object(manager, 'get_strategy', return_value=strategy, autospec=True) mocker.patch('dtocean_core.extensions.os.path.isfile', return_value=True, autospec=True) test_strategy = MockStrategy() test_strategy.add_simulation_title('Default') test_strategy.add_simulation_title('Default Clone 1') mock_stg_dict = manager._get_dump_dict(test_strategy) mocker.patch('dtocean_core.extensions.open', mocker.mock_open(read_data=pickle.dumps(mock_stg_dict, -1))) result = manager.load_strategy("mock.pkl") assert isinstance(result, MockStrategy) assert set(strategy._sim_record) == set(['Default', 'Default Clone 1']) def test_load_strategy_no_version(mocker, manager): strategy = MockStrategy() mocker.patch.object(manager, 'get_strategy', return_value=strategy, autospec=True) mocker.patch('dtocean_core.extensions.os.path.isfile', return_value=True, autospec=True) mock_stg_dict = {"name": "basic", "sim_record": ['Default', 'Default Clone 1'], "config": None, "sim_details": None} mocker.patch('dtocean_core.extensions.open', mocker.mock_open(read_data=pickle.dumps(mock_stg_dict, -1))) with pytest.raises(ValueError) as excinfo: manager.load_strategy("mock.pkl") assert "project object is required" in str(excinfo.value) def test_load_strategy_old(mocker, manager): strategy = MockStrategy() mocker.patch.object(manager, 'get_strategy', return_value=strategy, autospec=True) mocker.patch('dtocean_core.extensions.os.path.isfile', return_value=True, autospec=True) mock_stg_dict = {"name": "basic", "sim_record": [0, 1], "config": None, "sim_details": None} mocker.patch('dtocean_core.extensions.open', mocker.mock_open(read_data=pickle.dumps(mock_stg_dict, -1))) project = Project("mock") project.add_simulation(OrderedSim("Default")) project.add_simulation(OrderedSim("Default Clone 1")) result = manager.load_strategy("mock.pkl", project) assert isinstance(result, MockStrategy) assert set(strategy._sim_record) == set(['Default', 'Default Clone 1'])
DTOcean/dtocean-core
tests/test_extensions_strategy.py
Python
gpl-3.0
18,979
import re import os from lxml import etree from .utils import * from .namespaces import NAMESPACES CONTEXTS = ('root', 'body', 'p0', 'p', 'r', 't', 'tbl', 'tr', 'tc') META_COMMANDS = ('up', 'prev', 'next', 'cloneprev', 'clonenext', 'delete') DEFAULT_CMD_TO_CONTEXT_MAPPING = { 'for-each': ('w', 'p'), # xsl::for-each select=... 'choose': ('w', 'p'), # xsl::choose 'when': ('xsl', 'choose'), # xsl::when test=... 'otherwise': ('xsl', 'choose'), # xsl::otherwise 'if': ('w', 'p'), # xsl::if test=... 'sort': ('w', 'p'), # xsl::sort select=... 'value-of': ('w', 't'), # xsl::value-of select=... 'text': ('w', 't'), # xsl::text ... 'meta': ('w', 'r'), # xsl::meta up|prev|next|cloneprev|clonenext|delete } class XslError(Exception): pass class ParseError(XslError): pass class ElementNotFound(XslError): pass class XslCommand(object): """Object thats represents a single XSL command""" def __init__(self, xsl): self.parse(xsl) def __str__(self): return "xsl:%s:%s %s" % (self.context or '', self.cmd, self.meta_commands or self.text or self.options) def parse(self, xsl='text'): """ TODO: add double-quoted string literals that allows for escaped double quotes https://gist.github.com/prathe/2439752 or http://www.metaltoad.com/blog/regex-quoted-string-escapable-quotes """ try: cmd_text, option_text = xsl.split(None, 1) except ValueError: cmd_text = xsl option_text = '' try: context, cmd = cmd_text.strip().lower().split(':', 1) except ValueError: cmd = cmd_text.lower() context = None if not cmd in DEFAULT_CMD_TO_CONTEXT_MAPPING: raise ParseError("unknown command %s" % cmd) if context and not context in CONTEXTS: raise ParseError("unknown context %s" % context) self.context = context self.cmd = cmd self.text = None self.meta_commands = [] self.options = {} try: if cmd in ('choose', 'text', 'meta'): raise ValueError() option_name, expr = option_text.split('=', 1) option_name = option_name.strip().lower() expr = unescape(expr).strip("'").strip('"').strip() self.options = {option_name: expr} except ValueError: text = unescape(option_text) if cmd == 'meta': for mc in filter(lambda c: c, map(lambda c: c.strip(), text.lower().split(';'))): if mc in META_COMMANDS: # store in stack order self.meta_commands = [mc] + self.meta_commands else: raise ParseError("unknown meta command %s" % self.text) else: self.text = text class XslElement(LoggerMixin): """List thats represents a XSL command set""" namespaces = NAMESPACES w_ns = 'w' xsl_ns = 'xsl' def __init__(self, r, logger=None): self.commands = [] self.run = r self.parse() self.logger = logger def parse(self): def remove_junk(xsl): xsl = unidecode(xsl) xsl = re.sub(r"^[\t\s]*", "", xsl, re.DOTALL|re.MULTILINE|re.UNICODE) xsl = os.linesep.join([s for s in xsl.splitlines() if s]) xsl = re.sub(r"\n", "", xsl, re.DOTALL|re.MULTILINE|re.UNICODE) xsl = re.sub(r"\r", "", xsl, re.DOTALL|re.MULTILINE|re.UNICODE) xsl = re.sub(r"xsl\s*:", "xsl:", xsl, re.DOTALL|re.MULTILINE|re.UNICODE|re.IGNORECASE) xsl = re.sub(r"xsl:\s*", "xsl:", xsl, re.DOTALL|re.MULTILINE|re.UNICODE|re.IGNORECASE) return xsl t = self.run.xpath('.//w:t', namespaces=self.namespaces)[0] text = remove_junk(unicode(t.text)) for xsl in filter(lambda xsl: xsl.strip(), text.split('xsl:')): try: cmd = XslCommand(xsl) except ParseError as e: self.error("%s ignore invalid XSL %s: %s" % (self.__class__.__name__, xsl, e)) else: # store commands in stack order self.commands = [cmd] + self.commands # clean w:t t.text = '' @property def xsl(self): """Returns content as XSL text""" return ' '.join([str(cmd) for cmd in self.commands]) def __str__(self): return self.xsl def __repr__(self): return "<%s %s>" % (self.__class__.__name__, self.xsl) def hascontext(self, e, ns, context): return str(e.tag) == '{%s}%s' % (self.namespaces[ns], context) def getcontext(self, e, ns, context, raise_if_not_found=True): f = e while not self.hascontext(f, ns, context): f = f.getparent() if f is None: break if not f is None: return f elif raise_if_not_found: raise ElementNotFound("could not find %s:%s element in %s" % (ns, context, e)) def root(self, e): """Returns root node""" while not e.getparent() is None: e = e.getparent() return e def body(self, e): """Returns top level w:body node""" return self.getcontext(e, self.w_ns, 'body') def p0(self, e): """Returns top level w:p node""" body = self.body(e) p = self.p(e) if body == p.getparent(): return p else: raise ElementNotFound("could not find top level w:p element in %s" % e) def _w_x(self, e, x): d = self.getcontext(e, self.w_ns, x, raise_if_not_found=False) f = e.xpath('.//w:%s' % x, namespaces=self.namespaces) if d is not None: return d elif f: return f[0] else: raise ElementNotFound("could not find w:%s element in %s" % (x, e)) def t(self, e): """Returns w:t node""" return self._w_x(e, 't') def r(self, e): """Returns w:r node""" return self._w_x(e, 'r') def p(self, e): """Returns w:p node""" return self._w_x(e, 'p') def tc(self, e): """Returns w:tc node""" return self._w_x(e, 'tc') def tr(self, e): """Returns w:tr node""" return self._w_x(e, 'tr') def tbl(self, e): """Returns w:tbl node""" return self._w_x(e, 'tbl') def render(self, current): def append(e, qn, options={}): return etree.SubElement(e, qn, **options) def wrap(e, qn, options={}): f = e.makeelement(qn, options) p = e.getparent() i = p.index(e) p.remove(e) f.append(e) p.insert(i, f) return f def clone(e): return etree.fromstring(etree.tostring(e)) def cloneprev(e): c = clone(e) p = e.getparent() i = p.index(e) if i > 0: i -= 1 p.insert(i, c) return c def clonenext(e): c = clone(e) p = e.getparent() i = p.index(e) p.insert(i+1, c) return c ns, context = self.w_ns, None self.debug("render %s %s with %s" % (id(current), current.xpath('name()'), self)) while self.commands: cmd = self.commands.pop() # initialize namespace and context if context is None and ns == self.w_ns: ns, context = DEFAULT_CMD_TO_CONTEXT_MAPPING.get(cmd.cmd, current.xpath('name()').split(':')) current = getattr(self, context)(current) self.debug("initialize context to %s %s" % (id(current), current.xpath('name()'))) # switch to required context if cmd.context and cmd.context != context: current = getattr(self, cmd.context)(current) ns, context = current.xpath('name()').split(':') self.debug("changed context to %s %s" % (id(current), current.xpath('name()'))) if cmd.cmd == 'meta': while cmd.meta_commands: mc = cmd.meta_commands.pop() if mc == 'up' and current.getparent(): current = current.getparent() self.debug("meta up to %s %s" % (id(current), current.xpath('name()'))) elif mc == 'prev': parent = current.getparent() i = parent.index(current) if i > 0: current = parent[i-1] self.debug("meta prev to %s %s" % (id(current), current.xpath('name()'))) elif mc == 'next': parent = current.getparent() i = parent.index(current) if len(parent) > i+1: current = parent[i+1] self.debug("meta next to %s %s" % (id(current), current.xpath('name()'))) elif mc == 'cloneprev': cloneprev(current) self.debug("meta cloneprev from %s %s" % (id(current), current.xpath('name()'))) elif mc == 'clonenext': clonenext(current) self.debug("meta clonenext from %s %s" % (id(current), current.xpath('name()'))) elif mc == 'delete': parent = current.getparent() parent.remove(current) current = parent self.debug("meta delete and goto parent %s %s" % (id(current), current.xpath('name()'))) elif cmd.cmd in ('text', 'value-of'): current = append(current, etree.QName(self.namespaces[self.xsl_ns], cmd.cmd), cmd.options) current.text = cmd.text self.debug("append %s %s %s" % (id(current), current.xpath('name()'), cmd)) else: wrap(current, etree.QName(self.namespaces[self.xsl_ns], cmd.cmd), cmd.options) self.debug("wrap %s %s %s" % (id(current), current.xpath('name()'), cmd)) # fix current namespace and context ns, context = current.xpath('name()').split(':') # clear last cmd cmd = None
backbohne/docx-xslt
docxxslt/xsl.py
Python
mit
10,619
#!/usr/bin/python """ Make single page versions of the documentation for release and conversion into man pages etc. """ import os import re from datetime import datetime docpath = "docs/content" outfile = "MANUAL.md" # Order to add docs segments to make outfile docs = [ "about.md", "install.md", "docs.md", "drive.md", "s3.md", "swift.md", "dropbox.md", "googlecloudstorage.md", "local.md", "changelog.md", "bugs.md", "faq.md", "licence.md", "authors.md", "contact.md", ] # Docs which aren't made into outfile ignore_docs = [ "downloads.md", "privacy.md", ] def read_doc(doc): """Read file as a string""" path = os.path.join(docpath, doc) with open(path) as fd: contents = fd.read() parts = contents.split("---\n", 2) if len(parts) != 3: raise ValueError("Couldn't find --- markers: found %d parts" % len(parts)) contents = parts[2].strip()+"\n\n" # Remove icons contents = re.sub(r'<i class="fa.*?</i>\s*', "", contents) # Make [...](/links/) absolute contents = re.sub(r'\((\/.*?\/)\)', r"(http://rclone.org\1)", contents) return contents def check_docs(docpath): """Check all the docs are in docpath""" files = set(f for f in os.listdir(docpath) if f.endswith(".md")) files -= set(ignore_docs) docs_set = set(docs) if files == docs_set: return print "Files on disk but not in docs variable: %s" % ", ".join(files - docs_set) print "Files in docs variable but not on disk: %s" % ", ".join(docs_set - files) raise ValueError("Missing files") def main(): check_docs(docpath) with open(outfile, "w") as out: out.write("""\ %% rclone(1) User Manual %% Nick Craig-Wood %% %s """ % datetime.now().strftime("%b %d, %Y")) for doc in docs: out.write(read_doc(doc)) print "Written '%s'" % outfile if __name__ == "__main__": main()
X1011/rclone
make_manual.py
Python
mit
1,945
""" The structure of Expression Tree is a binary tree to evaluate certain expressions. All leaves of the Expression Tree have an number string value. All non-leaves of the Expression Tree have an operator string value. Now, given an expression array, build the expression tree of this expression, return the root of this expression tree. Example For the expression (2*6-(23+7)/(1+2)) (which can be represented by ["2" "*" "6" "-" "(" "23" "+" "7" ")" "/" "(" "1" "+" "2" ")"]). The expression tree will be like [ - ] / \ [ * ] [ / ] / \ / \ [ 2 ] [ 6 ] [ + ] [ + ] / \ / \ [ 23 ][ 7 ] [ 1 ] [ 2 ] . After building the tree, you just need to return root node [-]. """ __author__ = 'Daniel' class ExpressionTreeNode: def __init__(self, symbol): self.symbol = symbol self.left, self.right = None, None class Solution: def build(self, expression): """ :param expression: A string list :return: The root of expression tree """ post = self.infix2postfix(expression) tree_node = self.postfix2tree(post) return tree_node def infix2postfix(self, expression): """ :param expression: :return: """ post = [] op_stk = [] for elt in expression: if elt.isdigit(): post.append(elt) elif elt == "(": op_stk.append(elt) elif elt == ")": while op_stk and op_stk[-1] != "(": post.append(op_stk.pop()) op_stk.pop() else: while op_stk and self.precedence(op_stk[-1]) >= self.precedence( elt): # notice equal for the order of operators of same precedence. post.append(op_stk.pop()) op_stk.append(elt) while op_stk: post.append(op_stk.pop()) return post def postfix2tree(self, post): tree_stk = [] for elt in post: if elt.isdigit(): tree_stk.append(ExpressionTreeNode(elt)) else: pi = ExpressionTreeNode(elt) pi.right = tree_stk.pop() pi.left = tree_stk.pop() tree_stk.append(pi) try: return tree_stk.pop() except IndexError: return None def precedence(self, elt): if elt in ("(", ")"): return 0 if elt in ("+", "-"): return 1 if elt in ("*", "/"): return 2 return 3 if __name__ == "__main__": tree_ndoe = Solution().build(["2", "*", "6", "-", "(", "23", "+", "7", ")", "/", "(", "1", "+", "2", ")"]) assert tree_ndoe.symbol == "-"
algorhythms/LintCode
Expression Tree Build.py
Python
apache-2.0
2,906
from __future__ import print_function import os import yaml from flask.ext.debugtoolbar import DebugToolbarExtension from flask.ext.script import Manager from flask.ext.shellplus import Shell from flask_migrate import MigrateCommand, Migrate from sigh.apps import create_app from sigh.models import db from sigh.models import User, Sigh, Tag, tag_identifier, Comment base_dir = os.path.dirname(os.path.realpath(__file__)) config_file = os.path.join(base_dir, 'config.py') application = create_app(default_config=config_file) Migrate(application, db) manager = Manager(application) def debug_app(app): toolbar = DebugToolbarExtension() toolbar.init_app(app) def manage_app(app, app_manager): app_manager.init_app(app) @manager.command def runserver(port=5000, host='0.0.0.0', init=False): port = int(port) debug_app(application) application.run(host=host, port=port) @manager.command def load(fxtdir='fixtures/', app_name='sigh'): fixture_dir = os.path.join(base_dir, app_name, fxtdir) fixture_file = os.path.join(fixture_dir, 'testdata.yaml') with open(fixture_file) as f: fixture_data = yaml.load(f.read()) data_pairs = ((User, fixture_data['users']), (Sigh, fixture_data['sighs']), (Tag, fixture_data['tags']), (Comment, fixture_data['comments'])) with application.app_context(): for model, datas in data_pairs: for data in datas: model(**data).save() for data in fixture_data['tag_identifiers']: db.engine.execute(tag_identifier.insert().values(**data)) manager.add_command('shell', Shell(context=dict(app=application, db=db))) manager.add_command('db', MigrateCommand) if __name__ == '__main__': manager.run()
kxxoling/Programmer-Sign
manage.py
Python
mit
1,772
#!/usr/bin/python # -*- coding: latin-1 -*- # Copyright 2013 Telefonica Investigación y Desarrollo, S.A.U # # This file is part of FI-WARE LiveDemo App # # FI-WARE LiveDemo App is free software: you can redistribute it and/or modify it under the terms # of the GNU Affero General Public License as published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # FI-WARE LiveDemo App is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the # implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Affero General Public License # for more details. # # You should have received a copy of the GNU Affero General Public License along with FI-WARE LiveDemo App. If not, # see http://www.gnu.org/licenses/. # # For those usages not covered by the GNU Affero General Public License please contact with fermin at tid dot es __author__ = 'fermin' import subprocess from lxml import etree p = subprocess.Popen(['./query-issue.sh'], shell=False, stdout=subprocess.PIPE) output = p.stdout.read() doc = etree.fromstring(output) for ce in doc.findall('.//contextElement'): id = ce.find('.//id').text print id + ':' for ca in ce.findall('.//contextAttribute'): name = ca.find('name').text value = ca.find('contextValue').text print ' ', repr(name).ljust(30), ': ', str(value)
telefonicaid/fiware-livedemoapp
scripts/get-issues.py
Python
agpl-3.0
1,429
''' Simulation Based on Hippocampus Recordings Copyright Nate Sutton 2015 References: Data from CRCNS.org hc3 . Izhikevich neuron parameters from: http://f1000research.com/articles/3-104/v1 ''' import pylab import nest ''' Create objects to run experiment with ''' multimeter = nest.Create("multimeter",10) nest.SetStatus(multimeter, {"withtime":True, "record_from":["V_m"]}) multimeter2 = nest.Create("multimeter") nest.SetStatus(multimeter2, {"withtime":True, "record_from":["V_m"]}) spikedetector = nest.Create("spike_detector", params={"withgid": True, "withtime": True}) '''noise = nest.Create("poisson_generator", 2) nest.SetStatus(noise, [{"rate": 80000.0}, {"rate": 15000.0}])''' e_c_2_layer = nest.Create("izhikevich",50,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) e_c_3_layer = nest.Create("izhikevich",90,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) e_c_5_layer = nest.Create("izhikevich",80,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) c_a_1_layer = nest.Create("izhikevich",340,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) c_a_3_layer = nest.Create("izhikevich",100,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) d_g_layer = nest.Create("izhikevich",12,{'V_m':-70.0,'I_e':-15.0,'a':0.0012,'b':3.0,'c':-68.5,'d':10.0}) ''' Form connections between neurons and run sim NOTE: I may need to split the neurons into Ex and In groups in layers for connections With a number of neuron mismatch between layers how is that processed in connections? ''' syn_dict_ex = {"weight": 1.2} syn_dict_in = {"weight": -2.0} nest.Connect(e_c_2_layer, e_c_3_layer, "all_to_all", syn_spec=syn_dict_ex) nest.Connect(e_c_3_layer, e_c_5_layer, "all_to_all", syn_spec=syn_dict_ex) nest.Connect(e_c_5_layer, c_a_1_layer, "all_to_all", syn_spec=syn_dict_ex) nest.Connect(c_a_1_layer, c_a_3_layer, "all_to_all", syn_spec=syn_dict_ex) nest.Connect(c_a_3_layer, d_g_layer, "all_to_all", syn_spec=syn_dict_ex) nest.SetStatus(e_c_2_layer, {"I_e": 10.0}) nest.Connect(multimeter, e_c_2_layer) nest.Connect(multimeter2, d_g_layer) nest.Connect(e_c_2_layer, spikedetector) #nest.Simulate(350.0) nest.Simulate(1000.0) ''' Record activity ''' dmm = nest.GetStatus(multimeter)[0] Vms = dmm["events"]["V_m"] ts = dmm["events"]["times"] dmm2 = nest.GetStatus(multimeter2)[0] Vms2 = dmm2["events"]["V_m"] ts2 = dmm2["events"]["times"] ''' Plot results ''' pylab.figure(1) pylab.plot(ts, Vms) pylab.figure(2) pylab.plot(ts2, Vms2) dSD = nest.GetStatus(spikedetector,keys='events')[0] evs = dSD["senders"] ts = dSD["times"] pylab.figure(3) pylab.plot(ts, evs, ".") pylab.show()
nmsutton/MemoryModule
python_version/archive/memory_module_all_types.py
Python
mit
2,677
import sys from os import path sys.path.append( path.dirname( path.dirname( path.abspath(__file__) ) ) ) import MySQLdb import pandas as pd from scraper import utility class kOptionRelatedTesting: def __init__(self, csvFileName): #parser = lambda date: pd.datetime.strptime(date, '%Y%m%d') self.df = pd.read_csv(csvFileName)#, parse_dates = [0], date_parser = parser, index_col = "Date") try: self.db = MySQLdb.connect(utility.databaseHost, utility.databaseUsername, utility.databasePassword, utility.databaseName, charset="utf8", use_unicode=True) except Exception as e: print "Error in kOptionRelatedTesting connecting MYSQLdb.py" def __call__(self): #self.plotOIGraphs() self.plotOIGraph2() def plotOIGraph2(self): ceOISQL = """ select date ,sum(OpenInterest) from %s where optiontype="%s" group by date """ %(utility.dbTableNameByOptionExpiry, "CE") peOISQL = """ select date ,sum(OpenInterest) from %s where optiontype="%s" group by date """ %(utility.dbTableNameByOptionExpiry, "PE") cursor = self.db.cursor() cursor.execute(ceOISQL) ceRows = cursor.fetchall() cursor.execute(peOISQL) peRows = cursor.fetchall() #print rows[0][0] oiSeries = [["Date", "CE OI", "PE OI", "Nifty"]] dates = [] if len(ceRows) != len(peRows): print "Error CE and PE Rows out of sync" return for i in range(len(ceRows)): dates.append(ceRows[i][0]) #oiSeries.append([utility.dateDecoding(ceRows[i][0]), int(ceRows[i][1]), int(peRows[i][1])]) spotValueSQL = """select date, close from %s where date >= %s and date <= %s """ %(utility.dbTableName, min(dates), max(dates)) cursor.execute(spotValueSQL) spotValue = cursor.fetchall() #print spotValue for i in range(len(ceRows)): #dates.append(ceRows[i][0]) oiSeries.append([utility.dateDecoding(ceRows[i][0]), int(ceRows[i][1]), int(peRows[i][1]), spotValue[i][1]]) print oiSeries cursor.close() def plotOIGraphs(self): groups = self.df.groupby(["Date", "OptionType"]).groups ceOISeries = [] peOISeries = [] for i in groups.iteritems(): oiSum = 0 for j in i[1]: #print groups[i][j] oiSum += self.df.iloc[j]["OpenInterest"] if i[0][1] == "CE": #print str(i[0][0]) + " ce " + str(oiSum) ceOISeries.append(oiSum) elif i[0][1] == "PE": #print str(i[0][0]) + " pe " + str(oiSum) peOISeries.append(oiSum) print ceOISeries print peOISeries
puchchi/stock_scraper_latest
MainDriver/OptionRelatedTesting.py
Python
mit
2,849
import os import xlrd import urllib import libxml2 from BeautifulSoup import BeautifulSoup def initialize(): print "Initializing" htmlDirectory = os.path.join(os.getcwd(), 'html') if not os.path.exists(htmlDirectory): os.makedirs(htmlDirectory) return htmlDirectory else: print "Directory %s already exists, please remove and try again" % (htmlDirectory) exit() def openSpreadsheetFile(): spreadsheetLocation = os.path.join(os.getcwd(), "course_template.xlsx") print "Opening spreadsheet located at %s " % (spreadsheetLocation) spreadsheet = xlrd.open_workbook(spreadsheetLocation) print "Spreadsheet opened successfully" return spreadsheet def getStyleConfiguration(firstSheet): headerLogoLeft = firstSheet.cell(0,1).value print "Header Logo Left %s " % (headerLogoLeft) headerLogoRight = firstSheet.cell(1,1).value print "Header Logo Right %s " % (headerLogoRight) ColourDark = firstSheet.cell(2,1).value print "Colour Dark %s " % (ColourDark) ColourLight = firstSheet.cell(3,1).value print "Colour Light %s " % (ColourLight) CourseCode = firstSheet.cell(4,1).value print "Course Code %s " % (CourseCode) CourseName = firstSheet.cell(5,1).value print "Course Name %s " % (CourseName) MicroCode = firstSheet.cell(6,1).value print "Micro Code %s " % (MicroCode) MicroName = firstSheet.cell(7,1).value print "Micro Name %s " % (MicroName) GradientFill = "( " + ColourDark + ", " + ColourLight + " )" styleConfiguration = {'headerLogoLeft' : headerLogoLeft, 'headerLogoRight' : headerLogoRight, 'ColourDark' : ColourDark, 'ColourLight' : ColourLight, 'CourseCode' : CourseCode, 'CourseName' : CourseName, 'MicroCode' : MicroCode, 'MicroName' : MicroName, 'GradientFill' : GradientFill} return styleConfiguration def getContent(secondSheet): print "Creating list" l = list() print "Creating dictionary" d = dict() print "Setting num to zero" num = 0 print "Iterating through worksheet" for row in secondSheet.col(1): num = num + 1 print "num = %d" % (num) l.append(row.value) if num == 3: print "num equals 3" print "Adding list to dictionary" d[row.value] = l print "Re-setting num to zero" num = 0 print "Emptying the list" l = list() return d def createCSS(htmlDirectory, styleConfiguration): print "HTML Directory %s " % (htmlDirectory) file2 = open(os.path.join(htmlDirectory, 'custom_oer.css'), 'w') ContainerString = """.container{ background-color:#efe9e5; background: -webkit-linear-gradient""" + styleConfiguration.get('GradientFill') + """!important; background: -o-linear-gradient""" + styleConfiguration.get('GradientFill') + """!important; background: -moz-linear-gradient""" + styleConfiguration.get('GradientFill') + """!important; background: linear-gradient""" + styleConfiguration.get('GradientFill') + """!important; border:1px solid #5b5b5b; border-top-width: 0px; -ms-box-shadow: 1px 4px 4px 0px #1E1E1E !important; -moz-box-shadow: 1px 4px 4px 0px #1E1E1E !important; -webkit-box-shadow: 1px 4px 4px 0px #1E1E1E !important; box-shadow: 1px 4px 4px 0px #1E1E1E !important; }""" HeaderString = """.header-oer{ background: #FFF!important; text-align: center!important; border:1px solid #5b5b5b!important; border-top-width: 0px!important; -ms-box-shadow: 3px 4px 6px 0px #1E1E1E !important; -moz-box-shadow: 3px 4px 6px 0px #1E1E1E !important; -webkit-box-shadow: 3px 4px 6px 0px #1E1E1E !important; box-shadow: 3px 4px 6px 0px #1E1E1E !important; }""" FooterString = """.footer-wrap { background-color: #000; min-height: 70px; color: #fff; padding-top: 20px; font-size: 12px; padding: 20px 10px; text-align: center; border-top-width: 2px!important; -ms-box-shadow: 3px 4px 6px 0px #1E1E1E !important; -moz-box-shadow: 3px 4px 6px 0px #1E1E1E !important; -webkit-box-shadow: 3px 4px 6px 0px #1E1E1E !important; box-shadow: 3px 4px 6px 0px #1E1E1E !important; } .footer-wrap p { line-height: 18px; text-align: center; padding-bottom: 10px; } .footer-wrap .right { text-align: center; padding-bottom: 20px; } .footer-wrap a { color: white; } @media (min-width: 766px) { .footer-wrap { text-align: center; padding-bottom: 0px; } .footer-wrap .right { float: right; text-align: center; padding-right: 10px; padding-left: 20px; } .footer-wrap p { line-height: 15px; text-align: center; padding-bottom: 0px; margin-bottom: 2px; } }""" OerImageString = """.image-oer { position: relative; display: block; max-width: 100%; left: 0; right: 0; bottom: 0; margin: auto; }""" OerGreen = """.green-oer > li > a { color : green!important; }""" file2.write(OerGreen) file2.write(OerImageString) file2.write(ContainerString) file2.write(HeaderString) file2.write(FooterString) print OerGreen print OerImageString print ContainerString print HeaderString print FooterString def fetchWikicontent(wikiUrl): response = urllib.urlopen(wikiUrl) html = response.read() soup = BeautifulSoup(html) cleanHtml = soup.prettify() doc = libxml2.parseDoc(cleanHtml) ctxt = doc.xpathNewContext() res = ctxt.xpathEval("//*[@id='bodyContent']/p") return res def createHtml(htmlDirectory, styleConfiguration, wikiContent, mediaUrl, pageName): print "HTML Directory %s " % (htmlDirectory) file = open(os.path.join(htmlDirectory, pageName + '.html'), 'w') #print type(wikiContent) #print wikiContent HtmlString = """<!DOCTYPE html> <html lang="en"> <head> <meta charset="utf-8"> <meta http-equiv="X-UA-Compatible" content="IE=edge"> <meta name="viewport" content="width=device-width, initial-scale=1"> <meta name="description" content=""> <meta name="author" content=""> <link rel="icon" href="../../favicon.ico"> <title>""" + pageName + """</title> <!-- Bootstrap core CSS --> <!-- Latest compiled and minified CSS --> <link rel="stylesheet" href="custom_oer.css"> <link rel="stylesheet" href="http://maxcdn.bootstrapcdn.com/bootstrap/3.2.0/css/bootstrap.min.css"> <!-- Optional theme --> <link rel="stylesheet" href="http://maxcdn.bootstrapcdn.com/bootstrap/3.2.0/css/bootstrap-theme.min.css"> <!-- Latest compiled and minified JavaScript --> <script src="http://maxcdn.bootstrapcdn.com/bootstrap/3.2.0/js/bootstrap.min.js"></script> <!-- Custom styles for this template --> <link href="http://getbootstrap.com/examples/justified-nav/justified-nav.css" rel="stylesheet"> <!-- Just for debugging purposes. Don't actually copy these 2 lines! --> <!--[if lt IE 9]><script src="http://getbootstrap.com/assets/js/ie-emulation-modes-warning.js"></script><![endif]--> <script src="http://getbootstrap.com/assets/js/ie-emulation-modes-warning.js"></script> <!-- IE10 viewport hack for Surface/desktop Windows 8 bug --> <script src="http://getbootstrap.com/assets/js/ie10-viewport-bug-workaround.js"></script> <!-- HTML5 shim and Respond.js IE8 support of HTML5 elements and media queries --> <!--[if lt IE 9]> <script src="https://oss.maxcdn.com/html5shiv/3.7.2/html5shiv.min.js"></script> <script src="https://oss.maxcdn.com/respond/1.4.2/respond.min.js"></script> <![endif]--> </head> <body> <div class="row header-oer"> <div class="col-md-4"><img src=""" + styleConfiguration.get('headerLogoLeft') + """ alt="OERu"/></div> <div class="col-md-4"><h2>""" + styleConfiguration.get('CourseCode') + """ </h2> <br /><b> """ + styleConfiguration.get('CourseName') + """</b></div> <div class="col-md-4"><img src='""" + styleConfiguration.get('headerLogoRight') + """' alt="OERu"/></div> </div> <div class="container"> <div class="masthead"> <ul class="nav nav-justified"> <li class="active"><a href="#"> """ + pageName + """</a></li> <li><a href="#">Projects</a></li> <li><a href="#">Services</a></li> <li><a href="#">Downloads</a></li> <li><a href="#">About</a></li> <li><a href="#">Contact</a></li> </ul> </div> <br /> <!-- Example row of columns --> <div class="row"> <div class="col-md-8"> <h2>""" + pageName + """</h2> <p> """ + str(wikiContent) + """</p> </div> <div class="col-md-4"> <img class='image-oer' src=' """ + mediaUrl + """ '</div> </div> <br /> </div> <br /> </div> <!-- /container --> <!-- Site footer --> <div class="row"> <div class="col-md-1"></div> <div class="col-md-10"> <div class="footer-wrap" style="text-align: center;"> <p>#TODO ABN: 40 234 732 081 | CRICOS: QLD 00244B<span class="line-break">, </span> NSW 02225M | TEQSA: PRV12081<span class="line-break"> | </span> <a href="#">Disclaimer</a><span class="line-break"> | <a href="#">Contact us</a></p> <p>University of Southern Queensland<span class="line-break"></span> #TODO</p> </div> </div> <div class="col-md-1"></div> </div> <!-- Bootstrap core JavaScript ================================================== --> <!-- Placed at the end of the document so the pages load faster --> </body> </html>""" file.write(HtmlString) file.close()
tpmccallum/web-site-creator
oer_modules.py
Python
mit
8,998
import urllib.parse import requests import time import json import os from bs4 import BeautifulSoup def search_momo(query): query_enc = urllib.parse.quote(query) url = "https://m.momoshop.com.tw/mosearch/" + query_enc + ".html" headers = {'User-Agent': 'mozilla/5.0 (Linux; Android 6.0.1; ' 'Nexus 5x build/mtc19t applewebkit/537.36 (KHTML, like Gecko) ' 'Chrome/51.0.2702.81 Mobile Safari/537.36'} resp = requests.get(url, headers=headers) if not resp: return [] resp.encoding = 'utf-8' soup = BeautifulSoup(resp.text, 'html.parser') items = [] for elem in soup.find_all("li", "goodsItemLi"): item_name = elem.find("h3", "prdName").text.strip() item_price = elem.find("b", {"class": "price"}).text.strip() if not item_price: continue item_url = 'http://m.momoshop.com.tw' + elem.find('a')['href'] item_img_url = elem.a.div.find_all("img")[-1]['src'] item = { 'name': item_name, 'price': item_price, 'url': item_url, 'img_url': item_img_url, } items.append(item) return items if __name__ == '__main__': query = 'iphone 13 pro' items = search_momo(query) today = time.strftime('%Y-%m-%d') print('%s 搜尋 %s 共 %d 筆資料' % (today, query, len(items))) for i in items: print(i) data = { 'date': today, 'store': 'momo', 'items': items } with open(os.path.join('json', today + '-momo.json'), 'w', encoding='utf-8') as f: json.dump(data, f, indent=2, ensure_ascii=False)
jwlin/web-crawler-tutorial
ch7/search_momo.py
Python
mit
1,677
from __future__ import absolute_import from .Errors import error, message from . import ExprNodes from . import Nodes from . import Builtin from . import PyrexTypes from .. import Utils from .PyrexTypes import py_object_type, unspecified_type from .Visitor import CythonTransform, EnvTransform class TypedExprNode(ExprNodes.ExprNode): # Used for declaring assignments of a specified type without a known entry. def __init__(self, type): self.type = type object_expr = TypedExprNode(py_object_type) class MarkParallelAssignments(EnvTransform): # Collects assignments inside parallel blocks prange, with parallel. # Perhaps it's better to move it to ControlFlowAnalysis. # tells us whether we're in a normal loop in_loop = False parallel_errors = False def __init__(self, context): # Track the parallel block scopes (with parallel, for i in prange()) self.parallel_block_stack = [] super(MarkParallelAssignments, self).__init__(context) def mark_assignment(self, lhs, rhs, inplace_op=None): if isinstance(lhs, (ExprNodes.NameNode, Nodes.PyArgDeclNode)): if lhs.entry is None: # TODO: This shouldn't happen... return if self.parallel_block_stack: parallel_node = self.parallel_block_stack[-1] previous_assignment = parallel_node.assignments.get(lhs.entry) # If there was a previous assignment to the variable, keep the # previous assignment position if previous_assignment: pos, previous_inplace_op = previous_assignment if (inplace_op and previous_inplace_op and inplace_op != previous_inplace_op): # x += y; x *= y t = (inplace_op, previous_inplace_op) error(lhs.pos, "Reduction operator '%s' is inconsistent " "with previous reduction operator '%s'" % t) else: pos = lhs.pos parallel_node.assignments[lhs.entry] = (pos, inplace_op) parallel_node.assigned_nodes.append(lhs) elif isinstance(lhs, ExprNodes.SequenceNode): for arg in lhs.args: self.mark_assignment(arg, object_expr) else: # Could use this info to infer cdef class attributes... pass def visit_WithTargetAssignmentStatNode(self, node): self.mark_assignment(node.lhs, node.rhs) self.visitchildren(node) return node def visit_SingleAssignmentNode(self, node): self.mark_assignment(node.lhs, node.rhs) self.visitchildren(node) return node def visit_CascadedAssignmentNode(self, node): for lhs in node.lhs_list: self.mark_assignment(lhs, node.rhs) self.visitchildren(node) return node def visit_InPlaceAssignmentNode(self, node): self.mark_assignment(node.lhs, node.create_binop_node(), node.operator) self.visitchildren(node) return node def visit_ForInStatNode(self, node): # TODO: Remove redundancy with range optimization... is_special = False sequence = node.iterator.sequence target = node.target if isinstance(sequence, ExprNodes.SimpleCallNode): function = sequence.function if sequence.self is None and function.is_name: entry = self.current_env().lookup(function.name) if not entry or entry.is_builtin: if function.name == 'reversed' and len(sequence.args) == 1: sequence = sequence.args[0] elif function.name == 'enumerate' and len(sequence.args) == 1: if target.is_sequence_constructor and len(target.args) == 2: iterator = sequence.args[0] if iterator.is_name: iterator_type = iterator.infer_type(self.current_env()) if iterator_type.is_builtin_type: # assume that builtin types have a length within Py_ssize_t self.mark_assignment( target.args[0], ExprNodes.IntNode(target.pos, value='PY_SSIZE_T_MAX', type=PyrexTypes.c_py_ssize_t_type)) target = target.args[1] sequence = sequence.args[0] if isinstance(sequence, ExprNodes.SimpleCallNode): function = sequence.function if sequence.self is None and function.is_name: entry = self.current_env().lookup(function.name) if not entry or entry.is_builtin: if function.name in ('range', 'xrange'): is_special = True for arg in sequence.args[:2]: self.mark_assignment(target, arg) if len(sequence.args) > 2: self.mark_assignment( target, ExprNodes.binop_node(node.pos, '+', sequence.args[0], sequence.args[2])) if not is_special: # A for-loop basically translates to subsequent calls to # __getitem__(), so using an IndexNode here allows us to # naturally infer the base type of pointers, C arrays, # Python strings, etc., while correctly falling back to an # object type when the base type cannot be handled. self.mark_assignment(target, ExprNodes.IndexNode( node.pos, base=sequence, index=ExprNodes.IntNode(target.pos, value='PY_SSIZE_T_MAX', type=PyrexTypes.c_py_ssize_t_type))) self.visitchildren(node) return node def visit_ForFromStatNode(self, node): self.mark_assignment(node.target, node.bound1) if node.step is not None: self.mark_assignment(node.target, ExprNodes.binop_node(node.pos, '+', node.bound1, node.step)) self.visitchildren(node) return node def visit_WhileStatNode(self, node): self.visitchildren(node) return node def visit_ExceptClauseNode(self, node): if node.target is not None: self.mark_assignment(node.target, object_expr) self.visitchildren(node) return node def visit_FromCImportStatNode(self, node): pass # Can't be assigned to... def visit_FromImportStatNode(self, node): for name, target in node.items: if name != "*": self.mark_assignment(target, object_expr) self.visitchildren(node) return node def visit_DefNode(self, node): # use fake expressions with the right result type if node.star_arg: self.mark_assignment( node.star_arg, TypedExprNode(Builtin.tuple_type)) if node.starstar_arg: self.mark_assignment( node.starstar_arg, TypedExprNode(Builtin.dict_type)) EnvTransform.visit_FuncDefNode(self, node) return node def visit_DelStatNode(self, node): for arg in node.args: self.mark_assignment(arg, arg) self.visitchildren(node) return node def visit_ParallelStatNode(self, node): if self.parallel_block_stack: node.parent = self.parallel_block_stack[-1] else: node.parent = None nested = False if node.is_prange: if not node.parent: node.is_parallel = True else: node.is_parallel = (node.parent.is_prange or not node.parent.is_parallel) nested = node.parent.is_prange else: node.is_parallel = True # Note: nested with parallel() blocks are handled by # ParallelRangeTransform! # nested = node.parent nested = node.parent and node.parent.is_prange self.parallel_block_stack.append(node) nested = nested or len(self.parallel_block_stack) > 2 if not self.parallel_errors and nested and not node.is_prange: error(node.pos, "Only prange() may be nested") self.parallel_errors = True if node.is_prange: child_attrs = node.child_attrs node.child_attrs = ['body', 'target', 'args'] self.visitchildren(node) node.child_attrs = child_attrs self.parallel_block_stack.pop() if node.else_clause: node.else_clause = self.visit(node.else_clause) else: self.visitchildren(node) self.parallel_block_stack.pop() self.parallel_errors = False return node def visit_YieldExprNode(self, node): if self.parallel_block_stack: error(node.pos, "Yield not allowed in parallel sections") return node def visit_ReturnStatNode(self, node): node.in_parallel = bool(self.parallel_block_stack) return node class MarkOverflowingArithmetic(CythonTransform): # It may be possible to integrate this with the above for # performance improvements (though likely not worth it). might_overflow = False def __call__(self, root): self.env_stack = [] self.env = root.scope return super(MarkOverflowingArithmetic, self).__call__(root) def visit_safe_node(self, node): self.might_overflow, saved = False, self.might_overflow self.visitchildren(node) self.might_overflow = saved return node def visit_neutral_node(self, node): self.visitchildren(node) return node def visit_dangerous_node(self, node): self.might_overflow, saved = True, self.might_overflow self.visitchildren(node) self.might_overflow = saved return node def visit_FuncDefNode(self, node): self.env_stack.append(self.env) self.env = node.local_scope self.visit_safe_node(node) self.env = self.env_stack.pop() return node def visit_NameNode(self, node): if self.might_overflow: entry = node.entry or self.env.lookup(node.name) if entry: entry.might_overflow = True return node def visit_BinopNode(self, node): if node.operator in '&|^': return self.visit_neutral_node(node) else: return self.visit_dangerous_node(node) visit_UnopNode = visit_neutral_node visit_UnaryMinusNode = visit_dangerous_node visit_InPlaceAssignmentNode = visit_dangerous_node visit_Node = visit_safe_node def visit_assignment(self, lhs, rhs): if (isinstance(rhs, ExprNodes.IntNode) and isinstance(lhs, ExprNodes.NameNode) and Utils.long_literal(rhs.value)): entry = lhs.entry or self.env.lookup(lhs.name) if entry: entry.might_overflow = True def visit_SingleAssignmentNode(self, node): self.visit_assignment(node.lhs, node.rhs) self.visitchildren(node) return node def visit_CascadedAssignmentNode(self, node): for lhs in node.lhs_list: self.visit_assignment(lhs, node.rhs) self.visitchildren(node) return node class PyObjectTypeInferer(object): """ If it's not declared, it's a PyObject. """ def infer_types(self, scope): """ Given a dict of entries, map all unspecified types to a specified type. """ for name, entry in scope.entries.items(): if entry.type is unspecified_type: entry.type = py_object_type class SimpleAssignmentTypeInferer(object): """ Very basic type inference. Note: in order to support cross-closure type inference, this must be applies to nested scopes in top-down order. """ def set_entry_type(self, entry, entry_type): entry.type = entry_type for e in entry.all_entries(): e.type = entry_type def infer_types(self, scope): enabled = scope.directives['infer_types'] verbose = scope.directives['infer_types.verbose'] if enabled == True: spanning_type = aggressive_spanning_type elif enabled is None: # safe mode spanning_type = safe_spanning_type else: for entry in scope.entries.values(): if entry.type is unspecified_type: self.set_entry_type(entry, py_object_type) return # Set of assignemnts assignments = set() assmts_resolved = set() dependencies = {} assmt_to_names = {} for name, entry in scope.entries.items(): for assmt in entry.cf_assignments: names = assmt.type_dependencies() assmt_to_names[assmt] = names assmts = set() for node in names: assmts.update(node.cf_state) dependencies[assmt] = assmts if entry.type is unspecified_type: assignments.update(entry.cf_assignments) else: assmts_resolved.update(entry.cf_assignments) def infer_name_node_type(node): types = [assmt.inferred_type for assmt in node.cf_state] if not types: node_type = py_object_type else: entry = node.entry node_type = spanning_type( types, entry.might_overflow, entry.pos) node.inferred_type = node_type def infer_name_node_type_partial(node): types = [assmt.inferred_type for assmt in node.cf_state if assmt.inferred_type is not None] if not types: return entry = node.entry return spanning_type(types, entry.might_overflow, entry.pos) def resolve_assignments(assignments): resolved = set() for assmt in assignments: deps = dependencies[assmt] # All assignments are resolved if assmts_resolved.issuperset(deps): for node in assmt_to_names[assmt]: infer_name_node_type(node) # Resolve assmt inferred_type = assmt.infer_type() assmts_resolved.add(assmt) resolved.add(assmt) assignments.difference_update(resolved) return resolved def partial_infer(assmt): partial_types = [] for node in assmt_to_names[assmt]: partial_type = infer_name_node_type_partial(node) if partial_type is None: return False partial_types.append((node, partial_type)) for node, partial_type in partial_types: node.inferred_type = partial_type assmt.infer_type() return True partial_assmts = set() def resolve_partial(assignments): # try to handle circular references partials = set() for assmt in assignments: if assmt in partial_assmts: continue if partial_infer(assmt): partials.add(assmt) assmts_resolved.add(assmt) partial_assmts.update(partials) return partials # Infer assignments while True: if not resolve_assignments(assignments): if not resolve_partial(assignments): break inferred = set() # First pass for entry in scope.entries.values(): if entry.type is not unspecified_type: continue entry_type = py_object_type if assmts_resolved.issuperset(entry.cf_assignments): types = [assmt.inferred_type for assmt in entry.cf_assignments] if types and all(types): entry_type = spanning_type( types, entry.might_overflow, entry.pos) inferred.add(entry) self.set_entry_type(entry, entry_type) def reinfer(): dirty = False for entry in inferred: types = [assmt.infer_type() for assmt in entry.cf_assignments] new_type = spanning_type(types, entry.might_overflow, entry.pos) if new_type != entry.type: self.set_entry_type(entry, new_type) dirty = True return dirty # types propagation while reinfer(): pass if verbose: for entry in inferred: message(entry.pos, "inferred '%s' to be of type '%s'" % ( entry.name, entry.type)) def find_spanning_type(type1, type2): if type1 is type2: result_type = type1 elif type1 is PyrexTypes.c_bint_type or type2 is PyrexTypes.c_bint_type: # type inference can break the coercion back to a Python bool # if it returns an arbitrary int type here return py_object_type else: result_type = PyrexTypes.spanning_type(type1, type2) if result_type in (PyrexTypes.c_double_type, PyrexTypes.c_float_type, Builtin.float_type): # Python's float type is just a C double, so it's safe to # use the C type instead return PyrexTypes.c_double_type return result_type def aggressive_spanning_type(types, might_overflow, pos): result_type = reduce(find_spanning_type, types) if result_type.is_reference: result_type = result_type.ref_base_type if result_type.is_const: result_type = result_type.const_base_type if result_type.is_cpp_class: result_type.check_nullary_constructor(pos) return result_type def safe_spanning_type(types, might_overflow, pos): result_type = reduce(find_spanning_type, types) if result_type.is_const: result_type = result_type.const_base_type if result_type.is_reference: result_type = result_type.ref_base_type if result_type.is_cpp_class: result_type.check_nullary_constructor(pos) if result_type.is_pyobject: # In theory, any specific Python type is always safe to # infer. However, inferring str can cause some existing code # to break, since we are also now much more strict about # coercion from str to char *. See trac #553. if result_type.name == 'str': return py_object_type else: return result_type elif result_type is PyrexTypes.c_double_type: # Python's float type is just a C double, so it's safe to use # the C type instead return result_type elif result_type is PyrexTypes.c_bint_type: # find_spanning_type() only returns 'bint' for clean boolean # operations without other int types, so this is safe, too return result_type elif result_type.is_ptr: # Any pointer except (signed|unsigned|) char* can't implicitly # become a PyObject, and inferring char* is now accepted, too. return result_type elif result_type.is_cpp_class: # These can't implicitly become Python objects either. return result_type elif result_type.is_struct: # Though we have struct -> object for some structs, this is uncommonly # used, won't arise in pure Python, and there shouldn't be side # effects, so I'm declaring this safe. return result_type # TODO: double complex should be OK as well, but we need # to make sure everything is supported. elif (result_type.is_int or result_type.is_enum) and not might_overflow: return result_type return py_object_type def get_type_inferer(): return SimpleAssignmentTypeInferer()
thedrow/cython
Cython/Compiler/TypeInference.py
Python
apache-2.0
20,789
#!/usr/bin/env python # -*- coding: utf-8 -*- ############################################################### # GXMAIL - COMMAND LINE SMTP USER AGENT ############################################################### # # gxmail.py # # Copyright 2014 GaboXandre <[email protected]> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, # MA 02110-1301, USA. # # import smtplib import sys import os import argparse import simplejson as json def settings_mode(): print 'gxmail v%s Settings' %(AppInfo['Version']) ###################################################### # 0. Menu - will repeat until loop is false ###################################################### loop = True while loop is True: print '-'*80 print ' 1 - View profiles' print ' 2 - Add new profile' print ' 3 - Delete existing profile' print ' 0 - Exit' print '-'*80 MenuOption = raw_input('Enter a selection -> ') if MenuOption == '1': print 'Installed Profiles:' f = [] for (dirpath, dirnames, filenames) in os.walk(FileLocations['ProfileDir']): f.extend(filenames) break cntr = 0 length = len(f) while cntr < length: print str(cntr)+' - '+f[cntr] cntr += 1 raw_input('Press ENTER to continue') elif MenuOption == '2': print "Let's create a new profile: " prof_name = raw_input('Profile Name -> ') server = raw_input('Server -> ') port = raw_input('Port -> ') email = raw_input('Your email -> ') password = raw_input('Your password -> ') defprofile = [prof_name] defprofile.append(server) defprofile.append(port) defprofile.append(email) defprofile.append(password) create_profile(defprofile) elif MenuOption == '3': print ' 3 - Delete existing profile' delete = raw_input('Enter profile name to delete -> ') fullpath = FileLocations['ProfileDir']+delete try: os.remove(fullpath) print 'Done, the profile at "%s" has been deleted.' %(fullpath) raw_input('Press ENTER to continue') except Exception: print 'Opps, the profile at "%s" could not be deleted. Sorry' %(fullpath) raw_input('Press ENTER to continue') elif MenuOption == '0': loop = False else: print 'Sorry, %s is not a valid option.' %(str(MenuOption)) def initialize_smtp_server(arguments): server = arguments[0][1] port = arguments[0][2] email = arguments[0][3] password = arguments[0][4] smtpserver = smtplib.SMTP(server, port) smtpserver.ehlo() smtpserver.starttls() smtpserver.ehlo() smtpserver.login(email, password) return smtpserver def send_mail(arguments): print 'Sending email ... ' ###################################################### # 1. Common Variables ###################################################### to_email = arguments[1] from_email = arguments[0][3] subject = arguments[2] mime_type = arguments[4] xmailer = AppInfo['AppName']+'-v'+AppInfo['Version'] attachment = str(arguments[5]) ###################################################### # 2. Extract message from file ###################################################### file_name = arguments[3] #args.message the_file = open(file_name) msg = the_file.read() the_file.close() ###################################################### # 3a. Prepare email without attachment ###################################################### if attachment == 'None': # parse message from text file header = "To:%s\nFrom:%s\nSubject:%s\nX-Mailer: %s\nContent-type: %s\n " % (to_email, from_email, subject, xmailer, mime_type) content = header + "\n" + msg ###################################################### # 3b. Prepare email with attachment ###################################################### else: marker = '2325769521' # prepare attachment attachment_name = arguments[5] extract = open(attachment_name, 'r') encoded_attachment = extract.read() #Main Header header = "To:%s\nFrom:%s\nMIME-Version: 1.0\nX-Mailer: %s\nSubject:%s\nContent-Type: multipart/mixed; boundary=%s\n--%s\nContent-type: %s\nContent-Transfer-Encoding:8bit\n" % (to_email, from_email, xmailer, subject, marker, marker, mime_type) after_body = '--%s' %(marker) # attachment header attachment_header = "Content-Type: text/plain; name=\"%s\"\nContent-Disposition: attachment; filename=%s\n%s\n--%s--" %(attachment_name, attachment_name, encoded_attachment, marker) content = header + "\n" + msg +"\n"+after_body+'\n'+attachment_header ###################################################### # 4. Send email ###################################################### try: smtpserver = initialize_smtp_server(arguments) smtpserver.sendmail(from_email, to_email, content) smtpserver.close() print 'e-mail sent successfully to '+str(to_email) print '='*80 except Exception: print 'Opps, the email could not be sent.' print '='*80 def batch_mode(arguments): print 'you are now in batch mode...' ##########DEBUG ############################################ # 0. Prepare arguments ############################################ mime_type = arguments[4] if mime_type is True: arguments[4] = 'text/html' else: arguments[4] = 'text/plain' ############################################ # 1. Get the file with emails ############################################ batch_file_path = str(arguments[7]) batch_file = open(os.path.expanduser(batch_file_path)) ############################################ # 2. Itirate file to make the list ############################################ mail_list = [] with batch_file as f: for line in f: x = line.rstrip( ) mail_list.append(x) batch_file.close() ############################################ # 3. Iterate list and send emails ############################################ length = len(mail_list) cntr = 0 while cntr < length: arguments[1] = mail_list[cntr] send_mail(arguments) #print 'email sent to: '+str(mail_list[cntr]) #print '-'*80 cntr += 1 def interactive_mode(): print '-'*80 print 'Interactive Mode' print '-'*80 ############################################ # 0. Start the list with no values ############################################ global arguments arguments = [] print arguments ############################################ # 1. Get main input ############################################ p = raw_input('Profile (default): ') if p == '': arguments.append('None') else: arguments.append(str(p)) h = raw_input('MIME (text or html): ') if h == 'html': h = 'text/html' else: h = 'text/plain' t = raw_input('To: ') s = raw_input('Subject: ') # write the body with text editor print 'Choose your editor:' print '(v) for Vi' print '(n) for Nano' e = raw_input('editor -> ') if e == 'v': text = os.system('vi ~/.email-body') else: text = os.system('nano ~/.email-body') m = os.path.expanduser('~/.email-body') ############################################ # 2. Start the list # [0-profile, 1-to, 2-subject, 3-message, 4-text/html, 5-attachment, 6-interactive, 7-batch, 8-version ] ############################################ arguments.append(str(t)) arguments.append(str(s)) arguments.append(os.path.expanduser(m)) arguments.append(h) ############################################ # 3. Attachment? ############################################ question = raw_input('Include attachment?(y/n)-> ') if question == 'y': a = raw_input('Attachment: ') a = os.path.expanduser(a) arguments.append(os.path.expanduser(a)) else: a = 'None' arguments.append(str(a)) ############################################ # 3. Get profile info # Note this seciton is copy paste from select_profile # Shame on me !!!!! ############################################ profile = str(arguments[0]) if profile == 'None': profile_name = 'default' else: profile_name = profile profile_location = FileLocations['ProfileDir']+profile_name # load profile info myfile = open(profile_location) myfile2 = myfile.read() profile = json.loads(myfile2) arguments[0] = profile ############################################ # 3. Send email ############################################ arguments.append(False) arguments.append('None') arguments.append(False) send_mail(arguments) # Remove the temporary file os.system('rm ~/.email-body') def test_options(arguments): ###################################################### # Select Profile ###################################################### profile = str(arguments[0]) if profile == 'None': profile_name = 'default' else: profile_name = profile profile_location = FileLocations['ProfileDir']+profile_name # load profile info myfile = open(profile_location) myfile2 = myfile.read() profile = json.loads(myfile2) arguments[0] = profile ############################################ # 1. Check general options # a. version # b. interactive # c. batch ############################################ version = arguments[8] interactive = arguments[6] batch = str(arguments[7]) settings = arguments[9] if version is True: version_info = AppInfo['AppName']+'-v'+AppInfo['Version'] print version_info quit() # once version is ruled out comes the welcome to the program. print '='*80 print 'gxmail - version %s' %(AppInfo['Version']) print '='*80 if batch != 'None': batch_mode(arguments) quit() if interactive is True: interactive_mode() quit() if settings is True: settings_mode() quit() ###################################################### # 2. Check email option and pass them to send_email() # 1. to # 2. subject # 3. message # 4. type: text or html # 5. attachment #### should t be here? ###################################################### to = str(arguments[1]) subject = str(arguments[2]) message = str(arguments[3]) mime_type = arguments[4] attachment = str(arguments[5]) switch = 'ON' # test that all mandatory arguments are included if to == 'None': switch = 'OFF' if subject == 'None': switch = 'OFF' if message == 'None': switch = 'OFF' if switch == 'OFF': print 'Sorry, information is missing...\nUse flag -h or --help \nAlso, you may use interactive mode with flag -i or --interactive.' quit() #switch == 'ON', so we continue testing... if mime_type is True: arguments[4] = 'text/html' else: arguments[4] = 'text/plain' ###################################################### # 3. READY TO SEND EMAIL ###################################################### send_mail(arguments) def create_profile(defprofile): try: default_file = FileLocations['ProfileDir']+'/'+str(defprofile[0]) default = open(default_file, 'w') default.write(json.dumps(defprofile)) default.close() res = 'You are ready to send emails with your new profile!' print res quit() except Exception: print 'Error: Default profile could not be created. Sorry.' quit() def test_profiles(): f = [] for (dirpath, dirnames, filenames) in os.walk(FileLocations['ProfileDir']): f.extend(filenames) break length = len(f) if length == 0: os.mkdir(FileLocations['ProfileDir']) print '-'*80 print "You don't have a profile set up yet. Let's do it now!" print '-'*80 server = raw_input('Server -> ') port = raw_input('Port -> ') email = raw_input('Your email -> ') password = raw_input('Your password -> ') defprofile = ['default'] defprofile.append(server) defprofile.append(port) defprofile.append(email) defprofile.append(password) setup = create_profile(defprofile) def main(): global AppInfo global FileLocations global arguments AppInfo = { 'AppName' : 'gxmail', 'Version' : '1.2.1', 'Author' : 'GaboXandre', 'License' : 'GPL3', 'copyright' : '2014 GaboXandre' } FileLocations = { 'ProfileDir' : os.path.expanduser('~/.gxmail/')} # Command Line Arguments parser = argparse.ArgumentParser(description='%s is a simple text smpt client to send email from the command line. Very useful for scripts. If called without parameters, it starts in interactive mode.' %(AppInfo['AppName'])) parser.add_argument('-p', '--profile', help='Select profile to be used.', required=False) parser.add_argument('-to', help='Receipient. You may include several email addresses separating them with a comma. DO NOT use spaces', required=False) parser.add_argument('-s', '--subject', help='subject line.', required=False) parser.add_argument('-m', '--message', help='Import email body from text file.', required=False) parser.add_argument('-b', '--batch', help='Batch mode: get recepients from a text file.', required=False) parser.add_argument('-html', '--html', help='HTML mode: send html formated content.', required=False, action="store_true") parser.add_argument('-v', '--version', help='Prints version and exits program.', required=False, action="store_true") parser.add_argument('-i', '--interactive', help='Runs in interactive mode.', required=False, action="store_true") parser.add_argument('-set', '--settings', help='Access your profile settings.', required=False, action="store_true") parser.add_argument('-a', '--attachment', help='Send file attachment.', required=False) args = parser.parse_args() # list format: # [0-profile, 1-to, 2-subject, 3-message, 4-text/html, 5-attachment, 6-interactive, 7-batch, 8-version, 9-settings ] arguments = [args.profile, args.to, args.subject, args.message, args.html, args.attachment, args.interactive, args.batch, args.version, args.settings] return arguments if __name__ == '__main__': main() test_profiles() test_options(arguments)
GaboXandre/gxmail
gxmail.py
Python
gpl-3.0
14,299
from concert.devices.samplechangers.dummy import SampleChanger from concert.tests import TestCase class TestSampleChanger(TestCase): def setUp(self): super(TestSampleChanger, self).setUp() self.samplechanger = SampleChanger() def test_set_sample(self): self.samplechanger.sample = None self.assertEqual(None, self.samplechanger.sample)
ufo-kit/concert
concert/tests/unit/devices/test_samplechanger.py
Python
lgpl-3.0
380
# -*- coding: utf-8 -*- """ *************************************************************************** r_mapcalc.py ------------ Date : February 2016 Copyright : (C) 2016 by Médéric Ribreux Email : medspx at medspx dot fr *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * *************************************************************************** """ __author__ = 'Médéric Ribreux' __date__ = 'February 2016' __copyright__ = '(C) 2016, Médéric Ribreux' # This will get replaced with a git SHA1 when you do a git archive __revision__ = '$Format:%H$' import os def checkParameterValuesBeforeExecuting(alg, parameters, context): """ Verify if we have the right parameters """ if (alg.parameterAsString(parameters, 'expression', context) and alg.parameterAsString(parameters, 'file', context)): return False, alg.tr("You need to set either inline expression or a rules file!") return True, None def processInputs(alg, parameters, context, feedback): # We will use the same raster names than in QGIS to name the rasters in GRASS rasters = alg.parameterAsLayerList(parameters, 'maps', context) for idx, raster in enumerate(rasters): rasterName = os.path.splitext( os.path.basename(raster.source()))[0] alg.inputLayers.append(raster) alg.setSessionProjectionFromLayer(raster) command = 'r.in.gdal input="{0}" output="{1}" --overwrite -o'.format( os.path.normpath(raster.source()), rasterName) alg.commands.append(command) alg.removeParameter('maps') alg.postInputs() def processCommand(alg, parameters, context, feedback): alg.processCommand(parameters, context, feedback, True) def processOutputs(alg, parameters, context, feedback): # We need to export every raster from the GRASSDB alg.exportRasterLayersIntoDirectory('output_dir', parameters, context, wholeDB=True)
dwadler/QGIS
python/plugins/processing/algs/grass7/ext/r_mapcalc.py
Python
gpl-2.0
2,550
from . import func from .Var import var class NodeBranchPart(object): def __init__(self): self.rMatrixNum = -1 self.gdasrvNum = -1 #self.bigP = None class NodeBranch(object): def __init__(self): self.len = 0.1 #self.textDrawSymbol = '-' # See var.modelSymbols for some alternative symbols self.rawSplitKey = None # Odd or even self.splitKey = None # Only even #self.name = None #self.uName = None # under-name #self.color = None # US spelling. #self.support = None # A float, so that it can preserve all its significant # digits, yet can be formatted flexibly for output. #self.biRootCount = None # For cons trees, where the input trees are # bi-Rooted, ie have bifurcating roots. This # is the number of compatible input trees that # were rooted on this branch. self.parts = [] # NodeBranchPart() objects self.lenChanged = False class NodePart(object): def __init__(self): #self.pats = None #self.nPats = 0 self.compNum = -1 #self.cl = None #self.cl2 = None class Node(object): """A Node is a vertex in a Tree. All but the root have a branch. A Node has pointers to its parent, leftChild, and sibling, any of which may be None. """ def __init__(self): self.name = None self.nodeNum = -1 self.parent = None self.leftChild = None self.sibling = None self.isLeaf = 0 self.cNode = None # Pointer to a c-struct self.seqNum = -1 # Zero-based seq numbering of course, so -1 means no sequence. self.br = NodeBranch() #self.rootCount = None # For cons trees, where the input trees do not # have bifurcating roots. This is the number of # compatible input trees that were rooted on this node. self.parts = [] # NodePart objects self.doDataPart = 0 self.flag = 0 ##Ignore def wipe(self): """Set the pointers parent, leftChild, and sibling to None""" self.parent = None self.leftChild = None self.sibling = None def rightmostChild(self): """Find and return the rightmostChild of self. If self has no children, return None. """ n = self.leftChild if not n: return None while n.sibling: n = n.sibling return n def leftSibling(self): """Find and return the sibling on the left. A node has a pointer to its sibling, but that is the sibling on the right. It is a bit awkward to find the sibling on the left, as you need to go via the parent and the leftChild of the parent. If there is no parent, return None. If there is no leftSibling, return None. """ if not self.parent: #print 'leftSibling(%i). No parent. returning None.' % self.nodeNum return None lsib = self.parent.leftChild if lsib == self: #print 'leftSibling(%i). self is self.parent.leftChild. returning None.' % self.nodeNum return None while lsib: if lsib.sibling == self: #print 'leftSibling(%i): returning node %i' % (self.nodeNum, lsib.nodeNum) return lsib lsib = lsib.sibling # These next 3 were suggestions from Rick Ree. Thanks, Rick! # Then I added a couple more. Note that all of these use # recursion, and so could bump into the recursion limit, and might # fail on large trees. However, I tried iterPreOrder() on a # random tree of 10,000 taxa, and it was fine. # You can temporarily set a different recursion limit with the sys module. # oldlimit = sys.getrecursionlimit() # sys.setrecursionlimit(newLimit) # See also Tree.iterNodesNoRoot() def iterChildren(self): n = self.leftChild while n: yield n n = n.sibling def iterPostOrder(self): for c in self.iterChildren(): for n in c.iterPostOrder(): yield n yield self def iterPreOrder(self): yield self for c in self.iterChildren(): for n in c.iterPreOrder(): yield n def iterLeaves(self): for n in self.iterPreOrder(): if n.isLeaf: yield n def iterInternals(self): for n in self.iterPreOrder(): if not n.isLeaf: yield n def iterDown(self, showDown=False): """Iterates over all the nodes below self (including self) Starts by returning self. And then iterates over all nodes below self. It does so by a combination of Node.iterPreOrder() and Node.iterDown() (ie recursively). Now sometimes we want to know if the nodes that are returned come from iterDown() (strictly) or not (ie from iterPreOrder()). If that bit of info is needed, then you can turn on the arg ``showDown``. (The following is probably bad Python practice!) When that is done, whenever iterDown() is called the first node that is returned will have the attribute ``down`` set to True. But after it is returned, that ``down`` attribute is zapped (to try to keep the bloat down ...). So you need to test ``if hasattr(yourNode, 'down'):`` before you actually use it. """ if showDown: self.down = True yield self if showDown: del(self.down) if self.parent: for c in self.parent.iterChildren(): if c == self: for n in c.parent.iterDown(showDown): yield n else: for n in c.iterPreOrder(): yield n # ############################### def getNChildren(self): """Returns the number of children that the node has.""" if not self.leftChild: return 0 c = self.leftChild counter = 0 while c: c = c.sibling counter += 1 return counter def isAncestorOf(self, otherNode): """Asks whether self is an an ancestor of otherNode.""" n = otherNode while 1: n = n.parent if not n: return False elif n == self: return True def _ladderize(self, biggerGroupsOnBottom): """This is only used by Tree.ladderize().""" #print '====Node %i' % self.nodeNum if not self.leftChild: pass else: nLeaves = [] children = [] ch = self.leftChild while ch: nL = len([n2 for n2 in ch.iterLeaves()]) nLeaves.append(nL) ch.nLeaves = nL children.append(ch) ch = ch.sibling #print ' nLeaves = %s' % nLeaves allOnes = True for ch in children: if ch.nLeaves > 1: allOnes = False break if not allOnes: children = func.sortListOfObjectsOnAttribute(children, 'nLeaves') if not biggerGroupsOnBottom: children.reverse() #print '\n Children\n ------------' #for ch in children: # print ' node=%i, nLeaves=%i' % (ch.nodeNum, ch.nLeaves) self.leftChild = children[0] theLeftChild = self.leftChild theLeftChild.sibling = None for ch in children[1:]: theLeftChild.sibling = ch theLeftChild = ch theLeftChild.sibling = None for ch in children: del(ch.nLeaves) for ch in self.iterChildren(): ch._ladderize(biggerGroupsOnBottom) if var.usePfAndNumpy: import sys import pf #def __del__(self, freeNode=pf.p4_freeNode, dp_freeNode=pf.dp_freeNode, mysys=sys): def __del__(self, freeNode=pf.p4_freeNode, mysys=sys): #def __del__(self, freeNode=pf.p4_freeNode, dp_freeNode=pf.dp_freeNode): #def __del__(self, freeNode=pf.p4_freeNode): #if self.nodeNum == 0: #mysys.stdout.write('Node.__del__() deleting node %i\n' % self.nodeNum) #mysys.stdout.flush() if self.cNode: # Generally, cNodes are deleted before the cTree is freed. freeNode requires the cTree! mysys.stdout.write('Node.__del__() node %i (%s) has a cNode (%s). How?!?\n' % ( self.nodeNum, self, self.cNode)) if self.doDataPart: dp_freeNode(self.cNode) else: freeNode(self.cNode) self.cNode = None Node.__del__ = __del__ del(__del__)
Anaphory/p4-phylogeny
p4/Node.py
Python
gpl-2.0
9,304
import os import django TEST_DIR = os.path.join(os.path.abspath(os.path.dirname(__file__)), 'tests') COMPRESS_CACHE_BACKEND = 'locmem://' DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': ':memory:', } } INSTALLED_APPS = ( 'compressor', 'jingo', ) TEMPLATE_LOADERS = ( 'jingo.Loader', 'django.template.loaders.filesystem.Loader', 'django.template.loaders.app_directories.Loader', ) MEDIA_URL = '/media/' STATIC_URL = MEDIA_URL MEDIA_ROOT = os.path.join(TEST_DIR, 'media') TEMPLATE_DIRS = ( # Specifically choose a name that will not be considered # by app_directories loader, to make sure each test uses # a specific template without considering the others. os.path.join(TEST_DIR, 'test_templates'), ) TEST_RUNNER = 'discover_runner.DiscoverRunner' SECRET_KEY = "iufoj=mibkpdz*%bob952x(%49rqgv8gg45k36kjcg76&-y5=!"
rtucker-mozilla/WhistlePig
vendor-local/lib/python/jingo_offline_compressor/test_settings.py
Python
bsd-3-clause
912
from App.model import UserAgents async def agent_save(request, user): ua = request.headers['User-Agent'] now = datetime.datetime.now() uas = [await i for i in user.ips] if ua in [i.content for i in contents]: ua_in = [i for i in uas if i.content == content][0] ua_in.utime = now ua_in.count += 1 await ip_in.save() else: await UserAgents.insert_many([{ "content": ua, 'ctime': now, 'utime': now, 'user': user }])
Basic-Components/auth-center
auth-center/App/auth/login_agents.py
Python
mit
533
""" Registration page. """ import os from edxapp_acceptance.pages.lms.login_and_register import CombinedLoginAndRegisterPage from edxapp_acceptance.pages.common.utils import disable_animations from regression.pages.whitelabel import LMS_URL_WITH_AUTH, ORG from regression.tests.helpers.utils import click_checkbox, fill_input_fields, select_drop_down_values class RegisterPageExtended(CombinedLoginAndRegisterPage): """ This class is an extended class of Register Page, where we add methods that are different or not used in Register Page """ url = os.path.join(LMS_URL_WITH_AUTH, "register") def register_white_label_user(self, registration_fields, submit=True): """ Registers a whitelabel users for whitelabel tests. Arguments: registration_fields(dict): A dictionary of all fields to be filled. submit(bool): If True then registration form will be submitted. """ disable_animations(self) self.wait_for_element_visibility( '.form-toggle[data-type="login"]', 'Registration form is visible.' ) elements_and_values = { '#register-email': registration_fields['email'], '#register-name': registration_fields['name'], '#register-username': registration_fields['username'], '#register-password': registration_fields['password'], '#register-first_name': registration_fields['first_name'], '#register-last_name': registration_fields['last_name'], '#register-state': registration_fields['state'] } drop_down_names_and_values = { "country": registration_fields['country'], } select_drop_down_values(self, drop_down_names_and_values) fill_input_fields(self, elements_and_values) # Some tests still don't display the new registration page when running # on Jenkins. Once registration page is updated, remove this condition. if self.q(css='#register-honor_code').visible: click_checkbox(self, '#register-honor_code') click_checkbox(self, '#register-terms_of_service') if ORG == 'MITxPRO': fill_input_fields( self, { '#register-company': registration_fields['company'], '#register-title': registration_fields['title'] } ) if ORG != 'HarvardMedGlobalAcademy': select_drop_down_values( self, { "year_of_birth": registration_fields['year_of_birth'], "gender": registration_fields['gender'], "level_of_education": registration_fields[ 'level_of_education' ] } ) else: select_drop_down_values( self, { "profession": registration_fields['profession'], "specialty": registration_fields['specialty'] } ) if submit: self.q(css='.register-button').click() def toggle_to_login_page(self): """ Toggle to login page """ self.q(css='.form-toggle[data-type="login"]').click()
edx/edx-e2e-tests
regression/pages/whitelabel/registration_page.py
Python
agpl-3.0
3,344
# Copyright (c) 2012 LE GOFF Vincent # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # * Redistributions of source code must retain the above copyright notice, this # list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above copyright notice, # this list of conditions and the following disclaimer in the documentation # and/or other materials provided with the distribution. # * Neither the name of the copyright holder nor the names of its contributors # may be used to endorse or promote products derived from this software # without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT # OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. """This module contains a generic class for testing data connectors. Note that this class DOES NOT inherit from unittest.TestCase, being an abstract test. If you create a new data connector and would like to test it, simply create a __init__.py and test.py file in a sub- package called like your data connector. In the test.py file, create a class inherited from AbstractDCTest. Your test.py file should contains something like: # Don't forget the license and at least a line of documentation from unittest import TestCase from tests.dc.test import AbstractDCTest from dc.{nour_connector} import {YourConnector} class DCTest(AbstractDCTest, TestCase): name = "dc_name" connector = {YourConnector} """ import os from datetime import datetime import yaml from model import exceptions as mod_exceptions from model.functions import * from model import Model from repository import Repository from tests.model import * for model in models: model._repository = Repository(None, model) class AbstractDCTest: """Abstract class for testing data connectors. This class is abstract. It shouldn't be considered a regular test case and doesn't have enough informations to perform a test. It's a base test for a data connector (each data connector should have a class inherited from it). This allows to test different data connector to check that each one has the same basic abilities as any other. Testing methods (some could be added, NOT MODIFIED): test_create -- try to create an object from a model test_update -- try to update an object test_save -- try to save and retrieve stored datas test_delete -- try to delete an object test_primary_keys -- test that the primary keys are unique test_auto_increment -- test the behavior of an autoincrement field test_auto_increment_delete -- check that old keys are not re-used test_default -- test the default value of a field test_find -- try to a retrieve a single object test_get_all -- try to retrieve all the created objects Other methods: setUp -- set up the test case tearDown -- tear down the test case """ def setUp(self): """Set up the data connector.""" self.setup_data_connector() #self.dc.repository_manager.clear() def tearDown(self): """Destroy the data connector and tear it down.""" self.teardown_data_connector(destroy=True) def setup_data_connector(self): """Setup the data_connector. If available, read the configuration file found in test/config/dc/{data_connector_name}.yml. Otherwise, the file is created with the default configuration found in dc/{data_connector_name}/parameters.yml. """ self.dc = type(self).connector() self.dc.setup_test() self.dc.repository_manager.record_models(models) for model in models: model._repository.data_connector = self.dc type(model).extend(model) self.dc.repository_manager.add_model(model) def teardown_data_connector(self, destroy=False): """Tear down the data connector.""" self.dc.repository_manager.save() if destroy: self.dc.driver.destroy() else: self.dc.driver.close() self.dc = None def test_create(self): """Create a simple user.""" repository = User._repository user = repository.create(username="Kredh", password="fore123") self.assertEqual(user.username, "Kredh") self.assertEqual(user.password, "fore123") def test_update(self): """Create and update a simple user.""" repository = User._repository user = repository.create(username="Nitrate") user.username = "Erwyn" self.assertEqual(user.username, "Erwyn") def test_save(self): """Create a simple user and start a new data connector. This tests that the created datas are stored and can be retrieved exactly as they were stored. """ repository = User._repository user = repository.create(username="Percyst") uid = user.id username = user.username users = repository.get_all() self.teardown_data_connector() self.setup_data_connector() retrieved = repository.find(uid) self.assertEqual(retrieved.id, uid) self.assertEqual(retrieved.username, username) self.assertIsNot(retrieved, user) self.assertEqual(len(repository.get_all()), len(users)) def test_delete(self): """Create and delete an user. After the user was deleted, try to update it (which souldn't work). """ repository = User._repository user = repository.create(username="Noway") repository.delete(user) self.assertRaises(mod_exceptions.UpdateDeletedObject, setattr, user, "username", "no") def test_primary_keys(self): """Test that no created user has the same ID as another.""" repository = User._repository users = repository.get_all() uids = set() for user in users: uids.add(user.id) self.assertEqual(len(uids), len(users)) def test_update_primary_key(self): """Create and update the primary key of a product.""" repository = Product._repository product = repository.create(name="a jug of milk", price=2, quantity=1) product.name = "a croissant" self.assertIs(product, repository.find("a croissant")) self.assertRaises(mod_exceptions.ObjectNotFound, repository.find, \ "a jug of milk") def test_auto_increment(self): """Test the good behavior of a autoincrement field. First, we get the user with the highest id. When we create another user, its id should be greater than the previous one. This should still be true when we start a new data connection. """ # Create at least one user (otherwise max will go crazy) repository = User._repository at_least_one_user = repository.create(username="Atlist") # Get the user with the biggest id max_user = max(repository.get_all(), key=lambda user: user.id) new_user = repository.create(username="Ideafix") self.assertTrue(max_user.id < new_user.id) # Reset the data connection self.teardown_data_connector() self.setup_data_connector() still_new_user = repository.create(username="Overall") self.assertTrue(new_user.id < still_new_user.id) self.assertTrue(new_user.id < still_new_user.id) def test_auto_increment_delete(self): """Check that old IDs are not re-used after deletion. If we create a new user, an ID is allocated to it. If we delete it and create a different user, its ID should be different (the old ID should not be used). """ # Create the first user repository = User._repository first_user = repository.create(username="Uone") uid = first_user.id repository.delete(first_user) # Reset the data connection self.teardown_data_connector() self.setup_data_connector() second_user = repository.create(username="Utwo") self.assertTrue(second_user.id > uid) self.assertRaises(mod_exceptions.ObjectNotFound, repository.find, uid) def test_default(self): """Create a user to test the default value of 'password'.""" repository = User._repository user = repository.create(username="Delfin") self.assertEqual(user.password, "unknown") def test_callable_default(self): """Create a product to test the default with callable.""" repository = Product._repository product = repository.create(name="a huge car", price=100000, quantity=3) self.assertEqual(product.total_price, 300000) def test_find(self): """Create and try to find the created user.""" repository = User._repository user = repository.create(username="Martha") # Test the find method with a positional argument found_1 = repository.find(user.id) self.assertIs(user, found_1) # Test the find method with keyword arguments found_2 = repository.find(id=user.id) self.assertIs(found_1, found_2) def test_get_all(self): """Create an user and look for it in the User.get_all().""" repository = User._repository user = repository.create(username="Crowd") users = repository.get_all() self.assertIn(user, users) def test_datetime(self): """Test that a datetime field is well stored.""" repository = Post._repository post = repository.create(title="Something", content="No wait", published_at=datetime.now()) published_at = post.published_at self.teardown_data_connector() self.setup_data_connector() post = repository.find(post.id) stored = int(published_at.timestamp()) published_at = int(post.published_at.timestamp()) self.assertEqual(stored, published_at) def test_one2many(self): """Test the one2many relation between posts and comments. This test is primarily used to see if, when a comment is defined in a blog post, the blog post can retrieve this comment accurately. """ post_repository = Post._repository comment_repository = Comment._repository # Create two blog posts (without comments) post_1 = post_repository.create(title="my trip to California", content="excellent!") post_2 = post_repository.create(title="one day in Paris", content="great!") # Create two comments in the first blog post comment_1 = comment_repository.create(post=post_1, content="always") comment_2 = comment_repository.create(post=post_1, content="definitely") # Check that the two comments are in the first blog post self.assertIs(comment_1.post, post_1) self.assertIs(comment_2.post, post_1) self.assertIn(comment_1, post_1.comments) self.assertIn(comment_2, post_1.comments) # Try to update the second comment comment_2.post = post_2 self.assertIs(comment_2.post, post_2) self.assertIn(comment_2, post_2.comments) def test_many2one(self): """Test the many2one relation between posts and comments.""" post_repository = Post._repository comment_repository = Comment._repository # Create two blog posts (without comments) post_1 = post_repository.create(title="a snowy day in New York City", content="sometimes it happens.") post_2 = post_repository.create(title="the car I didn't buy", content="Shame") # Create two comments in the first blog post comment_1 = comment_repository.create(post=post_1, content="cold") comment_2 = comment_repository.create(post=post_1, content="no fear") # Update the comments (delete) del post_1.comments[1] self.assertNotIn(comment_2, post_1.comments) self.assertIsNot(comment_2.post, post_1) # Update the comments (add) post_2.comments.append(comment_2) self.assertIn(comment_2, post_2.comments) self.assertIs(comment_2.post, post_2) def test_uni_many2one(self): """Test the unidirectional many2one relation.""" command_repository = Command._repository product_repository = Product._repository cmd = command_repository.create(opportunity="birthday") product_1 = product_repository.create(name="an atlas", price=250, quantity=1) product_2 = product_repository.create(name="a map", price=2, quantity=1) cmd.products.append(product_1) cmd.products.append(product_2) self.assertIn(product_1, cmd.products) self.assertIn(product_2, cmd.products) self.assertRaises(TypeError, getattr, product_1, "command")
v-legoff/pa-poc3
src/tests/dc/test.py
Python
bsd-3-clause
13,883
# coding=utf-8 # Copyright 2022 The Google Research Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests for two_sat.dnf_circuit_lib.""" import math from absl.testing import absltest from absl.testing import parameterized import cirq from cirq.circuits import insert_strategy import numpy as np from bangbang_qaoa import circuit_lib from bangbang_qaoa.two_sat import dnf_circuit_lib from bangbang_qaoa.two_sat import dnf_lib class HamiltonianGeneratorTest(parameterized.TestCase): @parameterized.parameters( (True, True, 1), (True, False, -1), (False, True, -1), (False, False, 1), ) def test_get_sign(self, is_negative, other_is_negative, expected): self.assertEqual(dnf_circuit_lib._get_sign(is_negative, other_is_negative), expected) @parameterized.parameters( ( dnf_lib.Clause(4, 2, True, False), 1, [ ( (cirq.LineQubit(2),), cirq.ZPowGate(exponent=-2/math.pi, global_shift=-0.5) ), ( (cirq.LineQubit(4),), cirq.ZPowGate(exponent=2/math.pi, global_shift=-0.5) ), ( (cirq.LineQubit(2), cirq.LineQubit(4)), cirq.ZZPowGate(exponent=2/math.pi, global_shift=-0.5) ), ], ), ( dnf_lib.Clause(1, 3, False, True), 0, [ ( (cirq.LineQubit(1),), cirq.ZPowGate(exponent=0, global_shift=-0.5) ), ( (cirq.LineQubit(3),), cirq.ZPowGate(exponent=0, global_shift=-0.5) ), ( (cirq.LineQubit(1), cirq.LineQubit(3)), cirq.ZZPowGate(exponent=0, global_shift=-0.5) ), ], ) ) def test_generate_clause_hamiltonian_exponential(self, clause, time, expected_answers): circuit = cirq.Circuit() circuit.append( dnf_circuit_lib.generate_clause_hamiltonian_exponential(clause, time), strategy=insert_strategy.InsertStrategy.NEW_THEN_INLINE) generator = circuit.all_operations() answer_generator = iter(expected_answers) operation = next(generator) expected_qubits, expected_gate = next(answer_generator) self.assertTupleEqual(operation.qubits, expected_qubits) self.assertEqual(operation.gate, expected_gate) operation = next(generator) expected_qubits, expected_gate = next(answer_generator) self.assertTupleEqual(operation.qubits, expected_qubits) self.assertEqual(operation.gate, expected_gate) operation = next(generator) expected_qubits, expected_gate = next(answer_generator) self.assertTupleEqual(operation.qubits, expected_qubits) self.assertEqual(operation.gate, expected_gate) with self.assertRaises(StopIteration): next(generator) with self.assertRaises(StopIteration): next(answer_generator) def test_generate_dnf_hamiltonian_order(self): circuit = cirq.Circuit() dnf = dnf_lib.DNF(10, [dnf_lib.Clause(5, 7, False, False)]) circuit.append( dnf_circuit_lib.generate_dnf_hamiltonian_exponential(dnf, 0.5), strategy=insert_strategy.InsertStrategy.NEW_THEN_INLINE) generator = circuit.all_operations() operation = next(generator) self.assertEqual( operation, cirq.ZPowGate(exponent=-1.0 / math.pi, global_shift=-0.5).on(cirq.LineQubit(5))) operation = next(generator) self.assertEqual( operation, cirq.ZPowGate(exponent=-1.0 / math.pi, global_shift=-0.5).on(cirq.LineQubit(7))) operation = next(generator) self.assertEqual( operation, cirq.ZZPowGate(exponent=-1.0 / math.pi, global_shift=-0.5).on(cirq.LineQubit(5), cirq.LineQubit(7))) with self.assertRaises(StopIteration): next(generator) def test_generate_dnf_hamiltonian_content(self): clauses = [ dnf_lib.Clause(2, 4, True, False), dnf_lib.Clause(5, 4, True, True) ] dnf = dnf_lib.DNF(10, clauses) circuit = cirq.Circuit() circuit.append( dnf_circuit_lib.generate_dnf_hamiltonian_exponential(dnf, 0.25), strategy=insert_strategy.InsertStrategy.NEW_THEN_INLINE) operations = list(circuit.all_operations()) self.assertCountEqual( operations, [ cirq.ZPowGate(exponent=-0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(4)), cirq.ZPowGate(exponent=0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(2)), cirq.ZZPowGate(exponent=0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(2), cirq.LineQubit(4)), cirq.ZPowGate(exponent=0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(4)), cirq.ZPowGate(exponent=0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(5)), cirq.ZZPowGate(exponent=-0.5 / math.pi, global_shift=-0.5).on(cirq.LineQubit(4), cirq.LineQubit(5)), ] ) class BangBangProtocolCircuitTest(parameterized.TestCase): def test_bangbang_protocol_circuit_init(self): dnf = dnf_lib.DNF(4, [dnf_lib.Clause(0, 3, True, True)]) circuit = dnf_circuit_lib.BangBangProtocolCircuit(5.3, dnf) self.assertEqual(circuit.dnf, dnf) self.assertEqual(circuit.chunk_time, 5.3) self.assertEqual(circuit.num_qubits, 4) def test_get_hamiltonian_diagonal(self): dnf = dnf_lib.DNF(4, [dnf_lib.Clause(0, 3, True, True)]) circuit = dnf_circuit_lib.BangBangProtocolCircuit(5.3, dnf) np.testing.assert_allclose( circuit.get_hamiltonian_diagonal(), [1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0]) def test_bangbang_protocol_circuit_init_neg_chunk_time(self): with self.assertRaisesRegex( ValueError, 'chunk_time must be positive, not -1.2' ): dnf_circuit_lib.BangBangProtocolCircuit(-1.2, dnf_lib.DNF(22, [])) def test_generate_qaoa_circuit(self): dnf = dnf_lib.DNF(5, [dnf_lib.Clause(1, 2, False, False)]) circuit = dnf_circuit_lib.BangBangProtocolCircuit(0.2, dnf) qaoa_circuit = circuit.qaoa_circuit([ circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.X, circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.X, circuit_lib.HamiltonianType.X, ]) # Should 21 contain gates # 5 gates from Hadamard Layer # 2 layers of X Hamiltonian, which has 5 gates each # 2 layers of DNF Hamiltonian, which has 3 gates each # 5 + 2*5 + 2*3 = 21 self.assertLen(list(qaoa_circuit.all_operations()), 21) def test_get_wavefunction(self): dnf = dnf_lib.DNF(2, [dnf_lib.Clause(0, 1, True, False)]) # time is chosen so that ZPowGate = sqrt(Z) and Rx = sqrt(X) up to phase. circuit = dnf_circuit_lib.BangBangProtocolCircuit(math.pi / 4, dnf) bangbang_protocol = [ circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.X, ] cirq.testing.assert_allclose_up_to_global_phase( circuit.get_wavefunction(bangbang_protocol), np.array([0, (1 + 1j) / 2, (-1 + 1j) / 2, 0]), atol=0.000001) def test_get_probabilities_wrong_shape(self): dnf = dnf_lib.DNF(2, [dnf_lib.Clause(0, 1, True, False)]) # time is chosen so that ZPowGate = sqrt(Z) and Rx = sqrt(X) up to phase. circuit = dnf_circuit_lib.BangBangProtocolCircuit(math.pi / 4, dnf) with self.assertRaisesRegex( ValueError, r'The shape of wavefunction should be \(4\,\) but got \(3\,\)'): circuit.get_probabilities(wavefunction=np.array([1., 0., 0.])) def test_get_probabilities(self): dnf = dnf_lib.DNF(2, [dnf_lib.Clause(0, 1, True, False)]) # time is chosen so that ZPowGate = sqrt(Z) and Rx = sqrt(X) up to phase. circuit = dnf_circuit_lib.BangBangProtocolCircuit(math.pi / 4, dnf) bangbang_protocol = [ circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.X, ] probabilities = circuit.get_probabilities( circuit.get_wavefunction(bangbang_protocol)) np.testing.assert_allclose( probabilities, [0, 0.5, 0.5, 0], atol=0.00001) @parameterized.parameters( ([False, False, False, False], 3 / 4), ([False, False, False, True], 1), ([False, False, True, False], 1), ([False, False, True, True], 1), ([False, True, False, False], 3 /4), ([False, True, False, True], 1), ([False, True, True, False], 1), ([False, True, True, True], 1), ([True, False, False, False], 3 / 4), ([True, False, False, True], 1), ([True, False, True, False], 1), ([True, False, True, True], 1), ([True, True, False, False], 3 / 4), ([True, True, False, True], 1), ([True, True, True, False], 1), ([True, True, True, True], 1), ) def test_constraint_evaluation(self, measurement, expected_value): dnf = dnf_lib.DNF(4, [dnf_lib.Clause(0, 1, False, False), dnf_lib.Clause(0, 1, True, True), dnf_lib.Clause(0, 1, False, True), dnf_lib.Clause(0, 1, True, False), dnf_lib.Clause(2, 3, False, False)]) self.assertEqual(dnf.optimal_num_satisfied, 4) circuit = dnf_circuit_lib.BangBangProtocolCircuit(1, dnf) self.assertEqual(circuit.constraint_evaluation(measurement), expected_value) def test_get_constraint_expectation(self): dnf = dnf_lib.DNF(2, [dnf_lib.Clause(0, 1, True, False)]) # time is chosen so that ZPowGate = sqrt(Z) and Rx = sqrt(X) up to phase. circuit = dnf_circuit_lib.BangBangProtocolCircuit(math.pi / 4, dnf) bangbang_protocol = [ circuit_lib.HamiltonianType.CONSTRAINT, circuit_lib.HamiltonianType.X, ] self.assertAlmostEqual( circuit.get_constraint_expectation( circuit.get_wavefunction(bangbang_protocol)), 0.5, places=5) if __name__ == '__main__': absltest.main()
google-research/google-research
bangbang_qaoa/two_sat/dnf_circuit_lib_test.py
Python
apache-2.0
11,116
import unittest.mock from labonneboite.common.models import Office from labonneboite.common import pdf from labonneboite.tests.test_base import DatabaseTest from labonneboite.common.load_data import load_groupements_employeurs class DownloadTest(DatabaseTest): def setUp(self): super().setUp() # Create an office. self.office = Office( departement='75', siret='78548035101646', company_name='NICOLAS', headcount='03', city_code='75110', zipcode='75010', naf='4646Z', tel='0100000000', score=80, x=2.3488, y=48.8534, ) self.office.save() # Remove pdf file if it already exists pdf.delete_file(self.office) def test_office_fields_and_properties_are_str(self): """ Check if office fields are str """ self.assertEqual(type(self.office.company_name), str) self.assertEqual(type(self.office.address_as_text), str) self.assertEqual(type(self.office.phone), str) self.assertEqual(type(self.office.google_url), str) def test_office_details_page(self): """ Test the office details page of a regular office. """ rv = self.app.get(self.url_for('office.details', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) def test_office_details_page_of_non_existing_office(self): """ Test the office details page of a non existing office. """ # The details page of an nonexistent office should raise a 404. rv = self.app.get(self.url_for('office.details', siret='7x5x8x3x1x1x46')) self.assertEqual(rv.status_code, 404) def test_office_details_page_of_office_having_buggy_naf(self): """ Test the office details page of an office having NAF 9900Z. """ self.office.naf = '9900Z' self.office.save() rv = self.app.get(self.url_for('office.details', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) def test_office_details_page_of_office_which_is_a_groupement_employeurs(self): """ Test the office details page of an office being a groupement d'employeurs. """ self.office.siret = '30651644400024' # first siret in groupements_employeurs.csv self.office.save() self.assertIn(self.office.siret, load_groupements_employeurs()) rv = self.app.get(self.url_for('office.details', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) self.assertIn( u"Cette entreprise est un groupement d'employeurs.", rv.data.decode(), ) def test_office_details_page_of_office_which_is_not_a_groupement_employeurs(self): """ Test the office details page of an office not being a groupement d'employeurs. """ self.assertFalse(self.office.siret in load_groupements_employeurs()) rv = self.app.get(self.url_for('office.details', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) self.assertNotIn( u"Cette entreprise est un groupement d'employeurs.", rv.data.decode(), ) def test_download_regular_office(self): """ Test the office PDF download """ # normal behavior rv = self.app.get(self.url_for('office.download', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) self.assertEqual('application/pdf', rv.mimetype) self.assertLess(1000, rv.content_length) def test_download_triggers_activity_log(self): with unittest.mock.patch('labonneboite.common.activity.log') as activity_log: self.app.get(self.url_for('office.download', siret=self.office.siret)) activity_log.assert_called_with('telecharger-pdf', siret=self.office.siret) def test_download_missing_siret(self): """ Test the office PDF download of a non existing office """ # siret does not exist rv = self.app.get(self.url_for('office.download', siret='1234567890')) self.assertEqual(rv.status_code, 404) def test_download_of_office_having_buggy_naf(self): """ Test the office PDF download of an office having NAF 9900Z. """ self.office.naf = '9900Z' self.office.save() rv = self.app.get(self.url_for('office.download', siret=self.office.siret)) self.assertEqual(rv.status_code, 200) def test_toggle_details_event(self): with unittest.mock.patch('labonneboite.common.activity.log') as activity_log: rv = self.app.post(self.url_for('office.toggle_details_event', siret=self.office.siret)) activity_log.assert_called_with('afficher-details', siret=self.office.siret) self.assertEqual(rv.status_code, 200)
StartupsPoleEmploi/labonneboite
labonneboite/tests/web/front/test_companies.py
Python
agpl-3.0
4,969
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from tempest.lib.services.volume.v3 import types_client from tempest.tests.lib import fake_auth_provider from tempest.tests.lib.services import base class TestTypesClient(base.BaseServiceTest): FAKE_CREATE_VOLUME_TYPE = { 'volume_type': { 'id': '6685584b-1eac-4da6-b5c3-555430cf68ff', 'name': 'vol-type-001', 'description': 'volume type 0001', 'is_public': True, 'os-volume-type-access:is_public': True, 'extra_specs': { 'volume_backend_name': 'rbd' } } } FAKE_DEFAULT_VOLUME_TYPE_INFO = { 'volume_type': { 'id': '6685584b-1eac-4da6-b5c3-555430cf68ff', 'qos_specs_id': None, 'name': 'volume-type-test', 'description': 'default volume type', 'is_public': True, 'os-volume-type-access:is_public': True, 'extra_specs': { 'volume_backend_name': 'rbd' } } } FAKE_UPDATE_VOLUME_TYPE = { 'volume_type': { 'id': '6685584b-1eac-4da6-b5c3-555430cf68ff', 'qos_specs_id': None, 'name': 'volume-type-test', 'description': 'default volume type', 'os-volume-type-access:is_public': True, 'is_public': True, 'extra_specs': { 'volume_backend_name': 'rbd' } } } FAKE_VOLUME_TYPES = { 'volume_types': [ { 'name': 'volume_type01', 'qos_specs_id': None, 'extra_specs': { 'volume_backend_name': 'lvmdriver-1' }, 'os-volume-type-access:is_public': True, 'is_public': True, 'id': '6685584b-1eac-4da6-b5c3-555430cf68ff', 'description': None }, { 'name': 'volume_type02', 'qos_specs_id': None, 'extra_specs': { 'volume_backend_name': 'lvmdriver-1' }, 'os-volume-type-access:is_public': True, 'is_public': True, 'id': '8eb69a46-df97-4e41-9586-9a40a7533803', 'description': None } ] } FAKE_VOLUME_TYPE_EXTRA_SPECS = { 'extra_specs': { 'capabilities': 'gpu' } } FAKE_SHOW_VOLUME_TYPE_EXTRA_SPECS = { 'capabilities': 'gpu' } FAKE_VOLUME_TYPE_ACCESS = { 'volume_type_access': [{ 'volume_type_id': '3c67e124-39ad-4ace-a507-8bb7bf510c26', 'project_id': 'f270b245cb11498ca4031deb7e141cfa' }] } def setUp(self): super(TestTypesClient, self).setUp() fake_auth = fake_auth_provider.FakeAuthProvider() self.client = types_client.TypesClient(fake_auth, 'volume', 'regionOne') def _test_list_volume_types(self, bytes_body=False): self.check_service_client_function( self.client.list_volume_types, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_VOLUME_TYPES, bytes_body) def _test_show_volume_type(self, bytes_body=False): self.check_service_client_function( self.client.show_volume_type, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_DEFAULT_VOLUME_TYPE_INFO, to_utf=bytes_body, volume_type_id="6685584b-1eac-4da6-b5c3-555430cf68ff") def _test_create_volume_type(self, bytes_body=False): self.check_service_client_function( self.client.create_volume_type, 'tempest.lib.common.rest_client.RestClient.post', self.FAKE_CREATE_VOLUME_TYPE, to_utf=bytes_body, name='volume-type-test') def _test_delete_volume_type(self): self.check_service_client_function( self.client.delete_volume_type, 'tempest.lib.common.rest_client.RestClient.delete', {}, status=202, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff') def _test_list_volume_types_extra_specs(self, bytes_body=False): self.check_service_client_function( self.client.list_volume_types_extra_specs, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_VOLUME_TYPE_EXTRA_SPECS, to_utf=bytes_body, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff') def _test_show_volume_type_extra_specs(self, bytes_body=False): self.check_service_client_function( self.client.show_volume_type_extra_specs, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_SHOW_VOLUME_TYPE_EXTRA_SPECS, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff', extra_specs_name='capabilities', to_utf=bytes_body) def _test_create_volume_type_extra_specs(self, bytes_body=False): self.check_service_client_function( self.client.create_volume_type_extra_specs, 'tempest.lib.common.rest_client.RestClient.post', self.FAKE_VOLUME_TYPE_EXTRA_SPECS, volume_type_id="6685584b-1eac-4da6-b5c3-555430cf68ff", extra_specs=self.FAKE_VOLUME_TYPE_EXTRA_SPECS, to_utf=bytes_body) def _test_delete_volume_type_extra_specs(self): self.check_service_client_function( self.client.delete_volume_type_extra_specs, 'tempest.lib.common.rest_client.RestClient.delete', {}, status=202, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff', extra_spec_name='volume_backend_name') def _test_update_volume_type(self, bytes_body=False): self.check_service_client_function( self.client.update_volume_type, 'tempest.lib.common.rest_client.RestClient.put', self.FAKE_UPDATE_VOLUME_TYPE, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff', to_utf=bytes_body, name='update-volume-type-test', description='test update volume type description') def _test_update_volume_type_extra_specs(self, bytes_body=False): self.check_service_client_function( self.client.update_volume_type_extra_specs, 'tempest.lib.common.rest_client.RestClient.put', self.FAKE_SHOW_VOLUME_TYPE_EXTRA_SPECS, extra_spec_name='capabilities', volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff', extra_specs=self.FAKE_SHOW_VOLUME_TYPE_EXTRA_SPECS, to_utf=bytes_body) def _test_add_type_access(self): self.check_service_client_function( self.client.add_type_access, 'tempest.lib.common.rest_client.RestClient.post', {}, status=202, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff') def _test_remove_type_access(self): self.check_service_client_function( self.client.remove_type_access, 'tempest.lib.common.rest_client.RestClient.post', {}, status=202, volume_type_id='6685584b-1eac-4da6-b5c3-555430cf68ff') def _test_list_type_access(self, bytes_body=False): self.check_service_client_function( self.client.list_type_access, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_VOLUME_TYPE_ACCESS, volume_type_id='3c67e124-39ad-4ace-a507-8bb7bf510c26', to_utf=bytes_body) def test_list_volume_types_with_str_body(self): self._test_list_volume_types() def test_list_volume_types_with_bytes_body(self): self._test_list_volume_types(bytes_body=True) def test_show_volume_type_with_str_body(self): self._test_show_volume_type() def test_show_volume_type_with_bytes_body(self): self._test_show_volume_type(bytes_body=True) def test_create_volume_type_str_body(self): self._test_create_volume_type() def test_create_volume_type_with_bytes_body(self): self._test_create_volume_type(bytes_body=True) def test_list_volume_types_extra_specs_with_str_body(self): self._test_list_volume_types_extra_specs() def test_list_volume_types_extra_specs_with_bytes_body(self): self._test_list_volume_types_extra_specs(bytes_body=True) def test_show_volume_type_extra_specs_with_str_body(self): self._test_show_volume_type_extra_specs() def test_show_volume_type_extra_specs_with_bytes_body(self): self._test_show_volume_type_extra_specs(bytes_body=True) def test_create_volume_type_extra_specs_with_str_body(self): self._test_create_volume_type_extra_specs() def test_create_volume_type_extra_specs_with_bytes_body(self): self._test_create_volume_type_extra_specs(bytes_body=True) def test_delete_volume_type_extra_specs(self): self._test_delete_volume_type_extra_specs() def test_update_volume_type_with_str_body(self): self._test_update_volume_type() def test_update_volume_type_with_bytes_body(self): self._test_update_volume_type(bytes_body=True) def test_delete_volume_type(self): self._test_delete_volume_type() def test_update_volume_type_extra_specs_with_str_body(self): self._test_update_volume_type_extra_specs() def test_update_volume_type_extra_specs_with_bytes_body(self): self._test_update_volume_type_extra_specs(bytes_body=True) def test_add_type_access(self): self._test_add_type_access() def test_remove_type_access(self): self._test_remove_type_access() def test_list_type_access_with_str_body(self): self._test_list_type_access() def test_list_type_access_with_bytes_body(self): self._test_list_type_access(bytes_body=True)
masayukig/tempest
tempest/tests/lib/services/volume/v3/test_types_client.py
Python
apache-2.0
10,619
# Copyright 2012-2021 The Meson development team # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from . import mlog, mparser import pickle, os, uuid import sys from itertools import chain from pathlib import PurePath from collections import OrderedDict from .mesonlib import ( MesonException, EnvironmentException, MachineChoice, PerMachine, default_libdir, default_libexecdir, default_prefix, split_args, OptionKey, OptionType, ) from .wrap import WrapMode import ast import argparse import configparser import enum import shlex import typing as T if T.TYPE_CHECKING: from . import dependencies from .compilers.compilers import Compiler, CompileResult # noqa: F401 from .environment import Environment from .mesonlib import OptionOverrideProxy OptionDictType = T.Union[T.Dict[str, 'UserOption[T.Any]'], OptionOverrideProxy] KeyedOptionDictType = T.Union[T.Dict['OptionKey', 'UserOption[T.Any]'], OptionOverrideProxy] CompilerCheckCacheKey = T.Tuple[T.Tuple[str, ...], str, str, T.Tuple[str, ...], str] version = '0.58.999' backendlist = ['ninja', 'vs', 'vs2010', 'vs2015', 'vs2017', 'vs2019', 'xcode'] default_yielding = False # Can't bind this near the class method it seems, sadly. _T = T.TypeVar('_T') class MesonVersionMismatchException(MesonException): '''Build directory generated with Meson version is incompatible with current version''' def __init__(self, old_version: str, current_version: str) -> None: super().__init__('Build directory has been generated with Meson version {}, ' 'which is incompatible with the current version {}.' .format(old_version, current_version)) self.old_version = old_version self.current_version = current_version class UserOption(T.Generic[_T]): def __init__(self, description: str, choices: T.Optional[T.Union[str, T.List[_T]]], yielding: T.Optional[bool]): super().__init__() self.choices = choices self.description = description if yielding is None: yielding = default_yielding if not isinstance(yielding, bool): raise MesonException('Value of "yielding" must be a boolean.') self.yielding = yielding def printable_value(self) -> T.Union[str, int, bool, T.List[T.Union[str, int, bool]]]: assert isinstance(self.value, (str, int, bool, list)) return self.value # Check that the input is a valid value and return the # "cleaned" or "native" version. For example the Boolean # option could take the string "true" and return True. def validate_value(self, value: T.Any) -> _T: raise RuntimeError('Derived option class did not override validate_value.') def set_value(self, newvalue: T.Any) -> None: self.value = self.validate_value(newvalue) class UserStringOption(UserOption[str]): def __init__(self, description: str, value: T.Any, yielding: T.Optional[bool] = None): super().__init__(description, None, yielding) self.set_value(value) def validate_value(self, value: T.Any) -> str: if not isinstance(value, str): raise MesonException('Value "%s" for string option is not a string.' % str(value)) return value class UserBooleanOption(UserOption[bool]): def __init__(self, description: str, value, yielding: T.Optional[bool] = None) -> None: super().__init__(description, [True, False], yielding) self.set_value(value) def __bool__(self) -> bool: return self.value def validate_value(self, value: T.Any) -> bool: if isinstance(value, bool): return value if not isinstance(value, str): raise MesonException(f'Value {value} cannot be converted to a boolean') if value.lower() == 'true': return True if value.lower() == 'false': return False raise MesonException('Value %s is not boolean (true or false).' % value) class UserIntegerOption(UserOption[int]): def __init__(self, description: str, value: T.Any, yielding: T.Optional[bool] = None): min_value, max_value, default_value = value self.min_value = min_value self.max_value = max_value c = [] if min_value is not None: c.append('>=' + str(min_value)) if max_value is not None: c.append('<=' + str(max_value)) choices = ', '.join(c) super().__init__(description, choices, yielding) self.set_value(default_value) def validate_value(self, value: T.Any) -> int: if isinstance(value, str): value = self.toint(value) if not isinstance(value, int): raise MesonException('New value for integer option is not an integer.') if self.min_value is not None and value < self.min_value: raise MesonException('New value %d is less than minimum value %d.' % (value, self.min_value)) if self.max_value is not None and value > self.max_value: raise MesonException('New value %d is more than maximum value %d.' % (value, self.max_value)) return value def toint(self, valuestring: str) -> int: try: return int(valuestring) except ValueError: raise MesonException('Value string "%s" is not convertible to an integer.' % valuestring) class OctalInt(int): # NinjaBackend.get_user_option_args uses str() to converts it to a command line option # UserUmaskOption.toint() uses int(str, 8) to convert it to an integer # So we need to use oct instead of dec here if we do not want values to be misinterpreted. def __str__(self): return oct(int(self)) class UserUmaskOption(UserIntegerOption, UserOption[T.Union[str, OctalInt]]): def __init__(self, description: str, value: T.Any, yielding: T.Optional[bool] = None): super().__init__(description, (0, 0o777, value), yielding) self.choices = ['preserve', '0000-0777'] def printable_value(self) -> str: if self.value == 'preserve': return self.value return format(self.value, '04o') def validate_value(self, value: T.Any) -> T.Union[str, OctalInt]: if value is None or value == 'preserve': return 'preserve' return OctalInt(super().validate_value(value)) def toint(self, valuestring: T.Union[str, OctalInt]) -> int: try: return int(valuestring, 8) except ValueError as e: raise MesonException(f'Invalid mode: {e}') class UserComboOption(UserOption[str]): def __init__(self, description: str, choices: T.List[str], value: T.Any, yielding: T.Optional[bool] = None): super().__init__(description, choices, yielding) if not isinstance(self.choices, list): raise MesonException('Combo choices must be an array.') for i in self.choices: if not isinstance(i, str): raise MesonException('Combo choice elements must be strings.') self.set_value(value) def validate_value(self, value: T.Any) -> str: if value not in self.choices: if isinstance(value, bool): _type = 'boolean' elif isinstance(value, (int, float)): _type = 'number' else: _type = 'string' optionsstring = ', '.join([f'"{item}"' for item in self.choices]) raise MesonException('Value "{}" (of type "{}") for combo option "{}" is not one of the choices.' ' Possible choices are (as string): {}.'.format( value, _type, self.description, optionsstring)) return value class UserArrayOption(UserOption[T.List[str]]): def __init__(self, description: str, value: T.Union[str, T.List[str]], split_args: bool = False, user_input: bool = False, allow_dups: bool = False, **kwargs: T.Any) -> None: super().__init__(description, kwargs.get('choices', []), yielding=kwargs.get('yielding', None)) self.split_args = split_args self.allow_dups = allow_dups self.value = self.validate_value(value, user_input=user_input) def validate_value(self, value: T.Union[str, T.List[str]], user_input: bool = True) -> T.List[str]: # User input is for options defined on the command line (via -D # options). Users can put their input in as a comma separated # string, but for defining options in meson_options.txt the format # should match that of a combo if not user_input and isinstance(value, str) and not value.startswith('['): raise MesonException('Value does not define an array: ' + value) if isinstance(value, str): if value.startswith('['): try: newvalue = ast.literal_eval(value) except ValueError: raise MesonException(f'malformed option {value}') elif value == '': newvalue = [] else: if self.split_args: newvalue = split_args(value) else: newvalue = [v.strip() for v in value.split(',')] elif isinstance(value, list): newvalue = value else: raise MesonException(f'"{newvalue}" should be a string array, but it is not') if not self.allow_dups and len(set(newvalue)) != len(newvalue): msg = 'Duplicated values in array option is deprecated. ' \ 'This will become a hard error in the future.' mlog.deprecation(msg) for i in newvalue: if not isinstance(i, str): raise MesonException('String array element "{}" is not a string.'.format(str(newvalue))) if self.choices: bad = [x for x in newvalue if x not in self.choices] if bad: raise MesonException('Options "{}" are not in allowed choices: "{}"'.format( ', '.join(bad), ', '.join(self.choices))) return newvalue def extend_value(self, value: T.Union[str, T.List[str]]) -> None: """Extend the value with an additional value.""" new = self.validate_value(value) self.set_value(self.value + new) class UserFeatureOption(UserComboOption): static_choices = ['enabled', 'disabled', 'auto'] def __init__(self, description: str, value: T.Any, yielding: T.Optional[bool] = None): super().__init__(description, self.static_choices, value, yielding) def is_enabled(self) -> bool: return self.value == 'enabled' def is_disabled(self) -> bool: return self.value == 'disabled' def is_auto(self) -> bool: return self.value == 'auto' if T.TYPE_CHECKING: CacheKeyType = T.Tuple[T.Tuple[T.Any, ...], ...] SubCacheKeyType = T.Tuple[T.Any, ...] class DependencyCacheType(enum.Enum): OTHER = 0 PKG_CONFIG = 1 CMAKE = 2 @classmethod def from_type(cls, dep: 'dependencies.Dependency') -> 'DependencyCacheType': from . import dependencies # As more types gain search overrides they'll need to be added here if isinstance(dep, dependencies.PkgConfigDependency): return cls.PKG_CONFIG if isinstance(dep, dependencies.CMakeDependency): return cls.CMAKE return cls.OTHER class DependencySubCache: def __init__(self, type_: DependencyCacheType): self.types = [type_] self.__cache = {} # type: T.Dict[SubCacheKeyType, dependencies.Dependency] def __getitem__(self, key: 'SubCacheKeyType') -> 'dependencies.Dependency': return self.__cache[key] def __setitem__(self, key: 'SubCacheKeyType', value: 'dependencies.Dependency') -> None: self.__cache[key] = value def __contains__(self, key: 'SubCacheKeyType') -> bool: return key in self.__cache def values(self) -> T.Iterable['dependencies.Dependency']: return self.__cache.values() class DependencyCache: """Class that stores a cache of dependencies. This class is meant to encapsulate the fact that we need multiple keys to successfully lookup by providing a simple get/put interface. """ def __init__(self, builtins: 'KeyedOptionDictType', for_machine: MachineChoice): self.__cache = OrderedDict() # type: T.MutableMapping[CacheKeyType, DependencySubCache] self.__builtins = builtins self.__pkg_conf_key = OptionKey('pkg_config_path', machine=for_machine) self.__cmake_key = OptionKey('cmake_prefix_path', machine=for_machine) def __calculate_subkey(self, type_: DependencyCacheType) -> T.Tuple[T.Any, ...]: if type_ is DependencyCacheType.PKG_CONFIG: return tuple(self.__builtins[self.__pkg_conf_key].value) elif type_ is DependencyCacheType.CMAKE: return tuple(self.__builtins[self.__cmake_key].value) assert type_ is DependencyCacheType.OTHER, 'Someone forgot to update subkey calculations for a new type' return tuple() def __iter__(self) -> T.Iterator['CacheKeyType']: return self.keys() def put(self, key: 'CacheKeyType', dep: 'dependencies.Dependency') -> None: t = DependencyCacheType.from_type(dep) if key not in self.__cache: self.__cache[key] = DependencySubCache(t) subkey = self.__calculate_subkey(t) self.__cache[key][subkey] = dep def get(self, key: 'CacheKeyType') -> T.Optional['dependencies.Dependency']: """Get a value from the cache. If there is no cache entry then None will be returned. """ try: val = self.__cache[key] except KeyError: return None for t in val.types: subkey = self.__calculate_subkey(t) try: return val[subkey] except KeyError: pass return None def values(self) -> T.Iterator['dependencies.Dependency']: for c in self.__cache.values(): yield from c.values() def keys(self) -> T.Iterator['CacheKeyType']: return iter(self.__cache.keys()) def items(self) -> T.Iterator[T.Tuple['CacheKeyType', T.List['dependencies.Dependency']]]: for k, v in self.__cache.items(): vs = [] for t in v.types: subkey = self.__calculate_subkey(t) if subkey in v: vs.append(v[subkey]) yield k, vs def clear(self) -> None: self.__cache.clear() # Can't bind this near the class method it seems, sadly. _V = T.TypeVar('_V') # This class contains all data that must persist over multiple # invocations of Meson. It is roughly the same thing as # cmakecache. class CoreData: def __init__(self, options: argparse.Namespace, scratch_dir: str, meson_command: T.List[str]): self.lang_guids = { 'default': '8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942', 'c': '8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942', 'cpp': '8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942', 'test': '3AC096D0-A1C2-E12C-1390-A8335801FDAB', 'directory': '2150E333-8FDC-42A3-9474-1A3956D46DE8', } self.test_guid = str(uuid.uuid4()).upper() self.regen_guid = str(uuid.uuid4()).upper() self.install_guid = str(uuid.uuid4()).upper() self.meson_command = meson_command self.target_guids = {} self.version = version self.options: 'KeyedOptionDictType' = {} self.cross_files = self.__load_config_files(options, scratch_dir, 'cross') self.compilers = PerMachine(OrderedDict(), OrderedDict()) # type: PerMachine[T.Dict[str, Compiler]] # Set of subprojects that have already been initialized once, this is # required to be stored and reloaded with the coredata, as we don't # want to overwrite options for such subprojects. self.initialized_subprojects: T.Set[str] = set() build_cache = DependencyCache(self.options, MachineChoice.BUILD) host_cache = DependencyCache(self.options, MachineChoice.HOST) self.deps = PerMachine(build_cache, host_cache) # type: PerMachine[DependencyCache] self.compiler_check_cache = OrderedDict() # type: T.Dict[CompilerCheckCacheKey, compiler.CompileResult] # Only to print a warning if it changes between Meson invocations. self.config_files = self.__load_config_files(options, scratch_dir, 'native') self.builtin_options_libdir_cross_fixup() self.init_builtins('') @staticmethod def __load_config_files(options: argparse.Namespace, scratch_dir: str, ftype: str) -> T.List[str]: # Need to try and make the passed filenames absolute because when the # files are parsed later we'll have chdir()d. if ftype == 'cross': filenames = options.cross_file else: filenames = options.native_file if not filenames: return [] found_invalid = [] # type: T.List[str] missing = [] # type: T.List[str] real = [] # type: T.List[str] for i, f in enumerate(filenames): f = os.path.expanduser(os.path.expandvars(f)) if os.path.exists(f): if os.path.isfile(f): real.append(os.path.abspath(f)) continue elif os.path.isdir(f): found_invalid.append(os.path.abspath(f)) else: # in this case we've been passed some kind of pipe, copy # the contents of that file into the meson private (scratch) # directory so that it can be re-read when wiping/reconfiguring copy = os.path.join(scratch_dir, f'{uuid.uuid4()}.{ftype}.ini') with open(f) as rf: with open(copy, 'w') as wf: wf.write(rf.read()) real.append(copy) # Also replace the command line argument, as the pipe # probably won't exist on reconfigure filenames[i] = copy continue if sys.platform != 'win32': paths = [ os.environ.get('XDG_DATA_HOME', os.path.expanduser('~/.local/share')), ] + os.environ.get('XDG_DATA_DIRS', '/usr/local/share:/usr/share').split(':') for path in paths: path_to_try = os.path.join(path, 'meson', ftype, f) if os.path.isfile(path_to_try): real.append(path_to_try) break else: missing.append(f) else: missing.append(f) if missing: if found_invalid: mlog.log('Found invalid candidates for', ftype, 'file:', *found_invalid) mlog.log('Could not find any valid candidate for', ftype, 'files:', *missing) raise MesonException(f'Cannot find specified {ftype} file: {f}') return real def builtin_options_libdir_cross_fixup(self): # By default set libdir to "lib" when cross compiling since # getting the "system default" is always wrong on multiarch # platforms as it gets a value like lib/x86_64-linux-gnu. if self.cross_files: BUILTIN_OPTIONS[OptionKey('libdir')].default = 'lib' def sanitize_prefix(self, prefix): prefix = os.path.expanduser(prefix) if not os.path.isabs(prefix): raise MesonException('prefix value {!r} must be an absolute path' ''.format(prefix)) if prefix.endswith('/') or prefix.endswith('\\'): # On Windows we need to preserve the trailing slash if the # string is of type 'C:\' because 'C:' is not an absolute path. if len(prefix) == 3 and prefix[1] == ':': pass # If prefix is a single character, preserve it since it is # the root directory. elif len(prefix) == 1: pass else: prefix = prefix[:-1] return prefix def sanitize_dir_option_value(self, prefix: str, option: OptionKey, value: T.Any) -> T.Any: ''' If the option is an installation directory option and the value is an absolute path, check that it resides within prefix and return the value as a path relative to the prefix. This way everyone can do f.ex, get_option('libdir') and be sure to get the library directory relative to prefix. .as_posix() keeps the posix-like file seperators Meson uses. ''' try: value = PurePath(value) except TypeError: return value if option.name.endswith('dir') and value.is_absolute() and \ option not in BULITIN_DIR_NOPREFIX_OPTIONS: # Value must be a subdir of the prefix # commonpath will always return a path in the native format, so we # must use pathlib.PurePath to do the same conversion before # comparing. msg = ('The value of the \'{!s}\' option is \'{!s}\' which must be a ' 'subdir of the prefix {!r}.\nNote that if you pass a ' 'relative path, it is assumed to be a subdir of prefix.') # os.path.commonpath doesn't understand case-insensitive filesystems, # but PurePath().relative_to() does. try: value = value.relative_to(prefix) except ValueError: raise MesonException(msg.format(option, value, prefix)) if '..' in str(value): raise MesonException(msg.format(option, value, prefix)) return value.as_posix() def init_builtins(self, subproject: str) -> None: # Create builtin options with default values for key, opt in BUILTIN_OPTIONS.items(): self.add_builtin_option(self.options, key.evolve(subproject=subproject), opt) for for_machine in iter(MachineChoice): for key, opt in BUILTIN_OPTIONS_PER_MACHINE.items(): self.add_builtin_option(self.options, key.evolve(subproject=subproject, machine=for_machine), opt) @staticmethod def add_builtin_option(opts_map: 'KeyedOptionDictType', key: OptionKey, opt: 'BuiltinOption') -> None: if key.subproject: if opt.yielding: # This option is global and not per-subproject return value = opts_map[key.as_root()].value else: value = None opts_map[key] = opt.init_option(key, value, default_prefix()) def init_backend_options(self, backend_name: str) -> None: if backend_name == 'ninja': self.options[OptionKey('backend_max_links')] = UserIntegerOption( 'Maximum number of linker processes to run or 0 for no ' 'limit', (0, None, 0)) elif backend_name.startswith('vs'): self.options[OptionKey('backend_startup_project')] = UserStringOption( 'Default project to execute in Visual Studio', '') def get_option(self, key: OptionKey) -> T.Union[str, int, bool, WrapMode]: try: v = self.options[key].value if key.name == 'wrap_mode': return WrapMode[v] return v except KeyError: pass try: v = self.options[key.as_root()] if v.yielding: if key.name == 'wrap_mode': return WrapMode[v.value] return v.value except KeyError: pass raise MesonException(f'Tried to get unknown builtin option {str(key)}') def set_option(self, key: OptionKey, value) -> None: if key.is_builtin(): if key.name == 'prefix': value = self.sanitize_prefix(value) else: prefix = self.options[OptionKey('prefix')].value value = self.sanitize_dir_option_value(prefix, key, value) try: self.options[key].set_value(value) except KeyError: raise MesonException(f'Tried to set unknown builtin option {str(key)}') if key.name == 'buildtype': self._set_others_from_buildtype(value) def get_nondefault_buildtype_args(self): result= [] value = self.options[OptionKey('buildtype')].value if value == 'plain': opt = '0' debug = False elif value == 'debug': opt = '0' debug = True elif value == 'debugoptimized': opt = '2' debug = True elif value == 'release': opt = '3' debug = False elif value == 'minsize': opt = 's' debug = True else: assert(value == 'custom') return [] actual_opt = self.options[OptionKey('optimization')].value actual_debug = self.options[OptionKey('debug')].value if actual_opt != opt: result.append(('optimization', actual_opt, opt)) if actual_debug != debug: result.append(('debug', actual_debug, debug)) return result def _set_others_from_buildtype(self, value: str) -> None: if value == 'plain': opt = '0' debug = False elif value == 'debug': opt = '0' debug = True elif value == 'debugoptimized': opt = '2' debug = True elif value == 'release': opt = '3' debug = False elif value == 'minsize': opt = 's' debug = True else: assert(value == 'custom') return self.options[OptionKey('optimization')].set_value(opt) self.options[OptionKey('debug')].set_value(debug) @staticmethod def is_per_machine_option(optname: OptionKey) -> bool: if optname.name in BUILTIN_OPTIONS_PER_MACHINE: return True return optname.lang is not None def validate_option_value(self, option_name: OptionKey, override_value): try: opt = self.options[option_name] except KeyError: raise MesonException(f'Tried to validate unknown option {str(option_name)}') try: return opt.validate_value(override_value) except MesonException as e: raise type(e)(('Validation failed for option %s: ' % option_name) + str(e)) \ .with_traceback(sys.exc_info()[2]) def get_external_args(self, for_machine: MachineChoice, lang: str) -> T.Union[str, T.List[str]]: return self.options[OptionKey('args', machine=for_machine, lang=lang)].value def get_external_link_args(self, for_machine: MachineChoice, lang: str) -> T.Union[str, T.List[str]]: return self.options[OptionKey('link_args', machine=for_machine, lang=lang)].value def update_project_options(self, options: 'KeyedOptionDictType') -> None: for key, value in options.items(): if not key.is_project(): continue if key not in self.options: self.options[key] = value continue oldval = self.options[key] if type(oldval) != type(value): self.options[key] = value elif oldval.choices != value.choices: # If the choices have changed, use the new value, but attempt # to keep the old options. If they are not valid keep the new # defaults but warn. self.options[key] = value try: value.set_value(oldval.value) except MesonException as e: mlog.warning(f'Old value(s) of {key} are no longer valid, resetting to default ({value.value}).') def is_cross_build(self, when_building_for: MachineChoice = MachineChoice.HOST) -> bool: if when_building_for == MachineChoice.BUILD: return False return len(self.cross_files) > 0 def copy_build_options_from_regular_ones(self) -> None: assert not self.is_cross_build() for k in BUILTIN_OPTIONS_PER_MACHINE: o = self.options[k] self.options[k.as_build()].set_value(o.value) for bk, bv in self.options.items(): if bk.machine is MachineChoice.BUILD: hk = bk.as_host() try: hv = self.options[hk] bv.set_value(hv.value) except KeyError: continue def set_options(self, options: T.Dict[OptionKey, T.Any], subproject: str = '', warn_unknown: bool = True) -> None: if not self.is_cross_build(): options = {k: v for k, v in options.items() if k.machine is not MachineChoice.BUILD} # Set prefix first because it's needed to sanitize other options pfk = OptionKey('prefix') if pfk in options: prefix = self.sanitize_prefix(options[pfk]) self.options[OptionKey('prefix')].set_value(prefix) for key in BULITIN_DIR_NOPREFIX_OPTIONS: if key not in options: self.options[key].set_value(BUILTIN_OPTIONS[key].prefixed_default(key, prefix)) unknown_options: T.List[OptionKey] = [] for k, v in options.items(): if k == pfk: continue elif k not in self.options: unknown_options.append(k) else: self.set_option(k, v) if unknown_options and warn_unknown: unknown_options_str = ', '.join(sorted(str(s) for s in unknown_options)) sub = f'In subproject {subproject}: ' if subproject else '' mlog.warning(f'{sub}Unknown options: "{unknown_options_str}"') mlog.log('The value of new options can be set with:') mlog.log(mlog.bold('meson setup <builddir> --reconfigure -Dnew_option=new_value ...')) if not self.is_cross_build(): self.copy_build_options_from_regular_ones() def set_default_options(self, default_options: T.MutableMapping[OptionKey, str], subproject: str, env: 'Environment') -> None: # Preserve order: if env.options has 'buildtype' it must come after # 'optimization' if it is in default_options. options: T.MutableMapping[OptionKey, T.Any] if not subproject: options = OrderedDict(default_options) options.update(env.options) env.options = options # Create a subset of options, keeping only project and builtin # options for this subproject. # Language and backend specific options will be set later when adding # languages and setting the backend (builtin options must be set first # to know which backend we'll use). options = OrderedDict() for k, v in chain(default_options.items(), env.options.items()): # If this is a subproject, don't use other subproject options if k.subproject and k.subproject != subproject: continue # If the option is a builtin and is yielding then it's not allowed per subproject. # # Always test this using the HOST machine, as many builtin options # are not valid for the BUILD machine, but the yielding value does # not differ between them even when they are valid for both. if subproject and k.is_builtin() and self.options[k.evolve(subproject='', machine=MachineChoice.HOST)].yielding: continue # Skip base, compiler, and backend options, they are handled when # adding languages and setting backend. if k.type in {OptionType.COMPILER, OptionType.BACKEND, OptionType.BASE}: continue options[k] = v self.set_options(options, subproject=subproject) def add_compiler_options(self, options: 'KeyedOptionDictType', lang: str, for_machine: MachineChoice, env: 'Environment') -> None: for k, o in options.items(): value = env.options.get(k) if value is not None: o.set_value(value) self.options.setdefault(k, o) def add_lang_args(self, lang: str, comp: T.Type['Compiler'], for_machine: MachineChoice, env: 'Environment') -> None: """Add global language arguments that are needed before compiler/linker detection.""" from .compilers import compilers # These options are all new at this point, because the compiler is # responsible for adding its own options, thus calling # `self.options.update()`` is perfectly safe. self.options.update(compilers.get_global_options(lang, comp, for_machine, env)) def process_new_compiler(self, lang: str, comp: 'Compiler', env: 'Environment') -> None: from . import compilers self.compilers[comp.for_machine][lang] = comp self.add_compiler_options(comp.get_options(), lang, comp.for_machine, env) enabled_opts: T.List[OptionKey] = [] for key in comp.base_options: if key in self.options: continue oobj = compilers.base_options[key] if key in env.options: oobj.set_value(env.options[key]) enabled_opts.append(key) self.options[key] = oobj self.emit_base_options_warnings(enabled_opts) def emit_base_options_warnings(self, enabled_opts: T.List[OptionKey]) -> None: if OptionKey('b_bitcode') in enabled_opts: mlog.warning('Base option \'b_bitcode\' is enabled, which is incompatible with many linker options. Incompatible options such as \'b_asneeded\' have been disabled.', fatal=False) mlog.warning('Please see https://mesonbuild.com/Builtin-options.html#Notes_about_Apple_Bitcode_support for more details.', fatal=False) class CmdLineFileParser(configparser.ConfigParser): def __init__(self) -> None: # We don't want ':' as key delimiter, otherwise it would break when # storing subproject options like "subproject:option=value" super().__init__(delimiters=['='], interpolation=None) def optionxform(self, option: str) -> str: # Don't call str.lower() on keys return option class MachineFileParser(): def __init__(self, filenames: T.List[str]) -> None: self.parser = CmdLineFileParser() self.constants = {'True': True, 'False': False} self.sections = {} self.parser.read(filenames) # Parse [constants] first so they can be used in other sections if self.parser.has_section('constants'): self.constants.update(self._parse_section('constants')) for s in self.parser.sections(): if s == 'constants': continue self.sections[s] = self._parse_section(s) def _parse_section(self, s): self.scope = self.constants.copy() section = {} for entry, value in self.parser.items(s): if ' ' in entry or '\t' in entry or "'" in entry or '"' in entry: raise EnvironmentException(f'Malformed variable name {entry!r} in machine file.') # Windows paths... value = value.replace('\\', '\\\\') try: ast = mparser.Parser(value, 'machinefile').parse() res = self._evaluate_statement(ast.lines[0]) except MesonException: raise EnvironmentException(f'Malformed value in machine file variable {entry!r}.') except KeyError as e: raise EnvironmentException('Undefined constant {!r} in machine file variable {!r}.'.format(e.args[0], entry)) section[entry] = res self.scope[entry] = res return section def _evaluate_statement(self, node): if isinstance(node, (mparser.StringNode)): return node.value elif isinstance(node, mparser.BooleanNode): return node.value elif isinstance(node, mparser.NumberNode): return node.value elif isinstance(node, mparser.ArrayNode): return [self._evaluate_statement(arg) for arg in node.args.arguments] elif isinstance(node, mparser.IdNode): return self.scope[node.value] elif isinstance(node, mparser.ArithmeticNode): l = self._evaluate_statement(node.left) r = self._evaluate_statement(node.right) if node.operation == 'add': if (isinstance(l, str) and isinstance(r, str)) or \ (isinstance(l, list) and isinstance(r, list)): return l + r elif node.operation == 'div': if isinstance(l, str) and isinstance(r, str): return os.path.join(l, r) raise EnvironmentException('Unsupported node type') def parse_machine_files(filenames): parser = MachineFileParser(filenames) return parser.sections def get_cmd_line_file(build_dir: str) -> str: return os.path.join(build_dir, 'meson-private', 'cmd_line.txt') def read_cmd_line_file(build_dir: str, options: argparse.Namespace) -> None: filename = get_cmd_line_file(build_dir) if not os.path.isfile(filename): return config = CmdLineFileParser() config.read(filename) # Do a copy because config is not really a dict. options.cmd_line_options # overrides values from the file. d = {OptionKey.from_string(k): v for k, v in config['options'].items()} d.update(options.cmd_line_options) options.cmd_line_options = d properties = config['properties'] if not options.cross_file: options.cross_file = ast.literal_eval(properties.get('cross_file', '[]')) if not options.native_file: # This will be a string in the form: "['first', 'second', ...]", use # literal_eval to get it into the list of strings. options.native_file = ast.literal_eval(properties.get('native_file', '[]')) def write_cmd_line_file(build_dir: str, options: argparse.Namespace) -> None: filename = get_cmd_line_file(build_dir) config = CmdLineFileParser() properties = OrderedDict() if options.cross_file: properties['cross_file'] = options.cross_file if options.native_file: properties['native_file'] = options.native_file config['options'] = {str(k): str(v) for k, v in options.cmd_line_options.items()} config['properties'] = properties with open(filename, 'w') as f: config.write(f) def update_cmd_line_file(build_dir: str, options: argparse.Namespace): filename = get_cmd_line_file(build_dir) config = CmdLineFileParser() config.read(filename) config['options'].update({str(k): str(v) for k, v in options.cmd_line_options.items()}) with open(filename, 'w') as f: config.write(f) def get_cmd_line_options(build_dir: str, options: argparse.Namespace) -> str: copy = argparse.Namespace(**vars(options)) read_cmd_line_file(build_dir, copy) cmdline = ['-D{}={}'.format(str(k), v) for k, v in copy.cmd_line_options.items()] if options.cross_file: cmdline += [f'--cross-file {f}' for f in options.cross_file] if options.native_file: cmdline += [f'--native-file {f}' for f in options.native_file] return ' '.join([shlex.quote(x) for x in cmdline]) def major_versions_differ(v1: str, v2: str) -> bool: return v1.split('.')[0:2] != v2.split('.')[0:2] def load(build_dir: str) -> CoreData: filename = os.path.join(build_dir, 'meson-private', 'coredata.dat') load_fail_msg = f'Coredata file {filename!r} is corrupted. Try with a fresh build tree.' try: with open(filename, 'rb') as f: obj = pickle.load(f) except (pickle.UnpicklingError, EOFError): raise MesonException(load_fail_msg) except (ModuleNotFoundError, AttributeError): raise MesonException( "Coredata file {!r} references functions or classes that don't " "exist. This probably means that it was generated with an old " "version of meson.".format(filename)) if not isinstance(obj, CoreData): raise MesonException(load_fail_msg) if major_versions_differ(obj.version, version): raise MesonVersionMismatchException(obj.version, version) return obj def save(obj: CoreData, build_dir: str) -> str: filename = os.path.join(build_dir, 'meson-private', 'coredata.dat') prev_filename = filename + '.prev' tempfilename = filename + '~' if major_versions_differ(obj.version, version): raise MesonException('Fatal version mismatch corruption.') if os.path.exists(filename): import shutil shutil.copyfile(filename, prev_filename) with open(tempfilename, 'wb') as f: pickle.dump(obj, f) f.flush() os.fsync(f.fileno()) os.replace(tempfilename, filename) return filename def register_builtin_arguments(parser: argparse.ArgumentParser) -> None: for n, b in BUILTIN_OPTIONS.items(): b.add_to_argparse(str(n), parser, '') for n, b in BUILTIN_OPTIONS_PER_MACHINE.items(): b.add_to_argparse(str(n), parser, ' (just for host machine)') b.add_to_argparse(str(n.as_build()), parser, ' (just for build machine)') parser.add_argument('-D', action='append', dest='projectoptions', default=[], metavar="option", help='Set the value of an option, can be used several times to set multiple options.') def create_options_dict(options: T.List[str], subproject: str = '') -> T.Dict[OptionKey, str]: result: T.OrderedDict[OptionKey, str] = OrderedDict() for o in options: try: (key, value) = o.split('=', 1) except ValueError: raise MesonException(f'Option {o!r} must have a value separated by equals sign.') k = OptionKey.from_string(key) if subproject: k = k.evolve(subproject=subproject) result[k] = value return result def parse_cmd_line_options(args: argparse.Namespace) -> None: args.cmd_line_options = create_options_dict(args.projectoptions) # Merge builtin options set with --option into the dict. for key in chain( BUILTIN_OPTIONS.keys(), (k.as_build() for k in BUILTIN_OPTIONS_PER_MACHINE.keys()), BUILTIN_OPTIONS_PER_MACHINE.keys(), ): name = str(key) value = getattr(args, name, None) if value is not None: if key in args.cmd_line_options: cmdline_name = BuiltinOption.argparse_name_to_arg(name) raise MesonException( 'Got argument {0} as both -D{0} and {1}. Pick one.'.format(name, cmdline_name)) args.cmd_line_options[key] = value delattr(args, name) _U = T.TypeVar('_U', bound=UserOption[_T]) class BuiltinOption(T.Generic[_T, _U]): """Class for a builtin option type. There are some cases that are not fully supported yet. """ def __init__(self, opt_type: T.Type[_U], description: str, default: T.Any, yielding: bool = True, *, choices: T.Any = None): self.opt_type = opt_type self.description = description self.default = default self.choices = choices self.yielding = yielding def init_option(self, name: 'OptionKey', value: T.Optional[T.Any], prefix: str) -> _U: """Create an instance of opt_type and return it.""" if value is None: value = self.prefixed_default(name, prefix) keywords = {'yielding': self.yielding, 'value': value} if self.choices: keywords['choices'] = self.choices return self.opt_type(self.description, **keywords) def _argparse_action(self) -> T.Optional[str]: # If the type is a boolean, the presence of the argument in --foo form # is to enable it. Disabling happens by using -Dfoo=false, which is # parsed under `args.projectoptions` and does not hit this codepath. if isinstance(self.default, bool): return 'store_true' return None def _argparse_choices(self) -> T.Any: if self.opt_type is UserBooleanOption: return [True, False] elif self.opt_type is UserFeatureOption: return UserFeatureOption.static_choices return self.choices @staticmethod def argparse_name_to_arg(name: str) -> str: if name == 'warning_level': return '--warnlevel' else: return '--' + name.replace('_', '-') def prefixed_default(self, name: 'OptionKey', prefix: str = '') -> T.Any: if self.opt_type in [UserComboOption, UserIntegerOption]: return self.default try: return BULITIN_DIR_NOPREFIX_OPTIONS[name][prefix] except KeyError: pass return self.default def add_to_argparse(self, name: str, parser: argparse.ArgumentParser, help_suffix: str) -> None: kwargs = OrderedDict() c = self._argparse_choices() b = self._argparse_action() h = self.description if not b: h = '{} (default: {}).'.format(h.rstrip('.'), self.prefixed_default(name)) else: kwargs['action'] = b if c and not b: kwargs['choices'] = c kwargs['default'] = argparse.SUPPRESS kwargs['dest'] = name cmdline_name = self.argparse_name_to_arg(name) parser.add_argument(cmdline_name, help=h + help_suffix, **kwargs) # Update `docs/markdown/Builtin-options.md` after changing the options below # Also update mesonlib._BUILTIN_NAMES. See the comment there for why this is required. BUILTIN_DIR_OPTIONS: 'KeyedOptionDictType' = OrderedDict([ (OptionKey('prefix'), BuiltinOption(UserStringOption, 'Installation prefix', default_prefix())), (OptionKey('bindir'), BuiltinOption(UserStringOption, 'Executable directory', 'bin')), (OptionKey('datadir'), BuiltinOption(UserStringOption, 'Data file directory', 'share')), (OptionKey('includedir'), BuiltinOption(UserStringOption, 'Header file directory', 'include')), (OptionKey('infodir'), BuiltinOption(UserStringOption, 'Info page directory', 'share/info')), (OptionKey('libdir'), BuiltinOption(UserStringOption, 'Library directory', default_libdir())), (OptionKey('libexecdir'), BuiltinOption(UserStringOption, 'Library executable directory', default_libexecdir())), (OptionKey('localedir'), BuiltinOption(UserStringOption, 'Locale data directory', 'share/locale')), (OptionKey('localstatedir'), BuiltinOption(UserStringOption, 'Localstate data directory', 'var')), (OptionKey('mandir'), BuiltinOption(UserStringOption, 'Manual page directory', 'share/man')), (OptionKey('sbindir'), BuiltinOption(UserStringOption, 'System executable directory', 'sbin')), (OptionKey('sharedstatedir'), BuiltinOption(UserStringOption, 'Architecture-independent data directory', 'com')), (OptionKey('sysconfdir'), BuiltinOption(UserStringOption, 'Sysconf data directory', 'etc')), ]) BUILTIN_CORE_OPTIONS: 'KeyedOptionDictType' = OrderedDict([ (OptionKey('auto_features'), BuiltinOption(UserFeatureOption, "Override value of all 'auto' features", 'auto')), (OptionKey('backend'), BuiltinOption(UserComboOption, 'Backend to use', 'ninja', choices=backendlist)), (OptionKey('buildtype'), BuiltinOption(UserComboOption, 'Build type to use', 'debug', choices=['plain', 'debug', 'debugoptimized', 'release', 'minsize', 'custom'])), (OptionKey('debug'), BuiltinOption(UserBooleanOption, 'Debug', True)), (OptionKey('default_library'), BuiltinOption(UserComboOption, 'Default library type', 'shared', choices=['shared', 'static', 'both'], yielding=False)), (OptionKey('errorlogs'), BuiltinOption(UserBooleanOption, "Whether to print the logs from failing tests", True)), (OptionKey('install_umask'), BuiltinOption(UserUmaskOption, 'Default umask to apply on permissions of installed files', '022')), (OptionKey('layout'), BuiltinOption(UserComboOption, 'Build directory layout', 'mirror', choices=['mirror', 'flat'])), (OptionKey('optimization'), BuiltinOption(UserComboOption, 'Optimization level', '0', choices=['0', 'g', '1', '2', '3', 's'])), (OptionKey('stdsplit'), BuiltinOption(UserBooleanOption, 'Split stdout and stderr in test logs', True)), (OptionKey('strip'), BuiltinOption(UserBooleanOption, 'Strip targets on install', False)), (OptionKey('unity'), BuiltinOption(UserComboOption, 'Unity build', 'off', choices=['on', 'off', 'subprojects'])), (OptionKey('unity_size'), BuiltinOption(UserIntegerOption, 'Unity block size', (2, None, 4))), (OptionKey('warning_level'), BuiltinOption(UserComboOption, 'Compiler warning level to use', '1', choices=['0', '1', '2', '3'], yielding=False)), (OptionKey('werror'), BuiltinOption(UserBooleanOption, 'Treat warnings as errors', False, yielding=False)), (OptionKey('wrap_mode'), BuiltinOption(UserComboOption, 'Wrap mode', 'default', choices=['default', 'nofallback', 'nodownload', 'forcefallback', 'nopromote'])), (OptionKey('force_fallback_for'), BuiltinOption(UserArrayOption, 'Force fallback for those subprojects', [])), ]) BUILTIN_OPTIONS = OrderedDict(chain(BUILTIN_DIR_OPTIONS.items(), BUILTIN_CORE_OPTIONS.items())) BUILTIN_OPTIONS_PER_MACHINE: 'KeyedOptionDictType' = OrderedDict([ (OptionKey('pkg_config_path'), BuiltinOption(UserArrayOption, 'List of additional paths for pkg-config to search', [])), (OptionKey('cmake_prefix_path'), BuiltinOption(UserArrayOption, 'List of additional prefixes for cmake to search', [])), ]) # Special prefix-dependent defaults for installation directories that reside in # a path outside of the prefix in FHS and common usage. BULITIN_DIR_NOPREFIX_OPTIONS: T.Dict[OptionKey, T.Dict[str, str]] = { OptionKey('sysconfdir'): {'/usr': '/etc'}, OptionKey('localstatedir'): {'/usr': '/var', '/usr/local': '/var/local'}, OptionKey('sharedstatedir'): {'/usr': '/var/lib', '/usr/local': '/var/local/lib'}, } FORBIDDEN_TARGET_NAMES = {'clean': None, 'clean-ctlist': None, 'clean-gcno': None, 'clean-gcda': None, 'coverage': None, 'coverage-text': None, 'coverage-xml': None, 'coverage-html': None, 'phony': None, 'PHONY': None, 'all': None, 'test': None, 'benchmark': None, 'install': None, 'uninstall': None, 'build.ninja': None, 'scan-build': None, 'reconfigure': None, 'dist': None, 'distcheck': None, }
QuLogic/meson
mesonbuild/coredata.py
Python
apache-2.0
52,406
#!/usr/bin/env python3 # -*- coding: UTF-8 -*- # # Easy AVR USB Keyboard Firmware Keymapper # Copyright (C) 2018 David Howland # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program. If not, see <http://www.gnu.org/licenses/>. """The easykeymap package holds the EasyAVR keymapper application.""" from easykeymap.version import version_string __version__ = version_string
dhowland/EasyAVR
keymapper/easykeymap/__init__.py
Python
gpl-2.0
911
import numpy as np import sys import imp try: imp.find_module('pycuda') found_pycuda = True except ImportError: found_pycuda = False try: import mobility_cpp found_cpp = True except ImportError: try: from .mobility import mobility_cpp found_cpp = True except ImportError: pass sys.path.append('../') from . import mobility as mob from general_application_utils import timer if __name__ == '__main__': print('# Start') # Create blobs N = 1000 eta = 7.0 a = 0.13 r_vectors = 5 * a * np.random.rand(N, 3) L = np.array([0., 0., 0.]) # Generate random forces force = np.random.randn(len(r_vectors), 3) # ================================================================ # NO WALL TESTS # ================================================================ timer('zz_no_wall_loops_full_matrix') mobility_no_wall_loops = mob.rotne_prager_tensor_loops(r_vectors, eta, a) u_no_wall_loops_full = np.dot(mobility_no_wall_loops, force.flatten()) timer('zz_no_wall_loops_full_matrix') timer('zz_no_wall_full_matrix') mobility_no_wall = mob.rotne_prager_tensor(r_vectors, eta, a) u_no_wall_full = np.dot(mobility_no_wall, force.flatten()) timer('zz_no_wall_full_matrix') u_no_wall_numba = mob.no_wall_mobility_trans_times_force_numba(r_vectors, force, eta, a) timer('zz_no_wall_numba') u_no_wall_numba = mob.no_wall_mobility_trans_times_force_numba(r_vectors, force, eta, a) timer('zz_no_wall_numba') if found_pycuda: u_no_wall_pycuda = mob.no_wall_mobility_trans_times_force_pycuda(r_vectors, force, eta, a) timer('zz_no_wall_pycuda') u_no_wall_pycuda = mob.no_wall_mobility_trans_times_force_pycuda(r_vectors, force, eta, a) timer('zz_no_wall_pycuda') # ================================================================ # WALL TESTS # ================================================================ timer('python_loops') mobility_loops = mob.single_wall_fluid_mobility_loops(r_vectors, eta, a) u_loops = np.dot(mobility_loops, force.flatten()) timer('python_loops') timer('python') mobility = mob.single_wall_fluid_mobility(r_vectors, eta, a) u = np.dot(mobility, force.flatten()) timer('python') u_numba = mob.single_wall_mobility_trans_times_force_numba(r_vectors, force, eta, a) timer('numba') u_numba = mob.single_wall_mobility_trans_times_force_numba(r_vectors, force, eta, a, periodic_length = L) timer('numba') if found_pycuda: u_gpu = mob.single_wall_mobility_trans_times_force_pycuda(r_vectors, force, eta, a) timer('pycuda') u_gpu = mob.single_wall_mobility_trans_times_force_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('pycuda') if found_cpp: timer('cpp') u_cpp = mob.single_wall_mobility_trans_times_force_cpp(r_vectors, force, eta, a) timer('cpp') if False: np.set_printoptions(precision=6) print('no_wall_numba ', u_no_wall_numba) print('numba ', u_numba) print('pycuda ', u_gpu) print('diff ', u_numba - u_gpu) #print 'mobility_no_wall_loops \n', mobility_no_wall_loops #print 'mobility_no_wall \n', mobility_no_wall print('=================== No wall tests ===================') print('|u_no_wall_full - u_no_wall_loops_full| / |u_no_wall_loops_full| = ', np.linalg.norm(u_no_wall_full - u_no_wall_loops_full) / np.linalg.norm(u_no_wall_loops_full)) if found_pycuda: print('|u_no_wall_pycuda - u_no_wall_loops_full| / |u_no_wall_loops_full| = ', np.linalg.norm(u_no_wall_pycuda - u_no_wall_loops_full) / np.linalg.norm(u_no_wall_loops_full)) print('|u_no_wall_numba - u_no_wall_loops_full| / |u_no_wall_loops_full| = ', np.linalg.norm(u_no_wall_numba - u_no_wall_loops_full) / np.linalg.norm(u_no_wall_loops_full)) print('=================== Wall tests ===================') print('|u - u_loops| / |u_loops| = ', np.linalg.norm(u - u_loops) / np.linalg.norm(u_loops)) print('|u_numba - u_loops| / |u_loops| = ', np.linalg.norm(u_numba - u_loops) / np.linalg.norm(u_loops)) if found_pycuda: print('|u_gpu - u_loops| / |u_loops| = ', np.linalg.norm(u_gpu - u_loops) / np.linalg.norm(u_loops)) if found_cpp: print('|u_cpp - u_loops| / |u_loops| = ', np.linalg.norm(u_cpp - u_loops) / np.linalg.norm(u_loops)) if L[0] > 0. or L[1] > 0.: print('===================== Pseudo-periodic tests =============================') if found_pycuda: print('|u_numba - u_gpu| / |u_gpu| = ', np.linalg.norm(u_numba - u_gpu) / np.linalg.norm(u_gpu)) timer('', print_all=True, clean_all=True) # ========================================================== # Rot tests # ========================================================== print('\n\n\n\n') print('==========================================================') if found_pycuda: timer('u_no_wall_trans_times_torque_gpu') u_no_wall_trans_times_torque_gpu = mob.no_wall_mobility_trans_times_torque_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_trans_times_torque_gpu') u_no_wall_trans_times_torque_numba = mob.no_wall_mobility_trans_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_trans_times_torque_numba') u_no_wall_trans_times_torque_numba = mob.no_wall_mobility_trans_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_trans_times_torque_numba') print('|u_no_wall_trans_times_torque_numba - u_no_wall_trans_times_torque_gpu| / |u_no_wall_trans_times_torque_gpu| = ', \ np.linalg.norm(u_no_wall_trans_times_torque_numba - u_no_wall_trans_times_torque_gpu) / np.linalg.norm(u_no_wall_trans_times_torque_gpu)) u_wall_trans_times_torque_gpu = mob.single_wall_mobility_trans_times_torque_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_wall_trans_times_torque_gpu') u_wall_trans_times_torque_gpu = mob.single_wall_mobility_trans_times_torque_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_wall_trans_times_torque_gpu') u_wall_trans_times_torque_numba = mob.single_wall_mobility_trans_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_wall_trans_times_torque_numba') u_wall_trans_times_torque_numba = mob.single_wall_mobility_trans_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_wall_trans_times_torque_numba') print('|u_wall_trans_times_torque_numba - u_wall_trans_times_torque_gpu| / |u_wall_trans_times_torque_gpu| = ', \ np.linalg.norm(u_wall_trans_times_torque_numba - u_wall_trans_times_torque_gpu) / np.linalg.norm(u_wall_trans_times_torque_gpu)) timer('u_no_wall_rot_times_force_gpu') u_no_wall_rot_times_force_gpu = mob.no_wall_mobility_rot_times_force_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_force_gpu') u_no_wall_rot_times_force_numba = mob.no_wall_mobility_rot_times_force_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_force_numba') u_no_wall_rot_times_force_numba = mob.no_wall_mobility_rot_times_force_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_force_numba') print('|u_no_wall_rot_times_force_numba - u_no_wall_rot_times_force_gpu| / |u_no_wall_rot_times_force_gpu| = ', np.linalg.norm(u_no_wall_rot_times_force_numba - u_no_wall_rot_times_force_gpu) / np.linalg.norm(u_no_wall_rot_times_force_gpu)) timer('u_single_wall_rot_times_force_gpu') u_single_wall_rot_times_force_gpu = mob.single_wall_mobility_rot_times_force_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_force_gpu') u_single_wall_rot_times_force_numba = mob.single_wall_mobility_rot_times_force_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_force_numba') u_single_wall_rot_times_force_numba = mob.single_wall_mobility_rot_times_force_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_force_numba') print('|u_single_wall_rot_times_force_numba - u_single_wall_rot_times_force_gpu| / |u_single_wall_rot_times_force_gpu| = ', np.linalg.norm(u_single_wall_rot_times_force_numba - u_single_wall_rot_times_force_gpu) / np.linalg.norm(u_single_wall_rot_times_force_gpu)) timer('u_no_wall_rot_times_torque_gpu') u_no_wall_rot_times_torque_gpu = mob.no_wall_mobility_rot_times_torque_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_torque_gpu') u_no_wall_rot_times_torque_numba = mob.no_wall_mobility_rot_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_torque_numba') u_no_wall_rot_times_torque_numba = mob.no_wall_mobility_rot_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_no_wall_rot_times_torque_numba') print('|u_no_wall_rot_times_torque_numba - u_no_wall_rot_times_torque_gpu| / |u_no_wall_rot_times_torque_gpu| = ', np.linalg.norm(u_no_wall_rot_times_torque_numba - u_no_wall_rot_times_torque_gpu) / np.linalg.norm(u_no_wall_rot_times_torque_gpu)) timer('u_single_wall_rot_times_force_gpu') u_single_wall_rot_times_torque_gpu = mob.single_wall_mobility_rot_times_torque_pycuda(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_force_gpu') u_single_wall_rot_times_torque_numba = mob.single_wall_mobility_rot_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_torque_numba') u_single_wall_rot_times_torque_numba = mob.single_wall_mobility_rot_times_torque_numba(r_vectors, force, eta, a, periodic_length = L) timer('u_single_wall_rot_times_torque_numba') print('|u_single_wall_rot_times_torque_numba - u_single_wall_rot_times_torque_gpu| / |u_single_wall_rot_times_torque_gpu| = ', np.linalg.norm(u_single_wall_rot_times_torque_numba - u_single_wall_rot_times_torque_gpu) / np.linalg.norm(u_single_wall_rot_times_torque_gpu)) if False: np.set_printoptions(precision=6) print('no_wall = ', u_no_wall_trans_times_torque_gpu) print('gpu = ', u_wall_trans_times_torque_gpu) print('numba = ', u_wall_trans_times_torque_numba) timer('', print_all=True) print('# End')
stochasticHydroTools/RigidMultiblobsWall
mobility/test_blobs.py
Python
gpl-3.0
11,090
# -*- coding: utf-8 -*- # # Copyright (C) 2006-2009 Edgewall Software # All rights reserved. # # This software is licensed as described in the file COPYING, which # you should have received as part of this distribution. The terms # are also available at http://genshi.edgewall.org/wiki/License. # # This software consists of voluntary contributions made by many # individuals. For the exact contribution history, see the revision # history and logs, available at http://genshi.edgewall.org/log/. """Core classes for markup processing.""" try: reduce # builtin in Python < 3 except NameError: from functools import reduce import sys from itertools import chain import operator from genshi.util import plaintext, stripentities, striptags, stringrepr __all__ = ['Stream', 'Markup', 'escape', 'unescape', 'Attrs', 'Namespace', 'QName'] __docformat__ = 'restructuredtext en' class StreamEventKind(str): """A kind of event on a markup stream.""" __slots__ = [] _instances = {} def __new__(cls, val): return cls._instances.setdefault(val, str.__new__(cls, val)) class Stream(object): """Represents a stream of markup events. This class is basically an iterator over the events. Stream events are tuples of the form:: (kind, data, position) where ``kind`` is the event kind (such as `START`, `END`, `TEXT`, etc), ``data`` depends on the kind of event, and ``position`` is a ``(filename, line, offset)`` tuple that contains the location of the original element or text in the input. If the original location is unknown, ``position`` is ``(None, -1, -1)``. Also provided are ways to serialize the stream to text. The `serialize()` method will return an iterator over generated strings, while `render()` returns the complete generated text at once. Both accept various parameters that impact the way the stream is serialized. """ __slots__ = ['events', 'serializer'] START = StreamEventKind('START') #: a start tag END = StreamEventKind('END') #: an end tag TEXT = StreamEventKind('TEXT') #: literal text XML_DECL = StreamEventKind('XML_DECL') #: XML declaration DOCTYPE = StreamEventKind('DOCTYPE') #: doctype declaration START_NS = StreamEventKind('START_NS') #: start namespace mapping END_NS = StreamEventKind('END_NS') #: end namespace mapping START_CDATA = StreamEventKind('START_CDATA') #: start CDATA section END_CDATA = StreamEventKind('END_CDATA') #: end CDATA section PI = StreamEventKind('PI') #: processing instruction COMMENT = StreamEventKind('COMMENT') #: comment def __init__(self, events, serializer=None): """Initialize the stream with a sequence of markup events. :param events: a sequence or iterable providing the events :param serializer: the default serialization method to use for this stream :note: Changed in 0.5: added the `serializer` argument """ self.events = events #: The underlying iterable producing the events self.serializer = serializer #: The default serializion method def __iter__(self): return iter(self.events) def __or__(self, function): """Override the "bitwise or" operator to apply filters or serializers to the stream, providing a syntax similar to pipes on Unix shells. Assume the following stream produced by the `HTML` function: >>> from genshi.input import HTML >>> html = HTML('''<p onclick="alert('Whoa')">Hello, world!</p>''', encoding='utf-8') >>> print(html) <p onclick="alert('Whoa')">Hello, world!</p> A filter such as the HTML sanitizer can be applied to that stream using the pipe notation as follows: >>> from genshi.filters import HTMLSanitizer >>> sanitizer = HTMLSanitizer() >>> print(html | sanitizer) <p>Hello, world!</p> Filters can be any function that accepts and produces a stream (where a stream is anything that iterates over events): >>> def uppercase(stream): ... for kind, data, pos in stream: ... if kind is TEXT: ... data = data.upper() ... yield kind, data, pos >>> print(html | sanitizer | uppercase) <p>HELLO, WORLD!</p> Serializers can also be used with this notation: >>> from genshi.output import TextSerializer >>> output = TextSerializer() >>> print(html | sanitizer | uppercase | output) HELLO, WORLD! Commonly, serializers should be used at the end of the "pipeline"; using them somewhere in the middle may produce unexpected results. :param function: the callable object that should be applied as a filter :return: the filtered stream :rtype: `Stream` """ return Stream(_ensure(function(self)), serializer=self.serializer) def filter(self, *filters): """Apply filters to the stream. This method returns a new stream with the given filters applied. The filters must be callables that accept the stream object as parameter, and return the filtered stream. The call:: stream.filter(filter1, filter2) is equivalent to:: stream | filter1 | filter2 :param filters: one or more callable objects that should be applied as filters :return: the filtered stream :rtype: `Stream` """ return reduce(operator.or_, (self,) + filters) def render(self, method=None, encoding=None, out=None, **kwargs): """Return a string representation of the stream. Any additional keyword arguments are passed to the serializer, and thus depend on the `method` parameter value. :param method: determines how the stream is serialized; can be either "xml", "xhtml", "html", "text", or a custom serializer class; if `None`, the default serialization method of the stream is used :param encoding: how the output string should be encoded; if set to `None`, this method returns a `unicode` object :param out: a file-like object that the output should be written to instead of being returned as one big string; note that if this is a file or socket (or similar), the `encoding` must not be `None` (that is, the output must be encoded) :return: a `str` or `unicode` object (depending on the `encoding` parameter), or `None` if the `out` parameter is provided :rtype: `basestring` :see: XMLSerializer, XHTMLSerializer, HTMLSerializer, TextSerializer :note: Changed in 0.5: added the `out` parameter """ from genshi.output import encode if method is None: method = self.serializer or 'xml' generator = self.serialize(method=method, **kwargs) return encode(generator, method=method, encoding=encoding, out=out) def select(self, path, namespaces=None, variables=None): """Return a new stream that contains the events matching the given XPath expression. >>> from genshi import HTML >>> stream = HTML('<doc><elem>foo</elem><elem>bar</elem></doc>', encoding='utf-8') >>> print(stream.select('elem')) <elem>foo</elem><elem>bar</elem> >>> print(stream.select('elem/text()')) foobar Note that the outermost element of the stream becomes the *context node* for the XPath test. That means that the expression "doc" would not match anything in the example above, because it only tests against child elements of the outermost element: >>> print(stream.select('doc')) <BLANKLINE> You can use the "." expression to match the context node itself (although that usually makes little sense): >>> print(stream.select('.')) <doc><elem>foo</elem><elem>bar</elem></doc> :param path: a string containing the XPath expression :param namespaces: mapping of namespace prefixes used in the path :param variables: mapping of variable names to values :return: the selected substream :rtype: `Stream` :raises PathSyntaxError: if the given path expression is invalid or not supported """ from genshi.path import Path return Path(path).select(self, namespaces, variables) def serialize(self, method='xml', **kwargs): """Generate strings corresponding to a specific serialization of the stream. Unlike the `render()` method, this method is a generator that returns the serialized output incrementally, as opposed to returning a single string. Any additional keyword arguments are passed to the serializer, and thus depend on the `method` parameter value. :param method: determines how the stream is serialized; can be either "xml", "xhtml", "html", "text", or a custom serializer class; if `None`, the default serialization method of the stream is used :return: an iterator over the serialization results (`Markup` or `unicode` objects, depending on the serialization method) :rtype: ``iterator`` :see: XMLSerializer, XHTMLSerializer, HTMLSerializer, TextSerializer """ from genshi.output import get_serializer if method is None: method = self.serializer or 'xml' return get_serializer(method, **kwargs)(_ensure(self)) def __str__(self): return self.render() def __unicode__(self): return self.render(encoding=None) def __html__(self): return self START = Stream.START END = Stream.END TEXT = Stream.TEXT XML_DECL = Stream.XML_DECL DOCTYPE = Stream.DOCTYPE START_NS = Stream.START_NS END_NS = Stream.END_NS START_CDATA = Stream.START_CDATA END_CDATA = Stream.END_CDATA PI = Stream.PI COMMENT = Stream.COMMENT def _ensure(stream): """Ensure that every item on the stream is actually a markup event.""" stream = iter(stream) event = stream.next() # Check whether the iterable is a real markup event stream by examining the # first item it yields; if it's not we'll need to do some conversion if type(event) is not tuple or len(event) != 3: for event in chain([event], stream): if hasattr(event, 'totuple'): event = event.totuple() else: event = TEXT, unicode(event), (None, -1, -1) yield event return # This looks like a markup event stream, so we'll just pass it through # unchanged yield event for event in stream: yield event class Attrs(tuple): """Immutable sequence type that stores the attributes of an element. Ordering of the attributes is preserved, while access by name is also supported. >>> attrs = Attrs([('href', '#'), ('title', 'Foo')]) >>> attrs Attrs([('href', '#'), ('title', 'Foo')]) >>> 'href' in attrs True >>> 'tabindex' in attrs False >>> attrs.get('title') 'Foo' Instances may not be manipulated directly. Instead, the operators ``|`` and ``-`` can be used to produce new instances that have specific attributes added, replaced or removed. To remove an attribute, use the ``-`` operator. The right hand side can be either a string or a set/sequence of strings, identifying the name(s) of the attribute(s) to remove: >>> attrs - 'title' Attrs([('href', '#')]) >>> attrs - ('title', 'href') Attrs() The original instance is not modified, but the operator can of course be used with an assignment: >>> attrs Attrs([('href', '#'), ('title', 'Foo')]) >>> attrs -= 'title' >>> attrs Attrs([('href', '#')]) To add a new attribute, use the ``|`` operator, where the right hand value is a sequence of ``(name, value)`` tuples (which includes `Attrs` instances): >>> attrs | [('title', 'Bar')] Attrs([('href', '#'), ('title', 'Bar')]) If the attributes already contain an attribute with a given name, the value of that attribute is replaced: >>> attrs | [('href', 'http://example.org/')] Attrs([('href', 'http://example.org/')]) """ __slots__ = [] def __contains__(self, name): """Return whether the list includes an attribute with the specified name. :return: `True` if the list includes the attribute :rtype: `bool` """ for attr, _ in self: if attr == name: return True def __getitem__(self, i): """Return an item or slice of the attributes list. >>> attrs = Attrs([('href', '#'), ('title', 'Foo')]) >>> attrs[1] ('title', 'Foo') >>> attrs[1:] Attrs([('title', 'Foo')]) """ items = tuple.__getitem__(self, i) if type(i) is slice: return Attrs(items) return items def __getslice__(self, i, j): """Return a slice of the attributes list. >>> attrs = Attrs([('href', '#'), ('title', 'Foo')]) >>> attrs[1:] Attrs([('title', 'Foo')]) """ return Attrs(tuple.__getslice__(self, i, j)) def __or__(self, attrs): """Return a new instance that contains the attributes in `attrs` in addition to any already existing attributes. Any attributes in the new set that have a value of `None` are removed. :return: a new instance with the merged attributes :rtype: `Attrs` """ remove = set([an for an, av in attrs if av is None]) replace = dict([(an, av) for an, av in attrs if an in self and av is not None]) return Attrs([(sn, replace.get(sn, sv)) for sn, sv in self if sn not in remove] + [(an, av) for an, av in attrs if an not in self and an not in remove]) def __repr__(self): if not self: return 'Attrs()' return 'Attrs([%s])' % ', '.join([repr(item) for item in self]) def __sub__(self, names): """Return a new instance with all attributes with a name in `names` are removed. :param names: the names of the attributes to remove :return: a new instance with the attribute removed :rtype: `Attrs` """ if isinstance(names, basestring): names = (names,) return Attrs([(name, val) for name, val in self if name not in names]) def get(self, name, default=None): """Return the value of the attribute with the specified name, or the value of the `default` parameter if no such attribute is found. :param name: the name of the attribute :param default: the value to return when the attribute does not exist :return: the attribute value, or the `default` value if that attribute does not exist :rtype: `object` """ for attr, value in self: if attr == name: return value return default def totuple(self): """Return the attributes as a markup event. The returned event is a `TEXT` event, the data is the value of all attributes joined together. >>> Attrs([('href', '#'), ('title', 'Foo')]).totuple() ('TEXT', '#Foo', (None, -1, -1)) :return: a `TEXT` event :rtype: `tuple` """ return TEXT, ''.join([x[1] for x in self]), (None, -1, -1) class Markup(unicode): """Marks a string as being safe for inclusion in HTML/XML output without needing to be escaped. """ __slots__ = [] def __add__(self, other): return Markup(unicode.__add__(self, escape(other))) def __radd__(self, other): return Markup(unicode.__add__(escape(other), self)) def __mod__(self, args): if isinstance(args, dict): args = dict(zip(args.keys(), map(escape, args.values()))) elif isinstance(args, (list, tuple)): args = tuple(map(escape, args)) else: args = escape(args) return Markup(unicode.__mod__(self, args)) def __mul__(self, num): return Markup(unicode.__mul__(self, num)) __rmul__ = __mul__ def __repr__(self): return "<%s %s>" % (type(self).__name__, unicode.__repr__(self)) def join(self, seq, escape_quotes=True): """Return a `Markup` object which is the concatenation of the strings in the given sequence, where this `Markup` object is the separator between the joined elements. Any element in the sequence that is not a `Markup` instance is automatically escaped. :param seq: the sequence of strings to join :param escape_quotes: whether double quote characters in the elements should be escaped :return: the joined `Markup` object :rtype: `Markup` :see: `escape` """ return Markup(unicode.join(self, [escape(item, quotes=escape_quotes) for item in seq])) @classmethod def escape(cls, text, quotes=True): """Create a Markup instance from a string and escape special characters it may contain (<, >, & and \"). >>> escape('"1 < 2"') <Markup u'&#34;1 &lt; 2&#34;'> If the `quotes` parameter is set to `False`, the \" character is left as is. Escaping quotes is generally only required for strings that are to be used in attribute values. >>> escape('"1 < 2"', quotes=False) <Markup u'"1 &lt; 2"'> :param text: the text to escape :param quotes: if ``True``, double quote characters are escaped in addition to the other special characters :return: the escaped `Markup` string :rtype: `Markup` """ if not text: return cls() if type(text) is cls: return text if hasattr(text, '__html__'): return cls(text.__html__()) text = text.replace('&', '&amp;') \ .replace('<', '&lt;') \ .replace('>', '&gt;') if quotes: text = text.replace('"', '&#34;') return cls(text) def unescape(self): """Reverse-escapes &, <, >, and \" and returns a `unicode` object. >>> Markup('1 &lt; 2').unescape() u'1 < 2' :return: the unescaped string :rtype: `unicode` :see: `genshi.core.unescape` """ if not self: return '' return unicode(self).replace('&#34;', '"') \ .replace('&gt;', '>') \ .replace('&lt;', '<') \ .replace('&amp;', '&') def stripentities(self, keepxmlentities=False): """Return a copy of the text with any character or numeric entities replaced by the equivalent UTF-8 characters. If the `keepxmlentities` parameter is provided and evaluates to `True`, the core XML entities (``&amp;``, ``&apos;``, ``&gt;``, ``&lt;`` and ``&quot;``) are not stripped. :return: a `Markup` instance with entities removed :rtype: `Markup` :see: `genshi.util.stripentities` """ return Markup(stripentities(self, keepxmlentities=keepxmlentities)) def striptags(self): """Return a copy of the text with all XML/HTML tags removed. :return: a `Markup` instance with all tags removed :rtype: `Markup` :see: `genshi.util.striptags` """ return Markup(striptags(self)) try: from genshi._speedups import Markup except ImportError: pass # just use the Python implementation escape = Markup.escape def unescape(text): """Reverse-escapes &, <, >, and \" and returns a `unicode` object. >>> unescape(Markup('1 &lt; 2')) u'1 < 2' If the provided `text` object is not a `Markup` instance, it is returned unchanged. >>> unescape('1 &lt; 2') '1 &lt; 2' :param text: the text to unescape :return: the unescsaped string :rtype: `unicode` """ if not isinstance(text, Markup): return text return text.unescape() class Namespace(object): """Utility class creating and testing elements with a namespace. Internally, namespace URIs are encoded in the `QName` of any element or attribute, the namespace URI being enclosed in curly braces. This class helps create and test these strings. A `Namespace` object is instantiated with the namespace URI. >>> html = Namespace('http://www.w3.org/1999/xhtml') >>> html Namespace('http://www.w3.org/1999/xhtml') >>> html.uri u'http://www.w3.org/1999/xhtml' The `Namespace` object can than be used to generate `QName` objects with that namespace: >>> html.body QName('http://www.w3.org/1999/xhtml}body') >>> html.body.localname u'body' >>> html.body.namespace u'http://www.w3.org/1999/xhtml' The same works using item access notation, which is useful for element or attribute names that are not valid Python identifiers: >>> html['body'] QName('http://www.w3.org/1999/xhtml}body') A `Namespace` object can also be used to test whether a specific `QName` belongs to that namespace using the ``in`` operator: >>> qname = html.body >>> qname in html True >>> qname in Namespace('http://www.w3.org/2002/06/xhtml2') False """ def __new__(cls, uri): if type(uri) is cls: return uri return object.__new__(cls) def __getnewargs__(self): return (self.uri,) def __getstate__(self): return self.uri def __setstate__(self, uri): self.uri = uri def __init__(self, uri): self.uri = unicode(uri) def __contains__(self, qname): return qname.namespace == self.uri def __ne__(self, other): return not self == other def __eq__(self, other): if isinstance(other, Namespace): return self.uri == other.uri return self.uri == other def __getitem__(self, name): return QName(self.uri + '}' + name) __getattr__ = __getitem__ def __hash__(self): return hash(self.uri) if sys.version_info[0] == 2: # Only use stringrepr in python 2 def __repr__(self): return '%s(%s)' % (type(self).__name__, stringrepr(self.uri)) else: def __repr__(self): return '%s(%r)' % (type(self).__name__, self.uri) def __str__(self): return self.uri.encode('utf-8') def __unicode__(self): return self.uri # The namespace used by attributes such as xml:lang and xml:space XML_NAMESPACE = Namespace('http://www.w3.org/XML/1998/namespace') class QName(unicode): """A qualified element or attribute name. The unicode value of instances of this class contains the qualified name of the element or attribute, in the form ``{namespace-uri}local-name``. The namespace URI can be obtained through the additional `namespace` attribute, while the local name can be accessed through the `localname` attribute. >>> qname = QName('foo') >>> qname QName('foo') >>> qname.localname u'foo' >>> qname.namespace >>> qname = QName('http://www.w3.org/1999/xhtml}body') >>> qname QName('http://www.w3.org/1999/xhtml}body') >>> qname.localname u'body' >>> qname.namespace u'http://www.w3.org/1999/xhtml' """ __slots__ = ['namespace', 'localname'] def __new__(cls, qname): """Create the `QName` instance. :param qname: the qualified name as a string of the form ``{namespace-uri}local-name``, where the leading curly brace is optional """ if type(qname) is cls: return qname qname = qname.lstrip('{') parts = qname.split('}', 1) if len(parts) > 1: self = unicode.__new__(cls, '{%s' % qname) self.namespace, self.localname = map(unicode, parts) else: self = unicode.__new__(cls, qname) self.namespace, self.localname = None, unicode(qname) return self def __getnewargs__(self): return (self.lstrip('{'),) if sys.version_info[0] == 2: # Only use stringrepr in python 2 def __repr__(self): return '%s(%s)' % (type(self).__name__, stringrepr(self.lstrip('{'))) else: def __repr__(self): return '%s(%r)' % (type(self).__name__, self.lstrip('{'))
dag/genshi
genshi/core.py
Python
bsd-3-clause
25,672
# -*- coding: utf-8 -*- # This Source Code Form is subject to the terms of the Mozilla Public # License, v. 2.0. If a copy of the MPL was not distributed with this # file, You can obtain one at http://mozilla.org/MPL/2.0/. from __future__ import absolute_import PROJECT_NAME = 'releng-treestatus' APP_NAME = 'releng_treestatus'
srfraser/services
src/releng_treestatus/releng_treestatus/config.py
Python
mpl-2.0
331
import sys import getopt from src.main import Main def main(argv): __keyword, __path = '', '' try: opts, args = getopt.getopt(argv, 'a:p:', ['list']) except getopt.GetoptError: raise Exception('Something went wrong') sys.exit(2) for opt, arg in opts: if opt == '-a': __keyword = arg elif opt == '-p': __path = arg elif opt == '--list': Main.list() if '-a' in sys.argv[1:]: Main.add_shortcut(__keyword, __path) print('{0} is added with a pass {1}'.format(__keyword, __path)) def execute(__keyword): Main.goto(__keyword) if __name__ == '__main__': args_len = len(sys.argv) if args_len == 2 and '--list' not in sys.argv: execute(sys.argv[1]) else: main(sys.argv[1:])
Artie18/goto
app.py
Python
apache-2.0
823
from rest_framework.response import Response from rest_framework.views import APIView from mymoney.transactions.models import Transaction from .utils import get_currencies class ConfigAPIView(APIView): def get(self, request, *args, **kwargs): return Response({ 'currencies': dict(get_currencies()), 'payment_methods': dict(Transaction.PAYMENT_METHODS), 'statuses': dict(Transaction.STATUSES), })
ychab/mymoney-server
mymoney/core/views.py
Python
bsd-3-clause
457
# encoding: utf-8 import datetime import django from south.db import db from south.v2 import SchemaMigration from django.db import models # Django 1.5+ compatibility if django.VERSION >= (1, 5): from django.contrib.auth import get_user_model else: from django.contrib.auth.models import User def get_user_model(): return User class Migration(SchemaMigration): def forwards(self, orm): # Adding model 'Flag' db.create_table('waffle_flag', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('name', self.gf('django.db.models.fields.CharField')(unique=True, max_length=100)), ('everyone', self.gf('django.db.models.fields.NullBooleanField')(null=True, blank=True)), ('percent', self.gf('django.db.models.fields.DecimalField')(null=True, max_digits=3, decimal_places=1, blank=True)), ('superusers', self.gf('django.db.models.fields.BooleanField')(default=True)), ('staff', self.gf('django.db.models.fields.BooleanField')(default=False)), ('authenticated', self.gf('django.db.models.fields.BooleanField')(default=False)), ('rollout', self.gf('django.db.models.fields.BooleanField')(default=False)), )) db.send_create_signal('waffle', ['Flag']) # Adding M2M table for field groups on 'Flag' db.create_table('waffle_flag_groups', ( ('id', models.AutoField(verbose_name='ID', primary_key=True, auto_created=True)), ('flag', models.ForeignKey(orm['waffle.flag'], null=False)), ('group', models.ForeignKey(orm['auth.group'], null=False)) )) db.create_unique('waffle_flag_groups', ['flag_id', 'group_id']) # Adding M2M table for field users on 'Flag' db.create_table('waffle_flag_users', ( ('id', models.AutoField(verbose_name='ID', primary_key=True, auto_created=True)), ('flag', models.ForeignKey(orm['waffle.flag'], null=False)), ('user', models.ForeignKey(get_user_model(), null=False)) )) db.create_unique('waffle_flag_users', ['flag_id', 'user_id']) # Adding model 'Switch' db.create_table('waffle_switch', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('name', self.gf('django.db.models.fields.CharField')(unique=True, max_length=100)), ('active', self.gf('django.db.models.fields.BooleanField')(default=False)), )) db.send_create_signal('waffle', ['Switch']) def backwards(self, orm): # Deleting model 'Flag' db.delete_table('waffle_flag') # Removing M2M table for field groups on 'Flag' db.delete_table('waffle_flag_groups') # Removing M2M table for field users on 'Flag' db.delete_table('waffle_flag_users') # Deleting model 'Switch' db.delete_table('waffle_switch') models = { 'auth.group': { 'Meta': {'object_name': 'Group'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, 'auth.permission': { 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, 'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, 'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, 'waffle.flag': { 'Meta': {'object_name': 'Flag'}, 'authenticated': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'everyone': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}), 'percent': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '3', 'decimal_places': '1', 'blank': 'True'}), 'rollout': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'superusers': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'users': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.User']", 'symmetrical': 'False', 'blank': 'True'}) }, 'waffle.switch': { 'Meta': {'object_name': 'Switch'}, 'active': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) } } complete_apps = ['waffle']
mark-adams/django-waffle
waffle/south_migrations/0001_initial.py
Python
bsd-3-clause
7,674
############################################################################## # # Copyright (C) 2004-2014 Pexego Sistemas Informáticos All Rights Reserved # $Marta Vázquez Rodríguez$ <[email protected]> # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as published # by the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## from . import models from . import report
Comunitea/CMNT_004_15
project-addons/sale_display_stock/__init__.py
Python
agpl-3.0
1,022
from app.oauth import OAuthSignIn from flask import render_template, flash, redirect, url_for, g from flask.ext.login import login_user, logout_user, current_user, login_required from app import app, db, lm from app.forms import SettingsForm, EventForm from app.models import User, Settings, Event @lm.user_loader def load_user(id): return User.query.get(int(id)) @app.before_request def before_request(): g.user = current_user @app.errorhandler(404) def not_found_error(error): return render_template('404.html'), 404 @app.errorhandler(500) def internal_error(error): db.session.rollback() return render_template('500.html'), 500 @app.route('/') @app.route('/index') def index(): user = g.user return render_template('index.html', title='Home', user=user) @app.route('/authorize/<provider>') def oauth_authorize(provider): if not current_user.is_anonymous(): return redirect(url_for('index')) oauth = OAuthSignIn.get_provider(provider) return oauth.authorize() @app.route('/callback/<provider>') def oauth_callback(provider): if not current_user.is_anonymous(): return redirect(url_for('index')) oauth = OAuthSignIn.get_provider(provider) social_id, username, email = oauth.callback() if social_id is None: flash('Authentication failed.') return redirect(url_for('index')) user = User.query.filter_by(social_id=social_id).first() if not user: user = User(social_id=social_id, nickname=username, email=email) db.session.add(user) db.session.commit() login_user(user, True) return redirect(url_for('index')) @app.route('/logout') def logout(): logout_user() return redirect(url_for('index')) @app.route('/settings') @login_required def settings(): form = SettingsForm() settings_instance = g.user.settings.first() if form.validate_on_submit(): if settings_instance is None: settings_instance = Settings() settings_instance.set_from_dict_form(form.__dict__) settings_instance.User = g.user db.session.add(settings_instance) db.session.commit() flash('Settings saved') return redirect(url_for('index')) if settings_instance is not None: form.set_from_dict_model(settings_instance.__dict__) return render_template('settings.html', form=form) @app.route('/event') def events(): return redirect(url_for('event_list')) @app.route('/event/list', methods=['GET', 'POST']) def event_list(): events = Event.query.all() return render_template('event/list.html', events=events) @app.route('/event/show/<id>') def event_show(id): if id is not None: form = EventForm() event_instance = Event.query.filter_by(id=id).first() form.set_from_dict_model(event_instance.__dict__) return render_template('event/show.html', form=form) else: flash('Unable to find event') return redirect(url_for('event_list')) @app.route('/event/create') def event_create(): return event_edit(None) @app.route('/event/edit/<id>') def event_edit(id): form = EventForm() event_instance = Event() if id is not None: event_instance = Event.query.filter_by(id=id).first() if form.validate_on_submit(): event_instance.set_from_dict_form(form.__dict__) if id is None: event_instance.creator = g.user db.session.add(event_instance) db.session.commit() flash('Event saved') return redirect(url_for('event_list')) if event_instance is not None: form.set_from_dict_model(event_instance.__dict__) render_template('event/edit.html', form=form) @app.route('/event/delete/<id>') def event_delete(id): if id is not None: event = Event.query.filter_by(id=id).first() event.status = 'deleted' flash('Event deleted') return redirect(url_for('event_list')) else: flash('Unable to find event') return redirect(url_for('event_list'))
kozak127/gherkins
app/views.py
Python
mit
4,115
# -*- coding: utf-8 -*- # # Copyright © 2012 - 2015 Michal Čihař <[email protected]> # # This file is part of Weblate <http://weblate.org/> # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # from django.contrib import admin from django.conf import settings from django.utils.translation import ugettext_lazy as _ from weblate.trans.models import ( Project, SubProject, Translation, Advertisement, Unit, Suggestion, Comment, Check, Dictionary, Change, Source, WhiteboardMessage ) class ProjectAdmin(admin.ModelAdmin): list_display = ( 'name', 'slug', 'web', 'owner', 'enable_acl', 'enable_hooks', 'num_vcs', 'num_strings', 'num_words', 'num_langs', ) prepopulated_fields = {'slug': ('name',)} search_fields = ['name', 'slug', 'web'] actions = ['update_from_git', 'update_checks', 'force_commit'] def num_vcs(self, obj): return obj.subproject_set.exclude(repo__startswith='weblate:/').count() num_vcs.short_description = _('VCS repositories') def num_strings(self, obj): return obj.get_total() num_strings.short_description = _('Source strings') def num_words(self, obj): return obj.get_total_words() num_words.short_description = _('Source words') def num_langs(self, obj): return obj.get_language_count() num_langs.short_description = _('Languages') def update_from_git(self, request, queryset): """ Updates selected components from git. """ for project in queryset: project.do_update(request) self.message_user(request, "Updated %d git repos." % queryset.count()) update_from_git.short_description = _('Update VCS repository') def update_checks(self, request, queryset): """ Recalculates checks for selected components. """ cnt = 0 units = Unit.objects.filter( translation__subproject__project__in=queryset ) for unit in units.iterator(): unit.run_checks() cnt += 1 self.message_user(request, "Updated checks for %d units." % cnt) update_checks.short_description = _('Update quality checks') def force_commit(self, request, queryset): """ Commits pending changes for selected components. """ for project in queryset: project.commit_pending(request) self.message_user( request, "Flushed changes in %d git repos." % queryset.count() ) force_commit.short_description = _('Commit pending changes') class SubProjectAdmin(admin.ModelAdmin): list_display = [ 'name', 'slug', 'project', 'repo', 'branch', 'vcs', 'file_format' ] prepopulated_fields = {'slug': ('name',)} search_fields = ['name', 'slug', 'repo', 'branch'] list_filter = ['project', 'vcs', 'file_format'] actions = ['update_from_git', 'update_checks', 'force_commit'] def update_from_git(self, request, queryset): """ Updates selected components from git. """ for project in queryset: project.do_update(request) self.message_user(request, "Updated %d git repos." % queryset.count()) update_from_git.short_description = _('Update VCS repository') def update_checks(self, request, queryset): """ Recalculates checks for selected components. """ cnt = 0 units = Unit.objects.filter( translation__subproject__in=queryset ) for unit in units.iterator(): unit.run_checks() cnt += 1 self.message_user( request, "Updated checks for %d units." % cnt ) update_checks.short_description = _('Update quality checks') def force_commit(self, request, queryset): """ Commits pending changes for selected components. """ for project in queryset: project.commit_pending(request) self.message_user( request, "Flushed changes in %d git repos." % queryset.count() ) force_commit.short_description = _('Commit pending changes') class TranslationAdmin(admin.ModelAdmin): list_display = [ 'subproject', 'language', 'translated', 'total', 'fuzzy', 'revision', 'filename', 'enabled' ] search_fields = [ 'subproject__slug', 'language__code', 'revision', 'filename' ] list_filter = ['enabled', 'subproject__project', 'subproject', 'language'] actions = ['enable_translation', 'disable_translation'] def enable_translation(self, request, queryset): """ Mass enabling of translations. """ queryset.update(enabled=True) self.message_user( request, "Enabled %d translations." % queryset.count() ) def disable_translation(self, request, queryset): """ Mass disabling of translations. """ queryset.update(enabled=False) self.message_user( request, "Disabled %d translations." % queryset.count() ) class UnitAdmin(admin.ModelAdmin): list_display = ['source', 'target', 'position', 'fuzzy', 'translated'] search_fields = ['source', 'target', 'checksum'] list_filter = [ 'translation__subproject', 'translation__language', 'fuzzy', 'translated' ] class SuggestionAdmin(admin.ModelAdmin): list_display = ['contentsum', 'target', 'project', 'language', 'user'] list_filter = ['project', 'language'] search_fields = ['contentsum', 'target'] class CommentAdmin(admin.ModelAdmin): list_display = [ 'contentsum', 'comment', 'user', 'project', 'language', 'user' ] list_filter = ['project', 'language'] search_fields = ['contentsum', 'comment'] class CheckAdmin(admin.ModelAdmin): list_display = ['contentsum', 'check', 'project', 'language', 'ignore'] search_fields = ['contentsum', 'check'] list_filter = ['check', 'project', 'ignore'] class DictionaryAdmin(admin.ModelAdmin): list_display = ['source', 'target', 'project', 'language'] search_fields = ['source', 'target'] list_filter = ['project', 'language'] class ChangeAdmin(admin.ModelAdmin): list_display = ['unit', 'user', 'timestamp'] date_hierarchy = 'timestamp' list_filter = [ 'unit__translation__subproject', 'unit__translation__subproject__project', 'unit__translation__language' ] raw_id_fields = ('unit',) class WhiteboardAdmin(admin.ModelAdmin): list_display = ['message'] prepopulated_fields = {} search_fields = ['message'] class AdvertisementAdmin(admin.ModelAdmin): list_display = ['placement', 'date_start', 'date_end', 'text'] search_fields = ['text', 'note'] date_hierarchy = 'date_end' class SourceAdmin(admin.ModelAdmin): list_display = ['checksum', 'priority', 'timestamp'] date_hierarchy = 'timestamp' # Register in admin interface admin.site.register(Project, ProjectAdmin) admin.site.register(SubProject, SubProjectAdmin) admin.site.register(Advertisement, AdvertisementAdmin) admin.site.register(WhiteboardMessage, WhiteboardAdmin) # Show some controls only in debug mode if settings.DEBUG: admin.site.register(Translation, TranslationAdmin) admin.site.register(Unit, UnitAdmin) admin.site.register(Suggestion, SuggestionAdmin) admin.site.register(Comment, CommentAdmin) admin.site.register(Check, CheckAdmin) admin.site.register(Dictionary, DictionaryAdmin) admin.site.register(Change, ChangeAdmin) admin.site.register(Source, SourceAdmin)
renatofb/weblate
weblate/trans/admin.py
Python
gpl-3.0
8,277
# Copyright (C) 2013, Daniel Narvaez # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA import os from gi.repository import Gtk from dbus.mainloop.glib import DBusGMainLoop DBusGMainLoop(set_as_default=True) from jarabe.desktop.activitieslist import ActivityListPalette tests_dir = os.getcwd() base_dir = os.path.dirname(tests_dir) data_dir = os.path.join(tests_dir, "data") class MockActivityInfo: def get_bundle_id(self): return "mock" def get_activity_version(self): return 1 def get_is_favorite(self): return False def get_icon(self): return os.path.join(data_dir, "activity.svg") def get_name(self): return "mock" def get_path(self): return "mock" def is_user_activity(self): return True os.environ["SUGAR_MIME_DEFAULTS"] = \ os.path.join(base_dir, "data", "mime.defaults") palette = ActivityListPalette(MockActivityInfo()) palette.popup() Gtk.main()
erilyth/sugar
tests/views/activitieslist.py
Python
gpl-2.0
1,613
# Copyright Iris contributors # # This file is part of Iris and is released under the LGPL license. # See COPYING and COPYING.LESSER in the root of the repository for full # licensing details. """Integration tests for loading and saving netcdf files.""" # Import iris.tests first so that some things can be initialised before # importing anything else. import iris.tests as tests # isort:skip from os.path import dirname from os.path import join as path_join from os.path import sep as os_sep import shutil from subprocess import check_call import tempfile import iris from iris.tests import stock class TestClimatology(iris.tests.IrisTest): reference_cdl_path = os_sep.join( [ dirname(tests.__file__), ( "results/integration/climatology/TestClimatology/" "reference_simpledata.cdl" ), ] ) @classmethod def _simple_cdl_string(cls): with open(cls.reference_cdl_path, "r") as f: cdl_content = f.read() # Add the expected CDL first line since this is removed from the # stored results file. cdl_content = "netcdf {\n" + cdl_content return cdl_content @staticmethod def _load_sanitised_cube(filepath): cube = iris.load_cube(filepath) # Remove attributes convention, if any. cube.attributes.pop("Conventions", None) # Remove any var-names. for coord in cube.coords(): coord.var_name = None cube.var_name = None return cube @classmethod def setUpClass(cls): # Create a temp directory for temp files. cls.temp_dir = tempfile.mkdtemp() cls.path_ref_cdl = path_join(cls.temp_dir, "standard.cdl") cls.path_ref_nc = path_join(cls.temp_dir, "standard.nc") # Create reference CDL file. with open(cls.path_ref_cdl, "w") as f_out: f_out.write(cls._simple_cdl_string()) # Create reference netCDF file from reference CDL. command = "ncgen -o {} {}".format(cls.path_ref_nc, cls.path_ref_cdl) check_call(command, shell=True) cls.path_temp_nc = path_join(cls.temp_dir, "tmp.nc") # Create reference cube. cls.cube_ref = stock.climatology_3d() @classmethod def tearDownClass(cls): # Destroy a temp directory for temp files. shutil.rmtree(cls.temp_dir) ############################################################################### # Round-trip tests def test_cube_to_cube(self): # Save reference cube to file, load cube from same file, test against # reference cube. iris.save(self.cube_ref, self.path_temp_nc) cube = self._load_sanitised_cube(self.path_temp_nc) self.assertEqual(cube, self.cube_ref) def test_file_to_file(self): # Load cube from reference file, save same cube to file, test against # reference CDL. cube = iris.load_cube(self.path_ref_nc) iris.save(cube, self.path_temp_nc) self.assertCDL( self.path_temp_nc, reference_filename=self.reference_cdl_path, flags="", ) # NOTE: # The saving half of the round-trip tests is tested in the # appropriate dedicated test class: # unit.fileformats.netcdf.test_Saver.Test_write.test_with_climatology . # The loading half has no equivalent dedicated location, so is tested # here as test_load_from_file. def test_load_from_file(self): # Create cube from file, test against reference cube. cube = self._load_sanitised_cube(self.path_ref_nc) self.assertEqual(cube, self.cube_ref) if __name__ == "__main__": tests.main()
SciTools/iris
lib/iris/tests/integration/test_climatology.py
Python
lgpl-3.0
3,735
name0_1_1_0_1_0_0 = None name0_1_1_0_1_0_1 = None name0_1_1_0_1_0_2 = None name0_1_1_0_1_0_3 = None name0_1_1_0_1_0_4 = None
siosio/intellij-community
python/testData/completion/heavyStarPropagation/lib/_pkg0/_pkg0_1/_pkg0_1_1/_pkg0_1_1_0/_pkg0_1_1_0_1/_mod0_1_1_0_1_0.py
Python
apache-2.0
128
#!/usr/bin/python3 # # pkgvalidator.py # # Copyright (C) 2015 Endless Mobile, Inc. # Authors: # Mario Sanchez Prada <[email protected]> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. import config import gnupg import hashlib import os import re import shutil import utils from gi.repository import GLib from debug import * class PackageValidator: """ Class that allows validating a debian package based on its full URL and the fingerprint of the GPG public key used to sign the source APT repository. """ def __init__(self, uri, fingerprint, temporary_dir=config.TEMPORARY_DIR): self._uri = uri self._fingerprint = fingerprint self._temporary_dir = temporary_dir # Build needed URIs based on the package's full URI. self._release_file_uri = self._getReleaseFileURI() self._release_gpg_uri = self._release_file_uri + '.gpg' self._packages_file_uri = os.path.join(os.path.dirname(self._uri), 'Packages') # We need to make sure the directory for the the trusted.gpg # file exists before starting to use GPG. keyring_basedir = os.path.dirname(config.TRUSTED_KEYRING_FILE) os.makedirs(keyring_basedir, exist_ok=True) self._gpg = gnupg.GPG(keyring=config.TRUSTED_KEYRING_FILE) self._gpg.encoding = 'utf-8' def run(self, localfile=None): """ Run the checks required to validate the debian package, downloading the package from the URI specified in the constructor, unless an absolute path to an already present local file is provided via the localfile parameter. Return True if the debian package could be validated, or False otherwise. """ # If no local file has been specified, we download it from # the URI provided and check if it's valid from there. with_localfile = localfile is not None if not with_localfile: localfile = utils.downloadToTemporaryFile(self._uri) release_file_path = utils.downloadToTemporaryFile(self._release_file_uri, self._temporary_dir) release_gpg_path = utils.downloadToTemporaryFile(self._release_gpg_uri, self._temporary_dir) packages_file_path = utils.downloadToTemporaryFile(self._packages_file_uri, self._temporary_dir) self._importKeyIfNeeded(self._fingerprint) verified = self._verifySignature(release_gpg_path, release_file_path) result = verified and \ self._findHashForFile(release_file_path, packages_file_path, hashlib.sha256) and \ self._findHashForFile(packages_file_path, localfile, hashlib.sha1) os.remove(packages_file_path) os.remove(release_gpg_path) os.remove(release_file_path) if not with_localfile: os.remove(localfile) return result def _getReleaseFileURI(self, suffix=None): try: archive_root_index = self._uri.index('dists') except ValueError: debugprint("Could not find repository root for %s" %self._uri) return '' # URI is something like "$archive_root/dists/$distribution/", # so we need to look for the first '/' after (root_index + 6) # to be able to find the base URL of the distribution. try: dist_index = self._uri.find('/', archive_root_index + 6) except ValueError: debugprint("Could not find distribution base URL for %s" %self._uri) return '' return os.path.join(self._uri[:dist_index], 'Release') def _importKeyIfNeeded(self, key): keys = self._gpg.list_keys() for fp in keys.fingerprints: if fp == key: debugprint("Key %s found in local keyring" % fp) return self._gpg.recv_keys(config.TRUSTED_KEY_SERVER, key) def _verifySignature(self, signature_path, signed_path): signature_bfile = open(signature_path, 'rb') verified = self._gpg.verify_file(signature_bfile, signed_path) signature_bfile.close() if verified.trust_level is not None: debugprint("%s verified with signature %s" % (os.path.basename(signed_path), os.path.basename(signature_path))) return True debugprint("%s could NOT be verified with signature %s" % (os.path.basename(signed_path), os.path.basename(signature_path))) return False def _findHashForFile(self, haystack_path, needle_path, hash_func): needle_bfile = open(needle_path, 'rb') needle_hash = hash_func(needle_bfile.read()) needle_hash_str = needle_hash.hexdigest() needle_bfile.close() debugprint("Hash %s for %s: %s" % (needle_hash.name, needle_path, needle_hash_str)) found = False haystack_file = open(haystack_path, 'r') for line in haystack_file: if re.search(needle_hash_str, line): found = True break haystack_file.close() debugprint("%s hash %sfound in %s" % (os.path.basename(needle_path), ("" if found else "NOT "), os.path.basename(haystack_path))) return found if __name__== "__main__": # Values meant just for debugging purposes. TEST_URL='http://www.openprinting.org/download/printdriver/debian/dists/lsb3.2/main/binary-amd64/openprinting-ppds-postscript-brother_20130226-1lsb3.2_all.deb' TEST_KEY='F8897B6F00075648E248B7EC24CBF5474CFD1E2F' set_debugging(True) # By default every temporary file will be downloaded to config.TEMPORARY_DIR. shutil.rmtree(config.TEMPORARY_DIR, ignore_errors=True) os.makedirs(config.TEMPORARY_DIR, exist_ok=True) validator = PackageValidator(TEST_URL, TEST_KEY) try: debugprint("Validating package without specifying a local file...") if validator.run(): debugprint("OK") else: debugprint("FAIL") except GLib.GError as e: debugprint("EXCEPTION: %s)" % repr(e)) try: debpkg_path = utils.downloadToTemporaryFile(TEST_URL) debugprint("Validating package specifying a local file in %s..." % debpkg_path) if validator.run(localfile=debpkg_path): debugprint("OK") else: debugprint("FAIL") os.remove(debpkg_path) except GLib.GError as e: debugprint("EXCEPTION: %s)" % repr(e)) shutil.rmtree(config.TEMPORARY_DIR, ignore_errors=True)
endlessm/eos-config-printer
pkgvalidator.py
Python
gpl-2.0
7,289
# Copyright (C) 2013-2014 Computer Sciences Corporation # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from gevent import monkey monkey.patch_all() import sys import os import gevent import logging import ezdiscovery from modules import ezRPNginx from modules import ezRPParser from modules import ezRPService from modules import ezRPConfig as gConfig from ezconfiguration.EzConfiguration import EzConfiguration from ezconfiguration.helpers import ZookeeperConfiguration, SystemConfiguration from ezconfiguration.loaders.PropertiesConfigurationLoader import PropertiesConfigurationLoader from ezconfiguration.loaders.DirectoryConfigurationLoader import DirectoryConfigurationLoader from ezconfiguration.constants.EzBakePropertyConstants import EzBakePropertyConstants from ezconfiguration.security.CryptoImplementations import SharedSecretTextCryptoImplementation logger = logging.getLogger('ofe_control') logger.setLevel(logging.INFO) formatter = logging.Formatter('%(asctime)s - %(name)s - %(levelname)s - %(message)s') def log(arg): print(arg) def getEzSecurityServers(): rtn = [] ezdiscovery.connect(gConfig.zk) endpoints = ezdiscovery.get_common_endpoints('EzbakeSecurityService') ezdiscovery.disconnect() for endpoint in endpoints: name,port = endpoint.split(':',1) rtn.append((name,port)) return rtn def getEzProperties(): #load default configurations config = EzConfiguration() logger.info("loaded default ezconfiguration properties") #load configuration overrides overrideLoader = DirectoryConfigurationLoader(gConfig.ezconfig_dir) config = EzConfiguration(PropertiesConfigurationLoader(config.getProperties()), overrideLoader) logger.info("loaded property overrides") #load cryptoImpl cryptoImpl = SystemConfiguration(config.getProperties()).getTextCryptoImplementer() if not isinstance(cryptoImpl, SharedSecretTextCryptoImplementation): logger.warn("Couldn't get a SharedSecretTextCryptoImplementation. Is the EZB shared secret set properly?") return config.getProperties(cryptoImpl) if __name__ == '__main__': parser = ezRPParser.setupParser() args = parser.parse_args() # we're going to run everything from within this packaged application # so we need to find our own path print os.getpid() import logging.handlers wfh = logging.handlers.WatchedFileHandler(os.path.join(gConfig.logDirectory,'ofe_control.log')) wfh.setLevel(logging.INFO) wfh.setFormatter(formatter) logger.addHandler(wfh) gConfig.ezproperties = getEzProperties() if args.external_hostname is not None: gConfig.external_hostname = args.external_hostname else: gConfig.external_hostname = gConfig.ezproperties['external_hostname'] if args.internal_hostname is not None: gConfig.internal_hostname = args.internal_hostname else: gConfig.internal_hostname = gConfig.ezproperties['internal_hostname'] if args.zookeepers is not None: gConfig.zk = args.zookeepers else: gConfig.zk = ZookeeperConfiguration(gConfig.ezproperties).getZookeeperConnectionString() if args.port is not None: gConfig.thriftPort = args.port else: gConfig.thriftPort = gConfig.ezproperties['ofe.port'] gConfig.nginx_worker_username = gConfig.ezproperties['ofe.nginx_worker_username'] gConfig.https_port = gConfig.ezproperties['ofe.https_port'] gConfig.http_port = gConfig.ezproperties['ofe.http_port'] gConfig.max_ca_depth = gConfig.ezproperties['ofe.max_ca_depth'] if 'ofe.crl_file' in gConfig.ezproperties and gConfig.ezproperties['ofe.crl_file'] is not None: gConfig.ssl_crl_file = gConfig.ezproperties['ofe.crl_file'] gConfig.trustedLoadBalancers = gConfig.ezproperties.get('trusted.elastic.load.balancers'); # Drop the parsed argument dictionary into the global config object gConfig.args = args if args.no_clean_on_start: # simply clean up the config and log directories for this instance ezRPNginx.nginx_cleanup_self() else: # shut down all instances of nginx on this box and clean the # config and log directories for this instance ezRPNginx.nginx_cleanup() # do the basic setup ezRPNginx.nginx_basesetup(logger) ezs = ezRPService.EzReverseProxyService(logger) ezs.run() ezRPNginx.nginx_cleanup_self(masterPID=ezRPNginx.get_nginx_master_pid())
ezbake/ezbake-frontend
ezReverseProxy/ezReverseProxy.py
Python
apache-2.0
4,998
# ============================================================================== # Copyright (C) 2011 Diego Duclos # Copyright (C) 2011-2018 Anton Vorobyov # # This file is part of Eos. # # Eos is free software: you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Eos is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public License # along with Eos. If not, see <http://www.gnu.org/licenses/>. # ============================================================================== from eos import Drone from eos import ModuleHigh from eos import Restriction from eos import State from eos.const.eve import AttrId from tests.integration.restriction.testcase import RestrictionTestCase class TestMaxGroupActive(RestrictionTestCase): """Check functionality of max group active restriction.""" def setUp(self): RestrictionTestCase.setUp(self) self.mkattr(attr_id=AttrId.max_group_active) def test_fail_all(self): # Make sure error is raised for all items exceeding their group # restriction item_type = self.mktype( group_id=6, attrs={AttrId.max_group_active: 1}) item1 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item1) item2 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNotNone(error1) self.assertEqual(error1.group_id, 6) self.assertEqual(error1.quantity, 2) self.assertEqual(error1.max_allowed_quantity, 1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNotNone(error2) self.assertEqual(error2.group_id, 6) self.assertEqual(error2.quantity, 2) self.assertEqual(error2.max_allowed_quantity, 1) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_mix_one(self): # Make sure error is raised for just items which excess restriction, # even if both are from the same group item1 = ModuleHigh( self.mktype(group_id=92, attrs={AttrId.max_group_active: 1}).id, state=State.active) self.fit.modules.high.append(item1) item2 = ModuleHigh( self.mktype(group_id=92, attrs={AttrId.max_group_active: 2}).id, state=State.active) self.fit.modules.high.append(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNotNone(error1) self.assertEqual(error1.group_id, 92) self.assertEqual(error1.quantity, 2) self.assertEqual(error1.max_allowed_quantity, 1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNone(error2) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_pass(self): # Make sure no errors are raised when quantity of added items doesn't # exceed any restrictions item_type = self.mktype( group_id=860, attrs={AttrId.max_group_active: 2}) item1 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item1) item2 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNone(error1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNone(error2) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_pass_item_group_none(self): # Check that items with None group are not affected item_type = self.mktype( group_id=None, attrs={AttrId.max_group_active: 1}) item1 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item1) item2 = ModuleHigh(item_type.id, state=State.active) self.fit.modules.high.append(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNone(error1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNone(error2) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_pass_item_state(self): # No errors should occur if items are not active+ item_type = self.mktype( group_id=886, attrs={AttrId.max_group_active: 1}) item1 = ModuleHigh(item_type.id, state=State.online) self.fit.modules.high.append(item1) item2 = ModuleHigh(item_type.id, state=State.online) self.fit.modules.high.append(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNone(error1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNone(error2) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_pass_item_class_other(self): item_type = self.mktype( group_id=12, attrs={AttrId.max_group_active: 1}) item1 = Drone(item_type.id, state=State.active) self.fit.drones.add(item1) item2 = Drone(item_type.id, state=State.active) self.fit.drones.add(item2) # Action error1 = self.get_error(item1, Restriction.max_group_active) # Verification self.assertIsNone(error1) # Action error2 = self.get_error(item2, Restriction.max_group_active) # Verification self.assertIsNone(error2) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0) def test_pass_item_not_loaded(self): item = ModuleHigh(self.allocate_type_id(), state=State.active) self.fit.modules.high.append(item) # Action error = self.get_error(item, Restriction.max_group_active) # Verification self.assertIsNone(error) # Cleanup self.assert_solsys_buffers_empty(self.fit.solar_system) self.assert_log_entries(0)
pyfa-org/eos
tests/integration/restriction/restriction/test_max_group_active.py
Python
lgpl-3.0
7,182
# vim:tw=50 """String Escaping There is no difference between |'| and |"| - they both form equivalent strings. People usually pick one based on preference, changing only to include quotes inside, like this: "Don't touch my quoting." 'I need to "work", now.' Occasionally, you need to include both kinds of quotes inside of a string. In these cases, you can **escape** quotes using a backslash: "This string contains the \\" delimiter." Strings accept other escape sequences, like |'\n'|, which inserts a line feed character, making a new line. More info can be found here: http://docs.python.org/2/reference/lexical_analysis.html#string-literals Exercises - Try creating a string that contains a backslash: it will need to be escaped. """ __doc__ = """A demonstration of escape sequences. This multi-line string is delimited with triple ""\", and tells you that by escaping at least one of them (otherwise the string would end early). """ print "This has a double quote \" inside." print 'This has a single quote \' inside.' print "This has a second line:\n And this is it." print print __doc__ # Where is the backslash?
shiblon/pytour
tutorials/string_escaping.py
Python
apache-2.0
1,145
import zmq import json from . import redis import logging log = logging.getLogger(__name__) def utf(val): """Little helper function which turns strings to utf-8 encoded bytes""" if isinstance(val, str): return val.encode('utf-8') else: return val def blob(val): """Little helper function which turns data into bytes by either encoding or json.dumping them In production it can be a bad practice because you can't send json-dumped string (it will be just encoded). But for our example its fun that we can send pre-serialized data. And you always send json objects anyway, don't you? """ if isinstance(val, (dict, list)): return json.dumps(val).encode('utf-8') elif isinstance(val, str): return val.encode('utf-8') else: return val def cid(val): if hasattr(val, 'cid'): return val.cid assert isinstance(val, (bytes, bytearray)), ("Connection must be bytes " "or object having cid property") return val class Loop(object): def __init__(self): self._ctx = zmq.Context(1) self._poller = zmq.Poller() self._handlers = {} self._redises = {} self._outputs = {} def add_service(self, name, obj, **settings): sock = self._make_socket(zmq.PULL, settings) self._poller.register(sock, zmq.POLLIN) self._handlers[sock] = obj obj.configure(self) def add_output(self, name, **settings): sock = self._make_socket(zmq.PUB, settings) self._outputs[name] = Output(sock) def add_redis(self, name, *, socket): self._redises[name] = redis.Redis(socket_path=socket) def get(self, name): if name in self._outputs: return self._outputs[name] if name in self._redises: return self._redises[name] raise KeyError(name) def _make_socket(self, kind, settings): sock = self._ctx.socket(kind) sock.setsockopt(zmq.HWM, settings.get('hwm', 100)) # TODO(tailhook) implement socket options for i in settings.get('bind', ()): sock.bind(i) for i in settings.get('connect', ()): sock.connect(i) return sock def run(self): while True: socks = self._poller.poll() for s, _ in socks: msg = s.recv_multipart() log.debug("Received from zerogw: %r", msg) self._handlers[s](msg) class Output(object): def __init__(self, sock): self._sock = sock def subscribe(self, conn, topic): self._do_send((b'subscribe', cid(conn), utf(topic))) def unsubscribe(self, conn, topic): self._do_send((b'unsubscribe', cid(conn), utf(topic))) def drop(self, topic): self._do_send((b'drop', utf(topic))) def send(self, conn, data): self._do_send((b'send', cid(conn), blob(data))) def publish(self, topic, data): self._do_send((b'publish', utf(topic), blob(data))) def set_cookie(self, conn, cookie): self._do_send((b'set_cookie', cid(conn), utf(cookie))) def add_output(self, conn, prefix, name): self._do_send((b'add_output', cid(conn), utf(prefix), utf(name))) def del_output(self, conn, prefix, name): self._do_send((b'del_output', cid(conn), utf(prefix), utf(name))) def disconnect(self, conn): self._do_send((b'disconnect', cid(conn))) def _do_send(self, data): log.debug("Sending to zerogw: %r", data) # TODO(tailhook) handle errors self._sock.send_multipart(data)
tailhook/debian-zerogw
examples/tabbedchat/tabbedchat/loop.py
Python
mit
3,628
FILES = [ '../../vhdl_utils/io_utils.vhd', '../../vhdl_utils/txt_util.vhd', '../../../luz_uc_rtl/peripherals/memory/sim_memory_onchip_wb.vhd', '../../../luz_uc_rtl/cpu/defs.vhd', '../../../luz_uc_rtl/cpu/utils.vhd', '../../../luz_uc_rtl/cpu/alu.vhd', '../../../luz_uc_rtl/cpu/controller.vhd', '../../../luz_uc_rtl/cpu/registers.vhd', '../../../luz_uc_rtl/cpu/program_counter.vhd', '../../../luz_uc_rtl/cpu/cpu_top.vhd', 'cpu_top_tb.vhd', ] ################################################################## def do_compile(): import sys sys.path.append('../../python_utils') from VHDLCompiler import VHDLCompiler, VHDLCompileError params = '-work work -quiet -pedanticerrors -2002 -explicit' all = True vc = VHDLCompiler() try: vc.compile_files(FILES, params=params, lib='work', force_compile_all=all) except VHDLCompileError, err: print '!!!! Compile error !!!!' print err if __name__ == '__main__': do_compile()
eliben/luz-cpu
experimental/luz_uc/luz_uc_testbench/cpu/cpu_top/compile.py
Python
unlicense
1,075
# coding=utf-8 # Copyright 2015 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import (absolute_import, division, generators, nested_scopes, print_function, unicode_literals, with_statement) import hashlib import os import pkgutil from pants.backend.python.interpreter_cache import PythonInterpreterCache from pants.backend.python.subsystems.python_setup import PythonSetup from pants.backend.python.targets.python_binary import PythonBinary from pants.backend.python.targets.python_library import PythonLibrary from pants.backend.python.targets.python_target import PythonTarget from pants.backend.python.tasks2.pex_build_util import (dump_requirements, dump_sources, has_python_requirements, has_python_sources) from pants.backend.python.tasks2.python_execution_task_base import WrappedPEX from pants.backend.python.tasks2.resolve_requirements_task_base import ResolveRequirementsTaskBase from pants.base.exceptions import TaskError from pants.base.generator import Generator, TemplateData from pants.base.workunit import WorkUnit, WorkUnitLabel from pants.python.python_repos import PythonRepos from pants.util.dirutil import safe_concurrent_creation, safe_mkdir from pants.util.memo import memoized_method from pex.pex import PEX from pex.pex_builder import PEXBuilder from pex.pex_info import PexInfo class PythonEval(ResolveRequirementsTaskBase): class Error(TaskError): """A richer failure exception type useful for tests.""" def __init__(self, *args, **kwargs): compiled = kwargs.pop('compiled') failed = kwargs.pop('failed') super(PythonEval.Error, self).__init__(*args, **kwargs) self.compiled = compiled self.failed = failed _EXEC_NAME = '__pants_executable__' _EVAL_TEMPLATE_PATH = os.path.join('templates', 'python_eval', 'eval.py.mustache') @classmethod def prepare(cls, options, round_manager): # We don't need an interpreter selected for all targets in play, so prevent one being selected. pass @staticmethod def _is_evalable(target): return isinstance(target, (PythonLibrary, PythonBinary)) deprecated_options_scope = 'compile.python-eval' deprecated_options_scope_removal_version = '1.5.0.dev0' @classmethod def register_options(cls, register): super(PythonEval, cls).register_options(register) register('--skip', type=bool, help='If enabled, skip eval of python targets.') register('--fail-slow', type=bool, help='Compile all targets and present the full list of errors.') register('--closure', type=bool, help='Eval all targets in the closure individually instead of just the targets ' 'specified on the command line.') def execute(self): if self.get_options().skip: return targets = self.context.targets() if self.get_options().closure else self.context.target_roots with self.invalidated(filter(self._is_evalable, targets), invalidate_dependents=True, topological_order=True) as invalidation_check: compiled = self._compile_targets(invalidation_check.invalid_vts) return compiled # Collected and returned for tests @memoized_method def _interpreter_cache(self): interpreter_cache = PythonInterpreterCache(PythonSetup.global_instance(), PythonRepos.global_instance(), logger=self.context.log.debug) # Cache setup's requirement fetching can hang if run concurrently by another pants proc. self.context.acquire_lock() try: interpreter_cache.setup() finally: self.context.release_lock() return interpreter_cache def _compile_targets(self, invalid_vts): with self.context.new_workunit(name='eval-targets', labels=[WorkUnitLabel.MULTITOOL]): compiled = [] failed = [] for vt in invalid_vts: target = vt.target return_code = self._compile_target(vt) if return_code == 0: vt.update() # Ensure partial progress is marked valid. compiled.append(target) else: if self.get_options().fail_slow: failed.append(target) else: raise self.Error('Failed to eval {}'.format(target.address.spec), compiled=compiled, failed=[target]) if failed: msg = 'Failed to evaluate {} targets:\n {}'.format( len(failed), '\n '.join(t.address.spec for t in failed)) raise self.Error(msg, compiled=compiled, failed=failed) return compiled def _compile_target(self, vt): """'Compiles' a python target. 'Compiling' means forming an isolated chroot of its sources and transitive deps and then attempting to import each of the target's sources in the case of a python library or else the entry point in the case of a python binary. For a library with sources lib/core.py and lib/util.py a "compiler" main file would look like: if __name__ == '__main__': import lib.core import lib.util For a binary with entry point lib.bin:main the "compiler" main file would look like: if __name__ == '__main__': from lib.bin import main In either case the main file is executed within the target chroot to reveal missing BUILD dependencies. """ target = vt.target with self.context.new_workunit(name=target.address.spec): modules = self._get_modules(target) if not modules: # Nothing to eval, so a trivial compile success. return 0 interpreter = self._get_interpreter_for_target_closure(target) reqs_pex = self._resolve_requirements_for_versioned_target_closure(interpreter, vt) srcs_pex = self._source_pex_for_versioned_target_closure(interpreter, vt) # Create the executable pex. exec_pex_parent = os.path.join(self.workdir, 'executable_pex') executable_file_content = self._get_executable_file_content(exec_pex_parent, modules) hasher = hashlib.sha1() hasher.update(executable_file_content) exec_file_hash = hasher.hexdigest() exec_pex_path = os.path.realpath(os.path.join(exec_pex_parent, exec_file_hash)) if not os.path.isdir(exec_pex_path): with safe_concurrent_creation(exec_pex_path) as safe_path: # Write the entry point. safe_mkdir(safe_path) with open(os.path.join(safe_path, '{}.py'.format(self._EXEC_NAME)), 'w') as outfile: outfile.write(executable_file_content) pex_info = (target.pexinfo if isinstance(target, PythonBinary) else None) or PexInfo() # Override any user-specified entry point, under the assumption that the # executable_file_content does what the user intends (including, probably, calling that # underlying entry point). pex_info.entry_point = self._EXEC_NAME builder = PEXBuilder(safe_path, interpreter, pex_info=pex_info) builder.freeze() exec_pex = PEX(exec_pex_path, interpreter) extra_pex_paths = [pex.path() for pex in filter(None, [reqs_pex, srcs_pex])] pex = WrappedPEX(exec_pex, extra_pex_paths, interpreter) with self.context.new_workunit(name='eval', labels=[WorkUnitLabel.COMPILER, WorkUnitLabel.RUN, WorkUnitLabel.TOOL], cmd=' '.join(exec_pex.cmdline())) as workunit: returncode = pex.run(stdout=workunit.output('stdout'), stderr=workunit.output('stderr')) workunit.set_outcome(WorkUnit.SUCCESS if returncode == 0 else WorkUnit.FAILURE) if returncode != 0: self.context.log.error('Failed to eval {}'.format(target.address.spec)) return returncode @staticmethod def _get_modules(target): modules = [] if isinstance(target, PythonBinary): source = 'entry_point {}'.format(target.entry_point) components = target.entry_point.rsplit(':', 1) if not all([x.strip() for x in components]): raise TaskError('Invalid entry point {} for target {}'.format( target.entry_point, target.address.spec)) module = components[0] if len(components) == 2: function = components[1] data = TemplateData(source=source, import_statement='from {} import {}'.format(module, function)) else: data = TemplateData(source=source, import_statement='import {}'.format(module)) modules.append(data) else: for path in target.sources_relative_to_source_root(): if path.endswith('.py'): if os.path.basename(path) == '__init__.py': module_path = os.path.dirname(path) else: module_path, _ = os.path.splitext(path) source = 'file {}'.format(os.path.join(target.target_base, path)) module = module_path.replace(os.path.sep, '.') if module: data = TemplateData(source=source, import_statement='import {}'.format(module)) modules.append(data) return modules def _get_executable_file_content(self, exec_pex_parent, modules): generator = Generator(pkgutil.get_data(__name__, self._EVAL_TEMPLATE_PATH), chroot_parent=exec_pex_parent, modules=modules) return generator.render() def _get_interpreter_for_target_closure(self, target): targets = [t for t in target.closure() if isinstance(t, PythonTarget)] return self._interpreter_cache().select_interpreter_for_targets(targets) def _resolve_requirements_for_versioned_target_closure(self, interpreter, vt): reqs_pex_path = os.path.realpath(os.path.join(self.workdir, str(interpreter.identity), vt.cache_key.hash)) if not os.path.isdir(reqs_pex_path): req_libs = filter(has_python_requirements, vt.target.closure()) with safe_concurrent_creation(reqs_pex_path) as safe_path: builder = PEXBuilder(safe_path, interpreter=interpreter, copy=True) dump_requirements(builder, interpreter, req_libs, self.context.log) builder.freeze() return PEX(reqs_pex_path, interpreter=interpreter) def _source_pex_for_versioned_target_closure(self, interpreter, vt): source_pex_path = os.path.realpath(os.path.join(self.workdir, vt.cache_key.hash)) if not os.path.isdir(source_pex_path): with safe_concurrent_creation(source_pex_path) as safe_path: self._build_source_pex(interpreter, safe_path, vt.target.closure()) return PEX(source_pex_path, interpreter=interpreter) def _build_source_pex(self, interpreter, path, targets): builder = PEXBuilder(path=path, interpreter=interpreter, copy=True) for target in targets: if has_python_sources(target): dump_sources(builder, target, self.context.log) builder.freeze()
pombredanne/pants
contrib/python/src/python/pants/contrib/python/checks/tasks2/python_eval.py
Python
apache-2.0
11,131
from anchore_engine.subsys import logger from anchore_engine.subsys.auth.realms import CaseSensitivePermission logger.enable_test_logging() def test_anchore_permissions(): """ Test permission comparisons with mixed-case, wild-cards, etc :return: """ logger.info("Testing permission wildcard matches and mixed-case comparisions") # Default, case-sensitive, exact match assert CaseSensitivePermission(wildcard_string="Account1:listImages:*").implies( CaseSensitivePermission(wildcard_string="Account1:listImages:*") ) # Ignore case assert CaseSensitivePermission( wildcard_string="account1:listImages:*", case_sensitive=False ).implies( CaseSensitivePermission( wildcard_string="Account1:listImages:*", case_sensitive=False ) ) # Mixed case, mismatch assert not CaseSensitivePermission(wildcard_string="account1:listImages:*").implies( CaseSensitivePermission(wildcard_string="Account1:listImages:*") )
anchore/anchore-engine
tests/unit/anchore_engine/subsys/auth/test_permissions.py
Python
apache-2.0
1,020
# coding=utf-8 # -------------------------------------------------------------------------- # Code generated by Microsoft (R) AutoRest Code Generator 1.0.1.0 # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from msrest.serialization import Model class StorageAccountKeys(Model): """The access keys for the storage account. :param key1: Gets the value of key 1. :type key1: str :param key2: Gets the value of key 2. :type key2: str """ _attribute_map = { 'key1': {'key': 'key1', 'type': 'str'}, 'key2': {'key': 'key2', 'type': 'str'}, } def __init__(self, key1=None, key2=None): self.key1 = key1 self.key2 = key2
sergey-shandar/autorest
Samples/2a-validation/Python/storage/models/storage_account_keys.py
Python
mit
800
from libcloud.container.types import Provider from libcloud.container.providers import get_driver cls = get_driver(Provider.KUBERNETES) # 1. Client side cert auth conn = cls(host='192.168.99.103', port=8443, secure=True, key_file='/home/user/.minikube/client.key', cert_file='/home/user/.minikube/client.crt', ca_cert='/home/user/.minikube/ca.crt') # 2. Bearer bootstrap token auth conn = cls(key='my_token', host='126.32.21.4', ex_token_bearer_auth=True) # 3. Basic auth conn = cls(key='my_username', secret='THIS_IS)+_MY_SECRET_KEY+I6TVkv68o4H', host='126.32.21.4') for container in conn.list_containers(): print(container.name) for cluster in conn.list_clusters(): print(cluster.name)
Kami/libcloud
docs/examples/container/kubernetes/instantiate_driver.py
Python
apache-2.0
801
from backend import db from . import models from cruds.crud_courses.models import Courses from cruds.crud_course_section_students.models import CourseSectionStudents from cruds.crud_course_sections.models import CourseSections from cruds.crud_users.models import Users from sqlalchemy import or_, func class Manager: def course_times_by_student(self, course, student): return (db.session.query(func.count(CourseSectionStudents.id)). filter(CourseSectionStudents.course_section_id == CourseSections.id). filter(CourseSections.course_id == Courses.id). filter(Courses.program_id == models.Program.id). filter(models.Program.id == student.program_id). filter(CourseSectionStudents.user_id == student.id). filter(Courses.id == course.id). filter(or_ (CourseSectionStudents.status == 2, CourseSectionStudents.status == 3)). group_by(Courses.code,Courses.program_section).order_by(Courses.program_section).first()) def hours_and_credits_completed(self, student): return (db.session.query(func.sum(Courses.hours), func.sum(Courses.credits)). filter(CourseSectionStudents.course_section_id == CourseSections.id). filter(CourseSections.course_id == Courses.id). filter(Courses.program_id == models.Program.id). filter(models.Program.id == student.program_id). filter(CourseSectionStudents.user_id == student.id). filter(CourseSectionStudents.status == 2). group_by(models.Program.id).first()) def last_course_section_student(self, course, student): return (db.session.query(CourseSectionStudents). filter(CourseSectionStudents.course_section_id == CourseSections.id). filter(CourseSections.course_id == Courses.id). filter(Courses.program_id == models.Program.id). filter(models.Program.id == student.program_id). filter(CourseSectionStudents.user_id == student.id). filter(Courses.id == course.id). order_by(CourseSections.course_section_period.desc()).first()) def programs_users(self, program_id, user_type): return (db.session.query(Users). filter(models.Program.id==Users.program_id). filter(models.Program.id==program_id). filter(Users.type==user_type).all())
sandroandrade/emile-server
cruds/crud_program/manager.py
Python
gpl-3.0
3,163
from __future__ import unicode_literals import argparse import os import io import itertools import csv import shutil from django.db import connection from django.core.management.base import BaseCommand from django.core.management import settings from django.core import management from odm2admin.models import Dataloggerfiles from templatesAndSettings.settings import exportdb #os.environ.setdefault("DJANGO_SETTINGS_MODULE", "templatesAndSettings.settings.exportdb") os.environ['DJANGO_SETTINGS_MODULE'] = "templatesAndSettings.settings.exportdb" __author__ = 'leonmi' parser = argparse.ArgumentParser(description='this command will create an sqlite database dump of the provided JSON files.') # just passing database='export' to loaddata doesn't work because we need to tell models.py to use the correct table names. class Command(BaseCommand): def add_arguments(self, parser): parser.add_argument('jsonfile1', nargs=1, type=str) parser.add_argument('jsonfile2', nargs=1, type=str) parser.add_argument('dbfile', nargs=1, type=str) def handle(self, *args, **options): # (f,fileid, databeginson,columnheaderson, cmd): # cmdline = bool(options['cmdline'][0]) try: jsonfile1 = str(options['jsonfile1'][0]) jsonfile2 = str(options['jsonfile2'][0]) dbfile = str(options['dbfile'][0]) self.stdout.write('start data load') # print('start data load') #f = open('/home/azureadmin/webapps/logs/logfile.txt', 'rw') #f.write('start load data') #f.write(jsonfile1,jsonfile2) exportdb.DATABASES['default']['NAME'] = dbfile # print(connection.settings_dict['NAME']) #f.close() management.call_command('loaddata',jsonfile1) # ,database='export' management.call_command('loaddata',jsonfile2) # print('end data load') except Exception as e: return e
miguelcleon/ODM2-Admin
odm2admin/management/commands/create_sqlite_export.py
Python
mit
1,980
# -*- coding: utf-8 -*- # # QuBricks documentation build configuration file, created by # sphinx-quickstart2 on Thu Mar 12 13:10:30 2015. # # This file is execfile()d with the current directory set to its # containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. import sys import os # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. sys.path.insert(0, os.path.abspath('..')) sys.path.insert(0, os.path.abspath('.')) # -- General configuration ------------------------------------------------ # If your documentation needs a minimal Sphinx version, state it here. #needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.intersphinx', 'sphinx.ext.todo', 'sphinx.ext.coverage', 'sphinx.ext.mathjax', 'sphinx.ext.ifconfig', 'sphinx.ext.viewcode', 'numfig' ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix of source filenames. source_suffix = '.rst' # The encoding of source files. #source_encoding = 'utf-8-sig' # The master toctree document. master_doc = 'index' # General information about the project. project = u'QuBricks' copyright = u'2015, Matthew Wardrop' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. import qubricks version = qubricks.__version__ # The full version, including alpha/beta/rc tags. release = version # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. exclude_patterns = ['_build'] # The reST default role (used for this markup: `text`) to use for all # documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. #add_function_parentheses = True # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # If true, keep warnings as "system message" paragraphs in the built documents. #keep_warnings = False # -- Options for HTML output ---------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. html_theme = 'default' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. #html_theme_options = {} # Add any paths that contain custom themes here, relative to this directory. #html_theme_path = [] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". #html_title = None # A shorter title for the navigation bar. Default is the same as html_title. #html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. #html_favicon = None # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # Add any extra paths that contain custom files (such as robots.txt or # .htaccess) here, relative to this directory. These files are copied # directly to the root of the documentation. #html_extra_path = [] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. #html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. #html_use_smartypants = True # Custom sidebar templates, maps document names to template names. #html_sidebars = {} # Additional templates that should be rendered to pages, maps page names to # template names. #html_additional_pages = {} # If false, no module index is generated. #html_domain_indices = True # If false, no index is generated. #html_use_index = True # If true, the index is split into individual pages for each letter. #html_split_index = False # If true, links to the reST sources are added to the pages. #html_show_sourcelink = True # If true, "Created using Sphinx" is shown in the HTML footer. Default is True. #html_show_sphinx = True # If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. #html_show_copyright = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. #html_use_opensearch = '' # This is the file name suffix for HTML files (e.g. ".xhtml"). #html_file_suffix = None # Output file base name for HTML help builder. htmlhelp_basename = 'QuBricksdoc' # -- Options for LaTeX output --------------------------------------------- latex_elements = { # The paper size ('letterpaper' or 'a4paper'). #'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). #'pointsize': '10pt', # Additional stuff for the LaTeX preamble. #'preamble': '', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ ('index', 'QuBricks.tex', u'QuBricks Documentation', u'Matthew Wardrop', 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. latex_logo = "_static/qubricks_logo.pdf" # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = False # If true, show page references after internal links. #latex_show_pagerefs = False # If true, show URL addresses after external links. #latex_show_urls = False # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_domain_indices = True # -- Options for manual page output --------------------------------------- # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ ('index', 'qubricks', u'QuBricks Documentation', [u'Matthew Wardrop'], 1) ] # If true, show URL addresses after external links. #man_show_urls = False # -- Options for Texinfo output ------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ ('index', 'QuBricks', u'QuBricks Documentation', u'Matthew Wardrop', 'QuBricks', 'One line description of project.', 'Miscellaneous'), ] # Documents to append as an appendix to all manuals. #texinfo_appendices = [] # If false, no module index is generated. #texinfo_domain_indices = True # How to display URL addresses: 'footnote', 'no', or 'inline'. #texinfo_show_urls = 'footnote' # If true, do not generate a @detailmenu in the "Top" node's menu. #texinfo_no_detailmenu = False # Example configuration for intersphinx: refer to the Python standard library. intersphinx_mapping = {'http://docs.python.org/': None}
matthewwardrop/python-qubricks
docs/conf.py
Python
mit
8,595
# coding=utf-8 class bbs_property(): headers= { } host = '172.31.3.73:6020'
NJ-zero/Android
requests_demo/bbs/bbs_property.py
Python
mit
89
r''' Fold the logo of Engineered Folding Research Center --------------------------------------------------- This example shows one possible The target face is defined as horizontal plane at the height 8 and nodes [0,1,2] are involved in the minimum distance criterion. ''' from oricreate.gu import GuConstantLength, GuDofConstraints, fix from oricreate.simulation_step import \ SimulationStep, SimulationConfig def create_cp_factory(): # begin import numpy as np from oricreate.api import CreasePatternState, CustomCPFactory x = np.array([[0, 0, 0], [1, 0, 0], [2, 0, 0], [0, 1, 0], [1, 1, 0], [2, 1, 0], ], dtype='float_') L = np.array([[0, 1], [1, 2], [3, 4], [4, 5], [0, 3], [1, 4], [2, 5]], dtype='int_') F = np.array([[0, 1, 4, 3], [1, 2, 5, 4], ], dtype='int_') x_mid = (x[F[:, 1]] + x[F[:, 3]]) / 2.0 x_mid[:, 2] -= 1.0 n_F = len(F) n_x = len(x) x_mid_i = np.arange(n_x, n_x + n_F) L_mid = np.array([[F[:, 0], x_mid_i[:]], [F[:, 1], x_mid_i[:]], [F[:, 2], x_mid_i[:]], [F[:, 3], x_mid_i[:]]]) L_mid = np.vstack([L_mid[0].T, L_mid[1].T, L_mid[2].T, L_mid[3].T]) x_derived = np.vstack([x, x_mid]) L_derived = np.vstack([L, F[:, (1, 3)], L_mid]) F_derived = np.vstack([F[:, (0, 1, 2)], F[:, (0, 2, 3)]]) cp = CreasePatternState(X=x_derived, L=L_derived, F=F_derived ) cp.u[5, 2] = 0.01 cp_factory = CustomCPFactory(formed_object=cp) # end return cp_factory if __name__ == '__main__': import mayavi.mlab as m cp_factory = create_cp_factory() cp = cp_factory.formed_object # Link the crease factory it with the constraint client gu_constant_length = GuConstantLength() dof_constraints = fix([0], [0, 1, 2]) + fix([1], [1, 2]) + fix([3], [2]) + \ fix([5], 2, lambda t: 0.5) gu_dof_constraints = GuDofConstraints(dof_constraints=dof_constraints) sim_config = SimulationConfig(gu={'cl': gu_constant_length, 'dofs': gu_dof_constraints}, acc=1e-5, MAX_ITER=10) sim_step = SimulationStep(forming_task=cp_factory, config=sim_config) sim_step._solve_nr() m.figure(bgcolor=(1.0, 1.0, 1.0), fgcolor=(0.6, 0.6, 0.6)) cp.plot_mlab(m, nodes=True, lines=True) m.show() import matplotlib.pyplot as plt fig, ax = plt.subplots() cp.plot_mpl(ax, facets=True) plt.tight_layout() plt.show()
simvisage/oricreate
docs/howtos/ex08_rigid_facets/sim02_single_fold_quad.py
Python
gpl-3.0
2,817
from context import nflinterface import pytest import tempfile from flask import json @pytest.fixture def client(request): nflinterface.app.config['TESTING'] = True client = nflinterface.app.test_client() return client def test_app(): assert nflinterface.app != None def test_home(client): response = client.get('/', follow_redirects=True) assert b'nflstats' in response.data def test_get_player(client): payload = { 'last_name':'Brees', 'first_name':'Drew', 'team':'NO'} response = client.post('/get_player', data=json.dumps(payload)) json_data = json.loads(response.data) assert json_data['position'] == 'QB' assert json_data['status'] == 'Active' assert json_data['full_name'] == 'Drew Brees' def test_get_player_all_time_stats(client): payload = { 'id':'00-0022803' } response = client.post('/get_player_all_time_stats', data=json.dumps(payload)) json_data = json.loads(response.data) assert json_data[0]['passing_tds'] == 205 def test_get_player_stats_for_year(client): payload = { 'last_name':'Manning', 'first_name':'Eli', 'team':'NYG', 'year': 2015} response = client.post('/get_player_stats_for_year', data=json.dumps(payload)) json_data = json.loads(response.data) assert json_data[0]['passing_tds'] == 35 def test_get_player_all_time_stats_by_year(client): payload = { 'id':'00-0022803' } response = client.post('/get_player_all_time_stats_by_year', data=json.dumps(payload)) json_data = json.loads(response.data) print len(json_data) assert json_data[6]['passing_tds'] == 35 assert json_data[6]['year'] == 2015 def test_get_team_roster(client): payload = { 'team': 'NO' } response = client.post('/get_team_roster', data=json.dumps(payload)) roster = json.loads(response.data) assert roster[0]['team'] == 'NO' assert roster[0]['status'] == 'Active' def test_fuzzy_player_search(client): payload = { 'name': 'peyton Mannz' } response = client.post('/fuzzy_player_search', data=json.dumps(payload)) players = json.loads(response.data) assert players[0]['full_name'] == 'Peyton Manning' def test_get_all_names(client): response = client.post('/get_all_names') names = json.loads(response.data) assert len(names) == 6778 def test_get_player_from_id(client): payload = { 'id': '00-0027685' } response = client.post('/get_player_from_id', data=json.dumps(payload)) player = json.loads(response.data) assert player['first_name'] == 'Emmanuel'
strandx/nflstats
tests/test_nflinterface.py
Python
mit
2,644
# Copyright (c) 2011, 2012 Free Software Foundation # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # This project incorporates work covered by the following copyright and permission notice: # Copyright (c) 2009, Julien Fache # All rights reserved. # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions # are met: # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in # the documentation and/or other materials provided with the # distribution. # * Neither the name of the author nor the names of other # contributors may be used to endorse or promote products derived # from this software without specific prior written permission. # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS # FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE # COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, # INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES # (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR # SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) # HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, # STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED # OF THE POSSIBILITY OF SUCH DAMAGE. """Views for Gstudio nodetypes""" from django.shortcuts import redirect from django.shortcuts import get_object_or_404 from django.views.generic.list_detail import object_list from django.views.generic.date_based import archive_year from django.views.generic.date_based import archive_month from django.views.generic.date_based import archive_day from django.views.generic.date_based import object_detail from gstudio.models import Nodetype from gstudio.views.decorators import protect_nodetype from gstudio.views.decorators import update_queryset nodetype_index = update_queryset(object_list, Nodetype.objects.all) nodetype_year = update_queryset(archive_year, Nodetype.published.all) nodetype_month = update_queryset(archive_month, Nodetype.published.all) nodetype_day = update_queryset(archive_day, Nodetype.published.all) nodetype_detail = protect_nodetype(object_detail) def nodetype_shortlink(request, object_id): """ Redirect to the 'get_absolute_url' of a nodetype, accordingly to 'object_id' argument """ nodetype = get_object_or_404(Nodetype, pk=object_id) return redirect(nodetype, permanent=True)
gnowledge/ncert_nroer
gstudio/views/nodetypes1.py
Python
agpl-3.0
3,600
""" This is a setup.py script generated by py2applet Usage: python setup.py py2app """ from setuptools import setup APP = ['Burner.py'] DATA_FILES = [] PACKAGES = ['argparse', 'pyserial', 'wxPython'] OPTIONS = {'argv_emulation': False, 'iconfile':'Burner.icns'} setup( app=APP, data_files=DATA_FILES, options={'py2app': OPTIONS}, setup_requires=['py2app'], )
atom3dp/Burner
setup_mac.py
Python
gpl-3.0
383
""" Main routine of GSEA. """ import sys import config from analysis import Analysis def main(args=None): # Determine filenames. if args is None: args = sys.argv[1:] out_name = 'results.csv' # Analyze the data and write the results. A = Analysis(args[0], args[1], config.path['input'], config.analysis) A.analyzefiles(out_name, config.path['output']) if __name__ == "__main__": main()
tristanbrown/gsea
gsea/__main__.py
Python
mit
446
# Copyright 2020 Alfredo de la fuente - AvanzOSC # License AGPL-3.0 or later (https://www.gnu.org/licenses/agpl.html). { "name": "Stock Production Lot With Partner", "version": "12.0.1.0.0", "category": "Customized modules", "license": "AGPL-3", "author": "AvanzOSC", "website": "http://www.avanzosc.es", "depends": [ "sale_stock", "purchase_stock", ], "data": [ "views/stock_production_lot_views.xml", ], "installable": True, }
oihane/odoo-addons
stock_production_lot_with_partner/__manifest__.py
Python
agpl-3.0
497
############################################################################### # Copyright (C) 2008 Johann Haarhoff <[email protected]> # # This program is free software; you can redistribute it and/or modify # it under the terms of Version 2 of the GNU General Public License as # published by the Free Software Foundation. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. # ############################################################################### # # Originally written: # 2008 Johann Haarhoff, <[email protected]> # Modifications: # ############################################################################### import sys, string from xml.sax import saxutils, handler, make_parser # # define the errors we use # class Error(Exception): """ Just Extending Exception """ pass class OutOfOrderError(Error): """ Thrown when you close a xml tag before all its children are closed """ pass class TagNotOpenError(Error): """ Thrown when trying to close a tag that is not open """ class BasicXMLWriter(handler.ContentHandler): """ This just inherits from handler.ContentHandler and allows basic output with indents etc. """ def __init__(self, out = sys.stdout,indentstr = '\t'): handler.ContentHandler.__init__(self) self._out = out self._indentlevel = 0 self._printnl = 1 self._indentstr = indentstr # ContentHandler methods def startDocument(self): self._out.write('<?xml version="1.0" encoding="iso-8859-1"?>\n') def startElement(self, name, attrs): self._out.write('\n'+self._indentstr*self._indentlevel + '<' + name) for (name, value) in attrs.items(): self._out.write(' %s="%s"' % (name, saxutils.escape(value))) self._out.write('>') self._indentlevel = self._indentlevel + 1 def endElement(self, name): self._indentlevel = self._indentlevel - 1 if self._printnl: self._out.write('\n' + self._indentstr*self._indentlevel + '</%s>' % name) else: self._out.write('</%s>' % name) self._printnl=1 def characters(self, content): self._out.write(saxutils.escape(content)) self._printnl = 0; def ignorableWhitespace(self, content): self._out.write(content) def processingInstruction(self, target, data): self._out.write('<?%s %s?>' % (target, data)) class BetterXMLWriter(BasicXMLWriter): """ This makes life a bit easier by making sure the xml is relatively intact, it checks for closing tags out of order, and closing tags that have not been opened It also overrides endDocument to close the remaining open tags in the correct order. """ def __init__(self, out = sys.stdout,indentstr = '\t'): BasicXMLWriter.__init__(self,out,indentstr) self._openElements = [] def openElement(self,name,attrs={}): self.startElement(name,attrs) self._openElements.append(name) def closeLast(self): """ Closes the last open tag """ self.endElement(self._openElements.pop()) def closeElement(self,name): if not (name in self._openElements): raise TagNotOpenError() #print 'TagNotOpenError()' elif not (name == self._openElements[len(self._openElements)-1]): raise OutOfOrderError() #print 'OutOfOrderError()' else: self.endElement(name) self._openElements.pop() def addData(self,content): """ this is truly just here because i think addData() is more descriptive than characters """ self.characters(content) def addCData(self,content): """ allows us to add CDATA sections """ self._out.write('<![CDATA[') self._out.write(content) self._out.write(']]>') def endDocument(self): for i in range(0,len(self._openElements)): self.endElement(self._openElements.pop())
djhenderson/shape2ge
src/xmlwriter.py
Python
gpl-2.0
4,246
import sys import base64 import os import pytest import shutil import subprocess import yaml yaml_loader = yaml.SafeLoader yaml_dumper = yaml.SafeDumper try: yaml_loader = yaml.CSafeLoader yaml_dumper = yaml.CSafeDumper except AttributeError: pass from typing import Any, ClassVar, Dict, List, Optional, Sequence from typing import cast as typecast from kat.harness import abstract_test, sanitize, Name, Node, Test, Query, load_manifest from kat.utils import ShellCommand RBAC_CLUSTER_SCOPE = load_manifest("rbac_cluster_scope") RBAC_NAMESPACE_SCOPE = load_manifest("rbac_namespace_scope") AMBASSADOR = load_manifest("ambassador") BACKEND = load_manifest("backend") GRPC_ECHO_BACKEND = load_manifest("grpc_echo_backend") AUTH_BACKEND = load_manifest("auth_backend") GRPC_AUTH_BACKEND = load_manifest("grpc_auth_backend") GRPC_RLS_BACKEND = load_manifest("grpc_rls_backend") AMBASSADOR_LOCAL = """ --- apiVersion: v1 kind: Secret metadata: name: {self.path.k8s} annotations: kubernetes.io/service-account.name: {self.path.k8s} type: kubernetes.io/service-account-token """ def assert_default_errors(errors, include_ingress_errors=True): default_errors = [ ["", "Ambassador could not find core CRD definitions. Please visit https://www.getambassador.io/docs/edge-stack/latest/topics/install/upgrade-to-edge-stack/#5-update-and-restart for more information. You can continue using Ambassador via Kubernetes annotations, any configuration via CRDs will be ignored..."], ["", "Ambassador could not find Resolver type CRD definitions. Please visit https://www.getambassador.io/docs/edge-stack/latest/topics/install/upgrade-to-edge-stack/#5-update-and-restart for more information. You can continue using Ambassador via Kubernetes annotations, any configuration via CRDs will be ignored..."], ["", "Ambassador could not find the Host CRD definition. Please visit https://www.getambassador.io/docs/edge-stack/latest/topics/install/upgrade-to-edge-stack/#5-update-and-restart for more information. You can continue using Ambassador via Kubernetes annotations, any configuration via CRDs will be ignored..."], ["", "Ambassador could not find the LogService CRD definition. Please visit https://www.getambassador.io/docs/edge-stack/latest/topics/install/upgrade-to-edge-stack/#5-update-and-restart for more information. You can continue using Ambassador via Kubernetes annotations, any configuration via CRDs will be ignored..."] ] if include_ingress_errors: default_errors.append( ["", "Ambassador is not permitted to read Ingress resources. Please visit https://www.getambassador.io/docs/edge-stack/latest/topics/running/ingress-controller/#ambassador-as-an-ingress-controller for more information. You can continue using Ambassador, but Ingress resources will be ignored..." ] ) number_of_default_errors = len(default_errors) if errors[:number_of_default_errors] != default_errors: assert False, f"default error table mismatch: got\n{errors}" for error in errors[number_of_default_errors:]: assert 'found invalid port' in error[1], "Could not find 'found invalid port' in the error {}".format(error[1]) DEV = os.environ.get("AMBASSADOR_DEV", "0").lower() in ("1", "yes", "true") @abstract_test class AmbassadorTest(Test): """ AmbassadorTest is a top level ambassador test. """ OFFSET: ClassVar[int] = 0 IMAGE_BUILT: ClassVar[bool] = False _index: Optional[int] = None _ambassador_id: Optional[str] = None single_namespace: bool = False disable_endpoints: bool = False name: Name path: Name extra_ports: Optional[List[int]] = None debug_diagd: bool = True debug_envoy: bool = False manifest_envs = "" is_ambassador = True allow_edge_stack_redirect = False edge_stack_cleartext_host = True envoy_api_version = None env = [] def manifests(self) -> str: rbac = RBAC_CLUSTER_SCOPE self.manifest_envs += """ - name: POLL_EVERY_SECS value: "0" - name: CONSUL_WATCHER_PORT value: "8500" """ if os.environ.get('AMBASSADOR_LEGACY_MODE', 'false').lower() == 'true': self.manifest_envs += """ - name: AMBASSADOR_LEGACY_MODE value: "true" """ if os.environ.get('AMBASSADOR_FAST_RECONFIGURE', 'false').lower() == 'true': self.manifest_envs += """ - name: AMBASSADOR_FAST_RECONFIGURE value: "true" """ amb_debug = [] if self.debug_diagd: amb_debug.append("diagd") if self.debug_envoy: amb_debug.append("envoy") if amb_debug: self.manifest_envs += """ - name: AMBASSADOR_DEBUG value: "%s" """ % ":".join(amb_debug) if self.ambassador_id: self.manifest_envs += f""" - name: AMBASSADOR_LABEL_SELECTOR value: "kat-ambassador-id={self.ambassador_id}" """ if self.single_namespace: self.manifest_envs += """ - name: AMBASSADOR_SINGLE_NAMESPACE value: "yes" """ rbac = RBAC_NAMESPACE_SCOPE if self.disable_endpoints: self.manifest_envs += """ - name: AMBASSADOR_DISABLE_ENDPOINTS value: "yes" """ if not self.allow_edge_stack_redirect: self.manifest_envs += """ - name: AMBASSADOR_NO_TLS_REDIRECT value: "yes" """ if self.envoy_api_version is not None: self.manifest_envs += f""" - name: AMBASSADOR_ENVOY_API_VERSION value: "{self.envoy_api_version}" """ elif os.environ.get('KAT_USE_ENVOY_V3', '') != '': self.manifest_envs += """ - name: AMBASSADOR_ENVOY_API_VERSION value: "V3" """ eports = "" if self.extra_ports: for port in self.extra_ports: eports += f""" - name: extra-{port} protocol: TCP port: {port} targetPort: {port} """ if DEV: return self.format(rbac + AMBASSADOR_LOCAL, extra_ports=eports) else: return self.format(rbac + AMBASSADOR, image=os.environ["AMBASSADOR_DOCKER_IMAGE"], envs=self.manifest_envs, extra_ports=eports, capabilities_block = "") # Will tear this out of the harness shortly @property def ambassador_id(self) -> str: if self._ambassador_id is None: return self.name.k8s else: return typecast(str, self._ambassador_id) @ambassador_id.setter def ambassador_id(self, val: str) -> None: self._ambassador_id = val @property def index(self) -> int: if self._index is None: # lock here? self._index = AmbassadorTest.OFFSET AmbassadorTest.OFFSET += 1 return typecast(int, self._index) def post_manifest(self): if not DEV: return if os.environ.get('KAT_SKIP_DOCKER'): return image = os.environ["AMBASSADOR_DOCKER_IMAGE"] cached_image = os.environ["BASE_PY_IMAGE"] ambassador_base_image = os.environ["BASE_GO_IMAGE"] if not AmbassadorTest.IMAGE_BUILT: AmbassadorTest.IMAGE_BUILT = True cmd = ShellCommand('docker', 'ps', '-a', '-f', 'label=kat-family=ambassador', '--format', '{{.ID}}') if cmd.check('find old docker container IDs'): ids = cmd.stdout.split('\n') while ids: if ids[-1]: break ids.pop() if ids: print("Killing old containers...") ShellCommand.run('kill old containers', 'docker', 'kill', *ids, verbose=True) ShellCommand.run('rm old containers', 'docker', 'rm', *ids, verbose=True) context = os.path.dirname(os.path.dirname(os.path.dirname(__file__))) print("Starting docker build...", end="") sys.stdout.flush() cmd = ShellCommand("docker", "build", "--build-arg", "BASE_PY_IMAGE={}".format(cached_image), "--build-arg", "BASE_GO_IMAGE={}".format(ambassador_base_image), context, "-t", image) if cmd.check("docker build Ambassador image"): print("done.") else: pytest.exit("container failed to build") fname = "/tmp/k8s-%s.yaml" % self.path.k8s if os.path.exists(fname): with open(fname) as fd: content = fd.read() else: nsp = getattr(self, 'namespace', None) or 'default' cmd = ShellCommand("kubectl", "get", "-n", nsp, "-o", "yaml", "secret", self.path.k8s) if not cmd.check(f'fetch secret for {self.path.k8s}'): pytest.exit(f'could not fetch secret for {self.path.k8s}') content = cmd.stdout with open(fname, "wb") as fd: fd.write(content.encode('utf-8')) try: secret = yaml.load(content, Loader=yaml_loader) except Exception as e: print("could not parse YAML:\n%s" % content) raise e data = secret['data'] # secret_dir = tempfile.mkdtemp(prefix=self.path.k8s, suffix="secret") secret_dir = "/tmp/%s-ambassadormixin-%s" % (self.path.k8s, 'secret') shutil.rmtree(secret_dir, ignore_errors=True) os.mkdir(secret_dir, 0o777) for k, v in data.items(): with open(os.path.join(secret_dir, k), "wb") as f: f.write(base64.decodebytes(bytes(v, "utf8"))) print("Launching %s container." % self.path.k8s) command = ["docker", "run", "-d", "-l", "kat-family=ambassador", "--name", self.path.k8s] envs = [ "KUBERNETES_SERVICE_HOST=kubernetes", "KUBERNETES_SERVICE_PORT=443", "AMBASSADOR_SNAPSHOT_COUNT=1", "AMBASSADOR_CONFIG_BASE_DIR=/tmp/ambassador", "POLL_EVERY_SECS=0", "CONSUL_WATCHER_PORT=8500", "AMBASSADOR_UPDATE_MAPPING_STATUS=false", "AMBASSADOR_ID=%s" % self.ambassador_id] if self.namespace: envs.append("AMBASSADOR_NAMESPACE=%s" % self.namespace) if self.single_namespace: envs.append("AMBASSADOR_SINGLE_NAMESPACE=yes") if self.disable_endpoints: envs.append("AMBASSADOR_DISABLE_ENDPOINTS=yes") amb_debug = [] if self.debug_diagd: amb_debug.append("diagd") if self.debug_envoy: amb_debug.append("envoy") if amb_debug: envs.append("AMBASSADOR_DEBUG=%s" % ":".join(amb_debug)) envs.extend(self.env) [command.extend(["-e", env]) for env in envs] ports = ["%s:8877" % (8877 + self.index), "%s:8001" % (8001 + self.index), "%s:8080" % (8080 + self.index), "%s:8443" % (8443 + self.index)] if self.extra_ports: for port in self.extra_ports: ports.append(f'{port}:{port}') [command.extend(["-p", port]) for port in ports] volumes = ["%s:/var/run/secrets/kubernetes.io/serviceaccount" % secret_dir] [command.extend(["-v", volume]) for volume in volumes] command.append(image) if os.environ.get('KAT_SHOW_DOCKER'): print(" ".join(command)) cmd = ShellCommand(*command) if not cmd.check(f'start container for {self.path.k8s}'): pytest.exit(f'could not start container for {self.path.k8s}') def queries(self): if DEV: cmd = ShellCommand("docker", "ps", "-qf", "name=%s" % self.path.k8s) if not cmd.check(f'docker check for {self.path.k8s}'): if not cmd.stdout.strip(): log_cmd = ShellCommand("docker", "logs", self.path.k8s, stderr=subprocess.STDOUT) if log_cmd.check(f'docker logs for {self.path.k8s}'): print(cmd.stdout) pytest.exit(f'container failed to start for {self.path.k8s}') return () def scheme(self) -> str: return "http" def url(self, prefix, scheme=None, port=None) -> str: if scheme is None: scheme = self.scheme() if DEV: if not port: port = 8443 if scheme == 'https' else 8080 port += self.index return "%s://%s/%s" % (scheme, "localhost:%s" % port, prefix) else: host_and_port = self.path.fqdn if port: host_and_port += f':{port}' return "%s://%s/%s" % (scheme, host_and_port, prefix) def requirements(self): yield ("url", Query(self.url("ambassador/v0/check_ready"))) yield ("url", Query(self.url("ambassador/v0/check_alive"))) @abstract_test class ServiceType(Node): path: Name _manifests: Optional[str] use_superpod: bool = True def __init__(self, service_manifests: str=None, namespace: str=None, *args, **kwargs) -> None: super().__init__(namespace=namespace, *args, **kwargs) self._manifests = service_manifests if self._manifests: self.use_superpod = False def config(self): yield from () def manifests(self): if self.use_superpod: return None return self.format(self._manifests) def requirements(self): if self.use_superpod: yield from () yield ("url", Query("http://%s" % self.path.fqdn)) yield ("url", Query("https://%s" % self.path.fqdn)) @abstract_test class ServiceTypeGrpc(Node): path: Name def __init__(self, service_manifests: str=None, *args, **kwargs) -> None: super().__init__(*args, **kwargs) self._manifests = service_manifests or BACKEND def config(self): yield from () def manifests(self): return self.format(self._manifests) def requirements(self): yield ("url", Query("http://%s" % self.path.fqdn)) yield ("url", Query("https://%s" % self.path.fqdn)) class HTTP(ServiceType): pass class GRPC(ServiceType): pass class EGRPC(ServiceType): skip_variant: ClassVar[bool] = True def __init__(self, *args, **kwargs) -> None: super().__init__(*args, service_manifests=GRPC_ECHO_BACKEND, **kwargs) def requirements(self): yield ("url", Query("http://%s/echo.EchoService/Echo" % self.path.fqdn, headers={ "content-type": "application/grpc", "requested-status": "0" }, expected=200, grpc_type="real")) class AHTTP(ServiceType): skip_variant: ClassVar[bool] = True def __init__(self, *args, **kwargs) -> None: super().__init__(*args, service_manifests=AUTH_BACKEND, **kwargs) class AGRPC(ServiceType): skip_variant: ClassVar[bool] = True def __init__(self, protocol_version: str="v2", *args, **kwargs) -> None: self.protocol_version = protocol_version super().__init__(*args, service_manifests=GRPC_AUTH_BACKEND, **kwargs) def requirements(self): yield ("pod", self.path.k8s) class RLSGRPC(ServiceType): skip_variant: ClassVar[bool] = True def __init__(self, protocol_version: str="v2", *args, **kwargs) -> None: self.protocol_version = protocol_version super().__init__(*args, service_manifests=GRPC_RLS_BACKEND, **kwargs) def requirements(self): yield ("pod", self.path.k8s) @abstract_test class MappingTest(Test): target: ServiceType options: Sequence['OptionTest'] parent: AmbassadorTest no_local_mode = True skip_local_instead_of_xfail = "Plain (MappingTest)" def init(self, target: ServiceType, options=()) -> None: self.target = target self.options = list(options) self.is_ambassador = True @abstract_test class OptionTest(Test): VALUES: ClassVar[Any] = None value: Any parent: Test no_local_mode = True skip_local_instead_of_xfail = "Plain (OptionTests)" @classmethod def variants(cls): if cls.VALUES is None: yield cls() else: for val in cls.VALUES: yield cls(val, name=sanitize(val)) def init(self, value=None): self.value = value
datawire/ambassador
python/tests/kat/abstract_tests.py
Python
apache-2.0
16,480
""" WSGI config for roomfinder project. It exposes the WSGI callable as a module-level variable named ``application``. For more information on this file, see https://docs.djangoproject.com/en/1.8/howto/deployment/wsgi/ """ import os from django.core.wsgi import get_wsgi_application os.environ.setdefault("DJANGO_SETTINGS_MODULE", "roomfinder.settings") application = get_wsgi_application()
thyagostall/roomfinder
server/roomfinder/wsgi.py
Python
gpl-2.0
397
# -*- coding: utf-8 -*- # Generated by Django 1.11.2 on 2017-07-03 13:45 from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('frontend', '0001_initial'), ] operations = [ migrations.AlterField( model_name='frontenddeployment', name='deployed_at', field=models.DateTimeField(auto_now=True), ), ]
sussexstudent/falmer
falmer/frontend/migrations/0002_auto_20170703_1345.py
Python
mit
462
# Copyright 2018 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from pants.base.build_environment import pants_version from pants.version import VERSION as _VERSION from pants.testutil.test_base import TestBase class PantsPluginPantsRequirementTest(TestBase): def test_version(self): self.assertEqual(pants_version(), _VERSION)
tdyas/pants
testprojects/pants-plugins/tests/python/test_pants_plugin/test_pants_plugin_pants_requirement.py
Python
apache-2.0
404
#!/usr/bin/env python2 # -*- coding: utf-8 -*- # Copyright (c) 2014 CarlLee # Copyright (c) 2015 Troels Kofoed Jacobsen # Thanks to CarlLee for providing this file under the MIT license # https://github.com/CarlLee/ENML_PY import os from bs4 import BeautifulSoup MIME_TO_EXTESION_MAPPING = { 'image/png': '.png', 'image/jpg': '.jpg', 'image/jpeg': '.jpg', 'image/gif': '.gif' } def enmltohtml(content, pretty=True, header=True, **kwargs): """ converts ENML string into HTML string :param header: If True, note is wrapped in a <HTML><BODY> block. :type header: bool """ soup = BeautifulSoup(content, 'html.parser') todos = soup.find_all('en-todo') for todo in todos: checkbox = soup.new_tag('input') checkbox['type'] = 'checkbox' checkbox['disabled'] = 'true' if todo.has_attr('checked'): checkbox['checked'] = todo['checked'] todo.replace_with(checkbox) if 'media_store' in kwargs: store = kwargs['media_store'] all_media = soup.find_all('en-media') for media in all_media: resource_url = store.save(media['hash'], media['type']) # TODO: use different tags for different mime-types new_tag = soup.new_tag('img') new_tag['src'] = resource_url media.replace_with(new_tag) note = soup.find('en-note') if note: if header: html = soup.new_tag('html') html.append(note) note.name = 'body' else: html = note note.name = 'div' output = html.prettify().encode('utf-8') if pretty else str(html) return output return content class MediaStore(object): def __init__(self, note_store, note_guid): """ note_store: NoteStore object from EvernoteSDK note_guid: Guid of the note in which the resouces exist """ self.note_store = note_store self.note_guid = note_guid def _get_resource_by_hash(self, hash_str): """ get resource by its hash """ hash_bin = hash_str.decode('hex') resource = self.note_store.getResourceByHash(self.note_guid, hash_bin, True, False, False); return resource.data.body def save(self, hash_str, mime_type): pass class FileMediaStore(MediaStore): def __init__(self, note_store, note_guid, path): """ note_store: NoteStore object from EvernoteSDK note_guid: Guid of the note in which the resouces exist path: The path to store media file """ super(FileMediaStore, self).__init__(note_store, note_guid) self.path = os.path.abspath(path) def save(self, hash_str, mime_type): """ save the specified hash and return the saved file's URL """ if not os.path.exists(self.path): os.makedirs(self.path) data = self._get_resource_by_hash(hash_str) file_path = self.path + '/' + hash_str + MIME_TO_EXTESION_MAPPING[mime_type] f = open(file_path, "w") f.write(data) f.close() return "file://" + file_path
tkjacobsen/enote
enote/enmltohtml.py
Python
mit
3,150
# -*- coding: UTF-8 -*- # # Copyright 2012 Michinobu Maeda. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import webapp2 from google.appengine.ext import blobstore from jpzipcode.model import Status class ZipProvider(webapp2.RequestHandler): """生成物の出力""" def get(self): filename = self.request.path.replace('/download/', '') task = filename[0:2] cat = filename[3:4] ts = "%(y)s-%(m)s-%(d)s" % { 'y':filename[5:9], 'm':filename[9:11], 'd':filename[11:13], } stts = Status() if stts.get("ts_ar_%(cat)s" % {'cat':cat})[0:10] != ts: self.error(404) return key = stts.get("key_%(task)s_%(cat)s" % {'cat':cat, 'task':task}) blob_info = blobstore.BlobInfo(blobstore.BlobKey(key)) zr = blob_info.open() self.response.headers['Content-Type'] = 'application/zip' self.response.out.write(zr.read()) zr.close() app = webapp2.WSGIApplication([('/download/.*\.zip', ZipProvider)])
MichinobuMaeda/jpzipcode
src/gae/jpzipcode/controller/zipprovider.py
Python
apache-2.0
1,556
try: 1/1 print('Depois da excecao de divisão por 0') except ZeroDivisionError : print('Tratando qualquer excecao') else: print('Executado se não houver erro') finally: print('Sempre é executado')
renzon/poo-python
execao/tratamento.py
Python
mit
218
# -*- cpy-indent-level: 4; indent-tabs-mode: nil -*- # ex: set expandtab softtabstop=4 shiftwidth=4: # # Copyright (C) 2008,2009,2010,2011,2013,2015,2016 Contributor # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Contains the logic for `aq status`.""" from aquilon.aqdb.db_factory import db_prompt from aquilon.worker.broker import BrokerCommand class CommandStatus(BrokerCommand): requires_readonly = True def render(self, session, dbuser, **_): stat = [] stat.append("Aquilon Broker %s" % self.config.get("broker", "version")) stat.append("Server: %s" % self.config.get("broker", "servername")) stat.append("Database: %s" % db_prompt(session)) stat.append("Sandboxes: %s" % self.config.get("broker", "templatesdir")) if dbuser: stat.append("Connected as: %s [%s]" % (dbuser, dbuser.role.name)) return stat
guillaume-philippon/aquilon
lib/aquilon/worker/commands/status.py
Python
apache-2.0
1,392
"""Implementation of various utilitaries""" import bisect import itertools from collections import deque def sliding(sequence:iter, size:int) -> iter: """Yield tuple of `size` elements""" sequence = iter(sequence) cont = deque(itertools.islice(sequence, 0, size), maxlen=size) yield tuple(cont) for elem in sequence: cont.append(elem) yield tuple(cont) # found at https://docs.python.org/3.5/library/itertools.html def grouper(iterable, size, fillvalue=None): "Collect data into fixed-length chunks or blocks" # grouper('ABCDEFG', 3, 'x') --> ABC DEF Gxx" args = [iter(iterable)] * size return itertools.zip_longest(*args, fillvalue=fillvalue) def group_level(value, levels:tuple, groups:tuple) -> 'group': """Return the group to which given value belongs, according to given levels. See also https://docs.python.org/3.5/library/bisect.html#other-examples """ assert len(levels) == len(groups) - 1 return groups[bisect.bisect(levels, value)]
Aluriak/MusicGenerator
generator/utils.py
Python
gpl-2.0
1,028
# This file is part of Copernicus # http://www.copernicus-computing.org/ # # Copyright (C) 2011, Sander Pronk, Iman Pouya, Erik Lindahl, and others. # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License version 2 as published # by the Free Software Foundation # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. '''Very simple functions used by the command line tools''' import os import shutil from cpc.util.conf import conf_base, server_conf from cpc.util.conf.connection_bundle import ConnectionBundle import cpc.util.openssl import sys import textwrap from cpc.util.conf.conf_base import Conf from cpc.util.conf.conf_base import NoConfError, ConfError import cpc.util.conf.server_conf from cpc.util.exception import ClientError from cpc.util.conf.client_conf import ClientConf, NoServerError def printSortedConfigListDescriptions(configs): for key in sorted(configs.keys()): value = configs[key] spaces = '' for i in range(20 - len(value.name)): spaces = spaces + " " print value.name + spaces + value.description #+ '\n' def printSortedConfigListValues(configs): for key in sorted(configs.keys()): value = configs[key] spaces = '' for i in range(20 - len(value.name)): spaces = spaces + " " print value.name + spaces + str(value.get()) #+ '\n' def initiateConnectionBundle(conffile): cf = None try: cf = ConnectionBundle(conffile) return cf except NoConfError: print "Could not find a connection bundle \nPlease specify one with " \ "with the -c flag or supply the file with the name\nclient.cnx" \ " in your configuration folder " sys.exit(1) def getClientConf(): try: cfg = ClientConf() #make sure there is configured server cfg.getClientSecurePort() cfg.getClientHost() except (NoConfError, NoServerError): raise ClientError("No servers."\ " Use cpcc add-server to add one.") except cpc.util.conf.conf_base.ConfError as e: raise ClientError(e) def addServer(name, host, port): ClientConf().addServer(name, host,port) def useServer(name): ClientConf().setDefaultServer(name) def listServer(): return ClientConf().getServers() def initiateWorkerSetup(): ''' Creates a connection bundle @input configName String @return ConnectionBundle ''' openssl = cpc.util.openssl.OpenSSL() connectionBundle = openssl.setupClient() return connectionBundle def getArg(arglist, argnr, name): """Get argument, or print out argument description.""" try: ret = arglist[argnr] except IndexError: raise ClientError("Missing argument: %s" % name) return ret terminalWidth = 80 def printLogo(): logo = """ ___ _ / __\ ___ _ __ ___ _ __ _ __ (_) ___ _ _ ___ / / / _ \ | '_ \ / _ \| '__|| '_ \ | | / __|| | | |/ __| / /___| (_) || |_) || __/| | | | | || || (__ | |_| |\__ \____/ \___/ | .__/ \___||_| |_| |_||_| \___| \__,_||___/ |_|""" lines = logo.splitlines() for line in lines: print " %s"%line def printAuthors(): developers = ["Magnus Lundborg", "Patrik Falkman","Grant Rotskoff","Per Larsson"] authors = ["Sander Pronk","Iman Pouya","Erik Lindahl"] contributorsTxt = "Contributions from: %s"%", ".join(developers) authorsTxt = ", ".join(authors) wrapper = textwrap.TextWrapper(width=terminalWidth) lines = wrapper.wrap(contributorsTxt) print "\n" for line in lines: print line.center(terminalWidth) print "\n" for line in wrapper.wrap(authorsTxt): print line.center(terminalWidth) print "\n\n" def checkServerConfExistAndAskToRemove(hostConfDir,altDirName=None): ''' This method checks if a server conf exists and asks if the user wants to wipe it and continue. if Y the folder will be wiped and the setup flow will proceed if N the setup flow will be aborted returns: boolean ''' dirname = server_conf.resolveSetupConfBaseDir(altDirName) confDir=cpc.util.conf.conf_base.findAndCreateGlobalDir() # now if a host-specific directory already exists, we use that confDir = server_conf.resolveSetupConfDir(confDir, dirname, hostConfDir,altDirName=altDirName) if os.path.exists(confDir): answer = raw_input("A configuration already exists in %s. Overwrite? (y/N)? "%confDir) if(answer.lower() == 'y'): return True else: # answer = n print("Server setup aborted") exit(0)
soellman/copernicus
cpc/util/cmd_line_utils.py
Python
gpl-2.0
5,176
from django import forms from multiemailfield.widgets import MultiEmailWidget from multiemailfield import utils class MultiEmailFormField(forms.CharField): def __init__(self, *args, **kwargs): if 'widget' not in kwargs: kwargs['widget'] = MultiEmailWidget super(MultiEmailFormField, self).__init__(*args, **kwargs) def clean(self, value): return utils.load(super(MultiEmailFormField, self).clean(value))
sophilabs/django-multiemail-field
multiemailfield/forms.py
Python
mit
452
""" The bundled WSGI apps. * Routing: Uses URL prefixes to route to applications * StaticFiles: Serves a directory * StaticResources: Serves the resources from a python package """ import email.utils # For datetime formatting import functools from http import HTTPStatus import logging import mimetypes import os import posixpath import traceback import wsgiref.simple_server import wsgiref.util try: # Python 3.7+ import importlib.resources as importlib_resources except ImportError as e : # Python 3.6 import importlib_resources from .util import abspath __all__ = ('StaticFiles', 'StaticResources', 'Routing') logger = logging.getLogger(__name__) CHUNK_SIZE = 4 * 1024 # 4k # Follow Django in treating URLs as UTF-8 encoded (which requires undoing the # implicit ISO-8859-1 decoding applied in Python 3). Strictly speaking, URLs # should only be ASCII anyway, but UTF-8 can be found in the wild. def decode_path_info(path_info): return path_info.encode("iso-8859-1", "replace").decode("utf-8", "replace") def send_simple_text(environ, start_response, status, body): """ Send a simple message as plain text """ if isinstance(status, int): status = "{} {}".format(int(status), status.phrase) if isinstance(body, str): body = body.encode('utf-8') response_headers = [ ('Content-Type', 'text/plain'), ('Content-Length', str(len(body))) ] start_response(status, response_headers) return [body] def do_403(environ, start_response): """ Generic app to produce a 403 """ urlpath = environ['SCRIPT_NAME'] + environ['PATH_INFO'] return send_simple_text( environ, start_response, HTTPStatus.FORBIDDEN, "Path {} is not allowed.".format(urlpath), ) def do_404(environ, start_response): """ Generic app to produce a 404 """ urlpath = environ['SCRIPT_NAME'] + environ['PATH_INFO'] return send_simple_text( environ, start_response, HTTPStatus.NOT_FOUND, "Path {} was not found".format(urlpath), ) def do_405(environ, start_response): """ Generic app to produce a 405 """ urlpath = environ['SCRIPT_NAME'] + environ['PATH_INFO'] return send_simple_text( environ, start_response, HTTPStatus.METHOD_NOT_ALLOWED, "Method {} is not allowed on {}".format( environ['REQUEST_METHOD'], urlpath, ), ) def do_options(environ, start_response): """ Generic app to produce a response to OPTIONS """ start_response("204 No Content", [ ('Allow', 'OPTIONS, GET, HEAD'), ]) return [] def wsgi_catch_errors(func): @functools.wraps(func) def handler(*p): try: return func(*p) except BaseException: start_response = p[-1] start_response("500 Server Error", [ ('Content-Type', 'text/plain'), ]) return [traceback.format_exc().encode('utf-8')] return handler class Routing(dict): """ Implements a basic URL routing system. Path prefixes are compared to the request path. The longest prefix wins. Example: Routing({ '/': app, '/static': Static('mystatic'), }) """ def no_route_found(self, environ, start_response): """ Handle if there was no matching route """ return do_404(environ, start_response) @wsgi_catch_errors def __call__(self, environ, start_response): # SCRIPT_NAME + PATH_INFO = full url urlpath = environ['SCRIPT_NAME'] + environ['PATH_INFO'] if not urlpath: urlpath = '/' potentials = [ prefix for prefix in self.keys() if posixpath.commonpath([prefix, urlpath]) == prefix ] try: match = max(potentials, key=len) except ValueError: # max() got an empty list, aka no matches found return self.no_route_found(environ, start_response) logger.debug("For %r found %r routes, selected %r", urlpath, potentials, match) app = self[match] environ['SCRIPT_NAME'] = urlpath[:len(match)] environ['PATH_INFO'] = urlpath[len(match):] return app(environ, start_response) class StaticContentsApp: """ Base class for static serving implementatins """ max_age = 60 # 1min, takes the edge off any frequent responses while staying fresh def method_not_allowed(self, environ, start_response): """ Handle if we got something besides GET or HEAD """ return do_405(environ, start_response) def file_not_found(self, environ, start_response): """ Handle if the file cannot be found """ return do_404(environ, start_response) def is_a_directory(self, environ, start_response): """ Handle if we were given a directory """ return do_404(environ, start_response) def no_permissions(self, environ, start_response): """ Handle if we can't open the file """ return do_403(environ, start_response) def open(path): """ Return a file-like object in 'rb' mode. The path given is normalized. Add a .name attribute to the file if applicable Raise a FileNotFoundError, IsADirectoryError, or a PermissionError in case of error. """ raise NotImplementedError @wsgi_catch_errors def __call__(self, environ, start_response): if environ['REQUEST_METHOD'] == 'OPTIONS': return do_options(environ, start_response) elif environ['REQUEST_METHOD'] not in ('GET', 'HEAD'): return self.method_not_allowed(environ, start_response) path = posixpath.normpath(environ['PATH_INFO'] or '/') path_options = [path] if path.endswith('/'): path_options.append(path[:-1]) path_options.append(posixpath.join(path, 'index.html')) responder = None for option in path_options: try: file = self.open(option) except FileNotFoundError: logger.debug("file not found: %s", option) if responder is None: responder = self.file_not_found except (IsADirectoryError, OSError): # OSError on Windows logger.debug("is a directory: %s", option) if responder is None: responder = self.is_a_directory except PermissionError: logger.debug("permission error: %s", option) if responder is None: responder = self.no_permissions except NotADirectoryError: logger.debug("not a directory: %s", option) # This can happen if we get a file with a trailing slash # This should only happen with the first option, and should be # covered by the next option pass else: break else: assert responder return responder(environ, start_response) if hasattr(file, 'name'): filename = file.name else: filename = path mime, _ = mimetypes.guess_type(filename, strict=False) # NOTE: We're not doing cache control checking, because we don't # consistently have stat() available. # TODO: Type negotiation if 'HTTP_RANGE' in environ: return self._serve_partial_file(environ, start_response, file, filename, mime) else: return self._serve_whole_file(environ, start_response, file, filename, mime) def _default_headers(self, mime, file): rv = wsgiref.headers.Headers([ ('Content-Type', mime or 'application/octect-stream'), ('Accept-Ranges', 'bytes'), ('Cache-Control', 'max-age={}'.format(self.max_age)) ]) if hasattr(file, 'fileno'): try: stat = os.fstat(file.fileno()) except OSError: pass else: rv['Content-Length'] = str(stat.st_size) # rv['Last-Modified'] = email.utils.formatdate(stat.st_mtime, usegmt=True) return rv def _serve_whole_file(self, environ, start_response, file, filename, mime): response_headers = self._default_headers(mime, file) start_response('200 OK', response_headers._headers) if environ['REQUEST_METHOD'] == 'HEAD': file.close() return [] else: wrapper = environ.get('wsgi.file_wrapper', wsgiref.util.FileWrapper) return wrapper(file, CHUNK_SIZE) def _parse_range(self, header, length): logger.debug("Got range header %r (length=%s)", header, length) unit, _, ranges = header.partition('=') if unit != 'bytes': raise ValueError("Range not satisfiable: {}".format(header)) ranges = [bit.strip().split('-') for bit in ranges.split(',')] start, end = ranges[0] start = int(start) if start else 0 end = int(end) if end else None if length is not None: if end is None: end = length - 1 return start, end def _compose_content_range(self, start, end, total): rv = 'bytes ' if start is not None: rv += str(start) rv += '-' if end is not None: rv += str(end) rv += '/' if total is not None: rv += str(total) else: rv += '*' return rv def _serve_partial_file(self, environ, start_response, file, filename, mime): response_headers = self._default_headers(mime, file) length = response_headers['Content-Length'] if length: length = int(length) else: length = None start, end = self._parse_range(environ['HTTP_RANGE'], length) if length is not None: # Check ranges maxindex = length - 1 if start > maxindex or end > maxindex: start_response('416 Range Not Satisfiable', [ ('Content-Range', 'bytes */{}'.format(length)) ]) return [] assert start <= end assert length is None or end < length logger.debug("Serving %s (%s to %s of %s)", filename, start, end, length) response_headers['Content-Range'] = self._compose_content_range(start, end, length) if end is None: amount = None del response_headers['Content-Length'] else: amount = end - start + 1 response_headers['Content-Length'] = str(amount) start_response('206 Partial Content', response_headers._headers) if environ['REQUEST_METHOD'] == 'HEAD': file.close() return [] else: return self._partial_file_wrapper(file, start, amount) def _partial_file_wrapper(self, file, skip, amount): served = 0 if skip: file.seek(skip) while (amount is None) or (served <= amount): data = file.read(min(CHUNK_SIZE, amount - served)) if not data: break served += len(data) yield data logging.debug("Served %s of %s", served, amount) class StaticFiles(StaticContentsApp): """ Serves static files from a directory on the file system. """ def __init__(self, root): self.root = abspath(root) def open(self, file): if file: path = os.path.join(self.root, file.lstrip('/')) else: path = self.root logger.debug('Resolved %s to %s' % (file, path)) return open(path, 'rb') class StaticResources(StaticContentsApp): """ Serves static files from resources in python packages """ def __init__(self, root): self.root = root def open(self, file): slashed, basename = posixpath.split(file) slashed = slashed.rstrip('/') if slashed: packagename = "{}.{}".format(self.root, slashed.replace('/', '.')) else: packagename = self.root try: return importlib_resources.open_binary(packagename, basename) except ModuleNotFoundError: raise FileNotFoundError
r0x0r/pywebview
webview/wsgi.py
Python
bsd-3-clause
12,536
import sys from services.spawn import MobileTemplate from services.spawn import WeaponTemplate from resources.datatables import WeaponType from resources.datatables import Difficulty from resources.datatables import Options from java.util import Vector def addTemplate(core): mobileTemplate = MobileTemplate() mobileTemplate.setCreatureName('gackle_bat') mobileTemplate.setLevel(65) mobileTemplate.setDifficulty(Difficulty.NORMAL) mobileTemplate.setMinSpawnDistance(4) mobileTemplate.setMaxSpawnDistance(8) mobileTemplate.setDeathblow(False) mobileTemplate.setScale(1) mobileTemplate.setMeatType("Carnivore Meat") mobileTemplate.setMeatAmount(4) mobileTemplate.setHideType("Bristley Hide") mobileTemplate.setHideAmount(2) mobileTemplate.setBoneType("Animal Bones") mobileTemplate.setBoneAmount(3) mobileTemplate.setSocialGroup("gacklebat") mobileTemplate.setAssistRange(12) mobileTemplate.setStalker(False) mobileTemplate.setOptionsBitmask(Options.AGGRESSIVE | Options.ATTACKABLE) templates = Vector() templates.add('object/mobile/shared_gackle_bat.iff') mobileTemplate.setTemplates(templates) weaponTemplates = Vector() weapontemplate = WeaponTemplate('object/weapon/melee/unarmed/shared_unarmed_default.iff', WeaponType.UNARMED, 1.0, 6, 'kinetic') weaponTemplates.add(weapontemplate) mobileTemplate.setWeaponTemplateVector(weaponTemplates) attacks = Vector() attacks.add('bm_siphon_2') attacks.add('bm_puncture_2') attacks.add('bm_wing_buffet_4') mobileTemplate.setDefaultAttack('creatureMeleeAttack') mobileTemplate.setAttacks(attacks) core.spawnService.addMobileTemplate('gackle_bat', mobileTemplate) return
agry/NGECore2
scripts/mobiles/yavin4/gackle_bat.py
Python
lgpl-3.0
1,708
import sqlalchemy sqlalchemy.__version__ from sqlalchemy import create_engine # Creating an inmemory sqlite database for the tutorial purposes from sqlalchemy.ext.declarative import declarative_base from sqlalchemy import Column, Integer, String, Sequence, ForeignKey from sqlalchemy.orm import sessionmaker, aliased, relationship, backref from sqlalchemy.orm.exc import MultipleResultsFound,NoResultFound Session = sessionmaker() # when engine is created Session.configure(bind=engine) engine = create_engine('sqlite:///:memory:', echo=True) Base = declarative_base() Session.configure(bind=engine) class User(Base): __tablename__ = 'users' id = Column(Integer, Sequence('user_id_seq') ,primary_key=True) name = Column(String(50)) fullname = Column(String(50)) password = Column(String(12)) def __repr__(self): return "<User(name='%s', fullname='%s', password='%s')>" % (self.name, self.fullname, self.password) Base.metadata.create_all(engine) class Address(Base): __tablename__ = 'Addresses' id = Column(Integer, primary_key=True) email_address = Column(String, nullable=False) user_id = Column(Integer, ForeignKey('users.id')) user = relationship("User", backref=backref('addresses', order_by=id)) def __repr__(self): return "<Address(email_address=%s)>" % self.email_address Base.metadata.create_all(engine) session = Session() ed_user = User(name='ed', fullname="Edward Jones", password='nonesuch') session.add(ed_user) chloe_user = User(name='Chloeoh', fullname="Chloe Tinker", password='bubba') session.add(chloe_user) # our_user = session.query(User).filter_by(name='Chloeoh').first() # print our_user # print ed_user is our_user session.add_all([ User(name='Evan', fullname='Evan Brennan-White', password="fx3k9c"), User(name='Leia', fullname='Leia Brennan-White', password="fx3k9c"), User(name='Chance', fullname='Chance Brennan-White', password="dog")]) chloe_user.password = 'ra++le' # print session.dirty # print session.new session.commit() # print chloe_user.id # ed_user.name = 'Edwardo' # fake_user = User(name='broofus', fullname='Broofass', # password='Nothing' ) # session.add(fake_user) # print session.query(User).filter(User.name.in_(['Edwardo', 'broofus'])).all() # session.rollback() # print ed_user.name # print fake_user in session # print session.query(User).filter(User.name.in_(['ed', 'fake_user'])).all() # for instance in session.query(User).order_by(User.id): # print instance.name, instance.fullname # for name, fullname in session.query(User.name, User.fullname): # print name, fullname # for row in session.query(User, User.name,).all(): # print row.User, row.name # for row in session.query(User.name.label('full_label')).all(): # print row.full_label # user_alias = aliased(User, name='user_alias') # for row in session.query(user_alias, user_alias.name).all(): # print row.user_alias # for u in session.query(User).order_by(User.id)[1:2]: # print u # for u in session.query(User).filter(User.name=='Chloeoh').\ # filter(User.fullname!='Broofus Tinker'): # print u # for u in session.query(User).filter(User.name.like('Leia')).\ # filter(User.fullname!='Broofus Tinker'): # print u # for u in session.query(User).filter(User.name.in_(['Evan', 'Chance'])).\ # filter(User.fullname!='Broofus Tinker'): # print 'Boy',u # for u in session.query(User).filter((User.name=='Leia') | (User.name=='Chloeoh')): # print u.fullname # u = session.query(User).filter(User.name.match('Chloeoh')) query = session.query(User).filter(User.fullname.like('%Chloe%')).order_by(User.name) # print query.all() # for member in query: # print member.name # print query.first() try: user = query.one() userid = user.id msg = '' except MultipleResultsFound, e: user = query.first() userid = user.id msg = 'Multiple Results Found' except NoResultFound,e: userid = 0 msg = 'No Results Found' print 'UserID:', userid,msg jack = User(name="jack", fullname="Jack Bean", password="gjffdd") jack.addresses = [ Address(email_address='[email protected]'), Address(email_address='[email protected]') ] print jack.addresses[1] print jack.addresses[1].user session.add(jack) session.commit() jack = session.query(User).\ filter_by(name="jack").one() # jack.addresses is a lazy load of the address information because of the backref print jack, jack.addresses for u, a in session.query(User, Address) \ .filter(User.id==Address.user_id) \ .filter(Address.email_address==\ '[email protected]')\ .all(): print u print a qry = session.query(User).join(Address) \ .filter(Address.email_address=='[email protected]') \ .all() print qry qry = query.join(Address, User.id==Address.user_id) print qry.all() # Using Aliases to query a table twice adalias1 = aliased(Address) adalias2 = aliased(Address) for username, email1, email2 in \ session.query(User.name, \ adalias1.email_address, \ adalias2.email_address, ) \ .join(adalias1, User.addresses) \ .join(adalias2, User.addresses) \ .filter(adalias1.email_address=='[email protected]') \ .filter(adalias2.email_address=='[email protected]'): print username, email1, email2
micknh/EdFirst
relationships.py
Python
mit
5,104
import sys import os import os.path import logging import linecache import time #sys.path.remove('/usr/lib/python2.7/site-packages') # para test, probar dependencias custom_path = '{0}/{1}' sys.path.insert(1, custom_path.format(os.getcwd(), 'depen_packages')) sys.path.insert(1, custom_path.format(os.getcwd(), 'payfi')) #print sys.path import yaml from payfi import download_chunks as dw from payfi.watchdog.observers import Observer from payfi.watchdog.observers import Observer from payfi.watchdog.events import LoggingEventHandler filename = 'db_listener_config.yalm' log_path = 'db_log.log' def __load_config_file(file_name): """ Loads varibles and constants from yalm config file and turns them into module's global variables :param filename: str, config file name :return: None """ with open(file_name) as f: data_map = yaml.safe_load(f) f.close() globals().update(data_map) globals()['file_ext'] = tuple(globals()['file_ext']) globals()['register'] = tuple(globals()['register']) globals()['charge'] = tuple(globals()['charge']) globals()['success'] = tuple(globals()['success']) globals()['fail'] = tuple(globals()['fail']) class MySLoggingEventHandler1(LoggingEventHandler): def on_created(self, event): print 'file has been created {0}'.format(event.src_path) file_format = event.src_path[event.src_path.rfind('.'):] # finds the last point. if file_format in file_ext: t_op = linecache.getline(event.src_path, 1).rstrip() # removes '\n' 0 operation type res = linecache.getline(event.src_path, 2).rstrip() # operation result success/fail id_ter = linecache.getline(event.src_path, 3).rstrip() # terminal id print res # IMPORTANT: clear the cache, otherwise will read always the same values that come from an individual terminal linecache.clearcache() if t_op in register and res in fail: #'FAILURE': print 'delete inserted fingerprint needed pin and img_filename.. to do' # sends to the terminal's folder try: destiny_path = id_ter + file_format # in case terminal_id folder does not exist, create it dir_name = os.path.dirname(forward_path.format(id_ter, destiny_path)) # get destiny folder id if not os.path.exists(dir_name): # in case does not exist, create it os.mkdir(dir_name) # 0o777 epoch = str(time.time()) dw.prepare_client_file(forward_path.format(id_ter, destiny_path), (epoch[:epoch.index('.')], res)) except OSError: logging.error('destiny path is a directory, not a file') os.remove(event.src_path) # remove always everything if __name__ == "__main__": # init the logger logging.basicConfig(filename=log_path, format='%(asctime)s - %(levelname)s: (%(module)s) %(funcName)s - ' '%(message)s ', level=logging.ERROR) # logging.WARNING # load config file, in case of error close the program and register the error try: __load_config_file(filename) print 'watchdog_db has been initialized' #print globals() # just for tests except IOError: logging.error('Could not read config file') raise SystemExit path = sys.argv[1] if len(sys.argv) > 1 else db_listening_path # watchdog event_handler = MySLoggingEventHandler1() # LoggingEventHandler() observer = Observer() observer.schedule(event_handler, path, recursive=True) observer.start() try: while True: time.sleep(1) except KeyboardInterrupt: observer.stop() observer.join()
rnov/Fingerpay
work_unit/watchfile_db.py
Python
mit
3,816
import json import os from django.conf import settings from django.core.management.base import BaseCommand import commonware.log import amo from applications.models import Application, AppVersion log = commonware.log.getLogger('z.cron') # The validator uses the file created here to keep up to date with the # apps and versions on AMO. class Command(BaseCommand): help = 'Dump a json file containing AMO apps and versions.' JSON_PATH = os.path.join(settings.NETAPP_STORAGE, 'apps.json') def handle(self, *args, **kw): apps = {} for id, guid in Application.objects.values_list('id', 'guid'): apps[id] = dict(guid=guid, versions=[], name=amo.APPS_ALL[id].short) versions = (AppVersion.objects.values_list('application', 'version') .order_by('version_int')) for app, version in versions: apps[app]['versions'].append(version) with open(self.JSON_PATH, 'w') as f: json.dump(apps, f) log.debug("Wrote: %s" % f.name)
jbalogh/zamboni
apps/applications/management/commands/dump_apps.py
Python
bsd-3-clause
1,065
import jsonpickle import json import xlwings as xw DEBUG = False SMOOTH_E = 0.1 testdata_results_file = open("data/intrusion.testlabels.categorized", "r") testdata_results_str = testdata_results_file.read() testdata_results = testdata_results_str.split("\n") testdata_results = testdata_results[:-1] print("Reading attacktypes from file...") attacktypes_file = open("data/attacktypes.list", "r") attacktypes_str = attacktypes_file.read() attacktypes = attacktypes_str.split("\n") attacktypes = attacktypes[:-1] attacktypes_set = [] for idx, item in enumerate(attacktypes): item = item.split(" ") if item[1] not in attacktypes_set: attacktypes_set.append(item[1]) attacktypes[idx] = item attacktypes_file.close() print("Loading processed test data") testdata_processed_file = open("processed_data/intrusion.kmeanstestdataprocessed", "r") testdata = json.loads(testdata_processed_file.read()) testdata_processed_file.close() print("TESTDATA loaded...") def loadClassifier(classifier_str): print("About to load dtree") traindata_processed_file = open(classifier_str, "r") trained_dtree = jsonpickle.decode(traindata_processed_file.read()) traindata_processed_file.close() print("trained dtree loaded") return trained_dtree def calc_and_save(tree_str, confusion_matrix, offset): correct = 0 for e in attacktypes_set: correct = correct + confusion_matrix[e][e] print(((correct * 1.0) / len(testdata)) * 100) score = (((correct * 1.0) / len(testdata)) * 100) wb = xw.Book('part2_results.xlsx') sht = wb.sheets['Sheet1'] sht.range('A' + str(1 + offset)).value = "Name: " sht.range('B' + str(1 + offset)).value = tree_str for i in range(offset + 4, offset + 4 + len(attacktypes_set)): num = 'A' + str(i) sht.range(num).value = attacktypes_set[i - 4 - offset] alphas = ['A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J'] for i in range(1, 1 + len(attacktypes_set)): num = alphas[i] + str(3 + offset) sht.range(num).value = attacktypes_set[i - 1] for i in range(offset + 4, offset + 4 + len(attacktypes_set)): for j in range(1, 1 + len(attacktypes_set)): num = alphas[j] + str(i) sht.range(num).value = confusion_matrix[attacktypes_set[i-4-offset]][attacktypes_set[j-1]] sht.range('A' + str(10 + offset)).value = "Accuracy:" sht.range('B' + str(10 + offset)).value = score offset += 13 return offset def doTest(classifier): confusion_matrix = {} for i in attacktypes_set: confusion_matrix[i] = {} for j in attacktypes_set: confusion_matrix[i][j] = 0 for i in range(len(testdata)): prob_class = {} for e in attacktypes_set: prob = 1.0 attrs = testdata[i] for j in range(len(attrs)): # if(i > 1117000): # print("~~~~~~~~~~~~~") # print ("e", e) # print ("j", j) # print ("attrs", attrs) # print("classifier[0][e][j]", classifier[0][str(e)][j]) if(str(attrs[j]) in classifier[0][e][j].keys()): # print("~~~~~~~~~~~~~~~~~~~~~~~~") # print((classifier[0][e][j][str(attrs[j])] * 1.0)) # print((classifier[1][e][j] * 1.0)) prob = prob * (((classifier[0][e][j][str(attrs[j])] * 1.0) + SMOOTH_E) / ((classifier[1][e][j] * 1.0) + (SMOOTH_E * len(classifier[0][e][j].keys())))) #print(prob) else: prob = prob * ((SMOOTH_E * 1.0) / (classifier[1][e][j] + (SMOOTH_E * len(classifier[0][e][j].keys())))) prob = prob * ((classifier[2][str(e)] * 1.0) / classifier[3]) prob_class[str(e)] = prob cur_max = -1.0 max_class = None for k in prob_class.keys(): if(prob_class[k] > cur_max): cur_max = prob_class[k] max_class = k result = max_class confusion_matrix[testdata_results[i]][result] = confusion_matrix[testdata_results[i]][result] + 1 #print(prob_class) if(i % 1000 == 0): print("Done testing " + str(i) + " instances...") print(confusion_matrix) return confusion_matrix offset = 0 # Part 1 Testing classifier_str = "part_2/processed_classifier/intrusion.trainedclassifier" c_matrix = doTest(loadClassifier(classifier_str)) offset = calc_and_save(classifier_str, c_matrix, offset)
maher460/cmu10601
hw3/code/part2_validator.py
Python
mit
4,069
# Copyright 2018 Mycroft AI Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import unittest from adapt.engine import IntentDeterminationEngine from adapt.intent import IntentBuilder __author__ = 'seanfitz' class IntentEngineTests(unittest.TestCase): def setUp(self): self.engine = IntentDeterminationEngine() def testRegisterIntentParser(self): assert len(self.engine.intent_parsers) == 0 try: self.engine.register_intent_parser("NOTAPARSER") assert "Did not fail to register invalid intent parser" and False except ValueError as e: pass parser = IntentBuilder("Intent").build() self.engine.register_intent_parser(parser) assert len(self.engine.intent_parsers) == 1 def testRegisterRegexEntity(self): assert len(self.engine._regex_strings) == 0 assert len(self.engine.regular_expressions_entities) == 0 self.engine.register_regex_entity(".*") assert len(self.engine._regex_strings) == 1 assert len(self.engine.regular_expressions_entities) == 1 def testSelectBestIntent(self): parser1 = IntentBuilder("Parser1").require("Entity1").build() self.engine.register_intent_parser(parser1) self.engine.register_entity("tree", "Entity1") utterance = "go to the tree house" intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser1' parser2 = IntentBuilder("Parser2").require("Entity1").require("Entity2").build() self.engine.register_intent_parser(parser2) self.engine.register_entity("house", "Entity2") intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser2' def testDropIntent(self): parser1 = IntentBuilder("Parser1").require("Entity1").build() self.engine.register_intent_parser(parser1) self.engine.register_entity("tree", "Entity1") parser2 = (IntentBuilder("Parser2").require("Entity1") .require("Entity2").build()) self.engine.register_intent_parser(parser2) self.engine.register_entity("house", "Entity2") utterance = "go to the tree house" intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser2' assert self.engine.drop_intent_parser('Parser2') is True intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser1' def testDropEntity(self): parser1 = IntentBuilder("Parser1").require("Entity1").build() self.engine.register_intent_parser(parser1) self.engine.register_entity("laboratory", "Entity1") self.engine.register_entity("lab", "Entity1") utterance = "get out of my lab" utterance2 = "get out of my laboratory" intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser1' intent = next(self.engine.determine_intent(utterance2)) assert intent assert intent['intent_type'] == 'Parser1' # Remove Entity and re-register laboratory and make sure only that # matches. self.engine.drop_entity(entity_type='Entity1') self.engine.register_entity("laboratory", "Entity1") # Sentence containing lab should not produce any results with self.assertRaises(StopIteration): intent = next(self.engine.determine_intent(utterance)) # But sentence with laboratory should intent = next(self.engine.determine_intent(utterance2)) assert intent assert intent['intent_type'] == 'Parser1' def testCustomDropEntity(self): parser1 = (IntentBuilder("Parser1").one_of("Entity1", "Entity2") .build()) self.engine.register_intent_parser(parser1) self.engine.register_entity("laboratory", "Entity1") self.engine.register_entity("lab", "Entity2") utterance = "get out of my lab" utterance2 = "get out of my laboratory" intent = next(self.engine.determine_intent(utterance)) assert intent assert intent['intent_type'] == 'Parser1' intent = next(self.engine.determine_intent(utterance2)) assert intent assert intent['intent_type'] == 'Parser1' def matcher(data): return data[1].startswith('Entity') self.engine.drop_entity(match_func=matcher) self.engine.register_entity("laboratory", "Entity1") # Sentence containing lab should not produce any results with self.assertRaises(StopIteration): intent = next(self.engine.determine_intent(utterance)) # But sentence with laboratory should intent = next(self.engine.determine_intent(utterance2)) assert intent def testDropRegexEntity(self): self.engine.register_regex_entity(r"the dog (?P<Dog>.*)") self.engine.register_regex_entity(r"the cat (?P<Cat>.*)") assert len(self.engine._regex_strings) == 2 assert len(self.engine.regular_expressions_entities) == 2 self.engine.drop_regex_entity(entity_type='Cat') assert len(self.engine._regex_strings) == 1 assert len(self.engine.regular_expressions_entities) == 1 def testCustomDropRegexEntity(self): self.engine.register_regex_entity(r"the dog (?P<SkillADog>.*)") self.engine.register_regex_entity(r"the cat (?P<SkillACat>.*)") self.engine.register_regex_entity(r"the mangy dog (?P<SkillBDog>.*)") assert len(self.engine._regex_strings) == 3 assert len(self.engine.regular_expressions_entities) == 3 def matcher(regexp): """Matcher for all match groups defined for SkillB""" match_groups = regexp.groupindex.keys() return any([k.startswith('SkillB') for k in match_groups]) self.engine.drop_regex_entity(match_func=matcher) assert len(self.engine._regex_strings) == 2 assert len(self.engine.regular_expressions_entities) == 2 def testAddingOfRemovedRegexp(self): self.engine.register_regex_entity(r"the cool (?P<thing>.*)") def matcher(regexp): """Matcher for all match groups defined for SkillB""" match_groups = regexp.groupindex.keys() return any([k.startswith('thing') for k in match_groups]) self.engine.drop_regex_entity(match_func=matcher) assert len(self.engine.regular_expressions_entities) == 0 self.engine.register_regex_entity(r"the cool (?P<thing>.*)") assert len(self.engine.regular_expressions_entities) == 1 def testUsingOfRemovedRegexp(self): self.engine.register_regex_entity(r"the cool (?P<thing>.*)") parser = IntentBuilder("Intent").require("thing").build() self.engine.register_intent_parser(parser) def matcher(regexp): """Matcher for all match groups defined for SkillB""" match_groups = regexp.groupindex.keys() return any([k.startswith('thing') for k in match_groups]) self.engine.drop_regex_entity(match_func=matcher) assert len(self.engine.regular_expressions_entities) == 0 utterance = "the cool cat" intents = [match for match in self.engine.determine_intent(utterance)] assert len(intents) == 0 def testEmptyTags(self): # Validates https://github.com/MycroftAI/adapt/issues/114 engine = IntentDeterminationEngine() engine.register_entity("Kevin", "who") # same problem if several entities builder = IntentBuilder("Buddies") builder.optionally("who") # same problem if several entity types engine.register_intent_parser(builder.build()) intents = [i for i in engine.determine_intent("Julien is a friend")] assert len(intents) == 0 def testResultsAreSortedByConfidence(self): self.engine.register_entity('what is', 'Query', None) self.engine.register_entity('weather', 'Weather', None) self.engine.register_regex_entity('(at|in) (?P<Location>.+)') self.engine.register_regex_entity('(?P<Entity>.*)') i = IntentBuilder("CurrentWeatherIntent").require( "Weather").optionally("Location").build() self.engine.register_intent_parser(i) utterance = "what is the weather like in stockholm" intents = [ i for i in self.engine.determine_intent(utterance, num_results=100) ] confidences = [intent.get('confidence', 0.0) for intent in intents] assert len(confidences) > 1 assert all(confidences[i] >= confidences[i+1] for i in range(len(confidences)-1))
MycroftAI/adapt
test/IntentEngineTest.py
Python
apache-2.0
9,429
import select import socket import types from base import SMB, NotConnectedError, SMBTimeout from smb_structs import * class SMBConnection(SMB): log = logging.getLogger('SMB.SMBConnection') #: SMB messages will never be signed regardless of remote server's configurations; access errors will occur if the remote server requires signing. SIGN_NEVER = 0 #: SMB messages will be signed when remote server supports signing but not requires signing. SIGN_WHEN_SUPPORTED = 1 #: SMB messages will only be signed when remote server requires signing. SIGN_WHEN_REQUIRED = 2 def __init__(self, username, password, my_name, remote_name, domain = '', use_ntlm_v2 = True, sign_options = SIGN_WHEN_REQUIRED, is_direct_tcp = False): """ Create a new SMBConnection instance. *username* and *password* are the user credentials required to authenticate the underlying SMB connection with the remote server. File operations can only be proceeded after the connection has been authenticated successfully. Note that you need to call *connect* method to actually establish the SMB connection to the remote server and perform authentication. The default TCP port for most SMB/CIFS servers using NetBIOS over TCP/IP is 139. Some newer server installations might also support Direct hosting of SMB over TCP/IP; for these servers, the default TCP port is 445. :param string my_name: The local NetBIOS machine name that will identify where this connection is originating from. You can freely choose a name as long as it contains a maximum of 15 alphanumeric characters and does not contain spaces and any of ``\/:*?";|+`` :param string remote_name: The NetBIOS machine name of the remote server. On windows, you can find out the machine name by right-clicking on the "My Computer" and selecting "Properties". This parameter must be the same as what has been configured on the remote server, or else the connection will be rejected. :param string domain: The network domain. On windows, it is known as the workgroup. Usually, it is safe to leave this parameter as an empty string. :param boolean use_ntlm_v2: Indicates whether pysmb should be NTLMv1 or NTLMv2 authentication algorithm for authentication. The choice of NTLMv1 and NTLMv2 is configured on the remote server, and there is no mechanism to auto-detect which algorithm has been configured. Hence, we can only "guess" or try both algorithms. On Sambda, Windows Vista and Windows 7, NTLMv2 is enabled by default. On Windows XP, we can use NTLMv1 before NTLMv2. :param int sign_options: Determines whether SMB messages will be signed. Default is *SIGN_WHEN_REQUIRED*. If *SIGN_WHEN_REQUIRED* (value=2), SMB messages will only be signed when remote server requires signing. If *SIGN_WHEN_SUPPORTED* (value=1), SMB messages will be signed when remote server supports signing but not requires signing. If *SIGN_NEVER* (value=0), SMB messages will never be signed regardless of remote server's configurations; access errors will occur if the remote server requires signing. :param boolean is_direct_tcp: Controls whether the NetBIOS over TCP/IP (is_direct_tcp=False) or the newer Direct hosting of SMB over TCP/IP (is_direct_tcp=True) will be used for the communication. The default parameter is False which will use NetBIOS over TCP/IP for wider compatibility (TCP port: 139). """ SMB.__init__(self, username, password, my_name, remote_name, domain, use_ntlm_v2, sign_options, is_direct_tcp) self.sock = None self.auth_result = None self.is_busy = False self.is_direct_tcp = is_direct_tcp # # SMB (and its superclass) Methods # def onAuthOK(self): self.auth_result = True def onAuthFailed(self): self.auth_result = False def write(self, data): assert self.sock data_len = len(data) total_sent = 0 while total_sent < data_len: sent = self.sock.send(data[total_sent:]) if sent == 0: raise NotConnectedError('Server disconnected') total_sent = total_sent + sent # # Misc Properties # @property def isUsingSMB2(self): """A convenient property to return True if the underlying SMB connection is using SMB2 protocol.""" return self.is_using_smb2 # # Public Methods # def connect(self, ip, port = 139, sock_family = socket.AF_INET, timeout = 60): """ Establish the SMB connection to the remote SMB/CIFS server. You must call this method before attempting any of the file operations with the remote server. This method will block until the SMB connection has attempted at least one authentication. :return: A boolean value indicating the result of the authentication atttempt: True if authentication is successful; False, if otherwise. """ if self.sock: self.sock.close() self.auth_result = None self.sock = socket.socket(sock_family) self.sock.settimeout(timeout) self.sock.connect(( ip, port )) self.is_busy = True try: if not self.is_direct_tcp: self.requestNMBSession() else: self.onNMBSessionOK() while self.auth_result is None: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return self.auth_result def close(self): """ Terminate the SMB connection (if it has been started) and release any sources held by the underlying socket. """ if self.sock: self.sock.close() self.sock = None def listShares(self, timeout = 30): """ Retrieve a list of shared resources on remote server. :return: A list of :doc:`smb.base.SharedDevice<smb_SharedDevice>` instances describing the shared resource """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(entries): self.is_busy = False results.extend(entries) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._listShares(cb, eb, timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results def listPath(self, service_name, path, search = SMB_FILE_ATTRIBUTE_READONLY | SMB_FILE_ATTRIBUTE_HIDDEN | SMB_FILE_ATTRIBUTE_SYSTEM | SMB_FILE_ATTRIBUTE_DIRECTORY | SMB_FILE_ATTRIBUTE_ARCHIVE, pattern = '*', timeout = 30): """ Retrieve a directory listing of files/folders at *path* :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: path relative to the *service_name* where we are interested to learn about its files/sub-folders. :param integer search: integer value made up from a bitwise-OR of *SMB_FILE_ATTRIBUTE_xxx* bits (see smb_constants.py). The default *search* value will query for all read-only, hidden, system, archive files and directories. :param string/unicode pattern: the filter to apply to the results before returning to the client. :return: A list of :doc:`smb.base.SharedFile<smb_SharedFile>` instances. """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(entries): self.is_busy = False results.extend(entries) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._listPath(service_name, path, cb, eb, search = search, pattern = pattern, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results def listSnapshots(self, service_name, path, timeout = 30): """ Retrieve a list of available snapshots (shadow copies) for *path*. Note that snapshot features are only supported on Windows Vista Business, Enterprise and Ultimate, and on all Windows 7 editions. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: path relative to the *service_name* where we are interested in the list of available snapshots :return: A list of python *datetime.DateTime* instances in GMT/UTC time zone """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(entries): self.is_busy = False results.extend(entries) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._listSnapshots(service_name, path, cb, eb, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results def getAttributes(self, service_name, path, timeout = 30): """ Retrieve information about the file at *path* on the *service_name*. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: Path of the file on the remote server. If the file cannot be opened for reading, an :doc:`OperationFailure<smb_exceptions>` will be raised. :return: A :doc:`smb.base.SharedFile<smb_SharedFile>` instance containing the attributes of the file. """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(info): self.is_busy = False results.append(info) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._getAttributes(service_name, path, cb, eb, timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results[0] def retrieveFile(self, service_name, path, file_obj, timeout = 30): """ Retrieve the contents of the file at *path* on the *service_name* and write these contents to the provided *file_obj*. Use *retrieveFileFromOffset()* method if you wish to specify the offset to read from the remote *path* and/or the number of bytes to write to the *file_obj*. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: Path of the file on the remote server. If the file cannot be opened for reading, an :doc:`OperationFailure<smb_exceptions>` will be raised. :param file_obj: A file-like object that has a *write* method. Data will be written continuously to *file_obj* until EOF is received from the remote service. :return: A 2-element tuple of ( file attributes of the file on server, number of bytes written to *file_obj* ). The file attributes is an integer value made up from a bitwise-OR of *SMB_FILE_ATTRIBUTE_xxx* bits (see smb_constants.py) """ return self.retrieveFileFromOffset(service_name, path, file_obj, 0L, -1L, timeout) def retrieveFileFromOffset(self, service_name, path, file_obj, offset = 0L, max_length = -1L, timeout = 30): """ Retrieve the contents of the file at *path* on the *service_name* and write these contents to the provided *file_obj*. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: Path of the file on the remote server. If the file cannot be opened for reading, an :doc:`OperationFailure<smb_exceptions>` will be raised. :param file_obj: A file-like object that has a *write* method. Data will be written continuously to *file_obj* up to *max_length* number of bytes. :param integer/long offset: the offset in the remote *path* where the first byte will be read and written to *file_obj*. Must be either zero or a positive integer/long value. :param integer/long max_length: maximum number of bytes to read from the remote *path* and write to the *file_obj*. Specify a negative value to read from *offset* to the EOF. If zero, the method returns immediately after the file is opened successfully for reading. :return: A 2-element tuple of ( file attributes of the file on server, number of bytes written to *file_obj* ). The file attributes is an integer value made up from a bitwise-OR of *SMB_FILE_ATTRIBUTE_xxx* bits (see smb_constants.py) """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(r): self.is_busy = False results.append(r[1:]) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._retrieveFileFromOffset(service_name, path, file_obj, cb, eb, offset, max_length, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results[0] def storeFile(self, service_name, path, file_obj, timeout = 30): """ Store the contents of the *file_obj* at *path* on the *service_name*. If the file already exists on the remote server, it will be truncated and overwritten. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: Path of the file on the remote server. If the file at *path* does not exist, it will be created. Otherwise, it will be overwritten. If the *path* refers to a folder or the file cannot be opened for writing, an :doc:`OperationFailure<smb_exceptions>` will be raised. :param file_obj: A file-like object that has a *read* method. Data will read continuously from *file_obj* until EOF. :return: Number of bytes uploaded """ return self.storeFileFromOffset(service_name, path, file_obj, 0L, True, timeout) def storeFileFromOffset(self, service_name, path, file_obj, offset = 0L, truncate = False, timeout = 30): """ Store the contents of the *file_obj* at *path* on the *service_name*. :param string/unicode service_name: the name of the shared folder for the *path* :param string/unicode path: Path of the file on the remote server. If the file at *path* does not exist, it will be created. If the *path* refers to a folder or the file cannot be opened for writing, an :doc:`OperationFailure<smb_exceptions>` will be raised. :param file_obj: A file-like object that has a *read* method. Data will read continuously from *file_obj* until EOF. :param offset: Long integer value which specifies the offset in the remote server to start writing. First byte of the file is 0. :param truncate: Boolean value. If True and the file exists on the remote server, it will be truncated first before writing. Default is False. :return: the file position where the next byte will be written. """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(r): self.is_busy = False results.append(r[1]) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._storeFileFromOffset(service_name, path, file_obj, cb, eb, offset, truncate = truncate, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results[0] def deleteFiles(self, service_name, path_file_pattern, timeout = 30): """ Delete one or more regular files. It supports the use of wildcards in file names, allowing for deletion of multiple files in a single request. :param string/unicode service_name: Contains the name of the shared folder. :param string/unicode path_file_pattern: The pathname of the file(s) to be deleted, relative to the service_name. Wildcards may be used in th filename component of the path. If your path/filename contains non-English characters, you must pass in an unicode string. :return: None """ if not self.sock: raise NotConnectedError('Not connected to server') def cb(r): self.is_busy = False def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._deleteFiles(service_name, path_file_pattern, cb, eb, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False def resetFileAttributes(self, service_name, path_file_pattern, timeout = 30): """ Reset file attributes of one or more regular files or folders. It supports the use of wildcards in file names, allowing for unlocking of multiple files/folders in a single request. This function is very helpful when deleting files/folders that are read-only. Note: this function is currently only implemented for SMB2! Technically, it sets the FILE_ATTRIBUTE_NORMAL flag, therefore clearing all other flags. (See https://msdn.microsoft.com/en-us/library/cc232110.aspx for further information) :param string/unicode service_name: Contains the name of the shared folder. :param string/unicode path_file_pattern: The pathname of the file(s) to be deleted, relative to the service_name. Wildcards may be used in th filename component of the path. If your path/filename contains non-English characters, you must pass in an unicode string. :return: None """ if not self.sock: raise NotConnectedError('Not connected to server') def cb(r): self.is_busy = False def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._resetFileAttributes(service_name, path_file_pattern, cb, eb, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False def createDirectory(self, service_name, path, timeout = 30): """ Creates a new directory *path* on the *service_name*. :param string/unicode service_name: Contains the name of the shared folder. :param string/unicode path: The path of the new folder (relative to) the shared folder. If the path contains non-English characters, an unicode string must be used to pass in the path. :return: None """ if not self.sock: raise NotConnectedError('Not connected to server') def cb(r): self.is_busy = False def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._createDirectory(service_name, path, cb, eb, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False def deleteDirectory(self, service_name, path, timeout = 30): """ Delete the empty folder at *path* on *service_name* :param string/unicode service_name: Contains the name of the shared folder. :param string/unicode path: The path of the to-be-deleted folder (relative to) the shared folder. If the path contains non-English characters, an unicode string must be used to pass in the path. :return: None """ if not self.sock: raise NotConnectedError('Not connected to server') def cb(r): self.is_busy = False def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._deleteDirectory(service_name, path, cb, eb, timeout = timeout) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False def rename(self, service_name, old_path, new_path, timeout = 30): """ Rename a file or folder at *old_path* to *new_path* shared at *service_name*. Note that this method cannot be used to rename file/folder across different shared folders *old_path* and *new_path* are string/unicode referring to the old and new path of the renamed resources (relative to) the shared folder. If the path contains non-English characters, an unicode string must be used to pass in the path. :param string/unicode service_name: Contains the name of the shared folder. :return: None """ if not self.sock: raise NotConnectedError('Not connected to server') def cb(r): self.is_busy = False def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._rename(service_name, old_path, new_path, cb, eb) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False def echo(self, data, timeout = 10): """ Send an echo command containing *data* to the remote SMB/CIFS server. The remote SMB/CIFS will reply with the same *data*. :param string data: Data to send to the remote server. :return: The *data* parameter """ if not self.sock: raise NotConnectedError('Not connected to server') results = [ ] def cb(r): self.is_busy = False results.append(r) def eb(failure): self.is_busy = False raise failure self.is_busy = True try: self._echo(data, cb, eb) while self.is_busy: self._pollForNetBIOSPacket(timeout) finally: self.is_busy = False return results[0] # # Protected Methods # def _pollForNetBIOSPacket(self, timeout): expiry_time = time.time() + timeout read_len = 4 data = '' while read_len > 0: try: if expiry_time < time.time(): raise SMBTimeout ready, _, _ = select.select([ self.sock.fileno() ], [ ], [ ], timeout) if not ready: raise SMBTimeout d = self.sock.recv(read_len) if len(d) == 0: raise NotConnectedError data = data + d read_len -= len(d) except select.error, ex: if type(ex) is types.TupleType: if ex[0] != errno.EINTR and ex[0] != errno.EAGAIN: raise ex else: raise ex type, flags, length = struct.unpack('>BBH', data) if flags & 0x01: length = length | 0x10000 read_len = length while read_len > 0: try: if expiry_time < time.time(): raise SMBTimeout ready, _, _ = select.select([ self.sock.fileno() ], [ ], [ ], timeout) if not ready: raise SMBTimeout d = self.sock.recv(read_len) if len(d) == 0: raise NotConnectedError data = data + d read_len -= len(d) except select.error, ex: if type(ex) is types.TupleType: if ex[0] != errno.EINTR and ex[0] != errno.EAGAIN: raise ex else: raise ex self.feedData(data)
Hernanarce/pelisalacarta
python/main-classic/lib/sambatools/smb/SMBConnection.py
Python
gpl-3.0
25,187
#!/usr/bin/env python2 from eagle import * def changed(app, entry, value): print "app %s, entry %s, value %r" % (app.id, entry.id, value) App(title="Entries Test", center=(Entry(id="single"), Entry(id="multi", multiline=True), Entry(id="non-editable", label="non-editable", value="Value", editable=False), Entry(id="non-editable-multi", label="non-editable", value="Value", editable=False, multiline=True), ), data_changed_callback=changed, ) run()
ramalho/eagle-py
tests/entries.py
Python
lgpl-2.1
572
from datetime import timedelta from django.core.management.base import BaseCommand from django.utils import timezone from core.models import Claim class Command(BaseCommand): help = 'Cleans up old unauthorized claims' def add_arguments(self, parser): parser.add_argument('days_old', type=int) parser.add_argument( '--dry-run', action='store_true', dest='dry_run', default=False, help='Do not delete the claims', ) def handle(self, *args, **options): qs = Claim.objects.unauthorized().filter(created_at__lte=timezone.now() - timedelta(days=options['days_old'])) self.stdout.write('Found {} unautorized claims older than {} days for the clean up' .format(qs.count(), options['days_old'])) if not options['dry_run']: qs.delete()
dchaplinsky/badparking.in.ua
badparking/core/management/commands/cleanclaims.py
Python
mit
890
# This file is part of Invenio. # Copyright (C) 2003, 2004, 2005, 2006, 2007, 2008, 2010, 2011 CERN. # # Invenio is free software; you can redistribute it and/or # modify it under the terms of the GNU General Public License as # published by the Free Software Foundation; either version 2 of the # License, or (at your option) any later version. # # Invenio is distributed in the hope that it will be useful, but # WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Invenio; if not, write to the Free Software Foundation, Inc., # 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA. """PERSONAL FEATURES - YOUR ALERTS""" __revision__ = "$Id$" import cgi import time from invenio.config import CFG_SITE_LANG from invenio.legacy.dbquery import run_sql from invenio.legacy.webuser import isGuestUser from invenio.ext.logging import register_exception from invenio.legacy.websession.webaccount import warning_guest_user from invenio.legacy.webbasket.api import create_personal_baskets_selection_box from invenio.legacy.webbasket.db_layer import check_user_owns_baskets from invenio.base.i18n import gettext_set_language from invenio.utils.date import convert_datestruct_to_datetext, convert_datetext_to_dategui import invenio.legacy.template webalert_templates = invenio.legacy.template.load('webalert') ### IMPLEMENTATION class AlertError(Exception): pass def check_alert_name(alert_name, uid, ln=CFG_SITE_LANG): """check this user does not have another alert with this name.""" # load the right language _ = gettext_set_language(ln) sql = """select id_query from user_query_basket where id_user=%s and alert_name=%s""" res = run_sql(sql, (uid, alert_name.strip())) if len(res) > 0: raise AlertError( _("You already have an alert named %(x_name)s.", x_name=('<b>' + cgi.escape(alert_name) + '</b>',))) def get_textual_query_info_from_urlargs(urlargs, ln=CFG_SITE_LANG): """Return nicely formatted search pattern and catalogue from urlargs of the search query. Suitable for 'your searches' display.""" out = "" args = cgi.parse_qs(urlargs) return webalert_templates.tmpl_textual_query_info_from_urlargs( ln = ln, args = args, ) return out def perform_display(permanent, uid, ln=CFG_SITE_LANG): """display the searches performed by the current user input: default permanent="n"; permanent="y" display permanent queries(most popular) output: list of searches in formatted html """ # load the right language _ = gettext_set_language(ln) # first detect number of queries: nb_queries_total = 0 nb_queries_distinct = 0 query = "SELECT COUNT(*),COUNT(DISTINCT(id_query)) FROM user_query WHERE id_user=%s" res = run_sql(query, (uid,), 1) try: nb_queries_total = res[0][0] nb_queries_distinct = res[0][1] except: pass # query for queries: params = () if permanent == "n": SQL_query = "SELECT DISTINCT(q.id),q.urlargs "\ "FROM query q, user_query uq "\ "WHERE uq.id_user=%s "\ "AND uq.id_query=q.id "\ "ORDER BY q.id DESC" params = (uid,) else: # permanent="y" SQL_query = "SELECT q.id,q.urlargs "\ "FROM query q "\ "WHERE q.type='p'" query_result = run_sql(SQL_query, params) queries = [] if len(query_result) > 0: for row in query_result : if permanent == "n": res = run_sql("SELECT DATE_FORMAT(MAX(date),'%%Y-%%m-%%d %%H:%%i:%%s') FROM user_query WHERE id_user=%s and id_query=%s", (uid, row[0])) try: lastrun = res[0][0] except: lastrun = _("unknown") else: lastrun = "" queries.append({ 'id' : row[0], 'args' : row[1], 'textargs' : get_textual_query_info_from_urlargs(row[1], ln=ln), 'lastrun' : lastrun, }) return webalert_templates.tmpl_display_alerts( ln = ln, permanent = permanent, nb_queries_total = nb_queries_total, nb_queries_distinct = nb_queries_distinct, queries = queries, guest = isGuestUser(uid), guesttxt = warning_guest_user(type="alerts", ln=ln) ) def check_user_can_add_alert(id_user, id_query): """Check if ID_USER has really alert adding rights on ID_QUERY (that is, the user made the query herself or the query is one of predefined `popular' queries) and return True or False accordingly. Useful to filter out malicious users trying to guess idq URL parameter values in order to access potentially restricted query alerts.""" # is this a predefined popular query? res = run_sql("""SELECT COUNT(*) FROM query WHERE id=%s AND type='p'""", (id_query,)) if res and res[0][0]: return True # has the user performed this query in the past? res = run_sql("""SELECT COUNT(*) FROM user_query WHERE id_query=%s AND id_user=%s""", (id_query, id_user)) if res and res[0][0]: return True return False def perform_input_alert(action, id_query, alert_name, frequency, notification, id_basket, uid, old_id_basket=None, ln = CFG_SITE_LANG): """get the alert settings input: action="add" for a new alert (blank form), action="modify" for an update (get old values) id_query id the identifier of the search to be alerted for the "modify" action specify old alert_name, frequency of checking, e-mail notification and basket id. output: alert settings input form""" # load the right language _ = gettext_set_language(ln) # security check: if not check_user_can_add_alert(uid, id_query): raise AlertError(_("You do not have rights for this operation.")) # display query information res = run_sql("SELECT urlargs FROM query WHERE id=%s", (id_query,)) try: urlargs = res[0][0] except: urlargs = "UNKNOWN" baskets = create_personal_baskets_selection_box(uid=uid, html_select_box_name='idb', selected_bskid=old_id_basket, ln=ln) return webalert_templates.tmpl_input_alert( ln = ln, query = get_textual_query_info_from_urlargs(urlargs, ln = ln), action = action, frequency = frequency, notification = notification, alert_name = alert_name, baskets = baskets, old_id_basket = old_id_basket, id_basket = id_basket, id_query = id_query, guest = isGuestUser(uid), guesttxt = warning_guest_user(type="alerts", ln=ln) ) def check_alert_is_unique(id_basket, id_query, uid, ln=CFG_SITE_LANG ): """check the user does not have another alert for the specified query and basket""" _ = gettext_set_language(ln) sql = """select id_query from user_query_basket where id_user = %s and id_query = %s and id_basket = %s""" res = run_sql(sql, (uid, id_query, id_basket)) if len(res): raise AlertError(_("You already have an alert defined for the specified query and basket.")) def perform_add_alert(alert_name, frequency, notification, id_basket, id_query, uid, ln = CFG_SITE_LANG): """add an alert to the database input: the name of the new alert; alert frequency: 'month', 'week' or 'day'; setting for e-mail notification: 'y' for yes, 'n' for no; basket identifier: 'no' for no basket; new basket name for this alert; identifier of the query to be alerted output: confirmation message + the list of alerts Web page""" # sanity check if (None in (alert_name, frequency, notification, id_basket, id_query, uid)): return '' # load the right language _ = gettext_set_language(ln) # security check: if not check_user_can_add_alert(uid, id_query): raise AlertError(_("You do not have rights for this operation.")) # check the alert name is not empty alert_name = alert_name.strip() if alert_name == "": raise AlertError(_("The alert name cannot be empty.")) # check if the alert can be created check_alert_name(alert_name, uid, ln) check_alert_is_unique(id_basket, id_query, uid, ln) if id_basket != 0 and not check_user_owns_baskets(uid, id_basket): raise AlertError( _("You are not the owner of this basket.") ) # add a row to the alerts table: user_query_basket query = """INSERT INTO user_query_basket (id_user, id_query, id_basket, frequency, date_creation, date_lastrun, alert_name, notification) VALUES (%s,%s,%s,%s,%s,'',%s,%s)""" params = (uid, id_query, id_basket, frequency, convert_datestruct_to_datetext(time.localtime()), alert_name, notification) run_sql(query, params) out = _("The alert %(x_name)s has been added to your profile.", x_name='<b>' + cgi.escape(alert_name) + '</b>') # out %= '<b>' + cgi.escape(alert_name) + '</b>' out += perform_list_alerts(uid, ln=ln) return out def perform_list_alerts(uid, ln=CFG_SITE_LANG): """perform_list_alerts display the list of alerts for the connected user""" # set variables out = "" # query the database query = """ SELECT q.id, q.urlargs, a.id_basket, b.name, a.alert_name, a.frequency,a.notification, DATE_FORMAT(a.date_creation,'%%Y-%%m-%%d %%H:%%i:%%s'), DATE_FORMAT(a.date_lastrun,'%%Y-%%m-%%d %%H:%%i:%%s') FROM user_query_basket a LEFT JOIN query q ON a.id_query=q.id LEFT JOIN bskBASKET b ON a.id_basket=b.id WHERE a.id_user=%s ORDER BY a.alert_name ASC """ res = run_sql(query, (uid,)) alerts = [] for (qry_id, qry_args, bsk_id, bsk_name, alrt_name, alrt_frequency, alrt_notification, alrt_creation, alrt_last_run) in res: try: if not qry_id: raise StandardError("""\ Warning: I have detected a bad alert for user id %d. It seems one of his/her alert queries was deleted from the 'query' table. Please check this and delete it if needed. Otherwise no problem, I'm continuing with the other alerts now. Here are all the alerts defined by this user: %s""" % (uid, repr(res))) alerts.append({ 'queryid' : qry_id, 'queryargs' : qry_args, 'textargs' : get_textual_query_info_from_urlargs(qry_args, ln=ln), 'userid' : uid, 'basketid' : bsk_id, 'basketname' : bsk_name, 'alertname' : alrt_name, 'frequency' : alrt_frequency, 'notification' : alrt_notification, 'created' : convert_datetext_to_dategui(alrt_creation), 'lastrun' : convert_datetext_to_dategui(alrt_last_run) }) except StandardError: register_exception(alert_admin=True) # link to the "add new alert" form out = webalert_templates.tmpl_list_alerts(ln=ln, alerts=alerts, guest=isGuestUser(uid), guesttxt=warning_guest_user(type="alerts", ln=ln)) return out def perform_remove_alert(alert_name, id_query, id_basket, uid, ln=CFG_SITE_LANG): """perform_remove_alert: remove an alert from the database input: alert name identifier of the query; identifier of the basket uid output: confirmation message + the list of alerts Web page""" # load the right language _ = gettext_set_language(ln) # security check: if not check_user_can_add_alert(uid, id_query): raise AlertError(_("You do not have rights for this operation.")) # set variables out = "" if (None in (alert_name, id_query, id_basket, uid)): return out # remove a row from the alerts table: user_query_basket query = """DELETE FROM user_query_basket WHERE id_user=%s AND id_query=%s AND id_basket=%s""" params = (uid, id_query, id_basket) res = run_sql(query, params) if res: out += "The alert <b>%s</b> has been removed from your profile.<br /><br />\n" % cgi.escape(alert_name) else: out += "Unable to remove alert <b>%s</b>.<br /><br />\n" % cgi.escape(alert_name) out += perform_list_alerts(uid, ln=ln) return out def perform_update_alert(alert_name, frequency, notification, id_basket, id_query, old_id_basket, uid, ln = CFG_SITE_LANG): """update alert settings into the database input: the name of the new alert; alert frequency: 'month', 'week' or 'day'; setting for e-mail notification: 'y' for yes, 'n' for no; new basket identifier: 'no' for no basket; new basket name for this alert; identifier of the query to be alerted old identifier of the basket associated to the alert output: confirmation message + the list of alerts Web page""" out = '' # sanity check if (None in (alert_name, frequency, notification, id_basket, id_query, old_id_basket, uid)): return out # load the right language _ = gettext_set_language(ln) # security check: if not check_user_can_add_alert(uid, id_query): raise AlertError(_("You do not have rights for this operation.")) # check the alert name is not empty if alert_name.strip() == "": raise AlertError(_("The alert name cannot be empty.")) # check if the alert can be created sql = """select alert_name from user_query_basket where id_user=%s and id_basket=%s and id_query=%s""" try: old_alert_name = run_sql(sql, (uid, old_id_basket, id_query))[0][0] except IndexError: # FIXME: I18N since this technique of the below raise message, # since this technique (detecting old alert IDs) is not nice # and should be replaced some day soon. raise AlertError("Unable to detect old alert name.") if old_alert_name.strip()!="" and old_alert_name != alert_name: check_alert_name( alert_name, uid, ln) if id_basket != old_id_basket: check_alert_is_unique( id_basket, id_query, uid, ln) # update a row into the alerts table: user_query_basket query = """UPDATE user_query_basket SET alert_name=%s,frequency=%s,notification=%s, date_creation=%s,date_lastrun='',id_basket=%s WHERE id_user=%s AND id_query=%s AND id_basket=%s""" params = (alert_name, frequency, notification, convert_datestruct_to_datetext(time.localtime()), id_basket, uid, id_query, old_id_basket) run_sql(query, params) out += _("The alert %(x_name)s has been successfully updated.", x_name=("<b>" + cgi.escape(alert_name) + "</b>",)) out += "<br /><br />\n" + perform_list_alerts(uid, ln=ln) return out def is_selected(var, fld): "Checks if the two are equal, and if yes, returns ' selected'. Useful for select boxes." if var == fld: return " selected" else: return "" def account_list_alerts(uid, ln=CFG_SITE_LANG): """account_list_alerts: list alert for the account page input: the user id language output: the list of alerts Web page""" query = """ SELECT q.id, q.urlargs, a.id_user, a.id_query, a.id_basket, a.alert_name, a.frequency, a.notification, DATE_FORMAT(a.date_creation,'%%d %%b %%Y'), DATE_FORMAT(a.date_lastrun,'%%d %%b %%Y'), a.id_basket FROM query q, user_query_basket a WHERE a.id_user=%s AND a.id_query=q.id ORDER BY a.alert_name ASC """ res = run_sql(query, (uid,)) alerts = [] if len(res): for row in res: alerts.append({ 'id' : row[0], 'name' : row[5] }) return webalert_templates.tmpl_account_list_alerts(ln=ln, alerts=alerts) def account_list_searches(uid, ln=CFG_SITE_LANG): """ account_list_searches: list the searches of the user input: the user id output: resume of the searches""" out = "" # first detect number of queries: nb_queries_total = 0 res = run_sql("SELECT COUNT(*) FROM user_query WHERE id_user=%s", (uid,), 1) try: nb_queries_total = res[0][0] except: pass # load the right language _ = gettext_set_language(ln) out += _("You have made %(x_nb)s queries. A %(x_url_open)sdetailed list%(x_url_close)s is available with a possibility to (a) view search results and (b) subscribe to an automatic email alerting service for these queries.") % {'x_nb': nb_queries_total, 'x_url_open': '<a href="../youralerts/display?ln=%s">' % ln, 'x_url_close': '</a>'} return out
zenodo/invenio
invenio/legacy/webalert/api.py
Python
gpl-2.0
18,014
# encoding: UTF-8 ''' 本文件中实现了CTA策略引擎,针对CTA类型的策略,抽象简化了部分底层接口的功能。 关于平今和平昨规则: 1. 普通的平仓OFFSET_CLOSET等于平昨OFFSET_CLOSEYESTERDAY 2. 只有上期所的品种需要考虑平今和平昨的区别 3. 当上期所的期货有今仓时,调用Sell和Cover会使用OFFSET_CLOSETODAY,否则 会使用OFFSET_CLOSE 4. 以上设计意味着如果Sell和Cover的数量超过今日持仓量时,会导致出错(即用户 希望通过一个指令同时平今和平昨) 5. 采用以上设计的原因是考虑到vn.trader的用户主要是对TB、MC和金字塔类的平台 感到功能不足的用户(即希望更高频的交易),交易策略不应该出现4中所述的情况 6. 对于想要实现4中所述情况的用户,需要实现一个策略信号引擎和交易委托引擎分开 的定制化统结构(没错,得自己写) ''' from __future__ import division import traceback import json import os import traceback from collections import OrderedDict from datetime import datetime, timedelta from ctaBase import * from strategy import STRATEGY_CLASS from eventEngine import * from vtConstant import * from vtGateway import VtSubscribeReq, VtOrderReq, VtCancelOrderReq, VtLogData from vtFunction import todayDate ######################################################################## class CtaEngine(object): """CTA策略引擎""" settingFileName = 'CTA_setting.json' path = os.path.abspath(os.path.dirname(__file__)) settingFileName = os.path.join(path, settingFileName) #---------------------------------------------------------------------- def __init__(self, mainEngine, eventEngine): """Constructor""" self.mainEngine = mainEngine self.eventEngine = eventEngine # 当前日期 self.today = todayDate() # 保存策略实例的字典 # key为策略名称,value为策略实例,注意策略名称不允许重复 self.strategyDict = {} # 保存vtSymbol和策略实例映射的字典(用于推送tick数据) # 由于可能多个strategy交易同一个vtSymbol,因此key为vtSymbol # value为包含所有相关strategy对象的list self.tickStrategyDict = {} # 保存vtOrderID和strategy对象映射的字典(用于推送order和trade数据) # key为vtOrderID,value为strategy对象 self.orderStrategyDict = {} # 本地停止单编号计数 self.stopOrderCount = 0 # stopOrderID = STOPORDERPREFIX + str(stopOrderCount) # 本地停止单字典 # key为stopOrderID,value为stopOrder对象 self.stopOrderDict = {} # 停止单撤销后不会从本字典中删除 self.workingStopOrderDict = {} # 停止单撤销后会从本字典中删除 # 持仓缓存字典 # key为vtSymbol,value为PositionBuffer对象 self.posBufferDict = {} # 成交号集合,用来过滤已经收到过的成交推送 self.tradeSet = set() # 引擎类型为实盘 self.engineType = ENGINETYPE_TRADING # 注册事件监听 self.registerEvent() #---------------------------------------------------------------------- def sendOrder(self, vtSymbol, orderType, price, volume, strategy): """发单""" contract = self.mainEngine.getContract(vtSymbol) req = VtOrderReq() req.symbol = contract.symbol req.exchange = contract.exchange req.price = self.roundToPriceTick(contract.priceTick, price) req.volume = volume req.productClass = strategy.productClass req.currency = strategy.currency # 设计为CTA引擎发出的委托只允许使用限价单 req.priceType = PRICETYPE_LIMITPRICE # CTA委托类型映射 if orderType == CTAORDER_BUY: req.direction = DIRECTION_LONG req.offset = OFFSET_OPEN elif orderType == CTAORDER_SELL: req.direction = DIRECTION_SHORT # 只有上期所才要考虑平今平昨 if contract.exchange != EXCHANGE_SHFE: req.offset = OFFSET_CLOSE else: # 获取持仓缓存数据 posBuffer = self.posBufferDict.get(vtSymbol, None) # 如果获取持仓缓存失败,则默认平昨 if not posBuffer: req.offset = OFFSET_CLOSE # 否则如果有多头今仓,则使用平今 elif posBuffer.longToday: req.offset= OFFSET_CLOSETODAY # 其他情况使用平昨 else: req.offset = OFFSET_CLOSE elif orderType == CTAORDER_SHORT: req.direction = DIRECTION_SHORT req.offset = OFFSET_OPEN elif orderType == CTAORDER_COVER: req.direction = DIRECTION_LONG # 只有上期所才要考虑平今平昨 if contract.exchange != EXCHANGE_SHFE: req.offset = OFFSET_CLOSE else: # 获取持仓缓存数据 posBuffer = self.posBufferDict.get(vtSymbol, None) # 如果获取持仓缓存失败,则默认平昨 if not posBuffer: req.offset = OFFSET_CLOSE # 否则如果有空头今仓,则使用平今 elif posBuffer.shortToday: req.offset= OFFSET_CLOSETODAY # 其他情况使用平昨 else: req.offset = OFFSET_CLOSE vtOrderID = self.mainEngine.sendOrder(req, contract.gatewayName) # 发单 self.orderStrategyDict[vtOrderID] = strategy # 保存vtOrderID和策略的映射关系 self.writeCtaLog(u'策略%s发送委托,%s,%s,%s@%s' %(strategy.name, vtSymbol, req.direction, volume, price)) return vtOrderID #---------------------------------------------------------------------- def cancelOrder(self, vtOrderID): """撤单""" # 查询报单对象 order = self.mainEngine.getOrder(vtOrderID) # 如果查询成功 if order: # 检查是否报单还有效,只有有效时才发出撤单指令 orderFinished = (order.status==STATUS_ALLTRADED or order.status==STATUS_CANCELLED) if not orderFinished: req = VtCancelOrderReq() req.symbol = order.symbol req.exchange = order.exchange req.frontID = order.frontID req.sessionID = order.sessionID req.orderID = order.orderID self.mainEngine.cancelOrder(req, order.gatewayName) #---------------------------------------------------------------------- def sendStopOrder(self, vtSymbol, orderType, price, volume, strategy): """发停止单(本地实现)""" self.stopOrderCount += 1 stopOrderID = STOPORDERPREFIX + str(self.stopOrderCount) so = StopOrder() so.vtSymbol = vtSymbol so.orderType = orderType so.price = price so.volume = volume so.strategy = strategy so.stopOrderID = stopOrderID so.status = STOPORDER_WAITING if orderType == CTAORDER_BUY: so.direction = DIRECTION_LONG so.offset = OFFSET_OPEN elif orderType == CTAORDER_SELL: so.direction = DIRECTION_SHORT so.offset = OFFSET_CLOSE elif orderType == CTAORDER_SHORT: so.direction = DIRECTION_SHORT so.offset = OFFSET_OPEN elif orderType == CTAORDER_COVER: so.direction = DIRECTION_LONG so.offset = OFFSET_CLOSE # 保存stopOrder对象到字典中 self.stopOrderDict[stopOrderID] = so self.workingStopOrderDict[stopOrderID] = so return stopOrderID #---------------------------------------------------------------------- def cancelStopOrder(self, stopOrderID): """撤销停止单""" # 检查停止单是否存在 if stopOrderID in self.workingStopOrderDict: so = self.workingStopOrderDict[stopOrderID] so.status = STOPORDER_CANCELLED del self.workingStopOrderDict[stopOrderID] #---------------------------------------------------------------------- def processStopOrder(self, tick): """收到行情后处理本地停止单(检查是否要立即发出)""" vtSymbol = tick.vtSymbol # 首先检查是否有策略交易该合约 if vtSymbol in self.tickStrategyDict: # 遍历等待中的停止单,检查是否会被触发 for so in self.workingStopOrderDict.values(): if so.vtSymbol == vtSymbol: longTriggered = so.direction==DIRECTION_LONG and tick.lastPrice>=so.price # 多头停止单被触发 shortTriggered = so.direction==DIRECTION_SHORT and tick.lastPrice<=so.price # 空头停止单被触发 if longTriggered or shortTriggered: # 买入和卖出分别以涨停跌停价发单(模拟市价单) if so.direction==DIRECTION_LONG: price = tick.upperLimit else: price = tick.lowerLimit so.status = STOPORDER_TRIGGERED self.sendOrder(so.vtSymbol, so.orderType, price, so.volume, so.strategy) del self.workingStopOrderDict[so.stopOrderID] #---------------------------------------------------------------------- def processTickEvent(self, event): """处理行情推送""" tick = event.dict_['data'] # 收到tick行情后,先处理本地停止单(检查是否要立即发出) self.processStopOrder(tick) # 推送tick到对应的策略实例进行处理 if tick.vtSymbol in self.tickStrategyDict: # 将vtTickData数据转化为ctaTickData ctaTick = CtaTickData() d = ctaTick.__dict__ for key in d.keys(): if key != 'datetime': d[key] = tick.__getattribute__(key) # 添加datetime字段 ctaTick.datetime = datetime.strptime(' '.join([tick.date, tick.time]), '%Y%m%d %H:%M:%S.%f') # 逐个推送到策略实例中 l = self.tickStrategyDict[tick.vtSymbol] for strategy in l: self.callStrategyFunc(strategy, strategy.onTick, ctaTick) #---------------------------------------------------------------------- def processOrderEvent(self, event): """处理委托推送""" order = event.dict_['data'] if order.vtOrderID in self.orderStrategyDict: strategy = self.orderStrategyDict[order.vtOrderID] self.callStrategyFunc(strategy, strategy.onOrder, order) #---------------------------------------------------------------------- def processTradeEvent(self, event): """处理成交推送""" trade = event.dict_['data'] # 过滤已经收到过的成交回报 if trade.vtTradeID in self.tradeSet: return self.tradeSet.add(trade.vtTradeID) # 将成交推送到策略对象中 if trade.vtOrderID in self.orderStrategyDict: strategy = self.orderStrategyDict[trade.vtOrderID] # 计算策略持仓 if trade.direction == DIRECTION_LONG: strategy.pos += trade.volume else: strategy.pos -= trade.volume self.callStrategyFunc(strategy, strategy.onTrade, trade) # 更新持仓缓存数据 if trade.vtSymbol in self.tickStrategyDict: posBuffer = self.posBufferDict.get(trade.vtSymbol, None) if not posBuffer: posBuffer = PositionBuffer() posBuffer.vtSymbol = trade.vtSymbol self.posBufferDict[trade.vtSymbol] = posBuffer posBuffer.updateTradeData(trade) #---------------------------------------------------------------------- def processPositionEvent(self, event): """处理持仓推送""" pos = event.dict_['data'] # 更新持仓缓存数据 if pos.vtSymbol in self.tickStrategyDict: posBuffer = self.posBufferDict.get(pos.vtSymbol, None) if not posBuffer: posBuffer = PositionBuffer() posBuffer.vtSymbol = pos.vtSymbol self.posBufferDict[pos.vtSymbol] = posBuffer posBuffer.updatePositionData(pos) #---------------------------------------------------------------------- def registerEvent(self): """注册事件监听""" self.eventEngine.register(EVENT_TICK, self.processTickEvent) self.eventEngine.register(EVENT_ORDER, self.processOrderEvent) self.eventEngine.register(EVENT_TRADE, self.processTradeEvent) self.eventEngine.register(EVENT_POSITION, self.processPositionEvent) #---------------------------------------------------------------------- def insertData(self, dbName, collectionName, data): """插入数据到数据库(这里的data可以是CtaTickData或者CtaBarData)""" self.mainEngine.dbInsert(dbName, collectionName, data.__dict__) #---------------------------------------------------------------------- def loadBar(self, dbName, collectionName, days): """从数据库中读取Bar数据,startDate是datetime对象""" startDate = self.today - timedelta(days) d = {'datetime':{'$gte':startDate}} barData = self.mainEngine.dbQuery(dbName, collectionName, d) l = [] for d in barData: bar = CtaBarData() bar.__dict__ = d l.append(bar) return l #---------------------------------------------------------------------- def loadTick(self, dbName, collectionName, days): """从数据库中读取Tick数据,startDate是datetime对象""" startDate = self.today - timedelta(days) d = {'datetime':{'$gte':startDate}} tickData = self.mainEngine.dbQuery(dbName, collectionName, d) l = [] for d in tickData: tick = CtaTickData() tick.__dict__ = d l.append(tick) return l #---------------------------------------------------------------------- def writeCtaLog(self, content): """快速发出CTA模块日志事件""" log = VtLogData() log.logContent = content event = Event(type_=EVENT_CTA_LOG) event.dict_['data'] = log self.eventEngine.put(event) #---------------------------------------------------------------------- def loadStrategy(self, setting): """载入策略""" try: name = setting['name'] className = setting['className'] except: self.writeCtaLog(u'载入策略出错:%s' %traceback.format_exc()) return # 获取策略类 strategyClass = STRATEGY_CLASS.get(className, None) if not strategyClass: self.writeCtaLog(u'找不到策略类:%s' %className) return # 防止策略重名 if name in self.strategyDict: self.writeCtaLog(u'策略实例重名:%s' %name) else: # 创建策略实例 strategy = strategyClass(self, setting) self.strategyDict[name] = strategy # 保存Tick映射关系 if strategy.vtSymbol in self.tickStrategyDict: l = self.tickStrategyDict[strategy.vtSymbol] else: l = [] self.tickStrategyDict[strategy.vtSymbol] = l l.append(strategy) # 订阅合约 contract = self.mainEngine.getContract(strategy.vtSymbol) if contract: req = VtSubscribeReq() req.symbol = contract.symbol req.exchange = contract.exchange # 对于IB接口订阅行情时所需的货币和产品类型,从策略属性中获取 req.currency = strategy.currency req.productClass = strategy.productClass self.mainEngine.subscribe(req, contract.gatewayName) else: self.writeCtaLog(u'%s的交易合约%s无法找到' %(name, strategy.vtSymbol)) #---------------------------------------------------------------------- def initStrategy(self, name): """初始化策略""" if name in self.strategyDict: strategy = self.strategyDict[name] if not strategy.inited: strategy.inited = True self.callStrategyFunc(strategy, strategy.onInit) else: self.writeCtaLog(u'请勿重复初始化策略实例:%s' %name) else: self.writeCtaLog(u'策略实例不存在:%s' %name) #--------------------------------------------------------------------- def startStrategy(self, name): """启动策略""" if name in self.strategyDict: strategy = self.strategyDict[name] if strategy.inited and not strategy.trading: strategy.trading = True self.callStrategyFunc(strategy, strategy.onStart) else: self.writeCtaLog(u'策略实例不存在:%s' %name) #---------------------------------------------------------------------- def stopStrategy(self, name): """停止策略""" if name in self.strategyDict: strategy = self.strategyDict[name] if strategy.trading: strategy.trading = False self.callStrategyFunc(strategy, strategy.onStop) # 对该策略发出的所有限价单进行撤单 for vtOrderID, s in self.orderStrategyDict.items(): if s is strategy: self.cancelOrder(vtOrderID) # 对该策略发出的所有本地停止单撤单 for stopOrderID, so in self.workingStopOrderDict.items(): if so.strategy is strategy: self.cancelStopOrder(stopOrderID) else: self.writeCtaLog(u'策略实例不存在:%s' %name) #---------------------------------------------------------------------- def saveSetting(self): """保存策略配置""" with open(self.settingFileName, 'w') as f: l = [] for strategy in self.strategyDict.values(): setting = {} for param in strategy.paramList: setting[param] = strategy.__getattribute__(param) l.append(setting) jsonL = json.dumps(l, indent=4) f.write(jsonL) #---------------------------------------------------------------------- def loadSetting(self): """读取策略配置""" with open(self.settingFileName) as f: l = json.load(f) for setting in l: self.loadStrategy(setting) self.loadPosition() #---------------------------------------------------------------------- def getStrategyVar(self, name): """获取策略当前的变量字典""" if name in self.strategyDict: strategy = self.strategyDict[name] varDict = OrderedDict() for key in strategy.varList: varDict[key] = strategy.__getattribute__(key) return varDict else: self.writeCtaLog(u'策略实例不存在:' + name) return None #---------------------------------------------------------------------- def getStrategyParam(self, name): """获取策略的参数字典""" if name in self.strategyDict: strategy = self.strategyDict[name] paramDict = OrderedDict() for key in strategy.paramList: paramDict[key] = strategy.__getattribute__(key) return paramDict else: self.writeCtaLog(u'策略实例不存在:' + name) return None #---------------------------------------------------------------------- def putStrategyEvent(self, name): """触发策略状态变化事件(通常用于通知GUI更新)""" event = Event(EVENT_CTA_STRATEGY+name) self.eventEngine.put(event) #---------------------------------------------------------------------- def callStrategyFunc(self, strategy, func, params=None): """调用策略的函数,若触发异常则捕捉""" try: if params: func(params) else: func() except Exception: # 停止策略,修改状态为未初始化 strategy.trading = False strategy.inited = False # 发出日志 content = '\n'.join([u'策略%s触发异常已停止' %strategy.name, traceback.format_exc()]) self.writeCtaLog(content) #---------------------------------------------------------------------- def savePosition(self): """保存所有策略的持仓情况到数据库""" for strategy in self.strategyDict.values(): flt = {'name': strategy.name, 'vtSymbol': strategy.vtSymbol} d = {'name': strategy.name, 'vtSymbol': strategy.vtSymbol, 'pos': strategy.pos} self.mainEngine.dbUpdate(POSITION_DB_NAME, strategy.className, d, flt, True) content = '策略%s持仓保存成功' %strategy.name self.writeCtaLog(content) #---------------------------------------------------------------------- def loadPosition(self): """从数据库载入策略的持仓情况""" for strategy in self.strategyDict.values(): flt = {'name': strategy.name, 'vtSymbol': strategy.vtSymbol} posData = self.mainEngine.dbQuery(POSITION_DB_NAME, strategy.className, flt) for d in posData: strategy.pos = d['pos'] #---------------------------------------------------------------------- def roundToPriceTick(self, priceTick, price): """取整价格到合约最小价格变动""" if not priceTick: return price newPrice = round(price/priceTick, 0) * priceTick return newPrice ######################################################################## class PositionBuffer(object): """持仓缓存信息(本地维护的持仓数据)""" #---------------------------------------------------------------------- def __init__(self): """Constructor""" self.vtSymbol = EMPTY_STRING # 多头 self.longPosition = EMPTY_INT self.longToday = EMPTY_INT self.longYd = EMPTY_INT # 空头 self.shortPosition = EMPTY_INT self.shortToday = EMPTY_INT self.shortYd = EMPTY_INT #---------------------------------------------------------------------- def updatePositionData(self, pos): """更新持仓数据""" if pos.direction == DIRECTION_LONG: self.longPosition = pos.position self.longYd = pos.ydPosition self.longToday = self.longPosition - self.longYd else: self.shortPosition = pos.position self.shortYd = pos.ydPosition self.shortToday = self.shortPosition - self.shortYd #---------------------------------------------------------------------- def updateTradeData(self, trade): """更新成交数据""" if trade.direction == DIRECTION_LONG: # 多方开仓,则对应多头的持仓和今仓增加 if trade.offset == OFFSET_OPEN: self.longPosition += trade.volume self.longToday += trade.volume # 多方平今,对应空头的持仓和今仓减少 elif trade.offset == OFFSET_CLOSETODAY: self.shortPosition -= trade.volume self.shortToday -= trade.volume # 多方平昨,对应空头的持仓和昨仓减少 else: self.shortPosition -= trade.volume self.shortYd -= trade.volume else: # 空头和多头相同 if trade.offset == OFFSET_OPEN: self.shortPosition += trade.volume self.shortToday += trade.volume elif trade.offset == OFFSET_CLOSETODAY: self.longPosition -= trade.volume self.longToday -= trade.volume else: self.longPosition -= trade.volume self.longYd -= trade.volume
ujfjhz/vnpy
docker/dockerTrader/ctaStrategy/ctaEngine.py
Python
mit
25,335
""" Django settings for model_my_watershed project. For more information on this file, see https://docs.djangoproject.com/en/1.7/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/1.7/ref/settings/ """ from os import environ from os.path import abspath, basename, dirname, join, normpath from sys import path # Normally you should not import ANYTHING from Django directly # into your settings, but ImproperlyConfigured is an exception. from django.core.exceptions import ImproperlyConfigured from omgeo import postprocessors def get_env_setting(setting): """ Get the environment setting or return exception """ try: return environ[setting] except KeyError: error_msg = "Set the %s env variable" % setting raise ImproperlyConfigured(error_msg) # PATH CONFIGURATION DJANGO_ROOT = dirname(dirname(abspath(__file__))) # Absolute filesystem path to the top-level folder: SITE_ROOT = dirname(DJANGO_ROOT) # Site name: SITE_NAME = basename(DJANGO_ROOT) # Add our project to our pythonpath, this way we don't need to type our project # name in our dotted import paths: path.append(DJANGO_ROOT) # END PATH CONFIGURATION # DEBUG CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#debug DEBUG = False # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-debug TEMPLATE_DEBUG = DEBUG # END DEBUG CONFIGURATION # FILE STORAGE CONFIGURATION DEFAULT_FILE_STORAGE = 'django.core.files.storage.FileSystemStorage' # END FILE STORAGE CONFIGURATION # CACHE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#caches CACHES = { 'default': { # The Redis database at index 0 is used by Logstash/Beaver 'BACKEND': 'django_redis.cache.RedisCache', 'LOCATION': 'redis://{0}:{1}/1'.format( environ.get('MMW_CACHE_HOST', 'localhost'), environ.get('MMW_CACHE_PORT', 6379)), 'OPTIONS': { 'PARSER_CLASS': 'redis.connection.HiredisParser', 'SOCKET_TIMEOUT': 3, } } } # Don't throw exceptions if Redis is down. DJANGO_REDIS_IGNORE_EXCEPTIONS = True # END CACHE CONFIGURATION # DATABASE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.contrib.gis.db.backends.postgis', 'NAME': environ.get('MMW_DB_NAME', 'mmw'), 'USER': environ.get('MMW_DB_USER', 'mmw'), 'PASSWORD': environ.get('MMW_DB_PASSWORD', 'mmw'), 'HOST': environ.get('MMW_DB_HOST', 'localhost'), 'PORT': environ.get('MMW_DB_PORT', 5432), 'TEST_NAME': environ.get('DJANGO_TEST_DB_NAME', 'test_mmw') } } POSTGIS_VERSION = tuple( map(int, environ.get('DJANGO_POSTGIS_VERSION', '2.1.3').split(".")) ) # END DATABASE CONFIGURATION # CELERY CONFIGURATION BROKER_URL = 'redis://{0}:{1}/2'.format( environ.get('MMW_CACHE_HOST', 'localhost'), environ.get('MMW_CACHE_PORT', 6379)) CELERY_IMPORTS = ('celery.task.http',) CELERY_ACCEPT_CONTENT = ['json'] CELERY_TASK_SERIALIZER = 'json' CELERY_RESULT_SERIALIZER = 'json' CELERY_RESULT_BACKEND = 'djcelery.backends.cache:CacheBackend' STATSD_CELERY_SIGNALS = True # END CELERY CONFIGURATION # LOGGING CONFIGURATION LOGGING = { 'version': 1, 'disable_existing_loggers': True, 'handlers': { 'console': { 'class': 'logging.StreamHandler', }, }, 'loggers': { 'django': { 'handlers': ['console'], 'level': 'INFO', }, } } # END LOGGING CONFIGURATION # GENERAL CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#time-zone TIME_ZONE = 'America/New_York' # See: https://docs.djangoproject.com/en/dev/ref/settings/#language-code LANGUAGE_CODE = 'en-us' # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-i18n USE_I18N = False # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-l10n USE_L10N = False # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-tz USE_TZ = True # This generates false positives and is being removed # (https://code.djangoproject.com/ticket/23469) SILENCED_SYSTEM_CHECKS = ['1_6.W001', '1_6.W002'] # END GENERAL CONFIGURATION # MEDIA CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#media-root MEDIA_ROOT = environ['DJANGO_MEDIA_ROOT'] # See: https://docs.djangoproject.com/en/dev/ref/settings/#media-url MEDIA_URL = '/media/' # END MEDIA CONFIGURATION # STATIC FILE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#static-root STATIC_ROOT = environ['DJANGO_STATIC_ROOT'] # See: https://docs.djangoproject.com/en/dev/ref/settings/#static-url STATIC_URL = '/static/' # See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#std:setting-STATICFILES_DIRS # NOQA STATICFILES_DIR = '/var/cache/mmw/static/' STATICFILES_DIRS = ( STATICFILES_DIR, ) # See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#staticfiles-finders # NOQA STATICFILES_FINDERS = ( 'django.contrib.staticfiles.finders.FileSystemFinder', 'django.contrib.staticfiles.finders.AppDirectoriesFinder', ) # SECRET CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#secret-key # Note: This key should only be used for development and testing. SECRET_KEY = get_env_setting('DJANGO_SECRET_KEY') # END SECRET CONFIGURATION # SITE CONFIGURATION # Hosts/domain names that are valid for this site # See https://docs.djangoproject.com/en/1.5/ref/settings/#allowed-hosts ALLOWED_HOSTS = [] # END SITE CONFIGURATION # FIXTURE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#std:setting-FIXTURE_DIRS # NOQA FIXTURE_DIRS = ( normpath(join(SITE_ROOT, 'fixtures')), ) # END FIXTURE CONFIGURATION # TEMPLATE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-context-processors # NOQA TEMPLATE_CONTEXT_PROCESSORS = ( 'django.contrib.auth.context_processors.auth', 'django.core.context_processors.debug', 'django.core.context_processors.media', 'django.core.context_processors.static', 'django.core.context_processors.tz', 'django.contrib.messages.context_processors.messages', 'django.core.context_processors.request', ) # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-loaders TEMPLATE_LOADERS = ( 'django.template.loaders.filesystem.Loader', 'django.template.loaders.app_directories.Loader', ) # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-dirs TEMPLATE_DIRS = ( normpath(join(SITE_ROOT, 'templates')), ) # END TEMPLATE CONFIGURATION # MIDDLEWARE CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#middleware-classes MIDDLEWARE_CLASSES = ( # Default Django middleware. 'django.middleware.common.CommonMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', 'django_statsd.middleware.GraphiteRequestTimingMiddleware', 'django_statsd.middleware.GraphiteMiddleware', ) # END MIDDLEWARE CONFIGURATION # URL CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#root-urlconf ROOT_URLCONF = '%s.urls' % SITE_NAME # END URL CONFIGURATION # APP CONFIGURATION DJANGO_APPS = ( # Default Django apps: 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.gis', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', 'django.contrib.humanize', 'django.contrib.admin', ) THIRD_PARTY_APPS = ( 'rest_framework', 'watchman', 'registration', ) # THIRD-PARTY CONFIGURATION # watchman # Disable Storage checking, to avoid creating files on S3 on every health check WATCHMAN_CHECKS = ( 'watchman.checks.caches', 'watchman.checks.databases', ) # rest_framework REST_FRAMEWORK = { # Use Django's standard `django.contrib.auth` permissions, # or allow read-only access for unauthenticated users. 'DEFAULT_PERMISSION_CLASSES': [ 'rest_framework.permissions.DjangoModelPermissionsOrAnonReadOnly' ] } # registration ACCOUNT_ACTIVATION_DAYS = 7 # One-week activation window. REGISTRATION_AUTO_LOGIN = True # Automatically log the user in. # Add custom authentication classes AUTHENTICATION_BACKENDS = ( 'django.contrib.auth.backends.ModelBackend', 'apps.user.backends.ItsiAuthenticationBackend', ) # END THIRD-PARTY CONFIGURATION # Apps specific for this project go here. LOCAL_APPS = ( 'apps.core', 'apps.modeling', 'apps.home', 'apps.geocode', 'apps.water_balance', 'apps.user' ) # See: https://docs.djangoproject.com/en/dev/ref/settings/#installed-apps INSTALLED_APPS = DJANGO_APPS + THIRD_PARTY_APPS + LOCAL_APPS # END APP CONFIGURATION # WSGI CONFIGURATION # See: https://docs.djangoproject.com/en/dev/ref/settings/#wsgi-application WSGI_APPLICATION = '%s.wsgi.application' % SITE_NAME # END WSGI CONFIGURATION # Work-around to get django-registration-redux to work with Django 1.8. # Source: https://github.com/evonove/django-oauth-toolkit/issues/204 REGISTRATION_MANAGER_MODEL = 'registration.RegistrationManager' REGISTRATION_PROFILE_MODEL = 'registration.RegistrationProfile' MIGRATION_MODULES = { 'registration': 'mmw.migrations.registration', } OMGEO_SETTINGS = [[ 'omgeo.services.EsriWGSSSL', { 'preprocessors': [], 'postprocessors': [ postprocessors.UseHighScoreIfAtLeast(99), postprocessors.DupePicker( attr_dupes='match_addr', attr_sort='locator_type', ordered_list=['PointAddress', 'BuildingName', 'StreetAddress'] ), postprocessors.ScoreSorter(), postprocessors.GroupBy('match_addr'), postprocessors.GroupBy(('x', 'y')), postprocessors.SnapPoints(distance=10) ] } ]] # ITSI Portal Settings ITSI = { 'client_id': environ.get('MMW_ITSI_CLIENT_ID', 'model-my-watershed'), 'client_secret': environ.get('MMW_ITSI_SECRET_KEY', 'itsi_secret_key'), 'base_url': environ.get('MMW_ITSI_BASE_URL', 'http://learn.staging.concord.org/'), 'authorize_url': 'auth/concord_id/authorize', 'access_token_url': 'auth/concord_id/access_token', 'user_json_url': 'auth/concord_id/user.json', }
lewfish/model-my-watershed
src/mmw/mmw/settings/base.py
Python
apache-2.0
10,648
""" SAX driver for the pyexpat C module. This driver works with pyexpat.__version__ == '2.22'. """ version = "0.20" from xml.sax._exceptions import * from xml.sax.handler import feature_validation, feature_namespaces from xml.sax.handler import feature_namespace_prefixes from xml.sax.handler import feature_external_ges, feature_external_pes from xml.sax.handler import feature_string_interning from xml.sax.handler import property_xml_string, property_interning_dict # xml.parsers.expat does not raise ImportError in Jython import sys if sys.platform[:4] == "java": raise SAXReaderNotAvailable("expat not available in Java", None) del sys try: from xml.parsers import expat except ImportError: raise SAXReaderNotAvailable("expat not supported", None) else: if not hasattr(expat, "ParserCreate"): raise SAXReaderNotAvailable("expat not supported", None) from xml.sax import xmlreader, saxutils, handler AttributesImpl = xmlreader.AttributesImpl AttributesNSImpl = xmlreader.AttributesNSImpl # If we're using a sufficiently recent version of Python, we can use # weak references to avoid cycles between the parser and content # handler, otherwise we'll just have to pretend. try: import _weakref except ImportError: def _mkproxy(o): return o else: import weakref _mkproxy = weakref.proxy del weakref, _weakref # --- ExpatLocator class ExpatLocator(xmlreader.Locator): """Locator for use with the ExpatParser class. This uses a weak reference to the parser object to avoid creating a circular reference between the parser and the content handler. """ def __init__(self, parser): self._ref = _mkproxy(parser) def getColumnNumber(self): parser = self._ref if parser._parser is None: return None return parser._parser.ErrorColumnNumber def getLineNumber(self): parser = self._ref if parser._parser is None: return 1 return parser._parser.ErrorLineNumber def getPublicId(self): parser = self._ref if parser is None: return None return parser._source.getPublicId() def getSystemId(self): parser = self._ref if parser is None: return None return parser._source.getSystemId() # --- ExpatParser class ExpatParser(xmlreader.IncrementalParser, xmlreader.Locator): """SAX driver for the pyexpat C module.""" def __init__(self, namespaceHandling=0, bufsize=2**16-20): xmlreader.IncrementalParser.__init__(self, bufsize) self._source = xmlreader.InputSource() self._parser = None self._namespaces = namespaceHandling self._lex_handler_prop = None self._parsing = 0 self._entity_stack = [] self._external_ges = 1 self._interning = None # XMLReader methods def parse(self, source): "Parse an XML document from a URL or an InputSource." source = saxutils.prepare_input_source(source) self._source = source self.reset() self._cont_handler.setDocumentLocator(ExpatLocator(self)) xmlreader.IncrementalParser.parse(self, source) def prepareParser(self, source): if source.getSystemId() != None: self._parser.SetBase(source.getSystemId()) # Redefined setContentHandler to allow changing handlers during parsing def setContentHandler(self, handler): xmlreader.IncrementalParser.setContentHandler(self, handler) if self._parsing: self._reset_cont_handler() def getFeature(self, name): if name == feature_namespaces: return self._namespaces elif name == feature_string_interning: return self._interning is not None elif name in (feature_validation, feature_external_pes, feature_namespace_prefixes): return 0 elif name == feature_external_ges: return self._external_ges raise SAXNotRecognizedException("Feature '%s' not recognized" % name) def setFeature(self, name, state): if self._parsing: raise SAXNotSupportedException("Cannot set features while parsing") if name == feature_namespaces: self._namespaces = state elif name == feature_external_ges: self._external_ges = state elif name == feature_string_interning: if state: if self._interning is None: self._interning = {} else: self._interning = None elif name == feature_validation: if state: raise SAXNotSupportedException( "expat does not support validation") elif name == feature_external_pes: if state: raise SAXNotSupportedException( "expat does not read external parameter entities") elif name == feature_namespace_prefixes: if state: raise SAXNotSupportedException( "expat does not report namespace prefixes") else: raise SAXNotRecognizedException( "Feature '%s' not recognized" % name) def getProperty(self, name): if name == handler.property_lexical_handler: return self._lex_handler_prop elif name == property_interning_dict: return self._interning elif name == property_xml_string: if self._parser: if hasattr(self._parser, "GetInputContext"): return self._parser.GetInputContext() else: raise SAXNotRecognizedException( "This version of expat does not support getting" " the XML string") else: raise SAXNotSupportedException( "XML string cannot be returned when not parsing") raise SAXNotRecognizedException("Property '%s' not recognized" % name) def setProperty(self, name, value): if name == handler.property_lexical_handler: self._lex_handler_prop = value if self._parsing: self._reset_lex_handler_prop() elif name == property_interning_dict: self._interning = value elif name == property_xml_string: raise SAXNotSupportedException("Property '%s' cannot be set" % name) else: raise SAXNotRecognizedException("Property '%s' not recognized" % name) # IncrementalParser methods def feed(self, data, isFinal = 0): if not self._parsing: self.reset() self._parsing = 1 self._cont_handler.startDocument() try: # The isFinal parameter is internal to the expat reader. # If it is set to true, expat will check validity of the entire # document. When feeding chunks, they are not normally final - # except when invoked from close. self._parser.Parse(data, isFinal) except expat.error, e: exc = SAXParseException(expat.ErrorString(e.code), e, self) # FIXME: when to invoke error()? self._err_handler.fatalError(exc) def close(self): if self._entity_stack: # If we are completing an external entity, do nothing here return self.feed("", isFinal = 1) self._cont_handler.endDocument() self._parsing = 0 # break cycle created by expat handlers pointing to our methods self._parser = None def _reset_cont_handler(self): self._parser.ProcessingInstructionHandler = \ self._cont_handler.processingInstruction self._parser.CharacterDataHandler = self._cont_handler.characters def _reset_lex_handler_prop(self): lex = self._lex_handler_prop parser = self._parser if lex is None: parser.CommentHandler = None parser.StartCdataSectionHandler = None parser.EndCdataSectionHandler = None parser.StartDoctypeDeclHandler = None parser.EndDoctypeDeclHandler = None else: parser.CommentHandler = lex.comment parser.StartCdataSectionHandler = lex.startCDATA parser.EndCdataSectionHandler = lex.endCDATA parser.StartDoctypeDeclHandler = self.start_doctype_decl parser.EndDoctypeDeclHandler = lex.endDTD def reset(self): if self._namespaces: self._parser = expat.ParserCreate(self._source.getEncoding(), " ", intern=self._interning) self._parser.namespace_prefixes = 1 self._parser.StartElementHandler = self.start_element_ns self._parser.EndElementHandler = self.end_element_ns else: self._parser = expat.ParserCreate(self._source.getEncoding(), intern = self._interning) self._parser.StartElementHandler = self.start_element self._parser.EndElementHandler = self.end_element self._reset_cont_handler() self._parser.UnparsedEntityDeclHandler = self.unparsed_entity_decl self._parser.NotationDeclHandler = self.notation_decl self._parser.StartNamespaceDeclHandler = self.start_namespace_decl self._parser.EndNamespaceDeclHandler = self.end_namespace_decl self._decl_handler_prop = None if self._lex_handler_prop: self._reset_lex_handler_prop() # self._parser.DefaultHandler = # self._parser.DefaultHandlerExpand = # self._parser.NotStandaloneHandler = self._parser.ExternalEntityRefHandler = self.external_entity_ref try: self._parser.SkippedEntityHandler = self.skipped_entity_handler except AttributeError: # This pyexpat does not support SkippedEntity pass self._parser.SetParamEntityParsing( expat.XML_PARAM_ENTITY_PARSING_UNLESS_STANDALONE) self._parsing = 0 self._entity_stack = [] # Locator methods def getColumnNumber(self): if self._parser is None: return None return self._parser.ErrorColumnNumber def getLineNumber(self): if self._parser is None: return 1 return self._parser.ErrorLineNumber def getPublicId(self): return self._source.getPublicId() def getSystemId(self): return self._source.getSystemId() # event handlers def start_element(self, name, attrs): self._cont_handler.startElement(name, AttributesImpl(attrs)) def end_element(self, name): self._cont_handler.endElement(name) def start_element_ns(self, name, attrs): pair = name.split() if len(pair) == 1: # no namespace pair = (None, name) elif len(pair) == 3: pair = pair[0], pair[1] else: # default namespace pair = tuple(pair) newattrs = {} qnames = {} for (aname, value) in attrs.items(): parts = aname.split() length = len(parts) if length == 1: # no namespace qname = aname apair = (None, aname) elif length == 3: qname = "%s:%s" % (parts[2], parts[1]) apair = parts[0], parts[1] else: # default namespace qname = parts[1] apair = tuple(parts) newattrs[apair] = value qnames[apair] = qname self._cont_handler.startElementNS(pair, None, AttributesNSImpl(newattrs, qnames)) def end_element_ns(self, name): pair = name.split() if len(pair) == 1: pair = (None, name) elif len(pair) == 3: pair = pair[0], pair[1] else: pair = tuple(pair) self._cont_handler.endElementNS(pair, None) # this is not used (call directly to ContentHandler) def processing_instruction(self, target, data): self._cont_handler.processingInstruction(target, data) # this is not used (call directly to ContentHandler) def character_data(self, data): self._cont_handler.characters(data) def start_namespace_decl(self, prefix, uri): self._cont_handler.startPrefixMapping(prefix, uri) def end_namespace_decl(self, prefix): self._cont_handler.endPrefixMapping(prefix) def start_doctype_decl(self, name, sysid, pubid, has_internal_subset): self._lex_handler_prop.startDTD(name, pubid, sysid) def unparsed_entity_decl(self, name, base, sysid, pubid, notation_name): self._dtd_handler.unparsedEntityDecl(name, pubid, sysid, notation_name) def notation_decl(self, name, base, sysid, pubid): self._dtd_handler.notationDecl(name, pubid, sysid) def external_entity_ref(self, context, base, sysid, pubid): if not self._external_ges: return 1 source = self._ent_handler.resolveEntity(pubid, sysid) source = saxutils.prepare_input_source(source, self._source.getSystemId() or "") self._entity_stack.append((self._parser, self._source)) self._parser = self._parser.ExternalEntityParserCreate(context) self._source = source try: xmlreader.IncrementalParser.parse(self, source) except: return 0 # FIXME: save error info here? (self._parser, self._source) = self._entity_stack[-1] del self._entity_stack[-1] return 1 def skipped_entity_handler(self, name, is_pe): if is_pe: # The SAX spec requires to report skipped PEs with a '%' name = '%'+name self._cont_handler.skippedEntity(name) # --- def create_parser(*args, **kwargs): return ExpatParser(*args, **kwargs) # --- if __name__ == "__main__": import xml.sax p = create_parser() p.setContentHandler(xml.sax.XMLGenerator()) p.setErrorHandler(xml.sax.ErrorHandler()) p.parse("../../../hamlet.xml")
ztane/zsos
userland/lib/python2.5/xml/sax/expatreader.py
Python
gpl-3.0
14,504
from pipeline.compilers import SubProcessCompiler, CompilerBase from os.path import dirname from django.conf import settings import subprocess # DEPRECATED ... NOT REQUIRED. USED DJANGO-COMPRESSOR INSTEAD OF # DJANGO-PIPELINES class BabelCompiler(SubProcessCompiler): output_extension = 'js' def match_file(self, path): return path.endswith('.jsx') def compile_file(self, infile, outfile, outdated=False, force=False): if not force and not outdated: # File doesn't need to be recompiled return pipeline_settings = settings.PIPELINE command = [ pipeline_settings.get('BABEL_BINARY', '{}/node_modules/babel-cli/bin/babel.js'.format(settings.DJANGO_ROOT)), infile, "--out-file", outfile, pipeline_settings.get('BABEL_ARGUMENTS', '--presets react'), ] return self.execute_command(command, cwd=dirname(infile))
grvty-labs/A1-136
contrib/django_pipeline/compilers.py
Python
mit
957
# example.py from collections import namedtuple Stock = namedtuple('Stock', ['name', 'shares', 'price']) def compute_cost(records): total = 0.0 for rec in records: s = Stock(*rec) total += s.shares * s.price return total # Some Data records = [ ('GOOG', 100, 490.1), ('ACME', 100, 123.45), ('IBM', 50, 91.15) ] print(compute_cost(records))
tuanavu/python-cookbook-3rd
src/1/mapping_names_to_sequence_elements/example1.py
Python
mit
386
""" Command based UI for the obfuscator. """ # OAT - Obfuscation and Analysis Tool # Copyright (C) 2011 Andy Gurden # # This file is part of OAT. # # OAT is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # OAT is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with OAT. If not, see <http://www.gnu.org/licenses/>. from . import commandui from . import parsecmd from . import formatcmd from . import explorecmd from . import reordercmd from . import markcmd from . import visualisecmd from . import branchcmd class SolidConsole(commandui.CommandUI): """Solid command class.""" def __init__(self): commandui.CommandUI.__init__(self) parse = parsecmd.ParseCommand() explore = explorecmd.ExploreCommand(parse) format = formatcmd.FormatCommand(parse, explore) reorder = reordercmd.ReorderCommand(parse, explore) mark = markcmd.MarkCommand(parse, explore) visualise = visualisecmd.VisualiseCommand(parse, explore) branch = branchcmd.BranchCommand(parse, explore) self.add_command(parse) self.add_command(format) self.add_command(explore) self.add_command(reorder) self.add_command(mark) self.add_command(visualise) self.add_command(branch)
andyrooger/OAT
src/interactive/solidconsole.py
Python
gpl-3.0
1,759
import os import json from mako.lookup import TemplateLookup globalsJson = [] beginFileText = "/// GENERATED CODE START\n/// WARNING! This code has been generated automatically. Any changes will be overwritten.\n" endFileText = "\n\n/// GENERATED CODE END\n" def list(words): wordsStr = "" if words != None: lastWord = len(words) - 1 for i, w in enumerate(words): wordsStr += "\"" + w + "\"" if(i < lastWord): wordsStr += ", " return wordsStr def getMethodParamListN(method): args = [] if len(method['params']) > 0: for i in range(0, len(method['params'])): args.append("arg" + str(i)) return ", ".join(args) def getParamFlags(param): flags = [] if param['isIn']: flags.append("in") if param['isOut']: flags.append("out") if param['isReturn']: flags.append("return") return "|".join(flags) def getParamTypeId(param): if param['abstractType'] == 'void': return 0 elif param['abstractType'] == 'int': return 3 elif param['abstractType'] == 'float': return 4 elif param['abstractType'] == 'string': return 5 def getGlobalId(className): for c in globalsJson['classes']: if c['name'] == className: return c['globalId'] return -1 def generate(ctx, template, outputPath): with open(outputPath, 'w') as output: data = beginFileText data += template.render(ctx=ctx) data += endFileText output.write(data) class TemplateSet: def __init__(self, lookup, prefix): self.declaration = lookup.get_template(prefix + '.hpp') self.inline = lookup.get_template(prefix + '.inl') self.definition = lookup.get_template(prefix + '.cpp') def run(taskList): scriptDir = os.path.dirname(os.path.realpath(__file__)) mylookup = TemplateLookup( directories=[scriptDir], imports=['from generator.rcg import list, getMethodParamListN, getParamFlags, getParamTypeId'] ) templates = { 'library': TemplateSet(mylookup, 'library'), 'object': TemplateSet(mylookup, 'object'), 'scene': TemplateSet(mylookup, 'object'), 'component': TemplateSet(mylookup, 'object'), 'actor': TemplateSet(mylookup, 'object'), 'entity': TemplateSet(mylookup, 'object'), } with open('temp/globals.cdef', 'r') as globalsFile: globalsContent = globalsFile.read() globalsJson = json.loads(globalsContent) for t in taskList: cdefPath = t['cdef'] with open(cdefPath, 'r') as cdefFile: cdefContent = cdefFile.read() cdefList = json.loads(cdefContent) if cdefList == None: continue for c in cdefList: cName = c['name'] cType = c['type'] cTemplate = c['template'] c['globals'] = globalsJson if t['regenerate'] == True: pathFmt = 'temp/generated/{0}.generated.{1}' templSet = templates[cTemplate] generate(c, templSet.declaration, pathFmt.format(cName, 'hpp')) generate(c, templSet.inline, pathFmt.format(cName, 'inl')) generate(c, templSet.definition, pathFmt.format(cName, 'cpp')) # If task list was empty, then nothing has changed and no need to regenerate register.cpp if len(taskList) > 0: template = mylookup.get_template('game.generated.cpp') generate({'globals': globalsJson}, template, 'game.generated.cpp') template = mylookup.get_template('game.generated.hpp') generate({'globals': globalsJson}, template, 'game.generated.hpp')
creepydragon/r2
tools/generator/rcg.py
Python
gpl-3.0
3,256
import argparse default_move_command = "/opt/quads/quads/tools/move_and_rebuild_hosts.py" parser = argparse.ArgumentParser(description="Query current cloud for a given host") action_group = parser.add_mutually_exclusive_group() # ---- Generic actions action_group.add_argument( "--version", dest="action", action="store_const", const="version", help="Display version of QUADS", ) action_group.add_argument( "--mark-broken", dest="action", action="store_const", const="mark_broken", help="Mark host as broken", ) action_group.add_argument( "--mark-repaired", dest="action", action="store_const", const="mark_repaired", help="Mark broken host as repaired", ) action_group.add_argument( "--retire", dest="action", action="store_const", const="retire", help="Mark host as retired", ) action_group.add_argument( "--unretire", dest="action", action="store_const", const="retire", help="Mark broken host as back in business", ) # ---- Generic args parser.add_argument( "--debug", action="store_true", default=False, help="Show debugging information.", ) parser.add_argument( "--force", dest="force", action="store_true", help="Force host or cloud update when already defined", ) parser.add_argument( "--dry-run", dest="dryrun", action="store_true", default=None, help="Don't update state when used with --move-hosts", ) parser.add_argument( "--log-path", dest="logpath", type=str, default=None, help="Path to QUADS log file", ) time_args = parser.add_mutually_exclusive_group() time_args.add_argument( "-d", "--date", dest="datearg", type=str, default=None, help='date and time to query; e.g. "2016-06-01 08:00"', ) time_args.add_argument( "--months", dest="months", type=str, default=None, help="Number of months for reporting scheduled assignments", ) time_args.add_argument( "--year", dest="year", type=str, default=None, help="Year for reporting scheduled assignments", ) time_args.add_argument( "--weeks", dest="weeks", type=str, default=None, help="Number of weeks to extend an existing schedule", ) time_args.add_argument( "--now", dest="now", action="store_true", default=None, help="Now flag for use with --extend or --shrink instead of --week", ) # ---- Object args object_args = parser.add_mutually_exclusive_group() object_args.add_argument( "--host", dest="host", type=str, default=None, help="Specify the host to query", ) object_args.add_argument( "--host-list", dest="host_list", type=str, default=None, help="Specify file path to host list", ) object_args.add_argument( "--cloud", dest="cloud", type=str, default=None, help="Specify cloud name", ) # ---- Advanced actions action_group.add_argument( "--ls-owner", dest="action", action="store_const", const="owner", help="List owners", ) action_group.add_argument( "--ls-cc-users", dest="action", action="store_const", const="ccuser", help="List CC list", ) action_group.add_argument( "--ls-ticket", dest="action", action="store_const", const="ticket", help="List request ticket", ) action_group.add_argument( "--ls-qinq", dest="action", action="store_const", const="qinq", help="List cloud qinq state", ) action_group.add_argument( "--ls-wipe", dest="action", action="store_const", const="wipe", help="List cloud wipe state", ) action_group.add_argument( "--extend", dest="action", action="store_const", const="extend", help="Extend an existing schedule", ) action_group.add_argument( "--shrink", dest="action", action="store_const", const="shrink", help="Shrink an existing schedule", ) action_group.add_argument( "--define-host", dest="hostresource", type=str, default=None, help="Define a host resource", ) action_group.add_argument( "--define-host-details", dest="action", action="store_const", const="define_host_metadata", help="Define a host resource details via yaml", ) action_group.add_argument( "--export-host-details", dest="host_metadata_export", type=str, default=None, help="Path to QUADS log file", ) action_group.add_argument( "--define-cloud", dest="cloudresource", type=str, default=None, help="Define a cloud environment", ) action_group.add_argument( "--mod-cloud", dest="modcloud", type=str, default=None, help="Modify a cloud", ) action_group.add_argument( "--add-schedule", dest="action", action="store_const", const="add_schedule", help="Define a host reservation", ) action_group.add_argument( "--mod-schedule", dest="modschedule", type=str, default=None, help="Modify a host reservation", ) action_group.add_argument( "--add-interface", dest="addinterface", type=str, default=None, help="Define a host interface", ) action_group.add_argument( "--rm-schedule", dest="rmschedule", type=str, default=None, help="Remove a host reservation", ) action_group.add_argument( "--rm-interface", dest="rminterface", type=str, default=None, help="Remove a host interface", ) action_group.add_argument( "--mod-interface", dest="modinterface", type=str, default=None, help="Modify a host interface", ) action_group.add_argument( "--ls-hosts", dest="action", action="store_const", const="ls_hosts", help="List all hosts", ) action_group.add_argument( "--ls-clouds", dest="action", action="store_const", const="cloud", help="List all clouds", ) action_group.add_argument( "--rm-host", dest="rmhost", type=str, default=None, help="Remove a host", ) action_group.add_argument( "--rm-cloud", dest="rmcloud", type=str, default=None, help="Remove a cloud" ) action_group.add_argument( "--ls-available", dest="action", action="store_const", const="available", help="List available hosts on a specific time frame", ) action_group.add_argument( "--ls-schedule", dest="action", action="store_const", const="schedule", help="List the host reservations", ) action_group.add_argument( "--ls-interface", dest="action", action="store_const", const="interface", help="List the host interfaces", ) action_group.add_argument( "--ls-vlan", dest="action", action="store_const", const="ls_vlan", help="List the available vlans with the clouds assigned", ) action_group.add_argument( "--find-free-cloud", dest="action", action="store_const", const="free_cloud", help="List available hosts on a specific time frame", ) action_group.add_argument( "--report-available", dest="action", action="store_const", const="report_available", help="QUADS reporting server availability", ) action_group.add_argument( "--report-scheduled", dest="action", action="store_const", const="report_scheduled", help="QUADS reporting detailed scheduled assignments", ) action_group.add_argument( "--report-detailed", dest="action", action="store_const", const="report_detailed", help="QUADS reporting scheduled assignments", ) action_group.add_argument( "--ls-broken", dest="action", action="store_const", const="ls_broken", help="List all hosts marked as broken", ) action_group.add_argument( "--ls-retired", dest="action", action="store_const", const="ls_retired", help="List all hosts marked as retired", ) parser.add_argument( "--cloud-only", dest="cloudonly", type=str, default=None, help="Limit full report to hosts only in this cloud", ) parser.add_argument( "--cloud-owner", dest="cloudowner", type=str, default=None, help="Define environment owner", ) parser.add_argument( "--cc-users", dest="ccusers", type=str, default=None, help="Define environment CC list", ) parser.add_argument( "--qinq", dest="qinq", type=int, choices=[0, 1], default=0, help="Define environment qinq state", ) wipe_group_args = parser.add_mutually_exclusive_group() wipe_group_args.add_argument( "--no-wipe", dest="wipe", default=argparse.SUPPRESS, action="store_false", help="Define no wipe for safeguarding data after assignment", ) wipe_group_args.add_argument( "--wipe", dest="wipe", default=argparse.SUPPRESS, action="store_true", help="Define wipe for reprovisioning server before assignment", ) parser.add_argument( "--cloud-ticket", dest="cloudticket", type=str, default=None, help="Define environment ticket", ) parser.add_argument( "--description", dest="description", type=str, default=None, help="Defined description of cloud", ) parser.add_argument( "--default-cloud", dest="hostcloud", type=str, default=None, help="Defined default cloud for a host", ) parser.add_argument( "--summary", dest="summary", action="store_true", help="Generate a summary report", ) parser.add_argument( "--detail", dest="detail", action="store_true", help="Get additional data over the summary", ) parser.add_argument( "--full-summary", dest="fullsummary", action="store_true", help="Generate a summary report", ) parser.add_argument( "--schedule-start", dest="schedstart", type=str, default=None, help="Schedule start date/time", ) parser.add_argument( "--schedule-end", dest="schedend", type=str, default=None, help="Schedule end date/time", ) parser.add_argument( "--check", dest="check", action="store_true", default=None, help="Check for cloud extension", ) parser.add_argument( "--schedule-cloud", dest="schedcloud", type=str, default=None, help="Schedule cloud", ) parser.add_argument( "--interface-bios-id", dest="ifbiosid", type=str, default=None, help="Interface BIOS ID name", ) parser.add_argument( "--interface-mac", dest="ifmac", type=str, default=None, help="Interface MAC address", ) parser.add_argument( "--interface-ip", dest="ifip", type=str, default=None, help="Interface IP address", ) parser.add_argument( "--interface-port", dest="ifport", type=str, default=None, help="Switch port", ) parser.add_argument( "--interface-speed", dest="ifspeed", type=str, default=None, help="Interface speed", ) parser.add_argument( "--interface-vendor", dest="ifvendor", type=str, default=None, help="Interface vendor", ) pxe_group_args = parser.add_mutually_exclusive_group() pxe_group_args.add_argument( "--pxe-boot", dest="ifpxe", action="store_true", default=argparse.SUPPRESS, help="Interface pxe boot flag", ) pxe_group_args.add_argument( "--no-pxe-boot", dest="ifpxe", action="store_false", default=argparse.SUPPRESS, help="Disable Interface pxe boot flag", ) maintenance_group_args = parser.add_mutually_exclusive_group() maintenance_group_args.add_argument( "--maintenance", dest="ifmaintenance", action="store_true", default=argparse.SUPPRESS, help="Interface maintenance flag", ) maintenance_group_args.add_argument( "--no-maintenance", dest="ifmaintenance", action="store_false", default=argparse.SUPPRESS, help="Disable Interface maintenance flag", ) parser.add_argument( "--move-hosts", dest="movehosts", action="store_true", default=None, help="Move hosts if schedule has changed", ) parser.add_argument( "--move-command", dest="movecommand", type=str, default=default_move_command, help="External command to move a host", ) parser.add_argument( "--host-type", dest="hosttype", type=str, default=None, help="Open-ended identifier for host: util, baremetal, aws, openstack, libvirt, etc.", ) parser.add_argument( "--vlan", dest="vlan", type=int, default=None, help="VLAN id number for public routable network", ) parser.add_argument( "--metadata", dest="metadata", type=str, default=None, help="Path to yml with hosts metadata", ) parser.add_argument( "--filter", dest="filter", type=str, default=None, help="Filter search by host metadata", ) if __name__ == '__main__': # debugging helper parser.print_help()
redhat-performance/quads
quads/cli/parser.py
Python
gpl-3.0
12,769
# -*- coding: utf-8 -*- # # This file is part of Radicale Server - Calendar Server # Copyright © 2008 Nicolas Kandel # Copyright © 2008 Pascal Halter # Copyright © 2008-2013 Guillaume Ayoub # # This library is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Radicale. If not, see <http://www.gnu.org/licenses/>. """ Authentication management. """ import sys from .. import config, log def load(): """Load list of available authentication managers.""" auth_type = config.get("auth", "type") log.LOGGER.debug("Authentication type is %s" % auth_type) if auth_type == "None": return None elif auth_type == 'custom': auth_module = config.get("auth", "custom_handler") __import__(auth_module) module = sys.modules[auth_module] else: root_module = __import__( "auth.%s" % auth_type, globals=globals(), level=2) module = getattr(root_module, auth_type) # Override auth.is_authenticated sys.modules[__name__].is_authenticated = module.is_authenticated return module def is_authenticated(user, password): """Check if the user is authenticated. This method is overriden if an auth module is loaded. """ return True # Default is always True: no authentication
wohnsinn2/Radicale
radicale/auth/__init__.py
Python
gpl-3.0
1,784
""" Mostly equivalent to the views from django.contrib.auth.views, but implemented as class-based views. """ from __future__ import unicode_literals from django.conf import settings from django.contrib.auth import get_user_model, REDIRECT_FIELD_NAME from django.contrib.auth.decorators import login_required from django.contrib.auth.forms import (AuthenticationForm, SetPasswordForm, PasswordChangeForm, PasswordResetForm) from django.contrib.auth.tokens import default_token_generator from django.contrib import auth from django.contrib.sites.models import get_current_site from django.core.urlresolvers import reverse_lazy from django.shortcuts import redirect, resolve_url from django.utils.functional import lazy from django.utils.http import base36_to_int, is_safe_url from django.utils import six from django.views.decorators.cache import never_cache from django.views.decorators.csrf import csrf_protect from django.views.decorators.debug import sensitive_post_parameters from django.views.generic import FormView, TemplateView, RedirectView from authtools.forms import FriendlyPasswordResetForm User = get_user_model() def _safe_resolve_url(url): """ Previously, resolve_url_lazy would fail if the url was a unicode object. See <https://github.com/fusionbox/django-authtools/issues/13> for more information. Thanks to GitHub user alanwj for pointing out the problem and providing this solution. """ return six.text_type(resolve_url(url)) resolve_url_lazy = lazy(_safe_resolve_url, six.text_type) class WithCurrentSiteMixin(object): def get_current_site(self): return get_current_site(self.request) def get_context_data(self, **kwargs): kwargs = super(WithCurrentSiteMixin, self).get_context_data(**kwargs) current_site = self.get_current_site() kwargs.update({ 'site': current_site, 'site_name': current_site.name, }) return kwargs class WithNextUrlMixin(object): redirect_field_name = REDIRECT_FIELD_NAME success_url = None def get_next_url(self): if self.redirect_field_name in self.request.REQUEST: redirect_to = self.request.REQUEST[self.redirect_field_name] if is_safe_url(redirect_to, host=self.request.get_host()): return redirect_to # This mixin can be mixed with FormViews and RedirectViews. They # each use a different method to get the URL to redirect to, so we # need to provide both methods. def get_success_url(self): return self.get_next_url() or super(WithNextUrlMixin, self).get_success_url() def get_redirect_url(self, **kwargs): return self.get_next_url() or super(WithNextUrlMixin, self).get_redirect_url(**kwargs) def DecoratorMixin(decorator): """ Converts a decorator written for a function view into a mixin for a class-based view. :: LoginRequiredMixin = DecoratorMixin(login_required) class MyView(LoginRequiredMixin): pass class SomeView(DecoratorMixin(some_decorator), DecoratorMixin(something_else)): pass """ class Mixin(object): __doc__ = decorator.__doc__ @classmethod def as_view(cls, *args, **kwargs): view = super(Mixin, cls).as_view(*args, **kwargs) return decorator(view) Mixin.__name__ = str('DecoratorMixin(%s)' % decorator.__name__) return Mixin NeverCacheMixin = DecoratorMixin(never_cache) CsrfProtectMixin = DecoratorMixin(csrf_protect) LoginRequiredMixin = DecoratorMixin(login_required) SensitivePostParametersMixin = DecoratorMixin( sensitive_post_parameters('password', 'old_password', 'password1', 'password2', 'new_password1', 'new_password2') ) class AuthDecoratorsMixin(NeverCacheMixin, CsrfProtectMixin, SensitivePostParametersMixin): pass class LoginView(AuthDecoratorsMixin, WithCurrentSiteMixin, WithNextUrlMixin, FormView): form_class = AuthenticationForm template_name = 'registration/login.html' disallow_authenticated = True success_url = resolve_url_lazy(settings.LOGIN_REDIRECT_URL) def dispatch(self, *args, **kwargs): if self.disallow_authenticated and self.request.user.is_authenticated(): return redirect(self.get_success_url()) return super(LoginView, self).dispatch(*args, **kwargs) def form_valid(self, form): auth.login(self.request, form.get_user()) return super(LoginView, self).form_valid(form) def get_context_data(self, **kwargs): kwargs = super(LoginView, self).get_context_data(**kwargs) kwargs.update({ self.redirect_field_name: self.request.REQUEST.get( self.redirect_field_name, '', ), }) return kwargs login = LoginView.as_view() class LogoutView(NeverCacheMixin, WithCurrentSiteMixin, WithNextUrlMixin, TemplateView, RedirectView): template_name = 'registration/logged_out.html' permanent = False def get(self, *args, **kwargs): auth.logout(self.request) # If we have a url to redirect to, do it. Otherwise render the logged-out template. if self.get_redirect_url(**kwargs): return RedirectView.get(self, *args, **kwargs) else: return TemplateView.get(self, *args, **kwargs) logout = LogoutView.as_view() logout_then_login = LogoutView.as_view( url=reverse_lazy('login') ) class PasswordChangeView(LoginRequiredMixin, WithNextUrlMixin, AuthDecoratorsMixin, FormView): template_name = 'registration/password_change_form.html' form_class = PasswordChangeForm success_url = reverse_lazy('password_change_done') def get_form_kwargs(self): kwargs = super(PasswordChangeView, self).get_form_kwargs() kwargs['user'] = self.get_user() return kwargs def get_user(self): return self.request.user def form_valid(self, form): form.save() return super(PasswordChangeView, self).form_valid(form) password_change = PasswordChangeView.as_view() class PasswordChangeDoneView(LoginRequiredMixin, TemplateView): template_name = 'registration/password_change_done.html' password_change_done = PasswordChangeDoneView.as_view() # 4 views for password reset: # - password_reset sends the mail # - password_reset_done shows a success message for the above # - password_reset_confirm checks the link the user clicked and # prompts for a new password # - password_reset_complete shows a success message for the above class PasswordResetView(CsrfProtectMixin, FormView): template_name = 'registration/password_reset_form.html' token_generator = default_token_generator success_url = reverse_lazy('password_reset_done') domain_override = None subject_template_name = 'registration/password_reset_subject.txt' email_template_name = 'registration/password_reset_email.html' from_email = None form_class = PasswordResetForm def form_valid(self, form): form.save( domain_override=self.domain_override, subject_template_name=self.subject_template_name, email_template_name=self.email_template_name, token_generator=self.token_generator, from_email=self.from_email, request=self.request, use_https=self.request.is_secure(), ) return super(PasswordResetView, self).form_valid(form) password_reset = PasswordResetView.as_view() friendly_password_reset = PasswordResetView.as_view( form_class=FriendlyPasswordResetForm ) class PasswordResetDoneView(TemplateView): template_name = 'registration/password_reset_done.html' password_reset_done = PasswordResetDoneView.as_view() class PasswordResetConfirmView(AuthDecoratorsMixin, FormView): template_name = 'registration/password_reset_confirm.html' token_generator = default_token_generator form_class = SetPasswordForm success_url = reverse_lazy('password_reset_complete') def dispatch(self, *args, **kwargs): assert self.kwargs.get('token') is not None self.user = self.get_user() return super(PasswordResetConfirmView, self).dispatch(*args, **kwargs) def get_queryset(self): return User._default_manager.all() def get_user(self): # django 1.5 uses uidb36, django 1.6 uses uidb64 uidb36 = self.kwargs.get('uidb36') uidb64 = self.kwargs.get('uidb64') assert bool(uidb36) ^ bool(uidb64) try: if uidb36: uid = base36_to_int(uidb36) else: # urlsafe_base64_decode is not available in django 1.5 from django.utils.http import urlsafe_base64_decode uid = urlsafe_base64_decode(uidb64) return self.get_queryset().get(pk=uid) except (TypeError, ValueError, OverflowError, User.DoesNotExist): return None def valid_link(self): user = self.user return user is not None and self.token_generator.check_token(user, self.kwargs.get('token')) def get_form_kwargs(self): kwargs = super(PasswordResetConfirmView, self).get_form_kwargs() kwargs['user'] = self.user return kwargs def get_context_data(self, **kwargs): kwargs = super(PasswordResetConfirmView, self).get_context_data(**kwargs) if self.valid_link(): kwargs['validlink'] = True else: kwargs['validlink'] = False kwargs['form'] = None return kwargs def form_valid(self, form): if not self.valid_link(): return self.form_invalid(form) self.save_form(form) return super(PasswordResetConfirmView, self).form_valid(form) def save_form(self, form): return form.save() password_reset_confirm = PasswordResetConfirmView.as_view() # Django 1.6 added this as a temporary shim, see #14881. Since our view # works with base 36 or base 64, we can use the same view for both. password_reset_confirm_uidb36 = PasswordResetConfirmView.as_view() class PasswordResetConfirmAndLoginView(PasswordResetConfirmView): success_url = resolve_url_lazy(settings.LOGIN_REDIRECT_URL) def save_form(self, form): ret = super(PasswordResetConfirmAndLoginView, self).save_form(form) user = auth.authenticate(username=self.user.get_username(), password=form.cleaned_data['new_password1']) auth.login(self.request, user) return ret password_reset_confirm_and_login = PasswordResetConfirmAndLoginView.as_view() class PasswordResetCompleteView(TemplateView): template_name = 'registration/password_reset_complete.html' login_url = settings.LOGIN_URL def get_login_url(self): return resolve_url(self.login_url) def get_context_data(self, **kwargs): kwargs = super(PasswordResetCompleteView, self).get_context_data(**kwargs) kwargs['login_url'] = self.get_login_url() return kwargs password_reset_complete = PasswordResetCompleteView.as_view()
ziposoft/godiva
src/members/views.py
Python
mit
11,223